mirror of
https://github.com/raysan5/raylib.git
synced 2026-04-23 15:55:25 +00:00
35413 lines
1.2 MiB
35413 lines
1.2 MiB
// The Module object: Our interface to the outside world. We import
|
|
// and export values on it, and do the work to get that through
|
|
// closure compiler if necessary. There are various ways Module can be used:
|
|
// 1. Not defined. We create it here
|
|
// 2. A function parameter, function(Module) { ..generated code.. }
|
|
// 3. pre-run appended it, var Module = {}; ..generated code..
|
|
// 4. External script tag defines var Module.
|
|
// We need to do an eval in order to handle the closure compiler
|
|
// case, where this code here is minified but Module was defined
|
|
// elsewhere (e.g. case 4 above). We also need to check if Module
|
|
// already exists (e.g. case 3 above).
|
|
// Note that if you want to run closure, and also to use Module
|
|
// after the generated code, you will need to define var Module = {};
|
|
// before the code. Then that object will be used in the code, and you
|
|
// can continue to use Module afterwards as well.
|
|
var Module;
|
|
if (!Module) Module = (typeof Module !== 'undefined' ? Module : null) || {};
|
|
|
|
// Sometimes an existing Module object exists with properties
|
|
// meant to overwrite the default module functionality. Here
|
|
// we collect those properties and reapply _after_ we configure
|
|
// the current environment's defaults to avoid having to be so
|
|
// defensive during initialization.
|
|
var moduleOverrides = {};
|
|
for (var key in Module) {
|
|
if (Module.hasOwnProperty(key)) {
|
|
moduleOverrides[key] = Module[key];
|
|
}
|
|
}
|
|
|
|
// The environment setup code below is customized to use Module.
|
|
// *** Environment setup code ***
|
|
var ENVIRONMENT_IS_WEB = false;
|
|
var ENVIRONMENT_IS_WORKER = false;
|
|
var ENVIRONMENT_IS_NODE = false;
|
|
var ENVIRONMENT_IS_SHELL = false;
|
|
|
|
// Three configurations we can be running in:
|
|
// 1) We could be the application main() thread running in the main JS UI thread. (ENVIRONMENT_IS_WORKER == false and ENVIRONMENT_IS_PTHREAD == false)
|
|
// 2) We could be the application main() thread proxied to worker. (with Emscripten -s PROXY_TO_WORKER=1) (ENVIRONMENT_IS_WORKER == true, ENVIRONMENT_IS_PTHREAD == false)
|
|
// 3) We could be an application pthread running in a worker. (ENVIRONMENT_IS_WORKER == true and ENVIRONMENT_IS_PTHREAD == true)
|
|
|
|
if (Module['ENVIRONMENT']) {
|
|
if (Module['ENVIRONMENT'] === 'WEB') {
|
|
ENVIRONMENT_IS_WEB = true;
|
|
} else if (Module['ENVIRONMENT'] === 'WORKER') {
|
|
ENVIRONMENT_IS_WORKER = true;
|
|
} else if (Module['ENVIRONMENT'] === 'NODE') {
|
|
ENVIRONMENT_IS_NODE = true;
|
|
} else if (Module['ENVIRONMENT'] === 'SHELL') {
|
|
ENVIRONMENT_IS_SHELL = true;
|
|
} else {
|
|
throw new Error('The provided Module[\'ENVIRONMENT\'] value is not valid. It must be one of: WEB|WORKER|NODE|SHELL.');
|
|
}
|
|
} else {
|
|
ENVIRONMENT_IS_WEB = typeof window === 'object';
|
|
ENVIRONMENT_IS_WORKER = typeof importScripts === 'function';
|
|
ENVIRONMENT_IS_NODE = typeof process === 'object' && typeof require === 'function' && !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_WORKER;
|
|
ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER;
|
|
}
|
|
|
|
var ENVIRONMENT_IS_PTHREAD;
|
|
if (!ENVIRONMENT_IS_PTHREAD) ENVIRONMENT_IS_PTHREAD = false; // ENVIRONMENT_IS_PTHREAD=true will have been preset in pthread-main.js. Make it false in the main runtime thread.
|
|
var PthreadWorkerInit; // Collects together variables that are needed at initialization time for the web workers that host pthreads.
|
|
if (!ENVIRONMENT_IS_PTHREAD) PthreadWorkerInit = {};
|
|
var currentScriptUrl = ENVIRONMENT_IS_WORKER ? undefined : document.currentScript.src;
|
|
|
|
if (ENVIRONMENT_IS_NODE) {
|
|
// Expose functionality in the same simple way that the shells work
|
|
// Note that we pollute the global namespace here, otherwise we break in node
|
|
if (!Module['print']) Module['print'] = console.log;
|
|
if (!Module['printErr']) Module['printErr'] = console.warn;
|
|
|
|
var nodeFS;
|
|
var nodePath;
|
|
|
|
Module['read'] = function read(filename, binary) {
|
|
if (!nodeFS) nodeFS = require('fs');
|
|
if (!nodePath) nodePath = require('path');
|
|
filename = nodePath['normalize'](filename);
|
|
var ret = nodeFS['readFileSync'](filename);
|
|
return binary ? ret : ret.toString();
|
|
};
|
|
|
|
Module['readBinary'] = function readBinary(filename) {
|
|
var ret = Module['read'](filename, true);
|
|
if (!ret.buffer) {
|
|
ret = new Uint8Array(ret);
|
|
}
|
|
assert(ret.buffer);
|
|
return ret;
|
|
};
|
|
|
|
Module['load'] = function load(f) {
|
|
globalEval(read(f));
|
|
};
|
|
|
|
if (!Module['thisProgram']) {
|
|
if (process['argv'].length > 1) {
|
|
Module['thisProgram'] = process['argv'][1].replace(/\\/g, '/');
|
|
} else {
|
|
Module['thisProgram'] = 'unknown-program';
|
|
}
|
|
}
|
|
|
|
Module['arguments'] = process['argv'].slice(2);
|
|
|
|
if (typeof module !== 'undefined') {
|
|
module['exports'] = Module;
|
|
}
|
|
|
|
process['on']('uncaughtException', function(ex) {
|
|
// suppress ExitStatus exceptions from showing an error
|
|
if (!(ex instanceof ExitStatus)) {
|
|
throw ex;
|
|
}
|
|
});
|
|
|
|
Module['inspect'] = function () { return '[Emscripten Module object]'; };
|
|
}
|
|
else if (ENVIRONMENT_IS_SHELL) {
|
|
if (!Module['print']) Module['print'] = print;
|
|
if (typeof printErr != 'undefined') Module['printErr'] = printErr; // not present in v8 or older sm
|
|
|
|
if (typeof read != 'undefined') {
|
|
Module['read'] = read;
|
|
} else {
|
|
Module['read'] = function read() { throw 'no read() available' };
|
|
}
|
|
|
|
Module['readBinary'] = function readBinary(f) {
|
|
if (typeof readbuffer === 'function') {
|
|
return new Uint8Array(readbuffer(f));
|
|
}
|
|
var data = read(f, 'binary');
|
|
assert(typeof data === 'object');
|
|
return data;
|
|
};
|
|
|
|
if (typeof scriptArgs != 'undefined') {
|
|
Module['arguments'] = scriptArgs;
|
|
} else if (typeof arguments != 'undefined') {
|
|
Module['arguments'] = arguments;
|
|
}
|
|
|
|
if (typeof quit === 'function') {
|
|
Module['quit'] = function(status, toThrow) {
|
|
quit(status);
|
|
}
|
|
}
|
|
|
|
}
|
|
else if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) {
|
|
Module['read'] = function read(url) {
|
|
var xhr = new XMLHttpRequest();
|
|
xhr.open('GET', url, false);
|
|
xhr.send(null);
|
|
return xhr.responseText;
|
|
};
|
|
|
|
if (ENVIRONMENT_IS_WORKER) {
|
|
Module['readBinary'] = function read(url) {
|
|
var xhr = new XMLHttpRequest();
|
|
xhr.open('GET', url, false);
|
|
xhr.responseType = 'arraybuffer';
|
|
xhr.send(null);
|
|
return xhr.response;
|
|
};
|
|
}
|
|
|
|
Module['readAsync'] = function readAsync(url, onload, onerror) {
|
|
var xhr = new XMLHttpRequest();
|
|
xhr.open('GET', url, true);
|
|
xhr.responseType = 'arraybuffer';
|
|
xhr.onload = function xhr_onload() {
|
|
if (xhr.status == 200 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0
|
|
onload(xhr.response);
|
|
} else {
|
|
onerror();
|
|
}
|
|
};
|
|
xhr.onerror = onerror;
|
|
xhr.send(null);
|
|
};
|
|
|
|
if (typeof arguments != 'undefined') {
|
|
Module['arguments'] = arguments;
|
|
}
|
|
|
|
if (typeof console !== 'undefined') {
|
|
if (!Module['print']) Module['print'] = function print(x) {
|
|
console.log(x);
|
|
};
|
|
if (!Module['printErr']) Module['printErr'] = function printErr(x) {
|
|
console.warn(x);
|
|
};
|
|
} else {
|
|
// Probably a worker, and without console.log. We can do very little here...
|
|
var TRY_USE_DUMP = false;
|
|
if (!Module['print']) Module['print'] = (TRY_USE_DUMP && (typeof(dump) !== "undefined") ? (function(x) {
|
|
dump(x);
|
|
}) : (function(x) {
|
|
// self.postMessage(x); // enable this if you want stdout to be sent as messages
|
|
}));
|
|
}
|
|
|
|
if (ENVIRONMENT_IS_WORKER) {
|
|
Module['load'] = importScripts;
|
|
}
|
|
|
|
if (typeof Module['setWindowTitle'] === 'undefined') {
|
|
Module['setWindowTitle'] = function(title) { document.title = title };
|
|
}
|
|
}
|
|
else {
|
|
// Unreachable because SHELL is dependant on the others
|
|
throw 'Unknown runtime environment. Where are we?';
|
|
}
|
|
|
|
function globalEval(x) {
|
|
eval.call(null, x);
|
|
}
|
|
if (!Module['load'] && Module['read']) {
|
|
Module['load'] = function load(f) {
|
|
globalEval(Module['read'](f));
|
|
};
|
|
}
|
|
if (!Module['print']) {
|
|
Module['print'] = function(){};
|
|
}
|
|
if (!Module['printErr']) {
|
|
Module['printErr'] = Module['print'];
|
|
}
|
|
if (!Module['arguments']) {
|
|
Module['arguments'] = [];
|
|
}
|
|
if (!Module['thisProgram']) {
|
|
Module['thisProgram'] = './this.program';
|
|
}
|
|
if (!Module['quit']) {
|
|
Module['quit'] = function(status, toThrow) {
|
|
throw toThrow;
|
|
}
|
|
}
|
|
|
|
// *** Environment setup code ***
|
|
|
|
// Closure helpers
|
|
Module.print = Module['print'];
|
|
Module.printErr = Module['printErr'];
|
|
|
|
// Callbacks
|
|
Module['preRun'] = [];
|
|
Module['postRun'] = [];
|
|
|
|
// Merge back in the overrides
|
|
for (var key in moduleOverrides) {
|
|
if (moduleOverrides.hasOwnProperty(key)) {
|
|
Module[key] = moduleOverrides[key];
|
|
}
|
|
}
|
|
// Free the object hierarchy contained in the overrides, this lets the GC
|
|
// reclaim data used e.g. in memoryInitializerRequest, which is a large typed array.
|
|
moduleOverrides = undefined;
|
|
|
|
|
|
|
|
// {{PREAMBLE_ADDITIONS}}
|
|
|
|
// === Preamble library stuff ===
|
|
|
|
// Documentation for the public APIs defined in this file must be updated in:
|
|
// site/source/docs/api_reference/preamble.js.rst
|
|
// A prebuilt local version of the documentation is available at:
|
|
// site/build/text/docs/api_reference/preamble.js.txt
|
|
// You can also build docs locally as HTML or other formats in site/
|
|
// An online HTML version (which may be of a different version of Emscripten)
|
|
// is up at http://kripken.github.io/emscripten-site/docs/api_reference/preamble.js.html
|
|
|
|
//========================================
|
|
// Runtime code shared with compiler
|
|
//========================================
|
|
|
|
var Runtime = {
|
|
setTempRet0: function (value) {
|
|
tempRet0 = value;
|
|
return value;
|
|
},
|
|
getTempRet0: function () {
|
|
return tempRet0;
|
|
},
|
|
stackSave: function () {
|
|
return STACKTOP;
|
|
},
|
|
stackRestore: function (stackTop) {
|
|
STACKTOP = stackTop;
|
|
},
|
|
getNativeTypeSize: function (type) {
|
|
switch (type) {
|
|
case 'i1': case 'i8': return 1;
|
|
case 'i16': return 2;
|
|
case 'i32': return 4;
|
|
case 'i64': return 8;
|
|
case 'float': return 4;
|
|
case 'double': return 8;
|
|
default: {
|
|
if (type[type.length-1] === '*') {
|
|
return Runtime.QUANTUM_SIZE; // A pointer
|
|
} else if (type[0] === 'i') {
|
|
var bits = parseInt(type.substr(1));
|
|
assert(bits % 8 === 0);
|
|
return bits/8;
|
|
} else {
|
|
return 0;
|
|
}
|
|
}
|
|
}
|
|
},
|
|
getNativeFieldSize: function (type) {
|
|
return Math.max(Runtime.getNativeTypeSize(type), Runtime.QUANTUM_SIZE);
|
|
},
|
|
STACK_ALIGN: 16,
|
|
prepVararg: function (ptr, type) {
|
|
if (type === 'double' || type === 'i64') {
|
|
// move so the load is aligned
|
|
if (ptr & 7) {
|
|
assert((ptr & 7) === 4);
|
|
ptr += 4;
|
|
}
|
|
} else {
|
|
assert((ptr & 3) === 0);
|
|
}
|
|
return ptr;
|
|
},
|
|
getAlignSize: function (type, size, vararg) {
|
|
// we align i64s and doubles on 64-bit boundaries, unlike x86
|
|
if (!vararg && (type == 'i64' || type == 'double')) return 8;
|
|
if (!type) return Math.min(size, 8); // align structures internally to 64 bits
|
|
return Math.min(size || (type ? Runtime.getNativeFieldSize(type) : 0), Runtime.QUANTUM_SIZE);
|
|
},
|
|
dynCall: function (sig, ptr, args) {
|
|
if (args && args.length) {
|
|
assert(args.length == sig.length-1);
|
|
assert(('dynCall_' + sig) in Module, 'bad function pointer type - no table for sig \'' + sig + '\'');
|
|
return Module['dynCall_' + sig].apply(null, [ptr].concat(args));
|
|
} else {
|
|
assert(sig.length == 1);
|
|
assert(('dynCall_' + sig) in Module, 'bad function pointer type - no table for sig \'' + sig + '\'');
|
|
return Module['dynCall_' + sig].call(null, ptr);
|
|
}
|
|
},
|
|
functionPointers: [],
|
|
addFunction: function (func) {
|
|
for (var i = 0; i < Runtime.functionPointers.length; i++) {
|
|
if (!Runtime.functionPointers[i]) {
|
|
Runtime.functionPointers[i] = func;
|
|
return 2*(1 + i);
|
|
}
|
|
}
|
|
throw 'Finished up all reserved function pointers. Use a higher value for RESERVED_FUNCTION_POINTERS.';
|
|
},
|
|
removeFunction: function (index) {
|
|
Runtime.functionPointers[(index-2)/2] = null;
|
|
},
|
|
warnOnce: function (text) {
|
|
if (!Runtime.warnOnce.shown) Runtime.warnOnce.shown = {};
|
|
if (!Runtime.warnOnce.shown[text]) {
|
|
Runtime.warnOnce.shown[text] = 1;
|
|
Module.printErr(text);
|
|
}
|
|
},
|
|
funcWrappers: {},
|
|
getFuncWrapper: function (func, sig) {
|
|
assert(sig);
|
|
if (!Runtime.funcWrappers[sig]) {
|
|
Runtime.funcWrappers[sig] = {};
|
|
}
|
|
var sigCache = Runtime.funcWrappers[sig];
|
|
if (!sigCache[func]) {
|
|
// optimize away arguments usage in common cases
|
|
if (sig.length === 1) {
|
|
sigCache[func] = function dynCall_wrapper() {
|
|
return Runtime.dynCall(sig, func);
|
|
};
|
|
} else if (sig.length === 2) {
|
|
sigCache[func] = function dynCall_wrapper(arg) {
|
|
return Runtime.dynCall(sig, func, [arg]);
|
|
};
|
|
} else {
|
|
// general case
|
|
sigCache[func] = function dynCall_wrapper() {
|
|
return Runtime.dynCall(sig, func, Array.prototype.slice.call(arguments));
|
|
};
|
|
}
|
|
}
|
|
return sigCache[func];
|
|
},
|
|
getCompilerSetting: function (name) {
|
|
throw 'You must build with -s RETAIN_COMPILER_SETTINGS=1 for Runtime.getCompilerSetting or emscripten_get_compiler_setting to work';
|
|
},
|
|
stackAlloc: function (size) { var ret = STACKTOP;STACKTOP = (STACKTOP + size)|0;STACKTOP = (((STACKTOP)+15)&-16);(assert((((STACKTOP|0) < (STACK_MAX|0))|0))|0); return ret; },
|
|
staticAlloc: function (size) { var ret = STATICTOP;STATICTOP = (STATICTOP + (assert(!staticSealed),size))|0;STATICTOP = (((STATICTOP)+15)&-16); return ret; },
|
|
dynamicAlloc: function (size) { assert(DYNAMICTOP_PTR);var ret = HEAP32[DYNAMICTOP_PTR>>2];var end = (((ret + size + 15)|0) & -16);HEAP32[DYNAMICTOP_PTR>>2] = end;if (end >= TOTAL_MEMORY) {var success = enlargeMemory();if (!success) {HEAP32[DYNAMICTOP_PTR>>2] = ret;return 0;}}return ret;},
|
|
alignMemory: function (size,quantum) { var ret = size = Math.ceil((size)/(quantum ? quantum : 16))*(quantum ? quantum : 16); return ret; },
|
|
makeBigInt: function (low,high,unsigned) { var ret = (unsigned ? ((+((low>>>0)))+((+((high>>>0)))*4294967296.0)) : ((+((low>>>0)))+((+((high|0)))*4294967296.0))); return ret; },
|
|
GLOBAL_BASE: 8,
|
|
QUANTUM_SIZE: 4,
|
|
__dummy__: 0
|
|
}
|
|
|
|
|
|
|
|
Module["Runtime"] = Runtime;
|
|
|
|
|
|
|
|
//========================================
|
|
// Runtime essentials
|
|
//========================================
|
|
|
|
var ABORT = 0; // whether we are quitting the application. no code should run after this. set in exit() and abort()
|
|
var EXITSTATUS = 0;
|
|
|
|
function assert(condition, text) {
|
|
if (!condition) {
|
|
abort('Assertion failed: ' + text);
|
|
}
|
|
}
|
|
|
|
var globalScope = this;
|
|
|
|
// Returns the C function with a specified identifier (for C++, you need to do manual name mangling)
|
|
function getCFunc(ident) {
|
|
var func = Module['_' + ident]; // closure exported function
|
|
if (!func) {
|
|
try { func = eval('_' + ident); } catch(e) {}
|
|
}
|
|
assert(func, 'Cannot call unknown function ' + ident + ' (perhaps LLVM optimizations or closure removed it?)');
|
|
return func;
|
|
}
|
|
|
|
var cwrap, ccall;
|
|
(function(){
|
|
var JSfuncs = {
|
|
// Helpers for cwrap -- it can't refer to Runtime directly because it might
|
|
// be renamed by closure, instead it calls JSfuncs['stackSave'].body to find
|
|
// out what the minified function name is.
|
|
'stackSave': function() {
|
|
Runtime.stackSave()
|
|
},
|
|
'stackRestore': function() {
|
|
Runtime.stackRestore()
|
|
},
|
|
// type conversion from js to c
|
|
'arrayToC' : function(arr) {
|
|
var ret = Runtime.stackAlloc(arr.length);
|
|
writeArrayToMemory(arr, ret);
|
|
return ret;
|
|
},
|
|
'stringToC' : function(str) {
|
|
var ret = 0;
|
|
if (str !== null && str !== undefined && str !== 0) { // null string
|
|
// at most 4 bytes per UTF-8 code point, +1 for the trailing '\0'
|
|
var len = (str.length << 2) + 1;
|
|
ret = Runtime.stackAlloc(len);
|
|
stringToUTF8(str, ret, len);
|
|
}
|
|
return ret;
|
|
}
|
|
};
|
|
// For fast lookup of conversion functions
|
|
var toC = {'string' : JSfuncs['stringToC'], 'array' : JSfuncs['arrayToC']};
|
|
|
|
// C calling interface.
|
|
ccall = function ccallFunc(ident, returnType, argTypes, args, opts) {
|
|
var func = getCFunc(ident);
|
|
var cArgs = [];
|
|
var stack = 0;
|
|
assert(returnType !== 'array', 'Return type should not be "array".');
|
|
if (args) {
|
|
for (var i = 0; i < args.length; i++) {
|
|
var converter = toC[argTypes[i]];
|
|
if (converter) {
|
|
if (stack === 0) stack = Runtime.stackSave();
|
|
cArgs[i] = converter(args[i]);
|
|
} else {
|
|
cArgs[i] = args[i];
|
|
}
|
|
}
|
|
}
|
|
var ret = func.apply(null, cArgs);
|
|
if ((!opts || !opts.async) && typeof EmterpreterAsync === 'object') {
|
|
assert(!EmterpreterAsync.state, 'cannot start async op with normal JS calling ccall');
|
|
}
|
|
if (opts && opts.async) assert(!returnType, 'async ccalls cannot return values');
|
|
if (returnType === 'string') ret = Pointer_stringify(ret);
|
|
if (stack !== 0) {
|
|
if (opts && opts.async) {
|
|
EmterpreterAsync.asyncFinalizers.push(function() {
|
|
Runtime.stackRestore(stack);
|
|
});
|
|
return;
|
|
}
|
|
Runtime.stackRestore(stack);
|
|
}
|
|
return ret;
|
|
}
|
|
|
|
var sourceRegex = /^function\s*[a-zA-Z$_0-9]*\s*\(([^)]*)\)\s*{\s*([^*]*?)[\s;]*(?:return\s*(.*?)[;\s]*)?}$/;
|
|
function parseJSFunc(jsfunc) {
|
|
// Match the body and the return value of a javascript function source
|
|
var parsed = jsfunc.toString().match(sourceRegex).slice(1);
|
|
return {arguments : parsed[0], body : parsed[1], returnValue: parsed[2]}
|
|
}
|
|
|
|
// sources of useful functions. we create this lazily as it can trigger a source decompression on this entire file
|
|
var JSsource = null;
|
|
function ensureJSsource() {
|
|
if (!JSsource) {
|
|
JSsource = {};
|
|
for (var fun in JSfuncs) {
|
|
if (JSfuncs.hasOwnProperty(fun)) {
|
|
// Elements of toCsource are arrays of three items:
|
|
// the code, and the return value
|
|
JSsource[fun] = parseJSFunc(JSfuncs[fun]);
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
cwrap = function cwrap(ident, returnType, argTypes) {
|
|
argTypes = argTypes || [];
|
|
var cfunc = getCFunc(ident);
|
|
// When the function takes numbers and returns a number, we can just return
|
|
// the original function
|
|
var numericArgs = argTypes.every(function(type){ return type === 'number'});
|
|
var numericRet = (returnType !== 'string');
|
|
if ( numericRet && numericArgs) {
|
|
return cfunc;
|
|
}
|
|
// Creation of the arguments list (["$1","$2",...,"$nargs"])
|
|
var argNames = argTypes.map(function(x,i){return '$'+i});
|
|
var funcstr = "(function(" + argNames.join(',') + ") {";
|
|
var nargs = argTypes.length;
|
|
if (!numericArgs) {
|
|
// Generate the code needed to convert the arguments from javascript
|
|
// values to pointers
|
|
ensureJSsource();
|
|
funcstr += 'var stack = ' + JSsource['stackSave'].body + ';';
|
|
for (var i = 0; i < nargs; i++) {
|
|
var arg = argNames[i], type = argTypes[i];
|
|
if (type === 'number') continue;
|
|
var convertCode = JSsource[type + 'ToC']; // [code, return]
|
|
funcstr += 'var ' + convertCode.arguments + ' = ' + arg + ';';
|
|
funcstr += convertCode.body + ';';
|
|
funcstr += arg + '=(' + convertCode.returnValue + ');';
|
|
}
|
|
}
|
|
|
|
// When the code is compressed, the name of cfunc is not literally 'cfunc' anymore
|
|
var cfuncname = parseJSFunc(function(){return cfunc}).returnValue;
|
|
// Call the function
|
|
funcstr += 'var ret = ' + cfuncname + '(' + argNames.join(',') + ');';
|
|
if (!numericRet) { // Return type can only by 'string' or 'number'
|
|
// Convert the result to a string
|
|
var strgfy = parseJSFunc(function(){return Pointer_stringify}).returnValue;
|
|
funcstr += 'ret = ' + strgfy + '(ret);';
|
|
}
|
|
funcstr += "if (typeof EmterpreterAsync === 'object') { assert(!EmterpreterAsync.state, 'cannot start async op with normal JS calling cwrap') }";
|
|
if (!numericArgs) {
|
|
// If we had a stack, restore it
|
|
ensureJSsource();
|
|
funcstr += JSsource['stackRestore'].body.replace('()', '(stack)') + ';';
|
|
}
|
|
funcstr += 'return ret})';
|
|
return eval(funcstr);
|
|
};
|
|
})();
|
|
Module["ccall"] = ccall;
|
|
Module["cwrap"] = cwrap;
|
|
|
|
function setValue(ptr, value, type, noSafe) {
|
|
type = type || 'i8';
|
|
if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit
|
|
switch(type) {
|
|
case 'i1': HEAP8[((ptr)>>0)]=value; break;
|
|
case 'i8': HEAP8[((ptr)>>0)]=value; break;
|
|
case 'i16': HEAP16[((ptr)>>1)]=value; break;
|
|
case 'i32': HEAP32[((ptr)>>2)]=value; break;
|
|
case 'i64': (tempI64 = [value>>>0,(tempDouble=value,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((ptr)>>2)]=tempI64[0],HEAP32[(((ptr)+(4))>>2)]=tempI64[1]); break;
|
|
case 'float': HEAPF32[((ptr)>>2)]=value; break;
|
|
case 'double': HEAPF64[((ptr)>>3)]=value; break;
|
|
default: abort('invalid type for setValue: ' + type);
|
|
}
|
|
}
|
|
Module["setValue"] = setValue;
|
|
|
|
|
|
function getValue(ptr, type, noSafe) {
|
|
type = type || 'i8';
|
|
if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit
|
|
switch(type) {
|
|
case 'i1': return HEAP8[((ptr)>>0)];
|
|
case 'i8': return HEAP8[((ptr)>>0)];
|
|
case 'i16': return HEAP16[((ptr)>>1)];
|
|
case 'i32': return HEAP32[((ptr)>>2)];
|
|
case 'i64': return HEAP32[((ptr)>>2)];
|
|
case 'float': return HEAPF32[((ptr)>>2)];
|
|
case 'double': return HEAPF64[((ptr)>>3)];
|
|
default: abort('invalid type for setValue: ' + type);
|
|
}
|
|
return null;
|
|
}
|
|
Module["getValue"] = getValue;
|
|
|
|
var ALLOC_NORMAL = 0; // Tries to use _malloc()
|
|
var ALLOC_STACK = 1; // Lives for the duration of the current function call
|
|
var ALLOC_STATIC = 2; // Cannot be freed
|
|
var ALLOC_DYNAMIC = 3; // Cannot be freed except through sbrk
|
|
var ALLOC_NONE = 4; // Do not allocate
|
|
Module["ALLOC_NORMAL"] = ALLOC_NORMAL;
|
|
Module["ALLOC_STACK"] = ALLOC_STACK;
|
|
Module["ALLOC_STATIC"] = ALLOC_STATIC;
|
|
Module["ALLOC_DYNAMIC"] = ALLOC_DYNAMIC;
|
|
Module["ALLOC_NONE"] = ALLOC_NONE;
|
|
|
|
// allocate(): This is for internal use. You can use it yourself as well, but the interface
|
|
// is a little tricky (see docs right below). The reason is that it is optimized
|
|
// for multiple syntaxes to save space in generated code. So you should
|
|
// normally not use allocate(), and instead allocate memory using _malloc(),
|
|
// initialize it with setValue(), and so forth.
|
|
// @slab: An array of data, or a number. If a number, then the size of the block to allocate,
|
|
// in *bytes* (note that this is sometimes confusing: the next parameter does not
|
|
// affect this!)
|
|
// @types: Either an array of types, one for each byte (or 0 if no type at that position),
|
|
// or a single type which is used for the entire block. This only matters if there
|
|
// is initial data - if @slab is a number, then this does not matter at all and is
|
|
// ignored.
|
|
// @allocator: How to allocate memory, see ALLOC_*
|
|
function allocate(slab, types, allocator, ptr) {
|
|
var zeroinit, size;
|
|
if (typeof slab === 'number') {
|
|
zeroinit = true;
|
|
size = slab;
|
|
} else {
|
|
zeroinit = false;
|
|
size = slab.length;
|
|
}
|
|
|
|
var singleType = typeof types === 'string' ? types : null;
|
|
|
|
var ret;
|
|
if (allocator == ALLOC_NONE) {
|
|
ret = ptr;
|
|
} else {
|
|
ret = [typeof _malloc === 'function' ? _malloc : Runtime.staticAlloc, Runtime.stackAlloc, Runtime.staticAlloc, Runtime.dynamicAlloc][allocator === undefined ? ALLOC_STATIC : allocator](Math.max(size, singleType ? 1 : types.length));
|
|
}
|
|
|
|
if (zeroinit) {
|
|
var ptr = ret, stop;
|
|
assert((ret & 3) == 0);
|
|
stop = ret + (size & ~3);
|
|
for (; ptr < stop; ptr += 4) {
|
|
HEAP32[((ptr)>>2)]=0;
|
|
}
|
|
stop = ret + size;
|
|
while (ptr < stop) {
|
|
HEAP8[((ptr++)>>0)]=0;
|
|
}
|
|
return ret;
|
|
}
|
|
|
|
if (singleType === 'i8') {
|
|
if (slab.subarray || slab.slice) {
|
|
HEAPU8.set(slab, ret);
|
|
} else {
|
|
HEAPU8.set(new Uint8Array(slab), ret);
|
|
}
|
|
return ret;
|
|
}
|
|
|
|
var i = 0, type, typeSize, previousType;
|
|
while (i < size) {
|
|
var curr = slab[i];
|
|
|
|
if (typeof curr === 'function') {
|
|
curr = Runtime.getFunctionIndex(curr);
|
|
}
|
|
|
|
type = singleType || types[i];
|
|
if (type === 0) {
|
|
i++;
|
|
continue;
|
|
}
|
|
assert(type, 'Must know what type to store in allocate!');
|
|
|
|
if (type == 'i64') type = 'i32'; // special case: we have one i32 here, and one i32 later
|
|
|
|
setValue(ret+i, curr, type);
|
|
|
|
// no need to look up size unless type changes, so cache it
|
|
if (previousType !== type) {
|
|
typeSize = Runtime.getNativeTypeSize(type);
|
|
previousType = type;
|
|
}
|
|
i += typeSize;
|
|
}
|
|
|
|
return ret;
|
|
}
|
|
Module["allocate"] = allocate;
|
|
|
|
// Allocate memory during any stage of startup - static memory early on, dynamic memory later, malloc when ready
|
|
function getMemory(size) {
|
|
if (!staticSealed) return Runtime.staticAlloc(size);
|
|
if (!runtimeInitialized) return Runtime.dynamicAlloc(size);
|
|
return _malloc(size);
|
|
}
|
|
Module["getMemory"] = getMemory;
|
|
|
|
function Pointer_stringify(ptr, /* optional */ length) {
|
|
if (length === 0 || !ptr) return '';
|
|
// TODO: use TextDecoder
|
|
// Find the length, and check for UTF while doing so
|
|
var hasUtf = 0;
|
|
var t;
|
|
var i = 0;
|
|
while (1) {
|
|
assert(ptr + i < TOTAL_MEMORY);
|
|
t = HEAPU8[(((ptr)+(i))>>0)];
|
|
hasUtf |= t;
|
|
if (t == 0 && !length) break;
|
|
i++;
|
|
if (length && i == length) break;
|
|
}
|
|
if (!length) length = i;
|
|
|
|
var ret = '';
|
|
|
|
if (hasUtf < 128) {
|
|
var MAX_CHUNK = 1024; // split up into chunks, because .apply on a huge string can overflow the stack
|
|
var curr;
|
|
while (length > 0) {
|
|
curr = String.fromCharCode.apply(String, HEAPU8.subarray(ptr, ptr + Math.min(length, MAX_CHUNK)));
|
|
ret = ret ? ret + curr : curr;
|
|
ptr += MAX_CHUNK;
|
|
length -= MAX_CHUNK;
|
|
}
|
|
return ret;
|
|
}
|
|
return Module['UTF8ToString'](ptr);
|
|
}
|
|
Module["Pointer_stringify"] = Pointer_stringify;
|
|
|
|
// Given a pointer 'ptr' to a null-terminated ASCII-encoded string in the emscripten HEAP, returns
|
|
// a copy of that string as a Javascript String object.
|
|
|
|
function AsciiToString(ptr) {
|
|
var str = '';
|
|
while (1) {
|
|
var ch = HEAP8[((ptr++)>>0)];
|
|
if (!ch) return str;
|
|
str += String.fromCharCode(ch);
|
|
}
|
|
}
|
|
Module["AsciiToString"] = AsciiToString;
|
|
|
|
// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
|
|
// null-terminated and encoded in ASCII form. The copy will require at most str.length+1 bytes of space in the HEAP.
|
|
|
|
function stringToAscii(str, outPtr) {
|
|
return writeAsciiToMemory(str, outPtr, false);
|
|
}
|
|
Module["stringToAscii"] = stringToAscii;
|
|
|
|
// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the given array that contains uint8 values, returns
|
|
// a copy of that string as a Javascript String object.
|
|
|
|
var UTF8Decoder = typeof TextDecoder !== 'undefined' ? new TextDecoder('utf8') : undefined;
|
|
function UTF8ArrayToString(u8Array, idx) {
|
|
var endPtr = idx;
|
|
// TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself.
|
|
// Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage.
|
|
while (u8Array[endPtr]) ++endPtr;
|
|
|
|
if (endPtr - idx > 16 && u8Array.subarray && UTF8Decoder) {
|
|
return UTF8Decoder.decode(u8Array.subarray(idx, endPtr));
|
|
} else {
|
|
var u0, u1, u2, u3, u4, u5;
|
|
|
|
var str = '';
|
|
while (1) {
|
|
// For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629
|
|
u0 = u8Array[idx++];
|
|
if (!u0) return str;
|
|
if (!(u0 & 0x80)) { str += String.fromCharCode(u0); continue; }
|
|
u1 = u8Array[idx++] & 63;
|
|
if ((u0 & 0xE0) == 0xC0) { str += String.fromCharCode(((u0 & 31) << 6) | u1); continue; }
|
|
u2 = u8Array[idx++] & 63;
|
|
if ((u0 & 0xF0) == 0xE0) {
|
|
u0 = ((u0 & 15) << 12) | (u1 << 6) | u2;
|
|
} else {
|
|
u3 = u8Array[idx++] & 63;
|
|
if ((u0 & 0xF8) == 0xF0) {
|
|
u0 = ((u0 & 7) << 18) | (u1 << 12) | (u2 << 6) | u3;
|
|
} else {
|
|
u4 = u8Array[idx++] & 63;
|
|
if ((u0 & 0xFC) == 0xF8) {
|
|
u0 = ((u0 & 3) << 24) | (u1 << 18) | (u2 << 12) | (u3 << 6) | u4;
|
|
} else {
|
|
u5 = u8Array[idx++] & 63;
|
|
u0 = ((u0 & 1) << 30) | (u1 << 24) | (u2 << 18) | (u3 << 12) | (u4 << 6) | u5;
|
|
}
|
|
}
|
|
}
|
|
if (u0 < 0x10000) {
|
|
str += String.fromCharCode(u0);
|
|
} else {
|
|
var ch = u0 - 0x10000;
|
|
str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF));
|
|
}
|
|
}
|
|
}
|
|
}
|
|
Module["UTF8ArrayToString"] = UTF8ArrayToString;
|
|
|
|
// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the emscripten HEAP, returns
|
|
// a copy of that string as a Javascript String object.
|
|
|
|
function UTF8ToString(ptr) {
|
|
return UTF8ArrayToString(HEAPU8,ptr);
|
|
}
|
|
Module["UTF8ToString"] = UTF8ToString;
|
|
|
|
// Copies the given Javascript String object 'str' to the given byte array at address 'outIdx',
|
|
// encoded in UTF8 form and null-terminated. The copy will require at most str.length*4+1 bytes of space in the HEAP.
|
|
// Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write.
|
|
// Parameters:
|
|
// str: the Javascript string to copy.
|
|
// outU8Array: the array to copy to. Each index in this array is assumed to be one 8-byte element.
|
|
// outIdx: The starting offset in the array to begin the copying.
|
|
// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
|
|
// terminator, i.e. if maxBytesToWrite=1, only the null terminator will be written and nothing else.
|
|
// maxBytesToWrite=0 does not write any bytes to the output, not even the null terminator.
|
|
// Returns the number of bytes written, EXCLUDING the null terminator.
|
|
|
|
function stringToUTF8Array(str, outU8Array, outIdx, maxBytesToWrite) {
|
|
if (!(maxBytesToWrite > 0)) // Parameter maxBytesToWrite is not optional. Negative values, 0, null, undefined and false each don't write out any bytes.
|
|
return 0;
|
|
|
|
var startIdx = outIdx;
|
|
var endIdx = outIdx + maxBytesToWrite - 1; // -1 for string null terminator.
|
|
for (var i = 0; i < str.length; ++i) {
|
|
// Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8.
|
|
// See http://unicode.org/faq/utf_bom.html#utf16-3
|
|
// For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629
|
|
var u = str.charCodeAt(i); // possibly a lead surrogate
|
|
if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF);
|
|
if (u <= 0x7F) {
|
|
if (outIdx >= endIdx) break;
|
|
outU8Array[outIdx++] = u;
|
|
} else if (u <= 0x7FF) {
|
|
if (outIdx + 1 >= endIdx) break;
|
|
outU8Array[outIdx++] = 0xC0 | (u >> 6);
|
|
outU8Array[outIdx++] = 0x80 | (u & 63);
|
|
} else if (u <= 0xFFFF) {
|
|
if (outIdx + 2 >= endIdx) break;
|
|
outU8Array[outIdx++] = 0xE0 | (u >> 12);
|
|
outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
|
|
outU8Array[outIdx++] = 0x80 | (u & 63);
|
|
} else if (u <= 0x1FFFFF) {
|
|
if (outIdx + 3 >= endIdx) break;
|
|
outU8Array[outIdx++] = 0xF0 | (u >> 18);
|
|
outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
|
|
outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
|
|
outU8Array[outIdx++] = 0x80 | (u & 63);
|
|
} else if (u <= 0x3FFFFFF) {
|
|
if (outIdx + 4 >= endIdx) break;
|
|
outU8Array[outIdx++] = 0xF8 | (u >> 24);
|
|
outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63);
|
|
outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
|
|
outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
|
|
outU8Array[outIdx++] = 0x80 | (u & 63);
|
|
} else {
|
|
if (outIdx + 5 >= endIdx) break;
|
|
outU8Array[outIdx++] = 0xFC | (u >> 30);
|
|
outU8Array[outIdx++] = 0x80 | ((u >> 24) & 63);
|
|
outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63);
|
|
outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63);
|
|
outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63);
|
|
outU8Array[outIdx++] = 0x80 | (u & 63);
|
|
}
|
|
}
|
|
// Null-terminate the pointer to the buffer.
|
|
outU8Array[outIdx] = 0;
|
|
return outIdx - startIdx;
|
|
}
|
|
Module["stringToUTF8Array"] = stringToUTF8Array;
|
|
|
|
// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
|
|
// null-terminated and encoded in UTF8 form. The copy will require at most str.length*4+1 bytes of space in the HEAP.
|
|
// Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write.
|
|
// Returns the number of bytes written, EXCLUDING the null terminator.
|
|
|
|
function stringToUTF8(str, outPtr, maxBytesToWrite) {
|
|
assert(typeof maxBytesToWrite == 'number', 'stringToUTF8(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!');
|
|
return stringToUTF8Array(str, HEAPU8,outPtr, maxBytesToWrite);
|
|
}
|
|
Module["stringToUTF8"] = stringToUTF8;
|
|
|
|
// Returns the number of bytes the given Javascript string takes if encoded as a UTF8 byte array, EXCLUDING the null terminator byte.
|
|
|
|
function lengthBytesUTF8(str) {
|
|
var len = 0;
|
|
for (var i = 0; i < str.length; ++i) {
|
|
// Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8.
|
|
// See http://unicode.org/faq/utf_bom.html#utf16-3
|
|
var u = str.charCodeAt(i); // possibly a lead surrogate
|
|
if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF);
|
|
if (u <= 0x7F) {
|
|
++len;
|
|
} else if (u <= 0x7FF) {
|
|
len += 2;
|
|
} else if (u <= 0xFFFF) {
|
|
len += 3;
|
|
} else if (u <= 0x1FFFFF) {
|
|
len += 4;
|
|
} else if (u <= 0x3FFFFFF) {
|
|
len += 5;
|
|
} else {
|
|
len += 6;
|
|
}
|
|
}
|
|
return len;
|
|
}
|
|
Module["lengthBytesUTF8"] = lengthBytesUTF8;
|
|
|
|
// Given a pointer 'ptr' to a null-terminated UTF16LE-encoded string in the emscripten HEAP, returns
|
|
// a copy of that string as a Javascript String object.
|
|
|
|
var UTF16Decoder = typeof TextDecoder !== 'undefined' ? new TextDecoder('utf-16le') : undefined;
|
|
function UTF16ToString(ptr) {
|
|
assert(ptr % 2 == 0, 'Pointer passed to UTF16ToString must be aligned to two bytes!');
|
|
var endPtr = ptr;
|
|
// TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself.
|
|
// Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage.
|
|
var idx = endPtr >> 1;
|
|
while (HEAP16[idx]) ++idx;
|
|
endPtr = idx << 1;
|
|
|
|
if (endPtr - ptr > 32 && UTF16Decoder) {
|
|
return UTF16Decoder.decode(HEAPU8.subarray(ptr, endPtr));
|
|
} else {
|
|
var i = 0;
|
|
|
|
var str = '';
|
|
while (1) {
|
|
var codeUnit = HEAP16[(((ptr)+(i*2))>>1)];
|
|
if (codeUnit == 0) return str;
|
|
++i;
|
|
// fromCharCode constructs a character from a UTF-16 code unit, so we can pass the UTF16 string right through.
|
|
str += String.fromCharCode(codeUnit);
|
|
}
|
|
}
|
|
}
|
|
|
|
|
|
// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
|
|
// null-terminated and encoded in UTF16 form. The copy will require at most str.length*4+2 bytes of space in the HEAP.
|
|
// Use the function lengthBytesUTF16() to compute the exact number of bytes (excluding null terminator) that this function will write.
|
|
// Parameters:
|
|
// str: the Javascript string to copy.
|
|
// outPtr: Byte address in Emscripten HEAP where to write the string to.
|
|
// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
|
|
// terminator, i.e. if maxBytesToWrite=2, only the null terminator will be written and nothing else.
|
|
// maxBytesToWrite<2 does not write any bytes to the output, not even the null terminator.
|
|
// Returns the number of bytes written, EXCLUDING the null terminator.
|
|
|
|
function stringToUTF16(str, outPtr, maxBytesToWrite) {
|
|
assert(outPtr % 2 == 0, 'Pointer passed to stringToUTF16 must be aligned to two bytes!');
|
|
assert(typeof maxBytesToWrite == 'number', 'stringToUTF16(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!');
|
|
// Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed.
|
|
if (maxBytesToWrite === undefined) {
|
|
maxBytesToWrite = 0x7FFFFFFF;
|
|
}
|
|
if (maxBytesToWrite < 2) return 0;
|
|
maxBytesToWrite -= 2; // Null terminator.
|
|
var startPtr = outPtr;
|
|
var numCharsToWrite = (maxBytesToWrite < str.length*2) ? (maxBytesToWrite / 2) : str.length;
|
|
for (var i = 0; i < numCharsToWrite; ++i) {
|
|
// charCodeAt returns a UTF-16 encoded code unit, so it can be directly written to the HEAP.
|
|
var codeUnit = str.charCodeAt(i); // possibly a lead surrogate
|
|
HEAP16[((outPtr)>>1)]=codeUnit;
|
|
outPtr += 2;
|
|
}
|
|
// Null-terminate the pointer to the HEAP.
|
|
HEAP16[((outPtr)>>1)]=0;
|
|
return outPtr - startPtr;
|
|
}
|
|
|
|
|
|
// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte.
|
|
|
|
function lengthBytesUTF16(str) {
|
|
return str.length*2;
|
|
}
|
|
|
|
|
|
function UTF32ToString(ptr) {
|
|
assert(ptr % 4 == 0, 'Pointer passed to UTF32ToString must be aligned to four bytes!');
|
|
var i = 0;
|
|
|
|
var str = '';
|
|
while (1) {
|
|
var utf32 = HEAP32[(((ptr)+(i*4))>>2)];
|
|
if (utf32 == 0)
|
|
return str;
|
|
++i;
|
|
// Gotcha: fromCharCode constructs a character from a UTF-16 encoded code (pair), not from a Unicode code point! So encode the code point to UTF-16 for constructing.
|
|
// See http://unicode.org/faq/utf_bom.html#utf16-3
|
|
if (utf32 >= 0x10000) {
|
|
var ch = utf32 - 0x10000;
|
|
str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF));
|
|
} else {
|
|
str += String.fromCharCode(utf32);
|
|
}
|
|
}
|
|
}
|
|
|
|
|
|
// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr',
|
|
// null-terminated and encoded in UTF32 form. The copy will require at most str.length*4+4 bytes of space in the HEAP.
|
|
// Use the function lengthBytesUTF32() to compute the exact number of bytes (excluding null terminator) that this function will write.
|
|
// Parameters:
|
|
// str: the Javascript string to copy.
|
|
// outPtr: Byte address in Emscripten HEAP where to write the string to.
|
|
// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null
|
|
// terminator, i.e. if maxBytesToWrite=4, only the null terminator will be written and nothing else.
|
|
// maxBytesToWrite<4 does not write any bytes to the output, not even the null terminator.
|
|
// Returns the number of bytes written, EXCLUDING the null terminator.
|
|
|
|
function stringToUTF32(str, outPtr, maxBytesToWrite) {
|
|
assert(outPtr % 4 == 0, 'Pointer passed to stringToUTF32 must be aligned to four bytes!');
|
|
assert(typeof maxBytesToWrite == 'number', 'stringToUTF32(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!');
|
|
// Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed.
|
|
if (maxBytesToWrite === undefined) {
|
|
maxBytesToWrite = 0x7FFFFFFF;
|
|
}
|
|
if (maxBytesToWrite < 4) return 0;
|
|
var startPtr = outPtr;
|
|
var endPtr = startPtr + maxBytesToWrite - 4;
|
|
for (var i = 0; i < str.length; ++i) {
|
|
// Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap.
|
|
// See http://unicode.org/faq/utf_bom.html#utf16-3
|
|
var codeUnit = str.charCodeAt(i); // possibly a lead surrogate
|
|
if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) {
|
|
var trailSurrogate = str.charCodeAt(++i);
|
|
codeUnit = 0x10000 + ((codeUnit & 0x3FF) << 10) | (trailSurrogate & 0x3FF);
|
|
}
|
|
HEAP32[((outPtr)>>2)]=codeUnit;
|
|
outPtr += 4;
|
|
if (outPtr + 4 > endPtr) break;
|
|
}
|
|
// Null-terminate the pointer to the HEAP.
|
|
HEAP32[((outPtr)>>2)]=0;
|
|
return outPtr - startPtr;
|
|
}
|
|
|
|
|
|
// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte.
|
|
|
|
function lengthBytesUTF32(str) {
|
|
var len = 0;
|
|
for (var i = 0; i < str.length; ++i) {
|
|
// Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap.
|
|
// See http://unicode.org/faq/utf_bom.html#utf16-3
|
|
var codeUnit = str.charCodeAt(i);
|
|
if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) ++i; // possibly a lead surrogate, so skip over the tail surrogate.
|
|
len += 4;
|
|
}
|
|
|
|
return len;
|
|
}
|
|
|
|
|
|
function demangle(func) {
|
|
var __cxa_demangle_func = Module['___cxa_demangle'] || Module['__cxa_demangle'];
|
|
if (__cxa_demangle_func) {
|
|
try {
|
|
var s =
|
|
func.substr(1);
|
|
var len = lengthBytesUTF8(s)+1;
|
|
var buf = _malloc(len);
|
|
stringToUTF8(s, buf, len);
|
|
var status = _malloc(4);
|
|
var ret = __cxa_demangle_func(buf, 0, 0, status);
|
|
if (getValue(status, 'i32') === 0 && ret) {
|
|
return Pointer_stringify(ret);
|
|
}
|
|
// otherwise, libcxxabi failed
|
|
} catch(e) {
|
|
// ignore problems here
|
|
} finally {
|
|
if (buf) _free(buf);
|
|
if (status) _free(status);
|
|
if (ret) _free(ret);
|
|
}
|
|
// failure when using libcxxabi, don't demangle
|
|
return func;
|
|
}
|
|
Runtime.warnOnce('warning: build with -s DEMANGLE_SUPPORT=1 to link in libcxxabi demangling');
|
|
return func;
|
|
}
|
|
|
|
function demangleAll(text) {
|
|
var regex =
|
|
/__Z[\w\d_]+/g;
|
|
return text.replace(regex,
|
|
function(x) {
|
|
var y = demangle(x);
|
|
return x === y ? x : (x + ' [' + y + ']');
|
|
});
|
|
}
|
|
|
|
function jsStackTrace() {
|
|
var err = new Error();
|
|
if (!err.stack) {
|
|
// IE10+ special cases: It does have callstack info, but it is only populated if an Error object is thrown,
|
|
// so try that as a special-case.
|
|
try {
|
|
throw new Error(0);
|
|
} catch(e) {
|
|
err = e;
|
|
}
|
|
if (!err.stack) {
|
|
return '(no stack trace available)';
|
|
}
|
|
}
|
|
return err.stack.toString();
|
|
}
|
|
|
|
function stackTrace() {
|
|
var js = jsStackTrace();
|
|
if (Module['extraStackTrace']) js += '\n' + Module['extraStackTrace']();
|
|
return demangleAll(js);
|
|
}
|
|
Module["stackTrace"] = stackTrace;
|
|
|
|
// Memory management
|
|
|
|
var PAGE_SIZE = 16384;
|
|
var WASM_PAGE_SIZE = 65536;
|
|
var ASMJS_PAGE_SIZE = 16777216;
|
|
var MIN_TOTAL_MEMORY = 16777216;
|
|
|
|
function alignUp(x, multiple) {
|
|
if (x % multiple > 0) {
|
|
x += multiple - (x % multiple);
|
|
}
|
|
return x;
|
|
}
|
|
|
|
var HEAP;
|
|
var buffer;
|
|
var HEAP8, HEAPU8, HEAP16, HEAPU16, HEAP32, HEAPU32, HEAPF32, HEAPF64;
|
|
|
|
function updateGlobalBuffer(buf) {
|
|
Module['buffer'] = buffer = buf;
|
|
}
|
|
|
|
function updateGlobalBufferViews() {
|
|
Module['HEAP8'] = HEAP8 = new Int8Array(buffer);
|
|
Module['HEAP16'] = HEAP16 = new Int16Array(buffer);
|
|
Module['HEAP32'] = HEAP32 = new Int32Array(buffer);
|
|
Module['HEAPU8'] = HEAPU8 = new Uint8Array(buffer);
|
|
Module['HEAPU16'] = HEAPU16 = new Uint16Array(buffer);
|
|
Module['HEAPU32'] = HEAPU32 = new Uint32Array(buffer);
|
|
Module['HEAPF32'] = HEAPF32 = new Float32Array(buffer);
|
|
Module['HEAPF64'] = HEAPF64 = new Float64Array(buffer);
|
|
}
|
|
|
|
var STATIC_BASE, STATICTOP, staticSealed; // static area
|
|
var STACK_BASE, STACKTOP, STACK_MAX; // stack area
|
|
var DYNAMIC_BASE, DYNAMICTOP_PTR; // dynamic area handled by sbrk
|
|
|
|
if (!ENVIRONMENT_IS_PTHREAD) { // Pthreads have already initialized these variables in src/pthread-main.js, where they were passed to the thread worker at startup time
|
|
STATIC_BASE = STATICTOP = STACK_BASE = STACKTOP = STACK_MAX = DYNAMIC_BASE = DYNAMICTOP_PTR = 0;
|
|
staticSealed = false;
|
|
}
|
|
|
|
if (ENVIRONMENT_IS_PTHREAD) {
|
|
staticSealed = true; // The static memory area has been initialized already in the main thread, pthreads skip this.
|
|
}
|
|
|
|
// Initializes the stack cookie. Called at the startup of main and at the startup of each thread in pthreads mode.
|
|
function writeStackCookie() {
|
|
assert((STACK_MAX & 3) == 0);
|
|
HEAPU32[(STACK_MAX >> 2)-1] = 0x02135467;
|
|
HEAPU32[(STACK_MAX >> 2)-2] = 0x89BACDFE;
|
|
}
|
|
|
|
function checkStackCookie() {
|
|
if (HEAPU32[(STACK_MAX >> 2)-1] != 0x02135467 || HEAPU32[(STACK_MAX >> 2)-2] != 0x89BACDFE) {
|
|
abort('Stack overflow! Stack cookie has been overwritten, expected hex dwords 0x89BACDFE and 0x02135467, but received 0x' + HEAPU32[(STACK_MAX >> 2)-2].toString(16) + ' ' + HEAPU32[(STACK_MAX >> 2)-1].toString(16));
|
|
}
|
|
// Also test the global address 0 for integrity. This check is not compatible with SAFE_SPLIT_MEMORY though, since that mode already tests all address 0 accesses on its own.
|
|
if (HEAP32[0] !== 0x63736d65 /* 'emsc' */) throw 'Runtime error: The application has corrupted its heap memory area (address zero)!';
|
|
}
|
|
|
|
function abortStackOverflow(allocSize) {
|
|
abort('Stack overflow! Attempted to allocate ' + allocSize + ' bytes on the stack, but stack has only ' + (STACK_MAX - asm.stackSave() + allocSize) + ' bytes available!');
|
|
}
|
|
|
|
function abortOnCannotGrowMemory() {
|
|
abort('Cannot enlarge memory arrays. Either (1) compile with -s TOTAL_MEMORY=X with X higher than the current value ' + TOTAL_MEMORY + ', (2) compile with -s ALLOW_MEMORY_GROWTH=1 which adjusts the size at runtime but prevents some optimizations, (3) set Module.TOTAL_MEMORY to a higher value before the program runs, or if you want malloc to return NULL (0) instead of this abort, compile with -s ABORTING_MALLOC=0 ');
|
|
}
|
|
|
|
|
|
function enlargeMemory() {
|
|
abort('Cannot enlarge memory arrays, since compiling with pthreads support enabled (-s USE_PTHREADS=1).');
|
|
}
|
|
|
|
|
|
var TOTAL_STACK = Module['TOTAL_STACK'] || 5242880;
|
|
var TOTAL_MEMORY = Module['TOTAL_MEMORY'] || 16777216;
|
|
if (TOTAL_MEMORY < TOTAL_STACK) Module.printErr('TOTAL_MEMORY should be larger than TOTAL_STACK, was ' + TOTAL_MEMORY + '! (TOTAL_STACK=' + TOTAL_STACK + ')');
|
|
|
|
// Initialize the runtime's memory
|
|
// check for full engine support (use string 'subarray' to avoid closure compiler confusion)
|
|
assert(typeof Int32Array !== 'undefined' && typeof Float64Array !== 'undefined' && !!(new Int32Array(1)['subarray']) && !!(new Int32Array(1)['set']),
|
|
'JS engine does not provide full typed array support');
|
|
|
|
|
|
if (typeof SharedArrayBuffer !== 'undefined') {
|
|
if (!ENVIRONMENT_IS_PTHREAD) buffer = new SharedArrayBuffer(TOTAL_MEMORY);
|
|
// Currently SharedArrayBuffer does not have a slice() operation, so polyfill it in.
|
|
// Adapted from https://github.com/ttaubert/node-arraybuffer-slice, (c) 2014 Tim Taubert <tim@timtaubert.de>
|
|
// arraybuffer-slice may be freely distributed under the MIT license.
|
|
(function (undefined) {
|
|
"use strict";
|
|
function clamp(val, length) {
|
|
val = (val|0) || 0;
|
|
if (val < 0) return Math.max(val + length, 0);
|
|
return Math.min(val, length);
|
|
}
|
|
if (typeof SharedArrayBuffer !== 'undefined' && !SharedArrayBuffer.prototype.slice) {
|
|
SharedArrayBuffer.prototype.slice = function (from, to) {
|
|
var length = this.byteLength;
|
|
var begin = clamp(from, length);
|
|
var end = length;
|
|
if (to !== undefined) end = clamp(to, length);
|
|
if (begin > end) return new ArrayBuffer(0);
|
|
var num = end - begin;
|
|
var target = new ArrayBuffer(num);
|
|
var targetArray = new Uint8Array(target);
|
|
var sourceArray = new Uint8Array(this, begin, num);
|
|
targetArray.set(sourceArray);
|
|
return target;
|
|
};
|
|
}
|
|
})();
|
|
} else {
|
|
if (!ENVIRONMENT_IS_PTHREAD) buffer = new ArrayBuffer(TOTAL_MEMORY);
|
|
}
|
|
updateGlobalBufferViews();
|
|
|
|
if (typeof Atomics === 'undefined') {
|
|
// Polyfill singlethreaded atomics ops from http://lars-t-hansen.github.io/ecmascript_sharedmem/shmem.html#Atomics.add
|
|
// No thread-safety needed since we don't have multithreading support.
|
|
Atomics = {};
|
|
Atomics['add'] = function(t, i, v) { var w = t[i]; t[i] += v; return w; }
|
|
Atomics['and'] = function(t, i, v) { var w = t[i]; t[i] &= v; return w; }
|
|
Atomics['compareExchange'] = function(t, i, e, r) { var w = t[i]; if (w == e) t[i] = r; return w; }
|
|
Atomics['exchange'] = function(t, i, v) { var w = t[i]; t[i] = v; return w; }
|
|
Atomics['wait'] = function(t, i, v, o) { if (t[i] != v) return 'not-equal'; else return 'timed-out'; }
|
|
Atomics['wake'] = function(t, i, c) { return 0; }
|
|
Atomics['wakeOrRequeue'] = function(t, i1, c, i2, v) { return 0; }
|
|
Atomics['isLockFree'] = function(s) { return true; }
|
|
Atomics['load'] = function(t, i) { return t[i]; }
|
|
Atomics['or'] = function(t, i, v) { var w = t[i]; t[i] |= v; return w; }
|
|
Atomics['store'] = function(t, i, v) { t[i] = v; return v; }
|
|
Atomics['sub'] = function(t, i, v) { var w = t[i]; t[i] -= v; return w; }
|
|
Atomics['xor'] = function(t, i, v) { var w = t[i]; t[i] ^= v; return w; }
|
|
}
|
|
|
|
|
|
function getTotalMemory() {
|
|
return TOTAL_MEMORY;
|
|
}
|
|
|
|
// Endianness check (note: assumes compiler arch was little-endian)
|
|
if (!ENVIRONMENT_IS_PTHREAD) {
|
|
HEAP32[0] = 0x63736d65; /* 'emsc' */
|
|
} else {
|
|
if (HEAP32[0] !== 0x63736d65) throw 'Runtime error: The application has corrupted its heap memory area (address zero)!';
|
|
}
|
|
HEAP16[1] = 0x6373;
|
|
if (HEAPU8[2] !== 0x73 || HEAPU8[3] !== 0x63) throw 'Runtime error: expected the system to be little-endian!';
|
|
|
|
Module['HEAP'] = HEAP;
|
|
Module['buffer'] = buffer;
|
|
Module['HEAP8'] = HEAP8;
|
|
Module['HEAP16'] = HEAP16;
|
|
Module['HEAP32'] = HEAP32;
|
|
Module['HEAPU8'] = HEAPU8;
|
|
Module['HEAPU16'] = HEAPU16;
|
|
Module['HEAPU32'] = HEAPU32;
|
|
Module['HEAPF32'] = HEAPF32;
|
|
Module['HEAPF64'] = HEAPF64;
|
|
|
|
function callRuntimeCallbacks(callbacks) {
|
|
while(callbacks.length > 0) {
|
|
var callback = callbacks.shift();
|
|
if (typeof callback == 'function') {
|
|
callback();
|
|
continue;
|
|
}
|
|
var func = callback.func;
|
|
if (typeof func === 'number') {
|
|
if (callback.arg === undefined) {
|
|
Module['dynCall_v'](func);
|
|
} else {
|
|
Module['dynCall_vi'](func, callback.arg);
|
|
}
|
|
} else {
|
|
func(callback.arg === undefined ? null : callback.arg);
|
|
}
|
|
}
|
|
}
|
|
|
|
var __ATPRERUN__ = []; // functions called before the runtime is initialized
|
|
var __ATINIT__ = []; // functions called during startup
|
|
var __ATMAIN__ = []; // functions called when main() is to be run
|
|
var __ATEXIT__ = []; // functions called during shutdown
|
|
var __ATPOSTRUN__ = []; // functions called after the runtime has exited
|
|
|
|
var runtimeInitialized = false;
|
|
var runtimeExited = false;
|
|
|
|
if (ENVIRONMENT_IS_PTHREAD) runtimeInitialized = true; // The runtime is hosted in the main thread, and bits shared to pthreads via SharedArrayBuffer. No need to init again in pthread.
|
|
|
|
function preRun() {
|
|
if (ENVIRONMENT_IS_PTHREAD) return; // PThreads reuse the runtime from the main thread.
|
|
// compatibility - merge in anything from Module['preRun'] at this time
|
|
if (Module['preRun']) {
|
|
if (typeof Module['preRun'] == 'function') Module['preRun'] = [Module['preRun']];
|
|
while (Module['preRun'].length) {
|
|
addOnPreRun(Module['preRun'].shift());
|
|
}
|
|
}
|
|
callRuntimeCallbacks(__ATPRERUN__);
|
|
}
|
|
|
|
function ensureInitRuntime() {
|
|
checkStackCookie();
|
|
if (ENVIRONMENT_IS_PTHREAD) return; // PThreads reuse the runtime from the main thread.
|
|
if (runtimeInitialized) return;
|
|
runtimeInitialized = true;
|
|
callRuntimeCallbacks(__ATINIT__);
|
|
}
|
|
|
|
function preMain() {
|
|
checkStackCookie();
|
|
if (ENVIRONMENT_IS_PTHREAD) return; // PThreads reuse the runtime from the main thread.
|
|
callRuntimeCallbacks(__ATMAIN__);
|
|
}
|
|
|
|
function exitRuntime() {
|
|
checkStackCookie();
|
|
if (ENVIRONMENT_IS_PTHREAD) return; // PThreads reuse the runtime from the main thread.
|
|
callRuntimeCallbacks(__ATEXIT__);
|
|
runtimeExited = true;
|
|
}
|
|
|
|
function postRun() {
|
|
checkStackCookie();
|
|
if (ENVIRONMENT_IS_PTHREAD) return; // PThreads reuse the runtime from the main thread.
|
|
// compatibility - merge in anything from Module['postRun'] at this time
|
|
if (Module['postRun']) {
|
|
if (typeof Module['postRun'] == 'function') Module['postRun'] = [Module['postRun']];
|
|
while (Module['postRun'].length) {
|
|
addOnPostRun(Module['postRun'].shift());
|
|
}
|
|
}
|
|
callRuntimeCallbacks(__ATPOSTRUN__);
|
|
}
|
|
|
|
function addOnPreRun(cb) {
|
|
__ATPRERUN__.unshift(cb);
|
|
}
|
|
Module["addOnPreRun"] = addOnPreRun;
|
|
|
|
function addOnInit(cb) {
|
|
__ATINIT__.unshift(cb);
|
|
}
|
|
Module["addOnInit"] = addOnInit;
|
|
|
|
function addOnPreMain(cb) {
|
|
__ATMAIN__.unshift(cb);
|
|
}
|
|
Module["addOnPreMain"] = addOnPreMain;
|
|
|
|
function addOnExit(cb) {
|
|
__ATEXIT__.unshift(cb);
|
|
}
|
|
Module["addOnExit"] = addOnExit;
|
|
|
|
function addOnPostRun(cb) {
|
|
__ATPOSTRUN__.unshift(cb);
|
|
}
|
|
Module["addOnPostRun"] = addOnPostRun;
|
|
|
|
// Tools
|
|
|
|
|
|
function intArrayFromString(stringy, dontAddNull, length /* optional */) {
|
|
var len = length > 0 ? length : lengthBytesUTF8(stringy)+1;
|
|
var u8array = new Array(len);
|
|
var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length);
|
|
if (dontAddNull) u8array.length = numBytesWritten;
|
|
return u8array;
|
|
}
|
|
Module["intArrayFromString"] = intArrayFromString;
|
|
|
|
function intArrayToString(array) {
|
|
var ret = [];
|
|
for (var i = 0; i < array.length; i++) {
|
|
var chr = array[i];
|
|
if (chr > 0xFF) {
|
|
assert(false, 'Character code ' + chr + ' (' + String.fromCharCode(chr) + ') at offset ' + i + ' not in 0x00-0xFF.');
|
|
chr &= 0xFF;
|
|
}
|
|
ret.push(String.fromCharCode(chr));
|
|
}
|
|
return ret.join('');
|
|
}
|
|
Module["intArrayToString"] = intArrayToString;
|
|
|
|
// Deprecated: This function should not be called because it is unsafe and does not provide
|
|
// a maximum length limit of how many bytes it is allowed to write. Prefer calling the
|
|
// function stringToUTF8Array() instead, which takes in a maximum length that can be used
|
|
// to be secure from out of bounds writes.
|
|
function writeStringToMemory(string, buffer, dontAddNull) {
|
|
Runtime.warnOnce('writeStringToMemory is deprecated and should not be called! Use stringToUTF8() instead!');
|
|
|
|
var lastChar, end;
|
|
if (dontAddNull) {
|
|
// stringToUTF8Array always appends null. If we don't want to do that, remember the
|
|
// character that existed at the location where the null will be placed, and restore
|
|
// that after the write (below).
|
|
end = buffer + lengthBytesUTF8(string);
|
|
lastChar = HEAP8[end];
|
|
}
|
|
stringToUTF8(string, buffer, Infinity);
|
|
if (dontAddNull) HEAP8[end] = lastChar; // Restore the value under the null character.
|
|
}
|
|
Module["writeStringToMemory"] = writeStringToMemory;
|
|
|
|
function writeArrayToMemory(array, buffer) {
|
|
assert(array.length >= 0, 'writeArrayToMemory array must have a length (should be an array or typed array)')
|
|
HEAP8.set(array, buffer);
|
|
}
|
|
Module["writeArrayToMemory"] = writeArrayToMemory;
|
|
|
|
function writeAsciiToMemory(str, buffer, dontAddNull) {
|
|
for (var i = 0; i < str.length; ++i) {
|
|
assert(str.charCodeAt(i) === str.charCodeAt(i)&0xff);
|
|
HEAP8[((buffer++)>>0)]=str.charCodeAt(i);
|
|
}
|
|
// Null-terminate the pointer to the HEAP.
|
|
if (!dontAddNull) HEAP8[((buffer)>>0)]=0;
|
|
}
|
|
Module["writeAsciiToMemory"] = writeAsciiToMemory;
|
|
|
|
function unSign(value, bits, ignore) {
|
|
if (value >= 0) {
|
|
return value;
|
|
}
|
|
return bits <= 32 ? 2*Math.abs(1 << (bits-1)) + value // Need some trickery, since if bits == 32, we are right at the limit of the bits JS uses in bitshifts
|
|
: Math.pow(2, bits) + value;
|
|
}
|
|
function reSign(value, bits, ignore) {
|
|
if (value <= 0) {
|
|
return value;
|
|
}
|
|
var half = bits <= 32 ? Math.abs(1 << (bits-1)) // abs is needed if bits == 32
|
|
: Math.pow(2, bits-1);
|
|
if (value >= half && (bits <= 32 || value > half)) { // for huge values, we can hit the precision limit and always get true here. so don't do that
|
|
// but, in general there is no perfect solution here. With 64-bit ints, we get rounding and errors
|
|
// TODO: In i64 mode 1, resign the two parts separately and safely
|
|
value = -2*half + value; // Cannot bitshift half, as it may be at the limit of the bits JS uses in bitshifts
|
|
}
|
|
return value;
|
|
}
|
|
|
|
// Atomics.exchange is not yet implemented in the spec, so polyfill that in via compareExchange in the meanwhile.
|
|
// TODO: Keep an eye out for the opportunity to remove this once Atomics.exchange is available.
|
|
if (typeof Atomics !== 'undefined' && !Atomics['exchange']) {
|
|
Atomics['exchange'] = function(heap, index, val) {
|
|
var oldVal, oldVal2;
|
|
do {
|
|
oldVal = Atomics['load'](heap, index);
|
|
oldVal2 = Atomics['compareExchange'](heap, index, oldVal, val);
|
|
} while(oldVal != oldVal2);
|
|
return oldVal;
|
|
}
|
|
}
|
|
|
|
// check for imul support, and also for correctness ( https://bugs.webkit.org/show_bug.cgi?id=126345 )
|
|
if (!Math['imul'] || Math['imul'](0xffffffff, 5) !== -5) Math['imul'] = function imul(a, b) {
|
|
var ah = a >>> 16;
|
|
var al = a & 0xffff;
|
|
var bh = b >>> 16;
|
|
var bl = b & 0xffff;
|
|
return (al*bl + ((ah*bl + al*bh) << 16))|0;
|
|
};
|
|
Math.imul = Math['imul'];
|
|
|
|
|
|
if (!Math['clz32']) Math['clz32'] = function(x) {
|
|
x = x >>> 0;
|
|
for (var i = 0; i < 32; i++) {
|
|
if (x & (1 << (31 - i))) return i;
|
|
}
|
|
return 32;
|
|
};
|
|
Math.clz32 = Math['clz32']
|
|
|
|
if (!Math['trunc']) Math['trunc'] = function(x) {
|
|
return x < 0 ? Math.ceil(x) : Math.floor(x);
|
|
};
|
|
Math.trunc = Math['trunc'];
|
|
|
|
var Math_abs = Math.abs;
|
|
var Math_cos = Math.cos;
|
|
var Math_sin = Math.sin;
|
|
var Math_tan = Math.tan;
|
|
var Math_acos = Math.acos;
|
|
var Math_asin = Math.asin;
|
|
var Math_atan = Math.atan;
|
|
var Math_atan2 = Math.atan2;
|
|
var Math_exp = Math.exp;
|
|
var Math_log = Math.log;
|
|
var Math_sqrt = Math.sqrt;
|
|
var Math_ceil = Math.ceil;
|
|
var Math_floor = Math.floor;
|
|
var Math_pow = Math.pow;
|
|
var Math_imul = Math.imul;
|
|
var Math_fround = Math.fround;
|
|
var Math_round = Math.round;
|
|
var Math_min = Math.min;
|
|
var Math_clz32 = Math.clz32;
|
|
var Math_trunc = Math.trunc;
|
|
|
|
// A counter of dependencies for calling run(). If we need to
|
|
// do asynchronous work before running, increment this and
|
|
// decrement it. Incrementing must happen in a place like
|
|
// PRE_RUN_ADDITIONS (used by emcc to add file preloading).
|
|
// Note that you can add dependencies in preRun, even though
|
|
// it happens right before run - run will be postponed until
|
|
// the dependencies are met.
|
|
var runDependencies = 0;
|
|
var runDependencyWatcher = null;
|
|
var dependenciesFulfilled = null; // overridden to take different actions when all run dependencies are fulfilled
|
|
var runDependencyTracking = {};
|
|
|
|
function getUniqueRunDependency(id) {
|
|
var orig = id;
|
|
while (1) {
|
|
if (!runDependencyTracking[id]) return id;
|
|
id = orig + Math.random();
|
|
}
|
|
return id;
|
|
}
|
|
|
|
function addRunDependency(id) {
|
|
// We should never get here in pthreads (could no-op this out if called in pthreads, but that might indicate a bug in caller side,
|
|
// so good to be very explicit)
|
|
assert(!ENVIRONMENT_IS_PTHREAD);
|
|
runDependencies++;
|
|
if (Module['monitorRunDependencies']) {
|
|
Module['monitorRunDependencies'](runDependencies);
|
|
}
|
|
if (id) {
|
|
assert(!runDependencyTracking[id]);
|
|
runDependencyTracking[id] = 1;
|
|
if (runDependencyWatcher === null && typeof setInterval !== 'undefined') {
|
|
// Check for missing dependencies every few seconds
|
|
runDependencyWatcher = setInterval(function() {
|
|
if (ABORT) {
|
|
clearInterval(runDependencyWatcher);
|
|
runDependencyWatcher = null;
|
|
return;
|
|
}
|
|
var shown = false;
|
|
for (var dep in runDependencyTracking) {
|
|
if (!shown) {
|
|
shown = true;
|
|
Module.printErr('still waiting on run dependencies:');
|
|
}
|
|
Module.printErr('dependency: ' + dep);
|
|
}
|
|
if (shown) {
|
|
Module.printErr('(end of list)');
|
|
}
|
|
}, 10000);
|
|
}
|
|
} else {
|
|
Module.printErr('warning: run dependency added without ID');
|
|
}
|
|
}
|
|
Module["addRunDependency"] = addRunDependency;
|
|
|
|
function removeRunDependency(id) {
|
|
runDependencies--;
|
|
if (Module['monitorRunDependencies']) {
|
|
Module['monitorRunDependencies'](runDependencies);
|
|
}
|
|
if (id) {
|
|
assert(runDependencyTracking[id]);
|
|
delete runDependencyTracking[id];
|
|
} else {
|
|
Module.printErr('warning: run dependency removed without ID');
|
|
}
|
|
if (runDependencies == 0) {
|
|
if (runDependencyWatcher !== null) {
|
|
clearInterval(runDependencyWatcher);
|
|
runDependencyWatcher = null;
|
|
}
|
|
if (dependenciesFulfilled) {
|
|
var callback = dependenciesFulfilled;
|
|
dependenciesFulfilled = null;
|
|
callback(); // can add another dependenciesFulfilled
|
|
}
|
|
}
|
|
}
|
|
Module["removeRunDependency"] = removeRunDependency;
|
|
|
|
Module["preloadedImages"] = {}; // maps url to image data
|
|
Module["preloadedAudios"] = {}; // maps url to audio data
|
|
|
|
|
|
|
|
var memoryInitializer = null;
|
|
|
|
|
|
|
|
|
|
|
|
|
|
// === Body ===
|
|
|
|
var ASM_CONSTS = [function($0, $1) { { Module.printErr('bad name in getProcAddress: ' + [Pointer_stringify($0), Pointer_stringify($1)]); } },
|
|
function() { postMessage({ cmd: 'processQueuedMainThreadWork' }) }];
|
|
|
|
function _emscripten_asm_const_iii(code, a0, a1) {
|
|
return ASM_CONSTS[code](a0, a1);
|
|
}
|
|
|
|
function _emscripten_asm_const_v(code) {
|
|
return ASM_CONSTS[code]();
|
|
}
|
|
|
|
|
|
|
|
STATIC_BASE = 8;
|
|
|
|
STATICTOP = STATIC_BASE + 38272;
|
|
/* global initializers */ if (!ENVIRONMENT_IS_PTHREAD) __ATINIT__.push({ func: function() { ___emscripten_pthread_data_constructor() } });
|
|
|
|
|
|
if (!ENVIRONMENT_IS_PTHREAD) {
|
|
/* memory initializer */ allocate([32,3,0,0,194,1,0,0,15,0,0,0,32,186,32,60,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,32,0,32,0,0,176,1,0,0,0,0,0,0,0,0,0,32,37,249,142,0,10,2,0,0,128,190,125,95,244,125,31,160,242,43,74,30,9,82,8,0,64,34,65,80,20,4,16,32,32,41,46,18,8,34,8,0,32,34,65,80,20,4,16,32,32,249,16,76,8,250,62,60,16,34,125,222,247,125,16,32,32,161,232,50,8,34,8,0,8,34,5,16,4,69,16,0,240,163,164,50,8,82,8,0,4,34,5,16,4,69,16,32,32,249,226,94,8,2,0,129,2,62,125,31,244,125,16,0,0,32,0,0,176,1,128,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,190,15,0,192,15,224,247,251,125,126,191,95,232,190,80,0,162,8,8,68,232,47,20,10,133,2,129,80,72,160,80,0,162,40,228,73,40,40,20,10,132,2,129,64,72,160,72,0,190,15,2,16,175,235,247,9,132,62,159,216,79,160,71,0,34,136,228,9,161,42,20,10,132,2,129,80,72,160,72,0,34,40,8,4,160,47,20,10,133,2,129,80,72,162,80,0,190,143,0,0,33,32,244,251,125,126,129,95,232,156,208,7,0,128,0,0,224,15,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,128,1,12,0,130,66,191,223,239,247,251,11,5,5,133,66,191,4,72,0,198,66,161,80,40,20,64,8,5,37,133,66,160,8,168,0,170,70,161,80,40,20,64,8,5,37,133,66,144,16,8,0,146,74,161,95,232,247,67,8,5,37,121,126,136,32,8,0,130,82,161,64,40,1,66,8,137,36,133,64,132,64,8,0,130,98,161,64,42,2,66,8,81,36,133,64,130,128,8,0,130,66,191,192,47,244,67,248,33,252,133,126,191,0,9,62,0,0,0,0,4,0,0,0,0,0,0,0,128,1,12,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,4,0,4,0,32,72,65,0,0,0,0,0,8,0,0,4,4,0,4,60,32,0,65,0,0,0,0,0,8,0,0,240,125,223,247,133,239,75,81,190,239,251,190,239,59,81,4,0,69,65,20,133,40,74,73,170,40,138,162,32,8,81,4,240,69,65,244,157,40,74,71,170,40,138,162,224,11,81,4,16,69,65,20,132,40,74,73,170,40,138,162,0,10,145,2,240,125,223,247,133,47,74,209,170,232,251,190,224,123,31,1,0,0,0,0,4,8,64,0,0,0,8,32,0,0,0,0,0,0,0,0,132,15,96,0,0,0,8,32,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,172,1,15,0,0,0,0,0,0,0,0,0,0,0,0,0,36,1,9,0,0,0,0,0,0,0,0,0,6,0,0,0,36,1,9,0,0,0,0,0,0,0,128,16,9,162,40,250,36,1,9,0,0,0,0,0,0,0,0,62,1,42,37,66,34,82,9,0,0,0,0,0,0,0,128,138,3,42,34,34,36,41,9,0,0,0,0,0,0,0,128,10,1,42,37,18,36,1,9,0,0,0,0,0,0,0,128,10,1,190,232,251,36,1,9,0,0,0,0,0,0,0,128,190,14,0,0,2,172,1,15,0,0,0,0,0,0,0,128,4,0,0,224,3,0,0,0,0,0,0,0,0,0,0,128,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,56,0,0,0,14,184,67,132,3,58,32,0,128,160,190,2,32,0,0,240,138,32,82,196,2,43,32,4,34,145,2,248,59,0,240,7,142,56,75,228,2,58,32,2,28,138,30,8,42,233,17,4,224,11,66,244,2,130,36,1,20,4,20,232,186,4,209,5,128,184,195,231,10,58,137,0,28,14,60,40,2,9,80,4,128,0,64,196,2,128,68,0,34,132,32,232,2,0,80,4,0,0,64,128,2,0,32,5,0,142,62,8,2,0,16,4,224,3,64,128,66,0,0,7,0,132,0,248,3,0,240,7,0,0,64,128,34,0,0,4,0,0,0,0,0,0,0,0,0,0,64,128,2,0,0,4,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,7,128,0,194,160,72,24,0,0,1,132,33,9,146,2,66,38,4,1,33,81,0,0,127,63,2,66,2,16,41,0,34,20,192,239,247,251,253,126,9,161,223,239,247,187,187,3,18,15,68,40,20,10,133,66,9,129,64,32,16,16,17,1,8,4,68,40,20,10,133,66,127,129,64,32,16,16,17,1,4,130,199,239,247,251,253,126,9,129,207,231,243,17,17,1,50,169,80,40,20,10,133,66,9,161,64,32,16,16,17,1,64,184,80,40,20,10,133,66,121,191,223,239,247,187,187,3,32,160,31,0,0,0,0,0,0,16,0,0,0,0,0,0,112,32,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,40,2,8,131,34,1,0,2,8,67,2,1,0,1,1,124,20,4,132,68,1,0,32,4,132,4,128,8,63,130,0,132,66,191,223,239,247,3,126,161,80,40,20,10,33,0,0,132,70,161,80,40,20,138,82,161,80,40,20,122,161,239,3,158,74,161,80,40,20,82,82,161,80,40,20,74,31,8,2,132,82,161,80,40,20,34,74,161,80,40,244,75,161,239,3,132,98,161,80,40,20,82,74,161,80,40,4,122,161,40,2,124,66,191,223,239,247,139,126,191,223,239,247,11,189,239,3,0,0,0,0,0,0,0,4,0,0,0,0,8,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,8,5,32,0,0,4,132,0,34,129,69,17,16,66,1,0,148,66,81,0,0,8,66,81,148,42,162,32,8,165,80,0,0,0,32,0,0,0,0,0,0,0,5,0,0,0,0,8,190,239,251,254,251,190,239,251,20,145,235,251,190,239,251,0,32,8,130,32,10,162,40,138,20,145,40,138,162,40,138,62,190,239,251,254,11,190,239,251,20,145,40,138,162,40,138,0,162,40,138,34,8,130,32,8,20,145,40,138,162,40,138,8,190,239,251,254,251,190,239,251,20,145,47,250,190,239,251,0,0,0,0,0,64,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,32,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,33,0,4,0,0,0,0,0,0,0,0,0,0,0,0,130,80,20,2,20,0,0,0,0,0,0,0,0,0,0,16,0,0,0,32,0,0,0,0,0,0,0,0,0,0,0,190,40,138,162,40,34,0,0,0,0,0,0,0,0,0,0,170,40,138,162,232,34,0,0,0,0,0,0,0,0,0,0,170,40,138,162,168,34,0,0,0,0,0,0,0,0,0,0,170,40,138,162,232,34,0,0,0,0,0,0,0,0,0,0,190,239,251,190,47,62,0,0,0,0,0,0,0,0,0,0,4,0,0,0,40,32,0,0,0,0,0,0,0,0,0,0,0,0,0,128,15,62,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,3,0,0,0,1,0,0,0,4,0,0,0,6,0,0,0,5,0,0,0,7,0,0,0,6,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,5,0,0,0,5,0,0,0,2,0,0,0,4,0,0,0,1,0,0,0,7,0,0,0,5,0,0,0,2,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,1,0,0,0,1,0,0,0,3,0,0,0,4,0,0,0,3,0,0,0,6,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,3,0,0,0,5,0,0,0,6,0,0,0,5,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,7,0,0,0,6,0,0,0,7,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,2,0,0,0,7,0,0,0,2,0,0,0,3,0,0,0,5,0,0,0,2,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,1,0,0,0,2,0,0,0,5,0,0,0,2,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,3,0,0,0,1,0,0,0,3,0,0,0,4,0,0,0,4,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,7,0,0,0,1,0,0,0,5,0,0,0,3,0,0,0,7,0,0,0,3,0,0,0,5,0,0,0,4,0,0,0,1,0,0,0,7,0,0,0,4,0,0,0,3,0,0,0,5,0,0,0,3,0,0,0,3,0,0,0,2,0,0,0,5,0,0,0,6,0,0,0,1,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,5,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,5,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,4,0,0,0,6,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,9,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,3,0,0,0,5,0,0,0,255,255,255,255,0,1,0,0,255,255,255,255,0,0,128,191,176,11,0,0,5,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,2,0,0,0,127,145,0,0,0,4,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,10,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,176,11,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,3,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,255,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,80,104,121,115,97,99,32,91,114,97,121,108,105,98,93,32,45,32,66,111,100,121,32,115,104,97,116,116,101,114,0,80,104,121,115,97,99,0,76,101,102,116,32,109,111,117,115,101,32,98,117,116,116,111,110,32,105,110,32,112,111,108,121,103,111,110,32,97,114,101,97,32,116,111,32,115,104,97,116,116,101,114,32,98,111,100,121,10,80,114,101,115,115,32,39,82,39,32,116,111,32,114,101,115,101,116,32,101,120,97,109,112,108,101,0,80,111,119,101,114,101,100,32,98,121,0,73,110,105,116,105,97,108,105,122,105,110,103,32,114,97,121,108,105,98,32,40,118,49,46,55,46,48,41,0,35,99,97,110,118,97,115,0,84,97,114,103,101,116,32,116,105,109,101,32,112,101,114,32,102,114,97,109,101,58,32,37,48,50,46,48,51,102,32,109,105,108,108,105,115,101,99,111,110,100,115,0,69,115,99,97,112,101,0,67,97,110,118,97,115,32,115,99,97,108,101,100,32,116,111,32,102,117,108,108,115,99,114,101,101,110,46,32,69,108,101,109,101,110,116,83,105,122,101,58,32,40,37,105,120,37,105,41,44,32,83,99,114,101,101,110,83,105,122,101,40,37,105,120,37,105,41,0,67,97,110,118,97,115,32,115,99,97,108,101,100,32,116,111,32,119,105,110,100,111,119,101,100,46,32,69,108,101,109,101,110,116,83,105,122,101,58,32,40,37,105,120,37,105,41,44,32,83,99,114,101,101,110,83,105,122,101,40,37,105,120,37,105,41,0,91,84,69,88,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,102,111,110,116,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,68,88,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,69,84,67,49,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,69,84,67,50,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,80,86,82,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,65,83,84,67,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,84,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,91,84,69,88,32,73,68,32,37,105,93,32,84,101,120,116,117,114,101,32,99,114,101,97,116,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,37,105,120,37,105,41,0,84,101,120,116,117,114,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,99,114,101,97,116,101,100,0,73,109,97,103,101,32,100,97,116,97,32,102,111,114,109,97,116,32,105,115,32,99,111,109,112,114,101,115,115,101,100,44,32,99,97,110,32,110,111,116,32,98,101,32,99,111,110,118,101,114,116,101,100,0,70,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,32,102,111,114,32,112,105,120,101,108,32,100,97,116,97,32,114,101,116,114,105,101,118,97,108,0,70,97,105,108,101,100,32,116,111,32,105,110,105,116,105,97,108,105,122,101,32,71,76,70,87,0,84,114,121,105,110,103,32,116,111,32,101,110,97,98,108,101,32,77,83,65,65,32,120,52,0,67,108,111,115,101,115,116,32,102,117,108,108,115,99,114,101,101,110,32,118,105,100,101,111,109,111,100,101,58,32,37,105,32,120,32,37,105,0,71,76,70,87,32,70,97,105,108,101,100,32,116,111,32,105,110,105,116,105,97,108,105,122,101,32,87,105,110,100,111,119,0,68,105,115,112,108,97,121,32,100,101,118,105,99,101,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,82,101,110,100,101,114,32,115,105,122,101,58,32,37,105,32,120,32,37,105,0,83,99,114,101,101,110,32,115,105,122,101,58,32,37,105,32,120,32,37,105,0,86,105,101,119,112,111,114,116,32,111,102,102,115,101,116,115,58,32,37,105,44,32,37,105,0,84,114,121,105,110,103,32,116,111,32,101,110,97,98,108,101,32,86,83,89,78,67,0,71,80,85,58,32,86,101,110,100,111,114,58,32,32,32,37,115,0,71,80,85,58,32,82,101,110,100,101,114,101,114,58,32,37,115,0,71,80,85,58,32,86,101,114,115,105,111,110,58,32,32,37,115,0,71,80,85,58,32,71,76,83,76,58,32,32,32,32,32,37,115,0,32,0,78,117,109,98,101,114,32,111,102,32,115,117,112,112,111,114,116,101,100,32,101,120,116,101,110,115,105,111,110,115,58,32,37,105,0,71,76,95,79,69,83,95,118,101,114,116,101,120,95,97,114,114,97,121,95,111,98,106,101,99,116,0,103,108,71,101,110,86,101,114,116,101,120,65,114,114,97,121,115,79,69,83,0,103,108,66,105,110,100,86,101,114,116,101,120,65,114,114,97,121,79,69,83,0,103,108,68,101,108,101,116,101,86,101,114,116,101,120,65,114,114,97,121,115,79,69,83,0,71,76,95,79,69,83,95,116,101,120,116,117,114,101,95,110,112,111,116,0,71,76,95,69,88,84,95,116,101,120,116,117,114,101,95,99,111,109,112,114,101,115,115,105,111,110,95,115,51,116,99,0,71,76,95,87,69,66,71,76,95,99,111,109,112,114,101,115,115,101,100,95,116,101,120,116,117,114,101,95,115,51,116,99,0,71,76,95,87,69,66,75,73,84,95,87,69,66,71,76,95,99,111,109,112,114,101,115,115,101,100,95,116,101,120,116,117,114,101,95,115,51,116,99,0,71,76,95,79,69,83,95,99,111,109,112,114,101,115,115,101,100,95,69,84,67,49,95,82,71,66,56,95,116,101,120,116,117,114,101,0,71,76,95,87,69,66,71,76,95,99,111,109,112,114,101,115,115,101,100,95,116,101,120,116,117,114,101,95,101,116,99,49,0,71,76,95,65,82,66,95,69,83,51,95,99,111,109,112,97,116,105,98,105,108,105,116,121,0,71,76,95,73,77,71,95,116,101,120,116,117,114,101,95,99,111,109,112,114,101,115,115,105,111,110,95,112,118,114,116,99,0,71,76,95,75,72,82,95,116,101,120,116,117,114,101,95,99,111,109,112,114,101,115,115,105,111,110,95,97,115,116,99,95,104,100,114,0,71,76,95,69,88,84,95,116,101,120,116,117,114,101,95,102,105,108,116,101,114,95,97,110,105,115,111,116,114,111,112,105,99,0,71,76,95,69,88,84,95,116,101,120,116,117,114,101,95,109,105,114,114,111,114,95,99,108,97,109,112,0,91,69,88,84,69,78,83,73,79,78,93,32,86,65,79,32,101,120,116,101,110,115,105,111,110,32,100,101,116,101,99,116,101,100,44,32,86,65,79,32,102,117,110,99,116,105,111,110,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,69,88,84,69,78,83,73,79,78,93,32,86,65,79,32,101,120,116,101,110,115,105,111,110,32,110,111,116,32,102,111,117,110,100,44,32,86,65,79,32,117,115,97,103,101,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,78,80,79,84,32,116,101,120,116,117,114,101,115,32,101,120,116,101,110,115,105,111,110,32,100,101,116,101,99,116,101,100,44,32,102,117,108,108,32,78,80,79,84,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,78,80,79,84,32,116,101,120,116,117,114,101,115,32,101,120,116,101,110,115,105,111,110,32,110,111,116,32,102,111,117,110,100,44,32,108,105,109,105,116,101,100,32,78,80,79,84,32,115,117,112,112,111,114,116,32,40,110,111,45,109,105,112,109,97,112,115,44,32,110,111,45,114,101,112,101,97,116,41,0,91,69,88,84,69,78,83,73,79,78,93,32,68,88,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,69,84,67,49,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,69,84,67,50,47,69,65,67,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,80,86,82,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,65,83,84,67,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,65,110,105,115,111,116,114,111,112,105,99,32,116,101,120,116,117,114,101,115,32,102,105,108,116,101,114,105,110,103,32,115,117,112,112,111,114,116,101,100,32,40,109,97,120,58,32,37,46,48,102,88,41,0,91,69,88,84,69,78,83,73,79,78,93,32,67,108,97,109,112,32,109,105,114,114,111,114,32,119,114,97,112,32,116,101,120,116,117,114,101,32,109,111,100,101,32,115,117,112,112,111,114,116,101,100,0,91,84,69,88,32,73,68,32,37,105,93,32,66,97,115,101,32,119,104,105,116,101,32,116,101,120,116,117,114,101,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,66,97,115,101,32,119,104,105,116,101,32,116,101,120,116,117,114,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,79,112,101,110,71,76,32,100,101,102,97,117,108,116,32,115,116,97,116,101,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,67,80,85,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,108,105,110,101,115,44,32,116,114,105,97,110,103,108,101,115,44,32,113,117,97,100,115,41,0,91,86,65,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,65,79,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,108,105,110,101,115,41,0,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,66,79,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,108,105,110,101,115,41,0,91,86,65,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,65,79,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,116,114,105,97,110,103,108,101,115,41,0,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,66,79,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,116,114,105,97,110,103,108,101,115,41,0,91,86,65,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,65,79,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,113,117,97,100,115,41,0,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,66,79,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,113,117,97,100,115,41,0,35,118,101,114,115,105,111,110,32,49,48,48,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,51,32,118,101,114,116,101,120,80,111,115,105,116,105,111,110,59,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,50,32,118,101,114,116,101,120,84,101,120,67,111,111,114,100,59,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,52,32,118,101,114,116,101,120,67,111,108,111,114,59,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,50,32,102,114,97,103,84,101,120,67,111,111,114,100,59,32,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,52,32,102,114,97,103,67,111,108,111,114,59,32,32,32,32,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,109,97,116,52,32,109,118,112,77,97,116,114,105,120,59,32,32,32,32,32,32,32,32,32,32,32,32,10,118,111,105,100,32,109,97,105,110,40,41,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,123,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,32,32,32,32,102,114,97,103,84,101,120,67,111,111,114,100,32,61,32,118,101,114,116,101,120,84,101,120,67,111,111,114,100,59,32,10,32,32,32,32,102,114,97,103,67,111,108,111,114,32,61,32,118,101,114,116,101,120,67,111,108,111,114,59,32,32,32,32,32,32,32,10,32,32,32,32,103,108,95,80,111,115,105,116,105,111,110,32,61,32,109,118,112,77,97,116,114,105,120,42,118,101,99,52,40,118,101,114,116,101,120,80,111,115,105,116,105,111,110,44,32,49,46,48,41,59,32,10,125,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,0,35,118,101,114,115,105,111,110,32,49,48,48,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,112,114,101,99,105,115,105,111,110,32,109,101,100,105,117,109,112,32,102,108,111,97,116,59,32,32,32,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,50,32,102,114,97,103,84,101,120,67,111,111,114,100,59,32,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,52,32,102,114,97,103,67,111,108,111,114,59,32,32,32,32,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,115,97,109,112,108,101,114,50,68,32,116,101,120,116,117,114,101,48,59,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,118,101,99,52,32,99,111,108,68,105,102,102,117,115,101,59,32,32,32,32,32,32,32,32,32,32,32,10,118,111,105,100,32,109,97,105,110,40,41,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,123,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,32,32,32,32,118,101,99,52,32,116,101,120,101,108,67,111,108,111,114,32,61,32,116,101,120,116,117,114,101,50,68,40,116,101,120,116,117,114,101,48,44,32,102,114,97,103,84,101,120,67,111,111,114,100,41,59,32,10,32,32,32,32,103,108,95,70,114,97,103,67,111,108,111,114,32,61,32,116,101,120,101,108,67,111,108,111,114,42,99,111,108,68,105,102,102,117,115,101,42,102,114,97,103,67,111,108,111,114,59,32,32,32,32,32,32,10,125,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,0,91,83,72,68,82,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,115,104,97,100,101,114,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,83,72,68,82,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,115,104,97,100,101,114,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,118,101,114,116,101,120,80,111,115,105,116,105,111,110,0,118,101,114,116,101,120,84,101,120,67,111,111,114,100,0,118,101,114,116,101,120,84,101,120,67,111,111,114,100,50,0,118,101,114,116,101,120,78,111,114,109,97,108,0,118,101,114,116,101,120,84,97,110,103,101,110,116,0,118,101,114,116,101,120,67,111,108,111,114,0,109,118,112,77,97,116,114,105,120,0,99,111,108,68,105,102,102,117,115,101,0,99,111,108,65,109,98,105,101,110,116,0,99,111,108,83,112,101,99,117,108,97,114,0,116,101,120,116,117,114,101,48,0,116,101,120,116,117,114,101,49,0,116,101,120,116,117,114,101,50,0,91,86,83,72,68,82,32,73,68,32,37,105,93,32,70,97,105,108,101,100,32,116,111,32,99,111,109,112,105,108,101,32,118,101,114,116,101,120,32,115,104,97,100,101,114,46,46,46,0,37,115,0,91,86,83,72,68,82,32,73,68,32,37,105,93,32,86,101,114,116,101,120,32,115,104,97,100,101,114,32,99,111,109,112,105,108,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,70,83,72,68,82,32,73,68,32,37,105,93,32,70,97,105,108,101,100,32,116,111,32,99,111,109,112,105,108,101,32,102,114,97,103,109,101,110,116,32,115,104,97,100,101,114,46,46,46,0,91,70,83,72,68,82,32,73,68,32,37,105,93,32,70,114,97,103,109,101,110,116,32,115,104,97,100,101,114,32,99,111,109,112,105,108,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,83,72,68,82,32,73,68,32,37,105,93,32,70,97,105,108,101,100,32,116,111,32,108,105,110,107,32,115,104,97,100,101,114,32,112,114,111,103,114,97,109,46,46,46,0,91,83,72,68,82,32,73,68,32,37,105,93,32,83,104,97,100,101,114,32,112,114,111,103,114,97,109,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,68,79,87,78,83,67,65,76,73,78,71,58,32,82,101,113,117,105,114,101,100,32,115,99,114,101,101,110,32,115,105,122,101,32,40,37,105,120,37,105,41,32,105,115,32,98,105,103,103,101,114,32,116,104,97,110,32,100,105,115,112,108,97,121,32,115,105,122,101,32,40,37,105,120,37,105,41,0,68,111,119,110,115,99,97,108,101,32,109,97,116,114,105,120,32,103,101,110,101,114,97,116,101,100,44,32,99,111,110,116,101,110,116,32,119,105,108,108,32,98,101,32,114,101,110,100,101,114,101,100,32,97,116,58,32,37,105,32,120,32,37,105,0,85,80,83,67,65,76,73,78,71,58,32,82,101,113,117,105,114,101,100,32,115,99,114,101,101,110,32,115,105,122,101,58,32,37,105,32,120,32,37,105,32,45,62,32,68,105,115,112,108,97,121,32,115,105,122,101,58,32,37,105,32,120,32,37,105,0,91,71,76,70,87,51,32,69,114,114,111,114,93,32,67,111,100,101,58,32,37,105,32,68,101,99,114,105,112,116,105,111,110,58,32,37,115,0,73,78,70,79,58,32,0,87,65,82,78,73,78,71,58,32,0,87,105,110,100,111,119,32,99,108,111,115,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,84,69,88,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,116,101,120,116,117,114,101,32,100,97,116,97,32,40,98,97,115,101,32,119,104,105,116,101,32,116,101,120,116,117,114,101,41,32,102,114,111,109,32,86,82,65,77,0,91,84,69,88,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,116,101,120,116,117,114,101,32,100,97,116,97,32,102,114,111,109,32,86,82,65,77,32,40,71,80,85,41,0,83,116,97,99,107,32,66,117,102,102,101,114,32,79,118,101,114,102,108,111,119,32,40,77,65,88,32,37,105,32,77,97,116,114,105,120,41,0,77,65,88,95,76,73,78,69,83,95,66,65,84,67,72,32,111,118,101,114,102,108,111,119,0,77,65,88,95,84,82,73,65,78,71,76,69,83,95,66,65,84,67,72,32,111,118,101,114,102,108,111,119,0,77,65,88,95,81,85,65,68,83,95,66,65,84,67,72,32,111,118,101,114,102,108,111,119,0,69,88,84,0,65,82,66,0,79,69,83,0,65,78,71,76,69,0,103,108,67,114,101,97,116,101,80,114,111,103,114,97,109,79,98,106,101,99,116,0,103,108,67,114,101,97,116,101,80,114,111,103,114,97,109,0,103,108,85,115,101,80,114,111,103,114,97,109,79,98,106,101,99,116,0,103,108,85,115,101,80,114,111,103,114,97,109,0,103,108,67,114,101,97,116,101,83,104,97,100,101,114,79,98,106,101,99,116,0,103,108,67,114,101,97,116,101,83,104,97,100,101,114,0,103,108,65,116,116,97,99,104,79,98,106,101,99,116,0,103,108,65,116,116,97,99,104,83,104,97,100,101,114,0,103,108,68,101,116,97,99,104,79,98,106,101,99,116,0,103,108,68,101,116,97,99,104,83,104,97,100,101,114,0,103,108,80,105,120,101,108,83,116,111,114,101,105,0,103,108,71,101,116,83,116,114,105,110,103,0,103,108,71,101,116,73,110,116,101,103,101,114,118,0,103,108,71,101,116,70,108,111,97,116,118,0,103,108,71,101,116,66,111,111,108,101,97,110,118,0,103,108,71,101,110,84,101,120,116,117,114,101,115,0,103,108,68,101,108,101,116,101,84,101,120,116,117,114,101,115,0,103,108,67,111,109,112,114,101,115,115,101,100,84,101,120,73,109,97,103,101,50,68,0,103,108,67,111,109,112,114,101,115,115,101,100,84,101,120,83,117,98,73,109,97,103,101,50,68,0,103,108,84,101,120,73,109,97,103,101,50,68,0,103,108,84,101,120,83,117,98,73,109,97,103,101,50,68,0,103,108,82,101,97,100,80,105,120,101,108,115,0,103,108,66,105,110,100,84,101,120,116,117,114,101,0,103,108,71,101,116,84,101,120,80,97,114,97,109,101,116,101,114,102,118,0,103,108,71,101,116,84,101,120,80,97,114,97,109,101,116,101,114,105,118,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,102,118,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,105,118,0,103,108,73,115,84,101,120,116,117,114,101,0,103,108,71,101,110,66,117,102,102,101,114,115,0,103,108,68,101,108,101,116,101,66,117,102,102,101,114,115,0,103,108,71,101,116,66,117,102,102,101,114,80,97,114,97,109,101,116,101,114,105,118,0,103,108,66,117,102,102,101,114,68,97,116,97,0,103,108,66,117,102,102,101,114,83,117,98,68,97,116,97,0,103,108,73,115,66,117,102,102,101,114,0,103,108,71,101,110,82,101,110,100,101,114,98,117,102,102,101,114,115,0,103,108,68,101,108,101,116,101,82,101,110,100,101,114,98,117,102,102,101,114,115,0,103,108,66,105,110,100,82,101,110,100,101,114,98,117,102,102,101,114,0,103,108,71,101,116,82,101,110,100,101,114,98,117,102,102,101,114,80,97,114,97,109,101,116,101,114,105,118,0,103,108,73,115,82,101,110,100,101,114,98,117,102,102,101,114,0,103,108,71,101,116,85,110,105,102,111,114,109,102,118,0,103,108,71,101,116,85,110,105,102,111,114,109,105,118,0,103,108,71,101,116,85,110,105,102,111,114,109,76,111,99,97,116,105,111,110,0,103,108,71,101,116,86,101,114,116,101,120,65,116,116,114,105,98,102,118,0,103,108,71,101,116,86,101,114,116,101,120,65,116,116,114,105,98,105,118,0,103,108,71,101,116,86,101,114,116,101,120,65,116,116,114,105,98,80,111,105,110,116,101,114,118,0,103,108,71,101,116,65,99,116,105,118,101,85,110,105,102,111,114,109,0,103,108,85,110,105,102,111,114,109,49,102,0,103,108,85,110,105,102,111,114,109,50,102,0,103,108,85,110,105,102,111,114,109,51,102,0,103,108,85,110,105,102,111,114,109,52,102,0,103,108,85,110,105,102,111,114,109,49,105,0,103,108,85,110,105,102,111,114,109,50,105,0,103,108,85,110,105,102,111,114,109,51,105,0,103,108,85,110,105,102,111,114,109,52,105,0,103,108,85,110,105,102,111,114,109,49,105,118,0,103,108,85,110,105,102,111,114,109,50,105,118,0,103,108,85,110,105,102,111,114,109,51,105,118,0,103,108,85,110,105,102,111,114,109,52,105,118,0,103,108,85,110,105,102,111,114,109,49,102,118,0,103,108,85,110,105,102,111,114,109,50,102,118,0,103,108,85,110,105,102,111,114,109,51,102,118,0,103,108,85,110,105,102,111,114,109,52,102,118,0,103,108,85,110,105,102,111,114,109,77,97,116,114,105,120,50,102,118,0,103,108,85,110,105,102,111,114,109,77,97,116,114,105,120,51,102,118,0,103,108,85,110,105,102,111,114,109,77,97,116,114,105,120,52,102,118,0,103,108,66,105,110,100,66,117,102,102,101,114,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,49,102,118,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,50,102,118,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,51,102,118,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,52,102,118,0,103,108,71,101,116,65,116,116,114,105,98,76,111,99,97,116,105,111,110,0,103,108,71,101,116,65,99,116,105,118,101,65,116,116,114,105,98,0,103,108,68,101,108,101,116,101,83,104,97,100,101,114,0,103,108,71,101,116,65,116,116,97,99,104,101,100,83,104,97,100,101,114,115,0,103,108,83,104,97,100,101,114,83,111,117,114,99,101,0,103,108,71,101,116,83,104,97,100,101,114,83,111,117,114,99,101,0,103,108,67,111,109,112,105,108,101,83,104,97,100,101,114,0,103,108,71,101,116,83,104,97,100,101,114,73,110,102,111,76,111,103,0,103,108,71,101,116,83,104,97,100,101,114,105,118,0,103,108,71,101,116,80,114,111,103,114,97,109,105,118,0,103,108,73,115,83,104,97,100,101,114,0,103,108,68,101,108,101,116,101,80,114,111,103,114,97,109,0,103,108,71,101,116,83,104,97,100,101,114,80,114,101,99,105,115,105,111,110,70,111,114,109,97,116,0,103,108,76,105,110,107,80,114,111,103,114,97,109,0,103,108,71,101,116,80,114,111,103,114,97,109,73,110,102,111,76,111,103,0,103,108,86,97,108,105,100,97,116,101,80,114,111,103,114,97,109,0,103,108,73,115,80,114,111,103,114,97,109,0,103,108,66,105,110,100,65,116,116,114,105,98,76,111,99,97,116,105,111,110,0,103,108,66,105,110,100,70,114,97,109,101,98,117,102,102,101,114,0,103,108,71,101,110,70,114,97,109,101,98,117,102,102,101,114,115,0,103,108,68,101,108,101,116,101,70,114,97,109,101,98,117,102,102,101,114,115,0,103,108,70,114,97,109,101,98,117,102,102,101,114,82,101,110,100,101,114,98,117,102,102,101,114,0,103,108,70,114,97,109,101,98,117,102,102,101,114,84,101,120,116,117,114,101,50,68,0,103,108,71,101,116,70,114,97,109,101,98,117,102,102,101,114,65,116,116,97,99,104,109,101,110,116,80,97,114,97,109,101,116,101,114,105,118,0,103,108,73,115,70,114,97,109,101,98,117,102,102,101,114,0,103,108,68,101,108,101,116,101,79,98,106,101,99,116,0,103,108,71,101,116,79,98,106,101,99,116,80,97,114,97,109,101,116,101,114,105,118,0,103,108,71,101,116,73,110,102,111,76,111,103,0,103,108,66,105,110,100,80,114,111,103,114,97,109,0,103,108,71,101,116,80,111,105,110,116,101,114,118,0,103,108,68,114,97,119,82,97,110,103,101,69,108,101,109,101,110,116,115,0,103,108,69,110,97,98,108,101,67,108,105,101,110,116,83,116,97,116,101,0,103,108,86,101,114,116,101,120,80,111,105,110,116,101,114,0,103,108,84,101,120,67,111,111,114,100,80,111,105,110,116,101,114,0,103,108,78,111,114,109,97,108,80,111,105,110,116,101,114,0,103,108,67,111,108,111,114,80,111,105,110,116,101,114,0,103,108,67,108,105,101,110,116,65,99,116,105,118,101,84,101,120,116,117,114,101,0,103,108,71,101,110,86,101,114,116,101,120,65,114,114,97,121,115,0,103,108,68,101,108,101,116,101,86,101,114,116,101,120,65,114,114,97,121,115,0,103,108,66,105,110,100,86,101,114,116,101,120,65,114,114,97,121,0,103,108,77,97,116,114,105,120,77,111,100,101,0,103,108,76,111,97,100,73,100,101,110,116,105,116,121,0,103,108,76,111,97,100,77,97,116,114,105,120,102,0,103,108,70,114,117,115,116,117,109,0,103,108,82,111,116,97,116,101,102,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,80,111,105,110,116,101,114,0,103,108,69,110,97,98,108,101,86,101,114,116,101,120,65,116,116,114,105,98,65,114,114,97,121,0,103,108,68,105,115,97,98,108,101,86,101,114,116,101,120,65,116,116,114,105,98,65,114,114,97,121,0,103,108,68,114,97,119,65,114,114,97,121,115,0,103,108,68,114,97,119,69,108,101,109,101,110,116], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE);
|
|
/* memory initializer */ allocate([115,0,103,108,83,104,97,100,101,114,66,105,110,97,114,121,0,103,108,82,101,108,101,97,115,101,83,104,97,100,101,114,67,111,109,112,105,108,101,114,0,103,108,71,101,116,69,114,114,111,114,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,68,105,118,105,115,111,114,0,103,108,68,114,97,119,65,114,114,97,121,115,73,110,115,116,97,110,99,101,100,0,103,108,68,114,97,119,69,108,101,109,101,110,116,115,73,110,115,116,97,110,99,101,100,0,103,108,70,105,110,105,115,104,0,103,108,70,108,117,115,104,0,103,108,67,108,101,97,114,68,101,112,116,104,0,103,108,67,108,101,97,114,68,101,112,116,104,102,0,103,108,68,101,112,116,104,70,117,110,99,0,103,108,69,110,97,98,108,101,0,103,108,68,105,115,97,98,108,101,0,103,108,70,114,111,110,116,70,97,99,101,0,103,108,67,117,108,108,70,97,99,101,0,103,108,67,108,101,97,114,0,103,108,76,105,110,101,87,105,100,116,104,0,103,108,67,108,101,97,114,83,116,101,110,99,105,108,0,103,108,68,101,112,116,104,77,97,115,107,0,103,108,83,116,101,110,99,105,108,77,97,115,107,0,103,108,67,104,101,99,107,70,114,97,109,101,98,117,102,102,101,114,83,116,97,116,117,115,0,103,108,71,101,110,101,114,97,116,101,77,105,112,109,97,112,0,103,108,65,99,116,105,118,101,84,101,120,116,117,114,101,0,103,108,66,108,101,110,100,69,113,117,97,116,105,111,110,0,103,108,73,115,69,110,97,98,108,101,100,0,103,108,66,108,101,110,100,70,117,110,99,0,103,108,66,108,101,110,100,69,113,117,97,116,105,111,110,83,101,112,97,114,97,116,101,0,103,108,68,101,112,116,104,82,97,110,103,101,0,103,108,68,101,112,116,104,82,97,110,103,101,102,0,103,108,83,116,101,110,99,105,108,77,97,115,107,83,101,112,97,114,97,116,101,0,103,108,72,105,110,116,0,103,108,80,111,108,121,103,111,110,79,102,102,115,101,116,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,49,102,0,103,108,83,97,109,112,108,101,67,111,118,101,114,97,103,101,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,105,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,102,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,50,102,0,103,108,83,116,101,110,99,105,108,70,117,110,99,0,103,108,83,116,101,110,99,105,108,79,112,0,103,108,86,105,101,119,112,111,114,116,0,103,108,67,108,101,97,114,67,111,108,111,114,0,103,108,83,99,105,115,115,111,114,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,51,102,0,103,108,67,111,108,111,114,77,97,115,107,0,103,108,82,101,110,100,101,114,98,117,102,102,101,114,83,116,111,114,97,103,101,0,103,108,66,108,101,110,100,70,117,110,99,83,101,112,97,114,97,116,101,0,103,108,66,108,101,110,100,67,111,108,111,114,0,103,108,83,116,101,110,99,105,108,70,117,110,99,83,101,112,97,114,97,116,101,0,103,108,83,116,101,110,99,105,108,79,112,83,101,112,97,114,97,116,101,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,52,102,0,103,108,67,111,112,121,84,101,120,73,109,97,103,101,50,68,0,103,108,67,111,112,121,84,101,120,83,117,98,73,109,97,103,101,50,68,0,103,108,68,114,97,119,66,117,102,102,101,114,115,0,123,32,77,111,100,117,108,101,46,112,114,105,110,116,69,114,114,40,39,98,97,100,32,110,97,109,101,32,105,110,32,103,101,116,80,114,111,99,65,100,100,114,101,115,115,58,32,39,32,43,32,91,80,111,105,110,116,101,114,95,115,116,114,105,110,103,105,102,121,40,36,48,41,44,32,80,111,105,110,116,101,114,95,115,116,114,105,110,103,105,102,121,40,36,49,41,93,41,59,32,125,0,17,0,10,0,17,17,17,0,0,0,0,5,0,0,0,0,0,0,9,0,0,0,0,11,0,0,0,0,0,0,0,0,17,0,15,10,17,17,17,3,10,7,0,1,19,9,11,11,0,0,9,6,11,0,0,11,0,6,17,0,0,0,17,17,17,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,11,0,0,0,0,0,0,0,0,17,0,10,10,17,17,17,0,10,0,0,2,0,9,11,0,0,0,9,0,11,0,0,11,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,12,0,0,0,0,9,12,0,0,0,0,0,12,0,0,12,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,14,0,0,0,0,0,0,0,0,0,0,0,13,0,0,0,4,13,0,0,0,0,9,14,0,0,0,0,0,14,0,0,14,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,16,0,0,0,0,0,0,0,0,0,0,0,15,0,0,0,0,15,0,0,0,0,9,16,0,0,0,0,0,16,0,0,16,0,0,18,0,0,0,18,18,18,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,18,0,0,0,18,18,18,0,0,0,0,0,0,9,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,11,0,0,0,0,0,0,0,0,0,0,0,10,0,0,0,0,10,0,0,0,0,9,11,0,0,0,0,0,11,0,0,11,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,12,0,0,0,0,9,12,0,0,0,0,0,12,0,0,12,0,0,45,43,32,32,32,48,88,48,120,0,40,110,117,108,108,41,0,45,48,88,43,48,88,32,48,88,45,48,120,43,48,120,32,48,120,0,105,110,102,0,73,78,70,0,110,97,110,0,78,65,78,0,48,49,50,51,52,53,54,55,56,57,65,66,67,68,69,70,46,0,84,33,34,25,13,1,2,3,17,75,28,12,16,4,11,29,18,30,39,104,110,111,112,113,98,32,5,6,15,19,20,21,26,8,22,7,40,36,23,24,9,10,14,27,31,37,35,131,130,125,38,42,43,60,61,62,63,67,71,74,77,88,89,90,91,92,93,94,95,96,97,99,100,101,102,103,105,106,107,108,114,115,116,121,122,123,124,0,73,108,108,101,103,97,108,32,98,121,116,101,32,115,101,113,117,101,110,99,101,0,68,111,109,97,105,110,32,101,114,114,111,114,0,82,101,115,117,108,116,32,110,111,116,32,114,101,112,114,101,115,101,110,116,97,98,108,101,0,78,111,116,32,97,32,116,116,121,0,80,101,114,109,105,115,115,105,111,110,32,100,101,110,105,101,100,0,79,112,101,114,97,116,105,111,110,32,110,111,116,32,112,101,114,109,105,116,116,101,100,0,78,111,32,115,117,99,104,32,102,105,108,101,32,111,114,32,100,105,114,101,99,116,111,114,121,0,78,111,32,115,117,99,104,32,112,114,111,99,101,115,115,0,70,105,108,101,32,101,120,105,115,116,115,0,86,97,108,117,101,32,116,111,111,32,108,97,114,103,101,32,102,111,114,32,100,97,116,97,32,116,121,112,101,0,78,111,32,115,112,97,99,101,32,108,101,102,116,32,111,110,32,100,101,118,105,99,101,0,79,117,116,32,111,102,32,109,101,109,111,114,121,0,82,101,115,111,117,114,99,101,32,98,117,115,121,0,73,110,116,101,114,114,117,112,116,101,100,32,115,121,115,116,101,109,32,99,97,108,108,0,82,101,115,111,117,114,99,101,32,116,101,109,112,111,114,97,114,105,108,121,32,117,110,97,118,97,105,108,97,98,108,101,0,73,110,118,97,108,105,100,32,115,101,101,107,0,67,114,111,115,115,45,100,101,118,105,99,101,32,108,105,110,107,0,82,101,97,100,45,111,110,108,121,32,102,105,108,101,32,115,121,115,116,101,109,0,68,105,114,101,99,116,111,114,121,32,110,111,116,32,101,109,112,116,121,0,67,111,110,110,101,99,116,105,111,110,32,114,101,115,101,116,32,98,121,32,112,101,101,114,0,79,112,101,114,97,116,105,111,110,32,116,105,109,101,100,32,111,117,116,0,67,111,110,110,101,99,116,105,111,110,32,114,101,102,117,115,101,100,0,72,111,115,116,32,105,115,32,100,111,119,110,0,72,111,115,116,32,105,115,32,117,110,114,101,97,99,104,97,98,108,101,0,65,100,100,114,101,115,115,32,105,110,32,117,115,101,0,66,114,111,107,101,110,32,112,105,112,101,0,73,47,79,32,101,114,114,111,114,0,78,111,32,115,117,99,104,32,100,101,118,105,99,101,32,111,114,32,97,100,100,114,101,115,115,0,66,108,111,99,107,32,100,101,118,105,99,101,32,114,101,113,117,105,114,101,100,0,78,111,32,115,117,99,104,32,100,101,118,105,99,101,0,78,111,116,32,97,32,100,105,114,101,99,116,111,114,121,0,73,115,32,97,32,100,105,114,101,99,116,111,114,121,0,84,101,120,116,32,102,105,108,101,32,98,117,115,121,0,69,120,101,99,32,102,111,114,109,97,116,32,101,114,114,111,114,0,73,110,118,97,108,105,100,32,97,114,103,117,109,101,110,116,0,65,114,103,117,109,101,110,116,32,108,105,115,116,32,116,111,111,32,108,111,110,103,0,83,121,109,98,111,108,105,99,32,108,105,110,107,32,108,111,111,112,0,70,105,108,101,110,97,109,101,32,116,111,111,32,108,111,110,103,0,84,111,111,32,109,97,110,121,32,111,112,101,110,32,102,105,108,101,115,32,105,110,32,115,121,115,116,101,109,0,78,111,32,102,105,108,101,32,100,101,115,99,114,105,112,116,111,114,115,32,97,118,97,105,108,97,98,108,101,0,66,97,100,32,102,105,108,101,32,100,101,115,99,114,105,112,116,111,114,0,78,111,32,99,104,105,108,100,32,112,114,111,99,101,115,115,0,66,97,100,32,97,100,100,114,101,115,115,0,70,105,108,101,32,116,111,111,32,108,97,114,103,101,0,84,111,111,32,109,97,110,121,32,108,105,110,107,115,0,78,111,32,108,111,99,107,115,32,97,118,97,105,108,97,98,108,101,0,82,101,115,111,117,114,99,101,32,100,101,97,100,108,111,99,107,32,119,111,117,108,100,32,111,99,99,117,114,0,83,116,97,116,101,32,110,111,116,32,114,101,99,111,118,101,114,97,98,108,101,0,80,114,101,118,105,111,117,115,32,111,119,110,101,114,32,100,105,101,100,0,79,112,101,114,97,116,105,111,110,32,99,97,110,99,101,108,101,100,0,70,117,110,99,116,105,111,110,32,110,111,116,32,105,109,112,108,101,109,101,110,116,101,100,0,78,111,32,109,101,115,115,97,103,101,32,111,102,32,100,101,115,105,114,101,100,32,116,121,112,101,0,73,100,101,110,116,105,102,105,101,114,32,114,101,109,111,118,101,100,0,68,101,118,105,99,101,32,110,111,116,32,97,32,115,116,114,101,97,109,0,78,111,32,100,97,116,97,32,97,118,97,105,108,97,98,108,101,0,68,101,118,105,99,101,32,116,105,109,101,111,117,116,0,79,117,116,32,111,102,32,115,116,114,101,97,109,115,32,114,101,115,111,117,114,99,101,115,0,76,105,110,107,32,104,97,115,32,98,101,101,110,32,115,101,118,101,114,101,100,0,80,114,111,116,111,99,111,108,32,101,114,114,111,114,0,66,97,100,32,109,101,115,115,97,103,101,0,70,105,108,101,32,100,101,115,99,114,105,112,116,111,114,32,105,110,32,98,97,100,32,115,116,97,116,101,0,78,111,116,32,97,32,115,111,99,107,101,116,0,68,101,115,116,105,110,97,116,105,111,110,32,97,100,100,114,101,115,115,32,114,101,113,117,105,114,101,100,0,77,101,115,115,97,103,101,32,116,111,111,32,108,97,114,103,101,0,80,114,111,116,111,99,111,108,32,119,114,111,110,103,32,116,121,112,101,32,102,111,114,32,115,111,99,107,101,116,0,80,114,111,116,111,99,111,108,32,110,111,116,32,97,118,97,105,108,97,98,108,101,0,80,114,111,116,111,99,111,108,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,83,111,99,107,101,116,32,116,121,112,101,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,78,111,116,32,115,117,112,112,111,114,116,101,100,0,80,114,111,116,111,99,111,108,32,102,97,109,105,108,121,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,65,100,100,114,101,115,115,32,102,97,109,105,108,121,32,110,111,116,32,115,117,112,112,111,114,116,101,100,32,98,121,32,112,114,111,116,111,99,111,108,0,65,100,100,114,101,115,115,32,110,111,116,32,97,118,97,105,108,97,98,108,101,0,78,101,116,119,111,114,107,32,105,115,32,100,111,119,110,0,78,101,116,119,111,114,107,32,117,110,114,101,97,99,104,97,98,108,101,0,67,111,110,110,101,99,116,105,111,110,32,114,101,115,101,116,32,98,121,32,110,101,116,119,111,114,107,0,67,111,110,110,101,99,116,105,111,110,32,97,98,111,114,116,101,100,0,78,111,32,98,117,102,102,101,114,32,115,112,97,99,101,32,97,118,97,105,108,97,98,108,101,0,83,111,99,107,101,116,32,105,115,32,99,111,110,110,101,99,116,101,100,0,83,111,99,107,101,116,32,110,111,116,32,99,111,110,110,101,99,116,101,100,0,67,97,110,110,111,116,32,115,101,110,100,32,97,102,116,101,114,32,115,111,99,107,101,116,32,115,104,117,116,100,111,119,110,0,79,112,101,114,97,116,105,111,110,32,97,108,114,101,97,100,121,32,105,110,32,112,114,111,103,114,101,115,115,0,79,112,101,114,97,116,105,111,110,32,105,110,32,112,114,111,103,114,101,115,115,0,83,116,97,108,101,32,102,105,108,101,32,104,97,110,100,108,101,0,82,101,109,111,116,101,32,73,47,79,32,101,114,114,111,114,0,81,117,111,116,97,32,101,120,99,101,101,100,101,100,0,78,111,32,109,101,100,105,117,109,32,102,111,117,110,100,0,87,114,111,110,103,32,109,101,100,105,117,109,32,116,121,112,101,0,78,111,32,101,114,114,111,114,32,105,110,102,111,114,109,97,116,105,111,110,0,0,101,109,115,99,114,105,112,116,101,110,95,105,115,95,109,97,105,110,95,114,117,110,116,105,109,101,95,116,104,114,101,97,100,40,41,32,38,38,32,34,101,109,115,99,114,105,112,116,101,110,95,109,97,105,110,95,116,104,114,101,97,100,95,112,114,111,99,101,115,115,95,113,117,101,117,101,100,95,99,97,108,108,115,32,109,117,115,116,32,98,101,32,99,97,108,108,101,100,32,102,114,111,109,32,116,104,101,32,109,97,105,110,32,116,104,114,101,97,100,33,34,0,67,58,92,101,109,115,100,107,92,101,109,115,99,114,105,112,116,101,110,92,49,46,51,55,46,57,92,115,121,115,116,101,109,92,108,105,98,92,112,116,104,114,101,97,100,92,108,105,98,114,97,114,121,95,112,116,104,114,101,97,100,46,99,0,101,109,115,99,114,105,112,116,101,110,95,109,97,105,110,95,116,104,114,101,97,100,95,112,114,111,99,101,115,115,95,113,117,101,117,101,100,95,99,97,108,108,115,0,48,32,38,38,32,34,73,110,118,97,108,105,100,32,69,109,115,99,114,105,112,116,101,110,32,112,116,104,114,101,97,100,32,95,100,111,95,99,97,108,108,32,111,112,99,111,100,101,33,34,0,95,100,111,95,99,97,108,108,0,99,97,108,108,0,101,109,115,99,114,105,112,116,101,110,95,97,115,121,110,99,95,114,117,110,95,105,110,95,109,97,105,110,95,116,104,114,101,97,100,0,112,111,115,116,77,101,115,115,97,103,101,40,123,32,99,109,100,58,32,39,112,114,111,99,101,115,115,81,117,101,117,101,100,77,97,105,110,84,104,114,101,97,100,87,111,114,107,39,32,125,41,0], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE+10240);
|
|
}
|
|
|
|
|
|
|
|
|
|
|
|
/* no memory initializer */
|
|
var tempDoublePtr;
|
|
|
|
if (!ENVIRONMENT_IS_PTHREAD) tempDoublePtr = Runtime.alignMemory(allocate(12, "i8", ALLOC_STATIC), 8);
|
|
|
|
assert(tempDoublePtr % 8 == 0);
|
|
|
|
function copyTempFloat(ptr) { // functions, because inlining this code increases code size too much
|
|
|
|
HEAP8[tempDoublePtr] = HEAP8[ptr];
|
|
|
|
HEAP8[tempDoublePtr+1] = HEAP8[ptr+1];
|
|
|
|
HEAP8[tempDoublePtr+2] = HEAP8[ptr+2];
|
|
|
|
HEAP8[tempDoublePtr+3] = HEAP8[ptr+3];
|
|
|
|
}
|
|
|
|
function copyTempDouble(ptr) {
|
|
|
|
HEAP8[tempDoublePtr] = HEAP8[ptr];
|
|
|
|
HEAP8[tempDoublePtr+1] = HEAP8[ptr+1];
|
|
|
|
HEAP8[tempDoublePtr+2] = HEAP8[ptr+2];
|
|
|
|
HEAP8[tempDoublePtr+3] = HEAP8[ptr+3];
|
|
|
|
HEAP8[tempDoublePtr+4] = HEAP8[ptr+4];
|
|
|
|
HEAP8[tempDoublePtr+5] = HEAP8[ptr+5];
|
|
|
|
HEAP8[tempDoublePtr+6] = HEAP8[ptr+6];
|
|
|
|
HEAP8[tempDoublePtr+7] = HEAP8[ptr+7];
|
|
|
|
}
|
|
|
|
// {{PRE_LIBRARY}}
|
|
|
|
|
|
|
|
var GL={counter:1,lastError:0,buffers:[],mappedBuffers:{},programs:[],framebuffers:[],renderbuffers:[],textures:[],uniforms:[],shaders:[],vaos:[],contexts:[],currentContext:null,offscreenCanvases:{},timerQueriesEXT:[],byteSizeByTypeRoot:5120,byteSizeByType:[1,1,2,2,4,4,4,2,3,4,8],programInfos:{},stringCache:{},tempFixedLengthArray:[],packAlignment:4,unpackAlignment:4,init:function () {
|
|
GL.miniTempBuffer = new Float32Array(GL.MINI_TEMP_BUFFER_SIZE);
|
|
for (var i = 0; i < GL.MINI_TEMP_BUFFER_SIZE; i++) {
|
|
GL.miniTempBufferViews[i] = GL.miniTempBuffer.subarray(0, i+1);
|
|
}
|
|
|
|
// For functions such as glDrawBuffers, glInvalidateFramebuffer and glInvalidateSubFramebuffer that need to pass a short array to the WebGL API,
|
|
// create a set of short fixed-length arrays to avoid having to generate any garbage when calling those functions.
|
|
for (var i = 0; i < 32; i++) {
|
|
GL.tempFixedLengthArray.push(new Array(i));
|
|
}
|
|
},recordError:function recordError(errorCode) {
|
|
if (!GL.lastError) {
|
|
GL.lastError = errorCode;
|
|
}
|
|
},getNewId:function (table) {
|
|
var ret = GL.counter++;
|
|
for (var i = table.length; i < ret; i++) {
|
|
table[i] = null;
|
|
}
|
|
return ret;
|
|
},MINI_TEMP_BUFFER_SIZE:256,miniTempBuffer:null,miniTempBufferViews:[0],getSource:function (shader, count, string, length) {
|
|
var source = '';
|
|
for (var i = 0; i < count; ++i) {
|
|
var frag;
|
|
if (length) {
|
|
var len = HEAP32[(((length)+(i*4))>>2)];
|
|
if (len < 0) {
|
|
frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)]);
|
|
} else {
|
|
frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)], len);
|
|
}
|
|
} else {
|
|
frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)]);
|
|
}
|
|
source += frag;
|
|
}
|
|
return source;
|
|
},createContext:function (canvas, webGLContextAttributes) {
|
|
if (typeof webGLContextAttributes['majorVersion'] === 'undefined' && typeof webGLContextAttributes['minorVersion'] === 'undefined') {
|
|
webGLContextAttributes['majorVersion'] = 1;
|
|
webGLContextAttributes['minorVersion'] = 0;
|
|
}
|
|
var ctx;
|
|
var errorInfo = '?';
|
|
function onContextCreationError(event) {
|
|
errorInfo = event.statusMessage || errorInfo;
|
|
}
|
|
try {
|
|
canvas.addEventListener('webglcontextcreationerror', onContextCreationError, false);
|
|
try {
|
|
if (webGLContextAttributes['majorVersion'] == 1 && webGLContextAttributes['minorVersion'] == 0) {
|
|
ctx = canvas.getContext("webgl", webGLContextAttributes) || canvas.getContext("experimental-webgl", webGLContextAttributes);
|
|
} else if (webGLContextAttributes['majorVersion'] == 2 && webGLContextAttributes['minorVersion'] == 0) {
|
|
ctx = canvas.getContext("webgl2", webGLContextAttributes) || canvas.getContext("experimental-webgl2", webGLContextAttributes);
|
|
} else {
|
|
throw 'Unsupported WebGL context version ' + majorVersion + '.' + minorVersion + '!'
|
|
}
|
|
} finally {
|
|
canvas.removeEventListener('webglcontextcreationerror', onContextCreationError, false);
|
|
}
|
|
if (!ctx) throw ':(';
|
|
} catch (e) {
|
|
Module.print('Could not create canvas: ' + [errorInfo, e, JSON.stringify(webGLContextAttributes)]);
|
|
return 0;
|
|
}
|
|
// possible GL_DEBUG entry point: ctx = wrapDebugGL(ctx);
|
|
|
|
if (!ctx) return 0;
|
|
return GL.registerContext(ctx, webGLContextAttributes);
|
|
},registerContext:function (ctx, webGLContextAttributes) {
|
|
var handle = GL.getNewId(GL.contexts);
|
|
var context = {
|
|
handle: handle,
|
|
attributes: webGLContextAttributes,
|
|
version: webGLContextAttributes['majorVersion'],
|
|
GLctx: ctx
|
|
};
|
|
|
|
|
|
// Store the created context object so that we can access the context given a canvas without having to pass the parameters again.
|
|
if (ctx.canvas) ctx.canvas.GLctxObject = context;
|
|
GL.contexts[handle] = context;
|
|
if (typeof webGLContextAttributes['enableExtensionsByDefault'] === 'undefined' || webGLContextAttributes['enableExtensionsByDefault']) {
|
|
GL.initExtensions(context);
|
|
}
|
|
return handle;
|
|
},makeContextCurrent:function (contextHandle) {
|
|
var context = GL.contexts[contextHandle];
|
|
if (!context) return false;
|
|
GLctx = Module.ctx = context.GLctx; // Active WebGL context object.
|
|
GL.currentContext = context; // Active Emscripten GL layer context object.
|
|
return true;
|
|
},getContext:function (contextHandle) {
|
|
return GL.contexts[contextHandle];
|
|
},deleteContext:function (contextHandle) {
|
|
if (GL.currentContext === GL.contexts[contextHandle]) GL.currentContext = null;
|
|
if (typeof JSEvents === 'object') JSEvents.removeAllHandlersOnTarget(GL.contexts[contextHandle].GLctx.canvas); // Release all JS event handlers on the DOM element that the GL context is associated with since the context is now deleted.
|
|
if (GL.contexts[contextHandle] && GL.contexts[contextHandle].GLctx.canvas) GL.contexts[contextHandle].GLctx.canvas.GLctxObject = undefined; // Make sure the canvas object no longer refers to the context object so there are no GC surprises.
|
|
GL.contexts[contextHandle] = null;
|
|
},initExtensions:function (context) {
|
|
// If this function is called without a specific context object, init the extensions of the currently active context.
|
|
if (!context) context = GL.currentContext;
|
|
|
|
if (context.initExtensionsDone) return;
|
|
context.initExtensionsDone = true;
|
|
|
|
var GLctx = context.GLctx;
|
|
|
|
context.maxVertexAttribs = GLctx.getParameter(GLctx.MAX_VERTEX_ATTRIBS);
|
|
|
|
// Detect the presence of a few extensions manually, this GL interop layer itself will need to know if they exist.
|
|
|
|
if (context.version < 2) {
|
|
// Extension available from Firefox 26 and Google Chrome 30
|
|
var instancedArraysExt = GLctx.getExtension('ANGLE_instanced_arrays');
|
|
if (instancedArraysExt) {
|
|
GLctx['vertexAttribDivisor'] = function(index, divisor) { instancedArraysExt['vertexAttribDivisorANGLE'](index, divisor); };
|
|
GLctx['drawArraysInstanced'] = function(mode, first, count, primcount) { instancedArraysExt['drawArraysInstancedANGLE'](mode, first, count, primcount); };
|
|
GLctx['drawElementsInstanced'] = function(mode, count, type, indices, primcount) { instancedArraysExt['drawElementsInstancedANGLE'](mode, count, type, indices, primcount); };
|
|
}
|
|
|
|
// Extension available from Firefox 25 and WebKit
|
|
var vaoExt = GLctx.getExtension('OES_vertex_array_object');
|
|
if (vaoExt) {
|
|
GLctx['createVertexArray'] = function() { return vaoExt['createVertexArrayOES'](); };
|
|
GLctx['deleteVertexArray'] = function(vao) { vaoExt['deleteVertexArrayOES'](vao); };
|
|
GLctx['bindVertexArray'] = function(vao) { vaoExt['bindVertexArrayOES'](vao); };
|
|
GLctx['isVertexArray'] = function(vao) { return vaoExt['isVertexArrayOES'](vao); };
|
|
}
|
|
|
|
var drawBuffersExt = GLctx.getExtension('WEBGL_draw_buffers');
|
|
if (drawBuffersExt) {
|
|
GLctx['drawBuffers'] = function(n, bufs) { drawBuffersExt['drawBuffersWEBGL'](n, bufs); };
|
|
}
|
|
}
|
|
|
|
GLctx.disjointTimerQueryExt = GLctx.getExtension("EXT_disjoint_timer_query");
|
|
|
|
// These are the 'safe' feature-enabling extensions that don't add any performance impact related to e.g. debugging, and
|
|
// should be enabled by default so that client GLES2/GL code will not need to go through extra hoops to get its stuff working.
|
|
// As new extensions are ratified at http://www.khronos.org/registry/webgl/extensions/ , feel free to add your new extensions
|
|
// here, as long as they don't produce a performance impact for users that might not be using those extensions.
|
|
// E.g. debugging-related extensions should probably be off by default.
|
|
var automaticallyEnabledExtensions = [ "OES_texture_float", "OES_texture_half_float", "OES_standard_derivatives",
|
|
"OES_vertex_array_object", "WEBGL_compressed_texture_s3tc", "WEBGL_depth_texture",
|
|
"OES_element_index_uint", "EXT_texture_filter_anisotropic", "ANGLE_instanced_arrays",
|
|
"OES_texture_float_linear", "OES_texture_half_float_linear", "WEBGL_compressed_texture_atc",
|
|
"WEBGL_compressed_texture_pvrtc", "EXT_color_buffer_half_float", "WEBGL_color_buffer_float",
|
|
"EXT_frag_depth", "EXT_sRGB", "WEBGL_draw_buffers", "WEBGL_shared_resources",
|
|
"EXT_shader_texture_lod", "EXT_color_buffer_float"];
|
|
|
|
function shouldEnableAutomatically(extension) {
|
|
var ret = false;
|
|
automaticallyEnabledExtensions.forEach(function(include) {
|
|
if (ext.indexOf(include) != -1) {
|
|
ret = true;
|
|
}
|
|
});
|
|
return ret;
|
|
}
|
|
|
|
var exts = GLctx.getSupportedExtensions();
|
|
if (exts && exts.length > 0) {
|
|
GLctx.getSupportedExtensions().forEach(function(ext) {
|
|
if (automaticallyEnabledExtensions.indexOf(ext) != -1) {
|
|
GLctx.getExtension(ext); // Calling .getExtension enables that extension permanently, no need to store the return value to be enabled.
|
|
}
|
|
});
|
|
}
|
|
},populateUniformTable:function (program) {
|
|
var p = GL.programs[program];
|
|
GL.programInfos[program] = {
|
|
uniforms: {},
|
|
maxUniformLength: 0, // This is eagerly computed below, since we already enumerate all uniforms anyway.
|
|
maxAttributeLength: -1, // This is lazily computed and cached, computed when/if first asked, "-1" meaning not computed yet.
|
|
maxUniformBlockNameLength: -1 // Lazily computed as well
|
|
};
|
|
|
|
var ptable = GL.programInfos[program];
|
|
var utable = ptable.uniforms;
|
|
// A program's uniform table maps the string name of an uniform to an integer location of that uniform.
|
|
// The global GL.uniforms map maps integer locations to WebGLUniformLocations.
|
|
var numUniforms = GLctx.getProgramParameter(p, GLctx.ACTIVE_UNIFORMS);
|
|
for (var i = 0; i < numUniforms; ++i) {
|
|
var u = GLctx.getActiveUniform(p, i);
|
|
|
|
var name = u.name;
|
|
ptable.maxUniformLength = Math.max(ptable.maxUniformLength, name.length+1);
|
|
|
|
// Strip off any trailing array specifier we might have got, e.g. "[0]".
|
|
if (name.indexOf(']', name.length-1) !== -1) {
|
|
var ls = name.lastIndexOf('[');
|
|
name = name.slice(0, ls);
|
|
}
|
|
|
|
// Optimize memory usage slightly: If we have an array of uniforms, e.g. 'vec3 colors[3];', then
|
|
// only store the string 'colors' in utable, and 'colors[0]', 'colors[1]' and 'colors[2]' will be parsed as 'colors'+i.
|
|
// Note that for the GL.uniforms table, we still need to fetch the all WebGLUniformLocations for all the indices.
|
|
var loc = GLctx.getUniformLocation(p, name);
|
|
if (loc != null)
|
|
{
|
|
var id = GL.getNewId(GL.uniforms);
|
|
utable[name] = [u.size, id];
|
|
GL.uniforms[id] = loc;
|
|
|
|
for (var j = 1; j < u.size; ++j) {
|
|
var n = name + '['+j+']';
|
|
loc = GLctx.getUniformLocation(p, n);
|
|
id = GL.getNewId(GL.uniforms);
|
|
|
|
GL.uniforms[id] = loc;
|
|
}
|
|
}
|
|
}
|
|
}};function _emscripten_glIsRenderbuffer(renderbuffer) {
|
|
var rb = GL.renderbuffers[renderbuffer];
|
|
if (!rb) return 0;
|
|
return GLctx.isRenderbuffer(rb);
|
|
}
|
|
|
|
function _emscripten_glStencilMaskSeparate(x0, x1) { GLctx['stencilMaskSeparate'](x0, x1) }
|
|
|
|
function ___pthread_setcancelstate() { return 0 }
|
|
|
|
|
|
|
|
function _emscripten_get_now() { abort() }
|
|
|
|
|
|
|
|
function _emscripten_set_main_loop_timing(mode, value) {
|
|
Browser.mainLoop.timingMode = mode;
|
|
Browser.mainLoop.timingValue = value;
|
|
|
|
if (!Browser.mainLoop.func) {
|
|
console.error('emscripten_set_main_loop_timing: Cannot set timing mode for main loop since a main loop does not exist! Call emscripten_set_main_loop first to set one up.');
|
|
return 1; // Return non-zero on failure, can't set timing mode when there is no main loop.
|
|
}
|
|
|
|
if (mode == 0 /*EM_TIMING_SETTIMEOUT*/) {
|
|
Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setTimeout() {
|
|
var timeUntilNextTick = Math.max(0, Browser.mainLoop.tickStartTime + value - _emscripten_get_now())|0;
|
|
setTimeout(Browser.mainLoop.runner, timeUntilNextTick); // doing this each time means that on exception, we stop
|
|
};
|
|
Browser.mainLoop.method = 'timeout';
|
|
} else if (mode == 1 /*EM_TIMING_RAF*/) {
|
|
Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_rAF() {
|
|
Browser.requestAnimationFrame(Browser.mainLoop.runner);
|
|
};
|
|
Browser.mainLoop.method = 'rAF';
|
|
} else if (mode == 2 /*EM_TIMING_SETIMMEDIATE*/) {
|
|
if (!window['setImmediate']) {
|
|
// Emulate setImmediate. (note: not a complete polyfill, we don't emulate clearImmediate() to keep code size to minimum, since not needed)
|
|
var setImmediates = [];
|
|
var emscriptenMainLoopMessageId = 'setimmediate';
|
|
function Browser_setImmediate_messageHandler(event) {
|
|
if (event.source === window && event.data === emscriptenMainLoopMessageId) {
|
|
event.stopPropagation();
|
|
setImmediates.shift()();
|
|
}
|
|
}
|
|
window.addEventListener("message", Browser_setImmediate_messageHandler, true);
|
|
window['setImmediate'] = function Browser_emulated_setImmediate(func) {
|
|
setImmediates.push(func);
|
|
if (ENVIRONMENT_IS_WORKER) {
|
|
if (Module['setImmediates'] === undefined) Module['setImmediates'] = [];
|
|
Module['setImmediates'].push(func);
|
|
window.postMessage({target: emscriptenMainLoopMessageId}); // In --proxy-to-worker, route the message via proxyClient.js
|
|
} else window.postMessage(emscriptenMainLoopMessageId, "*"); // On the main thread, can just send the message to itself.
|
|
}
|
|
}
|
|
Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setImmediate() {
|
|
window['setImmediate'](Browser.mainLoop.runner);
|
|
};
|
|
Browser.mainLoop.method = 'immediate';
|
|
}
|
|
return 0;
|
|
}function _emscripten_set_main_loop(func, fps, simulateInfiniteLoop, arg, noSetTiming) {
|
|
Module['noExitRuntime'] = true;
|
|
|
|
assert(!Browser.mainLoop.func, 'emscripten_set_main_loop: there can only be one main loop function at once: call emscripten_cancel_main_loop to cancel the previous one before setting a new one with different parameters.');
|
|
|
|
Browser.mainLoop.func = func;
|
|
Browser.mainLoop.arg = arg;
|
|
|
|
var browserIterationFunc;
|
|
if (typeof arg !== 'undefined') {
|
|
browserIterationFunc = function() {
|
|
Module['dynCall_vi'](func, arg);
|
|
};
|
|
} else {
|
|
browserIterationFunc = function() {
|
|
Module['dynCall_v'](func);
|
|
};
|
|
}
|
|
|
|
var thisMainLoopId = Browser.mainLoop.currentlyRunningMainloop;
|
|
|
|
Browser.mainLoop.runner = function Browser_mainLoop_runner() {
|
|
if (ABORT) return;
|
|
if (Browser.mainLoop.queue.length > 0) {
|
|
var start = Date.now();
|
|
var blocker = Browser.mainLoop.queue.shift();
|
|
blocker.func(blocker.arg);
|
|
if (Browser.mainLoop.remainingBlockers) {
|
|
var remaining = Browser.mainLoop.remainingBlockers;
|
|
var next = remaining%1 == 0 ? remaining-1 : Math.floor(remaining);
|
|
if (blocker.counted) {
|
|
Browser.mainLoop.remainingBlockers = next;
|
|
} else {
|
|
// not counted, but move the progress along a tiny bit
|
|
next = next + 0.5; // do not steal all the next one's progress
|
|
Browser.mainLoop.remainingBlockers = (8*remaining + next)/9;
|
|
}
|
|
}
|
|
console.log('main loop blocker "' + blocker.name + '" took ' + (Date.now() - start) + ' ms'); //, left: ' + Browser.mainLoop.remainingBlockers);
|
|
Browser.mainLoop.updateStatus();
|
|
|
|
// catches pause/resume main loop from blocker execution
|
|
if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return;
|
|
|
|
setTimeout(Browser.mainLoop.runner, 0);
|
|
return;
|
|
}
|
|
|
|
// catch pauses from non-main loop sources
|
|
if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return;
|
|
|
|
// Implement very basic swap interval control
|
|
Browser.mainLoop.currentFrameNumber = Browser.mainLoop.currentFrameNumber + 1 | 0;
|
|
if (Browser.mainLoop.timingMode == 1/*EM_TIMING_RAF*/ && Browser.mainLoop.timingValue > 1 && Browser.mainLoop.currentFrameNumber % Browser.mainLoop.timingValue != 0) {
|
|
// Not the scheduled time to render this frame - skip.
|
|
Browser.mainLoop.scheduler();
|
|
return;
|
|
} else if (Browser.mainLoop.timingMode == 0/*EM_TIMING_SETTIMEOUT*/) {
|
|
Browser.mainLoop.tickStartTime = _emscripten_get_now();
|
|
}
|
|
|
|
// Signal GL rendering layer that processing of a new frame is about to start. This helps it optimize
|
|
// VBO double-buffering and reduce GPU stalls.
|
|
|
|
|
|
if (Browser.mainLoop.method === 'timeout' && Module.ctx) {
|
|
Module.printErr('Looks like you are rendering without using requestAnimationFrame for the main loop. You should use 0 for the frame rate in emscripten_set_main_loop in order to use requestAnimationFrame, as that can greatly improve your frame rates!');
|
|
Browser.mainLoop.method = ''; // just warn once per call to set main loop
|
|
}
|
|
|
|
Browser.mainLoop.runIter(browserIterationFunc);
|
|
|
|
checkStackCookie();
|
|
|
|
// catch pauses from the main loop itself
|
|
if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return;
|
|
|
|
// Queue new audio data. This is important to be right after the main loop invocation, so that we will immediately be able
|
|
// to queue the newest produced audio samples.
|
|
// TODO: Consider adding pre- and post- rAF callbacks so that GL.newRenderingFrameStarted() and SDL.audio.queueNewAudioData()
|
|
// do not need to be hardcoded into this function, but can be more generic.
|
|
if (typeof SDL === 'object' && SDL.audio && SDL.audio.queueNewAudioData) SDL.audio.queueNewAudioData();
|
|
|
|
Browser.mainLoop.scheduler();
|
|
}
|
|
|
|
if (!noSetTiming) {
|
|
if (fps && fps > 0) _emscripten_set_main_loop_timing(0/*EM_TIMING_SETTIMEOUT*/, 1000.0 / fps);
|
|
else _emscripten_set_main_loop_timing(1/*EM_TIMING_RAF*/, 1); // Do rAF by rendering each frame (no decimating)
|
|
|
|
Browser.mainLoop.scheduler();
|
|
}
|
|
|
|
if (simulateInfiniteLoop) {
|
|
throw 'SimulateInfiniteLoop';
|
|
}
|
|
}var Browser={mainLoop:{scheduler:null,method:"",currentlyRunningMainloop:0,func:null,arg:0,timingMode:0,timingValue:0,currentFrameNumber:0,queue:[],pause:function () {
|
|
Browser.mainLoop.scheduler = null;
|
|
Browser.mainLoop.currentlyRunningMainloop++; // Incrementing this signals the previous main loop that it's now become old, and it must return.
|
|
},resume:function () {
|
|
Browser.mainLoop.currentlyRunningMainloop++;
|
|
var timingMode = Browser.mainLoop.timingMode;
|
|
var timingValue = Browser.mainLoop.timingValue;
|
|
var func = Browser.mainLoop.func;
|
|
Browser.mainLoop.func = null;
|
|
_emscripten_set_main_loop(func, 0, false, Browser.mainLoop.arg, true /* do not set timing and call scheduler, we will do it on the next lines */);
|
|
_emscripten_set_main_loop_timing(timingMode, timingValue);
|
|
Browser.mainLoop.scheduler();
|
|
},updateStatus:function () {
|
|
if (Module['setStatus']) {
|
|
var message = Module['statusMessage'] || 'Please wait...';
|
|
var remaining = Browser.mainLoop.remainingBlockers;
|
|
var expected = Browser.mainLoop.expectedBlockers;
|
|
if (remaining) {
|
|
if (remaining < expected) {
|
|
Module['setStatus'](message + ' (' + (expected - remaining) + '/' + expected + ')');
|
|
} else {
|
|
Module['setStatus'](message);
|
|
}
|
|
} else {
|
|
Module['setStatus']('');
|
|
}
|
|
}
|
|
},runIter:function (func) {
|
|
if (ABORT) return;
|
|
if (Module['preMainLoop']) {
|
|
var preRet = Module['preMainLoop']();
|
|
if (preRet === false) {
|
|
return; // |return false| skips a frame
|
|
}
|
|
}
|
|
try {
|
|
func();
|
|
} catch (e) {
|
|
if (e instanceof ExitStatus) {
|
|
return;
|
|
} else {
|
|
if (e && typeof e === 'object' && e.stack) Module.printErr('exception thrown: ' + [e, e.stack]);
|
|
throw e;
|
|
}
|
|
}
|
|
if (Module['postMainLoop']) Module['postMainLoop']();
|
|
}},isFullscreen:false,pointerLock:false,moduleContextCreatedCallbacks:[],workers:[],init:function () {
|
|
if (!Module["preloadPlugins"]) Module["preloadPlugins"] = []; // needs to exist even in workers
|
|
|
|
if (Browser.initted) return;
|
|
Browser.initted = true;
|
|
|
|
try {
|
|
new Blob();
|
|
Browser.hasBlobConstructor = true;
|
|
} catch(e) {
|
|
Browser.hasBlobConstructor = false;
|
|
console.log("warning: no blob constructor, cannot create blobs with mimetypes");
|
|
}
|
|
Browser.BlobBuilder = typeof MozBlobBuilder != "undefined" ? MozBlobBuilder : (typeof WebKitBlobBuilder != "undefined" ? WebKitBlobBuilder : (!Browser.hasBlobConstructor ? console.log("warning: no BlobBuilder") : null));
|
|
Browser.URLObject = typeof window != "undefined" ? (window.URL ? window.URL : window.webkitURL) : undefined;
|
|
if (!Module.noImageDecoding && typeof Browser.URLObject === 'undefined') {
|
|
console.log("warning: Browser does not support creating object URLs. Built-in browser image decoding will not be available.");
|
|
Module.noImageDecoding = true;
|
|
}
|
|
|
|
// Support for plugins that can process preloaded files. You can add more of these to
|
|
// your app by creating and appending to Module.preloadPlugins.
|
|
//
|
|
// Each plugin is asked if it can handle a file based on the file's name. If it can,
|
|
// it is given the file's raw data. When it is done, it calls a callback with the file's
|
|
// (possibly modified) data. For example, a plugin might decompress a file, or it
|
|
// might create some side data structure for use later (like an Image element, etc.).
|
|
|
|
var imagePlugin = {};
|
|
imagePlugin['canHandle'] = function imagePlugin_canHandle(name) {
|
|
return !Module.noImageDecoding && /\.(jpg|jpeg|png|bmp)$/i.test(name);
|
|
};
|
|
imagePlugin['handle'] = function imagePlugin_handle(byteArray, name, onload, onerror) {
|
|
var b = null;
|
|
if (Browser.hasBlobConstructor) {
|
|
try {
|
|
b = new Blob([byteArray], { type: Browser.getMimetype(name) });
|
|
if (b.size !== byteArray.length) { // Safari bug #118630
|
|
// Safari's Blob can only take an ArrayBuffer
|
|
b = new Blob([(new Uint8Array(byteArray)).buffer], { type: Browser.getMimetype(name) });
|
|
}
|
|
} catch(e) {
|
|
Runtime.warnOnce('Blob constructor present but fails: ' + e + '; falling back to blob builder');
|
|
}
|
|
}
|
|
if (!b) {
|
|
var bb = new Browser.BlobBuilder();
|
|
bb.append((new Uint8Array(byteArray)).buffer); // we need to pass a buffer, and must copy the array to get the right data range
|
|
b = bb.getBlob();
|
|
}
|
|
var url = Browser.URLObject.createObjectURL(b);
|
|
assert(typeof url == 'string', 'createObjectURL must return a url as a string');
|
|
var img = new Image();
|
|
img.onload = function img_onload() {
|
|
assert(img.complete, 'Image ' + name + ' could not be decoded');
|
|
var canvas = document.createElement('canvas');
|
|
canvas.width = img.width;
|
|
canvas.height = img.height;
|
|
var ctx = canvas.getContext('2d');
|
|
ctx.drawImage(img, 0, 0);
|
|
Module["preloadedImages"][name] = canvas;
|
|
Browser.URLObject.revokeObjectURL(url);
|
|
if (onload) onload(byteArray);
|
|
};
|
|
img.onerror = function img_onerror(event) {
|
|
console.log('Image ' + url + ' could not be decoded');
|
|
if (onerror) onerror();
|
|
};
|
|
img.src = url;
|
|
};
|
|
Module['preloadPlugins'].push(imagePlugin);
|
|
|
|
var audioPlugin = {};
|
|
audioPlugin['canHandle'] = function audioPlugin_canHandle(name) {
|
|
return !Module.noAudioDecoding && name.substr(-4) in { '.ogg': 1, '.wav': 1, '.mp3': 1 };
|
|
};
|
|
audioPlugin['handle'] = function audioPlugin_handle(byteArray, name, onload, onerror) {
|
|
var done = false;
|
|
function finish(audio) {
|
|
if (done) return;
|
|
done = true;
|
|
Module["preloadedAudios"][name] = audio;
|
|
if (onload) onload(byteArray);
|
|
}
|
|
function fail() {
|
|
if (done) return;
|
|
done = true;
|
|
Module["preloadedAudios"][name] = new Audio(); // empty shim
|
|
if (onerror) onerror();
|
|
}
|
|
if (Browser.hasBlobConstructor) {
|
|
try {
|
|
var b = new Blob([byteArray], { type: Browser.getMimetype(name) });
|
|
} catch(e) {
|
|
return fail();
|
|
}
|
|
var url = Browser.URLObject.createObjectURL(b); // XXX we never revoke this!
|
|
assert(typeof url == 'string', 'createObjectURL must return a url as a string');
|
|
var audio = new Audio();
|
|
audio.addEventListener('canplaythrough', function() { finish(audio) }, false); // use addEventListener due to chromium bug 124926
|
|
audio.onerror = function audio_onerror(event) {
|
|
if (done) return;
|
|
console.log('warning: browser could not fully decode audio ' + name + ', trying slower base64 approach');
|
|
function encode64(data) {
|
|
var BASE = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/';
|
|
var PAD = '=';
|
|
var ret = '';
|
|
var leftchar = 0;
|
|
var leftbits = 0;
|
|
for (var i = 0; i < data.length; i++) {
|
|
leftchar = (leftchar << 8) | data[i];
|
|
leftbits += 8;
|
|
while (leftbits >= 6) {
|
|
var curr = (leftchar >> (leftbits-6)) & 0x3f;
|
|
leftbits -= 6;
|
|
ret += BASE[curr];
|
|
}
|
|
}
|
|
if (leftbits == 2) {
|
|
ret += BASE[(leftchar&3) << 4];
|
|
ret += PAD + PAD;
|
|
} else if (leftbits == 4) {
|
|
ret += BASE[(leftchar&0xf) << 2];
|
|
ret += PAD;
|
|
}
|
|
return ret;
|
|
}
|
|
audio.src = 'data:audio/x-' + name.substr(-3) + ';base64,' + encode64(byteArray);
|
|
finish(audio); // we don't wait for confirmation this worked - but it's worth trying
|
|
};
|
|
audio.src = url;
|
|
// workaround for chrome bug 124926 - we do not always get oncanplaythrough or onerror
|
|
Browser.safeSetTimeout(function() {
|
|
finish(audio); // try to use it even though it is not necessarily ready to play
|
|
}, 10000);
|
|
} else {
|
|
return fail();
|
|
}
|
|
};
|
|
Module['preloadPlugins'].push(audioPlugin);
|
|
|
|
// Canvas event setup
|
|
|
|
function pointerLockChange() {
|
|
Browser.pointerLock = document['pointerLockElement'] === Module['canvas'] ||
|
|
document['mozPointerLockElement'] === Module['canvas'] ||
|
|
document['webkitPointerLockElement'] === Module['canvas'] ||
|
|
document['msPointerLockElement'] === Module['canvas'];
|
|
}
|
|
var canvas = Module['canvas'];
|
|
if (canvas) {
|
|
// forced aspect ratio can be enabled by defining 'forcedAspectRatio' on Module
|
|
// Module['forcedAspectRatio'] = 4 / 3;
|
|
|
|
canvas.requestPointerLock = canvas['requestPointerLock'] ||
|
|
canvas['mozRequestPointerLock'] ||
|
|
canvas['webkitRequestPointerLock'] ||
|
|
canvas['msRequestPointerLock'] ||
|
|
function(){};
|
|
canvas.exitPointerLock = document['exitPointerLock'] ||
|
|
document['mozExitPointerLock'] ||
|
|
document['webkitExitPointerLock'] ||
|
|
document['msExitPointerLock'] ||
|
|
function(){}; // no-op if function does not exist
|
|
canvas.exitPointerLock = canvas.exitPointerLock.bind(document);
|
|
|
|
document.addEventListener('pointerlockchange', pointerLockChange, false);
|
|
document.addEventListener('mozpointerlockchange', pointerLockChange, false);
|
|
document.addEventListener('webkitpointerlockchange', pointerLockChange, false);
|
|
document.addEventListener('mspointerlockchange', pointerLockChange, false);
|
|
|
|
if (Module['elementPointerLock']) {
|
|
canvas.addEventListener("click", function(ev) {
|
|
if (!Browser.pointerLock && Module['canvas'].requestPointerLock) {
|
|
Module['canvas'].requestPointerLock();
|
|
ev.preventDefault();
|
|
}
|
|
}, false);
|
|
}
|
|
}
|
|
},createContext:function (canvas, useWebGL, setInModule, webGLContextAttributes) {
|
|
if (useWebGL && Module.ctx && canvas == Module.canvas) return Module.ctx; // no need to recreate GL context if it's already been created for this canvas.
|
|
|
|
var ctx;
|
|
var contextHandle;
|
|
if (useWebGL) {
|
|
// For GLES2/desktop GL compatibility, adjust a few defaults to be different to WebGL defaults, so that they align better with the desktop defaults.
|
|
var contextAttributes = {
|
|
antialias: false,
|
|
alpha: false
|
|
};
|
|
|
|
if (webGLContextAttributes) {
|
|
for (var attribute in webGLContextAttributes) {
|
|
contextAttributes[attribute] = webGLContextAttributes[attribute];
|
|
}
|
|
}
|
|
|
|
contextHandle = GL.createContext(canvas, contextAttributes);
|
|
if (contextHandle) {
|
|
ctx = GL.getContext(contextHandle).GLctx;
|
|
}
|
|
} else {
|
|
ctx = canvas.getContext('2d');
|
|
}
|
|
|
|
if (!ctx) return null;
|
|
|
|
if (setInModule) {
|
|
if (!useWebGL) assert(typeof GLctx === 'undefined', 'cannot set in module if GLctx is used, but we are a non-GL context that would replace it');
|
|
|
|
Module.ctx = ctx;
|
|
if (useWebGL) GL.makeContextCurrent(contextHandle);
|
|
Module.useWebGL = useWebGL;
|
|
Browser.moduleContextCreatedCallbacks.forEach(function(callback) { callback() });
|
|
Browser.init();
|
|
}
|
|
return ctx;
|
|
},destroyContext:function (canvas, useWebGL, setInModule) {},fullscreenHandlersInstalled:false,lockPointer:undefined,resizeCanvas:undefined,requestFullscreen:function (lockPointer, resizeCanvas, vrDevice) {
|
|
Browser.lockPointer = lockPointer;
|
|
Browser.resizeCanvas = resizeCanvas;
|
|
Browser.vrDevice = vrDevice;
|
|
if (typeof Browser.lockPointer === 'undefined') Browser.lockPointer = true;
|
|
if (typeof Browser.resizeCanvas === 'undefined') Browser.resizeCanvas = false;
|
|
if (typeof Browser.vrDevice === 'undefined') Browser.vrDevice = null;
|
|
|
|
var canvas = Module['canvas'];
|
|
function fullscreenChange() {
|
|
Browser.isFullscreen = false;
|
|
var canvasContainer = canvas.parentNode;
|
|
if ((document['fullscreenElement'] || document['mozFullScreenElement'] ||
|
|
document['msFullscreenElement'] || document['webkitFullscreenElement'] ||
|
|
document['webkitCurrentFullScreenElement']) === canvasContainer) {
|
|
canvas.exitFullscreen = document['exitFullscreen'] ||
|
|
document['cancelFullScreen'] ||
|
|
document['mozCancelFullScreen'] ||
|
|
document['msExitFullscreen'] ||
|
|
document['webkitCancelFullScreen'] ||
|
|
function() {};
|
|
canvas.exitFullscreen = canvas.exitFullscreen.bind(document);
|
|
if (Browser.lockPointer) canvas.requestPointerLock();
|
|
Browser.isFullscreen = true;
|
|
if (Browser.resizeCanvas) Browser.setFullscreenCanvasSize();
|
|
} else {
|
|
|
|
// remove the full screen specific parent of the canvas again to restore the HTML structure from before going full screen
|
|
canvasContainer.parentNode.insertBefore(canvas, canvasContainer);
|
|
canvasContainer.parentNode.removeChild(canvasContainer);
|
|
|
|
if (Browser.resizeCanvas) Browser.setWindowedCanvasSize();
|
|
}
|
|
if (Module['onFullScreen']) Module['onFullScreen'](Browser.isFullscreen);
|
|
if (Module['onFullscreen']) Module['onFullscreen'](Browser.isFullscreen);
|
|
Browser.updateCanvasDimensions(canvas);
|
|
}
|
|
|
|
if (!Browser.fullscreenHandlersInstalled) {
|
|
Browser.fullscreenHandlersInstalled = true;
|
|
document.addEventListener('fullscreenchange', fullscreenChange, false);
|
|
document.addEventListener('mozfullscreenchange', fullscreenChange, false);
|
|
document.addEventListener('webkitfullscreenchange', fullscreenChange, false);
|
|
document.addEventListener('MSFullscreenChange', fullscreenChange, false);
|
|
}
|
|
|
|
// create a new parent to ensure the canvas has no siblings. this allows browsers to optimize full screen performance when its parent is the full screen root
|
|
var canvasContainer = document.createElement("div");
|
|
canvas.parentNode.insertBefore(canvasContainer, canvas);
|
|
canvasContainer.appendChild(canvas);
|
|
|
|
// use parent of canvas as full screen root to allow aspect ratio correction (Firefox stretches the root to screen size)
|
|
canvasContainer.requestFullscreen = canvasContainer['requestFullscreen'] ||
|
|
canvasContainer['mozRequestFullScreen'] ||
|
|
canvasContainer['msRequestFullscreen'] ||
|
|
(canvasContainer['webkitRequestFullscreen'] ? function() { canvasContainer['webkitRequestFullscreen'](Element['ALLOW_KEYBOARD_INPUT']) } : null) ||
|
|
(canvasContainer['webkitRequestFullScreen'] ? function() { canvasContainer['webkitRequestFullScreen'](Element['ALLOW_KEYBOARD_INPUT']) } : null);
|
|
|
|
if (vrDevice) {
|
|
canvasContainer.requestFullscreen({ vrDisplay: vrDevice });
|
|
} else {
|
|
canvasContainer.requestFullscreen();
|
|
}
|
|
},requestFullScreen:function (lockPointer, resizeCanvas, vrDevice) {
|
|
Module.printErr('Browser.requestFullScreen() is deprecated. Please call Browser.requestFullscreen instead.');
|
|
Browser.requestFullScreen = function(lockPointer, resizeCanvas, vrDevice) {
|
|
return Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice);
|
|
}
|
|
return Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice);
|
|
},nextRAF:0,fakeRequestAnimationFrame:function (func) {
|
|
// try to keep 60fps between calls to here
|
|
var now = Date.now();
|
|
if (Browser.nextRAF === 0) {
|
|
Browser.nextRAF = now + 1000/60;
|
|
} else {
|
|
while (now + 2 >= Browser.nextRAF) { // fudge a little, to avoid timer jitter causing us to do lots of delay:0
|
|
Browser.nextRAF += 1000/60;
|
|
}
|
|
}
|
|
var delay = Math.max(Browser.nextRAF - now, 0);
|
|
setTimeout(func, delay);
|
|
},requestAnimationFrame:function requestAnimationFrame(func) {
|
|
if (typeof window === 'undefined') { // Provide fallback to setTimeout if window is undefined (e.g. in Node.js)
|
|
Browser.fakeRequestAnimationFrame(func);
|
|
} else {
|
|
if (!window.requestAnimationFrame) {
|
|
window.requestAnimationFrame = window['requestAnimationFrame'] ||
|
|
window['mozRequestAnimationFrame'] ||
|
|
window['webkitRequestAnimationFrame'] ||
|
|
window['msRequestAnimationFrame'] ||
|
|
window['oRequestAnimationFrame'] ||
|
|
Browser.fakeRequestAnimationFrame;
|
|
}
|
|
window.requestAnimationFrame(func);
|
|
}
|
|
},safeCallback:function (func) {
|
|
return function() {
|
|
if (!ABORT) return func.apply(null, arguments);
|
|
};
|
|
},allowAsyncCallbacks:true,queuedAsyncCallbacks:[],pauseAsyncCallbacks:function () {
|
|
Browser.allowAsyncCallbacks = false;
|
|
},resumeAsyncCallbacks:function () { // marks future callbacks as ok to execute, and synchronously runs any remaining ones right now
|
|
Browser.allowAsyncCallbacks = true;
|
|
if (Browser.queuedAsyncCallbacks.length > 0) {
|
|
var callbacks = Browser.queuedAsyncCallbacks;
|
|
Browser.queuedAsyncCallbacks = [];
|
|
callbacks.forEach(function(func) {
|
|
func();
|
|
});
|
|
}
|
|
},safeRequestAnimationFrame:function (func) {
|
|
return Browser.requestAnimationFrame(function() {
|
|
if (ABORT) return;
|
|
if (Browser.allowAsyncCallbacks) {
|
|
func();
|
|
} else {
|
|
Browser.queuedAsyncCallbacks.push(func);
|
|
}
|
|
});
|
|
},safeSetTimeout:function (func, timeout) {
|
|
Module['noExitRuntime'] = true;
|
|
return setTimeout(function() {
|
|
if (ABORT) return;
|
|
if (Browser.allowAsyncCallbacks) {
|
|
func();
|
|
} else {
|
|
Browser.queuedAsyncCallbacks.push(func);
|
|
}
|
|
}, timeout);
|
|
},safeSetInterval:function (func, timeout) {
|
|
Module['noExitRuntime'] = true;
|
|
return setInterval(function() {
|
|
if (ABORT) return;
|
|
if (Browser.allowAsyncCallbacks) {
|
|
func();
|
|
} // drop it on the floor otherwise, next interval will kick in
|
|
}, timeout);
|
|
},getMimetype:function (name) {
|
|
return {
|
|
'jpg': 'image/jpeg',
|
|
'jpeg': 'image/jpeg',
|
|
'png': 'image/png',
|
|
'bmp': 'image/bmp',
|
|
'ogg': 'audio/ogg',
|
|
'wav': 'audio/wav',
|
|
'mp3': 'audio/mpeg'
|
|
}[name.substr(name.lastIndexOf('.')+1)];
|
|
},getUserMedia:function (func) {
|
|
if(!window.getUserMedia) {
|
|
window.getUserMedia = navigator['getUserMedia'] ||
|
|
navigator['mozGetUserMedia'];
|
|
}
|
|
window.getUserMedia(func);
|
|
},getMovementX:function (event) {
|
|
return event['movementX'] ||
|
|
event['mozMovementX'] ||
|
|
event['webkitMovementX'] ||
|
|
0;
|
|
},getMovementY:function (event) {
|
|
return event['movementY'] ||
|
|
event['mozMovementY'] ||
|
|
event['webkitMovementY'] ||
|
|
0;
|
|
},getMouseWheelDelta:function (event) {
|
|
var delta = 0;
|
|
switch (event.type) {
|
|
case 'DOMMouseScroll':
|
|
delta = event.detail;
|
|
break;
|
|
case 'mousewheel':
|
|
delta = event.wheelDelta;
|
|
break;
|
|
case 'wheel':
|
|
delta = event['deltaY'];
|
|
break;
|
|
default:
|
|
throw 'unrecognized mouse wheel event: ' + event.type;
|
|
}
|
|
return delta;
|
|
},mouseX:0,mouseY:0,mouseMovementX:0,mouseMovementY:0,touches:{},lastTouches:{},calculateMouseEvent:function (event) { // event should be mousemove, mousedown or mouseup
|
|
if (Browser.pointerLock) {
|
|
// When the pointer is locked, calculate the coordinates
|
|
// based on the movement of the mouse.
|
|
// Workaround for Firefox bug 764498
|
|
if (event.type != 'mousemove' &&
|
|
('mozMovementX' in event)) {
|
|
Browser.mouseMovementX = Browser.mouseMovementY = 0;
|
|
} else {
|
|
Browser.mouseMovementX = Browser.getMovementX(event);
|
|
Browser.mouseMovementY = Browser.getMovementY(event);
|
|
}
|
|
|
|
// check if SDL is available
|
|
if (typeof SDL != "undefined") {
|
|
Browser.mouseX = SDL.mouseX + Browser.mouseMovementX;
|
|
Browser.mouseY = SDL.mouseY + Browser.mouseMovementY;
|
|
} else {
|
|
// just add the mouse delta to the current absolut mouse position
|
|
// FIXME: ideally this should be clamped against the canvas size and zero
|
|
Browser.mouseX += Browser.mouseMovementX;
|
|
Browser.mouseY += Browser.mouseMovementY;
|
|
}
|
|
} else {
|
|
// Otherwise, calculate the movement based on the changes
|
|
// in the coordinates.
|
|
var rect = Module["canvas"].getBoundingClientRect();
|
|
var cw = Module["canvas"].width;
|
|
var ch = Module["canvas"].height;
|
|
|
|
// Neither .scrollX or .pageXOffset are defined in a spec, but
|
|
// we prefer .scrollX because it is currently in a spec draft.
|
|
// (see: http://www.w3.org/TR/2013/WD-cssom-view-20131217/)
|
|
var scrollX = ((typeof window.scrollX !== 'undefined') ? window.scrollX : window.pageXOffset);
|
|
var scrollY = ((typeof window.scrollY !== 'undefined') ? window.scrollY : window.pageYOffset);
|
|
// If this assert lands, it's likely because the browser doesn't support scrollX or pageXOffset
|
|
// and we have no viable fallback.
|
|
assert((typeof scrollX !== 'undefined') && (typeof scrollY !== 'undefined'), 'Unable to retrieve scroll position, mouse positions likely broken.');
|
|
|
|
if (event.type === 'touchstart' || event.type === 'touchend' || event.type === 'touchmove') {
|
|
var touch = event.touch;
|
|
if (touch === undefined) {
|
|
return; // the "touch" property is only defined in SDL
|
|
|
|
}
|
|
var adjustedX = touch.pageX - (scrollX + rect.left);
|
|
var adjustedY = touch.pageY - (scrollY + rect.top);
|
|
|
|
adjustedX = adjustedX * (cw / rect.width);
|
|
adjustedY = adjustedY * (ch / rect.height);
|
|
|
|
var coords = { x: adjustedX, y: adjustedY };
|
|
|
|
if (event.type === 'touchstart') {
|
|
Browser.lastTouches[touch.identifier] = coords;
|
|
Browser.touches[touch.identifier] = coords;
|
|
} else if (event.type === 'touchend' || event.type === 'touchmove') {
|
|
var last = Browser.touches[touch.identifier];
|
|
if (!last) last = coords;
|
|
Browser.lastTouches[touch.identifier] = last;
|
|
Browser.touches[touch.identifier] = coords;
|
|
}
|
|
return;
|
|
}
|
|
|
|
var x = event.pageX - (scrollX + rect.left);
|
|
var y = event.pageY - (scrollY + rect.top);
|
|
|
|
// the canvas might be CSS-scaled compared to its backbuffer;
|
|
// SDL-using content will want mouse coordinates in terms
|
|
// of backbuffer units.
|
|
x = x * (cw / rect.width);
|
|
y = y * (ch / rect.height);
|
|
|
|
Browser.mouseMovementX = x - Browser.mouseX;
|
|
Browser.mouseMovementY = y - Browser.mouseY;
|
|
Browser.mouseX = x;
|
|
Browser.mouseY = y;
|
|
}
|
|
},asyncLoad:function (url, onload, onerror, noRunDep) {
|
|
var dep = !noRunDep ? getUniqueRunDependency('al ' + url) : '';
|
|
Module['readAsync'](url, function(arrayBuffer) {
|
|
assert(arrayBuffer, 'Loading data file "' + url + '" failed (no arrayBuffer).');
|
|
onload(new Uint8Array(arrayBuffer));
|
|
if (dep) removeRunDependency(dep);
|
|
}, function(event) {
|
|
if (onerror) {
|
|
onerror();
|
|
} else {
|
|
throw 'Loading data file "' + url + '" failed.';
|
|
}
|
|
});
|
|
if (dep) addRunDependency(dep);
|
|
},resizeListeners:[],updateResizeListeners:function () {
|
|
var canvas = Module['canvas'];
|
|
Browser.resizeListeners.forEach(function(listener) {
|
|
listener(canvas.width, canvas.height);
|
|
});
|
|
},setCanvasSize:function (width, height, noUpdates) {
|
|
var canvas = Module['canvas'];
|
|
Browser.updateCanvasDimensions(canvas, width, height);
|
|
if (!noUpdates) Browser.updateResizeListeners();
|
|
},windowedWidth:0,windowedHeight:0,setFullscreenCanvasSize:function () {
|
|
// check if SDL is available
|
|
if (typeof SDL != "undefined") {
|
|
var flags = HEAPU32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)];
|
|
flags = flags | 0x00800000; // set SDL_FULLSCREEN flag
|
|
HEAP32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)]=flags
|
|
}
|
|
Browser.updateResizeListeners();
|
|
},setWindowedCanvasSize:function () {
|
|
// check if SDL is available
|
|
if (typeof SDL != "undefined") {
|
|
var flags = HEAPU32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)];
|
|
flags = flags & ~0x00800000; // clear SDL_FULLSCREEN flag
|
|
HEAP32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)]=flags
|
|
}
|
|
Browser.updateResizeListeners();
|
|
},updateCanvasDimensions:function (canvas, wNative, hNative) {
|
|
if (wNative && hNative) {
|
|
canvas.widthNative = wNative;
|
|
canvas.heightNative = hNative;
|
|
} else {
|
|
wNative = canvas.widthNative;
|
|
hNative = canvas.heightNative;
|
|
}
|
|
var w = wNative;
|
|
var h = hNative;
|
|
if (Module['forcedAspectRatio'] && Module['forcedAspectRatio'] > 0) {
|
|
if (w/h < Module['forcedAspectRatio']) {
|
|
w = Math.round(h * Module['forcedAspectRatio']);
|
|
} else {
|
|
h = Math.round(w / Module['forcedAspectRatio']);
|
|
}
|
|
}
|
|
if (((document['fullscreenElement'] || document['mozFullScreenElement'] ||
|
|
document['msFullscreenElement'] || document['webkitFullscreenElement'] ||
|
|
document['webkitCurrentFullScreenElement']) === canvas.parentNode) && (typeof screen != 'undefined')) {
|
|
var factor = Math.min(screen.width / w, screen.height / h);
|
|
w = Math.round(w * factor);
|
|
h = Math.round(h * factor);
|
|
}
|
|
if (Browser.resizeCanvas) {
|
|
if (canvas.width != w) canvas.width = w;
|
|
if (canvas.height != h) canvas.height = h;
|
|
if (typeof canvas.style != 'undefined') {
|
|
canvas.style.removeProperty( "width");
|
|
canvas.style.removeProperty("height");
|
|
}
|
|
} else {
|
|
if (canvas.width != wNative) canvas.width = wNative;
|
|
if (canvas.height != hNative) canvas.height = hNative;
|
|
if (typeof canvas.style != 'undefined') {
|
|
if (w != wNative || h != hNative) {
|
|
canvas.style.setProperty( "width", w + "px", "important");
|
|
canvas.style.setProperty("height", h + "px", "important");
|
|
} else {
|
|
canvas.style.removeProperty( "width");
|
|
canvas.style.removeProperty("height");
|
|
}
|
|
}
|
|
}
|
|
},wgetRequests:{},nextWgetRequestHandle:0,getNextWgetRequestHandle:function () {
|
|
var handle = Browser.nextWgetRequestHandle;
|
|
Browser.nextWgetRequestHandle++;
|
|
return handle;
|
|
}};var GLFW={Window:function (id, width, height, title, monitor, share) {
|
|
this.id = id;
|
|
this.x = 0;
|
|
this.y = 0;
|
|
this.fullscreen = false; // Used to determine if app in fullscreen mode
|
|
this.storedX = 0; // Used to store X before fullscreen
|
|
this.storedY = 0; // Used to store Y before fullscreen
|
|
this.width = width;
|
|
this.height = height;
|
|
this.storedWidth = width; // Used to store width before fullscreen
|
|
this.storedHeight = height; // Used to store height before fullscreen
|
|
this.title = title;
|
|
this.monitor = monitor;
|
|
this.share = share;
|
|
this.attributes = GLFW.hints;
|
|
this.inputModes = {
|
|
0x00033001:0x00034001, // GLFW_CURSOR (GLFW_CURSOR_NORMAL)
|
|
0x00033002:0, // GLFW_STICKY_KEYS
|
|
0x00033003:0, // GLFW_STICKY_MOUSE_BUTTONS
|
|
};
|
|
this.buttons = 0;
|
|
this.keys = new Array();
|
|
this.shouldClose = 0;
|
|
this.title = null;
|
|
this.windowPosFunc = null; // GLFWwindowposfun
|
|
this.windowSizeFunc = null; // GLFWwindowsizefun
|
|
this.windowCloseFunc = null; // GLFWwindowclosefun
|
|
this.windowRefreshFunc = null; // GLFWwindowrefreshfun
|
|
this.windowFocusFunc = null; // GLFWwindowfocusfun
|
|
this.windowIconifyFunc = null; // GLFWwindowiconifyfun
|
|
this.framebufferSizeFunc = null; // GLFWframebuffersizefun
|
|
this.mouseButtonFunc = null; // GLFWmousebuttonfun
|
|
this.cursorPosFunc = null; // GLFWcursorposfun
|
|
this.cursorEnterFunc = null; // GLFWcursorenterfun
|
|
this.scrollFunc = null; // GLFWscrollfun
|
|
this.keyFunc = null; // GLFWkeyfun
|
|
this.charFunc = null; // GLFWcharfun
|
|
this.userptr = null;
|
|
},WindowFromId:function (id) {
|
|
if (id <= 0 || !GLFW.windows) return null;
|
|
return GLFW.windows[id - 1];
|
|
},errorFunc:null,monitorFunc:null,active:null,windows:null,monitors:null,monitorString:null,versionString:null,initialTime:null,extensions:null,hints:null,defaultHints:{131073:0,131074:0,131075:1,131076:1,131077:1,135169:8,135170:8,135171:8,135172:8,135173:24,135174:8,135175:0,135176:0,135177:0,135178:0,135179:0,135180:0,135181:0,135182:0,135183:0,139265:196609,139266:1,139267:0,139268:0,139269:0,139270:0,139271:0,139272:0},DOMToGLFWKeyCode:function (keycode) {
|
|
switch (keycode) {
|
|
// these keycodes are only defined for GLFW3, assume they are the same for GLFW2
|
|
case 0x20:return 32; // DOM_VK_SPACE -> GLFW_KEY_SPACE
|
|
case 0xDE:return 39; // DOM_VK_QUOTE -> GLFW_KEY_APOSTROPHE
|
|
case 0xBC:return 44; // DOM_VK_COMMA -> GLFW_KEY_COMMA
|
|
case 0xAD:return 45; // DOM_VK_HYPHEN_MINUS -> GLFW_KEY_MINUS
|
|
case 0xBD:return 45; // DOM_VK_MINUS -> GLFW_KEY_MINUS
|
|
case 0xBE:return 46; // DOM_VK_PERIOD -> GLFW_KEY_PERIOD
|
|
case 0xBF:return 47; // DOM_VK_SLASH -> GLFW_KEY_SLASH
|
|
case 0x30:return 48; // DOM_VK_0 -> GLFW_KEY_0
|
|
case 0x31:return 49; // DOM_VK_1 -> GLFW_KEY_1
|
|
case 0x32:return 50; // DOM_VK_2 -> GLFW_KEY_2
|
|
case 0x33:return 51; // DOM_VK_3 -> GLFW_KEY_3
|
|
case 0x34:return 52; // DOM_VK_4 -> GLFW_KEY_4
|
|
case 0x35:return 53; // DOM_VK_5 -> GLFW_KEY_5
|
|
case 0x36:return 54; // DOM_VK_6 -> GLFW_KEY_6
|
|
case 0x37:return 55; // DOM_VK_7 -> GLFW_KEY_7
|
|
case 0x38:return 56; // DOM_VK_8 -> GLFW_KEY_8
|
|
case 0x39:return 57; // DOM_VK_9 -> GLFW_KEY_9
|
|
case 0x3B:return 59; // DOM_VK_SEMICOLON -> GLFW_KEY_SEMICOLON
|
|
case 0x3D:return 61; // DOM_VK_EQUALS -> GLFW_KEY_EQUAL
|
|
case 0xBB:return 61; // DOM_VK_EQUALS -> GLFW_KEY_EQUAL
|
|
case 0x41:return 65; // DOM_VK_A -> GLFW_KEY_A
|
|
case 0x42:return 66; // DOM_VK_B -> GLFW_KEY_B
|
|
case 0x43:return 67; // DOM_VK_C -> GLFW_KEY_C
|
|
case 0x44:return 68; // DOM_VK_D -> GLFW_KEY_D
|
|
case 0x45:return 69; // DOM_VK_E -> GLFW_KEY_E
|
|
case 0x46:return 70; // DOM_VK_F -> GLFW_KEY_F
|
|
case 0x47:return 71; // DOM_VK_G -> GLFW_KEY_G
|
|
case 0x48:return 72; // DOM_VK_H -> GLFW_KEY_H
|
|
case 0x49:return 73; // DOM_VK_I -> GLFW_KEY_I
|
|
case 0x4A:return 74; // DOM_VK_J -> GLFW_KEY_J
|
|
case 0x4B:return 75; // DOM_VK_K -> GLFW_KEY_K
|
|
case 0x4C:return 76; // DOM_VK_L -> GLFW_KEY_L
|
|
case 0x4D:return 77; // DOM_VK_M -> GLFW_KEY_M
|
|
case 0x4E:return 78; // DOM_VK_N -> GLFW_KEY_N
|
|
case 0x4F:return 79; // DOM_VK_O -> GLFW_KEY_O
|
|
case 0x50:return 80; // DOM_VK_P -> GLFW_KEY_P
|
|
case 0x51:return 81; // DOM_VK_Q -> GLFW_KEY_Q
|
|
case 0x52:return 82; // DOM_VK_R -> GLFW_KEY_R
|
|
case 0x53:return 83; // DOM_VK_S -> GLFW_KEY_S
|
|
case 0x54:return 84; // DOM_VK_T -> GLFW_KEY_T
|
|
case 0x55:return 85; // DOM_VK_U -> GLFW_KEY_U
|
|
case 0x56:return 86; // DOM_VK_V -> GLFW_KEY_V
|
|
case 0x57:return 87; // DOM_VK_W -> GLFW_KEY_W
|
|
case 0x58:return 88; // DOM_VK_X -> GLFW_KEY_X
|
|
case 0x59:return 89; // DOM_VK_Y -> GLFW_KEY_Y
|
|
case 0x5a:return 90; // DOM_VK_Z -> GLFW_KEY_Z
|
|
case 0xDB:return 91; // DOM_VK_OPEN_BRACKET -> GLFW_KEY_LEFT_BRACKET
|
|
case 0xDC:return 92; // DOM_VK_BACKSLASH -> GLFW_KEY_BACKSLASH
|
|
case 0xDD:return 93; // DOM_VK_CLOSE_BRACKET -> GLFW_KEY_RIGHT_BRACKET
|
|
case 0xC0:return 94; // DOM_VK_BACK_QUOTE -> GLFW_KEY_GRAVE_ACCENT
|
|
|
|
|
|
case 0x1B:return 256; // DOM_VK_ESCAPE -> GLFW_KEY_ESCAPE
|
|
case 0x0D:return 257; // DOM_VK_RETURN -> GLFW_KEY_ENTER
|
|
case 0x09:return 258; // DOM_VK_TAB -> GLFW_KEY_TAB
|
|
case 0x08:return 259; // DOM_VK_BACK -> GLFW_KEY_BACKSPACE
|
|
case 0x2D:return 260; // DOM_VK_INSERT -> GLFW_KEY_INSERT
|
|
case 0x2E:return 261; // DOM_VK_DELETE -> GLFW_KEY_DELETE
|
|
case 0x27:return 262; // DOM_VK_RIGHT -> GLFW_KEY_RIGHT
|
|
case 0x25:return 263; // DOM_VK_LEFT -> GLFW_KEY_LEFT
|
|
case 0x28:return 264; // DOM_VK_DOWN -> GLFW_KEY_DOWN
|
|
case 0x26:return 265; // DOM_VK_UP -> GLFW_KEY_UP
|
|
case 0x21:return 266; // DOM_VK_PAGE_UP -> GLFW_KEY_PAGE_UP
|
|
case 0x22:return 267; // DOM_VK_PAGE_DOWN -> GLFW_KEY_PAGE_DOWN
|
|
case 0x24:return 268; // DOM_VK_HOME -> GLFW_KEY_HOME
|
|
case 0x23:return 269; // DOM_VK_END -> GLFW_KEY_END
|
|
case 0x14:return 280; // DOM_VK_CAPS_LOCK -> GLFW_KEY_CAPS_LOCK
|
|
case 0x91:return 281; // DOM_VK_SCROLL_LOCK -> GLFW_KEY_SCROLL_LOCK
|
|
case 0x90:return 282; // DOM_VK_NUM_LOCK -> GLFW_KEY_NUM_LOCK
|
|
case 0x2C:return 283; // DOM_VK_SNAPSHOT -> GLFW_KEY_PRINT_SCREEN
|
|
case 0x13:return 284; // DOM_VK_PAUSE -> GLFW_KEY_PAUSE
|
|
case 0x70:return 290; // DOM_VK_F1 -> GLFW_KEY_F1
|
|
case 0x71:return 291; // DOM_VK_F2 -> GLFW_KEY_F2
|
|
case 0x72:return 292; // DOM_VK_F3 -> GLFW_KEY_F3
|
|
case 0x73:return 293; // DOM_VK_F4 -> GLFW_KEY_F4
|
|
case 0x74:return 294; // DOM_VK_F5 -> GLFW_KEY_F5
|
|
case 0x75:return 295; // DOM_VK_F6 -> GLFW_KEY_F6
|
|
case 0x76:return 296; // DOM_VK_F7 -> GLFW_KEY_F7
|
|
case 0x77:return 297; // DOM_VK_F8 -> GLFW_KEY_F8
|
|
case 0x78:return 298; // DOM_VK_F9 -> GLFW_KEY_F9
|
|
case 0x79:return 299; // DOM_VK_F10 -> GLFW_KEY_F10
|
|
case 0x7A:return 300; // DOM_VK_F11 -> GLFW_KEY_F11
|
|
case 0x7B:return 301; // DOM_VK_F12 -> GLFW_KEY_F12
|
|
case 0x7C:return 302; // DOM_VK_F13 -> GLFW_KEY_F13
|
|
case 0x7D:return 303; // DOM_VK_F14 -> GLFW_KEY_F14
|
|
case 0x7E:return 304; // DOM_VK_F15 -> GLFW_KEY_F15
|
|
case 0x7F:return 305; // DOM_VK_F16 -> GLFW_KEY_F16
|
|
case 0x80:return 306; // DOM_VK_F17 -> GLFW_KEY_F17
|
|
case 0x81:return 307; // DOM_VK_F18 -> GLFW_KEY_F18
|
|
case 0x82:return 308; // DOM_VK_F19 -> GLFW_KEY_F19
|
|
case 0x83:return 309; // DOM_VK_F20 -> GLFW_KEY_F20
|
|
case 0x84:return 310; // DOM_VK_F21 -> GLFW_KEY_F21
|
|
case 0x85:return 311; // DOM_VK_F22 -> GLFW_KEY_F22
|
|
case 0x86:return 312; // DOM_VK_F23 -> GLFW_KEY_F23
|
|
case 0x87:return 313; // DOM_VK_F24 -> GLFW_KEY_F24
|
|
case 0x88:return 314; // 0x88 (not used?) -> GLFW_KEY_F25
|
|
case 0x60:return 320; // DOM_VK_NUMPAD0 -> GLFW_KEY_KP_0
|
|
case 0x61:return 321; // DOM_VK_NUMPAD1 -> GLFW_KEY_KP_1
|
|
case 0x62:return 322; // DOM_VK_NUMPAD2 -> GLFW_KEY_KP_2
|
|
case 0x63:return 323; // DOM_VK_NUMPAD3 -> GLFW_KEY_KP_3
|
|
case 0x64:return 324; // DOM_VK_NUMPAD4 -> GLFW_KEY_KP_4
|
|
case 0x65:return 325; // DOM_VK_NUMPAD5 -> GLFW_KEY_KP_5
|
|
case 0x66:return 326; // DOM_VK_NUMPAD6 -> GLFW_KEY_KP_6
|
|
case 0x67:return 327; // DOM_VK_NUMPAD7 -> GLFW_KEY_KP_7
|
|
case 0x68:return 328; // DOM_VK_NUMPAD8 -> GLFW_KEY_KP_8
|
|
case 0x69:return 329; // DOM_VK_NUMPAD9 -> GLFW_KEY_KP_9
|
|
case 0x6E:return 330; // DOM_VK_DECIMAL -> GLFW_KEY_KP_DECIMAL
|
|
case 0x6F:return 331; // DOM_VK_DIVIDE -> GLFW_KEY_KP_DIVIDE
|
|
case 0x6A:return 332; // DOM_VK_MULTIPLY -> GLFW_KEY_KP_MULTIPLY
|
|
case 0x6D:return 333; // DOM_VK_SUBTRACT -> GLFW_KEY_KP_SUBTRACT
|
|
case 0x6B:return 334; // DOM_VK_ADD -> GLFW_KEY_KP_ADD
|
|
// case 0x0D:return 335; // DOM_VK_RETURN -> GLFW_KEY_KP_ENTER (DOM_KEY_LOCATION_RIGHT)
|
|
// case 0x61:return 336; // DOM_VK_EQUALS -> GLFW_KEY_KP_EQUAL (DOM_KEY_LOCATION_RIGHT)
|
|
case 0x10:return 340; // DOM_VK_SHIFT -> GLFW_KEY_LEFT_SHIFT
|
|
case 0x11:return 341; // DOM_VK_CONTROL -> GLFW_KEY_LEFT_CONTROL
|
|
case 0x12:return 342; // DOM_VK_ALT -> GLFW_KEY_LEFT_ALT
|
|
case 0x5B:return 343; // DOM_VK_WIN -> GLFW_KEY_LEFT_SUPER
|
|
// case 0x10:return 344; // DOM_VK_SHIFT -> GLFW_KEY_RIGHT_SHIFT (DOM_KEY_LOCATION_RIGHT)
|
|
// case 0x11:return 345; // DOM_VK_CONTROL -> GLFW_KEY_RIGHT_CONTROL (DOM_KEY_LOCATION_RIGHT)
|
|
// case 0x12:return 346; // DOM_VK_ALT -> GLFW_KEY_RIGHT_ALT (DOM_KEY_LOCATION_RIGHT)
|
|
// case 0x5B:return 347; // DOM_VK_WIN -> GLFW_KEY_RIGHT_SUPER (DOM_KEY_LOCATION_RIGHT)
|
|
case 0x5D:return 348; // DOM_VK_CONTEXT_MENU -> GLFW_KEY_MENU
|
|
// XXX: GLFW_KEY_WORLD_1, GLFW_KEY_WORLD_2 what are these?
|
|
default:return -1; // GLFW_KEY_UNKNOWN
|
|
};
|
|
},getModBits:function (win) {
|
|
var mod = 0;
|
|
if (win.keys[340]) mod |= 0x0001; // GLFW_MOD_SHIFT
|
|
if (win.keys[341]) mod |= 0x0002; // GLFW_MOD_CONTROL
|
|
if (win.keys[342]) mod |= 0x0004; // GLFW_MOD_ALT
|
|
if (win.keys[343]) mod |= 0x0008; // GLFW_MOD_SUPER
|
|
return mod;
|
|
},onKeyPress:function (event) {
|
|
if (!GLFW.active || !GLFW.active.charFunc) return;
|
|
|
|
// correct unicode charCode is only available with onKeyPress event
|
|
var charCode = event.charCode;
|
|
if (charCode == 0 || (charCode >= 0x00 && charCode <= 0x1F)) return;
|
|
|
|
|
|
Module['dynCall_vii'](GLFW.active.charFunc, GLFW.active.id, charCode);
|
|
},onKeyChanged:function (event, status) {
|
|
if (!GLFW.active) return;
|
|
|
|
var key = GLFW.DOMToGLFWKeyCode(event.keyCode);
|
|
if (key == -1) return;
|
|
|
|
var repeat = status && GLFW.active.keys[key];
|
|
GLFW.active.keys[key] = status;
|
|
if (!GLFW.active.keyFunc) return;
|
|
|
|
|
|
if (repeat) status = 2; // GLFW_REPEAT
|
|
Module['dynCall_viiiii'](GLFW.active.keyFunc, GLFW.active.id, key, event.keyCode, status, GLFW.getModBits(GLFW.active));
|
|
},onKeydown:function (event) {
|
|
GLFW.onKeyChanged(event, 1); // GLFW_PRESS or GLFW_REPEAT
|
|
|
|
// This logic comes directly from the sdl implementation. We cannot
|
|
// call preventDefault on all keydown events otherwise onKeyPress will
|
|
// not get called
|
|
if (event.keyCode === 8 /* backspace */ || event.keyCode === 9 /* tab */) {
|
|
event.preventDefault();
|
|
}
|
|
},onKeyup:function (event) {
|
|
GLFW.onKeyChanged(event, 0); // GLFW_RELEASE
|
|
},onMousemove:function (event) {
|
|
if (!GLFW.active) return;
|
|
|
|
Browser.calculateMouseEvent(event);
|
|
|
|
if (event.target != Module["canvas"] || !GLFW.active.cursorPosFunc) return;
|
|
|
|
|
|
Module['dynCall_vidd'](GLFW.active.cursorPosFunc, GLFW.active.id, Browser.mouseX, Browser.mouseY);
|
|
},DOMToGLFWMouseButton:function (event) {
|
|
// DOM and glfw have different button codes.
|
|
// See http://www.w3schools.com/jsref/event_button.asp.
|
|
var eventButton = event['button'];
|
|
if (eventButton > 0) {
|
|
if (eventButton == 1) {
|
|
eventButton = 2;
|
|
} else {
|
|
eventButton = 1;
|
|
}
|
|
}
|
|
return eventButton;
|
|
},onMouseenter:function (event) {
|
|
if (!GLFW.active) return;
|
|
|
|
if (event.target != Module["canvas"] || !GLFW.active.cursorEnterFunc) return;
|
|
|
|
Module['dynCall_vii'](GLFW.active.cursorEnterFunc, GLFW.active.id, 1);
|
|
},onMouseleave:function (event) {
|
|
if (!GLFW.active) return;
|
|
|
|
if (event.target != Module["canvas"] || !GLFW.active.cursorEnterFunc) return;
|
|
|
|
Module['dynCall_vii'](GLFW.active.cursorEnterFunc, GLFW.active.id, 0);
|
|
},onMouseButtonChanged:function (event, status) {
|
|
if (!GLFW.active) return;
|
|
|
|
Browser.calculateMouseEvent(event);
|
|
|
|
if (event.target != Module["canvas"]) return;
|
|
|
|
eventButton = GLFW.DOMToGLFWMouseButton(event);
|
|
|
|
if (status == 1) { // GLFW_PRESS
|
|
GLFW.active.buttons |= (1 << eventButton);
|
|
try {
|
|
event.target.setCapture();
|
|
} catch (e) {}
|
|
} else { // GLFW_RELEASE
|
|
GLFW.active.buttons &= ~(1 << eventButton);
|
|
}
|
|
|
|
if (!GLFW.active.mouseButtonFunc) return;
|
|
|
|
|
|
Module['dynCall_viiii'](GLFW.active.mouseButtonFunc, GLFW.active.id, eventButton, status, GLFW.getModBits(GLFW.active));
|
|
},onMouseButtonDown:function (event) {
|
|
if (!GLFW.active) return;
|
|
GLFW.onMouseButtonChanged(event, 1); // GLFW_PRESS
|
|
},onMouseButtonUp:function (event) {
|
|
if (!GLFW.active) return;
|
|
GLFW.onMouseButtonChanged(event, 0); // GLFW_RELEASE
|
|
},onMouseWheel:function (event) {
|
|
// Note the minus sign that flips browser wheel direction (positive direction scrolls page down) to native wheel direction (positive direction is mouse wheel up)
|
|
var delta = -Browser.getMouseWheelDelta(event);
|
|
delta = (delta == 0) ? 0 : (delta > 0 ? Math.max(delta, 1) : Math.min(delta, -1)); // Quantize to integer so that minimum scroll is at least +/- 1.
|
|
GLFW.wheelPos += delta;
|
|
|
|
if (!GLFW.active || !GLFW.active.scrollFunc || event.target != Module['canvas']) return;
|
|
|
|
|
|
var sx = 0;
|
|
var sy = 0;
|
|
if (event.type == 'mousewheel') {
|
|
sx = event.wheelDeltaX;
|
|
sy = event.wheelDeltaY;
|
|
} else {
|
|
sx = event.deltaX;
|
|
sy = event.deltaY;
|
|
}
|
|
|
|
Module['dynCall_vidd'](GLFW.active.scrollFunc, GLFW.active.id, sx, sy);
|
|
|
|
event.preventDefault();
|
|
},onCanvasResize:function (width, height) {
|
|
if (!GLFW.active) return;
|
|
|
|
var resizeNeeded = true;
|
|
|
|
// If the client is requestiong fullscreen mode
|
|
if (document["fullscreen"] || document["fullScreen"] || document["mozFullScreen"] || document["webkitIsFullScreen"]) {
|
|
GLFW.active.storedX = GLFW.active.x;
|
|
GLFW.active.storedY = GLFW.active.y;
|
|
GLFW.active.storedWidth = GLFW.active.width;
|
|
GLFW.active.storedHeight = GLFW.active.height;
|
|
GLFW.active.x = GLFW.active.y = 0;
|
|
GLFW.active.width = screen.width;
|
|
GLFW.active.height = screen.height;
|
|
GLFW.active.fullscreen = true;
|
|
|
|
// If the client is reverting from fullscreen mode
|
|
} else if (GLFW.active.fullscreen == true) {
|
|
GLFW.active.x = GLFW.active.storedX;
|
|
GLFW.active.y = GLFW.active.storedY;
|
|
GLFW.active.width = GLFW.active.storedWidth;
|
|
GLFW.active.height = GLFW.active.storedHeight;
|
|
GLFW.active.fullscreen = false;
|
|
|
|
// If the width/height values do not match current active window sizes
|
|
} else if (GLFW.active.width != width || GLFW.active.height != height) {
|
|
GLFW.active.width = width;
|
|
GLFW.active.height = height;
|
|
} else {
|
|
resizeNeeded = false;
|
|
}
|
|
|
|
// If any of the above conditions were true, we need to resize the canvas
|
|
if (resizeNeeded) {
|
|
// resets the canvas size to counter the aspect preservation of Browser.updateCanvasDimensions
|
|
Browser.setCanvasSize(GLFW.active.width, GLFW.active.height, true);
|
|
// TODO: Client dimensions (clientWidth/clientHeight) vs pixel dimensions (width/height) of
|
|
// the canvas should drive window and framebuffer size respectfully.
|
|
GLFW.onWindowSizeChanged();
|
|
GLFW.onFramebufferSizeChanged();
|
|
}
|
|
},onWindowSizeChanged:function () {
|
|
if (!GLFW.active) return;
|
|
|
|
if (!GLFW.active.windowSizeFunc) return;
|
|
|
|
|
|
Module['dynCall_viii'](GLFW.active.windowSizeFunc, GLFW.active.id, GLFW.active.width, GLFW.active.height);
|
|
},onFramebufferSizeChanged:function () {
|
|
if (!GLFW.active) return;
|
|
|
|
if (!GLFW.active.framebufferSizeFunc) return;
|
|
|
|
Module['dynCall_viii'](GLFW.active.framebufferSizeFunc, GLFW.active.id, GLFW.active.width, GLFW.active.height);
|
|
},requestFullscreen:function () {
|
|
var RFS = Module["canvas"]['requestFullscreen'] ||
|
|
Module["canvas"]['mozRequestFullScreen'] ||
|
|
Module["canvas"]['webkitRequestFullScreen'] ||
|
|
(function() {});
|
|
RFS.apply(Module["canvas"], []);
|
|
},requestFullScreen:function () {
|
|
Module.printErr('GLFW.requestFullScreen() is deprecated. Please call GLFW.requestFullscreen instead.');
|
|
GLFW.requestFullScreen = function() {
|
|
return GLFW.requestFullscreen();
|
|
}
|
|
return GLFW.requestFullscreen();
|
|
},exitFullscreen:function () {
|
|
var CFS = document['exitFullscreen'] ||
|
|
document['cancelFullScreen'] ||
|
|
document['mozCancelFullScreen'] ||
|
|
document['webkitCancelFullScreen'] ||
|
|
(function() {});
|
|
CFS.apply(document, []);
|
|
},cancelFullScreen:function () {
|
|
Module.printErr('GLFW.cancelFullScreen() is deprecated. Please call GLFW.exitFullscreen instead.');
|
|
GLFW.cancelFullScreen = function() {
|
|
return GLFW.exitFullscreen();
|
|
}
|
|
return GLFW.exitFullscreen();
|
|
},getTime:function () {
|
|
return _emscripten_get_now() / 1000;
|
|
},setWindowTitle:function (winid, title) {
|
|
var win = GLFW.WindowFromId(winid);
|
|
if (!win) return;
|
|
|
|
win.title = Pointer_stringify(title);
|
|
if (GLFW.active.id == win.id) {
|
|
document.title = win.title;
|
|
}
|
|
},setKeyCallback:function (winid, cbfun) {
|
|
var win = GLFW.WindowFromId(winid);
|
|
if (!win) return;
|
|
win.keyFunc = cbfun;
|
|
},setCharCallback:function (winid, cbfun) {
|
|
var win = GLFW.WindowFromId(winid);
|
|
if (!win) return;
|
|
win.charFunc = cbfun;
|
|
},setMouseButtonCallback:function (winid, cbfun) {
|
|
var win = GLFW.WindowFromId(winid);
|
|
if (!win) return;
|
|
win.mouseButtonFunc = cbfun;
|
|
},setCursorPosCallback:function (winid, cbfun) {
|
|
var win = GLFW.WindowFromId(winid);
|
|
if (!win) return;
|
|
win.cursorPosFunc = cbfun;
|
|
},setScrollCallback:function (winid, cbfun) {
|
|
var win = GLFW.WindowFromId(winid);
|
|
if (!win) return;
|
|
win.scrollFunc = cbfun;
|
|
},setWindowSizeCallback:function (winid, cbfun) {
|
|
var win = GLFW.WindowFromId(winid);
|
|
if (!win) return;
|
|
win.windowSizeFunc = cbfun;
|
|
|
|
},setWindowCloseCallback:function (winid, cbfun) {
|
|
var win = GLFW.WindowFromId(winid);
|
|
if (!win) return;
|
|
win.windowCloseFunc = cbfun;
|
|
},setWindowRefreshCallback:function (winid, cbfun) {
|
|
var win = GLFW.WindowFromId(winid);
|
|
if (!win) return;
|
|
win.windowRefreshFunc = cbfun;
|
|
},onClickRequestPointerLock:function (e) {
|
|
if (!Browser.pointerLock && Module['canvas'].requestPointerLock) {
|
|
Module['canvas'].requestPointerLock();
|
|
e.preventDefault();
|
|
}
|
|
},setInputMode:function (winid, mode, value) {
|
|
var win = GLFW.WindowFromId(winid);
|
|
if (!win) return;
|
|
|
|
switch(mode) {
|
|
case 0x00033001: { // GLFW_CURSOR
|
|
switch(value) {
|
|
case 0x00034001: { // GLFW_CURSOR_NORMAL
|
|
win.inputModes[mode] = value;
|
|
Module['canvas'].removeEventListener('click', GLFW.onClickRequestPointerLock, true);
|
|
Module['canvas'].exitPointerLock();
|
|
break;
|
|
}
|
|
case 0x00034002: { // GLFW_CURSOR_HIDDEN
|
|
console.log("glfwSetInputMode called with GLFW_CURSOR_HIDDEN value not implemented.");
|
|
break;
|
|
}
|
|
case 0x00034003: { // GLFW_CURSOR_DISABLED
|
|
win.inputModes[mode] = value;
|
|
Module['canvas'].addEventListener('click', GLFW.onClickRequestPointerLock, true);
|
|
Module['canvas'].requestPointerLock();
|
|
break;
|
|
}
|
|
default: {
|
|
console.log("glfwSetInputMode called with unknown value parameter value: " + value + ".");
|
|
break;
|
|
}
|
|
}
|
|
break;
|
|
}
|
|
case 0x00033002: { // GLFW_STICKY_KEYS
|
|
console.log("glfwSetInputMode called with GLFW_STICKY_KEYS mode not implemented.");
|
|
break;
|
|
}
|
|
case 0x00033003: { // GLFW_STICKY_MOUSE_BUTTONS
|
|
console.log("glfwSetInputMode called with GLFW_STICKY_MOUSE_BUTTONS mode not implemented.");
|
|
break;
|
|
}
|
|
default: {
|
|
console.log("glfwSetInputMode called with unknown mode parameter value: " + mode + ".");
|
|
break;
|
|
}
|
|
}
|
|
},getKey:function (winid, key) {
|
|
var win = GLFW.WindowFromId(winid);
|
|
if (!win) return 0;
|
|
return win.keys[key];
|
|
},getMouseButton:function (winid, button) {
|
|
var win = GLFW.WindowFromId(winid);
|
|
if (!win) return 0;
|
|
return (win.buttons & (1 << button)) > 0;
|
|
},getCursorPos:function (winid, x, y) {
|
|
setValue(x, Browser.mouseX, 'double');
|
|
setValue(y, Browser.mouseY, 'double');
|
|
},getMousePos:function (winid, x, y) {
|
|
setValue(x, Browser.mouseX, 'i32');
|
|
setValue(y, Browser.mouseY, 'i32');
|
|
},setCursorPos:function (winid, x, y) {
|
|
},getWindowPos:function (winid, x, y) {
|
|
var wx = 0;
|
|
var wy = 0;
|
|
|
|
var win = GLFW.WindowFromId(winid);
|
|
if (win) {
|
|
wx = win.x;
|
|
wy = win.y;
|
|
}
|
|
|
|
setValue(x, wx, 'i32');
|
|
setValue(y, wy, 'i32');
|
|
},setWindowPos:function (winid, x, y) {
|
|
var win = GLFW.WindowFromId(winid);
|
|
if (!win) return;
|
|
win.x = x;
|
|
win.y = y;
|
|
},getWindowSize:function (winid, width, height) {
|
|
var ww = 0;
|
|
var wh = 0;
|
|
|
|
var win = GLFW.WindowFromId(winid);
|
|
if (win) {
|
|
ww = win.width;
|
|
wh = win.height;
|
|
}
|
|
|
|
setValue(width, ww, 'i32');
|
|
setValue(height, wh, 'i32');
|
|
},setWindowSize:function (winid, width, height) {
|
|
var win = GLFW.WindowFromId(winid);
|
|
if (!win) return;
|
|
|
|
if (GLFW.active.id == win.id) {
|
|
if (width == screen.width && height == screen.height) {
|
|
GLFW.requestFullscreen();
|
|
} else {
|
|
GLFW.exitFullscreen();
|
|
Browser.setCanvasSize(width, height);
|
|
win.width = width;
|
|
win.height = height;
|
|
}
|
|
}
|
|
|
|
if (!win.windowSizeFunc) return;
|
|
|
|
|
|
Module['dynCall_viii'](win.windowSizeFunc, win.id, width, height);
|
|
},createWindow:function (width, height, title, monitor, share) {
|
|
var i, id;
|
|
for (i = 0; i < GLFW.windows.length && GLFW.windows[i] !== null; i++);
|
|
if (i > 0) throw "glfwCreateWindow only supports one window at time currently";
|
|
|
|
// id for window
|
|
id = i + 1;
|
|
|
|
// not valid
|
|
if (width <= 0 || height <= 0) return 0;
|
|
|
|
if (monitor) {
|
|
GLFW.requestFullscreen();
|
|
} else {
|
|
Browser.setCanvasSize(width, height);
|
|
}
|
|
|
|
// Create context when there are no existing alive windows
|
|
for (i = 0; i < GLFW.windows.length && GLFW.windows[i] == null; i++);
|
|
if (i == GLFW.windows.length) {
|
|
var contextAttributes = {
|
|
antialias: (GLFW.hints[0x0002100D] > 1), // GLFW_SAMPLES
|
|
depth: (GLFW.hints[0x00021005] > 0), // GLFW_DEPTH_BITS
|
|
stencil: (GLFW.hints[0x00021006] > 0), // GLFW_STENCIL_BITS
|
|
alpha: (GLFW.hints[0x00021004] > 0) // GLFW_ALPHA_BITS
|
|
}
|
|
Module.ctx = Browser.createContext(Module['canvas'], true, true, contextAttributes);
|
|
}
|
|
|
|
// If context creation failed, do not return a valid window
|
|
if (!Module.ctx) return 0;
|
|
|
|
// Get non alive id
|
|
var win = new GLFW.Window(id, width, height, title, monitor, share);
|
|
|
|
// Set window to array
|
|
if (id - 1 == GLFW.windows.length) {
|
|
GLFW.windows.push(win);
|
|
} else {
|
|
GLFW.windows[id - 1] = win;
|
|
}
|
|
|
|
GLFW.active = win;
|
|
return win.id;
|
|
},destroyWindow:function (winid) {
|
|
var win = GLFW.WindowFromId(winid);
|
|
if (!win) return;
|
|
|
|
if (win.windowCloseFunc)
|
|
Module['dynCall_vi'](win.windowCloseFunc, win.id);
|
|
|
|
GLFW.windows[win.id - 1] = null;
|
|
if (GLFW.active.id == win.id)
|
|
GLFW.active = null;
|
|
|
|
// Destroy context when no alive windows
|
|
for (var i = 0; i < GLFW.windows.length; i++)
|
|
if (GLFW.windows[i] !== null) return;
|
|
|
|
Module.ctx = Browser.destroyContext(Module['canvas'], true, true);
|
|
},swapBuffers:function (winid) {
|
|
},GLFW2ParamToGLFW3Param:function (param) {
|
|
table = {
|
|
0x00030001:0, // GLFW_MOUSE_CURSOR
|
|
0x00030002:0, // GLFW_STICKY_KEYS
|
|
0x00030003:0, // GLFW_STICKY_MOUSE_BUTTONS
|
|
0x00030004:0, // GLFW_SYSTEM_KEYS
|
|
0x00030005:0, // GLFW_KEY_REPEAT
|
|
0x00030006:0, // GLFW_AUTO_POLL_EVENTS
|
|
0x00020001:0, // GLFW_OPENED
|
|
0x00020002:0, // GLFW_ACTIVE
|
|
0x00020003:0, // GLFW_ICONIFIED
|
|
0x00020004:0, // GLFW_ACCELERATED
|
|
0x00020005:0x00021001, // GLFW_RED_BITS
|
|
0x00020006:0x00021002, // GLFW_GREEN_BITS
|
|
0x00020007:0x00021003, // GLFW_BLUE_BITS
|
|
0x00020008:0x00021004, // GLFW_ALPHA_BITS
|
|
0x00020009:0x00021005, // GLFW_DEPTH_BITS
|
|
0x0002000A:0x00021006, // GLFW_STENCIL_BITS
|
|
0x0002000B:0x0002100F, // GLFW_REFRESH_RATE
|
|
0x0002000C:0x00021007, // GLFW_ACCUM_RED_BITS
|
|
0x0002000D:0x00021008, // GLFW_ACCUM_GREEN_BITS
|
|
0x0002000E:0x00021009, // GLFW_ACCUM_BLUE_BITS
|
|
0x0002000F:0x0002100A, // GLFW_ACCUM_ALPHA_BITS
|
|
0x00020010:0x0002100B, // GLFW_AUX_BUFFERS
|
|
0x00020011:0x0002100C, // GLFW_STEREO
|
|
0x00020012:0, // GLFW_WINDOW_NO_RESIZE
|
|
0x00020013:0x0002100D, // GLFW_FSAA_SAMPLES
|
|
0x00020014:0x00022002, // GLFW_OPENGL_VERSION_MAJOR
|
|
0x00020015:0x00022003, // GLFW_OPENGL_VERSION_MINOR
|
|
0x00020016:0x00022006, // GLFW_OPENGL_FORWARD_COMPAT
|
|
0x00020017:0x00022007, // GLFW_OPENGL_DEBUG_CONTEXT
|
|
0x00020018:0x00022008, // GLFW_OPENGL_PROFILE
|
|
};
|
|
return table[param];
|
|
}};function _glfwGetVideoModes(monitor, count) {
|
|
setValue(count, 0, 'i32');
|
|
return 0;
|
|
}
|
|
|
|
function _glLinkProgram(program) {
|
|
GLctx.linkProgram(GL.programs[program]);
|
|
GL.programInfos[program] = null; // uniforms no longer keep the same names after linking
|
|
GL.populateUniformTable(program);
|
|
}
|
|
|
|
function _glBindTexture(target, texture) {
|
|
GLctx.bindTexture(target, texture ? GL.textures[texture] : null);
|
|
}
|
|
|
|
function _emscripten_glStencilFunc(x0, x1, x2) { GLctx['stencilFunc'](x0, x1, x2) }
|
|
|
|
function _glGetString(name_) {
|
|
if (GL.stringCache[name_]) return GL.stringCache[name_];
|
|
var ret;
|
|
switch(name_) {
|
|
case 0x1F00 /* GL_VENDOR */:
|
|
case 0x1F01 /* GL_RENDERER */:
|
|
case 0x9245 /* UNMASKED_VENDOR_WEBGL */:
|
|
case 0x9246 /* UNMASKED_RENDERER_WEBGL */:
|
|
ret = allocate(intArrayFromString(GLctx.getParameter(name_)), 'i8', ALLOC_NORMAL);
|
|
break;
|
|
case 0x1F02 /* GL_VERSION */:
|
|
var glVersion = GLctx.getParameter(GLctx.VERSION);
|
|
// return GLES version string corresponding to the version of the WebGL context
|
|
{
|
|
glVersion = 'OpenGL ES 2.0 (' + glVersion + ')';
|
|
}
|
|
ret = allocate(intArrayFromString(glVersion), 'i8', ALLOC_NORMAL);
|
|
break;
|
|
case 0x1F03 /* GL_EXTENSIONS */:
|
|
var exts = GLctx.getSupportedExtensions();
|
|
var gl_exts = [];
|
|
for (var i = 0; i < exts.length; ++i) {
|
|
gl_exts.push(exts[i]);
|
|
gl_exts.push("GL_" + exts[i]);
|
|
}
|
|
ret = allocate(intArrayFromString(gl_exts.join(' ')), 'i8', ALLOC_NORMAL);
|
|
break;
|
|
case 0x8B8C /* GL_SHADING_LANGUAGE_VERSION */:
|
|
var glslVersion = GLctx.getParameter(GLctx.SHADING_LANGUAGE_VERSION);
|
|
// extract the version number 'N.M' from the string 'WebGL GLSL ES N.M ...'
|
|
var ver_re = /^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/;
|
|
var ver_num = glslVersion.match(ver_re);
|
|
if (ver_num !== null) {
|
|
if (ver_num[1].length == 3) ver_num[1] = ver_num[1] + '0'; // ensure minor version has 2 digits
|
|
glslVersion = 'OpenGL ES GLSL ES ' + ver_num[1] + ' (' + glslVersion + ')';
|
|
}
|
|
ret = allocate(intArrayFromString(glslVersion), 'i8', ALLOC_NORMAL);
|
|
break;
|
|
default:
|
|
GL.recordError(0x0500/*GL_INVALID_ENUM*/);
|
|
return 0;
|
|
}
|
|
GL.stringCache[name_] = ret;
|
|
return ret;
|
|
}
|
|
|
|
function _emscripten_glUniform3iv(location, count, value) {
|
|
|
|
|
|
GLctx.uniform3iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*12)>>2));
|
|
}
|
|
|
|
function _emscripten_glShaderSource(shader, count, string, length) {
|
|
var source = GL.getSource(shader, count, string, length);
|
|
|
|
|
|
GLctx.shaderSource(GL.shaders[shader], source);
|
|
}
|
|
|
|
function _emscripten_glReleaseShaderCompiler() {
|
|
// NOP (as allowed by GLES 2.0 spec)
|
|
}
|
|
|
|
function _glDeleteProgram(id) {
|
|
if (!id) return;
|
|
var program = GL.programs[id];
|
|
if (!program) { // glDeleteProgram actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
|
|
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
GLctx.deleteProgram(program);
|
|
program.name = 0;
|
|
GL.programs[id] = null;
|
|
GL.programInfos[id] = null;
|
|
}
|
|
|
|
function _emscripten_glTexParameterf(x0, x1, x2) { GLctx['texParameterf'](x0, x1, x2) }
|
|
|
|
function _emscripten_glTexParameteri(x0, x1, x2) { GLctx['texParameteri'](x0, x1, x2) }
|
|
|
|
function _glCompileShader(shader) {
|
|
GLctx.compileShader(GL.shaders[shader]);
|
|
}
|
|
|
|
|
|
|
|
|
|
var ERRNO_CODES={EPERM:1,ENOENT:2,ESRCH:3,EINTR:4,EIO:5,ENXIO:6,E2BIG:7,ENOEXEC:8,EBADF:9,ECHILD:10,EAGAIN:11,EWOULDBLOCK:11,ENOMEM:12,EACCES:13,EFAULT:14,ENOTBLK:15,EBUSY:16,EEXIST:17,EXDEV:18,ENODEV:19,ENOTDIR:20,EISDIR:21,EINVAL:22,ENFILE:23,EMFILE:24,ENOTTY:25,ETXTBSY:26,EFBIG:27,ENOSPC:28,ESPIPE:29,EROFS:30,EMLINK:31,EPIPE:32,EDOM:33,ERANGE:34,ENOMSG:42,EIDRM:43,ECHRNG:44,EL2NSYNC:45,EL3HLT:46,EL3RST:47,ELNRNG:48,EUNATCH:49,ENOCSI:50,EL2HLT:51,EDEADLK:35,ENOLCK:37,EBADE:52,EBADR:53,EXFULL:54,ENOANO:55,EBADRQC:56,EBADSLT:57,EDEADLOCK:35,EBFONT:59,ENOSTR:60,ENODATA:61,ETIME:62,ENOSR:63,ENONET:64,ENOPKG:65,EREMOTE:66,ENOLINK:67,EADV:68,ESRMNT:69,ECOMM:70,EPROTO:71,EMULTIHOP:72,EDOTDOT:73,EBADMSG:74,ENOTUNIQ:76,EBADFD:77,EREMCHG:78,ELIBACC:79,ELIBBAD:80,ELIBSCN:81,ELIBMAX:82,ELIBEXEC:83,ENOSYS:38,ENOTEMPTY:39,ENAMETOOLONG:36,ELOOP:40,EOPNOTSUPP:95,EPFNOSUPPORT:96,ECONNRESET:104,ENOBUFS:105,EAFNOSUPPORT:97,EPROTOTYPE:91,ENOTSOCK:88,ENOPROTOOPT:92,ESHUTDOWN:108,ECONNREFUSED:111,EADDRINUSE:98,ECONNABORTED:103,ENETUNREACH:101,ENETDOWN:100,ETIMEDOUT:110,EHOSTDOWN:112,EHOSTUNREACH:113,EINPROGRESS:115,EALREADY:114,EDESTADDRREQ:89,EMSGSIZE:90,EPROTONOSUPPORT:93,ESOCKTNOSUPPORT:94,EADDRNOTAVAIL:99,ENETRESET:102,EISCONN:106,ENOTCONN:107,ETOOMANYREFS:109,EUSERS:87,EDQUOT:122,ESTALE:116,ENOTSUP:95,ENOMEDIUM:123,EILSEQ:84,EOVERFLOW:75,ECANCELED:125,ENOTRECOVERABLE:131,EOWNERDEAD:130,ESTRPIPE:86};
|
|
|
|
var ERRNO_MESSAGES={0:"Success",1:"Not super-user",2:"No such file or directory",3:"No such process",4:"Interrupted system call",5:"I/O error",6:"No such device or address",7:"Arg list too long",8:"Exec format error",9:"Bad file number",10:"No children",11:"No more processes",12:"Not enough core",13:"Permission denied",14:"Bad address",15:"Block device required",16:"Mount device busy",17:"File exists",18:"Cross-device link",19:"No such device",20:"Not a directory",21:"Is a directory",22:"Invalid argument",23:"Too many open files in system",24:"Too many open files",25:"Not a typewriter",26:"Text file busy",27:"File too large",28:"No space left on device",29:"Illegal seek",30:"Read only file system",31:"Too many links",32:"Broken pipe",33:"Math arg out of domain of func",34:"Math result not representable",35:"File locking deadlock error",36:"File or path name too long",37:"No record locks available",38:"Function not implemented",39:"Directory not empty",40:"Too many symbolic links",42:"No message of desired type",43:"Identifier removed",44:"Channel number out of range",45:"Level 2 not synchronized",46:"Level 3 halted",47:"Level 3 reset",48:"Link number out of range",49:"Protocol driver not attached",50:"No CSI structure available",51:"Level 2 halted",52:"Invalid exchange",53:"Invalid request descriptor",54:"Exchange full",55:"No anode",56:"Invalid request code",57:"Invalid slot",59:"Bad font file fmt",60:"Device not a stream",61:"No data (for no delay io)",62:"Timer expired",63:"Out of streams resources",64:"Machine is not on the network",65:"Package not installed",66:"The object is remote",67:"The link has been severed",68:"Advertise error",69:"Srmount error",70:"Communication error on send",71:"Protocol error",72:"Multihop attempted",73:"Cross mount point (not really error)",74:"Trying to read unreadable message",75:"Value too large for defined data type",76:"Given log. name not unique",77:"f.d. invalid for this operation",78:"Remote address changed",79:"Can access a needed shared lib",80:"Accessing a corrupted shared lib",81:".lib section in a.out corrupted",82:"Attempting to link in too many libs",83:"Attempting to exec a shared library",84:"Illegal byte sequence",86:"Streams pipe error",87:"Too many users",88:"Socket operation on non-socket",89:"Destination address required",90:"Message too long",91:"Protocol wrong type for socket",92:"Protocol not available",93:"Unknown protocol",94:"Socket type not supported",95:"Not supported",96:"Protocol family not supported",97:"Address family not supported by protocol family",98:"Address already in use",99:"Address not available",100:"Network interface is not configured",101:"Network is unreachable",102:"Connection reset by network",103:"Connection aborted",104:"Connection reset by peer",105:"No buffer space available",106:"Socket is already connected",107:"Socket is not connected",108:"Can't send after socket shutdown",109:"Too many references",110:"Connection timed out",111:"Connection refused",112:"Host is down",113:"Host is unreachable",114:"Socket already connected",115:"Connection already in progress",116:"Stale file handle",122:"Quota exceeded",123:"No medium (in tape drive)",125:"Operation canceled",130:"Previous owner died",131:"State not recoverable"};
|
|
|
|
function ___setErrNo(value) {
|
|
if (Module['___errno_location']) HEAP32[((Module['___errno_location']())>>2)]=value;
|
|
else Module.printErr('failed to set errno from JS');
|
|
return value;
|
|
}
|
|
|
|
var PATH={splitPath:function (filename) {
|
|
var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;
|
|
return splitPathRe.exec(filename).slice(1);
|
|
},normalizeArray:function (parts, allowAboveRoot) {
|
|
// if the path tries to go above the root, `up` ends up > 0
|
|
var up = 0;
|
|
for (var i = parts.length - 1; i >= 0; i--) {
|
|
var last = parts[i];
|
|
if (last === '.') {
|
|
parts.splice(i, 1);
|
|
} else if (last === '..') {
|
|
parts.splice(i, 1);
|
|
up++;
|
|
} else if (up) {
|
|
parts.splice(i, 1);
|
|
up--;
|
|
}
|
|
}
|
|
// if the path is allowed to go above the root, restore leading ..s
|
|
if (allowAboveRoot) {
|
|
for (; up--; up) {
|
|
parts.unshift('..');
|
|
}
|
|
}
|
|
return parts;
|
|
},normalize:function (path) {
|
|
var isAbsolute = path.charAt(0) === '/',
|
|
trailingSlash = path.substr(-1) === '/';
|
|
// Normalize the path
|
|
path = PATH.normalizeArray(path.split('/').filter(function(p) {
|
|
return !!p;
|
|
}), !isAbsolute).join('/');
|
|
if (!path && !isAbsolute) {
|
|
path = '.';
|
|
}
|
|
if (path && trailingSlash) {
|
|
path += '/';
|
|
}
|
|
return (isAbsolute ? '/' : '') + path;
|
|
},dirname:function (path) {
|
|
var result = PATH.splitPath(path),
|
|
root = result[0],
|
|
dir = result[1];
|
|
if (!root && !dir) {
|
|
// No dirname whatsoever
|
|
return '.';
|
|
}
|
|
if (dir) {
|
|
// It has a dirname, strip trailing slash
|
|
dir = dir.substr(0, dir.length - 1);
|
|
}
|
|
return root + dir;
|
|
},basename:function (path) {
|
|
// EMSCRIPTEN return '/'' for '/', not an empty string
|
|
if (path === '/') return '/';
|
|
var lastSlash = path.lastIndexOf('/');
|
|
if (lastSlash === -1) return path;
|
|
return path.substr(lastSlash+1);
|
|
},extname:function (path) {
|
|
return PATH.splitPath(path)[3];
|
|
},join:function () {
|
|
var paths = Array.prototype.slice.call(arguments, 0);
|
|
return PATH.normalize(paths.join('/'));
|
|
},join2:function (l, r) {
|
|
return PATH.normalize(l + '/' + r);
|
|
},resolve:function () {
|
|
var resolvedPath = '',
|
|
resolvedAbsolute = false;
|
|
for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) {
|
|
var path = (i >= 0) ? arguments[i] : FS.cwd();
|
|
// Skip empty and invalid entries
|
|
if (typeof path !== 'string') {
|
|
throw new TypeError('Arguments to path.resolve must be strings');
|
|
} else if (!path) {
|
|
return ''; // an invalid portion invalidates the whole thing
|
|
}
|
|
resolvedPath = path + '/' + resolvedPath;
|
|
resolvedAbsolute = path.charAt(0) === '/';
|
|
}
|
|
// At this point the path should be resolved to a full absolute path, but
|
|
// handle relative paths to be safe (might happen when process.cwd() fails)
|
|
resolvedPath = PATH.normalizeArray(resolvedPath.split('/').filter(function(p) {
|
|
return !!p;
|
|
}), !resolvedAbsolute).join('/');
|
|
return ((resolvedAbsolute ? '/' : '') + resolvedPath) || '.';
|
|
},relative:function (from, to) {
|
|
from = PATH.resolve(from).substr(1);
|
|
to = PATH.resolve(to).substr(1);
|
|
function trim(arr) {
|
|
var start = 0;
|
|
for (; start < arr.length; start++) {
|
|
if (arr[start] !== '') break;
|
|
}
|
|
var end = arr.length - 1;
|
|
for (; end >= 0; end--) {
|
|
if (arr[end] !== '') break;
|
|
}
|
|
if (start > end) return [];
|
|
return arr.slice(start, end - start + 1);
|
|
}
|
|
var fromParts = trim(from.split('/'));
|
|
var toParts = trim(to.split('/'));
|
|
var length = Math.min(fromParts.length, toParts.length);
|
|
var samePartsLength = length;
|
|
for (var i = 0; i < length; i++) {
|
|
if (fromParts[i] !== toParts[i]) {
|
|
samePartsLength = i;
|
|
break;
|
|
}
|
|
}
|
|
var outputParts = [];
|
|
for (var i = samePartsLength; i < fromParts.length; i++) {
|
|
outputParts.push('..');
|
|
}
|
|
outputParts = outputParts.concat(toParts.slice(samePartsLength));
|
|
return outputParts.join('/');
|
|
}};
|
|
|
|
var TTY={ttys:[],init:function () {
|
|
// https://github.com/kripken/emscripten/pull/1555
|
|
// if (ENVIRONMENT_IS_NODE) {
|
|
// // currently, FS.init does not distinguish if process.stdin is a file or TTY
|
|
// // device, it always assumes it's a TTY device. because of this, we're forcing
|
|
// // process.stdin to UTF8 encoding to at least make stdin reading compatible
|
|
// // with text files until FS.init can be refactored.
|
|
// process['stdin']['setEncoding']('utf8');
|
|
// }
|
|
},shutdown:function () {
|
|
// https://github.com/kripken/emscripten/pull/1555
|
|
// if (ENVIRONMENT_IS_NODE) {
|
|
// // inolen: any idea as to why node -e 'process.stdin.read()' wouldn't exit immediately (with process.stdin being a tty)?
|
|
// // isaacs: because now it's reading from the stream, you've expressed interest in it, so that read() kicks off a _read() which creates a ReadReq operation
|
|
// // inolen: I thought read() in that case was a synchronous operation that just grabbed some amount of buffered data if it exists?
|
|
// // isaacs: it is. but it also triggers a _read() call, which calls readStart() on the handle
|
|
// // isaacs: do process.stdin.pause() and i'd think it'd probably close the pending call
|
|
// process['stdin']['pause']();
|
|
// }
|
|
},register:function (dev, ops) {
|
|
TTY.ttys[dev] = { input: [], output: [], ops: ops };
|
|
FS.registerDevice(dev, TTY.stream_ops);
|
|
},stream_ops:{open:function (stream) {
|
|
var tty = TTY.ttys[stream.node.rdev];
|
|
if (!tty) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
|
|
}
|
|
stream.tty = tty;
|
|
stream.seekable = false;
|
|
},close:function (stream) {
|
|
// flush any pending line data
|
|
stream.tty.ops.flush(stream.tty);
|
|
},flush:function (stream) {
|
|
stream.tty.ops.flush(stream.tty);
|
|
},read:function (stream, buffer, offset, length, pos /* ignored */) {
|
|
if (!stream.tty || !stream.tty.ops.get_char) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENXIO);
|
|
}
|
|
var bytesRead = 0;
|
|
for (var i = 0; i < length; i++) {
|
|
var result;
|
|
try {
|
|
result = stream.tty.ops.get_char(stream.tty);
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO);
|
|
}
|
|
if (result === undefined && bytesRead === 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
|
|
}
|
|
if (result === null || result === undefined) break;
|
|
bytesRead++;
|
|
buffer[offset+i] = result;
|
|
}
|
|
if (bytesRead) {
|
|
stream.node.timestamp = Date.now();
|
|
}
|
|
return bytesRead;
|
|
},write:function (stream, buffer, offset, length, pos) {
|
|
if (!stream.tty || !stream.tty.ops.put_char) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENXIO);
|
|
}
|
|
for (var i = 0; i < length; i++) {
|
|
try {
|
|
stream.tty.ops.put_char(stream.tty, buffer[offset+i]);
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO);
|
|
}
|
|
}
|
|
if (length) {
|
|
stream.node.timestamp = Date.now();
|
|
}
|
|
return i;
|
|
}},default_tty_ops:{get_char:function (tty) {
|
|
if (!tty.input.length) {
|
|
var result = null;
|
|
if (ENVIRONMENT_IS_NODE) {
|
|
// we will read data by chunks of BUFSIZE
|
|
var BUFSIZE = 256;
|
|
var buf = new Buffer(BUFSIZE);
|
|
var bytesRead = 0;
|
|
|
|
var isPosixPlatform = (process.platform != 'win32'); // Node doesn't offer a direct check, so test by exclusion
|
|
|
|
var fd = process.stdin.fd;
|
|
if (isPosixPlatform) {
|
|
// Linux and Mac cannot use process.stdin.fd (which isn't set up as sync)
|
|
var usingDevice = false;
|
|
try {
|
|
fd = fs.openSync('/dev/stdin', 'r');
|
|
usingDevice = true;
|
|
} catch (e) {}
|
|
}
|
|
|
|
try {
|
|
bytesRead = fs.readSync(fd, buf, 0, BUFSIZE, null);
|
|
} catch(e) {
|
|
// Cross-platform differences: on Windows, reading EOF throws an exception, but on other OSes,
|
|
// reading EOF returns 0. Uniformize behavior by treating the EOF exception to return 0.
|
|
if (e.toString().indexOf('EOF') != -1) bytesRead = 0;
|
|
else throw e;
|
|
}
|
|
|
|
if (usingDevice) { fs.closeSync(fd); }
|
|
if (bytesRead > 0) {
|
|
result = buf.slice(0, bytesRead).toString('utf-8');
|
|
} else {
|
|
result = null;
|
|
}
|
|
|
|
} else if (typeof window != 'undefined' &&
|
|
typeof window.prompt == 'function') {
|
|
// Browser.
|
|
result = window.prompt('Input: '); // returns null on cancel
|
|
if (result !== null) {
|
|
result += '\n';
|
|
}
|
|
} else if (typeof readline == 'function') {
|
|
// Command line.
|
|
result = readline();
|
|
if (result !== null) {
|
|
result += '\n';
|
|
}
|
|
}
|
|
if (!result) {
|
|
return null;
|
|
}
|
|
tty.input = intArrayFromString(result, true);
|
|
}
|
|
return tty.input.shift();
|
|
},put_char:function (tty, val) {
|
|
if (val === null || val === 10) {
|
|
Module['print'](UTF8ArrayToString(tty.output, 0));
|
|
tty.output = [];
|
|
} else {
|
|
if (val != 0) tty.output.push(val); // val == 0 would cut text output off in the middle.
|
|
}
|
|
},flush:function (tty) {
|
|
if (tty.output && tty.output.length > 0) {
|
|
Module['print'](UTF8ArrayToString(tty.output, 0));
|
|
tty.output = [];
|
|
}
|
|
}},default_tty1_ops:{put_char:function (tty, val) {
|
|
if (val === null || val === 10) {
|
|
Module['printErr'](UTF8ArrayToString(tty.output, 0));
|
|
tty.output = [];
|
|
} else {
|
|
if (val != 0) tty.output.push(val);
|
|
}
|
|
},flush:function (tty) {
|
|
if (tty.output && tty.output.length > 0) {
|
|
Module['printErr'](UTF8ArrayToString(tty.output, 0));
|
|
tty.output = [];
|
|
}
|
|
}}};
|
|
|
|
var MEMFS={ops_table:null,mount:function (mount) {
|
|
return MEMFS.createNode(null, '/', 16384 | 511 /* 0777 */, 0);
|
|
},createNode:function (parent, name, mode, dev) {
|
|
if (FS.isBlkdev(mode) || FS.isFIFO(mode)) {
|
|
// no supported
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
}
|
|
if (!MEMFS.ops_table) {
|
|
MEMFS.ops_table = {
|
|
dir: {
|
|
node: {
|
|
getattr: MEMFS.node_ops.getattr,
|
|
setattr: MEMFS.node_ops.setattr,
|
|
lookup: MEMFS.node_ops.lookup,
|
|
mknod: MEMFS.node_ops.mknod,
|
|
rename: MEMFS.node_ops.rename,
|
|
unlink: MEMFS.node_ops.unlink,
|
|
rmdir: MEMFS.node_ops.rmdir,
|
|
readdir: MEMFS.node_ops.readdir,
|
|
symlink: MEMFS.node_ops.symlink
|
|
},
|
|
stream: {
|
|
llseek: MEMFS.stream_ops.llseek
|
|
}
|
|
},
|
|
file: {
|
|
node: {
|
|
getattr: MEMFS.node_ops.getattr,
|
|
setattr: MEMFS.node_ops.setattr
|
|
},
|
|
stream: {
|
|
llseek: MEMFS.stream_ops.llseek,
|
|
read: MEMFS.stream_ops.read,
|
|
write: MEMFS.stream_ops.write,
|
|
allocate: MEMFS.stream_ops.allocate,
|
|
mmap: MEMFS.stream_ops.mmap,
|
|
msync: MEMFS.stream_ops.msync
|
|
}
|
|
},
|
|
link: {
|
|
node: {
|
|
getattr: MEMFS.node_ops.getattr,
|
|
setattr: MEMFS.node_ops.setattr,
|
|
readlink: MEMFS.node_ops.readlink
|
|
},
|
|
stream: {}
|
|
},
|
|
chrdev: {
|
|
node: {
|
|
getattr: MEMFS.node_ops.getattr,
|
|
setattr: MEMFS.node_ops.setattr
|
|
},
|
|
stream: FS.chrdev_stream_ops
|
|
}
|
|
};
|
|
}
|
|
var node = FS.createNode(parent, name, mode, dev);
|
|
if (FS.isDir(node.mode)) {
|
|
node.node_ops = MEMFS.ops_table.dir.node;
|
|
node.stream_ops = MEMFS.ops_table.dir.stream;
|
|
node.contents = {};
|
|
} else if (FS.isFile(node.mode)) {
|
|
node.node_ops = MEMFS.ops_table.file.node;
|
|
node.stream_ops = MEMFS.ops_table.file.stream;
|
|
node.usedBytes = 0; // The actual number of bytes used in the typed array, as opposed to contents.length which gives the whole capacity.
|
|
// When the byte data of the file is populated, this will point to either a typed array, or a normal JS array. Typed arrays are preferred
|
|
// for performance, and used by default. However, typed arrays are not resizable like normal JS arrays are, so there is a small disk size
|
|
// penalty involved for appending file writes that continuously grow a file similar to std::vector capacity vs used -scheme.
|
|
node.contents = null;
|
|
} else if (FS.isLink(node.mode)) {
|
|
node.node_ops = MEMFS.ops_table.link.node;
|
|
node.stream_ops = MEMFS.ops_table.link.stream;
|
|
} else if (FS.isChrdev(node.mode)) {
|
|
node.node_ops = MEMFS.ops_table.chrdev.node;
|
|
node.stream_ops = MEMFS.ops_table.chrdev.stream;
|
|
}
|
|
node.timestamp = Date.now();
|
|
// add the new node to the parent
|
|
if (parent) {
|
|
parent.contents[name] = node;
|
|
}
|
|
return node;
|
|
},getFileDataAsRegularArray:function (node) {
|
|
if (node.contents && node.contents.subarray) {
|
|
var arr = [];
|
|
for (var i = 0; i < node.usedBytes; ++i) arr.push(node.contents[i]);
|
|
return arr; // Returns a copy of the original data.
|
|
}
|
|
return node.contents; // No-op, the file contents are already in a JS array. Return as-is.
|
|
},getFileDataAsTypedArray:function (node) {
|
|
if (!node.contents) return new Uint8Array;
|
|
if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); // Make sure to not return excess unused bytes.
|
|
return new Uint8Array(node.contents);
|
|
},expandFileStorage:function (node, newCapacity) {
|
|
// If we are asked to expand the size of a file that already exists, revert to using a standard JS array to store the file
|
|
// instead of a typed array. This makes resizing the array more flexible because we can just .push() elements at the back to
|
|
// increase the size.
|
|
if (node.contents && node.contents.subarray && newCapacity > node.contents.length) {
|
|
node.contents = MEMFS.getFileDataAsRegularArray(node);
|
|
node.usedBytes = node.contents.length; // We might be writing to a lazy-loaded file which had overridden this property, so force-reset it.
|
|
}
|
|
|
|
if (!node.contents || node.contents.subarray) { // Keep using a typed array if creating a new storage, or if old one was a typed array as well.
|
|
var prevCapacity = node.contents ? node.contents.length : 0;
|
|
if (prevCapacity >= newCapacity) return; // No need to expand, the storage was already large enough.
|
|
// Don't expand strictly to the given requested limit if it's only a very small increase, but instead geometrically grow capacity.
|
|
// For small filesizes (<1MB), perform size*2 geometric increase, but for large sizes, do a much more conservative size*1.125 increase to
|
|
// avoid overshooting the allocation cap by a very large margin.
|
|
var CAPACITY_DOUBLING_MAX = 1024 * 1024;
|
|
newCapacity = Math.max(newCapacity, (prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2.0 : 1.125)) | 0);
|
|
if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); // At minimum allocate 256b for each file when expanding.
|
|
var oldContents = node.contents;
|
|
node.contents = new Uint8Array(newCapacity); // Allocate new storage.
|
|
if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0); // Copy old data over to the new storage.
|
|
return;
|
|
}
|
|
// Not using a typed array to back the file storage. Use a standard JS array instead.
|
|
if (!node.contents && newCapacity > 0) node.contents = [];
|
|
while (node.contents.length < newCapacity) node.contents.push(0);
|
|
},resizeFileStorage:function (node, newSize) {
|
|
if (node.usedBytes == newSize) return;
|
|
if (newSize == 0) {
|
|
node.contents = null; // Fully decommit when requesting a resize to zero.
|
|
node.usedBytes = 0;
|
|
return;
|
|
}
|
|
if (!node.contents || node.contents.subarray) { // Resize a typed array if that is being used as the backing store.
|
|
var oldContents = node.contents;
|
|
node.contents = new Uint8Array(new ArrayBuffer(newSize)); // Allocate new storage.
|
|
if (oldContents) {
|
|
node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))); // Copy old data over to the new storage.
|
|
}
|
|
node.usedBytes = newSize;
|
|
return;
|
|
}
|
|
// Backing with a JS array.
|
|
if (!node.contents) node.contents = [];
|
|
if (node.contents.length > newSize) node.contents.length = newSize;
|
|
else while (node.contents.length < newSize) node.contents.push(0);
|
|
node.usedBytes = newSize;
|
|
},node_ops:{getattr:function (node) {
|
|
var attr = {};
|
|
// device numbers reuse inode numbers.
|
|
attr.dev = FS.isChrdev(node.mode) ? node.id : 1;
|
|
attr.ino = node.id;
|
|
attr.mode = node.mode;
|
|
attr.nlink = 1;
|
|
attr.uid = 0;
|
|
attr.gid = 0;
|
|
attr.rdev = node.rdev;
|
|
if (FS.isDir(node.mode)) {
|
|
attr.size = 4096;
|
|
} else if (FS.isFile(node.mode)) {
|
|
attr.size = node.usedBytes;
|
|
} else if (FS.isLink(node.mode)) {
|
|
attr.size = node.link.length;
|
|
} else {
|
|
attr.size = 0;
|
|
}
|
|
attr.atime = new Date(node.timestamp);
|
|
attr.mtime = new Date(node.timestamp);
|
|
attr.ctime = new Date(node.timestamp);
|
|
// NOTE: In our implementation, st_blocks = Math.ceil(st_size/st_blksize),
|
|
// but this is not required by the standard.
|
|
attr.blksize = 4096;
|
|
attr.blocks = Math.ceil(attr.size / attr.blksize);
|
|
return attr;
|
|
},setattr:function (node, attr) {
|
|
if (attr.mode !== undefined) {
|
|
node.mode = attr.mode;
|
|
}
|
|
if (attr.timestamp !== undefined) {
|
|
node.timestamp = attr.timestamp;
|
|
}
|
|
if (attr.size !== undefined) {
|
|
MEMFS.resizeFileStorage(node, attr.size);
|
|
}
|
|
},lookup:function (parent, name) {
|
|
throw FS.genericErrors[ERRNO_CODES.ENOENT];
|
|
},mknod:function (parent, name, mode, dev) {
|
|
return MEMFS.createNode(parent, name, mode, dev);
|
|
},rename:function (old_node, new_dir, new_name) {
|
|
// if we're overwriting a directory at new_name, make sure it's empty.
|
|
if (FS.isDir(old_node.mode)) {
|
|
var new_node;
|
|
try {
|
|
new_node = FS.lookupNode(new_dir, new_name);
|
|
} catch (e) {
|
|
}
|
|
if (new_node) {
|
|
for (var i in new_node.contents) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
|
|
}
|
|
}
|
|
}
|
|
// do the internal rewiring
|
|
delete old_node.parent.contents[old_node.name];
|
|
old_node.name = new_name;
|
|
new_dir.contents[new_name] = old_node;
|
|
old_node.parent = new_dir;
|
|
},unlink:function (parent, name) {
|
|
delete parent.contents[name];
|
|
},rmdir:function (parent, name) {
|
|
var node = FS.lookupNode(parent, name);
|
|
for (var i in node.contents) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
|
|
}
|
|
delete parent.contents[name];
|
|
},readdir:function (node) {
|
|
var entries = ['.', '..']
|
|
for (var key in node.contents) {
|
|
if (!node.contents.hasOwnProperty(key)) {
|
|
continue;
|
|
}
|
|
entries.push(key);
|
|
}
|
|
return entries;
|
|
},symlink:function (parent, newname, oldpath) {
|
|
var node = MEMFS.createNode(parent, newname, 511 /* 0777 */ | 40960, 0);
|
|
node.link = oldpath;
|
|
return node;
|
|
},readlink:function (node) {
|
|
if (!FS.isLink(node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
return node.link;
|
|
}},stream_ops:{read:function (stream, buffer, offset, length, position) {
|
|
var contents = stream.node.contents;
|
|
if (position >= stream.node.usedBytes) return 0;
|
|
var size = Math.min(stream.node.usedBytes - position, length);
|
|
assert(size >= 0);
|
|
if (size > 8 && contents.subarray) { // non-trivial, and typed array
|
|
buffer.set(contents.subarray(position, position + size), offset);
|
|
} else {
|
|
for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i];
|
|
}
|
|
return size;
|
|
},write:function (stream, buffer, offset, length, position, canOwn) {
|
|
if (!length) return 0;
|
|
var node = stream.node;
|
|
node.timestamp = Date.now();
|
|
|
|
if (buffer.subarray && (!node.contents || node.contents.subarray)) { // This write is from a typed array to a typed array?
|
|
if (canOwn) {
|
|
assert(position === 0, 'canOwn must imply no weird position inside the file');
|
|
node.contents = buffer.subarray(offset, offset + length);
|
|
node.usedBytes = length;
|
|
return length;
|
|
} else if (node.usedBytes === 0 && position === 0) { // If this is a simple first write to an empty file, do a fast set since we don't need to care about old data.
|
|
node.contents = new Uint8Array(buffer.subarray(offset, offset + length));
|
|
node.usedBytes = length;
|
|
return length;
|
|
} else if (position + length <= node.usedBytes) { // Writing to an already allocated and used subrange of the file?
|
|
node.contents.set(buffer.subarray(offset, offset + length), position);
|
|
return length;
|
|
}
|
|
}
|
|
|
|
// Appending to an existing file and we need to reallocate, or source data did not come as a typed array.
|
|
MEMFS.expandFileStorage(node, position+length);
|
|
if (node.contents.subarray && buffer.subarray) node.contents.set(buffer.subarray(offset, offset + length), position); // Use typed array write if available.
|
|
else {
|
|
for (var i = 0; i < length; i++) {
|
|
node.contents[position + i] = buffer[offset + i]; // Or fall back to manual write if not.
|
|
}
|
|
}
|
|
node.usedBytes = Math.max(node.usedBytes, position+length);
|
|
return length;
|
|
},llseek:function (stream, offset, whence) {
|
|
var position = offset;
|
|
if (whence === 1) { // SEEK_CUR.
|
|
position += stream.position;
|
|
} else if (whence === 2) { // SEEK_END.
|
|
if (FS.isFile(stream.node.mode)) {
|
|
position += stream.node.usedBytes;
|
|
}
|
|
}
|
|
if (position < 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
return position;
|
|
},allocate:function (stream, offset, length) {
|
|
MEMFS.expandFileStorage(stream.node, offset + length);
|
|
stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length);
|
|
},mmap:function (stream, buffer, offset, length, position, prot, flags) {
|
|
if (!FS.isFile(stream.node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
|
|
}
|
|
var ptr;
|
|
var allocated;
|
|
var contents = stream.node.contents;
|
|
// Only make a new copy when MAP_PRIVATE is specified.
|
|
if ( !(flags & 2) &&
|
|
(contents.buffer === buffer || contents.buffer === buffer.buffer) ) {
|
|
// We can't emulate MAP_SHARED when the file is not backed by the buffer
|
|
// we're mapping to (e.g. the HEAP buffer).
|
|
allocated = false;
|
|
ptr = contents.byteOffset;
|
|
} else {
|
|
// Try to avoid unnecessary slices.
|
|
if (position > 0 || position + length < stream.node.usedBytes) {
|
|
if (contents.subarray) {
|
|
contents = contents.subarray(position, position + length);
|
|
} else {
|
|
contents = Array.prototype.slice.call(contents, position, position + length);
|
|
}
|
|
}
|
|
allocated = true;
|
|
ptr = _malloc(length);
|
|
if (!ptr) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOMEM);
|
|
}
|
|
buffer.set(contents, ptr);
|
|
}
|
|
return { ptr: ptr, allocated: allocated };
|
|
},msync:function (stream, buffer, offset, length, mmapFlags) {
|
|
if (!FS.isFile(stream.node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
|
|
}
|
|
if (mmapFlags & 2) {
|
|
// MAP_PRIVATE calls need not to be synced back to underlying fs
|
|
return 0;
|
|
}
|
|
|
|
var bytesWritten = MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false);
|
|
// should we check if bytesWritten and length are the same?
|
|
return 0;
|
|
}}};
|
|
|
|
var IDBFS={dbs:{},indexedDB:function () {
|
|
if (typeof indexedDB !== 'undefined') return indexedDB;
|
|
var ret = null;
|
|
if (typeof window === 'object') ret = window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
|
|
assert(ret, 'IDBFS used, but indexedDB not supported');
|
|
return ret;
|
|
},DB_VERSION:21,DB_STORE_NAME:"FILE_DATA",mount:function (mount) {
|
|
// reuse all of the core MEMFS functionality
|
|
return MEMFS.mount.apply(null, arguments);
|
|
},syncfs:function (mount, populate, callback) {
|
|
IDBFS.getLocalSet(mount, function(err, local) {
|
|
if (err) return callback(err);
|
|
|
|
IDBFS.getRemoteSet(mount, function(err, remote) {
|
|
if (err) return callback(err);
|
|
|
|
var src = populate ? remote : local;
|
|
var dst = populate ? local : remote;
|
|
|
|
IDBFS.reconcile(src, dst, callback);
|
|
});
|
|
});
|
|
},getDB:function (name, callback) {
|
|
// check the cache first
|
|
var db = IDBFS.dbs[name];
|
|
if (db) {
|
|
return callback(null, db);
|
|
}
|
|
|
|
var req;
|
|
try {
|
|
req = IDBFS.indexedDB().open(name, IDBFS.DB_VERSION);
|
|
} catch (e) {
|
|
return callback(e);
|
|
}
|
|
if (!req) {
|
|
return callback("Unable to connect to IndexedDB");
|
|
}
|
|
req.onupgradeneeded = function(e) {
|
|
var db = e.target.result;
|
|
var transaction = e.target.transaction;
|
|
|
|
var fileStore;
|
|
|
|
if (db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)) {
|
|
fileStore = transaction.objectStore(IDBFS.DB_STORE_NAME);
|
|
} else {
|
|
fileStore = db.createObjectStore(IDBFS.DB_STORE_NAME);
|
|
}
|
|
|
|
if (!fileStore.indexNames.contains('timestamp')) {
|
|
fileStore.createIndex('timestamp', 'timestamp', { unique: false });
|
|
}
|
|
};
|
|
req.onsuccess = function() {
|
|
db = req.result;
|
|
|
|
// add to the cache
|
|
IDBFS.dbs[name] = db;
|
|
callback(null, db);
|
|
};
|
|
req.onerror = function(e) {
|
|
callback(this.error);
|
|
e.preventDefault();
|
|
};
|
|
},getLocalSet:function (mount, callback) {
|
|
var entries = {};
|
|
|
|
function isRealDir(p) {
|
|
return p !== '.' && p !== '..';
|
|
};
|
|
function toAbsolute(root) {
|
|
return function(p) {
|
|
return PATH.join2(root, p);
|
|
}
|
|
};
|
|
|
|
var check = FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint));
|
|
|
|
while (check.length) {
|
|
var path = check.pop();
|
|
var stat;
|
|
|
|
try {
|
|
stat = FS.stat(path);
|
|
} catch (e) {
|
|
return callback(e);
|
|
}
|
|
|
|
if (FS.isDir(stat.mode)) {
|
|
check.push.apply(check, FS.readdir(path).filter(isRealDir).map(toAbsolute(path)));
|
|
}
|
|
|
|
entries[path] = { timestamp: stat.mtime };
|
|
}
|
|
|
|
return callback(null, { type: 'local', entries: entries });
|
|
},getRemoteSet:function (mount, callback) {
|
|
var entries = {};
|
|
|
|
IDBFS.getDB(mount.mountpoint, function(err, db) {
|
|
if (err) return callback(err);
|
|
|
|
var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readonly');
|
|
transaction.onerror = function(e) {
|
|
callback(this.error);
|
|
e.preventDefault();
|
|
};
|
|
|
|
var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
|
|
var index = store.index('timestamp');
|
|
|
|
index.openKeyCursor().onsuccess = function(event) {
|
|
var cursor = event.target.result;
|
|
|
|
if (!cursor) {
|
|
return callback(null, { type: 'remote', db: db, entries: entries });
|
|
}
|
|
|
|
entries[cursor.primaryKey] = { timestamp: cursor.key };
|
|
|
|
cursor.continue();
|
|
};
|
|
});
|
|
},loadLocalEntry:function (path, callback) {
|
|
var stat, node;
|
|
|
|
try {
|
|
var lookup = FS.lookupPath(path);
|
|
node = lookup.node;
|
|
stat = FS.stat(path);
|
|
} catch (e) {
|
|
return callback(e);
|
|
}
|
|
|
|
if (FS.isDir(stat.mode)) {
|
|
return callback(null, { timestamp: stat.mtime, mode: stat.mode });
|
|
} else if (FS.isFile(stat.mode)) {
|
|
// Performance consideration: storing a normal JavaScript array to a IndexedDB is much slower than storing a typed array.
|
|
// Therefore always convert the file contents to a typed array first before writing the data to IndexedDB.
|
|
node.contents = MEMFS.getFileDataAsTypedArray(node);
|
|
return callback(null, { timestamp: stat.mtime, mode: stat.mode, contents: node.contents });
|
|
} else {
|
|
return callback(new Error('node type not supported'));
|
|
}
|
|
},storeLocalEntry:function (path, entry, callback) {
|
|
try {
|
|
if (FS.isDir(entry.mode)) {
|
|
FS.mkdir(path, entry.mode);
|
|
} else if (FS.isFile(entry.mode)) {
|
|
FS.writeFile(path, entry.contents, { encoding: 'binary', canOwn: true });
|
|
} else {
|
|
return callback(new Error('node type not supported'));
|
|
}
|
|
|
|
FS.chmod(path, entry.mode);
|
|
FS.utime(path, entry.timestamp, entry.timestamp);
|
|
} catch (e) {
|
|
return callback(e);
|
|
}
|
|
|
|
callback(null);
|
|
},removeLocalEntry:function (path, callback) {
|
|
try {
|
|
var lookup = FS.lookupPath(path);
|
|
var stat = FS.stat(path);
|
|
|
|
if (FS.isDir(stat.mode)) {
|
|
FS.rmdir(path);
|
|
} else if (FS.isFile(stat.mode)) {
|
|
FS.unlink(path);
|
|
}
|
|
} catch (e) {
|
|
return callback(e);
|
|
}
|
|
|
|
callback(null);
|
|
},loadRemoteEntry:function (store, path, callback) {
|
|
var req = store.get(path);
|
|
req.onsuccess = function(event) { callback(null, event.target.result); };
|
|
req.onerror = function(e) {
|
|
callback(this.error);
|
|
e.preventDefault();
|
|
};
|
|
},storeRemoteEntry:function (store, path, entry, callback) {
|
|
var req = store.put(entry, path);
|
|
req.onsuccess = function() { callback(null); };
|
|
req.onerror = function(e) {
|
|
callback(this.error);
|
|
e.preventDefault();
|
|
};
|
|
},removeRemoteEntry:function (store, path, callback) {
|
|
var req = store.delete(path);
|
|
req.onsuccess = function() { callback(null); };
|
|
req.onerror = function(e) {
|
|
callback(this.error);
|
|
e.preventDefault();
|
|
};
|
|
},reconcile:function (src, dst, callback) {
|
|
var total = 0;
|
|
|
|
var create = [];
|
|
Object.keys(src.entries).forEach(function (key) {
|
|
var e = src.entries[key];
|
|
var e2 = dst.entries[key];
|
|
if (!e2 || e.timestamp > e2.timestamp) {
|
|
create.push(key);
|
|
total++;
|
|
}
|
|
});
|
|
|
|
var remove = [];
|
|
Object.keys(dst.entries).forEach(function (key) {
|
|
var e = dst.entries[key];
|
|
var e2 = src.entries[key];
|
|
if (!e2) {
|
|
remove.push(key);
|
|
total++;
|
|
}
|
|
});
|
|
|
|
if (!total) {
|
|
return callback(null);
|
|
}
|
|
|
|
var errored = false;
|
|
var completed = 0;
|
|
var db = src.type === 'remote' ? src.db : dst.db;
|
|
var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readwrite');
|
|
var store = transaction.objectStore(IDBFS.DB_STORE_NAME);
|
|
|
|
function done(err) {
|
|
if (err) {
|
|
if (!done.errored) {
|
|
done.errored = true;
|
|
return callback(err);
|
|
}
|
|
return;
|
|
}
|
|
if (++completed >= total) {
|
|
return callback(null);
|
|
}
|
|
};
|
|
|
|
transaction.onerror = function(e) {
|
|
done(this.error);
|
|
e.preventDefault();
|
|
};
|
|
|
|
// sort paths in ascending order so directory entries are created
|
|
// before the files inside them
|
|
create.sort().forEach(function (path) {
|
|
if (dst.type === 'local') {
|
|
IDBFS.loadRemoteEntry(store, path, function (err, entry) {
|
|
if (err) return done(err);
|
|
IDBFS.storeLocalEntry(path, entry, done);
|
|
});
|
|
} else {
|
|
IDBFS.loadLocalEntry(path, function (err, entry) {
|
|
if (err) return done(err);
|
|
IDBFS.storeRemoteEntry(store, path, entry, done);
|
|
});
|
|
}
|
|
});
|
|
|
|
// sort paths in descending order so files are deleted before their
|
|
// parent directories
|
|
remove.sort().reverse().forEach(function(path) {
|
|
if (dst.type === 'local') {
|
|
IDBFS.removeLocalEntry(path, done);
|
|
} else {
|
|
IDBFS.removeRemoteEntry(store, path, done);
|
|
}
|
|
});
|
|
}};
|
|
|
|
var NODEFS={isWindows:false,staticInit:function () {
|
|
NODEFS.isWindows = !!process.platform.match(/^win/);
|
|
},mount:function (mount) {
|
|
assert(ENVIRONMENT_IS_NODE);
|
|
return NODEFS.createNode(null, '/', NODEFS.getMode(mount.opts.root), 0);
|
|
},createNode:function (parent, name, mode, dev) {
|
|
if (!FS.isDir(mode) && !FS.isFile(mode) && !FS.isLink(mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
var node = FS.createNode(parent, name, mode);
|
|
node.node_ops = NODEFS.node_ops;
|
|
node.stream_ops = NODEFS.stream_ops;
|
|
return node;
|
|
},getMode:function (path) {
|
|
var stat;
|
|
try {
|
|
stat = fs.lstatSync(path);
|
|
if (NODEFS.isWindows) {
|
|
// On Windows, directories return permission bits 'rw-rw-rw-', even though they have 'rwxrwxrwx', so
|
|
// propagate write bits to execute bits.
|
|
stat.mode = stat.mode | ((stat.mode & 146) >> 1);
|
|
}
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
return stat.mode;
|
|
},realPath:function (node) {
|
|
var parts = [];
|
|
while (node.parent !== node) {
|
|
parts.push(node.name);
|
|
node = node.parent;
|
|
}
|
|
parts.push(node.mount.opts.root);
|
|
parts.reverse();
|
|
return PATH.join.apply(null, parts);
|
|
},flagsToPermissionStringMap:{0:"r",1:"r+",2:"r+",64:"r",65:"r+",66:"r+",129:"rx+",193:"rx+",514:"w+",577:"w",578:"w+",705:"wx",706:"wx+",1024:"a",1025:"a",1026:"a+",1089:"a",1090:"a+",1153:"ax",1154:"ax+",1217:"ax",1218:"ax+",4096:"rs",4098:"rs+"},flagsToPermissionString:function (flags) {
|
|
flags &= ~0x200000 /*O_PATH*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
|
|
flags &= ~0x800 /*O_NONBLOCK*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
|
|
flags &= ~0x8000 /*O_LARGEFILE*/; // Ignore this flag from musl, otherwise node.js fails to open the file.
|
|
flags &= ~0x80000 /*O_CLOEXEC*/; // Some applications may pass it; it makes no sense for a single process.
|
|
if (flags in NODEFS.flagsToPermissionStringMap) {
|
|
return NODEFS.flagsToPermissionStringMap[flags];
|
|
} else {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
},node_ops:{getattr:function (node) {
|
|
var path = NODEFS.realPath(node);
|
|
var stat;
|
|
try {
|
|
stat = fs.lstatSync(path);
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
// node.js v0.10.20 doesn't report blksize and blocks on Windows. Fake them with default blksize of 4096.
|
|
// See http://support.microsoft.com/kb/140365
|
|
if (NODEFS.isWindows && !stat.blksize) {
|
|
stat.blksize = 4096;
|
|
}
|
|
if (NODEFS.isWindows && !stat.blocks) {
|
|
stat.blocks = (stat.size+stat.blksize-1)/stat.blksize|0;
|
|
}
|
|
return {
|
|
dev: stat.dev,
|
|
ino: stat.ino,
|
|
mode: stat.mode,
|
|
nlink: stat.nlink,
|
|
uid: stat.uid,
|
|
gid: stat.gid,
|
|
rdev: stat.rdev,
|
|
size: stat.size,
|
|
atime: stat.atime,
|
|
mtime: stat.mtime,
|
|
ctime: stat.ctime,
|
|
blksize: stat.blksize,
|
|
blocks: stat.blocks
|
|
};
|
|
},setattr:function (node, attr) {
|
|
var path = NODEFS.realPath(node);
|
|
try {
|
|
if (attr.mode !== undefined) {
|
|
fs.chmodSync(path, attr.mode);
|
|
// update the common node structure mode as well
|
|
node.mode = attr.mode;
|
|
}
|
|
if (attr.timestamp !== undefined) {
|
|
var date = new Date(attr.timestamp);
|
|
fs.utimesSync(path, date, date);
|
|
}
|
|
if (attr.size !== undefined) {
|
|
fs.truncateSync(path, attr.size);
|
|
}
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
},lookup:function (parent, name) {
|
|
var path = PATH.join2(NODEFS.realPath(parent), name);
|
|
var mode = NODEFS.getMode(path);
|
|
return NODEFS.createNode(parent, name, mode);
|
|
},mknod:function (parent, name, mode, dev) {
|
|
var node = NODEFS.createNode(parent, name, mode, dev);
|
|
// create the backing node for this in the fs root as well
|
|
var path = NODEFS.realPath(node);
|
|
try {
|
|
if (FS.isDir(node.mode)) {
|
|
fs.mkdirSync(path, node.mode);
|
|
} else {
|
|
fs.writeFileSync(path, '', { mode: node.mode });
|
|
}
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
return node;
|
|
},rename:function (oldNode, newDir, newName) {
|
|
var oldPath = NODEFS.realPath(oldNode);
|
|
var newPath = PATH.join2(NODEFS.realPath(newDir), newName);
|
|
try {
|
|
fs.renameSync(oldPath, newPath);
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
},unlink:function (parent, name) {
|
|
var path = PATH.join2(NODEFS.realPath(parent), name);
|
|
try {
|
|
fs.unlinkSync(path);
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
},rmdir:function (parent, name) {
|
|
var path = PATH.join2(NODEFS.realPath(parent), name);
|
|
try {
|
|
fs.rmdirSync(path);
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
},readdir:function (node) {
|
|
var path = NODEFS.realPath(node);
|
|
try {
|
|
return fs.readdirSync(path);
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
},symlink:function (parent, newName, oldPath) {
|
|
var newPath = PATH.join2(NODEFS.realPath(parent), newName);
|
|
try {
|
|
fs.symlinkSync(oldPath, newPath);
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
},readlink:function (node) {
|
|
var path = NODEFS.realPath(node);
|
|
try {
|
|
path = fs.readlinkSync(path);
|
|
path = NODEJS_PATH.relative(NODEJS_PATH.resolve(node.mount.opts.root), path);
|
|
return path;
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
}},stream_ops:{open:function (stream) {
|
|
var path = NODEFS.realPath(stream.node);
|
|
try {
|
|
if (FS.isFile(stream.node.mode)) {
|
|
stream.nfd = fs.openSync(path, NODEFS.flagsToPermissionString(stream.flags));
|
|
}
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
},close:function (stream) {
|
|
try {
|
|
if (FS.isFile(stream.node.mode) && stream.nfd) {
|
|
fs.closeSync(stream.nfd);
|
|
}
|
|
} catch (e) {
|
|
if (!e.code) throw e;
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
},read:function (stream, buffer, offset, length, position) {
|
|
if (length === 0) return 0; // node errors on 0 length reads
|
|
// FIXME this is terrible.
|
|
var nbuffer = new Buffer(length);
|
|
var res;
|
|
try {
|
|
res = fs.readSync(stream.nfd, nbuffer, 0, length, position);
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
if (res > 0) {
|
|
for (var i = 0; i < res; i++) {
|
|
buffer[offset + i] = nbuffer[i];
|
|
}
|
|
}
|
|
return res;
|
|
},write:function (stream, buffer, offset, length, position) {
|
|
// FIXME this is terrible.
|
|
var nbuffer = new Buffer(buffer.subarray(offset, offset + length));
|
|
var res;
|
|
try {
|
|
res = fs.writeSync(stream.nfd, nbuffer, 0, length, position);
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
return res;
|
|
},llseek:function (stream, offset, whence) {
|
|
var position = offset;
|
|
if (whence === 1) { // SEEK_CUR.
|
|
position += stream.position;
|
|
} else if (whence === 2) { // SEEK_END.
|
|
if (FS.isFile(stream.node.mode)) {
|
|
try {
|
|
var stat = fs.fstatSync(stream.nfd);
|
|
position += stat.size;
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES[e.code]);
|
|
}
|
|
}
|
|
}
|
|
|
|
if (position < 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
|
|
return position;
|
|
}}};
|
|
|
|
var WORKERFS={DIR_MODE:16895,FILE_MODE:33279,reader:null,mount:function (mount) {
|
|
assert(ENVIRONMENT_IS_WORKER);
|
|
if (!WORKERFS.reader) WORKERFS.reader = new FileReaderSync();
|
|
var root = WORKERFS.createNode(null, '/', WORKERFS.DIR_MODE, 0);
|
|
var createdParents = {};
|
|
function ensureParent(path) {
|
|
// return the parent node, creating subdirs as necessary
|
|
var parts = path.split('/');
|
|
var parent = root;
|
|
for (var i = 0; i < parts.length-1; i++) {
|
|
var curr = parts.slice(0, i+1).join('/');
|
|
// Issue 4254: Using curr as a node name will prevent the node
|
|
// from being found in FS.nameTable when FS.open is called on
|
|
// a path which holds a child of this node,
|
|
// given that all FS functions assume node names
|
|
// are just their corresponding parts within their given path,
|
|
// rather than incremental aggregates which include their parent's
|
|
// directories.
|
|
if (!createdParents[curr]) {
|
|
createdParents[curr] = WORKERFS.createNode(parent, parts[i], WORKERFS.DIR_MODE, 0);
|
|
}
|
|
parent = createdParents[curr];
|
|
}
|
|
return parent;
|
|
}
|
|
function base(path) {
|
|
var parts = path.split('/');
|
|
return parts[parts.length-1];
|
|
}
|
|
// We also accept FileList here, by using Array.prototype
|
|
Array.prototype.forEach.call(mount.opts["files"] || [], function(file) {
|
|
WORKERFS.createNode(ensureParent(file.name), base(file.name), WORKERFS.FILE_MODE, 0, file, file.lastModifiedDate);
|
|
});
|
|
(mount.opts["blobs"] || []).forEach(function(obj) {
|
|
WORKERFS.createNode(ensureParent(obj["name"]), base(obj["name"]), WORKERFS.FILE_MODE, 0, obj["data"]);
|
|
});
|
|
(mount.opts["packages"] || []).forEach(function(pack) {
|
|
pack['metadata'].files.forEach(function(file) {
|
|
var name = file.filename.substr(1); // remove initial slash
|
|
WORKERFS.createNode(ensureParent(name), base(name), WORKERFS.FILE_MODE, 0, pack['blob'].slice(file.start, file.end));
|
|
});
|
|
});
|
|
return root;
|
|
},createNode:function (parent, name, mode, dev, contents, mtime) {
|
|
var node = FS.createNode(parent, name, mode);
|
|
node.mode = mode;
|
|
node.node_ops = WORKERFS.node_ops;
|
|
node.stream_ops = WORKERFS.stream_ops;
|
|
node.timestamp = (mtime || new Date).getTime();
|
|
assert(WORKERFS.FILE_MODE !== WORKERFS.DIR_MODE);
|
|
if (mode === WORKERFS.FILE_MODE) {
|
|
node.size = contents.size;
|
|
node.contents = contents;
|
|
} else {
|
|
node.size = 4096;
|
|
node.contents = {};
|
|
}
|
|
if (parent) {
|
|
parent.contents[name] = node;
|
|
}
|
|
return node;
|
|
},node_ops:{getattr:function (node) {
|
|
return {
|
|
dev: 1,
|
|
ino: undefined,
|
|
mode: node.mode,
|
|
nlink: 1,
|
|
uid: 0,
|
|
gid: 0,
|
|
rdev: undefined,
|
|
size: node.size,
|
|
atime: new Date(node.timestamp),
|
|
mtime: new Date(node.timestamp),
|
|
ctime: new Date(node.timestamp),
|
|
blksize: 4096,
|
|
blocks: Math.ceil(node.size / 4096),
|
|
};
|
|
},setattr:function (node, attr) {
|
|
if (attr.mode !== undefined) {
|
|
node.mode = attr.mode;
|
|
}
|
|
if (attr.timestamp !== undefined) {
|
|
node.timestamp = attr.timestamp;
|
|
}
|
|
},lookup:function (parent, name) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
|
|
},mknod:function (parent, name, mode, dev) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
},rename:function (oldNode, newDir, newName) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
},unlink:function (parent, name) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
},rmdir:function (parent, name) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
},readdir:function (node) {
|
|
var entries = ['.', '..'];
|
|
for (var key in node.contents) {
|
|
if (!node.contents.hasOwnProperty(key)) {
|
|
continue;
|
|
}
|
|
entries.push(key);
|
|
}
|
|
return entries;
|
|
},symlink:function (parent, newName, oldPath) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
},readlink:function (node) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
}},stream_ops:{read:function (stream, buffer, offset, length, position) {
|
|
if (position >= stream.node.size) return 0;
|
|
var chunk = stream.node.contents.slice(position, position + length);
|
|
var ab = WORKERFS.reader.readAsArrayBuffer(chunk);
|
|
buffer.set(new Uint8Array(ab), offset);
|
|
return chunk.size;
|
|
},write:function (stream, buffer, offset, length, position) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO);
|
|
},llseek:function (stream, offset, whence) {
|
|
var position = offset;
|
|
if (whence === 1) { // SEEK_CUR.
|
|
position += stream.position;
|
|
} else if (whence === 2) { // SEEK_END.
|
|
if (FS.isFile(stream.node.mode)) {
|
|
position += stream.node.size;
|
|
}
|
|
}
|
|
if (position < 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
return position;
|
|
}}};
|
|
|
|
var _stdin; if (ENVIRONMENT_IS_PTHREAD) _stdin = PthreadWorkerInit._stdin; else PthreadWorkerInit._stdin = _stdin = allocate(1, "i32*", ALLOC_STATIC);
|
|
|
|
var _stdout; if (ENVIRONMENT_IS_PTHREAD) _stdout = PthreadWorkerInit._stdout; else PthreadWorkerInit._stdout = _stdout = allocate(1, "i32*", ALLOC_STATIC);
|
|
|
|
var _stderr; if (ENVIRONMENT_IS_PTHREAD) _stderr = PthreadWorkerInit._stderr; else PthreadWorkerInit._stderr = _stderr = allocate(1, "i32*", ALLOC_STATIC);var FS={root:null,mounts:[],devices:[null],streams:[],nextInode:1,nameTable:null,currentPath:"/",initialized:false,ignorePermissions:true,trackingDelegate:{},tracking:{openFlags:{READ:1,WRITE:2}},ErrnoError:null,genericErrors:{},filesystems:null,syncFSRequests:0,handleFSError:function (e) {
|
|
if (!(e instanceof FS.ErrnoError)) throw e + ' : ' + stackTrace();
|
|
return ___setErrNo(e.errno);
|
|
},lookupPath:function (path, opts) {
|
|
path = PATH.resolve(FS.cwd(), path);
|
|
opts = opts || {};
|
|
|
|
if (!path) return { path: '', node: null };
|
|
|
|
var defaults = {
|
|
follow_mount: true,
|
|
recurse_count: 0
|
|
};
|
|
for (var key in defaults) {
|
|
if (opts[key] === undefined) {
|
|
opts[key] = defaults[key];
|
|
}
|
|
}
|
|
|
|
if (opts.recurse_count > 8) { // max recursive lookup of 8
|
|
throw new FS.ErrnoError(ERRNO_CODES.ELOOP);
|
|
}
|
|
|
|
// split the path
|
|
var parts = PATH.normalizeArray(path.split('/').filter(function(p) {
|
|
return !!p;
|
|
}), false);
|
|
|
|
// start at the root
|
|
var current = FS.root;
|
|
var current_path = '/';
|
|
|
|
for (var i = 0; i < parts.length; i++) {
|
|
var islast = (i === parts.length-1);
|
|
if (islast && opts.parent) {
|
|
// stop resolving
|
|
break;
|
|
}
|
|
|
|
current = FS.lookupNode(current, parts[i]);
|
|
current_path = PATH.join2(current_path, parts[i]);
|
|
|
|
// jump to the mount's root node if this is a mountpoint
|
|
if (FS.isMountpoint(current)) {
|
|
if (!islast || (islast && opts.follow_mount)) {
|
|
current = current.mounted.root;
|
|
}
|
|
}
|
|
|
|
// by default, lookupPath will not follow a symlink if it is the final path component.
|
|
// setting opts.follow = true will override this behavior.
|
|
if (!islast || opts.follow) {
|
|
var count = 0;
|
|
while (FS.isLink(current.mode)) {
|
|
var link = FS.readlink(current_path);
|
|
current_path = PATH.resolve(PATH.dirname(current_path), link);
|
|
|
|
var lookup = FS.lookupPath(current_path, { recurse_count: opts.recurse_count });
|
|
current = lookup.node;
|
|
|
|
if (count++ > 40) { // limit max consecutive symlinks to 40 (SYMLOOP_MAX).
|
|
throw new FS.ErrnoError(ERRNO_CODES.ELOOP);
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
return { path: current_path, node: current };
|
|
},getPath:function (node) {
|
|
var path;
|
|
while (true) {
|
|
if (FS.isRoot(node)) {
|
|
var mount = node.mount.mountpoint;
|
|
if (!path) return mount;
|
|
return mount[mount.length-1] !== '/' ? mount + '/' + path : mount + path;
|
|
}
|
|
path = path ? node.name + '/' + path : node.name;
|
|
node = node.parent;
|
|
}
|
|
},hashName:function (parentid, name) {
|
|
var hash = 0;
|
|
|
|
|
|
for (var i = 0; i < name.length; i++) {
|
|
hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0;
|
|
}
|
|
return ((parentid + hash) >>> 0) % FS.nameTable.length;
|
|
},hashAddNode:function (node) {
|
|
var hash = FS.hashName(node.parent.id, node.name);
|
|
node.name_next = FS.nameTable[hash];
|
|
FS.nameTable[hash] = node;
|
|
},hashRemoveNode:function (node) {
|
|
var hash = FS.hashName(node.parent.id, node.name);
|
|
if (FS.nameTable[hash] === node) {
|
|
FS.nameTable[hash] = node.name_next;
|
|
} else {
|
|
var current = FS.nameTable[hash];
|
|
while (current) {
|
|
if (current.name_next === node) {
|
|
current.name_next = node.name_next;
|
|
break;
|
|
}
|
|
current = current.name_next;
|
|
}
|
|
}
|
|
},lookupNode:function (parent, name) {
|
|
var err = FS.mayLookup(parent);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err, parent);
|
|
}
|
|
var hash = FS.hashName(parent.id, name);
|
|
for (var node = FS.nameTable[hash]; node; node = node.name_next) {
|
|
var nodeName = node.name;
|
|
if (node.parent.id === parent.id && nodeName === name) {
|
|
return node;
|
|
}
|
|
}
|
|
// if we failed to find it in the cache, call into the VFS
|
|
return FS.lookup(parent, name);
|
|
},createNode:function (parent, name, mode, rdev) {
|
|
if (!FS.FSNode) {
|
|
FS.FSNode = function(parent, name, mode, rdev) {
|
|
if (!parent) {
|
|
parent = this; // root node sets parent to itself
|
|
}
|
|
this.parent = parent;
|
|
this.mount = parent.mount;
|
|
this.mounted = null;
|
|
this.id = FS.nextInode++;
|
|
this.name = name;
|
|
this.mode = mode;
|
|
this.node_ops = {};
|
|
this.stream_ops = {};
|
|
this.rdev = rdev;
|
|
};
|
|
|
|
FS.FSNode.prototype = {};
|
|
|
|
// compatibility
|
|
var readMode = 292 | 73;
|
|
var writeMode = 146;
|
|
|
|
// NOTE we must use Object.defineProperties instead of individual calls to
|
|
// Object.defineProperty in order to make closure compiler happy
|
|
Object.defineProperties(FS.FSNode.prototype, {
|
|
read: {
|
|
get: function() { return (this.mode & readMode) === readMode; },
|
|
set: function(val) { val ? this.mode |= readMode : this.mode &= ~readMode; }
|
|
},
|
|
write: {
|
|
get: function() { return (this.mode & writeMode) === writeMode; },
|
|
set: function(val) { val ? this.mode |= writeMode : this.mode &= ~writeMode; }
|
|
},
|
|
isFolder: {
|
|
get: function() { return FS.isDir(this.mode); }
|
|
},
|
|
isDevice: {
|
|
get: function() { return FS.isChrdev(this.mode); }
|
|
}
|
|
});
|
|
}
|
|
|
|
var node = new FS.FSNode(parent, name, mode, rdev);
|
|
|
|
FS.hashAddNode(node);
|
|
|
|
return node;
|
|
},destroyNode:function (node) {
|
|
FS.hashRemoveNode(node);
|
|
},isRoot:function (node) {
|
|
return node === node.parent;
|
|
},isMountpoint:function (node) {
|
|
return !!node.mounted;
|
|
},isFile:function (mode) {
|
|
return (mode & 61440) === 32768;
|
|
},isDir:function (mode) {
|
|
return (mode & 61440) === 16384;
|
|
},isLink:function (mode) {
|
|
return (mode & 61440) === 40960;
|
|
},isChrdev:function (mode) {
|
|
return (mode & 61440) === 8192;
|
|
},isBlkdev:function (mode) {
|
|
return (mode & 61440) === 24576;
|
|
},isFIFO:function (mode) {
|
|
return (mode & 61440) === 4096;
|
|
},isSocket:function (mode) {
|
|
return (mode & 49152) === 49152;
|
|
},flagModes:{"r":0,"rs":1052672,"r+":2,"w":577,"wx":705,"xw":705,"w+":578,"wx+":706,"xw+":706,"a":1089,"ax":1217,"xa":1217,"a+":1090,"ax+":1218,"xa+":1218},modeStringToFlags:function (str) {
|
|
var flags = FS.flagModes[str];
|
|
if (typeof flags === 'undefined') {
|
|
throw new Error('Unknown file open mode: ' + str);
|
|
}
|
|
return flags;
|
|
},flagsToPermissionString:function (flag) {
|
|
var perms = ['r', 'w', 'rw'][flag & 3];
|
|
if ((flag & 512)) {
|
|
perms += 'w';
|
|
}
|
|
return perms;
|
|
},nodePermissions:function (node, perms) {
|
|
if (FS.ignorePermissions) {
|
|
return 0;
|
|
}
|
|
// return 0 if any user, group or owner bits are set.
|
|
if (perms.indexOf('r') !== -1 && !(node.mode & 292)) {
|
|
return ERRNO_CODES.EACCES;
|
|
} else if (perms.indexOf('w') !== -1 && !(node.mode & 146)) {
|
|
return ERRNO_CODES.EACCES;
|
|
} else if (perms.indexOf('x') !== -1 && !(node.mode & 73)) {
|
|
return ERRNO_CODES.EACCES;
|
|
}
|
|
return 0;
|
|
},mayLookup:function (dir) {
|
|
var err = FS.nodePermissions(dir, 'x');
|
|
if (err) return err;
|
|
if (!dir.node_ops.lookup) return ERRNO_CODES.EACCES;
|
|
return 0;
|
|
},mayCreate:function (dir, name) {
|
|
try {
|
|
var node = FS.lookupNode(dir, name);
|
|
return ERRNO_CODES.EEXIST;
|
|
} catch (e) {
|
|
}
|
|
return FS.nodePermissions(dir, 'wx');
|
|
},mayDelete:function (dir, name, isdir) {
|
|
var node;
|
|
try {
|
|
node = FS.lookupNode(dir, name);
|
|
} catch (e) {
|
|
return e.errno;
|
|
}
|
|
var err = FS.nodePermissions(dir, 'wx');
|
|
if (err) {
|
|
return err;
|
|
}
|
|
if (isdir) {
|
|
if (!FS.isDir(node.mode)) {
|
|
return ERRNO_CODES.ENOTDIR;
|
|
}
|
|
if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) {
|
|
return ERRNO_CODES.EBUSY;
|
|
}
|
|
} else {
|
|
if (FS.isDir(node.mode)) {
|
|
return ERRNO_CODES.EISDIR;
|
|
}
|
|
}
|
|
return 0;
|
|
},mayOpen:function (node, flags) {
|
|
if (!node) {
|
|
return ERRNO_CODES.ENOENT;
|
|
}
|
|
if (FS.isLink(node.mode)) {
|
|
return ERRNO_CODES.ELOOP;
|
|
} else if (FS.isDir(node.mode)) {
|
|
if (FS.flagsToPermissionString(flags) !== 'r' || // opening for write
|
|
(flags & 512)) { // TODO: check for O_SEARCH? (== search for dir only)
|
|
return ERRNO_CODES.EISDIR;
|
|
}
|
|
}
|
|
return FS.nodePermissions(node, FS.flagsToPermissionString(flags));
|
|
},MAX_OPEN_FDS:4096,nextfd:function (fd_start, fd_end) {
|
|
fd_start = fd_start || 0;
|
|
fd_end = fd_end || FS.MAX_OPEN_FDS;
|
|
for (var fd = fd_start; fd <= fd_end; fd++) {
|
|
if (!FS.streams[fd]) {
|
|
return fd;
|
|
}
|
|
}
|
|
throw new FS.ErrnoError(ERRNO_CODES.EMFILE);
|
|
},getStream:function (fd) {
|
|
return FS.streams[fd];
|
|
},createStream:function (stream, fd_start, fd_end) {
|
|
if (!FS.FSStream) {
|
|
FS.FSStream = function(){};
|
|
FS.FSStream.prototype = {};
|
|
// compatibility
|
|
Object.defineProperties(FS.FSStream.prototype, {
|
|
object: {
|
|
get: function() { return this.node; },
|
|
set: function(val) { this.node = val; }
|
|
},
|
|
isRead: {
|
|
get: function() { return (this.flags & 2097155) !== 1; }
|
|
},
|
|
isWrite: {
|
|
get: function() { return (this.flags & 2097155) !== 0; }
|
|
},
|
|
isAppend: {
|
|
get: function() { return (this.flags & 1024); }
|
|
}
|
|
});
|
|
}
|
|
// clone it, so we can return an instance of FSStream
|
|
var newStream = new FS.FSStream();
|
|
for (var p in stream) {
|
|
newStream[p] = stream[p];
|
|
}
|
|
stream = newStream;
|
|
var fd = FS.nextfd(fd_start, fd_end);
|
|
stream.fd = fd;
|
|
FS.streams[fd] = stream;
|
|
return stream;
|
|
},closeStream:function (fd) {
|
|
FS.streams[fd] = null;
|
|
},chrdev_stream_ops:{open:function (stream) {
|
|
var device = FS.getDevice(stream.node.rdev);
|
|
// override node's stream ops with the device's
|
|
stream.stream_ops = device.stream_ops;
|
|
// forward the open call
|
|
if (stream.stream_ops.open) {
|
|
stream.stream_ops.open(stream);
|
|
}
|
|
},llseek:function () {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
|
|
}},major:function (dev) {
|
|
return ((dev) >> 8);
|
|
},minor:function (dev) {
|
|
return ((dev) & 0xff);
|
|
},makedev:function (ma, mi) {
|
|
return ((ma) << 8 | (mi));
|
|
},registerDevice:function (dev, ops) {
|
|
FS.devices[dev] = { stream_ops: ops };
|
|
},getDevice:function (dev) {
|
|
return FS.devices[dev];
|
|
},getMounts:function (mount) {
|
|
var mounts = [];
|
|
var check = [mount];
|
|
|
|
while (check.length) {
|
|
var m = check.pop();
|
|
|
|
mounts.push(m);
|
|
|
|
check.push.apply(check, m.mounts);
|
|
}
|
|
|
|
return mounts;
|
|
},syncfs:function (populate, callback) {
|
|
if (typeof(populate) === 'function') {
|
|
callback = populate;
|
|
populate = false;
|
|
}
|
|
|
|
FS.syncFSRequests++;
|
|
|
|
if (FS.syncFSRequests > 1) {
|
|
console.log('warning: ' + FS.syncFSRequests + ' FS.syncfs operations in flight at once, probably just doing extra work');
|
|
}
|
|
|
|
var mounts = FS.getMounts(FS.root.mount);
|
|
var completed = 0;
|
|
|
|
function doCallback(err) {
|
|
assert(FS.syncFSRequests > 0);
|
|
FS.syncFSRequests--;
|
|
return callback(err);
|
|
}
|
|
|
|
function done(err) {
|
|
if (err) {
|
|
if (!done.errored) {
|
|
done.errored = true;
|
|
return doCallback(err);
|
|
}
|
|
return;
|
|
}
|
|
if (++completed >= mounts.length) {
|
|
doCallback(null);
|
|
}
|
|
};
|
|
|
|
// sync all mounts
|
|
mounts.forEach(function (mount) {
|
|
if (!mount.type.syncfs) {
|
|
return done(null);
|
|
}
|
|
mount.type.syncfs(mount, populate, done);
|
|
});
|
|
},mount:function (type, opts, mountpoint) {
|
|
var root = mountpoint === '/';
|
|
var pseudo = !mountpoint;
|
|
var node;
|
|
|
|
if (root && FS.root) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
|
|
} else if (!root && !pseudo) {
|
|
var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
|
|
|
|
mountpoint = lookup.path; // use the absolute path
|
|
node = lookup.node;
|
|
|
|
if (FS.isMountpoint(node)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
|
|
}
|
|
|
|
if (!FS.isDir(node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
|
|
}
|
|
}
|
|
|
|
var mount = {
|
|
type: type,
|
|
opts: opts,
|
|
mountpoint: mountpoint,
|
|
mounts: []
|
|
};
|
|
|
|
// create a root node for the fs
|
|
var mountRoot = type.mount(mount);
|
|
mountRoot.mount = mount;
|
|
mount.root = mountRoot;
|
|
|
|
if (root) {
|
|
FS.root = mountRoot;
|
|
} else if (node) {
|
|
// set as a mountpoint
|
|
node.mounted = mount;
|
|
|
|
// add the new mount to the current mount's children
|
|
if (node.mount) {
|
|
node.mount.mounts.push(mount);
|
|
}
|
|
}
|
|
|
|
return mountRoot;
|
|
},unmount:function (mountpoint) {
|
|
var lookup = FS.lookupPath(mountpoint, { follow_mount: false });
|
|
|
|
if (!FS.isMountpoint(lookup.node)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
|
|
// destroy the nodes for this mount, and all its child mounts
|
|
var node = lookup.node;
|
|
var mount = node.mounted;
|
|
var mounts = FS.getMounts(mount);
|
|
|
|
Object.keys(FS.nameTable).forEach(function (hash) {
|
|
var current = FS.nameTable[hash];
|
|
|
|
while (current) {
|
|
var next = current.name_next;
|
|
|
|
if (mounts.indexOf(current.mount) !== -1) {
|
|
FS.destroyNode(current);
|
|
}
|
|
|
|
current = next;
|
|
}
|
|
});
|
|
|
|
// no longer a mountpoint
|
|
node.mounted = null;
|
|
|
|
// remove this mount from the child mounts
|
|
var idx = node.mount.mounts.indexOf(mount);
|
|
assert(idx !== -1);
|
|
node.mount.mounts.splice(idx, 1);
|
|
},lookup:function (parent, name) {
|
|
return parent.node_ops.lookup(parent, name);
|
|
},mknod:function (path, mode, dev) {
|
|
var lookup = FS.lookupPath(path, { parent: true });
|
|
var parent = lookup.node;
|
|
var name = PATH.basename(path);
|
|
if (!name || name === '.' || name === '..') {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
var err = FS.mayCreate(parent, name);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err);
|
|
}
|
|
if (!parent.node_ops.mknod) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
}
|
|
return parent.node_ops.mknod(parent, name, mode, dev);
|
|
},create:function (path, mode) {
|
|
mode = mode !== undefined ? mode : 438 /* 0666 */;
|
|
mode &= 4095;
|
|
mode |= 32768;
|
|
return FS.mknod(path, mode, 0);
|
|
},mkdir:function (path, mode) {
|
|
mode = mode !== undefined ? mode : 511 /* 0777 */;
|
|
mode &= 511 | 512;
|
|
mode |= 16384;
|
|
return FS.mknod(path, mode, 0);
|
|
},mkdirTree:function (path, mode) {
|
|
var dirs = path.split('/');
|
|
var d = '';
|
|
for (var i = 0; i < dirs.length; ++i) {
|
|
if (!dirs[i]) continue;
|
|
d += '/' + dirs[i];
|
|
try {
|
|
FS.mkdir(d, mode);
|
|
} catch(e) {
|
|
if (e.errno != ERRNO_CODES.EEXIST) throw e;
|
|
}
|
|
}
|
|
},mkdev:function (path, mode, dev) {
|
|
if (typeof(dev) === 'undefined') {
|
|
dev = mode;
|
|
mode = 438 /* 0666 */;
|
|
}
|
|
mode |= 8192;
|
|
return FS.mknod(path, mode, dev);
|
|
},symlink:function (oldpath, newpath) {
|
|
if (!PATH.resolve(oldpath)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
|
|
}
|
|
var lookup = FS.lookupPath(newpath, { parent: true });
|
|
var parent = lookup.node;
|
|
if (!parent) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
|
|
}
|
|
var newname = PATH.basename(newpath);
|
|
var err = FS.mayCreate(parent, newname);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err);
|
|
}
|
|
if (!parent.node_ops.symlink) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
}
|
|
return parent.node_ops.symlink(parent, newname, oldpath);
|
|
},rename:function (old_path, new_path) {
|
|
var old_dirname = PATH.dirname(old_path);
|
|
var new_dirname = PATH.dirname(new_path);
|
|
var old_name = PATH.basename(old_path);
|
|
var new_name = PATH.basename(new_path);
|
|
// parents must exist
|
|
var lookup, old_dir, new_dir;
|
|
try {
|
|
lookup = FS.lookupPath(old_path, { parent: true });
|
|
old_dir = lookup.node;
|
|
lookup = FS.lookupPath(new_path, { parent: true });
|
|
new_dir = lookup.node;
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
|
|
}
|
|
if (!old_dir || !new_dir) throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
|
|
// need to be part of the same mount
|
|
if (old_dir.mount !== new_dir.mount) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EXDEV);
|
|
}
|
|
// source must exist
|
|
var old_node = FS.lookupNode(old_dir, old_name);
|
|
// old path should not be an ancestor of the new path
|
|
var relative = PATH.relative(old_path, new_dirname);
|
|
if (relative.charAt(0) !== '.') {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
// new path should not be an ancestor of the old path
|
|
relative = PATH.relative(new_path, old_dirname);
|
|
if (relative.charAt(0) !== '.') {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY);
|
|
}
|
|
// see if the new path already exists
|
|
var new_node;
|
|
try {
|
|
new_node = FS.lookupNode(new_dir, new_name);
|
|
} catch (e) {
|
|
// not fatal
|
|
}
|
|
// early out if nothing needs to change
|
|
if (old_node === new_node) {
|
|
return;
|
|
}
|
|
// we'll need to delete the old entry
|
|
var isdir = FS.isDir(old_node.mode);
|
|
var err = FS.mayDelete(old_dir, old_name, isdir);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err);
|
|
}
|
|
// need delete permissions if we'll be overwriting.
|
|
// need create permissions if new doesn't already exist.
|
|
err = new_node ?
|
|
FS.mayDelete(new_dir, new_name, isdir) :
|
|
FS.mayCreate(new_dir, new_name);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err);
|
|
}
|
|
if (!old_dir.node_ops.rename) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
}
|
|
if (FS.isMountpoint(old_node) || (new_node && FS.isMountpoint(new_node))) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
|
|
}
|
|
// if we are going to change the parent, check write permissions
|
|
if (new_dir !== old_dir) {
|
|
err = FS.nodePermissions(old_dir, 'w');
|
|
if (err) {
|
|
throw new FS.ErrnoError(err);
|
|
}
|
|
}
|
|
try {
|
|
if (FS.trackingDelegate['willMovePath']) {
|
|
FS.trackingDelegate['willMovePath'](old_path, new_path);
|
|
}
|
|
} catch(e) {
|
|
console.log("FS.trackingDelegate['willMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message);
|
|
}
|
|
// remove the node from the lookup hash
|
|
FS.hashRemoveNode(old_node);
|
|
// do the underlying fs rename
|
|
try {
|
|
old_dir.node_ops.rename(old_node, new_dir, new_name);
|
|
} catch (e) {
|
|
throw e;
|
|
} finally {
|
|
// add the node back to the hash (in case node_ops.rename
|
|
// changed its name)
|
|
FS.hashAddNode(old_node);
|
|
}
|
|
try {
|
|
if (FS.trackingDelegate['onMovePath']) FS.trackingDelegate['onMovePath'](old_path, new_path);
|
|
} catch(e) {
|
|
console.log("FS.trackingDelegate['onMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message);
|
|
}
|
|
},rmdir:function (path) {
|
|
var lookup = FS.lookupPath(path, { parent: true });
|
|
var parent = lookup.node;
|
|
var name = PATH.basename(path);
|
|
var node = FS.lookupNode(parent, name);
|
|
var err = FS.mayDelete(parent, name, true);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err);
|
|
}
|
|
if (!parent.node_ops.rmdir) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
}
|
|
if (FS.isMountpoint(node)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
|
|
}
|
|
try {
|
|
if (FS.trackingDelegate['willDeletePath']) {
|
|
FS.trackingDelegate['willDeletePath'](path);
|
|
}
|
|
} catch(e) {
|
|
console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message);
|
|
}
|
|
parent.node_ops.rmdir(parent, name);
|
|
FS.destroyNode(node);
|
|
try {
|
|
if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path);
|
|
} catch(e) {
|
|
console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message);
|
|
}
|
|
},readdir:function (path) {
|
|
var lookup = FS.lookupPath(path, { follow: true });
|
|
var node = lookup.node;
|
|
if (!node.node_ops.readdir) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
|
|
}
|
|
return node.node_ops.readdir(node);
|
|
},unlink:function (path) {
|
|
var lookup = FS.lookupPath(path, { parent: true });
|
|
var parent = lookup.node;
|
|
var name = PATH.basename(path);
|
|
var node = FS.lookupNode(parent, name);
|
|
var err = FS.mayDelete(parent, name, false);
|
|
if (err) {
|
|
// According to POSIX, we should map EISDIR to EPERM, but
|
|
// we instead do what Linux does (and we must, as we use
|
|
// the musl linux libc).
|
|
throw new FS.ErrnoError(err);
|
|
}
|
|
if (!parent.node_ops.unlink) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
}
|
|
if (FS.isMountpoint(node)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBUSY);
|
|
}
|
|
try {
|
|
if (FS.trackingDelegate['willDeletePath']) {
|
|
FS.trackingDelegate['willDeletePath'](path);
|
|
}
|
|
} catch(e) {
|
|
console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message);
|
|
}
|
|
parent.node_ops.unlink(parent, name);
|
|
FS.destroyNode(node);
|
|
try {
|
|
if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path);
|
|
} catch(e) {
|
|
console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message);
|
|
}
|
|
},readlink:function (path) {
|
|
var lookup = FS.lookupPath(path);
|
|
var link = lookup.node;
|
|
if (!link) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
|
|
}
|
|
if (!link.node_ops.readlink) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
return PATH.resolve(FS.getPath(link.parent), link.node_ops.readlink(link));
|
|
},stat:function (path, dontFollow) {
|
|
var lookup = FS.lookupPath(path, { follow: !dontFollow });
|
|
var node = lookup.node;
|
|
if (!node) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
|
|
}
|
|
if (!node.node_ops.getattr) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
}
|
|
return node.node_ops.getattr(node);
|
|
},lstat:function (path) {
|
|
return FS.stat(path, true);
|
|
},chmod:function (path, mode, dontFollow) {
|
|
var node;
|
|
if (typeof path === 'string') {
|
|
var lookup = FS.lookupPath(path, { follow: !dontFollow });
|
|
node = lookup.node;
|
|
} else {
|
|
node = path;
|
|
}
|
|
if (!node.node_ops.setattr) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
}
|
|
node.node_ops.setattr(node, {
|
|
mode: (mode & 4095) | (node.mode & ~4095),
|
|
timestamp: Date.now()
|
|
});
|
|
},lchmod:function (path, mode) {
|
|
FS.chmod(path, mode, true);
|
|
},fchmod:function (fd, mode) {
|
|
var stream = FS.getStream(fd);
|
|
if (!stream) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
}
|
|
FS.chmod(stream.node, mode);
|
|
},chown:function (path, uid, gid, dontFollow) {
|
|
var node;
|
|
if (typeof path === 'string') {
|
|
var lookup = FS.lookupPath(path, { follow: !dontFollow });
|
|
node = lookup.node;
|
|
} else {
|
|
node = path;
|
|
}
|
|
if (!node.node_ops.setattr) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
}
|
|
node.node_ops.setattr(node, {
|
|
timestamp: Date.now()
|
|
// we ignore the uid / gid for now
|
|
});
|
|
},lchown:function (path, uid, gid) {
|
|
FS.chown(path, uid, gid, true);
|
|
},fchown:function (fd, uid, gid) {
|
|
var stream = FS.getStream(fd);
|
|
if (!stream) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
}
|
|
FS.chown(stream.node, uid, gid);
|
|
},truncate:function (path, len) {
|
|
if (len < 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
var node;
|
|
if (typeof path === 'string') {
|
|
var lookup = FS.lookupPath(path, { follow: true });
|
|
node = lookup.node;
|
|
} else {
|
|
node = path;
|
|
}
|
|
if (!node.node_ops.setattr) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EPERM);
|
|
}
|
|
if (FS.isDir(node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
|
|
}
|
|
if (!FS.isFile(node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
var err = FS.nodePermissions(node, 'w');
|
|
if (err) {
|
|
throw new FS.ErrnoError(err);
|
|
}
|
|
node.node_ops.setattr(node, {
|
|
size: len,
|
|
timestamp: Date.now()
|
|
});
|
|
},ftruncate:function (fd, len) {
|
|
var stream = FS.getStream(fd);
|
|
if (!stream) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
}
|
|
if ((stream.flags & 2097155) === 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
FS.truncate(stream.node, len);
|
|
},utime:function (path, atime, mtime) {
|
|
var lookup = FS.lookupPath(path, { follow: true });
|
|
var node = lookup.node;
|
|
node.node_ops.setattr(node, {
|
|
timestamp: Math.max(atime, mtime)
|
|
});
|
|
},open:function (path, flags, mode, fd_start, fd_end) {
|
|
if (path === "") {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
|
|
}
|
|
flags = typeof flags === 'string' ? FS.modeStringToFlags(flags) : flags;
|
|
mode = typeof mode === 'undefined' ? 438 /* 0666 */ : mode;
|
|
if ((flags & 64)) {
|
|
mode = (mode & 4095) | 32768;
|
|
} else {
|
|
mode = 0;
|
|
}
|
|
var node;
|
|
if (typeof path === 'object') {
|
|
node = path;
|
|
} else {
|
|
path = PATH.normalize(path);
|
|
try {
|
|
var lookup = FS.lookupPath(path, {
|
|
follow: !(flags & 131072)
|
|
});
|
|
node = lookup.node;
|
|
} catch (e) {
|
|
// ignore
|
|
}
|
|
}
|
|
// perhaps we need to create the node
|
|
var created = false;
|
|
if ((flags & 64)) {
|
|
if (node) {
|
|
// if O_CREAT and O_EXCL are set, error out if the node already exists
|
|
if ((flags & 128)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EEXIST);
|
|
}
|
|
} else {
|
|
// node doesn't exist, try to create it
|
|
node = FS.mknod(path, mode, 0);
|
|
created = true;
|
|
}
|
|
}
|
|
if (!node) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
|
|
}
|
|
// can't truncate a device
|
|
if (FS.isChrdev(node.mode)) {
|
|
flags &= ~512;
|
|
}
|
|
// if asked only for a directory, then this must be one
|
|
if ((flags & 65536) && !FS.isDir(node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
|
|
}
|
|
// check permissions, if this is not a file we just created now (it is ok to
|
|
// create and write to a file with read-only permissions; it is read-only
|
|
// for later use)
|
|
if (!created) {
|
|
var err = FS.mayOpen(node, flags);
|
|
if (err) {
|
|
throw new FS.ErrnoError(err);
|
|
}
|
|
}
|
|
// do truncation if necessary
|
|
if ((flags & 512)) {
|
|
FS.truncate(node, 0);
|
|
}
|
|
// we've already handled these, don't pass down to the underlying vfs
|
|
flags &= ~(128 | 512);
|
|
|
|
// register the stream with the filesystem
|
|
var stream = FS.createStream({
|
|
node: node,
|
|
path: FS.getPath(node), // we want the absolute path to the node
|
|
flags: flags,
|
|
seekable: true,
|
|
position: 0,
|
|
stream_ops: node.stream_ops,
|
|
// used by the file family libc calls (fopen, fwrite, ferror, etc.)
|
|
ungotten: [],
|
|
error: false
|
|
}, fd_start, fd_end);
|
|
// call the new stream's open function
|
|
if (stream.stream_ops.open) {
|
|
stream.stream_ops.open(stream);
|
|
}
|
|
if (Module['logReadFiles'] && !(flags & 1)) {
|
|
if (!FS.readFiles) FS.readFiles = {};
|
|
if (!(path in FS.readFiles)) {
|
|
FS.readFiles[path] = 1;
|
|
Module['printErr']('read file: ' + path);
|
|
}
|
|
}
|
|
try {
|
|
if (FS.trackingDelegate['onOpenFile']) {
|
|
var trackingFlags = 0;
|
|
if ((flags & 2097155) !== 1) {
|
|
trackingFlags |= FS.tracking.openFlags.READ;
|
|
}
|
|
if ((flags & 2097155) !== 0) {
|
|
trackingFlags |= FS.tracking.openFlags.WRITE;
|
|
}
|
|
FS.trackingDelegate['onOpenFile'](path, trackingFlags);
|
|
}
|
|
} catch(e) {
|
|
console.log("FS.trackingDelegate['onOpenFile']('"+path+"', flags) threw an exception: " + e.message);
|
|
}
|
|
return stream;
|
|
},close:function (stream) {
|
|
if (stream.getdents) stream.getdents = null; // free readdir state
|
|
try {
|
|
if (stream.stream_ops.close) {
|
|
stream.stream_ops.close(stream);
|
|
}
|
|
} catch (e) {
|
|
throw e;
|
|
} finally {
|
|
FS.closeStream(stream.fd);
|
|
}
|
|
},llseek:function (stream, offset, whence) {
|
|
if (!stream.seekable || !stream.stream_ops.llseek) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
|
|
}
|
|
stream.position = stream.stream_ops.llseek(stream, offset, whence);
|
|
stream.ungotten = [];
|
|
return stream.position;
|
|
},read:function (stream, buffer, offset, length, position) {
|
|
if (length < 0 || position < 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
if ((stream.flags & 2097155) === 1) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
}
|
|
if (FS.isDir(stream.node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
|
|
}
|
|
if (!stream.stream_ops.read) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
var seeking = true;
|
|
if (typeof position === 'undefined') {
|
|
position = stream.position;
|
|
seeking = false;
|
|
} else if (!stream.seekable) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
|
|
}
|
|
var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position);
|
|
if (!seeking) stream.position += bytesRead;
|
|
return bytesRead;
|
|
},write:function (stream, buffer, offset, length, position, canOwn) {
|
|
if (length < 0 || position < 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
if ((stream.flags & 2097155) === 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
}
|
|
if (FS.isDir(stream.node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EISDIR);
|
|
}
|
|
if (!stream.stream_ops.write) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
if (stream.flags & 1024) {
|
|
// seek to the end before writing in append mode
|
|
FS.llseek(stream, 0, 2);
|
|
}
|
|
var seeking = true;
|
|
if (typeof position === 'undefined') {
|
|
position = stream.position;
|
|
seeking = false;
|
|
} else if (!stream.seekable) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ESPIPE);
|
|
}
|
|
var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn);
|
|
if (!seeking) stream.position += bytesWritten;
|
|
try {
|
|
if (stream.path && FS.trackingDelegate['onWriteToFile']) FS.trackingDelegate['onWriteToFile'](stream.path);
|
|
} catch(e) {
|
|
console.log("FS.trackingDelegate['onWriteToFile']('"+path+"') threw an exception: " + e.message);
|
|
}
|
|
return bytesWritten;
|
|
},allocate:function (stream, offset, length) {
|
|
if (offset < 0 || length <= 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EINVAL);
|
|
}
|
|
if ((stream.flags & 2097155) === 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
}
|
|
if (!FS.isFile(stream.node.mode) && !FS.isDir(node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
|
|
}
|
|
if (!stream.stream_ops.allocate) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP);
|
|
}
|
|
stream.stream_ops.allocate(stream, offset, length);
|
|
},mmap:function (stream, buffer, offset, length, position, prot, flags) {
|
|
// TODO if PROT is PROT_WRITE, make sure we have write access
|
|
if ((stream.flags & 2097155) === 1) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EACCES);
|
|
}
|
|
if (!stream.stream_ops.mmap) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENODEV);
|
|
}
|
|
return stream.stream_ops.mmap(stream, buffer, offset, length, position, prot, flags);
|
|
},msync:function (stream, buffer, offset, length, mmapFlags) {
|
|
if (!stream || !stream.stream_ops.msync) {
|
|
return 0;
|
|
}
|
|
return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags);
|
|
},munmap:function (stream) {
|
|
return 0;
|
|
},ioctl:function (stream, cmd, arg) {
|
|
if (!stream.stream_ops.ioctl) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTTY);
|
|
}
|
|
return stream.stream_ops.ioctl(stream, cmd, arg);
|
|
},readFile:function (path, opts) {
|
|
opts = opts || {};
|
|
opts.flags = opts.flags || 'r';
|
|
opts.encoding = opts.encoding || 'binary';
|
|
if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') {
|
|
throw new Error('Invalid encoding type "' + opts.encoding + '"');
|
|
}
|
|
var ret;
|
|
var stream = FS.open(path, opts.flags);
|
|
var stat = FS.stat(path);
|
|
var length = stat.size;
|
|
var buf = new Uint8Array(length);
|
|
FS.read(stream, buf, 0, length, 0);
|
|
if (opts.encoding === 'utf8') {
|
|
ret = UTF8ArrayToString(buf, 0);
|
|
} else if (opts.encoding === 'binary') {
|
|
ret = buf;
|
|
}
|
|
FS.close(stream);
|
|
return ret;
|
|
},writeFile:function (path, data, opts) {
|
|
opts = opts || {};
|
|
opts.flags = opts.flags || 'w';
|
|
opts.encoding = opts.encoding || 'utf8';
|
|
if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') {
|
|
throw new Error('Invalid encoding type "' + opts.encoding + '"');
|
|
}
|
|
var stream = FS.open(path, opts.flags, opts.mode);
|
|
if (opts.encoding === 'utf8') {
|
|
var buf = new Uint8Array(lengthBytesUTF8(data)+1);
|
|
var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length);
|
|
FS.write(stream, buf, 0, actualNumBytes, 0, opts.canOwn);
|
|
} else if (opts.encoding === 'binary') {
|
|
FS.write(stream, data, 0, data.length, 0, opts.canOwn);
|
|
}
|
|
FS.close(stream);
|
|
},cwd:function () {
|
|
return FS.currentPath;
|
|
},chdir:function (path) {
|
|
var lookup = FS.lookupPath(path, { follow: true });
|
|
if (lookup.node === null) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOENT);
|
|
}
|
|
if (!FS.isDir(lookup.node.mode)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR);
|
|
}
|
|
var err = FS.nodePermissions(lookup.node, 'x');
|
|
if (err) {
|
|
throw new FS.ErrnoError(err);
|
|
}
|
|
FS.currentPath = lookup.path;
|
|
},createDefaultDirectories:function () {
|
|
FS.mkdir('/tmp');
|
|
FS.mkdir('/home');
|
|
FS.mkdir('/home/web_user');
|
|
},createDefaultDevices:function () {
|
|
// create /dev
|
|
FS.mkdir('/dev');
|
|
// setup /dev/null
|
|
FS.registerDevice(FS.makedev(1, 3), {
|
|
read: function() { return 0; },
|
|
write: function(stream, buffer, offset, length, pos) { return length; }
|
|
});
|
|
FS.mkdev('/dev/null', FS.makedev(1, 3));
|
|
// setup /dev/tty and /dev/tty1
|
|
// stderr needs to print output using Module['printErr']
|
|
// so we register a second tty just for it.
|
|
TTY.register(FS.makedev(5, 0), TTY.default_tty_ops);
|
|
TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops);
|
|
FS.mkdev('/dev/tty', FS.makedev(5, 0));
|
|
FS.mkdev('/dev/tty1', FS.makedev(6, 0));
|
|
// setup /dev/[u]random
|
|
var random_device;
|
|
if (typeof crypto !== 'undefined') {
|
|
// for modern web browsers
|
|
var randomBuffer = new Uint8Array(1);
|
|
random_device = function() { crypto.getRandomValues(randomBuffer); return randomBuffer[0]; };
|
|
} else if (ENVIRONMENT_IS_NODE) {
|
|
// for nodejs
|
|
random_device = function() { return require('crypto').randomBytes(1)[0]; };
|
|
} else {
|
|
// default for ES5 platforms
|
|
random_device = function() { return (Math.random()*256)|0; };
|
|
}
|
|
FS.createDevice('/dev', 'random', random_device);
|
|
FS.createDevice('/dev', 'urandom', random_device);
|
|
// we're not going to emulate the actual shm device,
|
|
// just create the tmp dirs that reside in it commonly
|
|
FS.mkdir('/dev/shm');
|
|
FS.mkdir('/dev/shm/tmp');
|
|
},createSpecialDirectories:function () {
|
|
// create /proc/self/fd which allows /proc/self/fd/6 => readlink gives the name of the stream for fd 6 (see test_unistd_ttyname)
|
|
FS.mkdir('/proc');
|
|
FS.mkdir('/proc/self');
|
|
FS.mkdir('/proc/self/fd');
|
|
FS.mount({
|
|
mount: function() {
|
|
var node = FS.createNode('/proc/self', 'fd', 16384 | 511 /* 0777 */, 73);
|
|
node.node_ops = {
|
|
lookup: function(parent, name) {
|
|
var fd = +name;
|
|
var stream = FS.getStream(fd);
|
|
if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
var ret = {
|
|
parent: null,
|
|
mount: { mountpoint: 'fake' },
|
|
node_ops: { readlink: function() { return stream.path } }
|
|
};
|
|
ret.parent = ret; // make it look like a simple root node
|
|
return ret;
|
|
}
|
|
};
|
|
return node;
|
|
}
|
|
}, {}, '/proc/self/fd');
|
|
},createStandardStreams:function () {
|
|
// TODO deprecate the old functionality of a single
|
|
// input / output callback and that utilizes FS.createDevice
|
|
// and instead require a unique set of stream ops
|
|
|
|
// by default, we symlink the standard streams to the
|
|
// default tty devices. however, if the standard streams
|
|
// have been overwritten we create a unique device for
|
|
// them instead.
|
|
if (Module['stdin']) {
|
|
FS.createDevice('/dev', 'stdin', Module['stdin']);
|
|
} else {
|
|
FS.symlink('/dev/tty', '/dev/stdin');
|
|
}
|
|
if (Module['stdout']) {
|
|
FS.createDevice('/dev', 'stdout', null, Module['stdout']);
|
|
} else {
|
|
FS.symlink('/dev/tty', '/dev/stdout');
|
|
}
|
|
if (Module['stderr']) {
|
|
FS.createDevice('/dev', 'stderr', null, Module['stderr']);
|
|
} else {
|
|
FS.symlink('/dev/tty1', '/dev/stderr');
|
|
}
|
|
|
|
// open default streams for the stdin, stdout and stderr devices
|
|
var stdin = FS.open('/dev/stdin', 'r');
|
|
assert(stdin.fd === 0, 'invalid handle for stdin (' + stdin.fd + ')');
|
|
|
|
var stdout = FS.open('/dev/stdout', 'w');
|
|
assert(stdout.fd === 1, 'invalid handle for stdout (' + stdout.fd + ')');
|
|
|
|
var stderr = FS.open('/dev/stderr', 'w');
|
|
assert(stderr.fd === 2, 'invalid handle for stderr (' + stderr.fd + ')');
|
|
},ensureErrnoError:function () {
|
|
if (FS.ErrnoError) return;
|
|
FS.ErrnoError = function ErrnoError(errno, node) {
|
|
//Module.printErr(stackTrace()); // useful for debugging
|
|
this.node = node;
|
|
this.setErrno = function(errno) {
|
|
this.errno = errno;
|
|
for (var key in ERRNO_CODES) {
|
|
if (ERRNO_CODES[key] === errno) {
|
|
this.code = key;
|
|
break;
|
|
}
|
|
}
|
|
};
|
|
this.setErrno(errno);
|
|
this.message = ERRNO_MESSAGES[errno];
|
|
if (this.stack) this.stack = demangleAll(this.stack);
|
|
};
|
|
FS.ErrnoError.prototype = new Error();
|
|
FS.ErrnoError.prototype.constructor = FS.ErrnoError;
|
|
// Some errors may happen quite a bit, to avoid overhead we reuse them (and suffer a lack of stack info)
|
|
[ERRNO_CODES.ENOENT].forEach(function(code) {
|
|
FS.genericErrors[code] = new FS.ErrnoError(code);
|
|
FS.genericErrors[code].stack = '<generic error, no stack>';
|
|
});
|
|
},staticInit:function () {
|
|
FS.ensureErrnoError();
|
|
|
|
FS.nameTable = new Array(4096);
|
|
|
|
FS.mount(MEMFS, {}, '/');
|
|
|
|
FS.createDefaultDirectories();
|
|
FS.createDefaultDevices();
|
|
FS.createSpecialDirectories();
|
|
|
|
FS.filesystems = {
|
|
'MEMFS': MEMFS,
|
|
'IDBFS': IDBFS,
|
|
'NODEFS': NODEFS,
|
|
'WORKERFS': WORKERFS,
|
|
};
|
|
},init:function (input, output, error) {
|
|
assert(!FS.init.initialized, 'FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)');
|
|
FS.init.initialized = true;
|
|
|
|
FS.ensureErrnoError();
|
|
|
|
// Allow Module.stdin etc. to provide defaults, if none explicitly passed to us here
|
|
Module['stdin'] = input || Module['stdin'];
|
|
Module['stdout'] = output || Module['stdout'];
|
|
Module['stderr'] = error || Module['stderr'];
|
|
|
|
FS.createStandardStreams();
|
|
},quit:function () {
|
|
FS.init.initialized = false;
|
|
// force-flush all streams, so we get musl std streams printed out
|
|
var fflush = Module['_fflush'];
|
|
if (fflush) fflush(0);
|
|
// close all of our streams
|
|
for (var i = 0; i < FS.streams.length; i++) {
|
|
var stream = FS.streams[i];
|
|
if (!stream) {
|
|
continue;
|
|
}
|
|
FS.close(stream);
|
|
}
|
|
},getMode:function (canRead, canWrite) {
|
|
var mode = 0;
|
|
if (canRead) mode |= 292 | 73;
|
|
if (canWrite) mode |= 146;
|
|
return mode;
|
|
},joinPath:function (parts, forceRelative) {
|
|
var path = PATH.join.apply(null, parts);
|
|
if (forceRelative && path[0] == '/') path = path.substr(1);
|
|
return path;
|
|
},absolutePath:function (relative, base) {
|
|
return PATH.resolve(base, relative);
|
|
},standardizePath:function (path) {
|
|
return PATH.normalize(path);
|
|
},findObject:function (path, dontResolveLastLink) {
|
|
var ret = FS.analyzePath(path, dontResolveLastLink);
|
|
if (ret.exists) {
|
|
return ret.object;
|
|
} else {
|
|
___setErrNo(ret.error);
|
|
return null;
|
|
}
|
|
},analyzePath:function (path, dontResolveLastLink) {
|
|
// operate from within the context of the symlink's target
|
|
try {
|
|
var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
|
|
path = lookup.path;
|
|
} catch (e) {
|
|
}
|
|
var ret = {
|
|
isRoot: false, exists: false, error: 0, name: null, path: null, object: null,
|
|
parentExists: false, parentPath: null, parentObject: null
|
|
};
|
|
try {
|
|
var lookup = FS.lookupPath(path, { parent: true });
|
|
ret.parentExists = true;
|
|
ret.parentPath = lookup.path;
|
|
ret.parentObject = lookup.node;
|
|
ret.name = PATH.basename(path);
|
|
lookup = FS.lookupPath(path, { follow: !dontResolveLastLink });
|
|
ret.exists = true;
|
|
ret.path = lookup.path;
|
|
ret.object = lookup.node;
|
|
ret.name = lookup.node.name;
|
|
ret.isRoot = lookup.path === '/';
|
|
} catch (e) {
|
|
ret.error = e.errno;
|
|
};
|
|
return ret;
|
|
},createFolder:function (parent, name, canRead, canWrite) {
|
|
var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
|
|
var mode = FS.getMode(canRead, canWrite);
|
|
return FS.mkdir(path, mode);
|
|
},createPath:function (parent, path, canRead, canWrite) {
|
|
parent = typeof parent === 'string' ? parent : FS.getPath(parent);
|
|
var parts = path.split('/').reverse();
|
|
while (parts.length) {
|
|
var part = parts.pop();
|
|
if (!part) continue;
|
|
var current = PATH.join2(parent, part);
|
|
try {
|
|
FS.mkdir(current);
|
|
} catch (e) {
|
|
// ignore EEXIST
|
|
}
|
|
parent = current;
|
|
}
|
|
return current;
|
|
},createFile:function (parent, name, properties, canRead, canWrite) {
|
|
var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
|
|
var mode = FS.getMode(canRead, canWrite);
|
|
return FS.create(path, mode);
|
|
},createDataFile:function (parent, name, data, canRead, canWrite, canOwn) {
|
|
var path = name ? PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name) : parent;
|
|
var mode = FS.getMode(canRead, canWrite);
|
|
var node = FS.create(path, mode);
|
|
if (data) {
|
|
if (typeof data === 'string') {
|
|
var arr = new Array(data.length);
|
|
for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i);
|
|
data = arr;
|
|
}
|
|
// make sure we can write to the file
|
|
FS.chmod(node, mode | 146);
|
|
var stream = FS.open(node, 'w');
|
|
FS.write(stream, data, 0, data.length, 0, canOwn);
|
|
FS.close(stream);
|
|
FS.chmod(node, mode);
|
|
}
|
|
return node;
|
|
},createDevice:function (parent, name, input, output) {
|
|
var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
|
|
var mode = FS.getMode(!!input, !!output);
|
|
if (!FS.createDevice.major) FS.createDevice.major = 64;
|
|
var dev = FS.makedev(FS.createDevice.major++, 0);
|
|
// Create a fake device that a set of stream ops to emulate
|
|
// the old behavior.
|
|
FS.registerDevice(dev, {
|
|
open: function(stream) {
|
|
stream.seekable = false;
|
|
},
|
|
close: function(stream) {
|
|
// flush any pending line data
|
|
if (output && output.buffer && output.buffer.length) {
|
|
output(10);
|
|
}
|
|
},
|
|
read: function(stream, buffer, offset, length, pos /* ignored */) {
|
|
var bytesRead = 0;
|
|
for (var i = 0; i < length; i++) {
|
|
var result;
|
|
try {
|
|
result = input();
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO);
|
|
}
|
|
if (result === undefined && bytesRead === 0) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EAGAIN);
|
|
}
|
|
if (result === null || result === undefined) break;
|
|
bytesRead++;
|
|
buffer[offset+i] = result;
|
|
}
|
|
if (bytesRead) {
|
|
stream.node.timestamp = Date.now();
|
|
}
|
|
return bytesRead;
|
|
},
|
|
write: function(stream, buffer, offset, length, pos) {
|
|
for (var i = 0; i < length; i++) {
|
|
try {
|
|
output(buffer[offset+i]);
|
|
} catch (e) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO);
|
|
}
|
|
}
|
|
if (length) {
|
|
stream.node.timestamp = Date.now();
|
|
}
|
|
return i;
|
|
}
|
|
});
|
|
return FS.mkdev(path, mode, dev);
|
|
},createLink:function (parent, name, target, canRead, canWrite) {
|
|
var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name);
|
|
return FS.symlink(target, path);
|
|
},forceLoadFile:function (obj) {
|
|
if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true;
|
|
var success = true;
|
|
if (typeof XMLHttpRequest !== 'undefined') {
|
|
throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread.");
|
|
} else if (Module['read']) {
|
|
// Command-line.
|
|
try {
|
|
// WARNING: Can't read binary files in V8's d8 or tracemonkey's js, as
|
|
// read() will try to parse UTF8.
|
|
obj.contents = intArrayFromString(Module['read'](obj.url), true);
|
|
obj.usedBytes = obj.contents.length;
|
|
} catch (e) {
|
|
success = false;
|
|
}
|
|
} else {
|
|
throw new Error('Cannot load without read() or XMLHttpRequest.');
|
|
}
|
|
if (!success) ___setErrNo(ERRNO_CODES.EIO);
|
|
return success;
|
|
},createLazyFile:function (parent, name, url, canRead, canWrite) {
|
|
// Lazy chunked Uint8Array (implements get and length from Uint8Array). Actual getting is abstracted away for eventual reuse.
|
|
function LazyUint8Array() {
|
|
this.lengthKnown = false;
|
|
this.chunks = []; // Loaded chunks. Index is the chunk number
|
|
}
|
|
LazyUint8Array.prototype.get = function LazyUint8Array_get(idx) {
|
|
if (idx > this.length-1 || idx < 0) {
|
|
return undefined;
|
|
}
|
|
var chunkOffset = idx % this.chunkSize;
|
|
var chunkNum = (idx / this.chunkSize)|0;
|
|
return this.getter(chunkNum)[chunkOffset];
|
|
}
|
|
LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) {
|
|
this.getter = getter;
|
|
}
|
|
LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() {
|
|
// Find length
|
|
var xhr = new XMLHttpRequest();
|
|
xhr.open('HEAD', url, false);
|
|
xhr.send(null);
|
|
if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
|
|
var datalength = Number(xhr.getResponseHeader("Content-length"));
|
|
var header;
|
|
var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes";
|
|
var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip";
|
|
|
|
var chunkSize = 1024*1024; // Chunk size in bytes
|
|
|
|
if (!hasByteServing) chunkSize = datalength;
|
|
|
|
// Function to get a range from the remote URL.
|
|
var doXHR = (function(from, to) {
|
|
if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!");
|
|
if (to > datalength-1) throw new Error("only " + datalength + " bytes available! programmer error!");
|
|
|
|
// TODO: Use mozResponseArrayBuffer, responseStream, etc. if available.
|
|
var xhr = new XMLHttpRequest();
|
|
xhr.open('GET', url, false);
|
|
if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to);
|
|
|
|
// Some hints to the browser that we want binary data.
|
|
if (typeof Uint8Array != 'undefined') xhr.responseType = 'arraybuffer';
|
|
if (xhr.overrideMimeType) {
|
|
xhr.overrideMimeType('text/plain; charset=x-user-defined');
|
|
}
|
|
|
|
xhr.send(null);
|
|
if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status);
|
|
if (xhr.response !== undefined) {
|
|
return new Uint8Array(xhr.response || []);
|
|
} else {
|
|
return intArrayFromString(xhr.responseText || '', true);
|
|
}
|
|
});
|
|
var lazyArray = this;
|
|
lazyArray.setDataGetter(function(chunkNum) {
|
|
var start = chunkNum * chunkSize;
|
|
var end = (chunkNum+1) * chunkSize - 1; // including this byte
|
|
end = Math.min(end, datalength-1); // if datalength-1 is selected, this is the last block
|
|
if (typeof(lazyArray.chunks[chunkNum]) === "undefined") {
|
|
lazyArray.chunks[chunkNum] = doXHR(start, end);
|
|
}
|
|
if (typeof(lazyArray.chunks[chunkNum]) === "undefined") throw new Error("doXHR failed!");
|
|
return lazyArray.chunks[chunkNum];
|
|
});
|
|
|
|
if (usesGzip || !datalength) {
|
|
// if the server uses gzip or doesn't supply the length, we have to download the whole file to get the (uncompressed) length
|
|
chunkSize = datalength = 1; // this will force getter(0)/doXHR do download the whole file
|
|
datalength = this.getter(0).length;
|
|
chunkSize = datalength;
|
|
console.log("LazyFiles on gzip forces download of the whole file when length is accessed");
|
|
}
|
|
|
|
this._length = datalength;
|
|
this._chunkSize = chunkSize;
|
|
this.lengthKnown = true;
|
|
}
|
|
if (typeof XMLHttpRequest !== 'undefined') {
|
|
if (!ENVIRONMENT_IS_WORKER) throw 'Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc';
|
|
var lazyArray = new LazyUint8Array();
|
|
Object.defineProperties(lazyArray, {
|
|
length: {
|
|
get: function() {
|
|
if(!this.lengthKnown) {
|
|
this.cacheLength();
|
|
}
|
|
return this._length;
|
|
}
|
|
},
|
|
chunkSize: {
|
|
get: function() {
|
|
if(!this.lengthKnown) {
|
|
this.cacheLength();
|
|
}
|
|
return this._chunkSize;
|
|
}
|
|
}
|
|
});
|
|
|
|
var properties = { isDevice: false, contents: lazyArray };
|
|
} else {
|
|
var properties = { isDevice: false, url: url };
|
|
}
|
|
|
|
var node = FS.createFile(parent, name, properties, canRead, canWrite);
|
|
// This is a total hack, but I want to get this lazy file code out of the
|
|
// core of MEMFS. If we want to keep this lazy file concept I feel it should
|
|
// be its own thin LAZYFS proxying calls to MEMFS.
|
|
if (properties.contents) {
|
|
node.contents = properties.contents;
|
|
} else if (properties.url) {
|
|
node.contents = null;
|
|
node.url = properties.url;
|
|
}
|
|
// Add a function that defers querying the file size until it is asked the first time.
|
|
Object.defineProperties(node, {
|
|
usedBytes: {
|
|
get: function() { return this.contents.length; }
|
|
}
|
|
});
|
|
// override each stream op with one that tries to force load the lazy file first
|
|
var stream_ops = {};
|
|
var keys = Object.keys(node.stream_ops);
|
|
keys.forEach(function(key) {
|
|
var fn = node.stream_ops[key];
|
|
stream_ops[key] = function forceLoadLazyFile() {
|
|
if (!FS.forceLoadFile(node)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO);
|
|
}
|
|
return fn.apply(null, arguments);
|
|
};
|
|
});
|
|
// use a custom read function
|
|
stream_ops.read = function stream_ops_read(stream, buffer, offset, length, position) {
|
|
if (!FS.forceLoadFile(node)) {
|
|
throw new FS.ErrnoError(ERRNO_CODES.EIO);
|
|
}
|
|
var contents = stream.node.contents;
|
|
if (position >= contents.length)
|
|
return 0;
|
|
var size = Math.min(contents.length - position, length);
|
|
assert(size >= 0);
|
|
if (contents.slice) { // normal array
|
|
for (var i = 0; i < size; i++) {
|
|
buffer[offset + i] = contents[position + i];
|
|
}
|
|
} else {
|
|
for (var i = 0; i < size; i++) { // LazyUint8Array from sync binary XHR
|
|
buffer[offset + i] = contents.get(position + i);
|
|
}
|
|
}
|
|
return size;
|
|
};
|
|
node.stream_ops = stream_ops;
|
|
return node;
|
|
},createPreloadedFile:function (parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) {
|
|
Browser.init(); // XXX perhaps this method should move onto Browser?
|
|
// TODO we should allow people to just pass in a complete filename instead
|
|
// of parent and name being that we just join them anyways
|
|
var fullname = name ? PATH.resolve(PATH.join2(parent, name)) : parent;
|
|
var dep = getUniqueRunDependency('cp ' + fullname); // might have several active requests for the same fullname
|
|
function processData(byteArray) {
|
|
function finish(byteArray) {
|
|
if (preFinish) preFinish();
|
|
if (!dontCreateFile) {
|
|
FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn);
|
|
}
|
|
if (onload) onload();
|
|
removeRunDependency(dep);
|
|
}
|
|
var handled = false;
|
|
Module['preloadPlugins'].forEach(function(plugin) {
|
|
if (handled) return;
|
|
if (plugin['canHandle'](fullname)) {
|
|
plugin['handle'](byteArray, fullname, finish, function() {
|
|
if (onerror) onerror();
|
|
removeRunDependency(dep);
|
|
});
|
|
handled = true;
|
|
}
|
|
});
|
|
if (!handled) finish(byteArray);
|
|
}
|
|
addRunDependency(dep);
|
|
if (typeof url == 'string') {
|
|
Browser.asyncLoad(url, function(byteArray) {
|
|
processData(byteArray);
|
|
}, onerror);
|
|
} else {
|
|
processData(url);
|
|
}
|
|
},indexedDB:function () {
|
|
return window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB;
|
|
},DB_NAME:function () {
|
|
return 'EM_FS_' + window.location.pathname;
|
|
},DB_VERSION:20,DB_STORE_NAME:"FILE_DATA",saveFilesToDB:function (paths, onload, onerror) {
|
|
onload = onload || function(){};
|
|
onerror = onerror || function(){};
|
|
var indexedDB = FS.indexedDB();
|
|
try {
|
|
var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION);
|
|
} catch (e) {
|
|
return onerror(e);
|
|
}
|
|
openRequest.onupgradeneeded = function openRequest_onupgradeneeded() {
|
|
console.log('creating db');
|
|
var db = openRequest.result;
|
|
db.createObjectStore(FS.DB_STORE_NAME);
|
|
};
|
|
openRequest.onsuccess = function openRequest_onsuccess() {
|
|
var db = openRequest.result;
|
|
var transaction = db.transaction([FS.DB_STORE_NAME], 'readwrite');
|
|
var files = transaction.objectStore(FS.DB_STORE_NAME);
|
|
var ok = 0, fail = 0, total = paths.length;
|
|
function finish() {
|
|
if (fail == 0) onload(); else onerror();
|
|
}
|
|
paths.forEach(function(path) {
|
|
var putRequest = files.put(FS.analyzePath(path).object.contents, path);
|
|
putRequest.onsuccess = function putRequest_onsuccess() { ok++; if (ok + fail == total) finish() };
|
|
putRequest.onerror = function putRequest_onerror() { fail++; if (ok + fail == total) finish() };
|
|
});
|
|
transaction.onerror = onerror;
|
|
};
|
|
openRequest.onerror = onerror;
|
|
},loadFilesFromDB:function (paths, onload, onerror) {
|
|
onload = onload || function(){};
|
|
onerror = onerror || function(){};
|
|
var indexedDB = FS.indexedDB();
|
|
try {
|
|
var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION);
|
|
} catch (e) {
|
|
return onerror(e);
|
|
}
|
|
openRequest.onupgradeneeded = onerror; // no database to load from
|
|
openRequest.onsuccess = function openRequest_onsuccess() {
|
|
var db = openRequest.result;
|
|
try {
|
|
var transaction = db.transaction([FS.DB_STORE_NAME], 'readonly');
|
|
} catch(e) {
|
|
onerror(e);
|
|
return;
|
|
}
|
|
var files = transaction.objectStore(FS.DB_STORE_NAME);
|
|
var ok = 0, fail = 0, total = paths.length;
|
|
function finish() {
|
|
if (fail == 0) onload(); else onerror();
|
|
}
|
|
paths.forEach(function(path) {
|
|
var getRequest = files.get(path);
|
|
getRequest.onsuccess = function getRequest_onsuccess() {
|
|
if (FS.analyzePath(path).exists) {
|
|
FS.unlink(path);
|
|
}
|
|
FS.createDataFile(PATH.dirname(path), PATH.basename(path), getRequest.result, true, true, true);
|
|
ok++;
|
|
if (ok + fail == total) finish();
|
|
};
|
|
getRequest.onerror = function getRequest_onerror() { fail++; if (ok + fail == total) finish() };
|
|
});
|
|
transaction.onerror = onerror;
|
|
};
|
|
openRequest.onerror = onerror;
|
|
}};var SYSCALLS={DEFAULT_POLLMASK:5,mappings:{},umask:511,calculateAt:function (dirfd, path) {
|
|
if (path[0] !== '/') {
|
|
// relative path
|
|
var dir;
|
|
if (dirfd === -100) {
|
|
dir = FS.cwd();
|
|
} else {
|
|
var dirstream = FS.getStream(dirfd);
|
|
if (!dirstream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
dir = dirstream.path;
|
|
}
|
|
path = PATH.join2(dir, path);
|
|
}
|
|
return path;
|
|
},doStat:function (func, path, buf) {
|
|
try {
|
|
var stat = func(path);
|
|
} catch (e) {
|
|
if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) {
|
|
// an error occurred while trying to look up the path; we should just report ENOTDIR
|
|
return -ERRNO_CODES.ENOTDIR;
|
|
}
|
|
throw e;
|
|
}
|
|
HEAP32[((buf)>>2)]=stat.dev;
|
|
HEAP32[(((buf)+(4))>>2)]=0;
|
|
HEAP32[(((buf)+(8))>>2)]=stat.ino;
|
|
HEAP32[(((buf)+(12))>>2)]=stat.mode;
|
|
HEAP32[(((buf)+(16))>>2)]=stat.nlink;
|
|
HEAP32[(((buf)+(20))>>2)]=stat.uid;
|
|
HEAP32[(((buf)+(24))>>2)]=stat.gid;
|
|
HEAP32[(((buf)+(28))>>2)]=stat.rdev;
|
|
HEAP32[(((buf)+(32))>>2)]=0;
|
|
HEAP32[(((buf)+(36))>>2)]=stat.size;
|
|
HEAP32[(((buf)+(40))>>2)]=4096;
|
|
HEAP32[(((buf)+(44))>>2)]=stat.blocks;
|
|
HEAP32[(((buf)+(48))>>2)]=(stat.atime.getTime() / 1000)|0;
|
|
HEAP32[(((buf)+(52))>>2)]=0;
|
|
HEAP32[(((buf)+(56))>>2)]=(stat.mtime.getTime() / 1000)|0;
|
|
HEAP32[(((buf)+(60))>>2)]=0;
|
|
HEAP32[(((buf)+(64))>>2)]=(stat.ctime.getTime() / 1000)|0;
|
|
HEAP32[(((buf)+(68))>>2)]=0;
|
|
HEAP32[(((buf)+(72))>>2)]=stat.ino;
|
|
return 0;
|
|
},doMsync:function (addr, stream, len, flags) {
|
|
var buffer = new Uint8Array(HEAPU8.subarray(addr, addr + len));
|
|
FS.msync(stream, buffer, 0, len, flags);
|
|
},doMkdir:function (path, mode) {
|
|
// remove a trailing slash, if one - /a/b/ has basename of '', but
|
|
// we want to create b in the context of this function
|
|
path = PATH.normalize(path);
|
|
if (path[path.length-1] === '/') path = path.substr(0, path.length-1);
|
|
FS.mkdir(path, mode, 0);
|
|
return 0;
|
|
},doMknod:function (path, mode, dev) {
|
|
// we don't want this in the JS API as it uses mknod to create all nodes.
|
|
switch (mode & 61440) {
|
|
case 32768:
|
|
case 8192:
|
|
case 24576:
|
|
case 4096:
|
|
case 49152:
|
|
break;
|
|
default: return -ERRNO_CODES.EINVAL;
|
|
}
|
|
FS.mknod(path, mode, dev);
|
|
return 0;
|
|
},doReadlink:function (path, buf, bufsize) {
|
|
if (bufsize <= 0) return -ERRNO_CODES.EINVAL;
|
|
var ret = FS.readlink(path);
|
|
|
|
var len = Math.min(bufsize, lengthBytesUTF8(ret));
|
|
var endChar = HEAP8[buf+len];
|
|
stringToUTF8(ret, buf, bufsize+1);
|
|
// readlink is one of the rare functions that write out a C string, but does never append a null to the output buffer(!)
|
|
// stringToUTF8() always appends a null byte, so restore the character under the null byte after the write.
|
|
HEAP8[buf+len] = endChar;
|
|
|
|
return len;
|
|
},doAccess:function (path, amode) {
|
|
if (amode & ~7) {
|
|
// need a valid mode
|
|
return -ERRNO_CODES.EINVAL;
|
|
}
|
|
var node;
|
|
var lookup = FS.lookupPath(path, { follow: true });
|
|
node = lookup.node;
|
|
var perms = '';
|
|
if (amode & 4) perms += 'r';
|
|
if (amode & 2) perms += 'w';
|
|
if (amode & 1) perms += 'x';
|
|
if (perms /* otherwise, they've just passed F_OK */ && FS.nodePermissions(node, perms)) {
|
|
return -ERRNO_CODES.EACCES;
|
|
}
|
|
return 0;
|
|
},doDup:function (path, flags, suggestFD) {
|
|
var suggest = FS.getStream(suggestFD);
|
|
if (suggest) FS.close(suggest);
|
|
return FS.open(path, flags, 0, suggestFD, suggestFD).fd;
|
|
},doReadv:function (stream, iov, iovcnt, offset) {
|
|
var ret = 0;
|
|
for (var i = 0; i < iovcnt; i++) {
|
|
var ptr = HEAP32[(((iov)+(i*8))>>2)];
|
|
var len = HEAP32[(((iov)+(i*8 + 4))>>2)];
|
|
var curr = FS.read(stream, HEAP8,ptr, len, offset);
|
|
if (curr < 0) return -1;
|
|
ret += curr;
|
|
if (curr < len) break; // nothing more to read
|
|
}
|
|
return ret;
|
|
},doWritev:function (stream, iov, iovcnt, offset) {
|
|
var ret = 0;
|
|
for (var i = 0; i < iovcnt; i++) {
|
|
var ptr = HEAP32[(((iov)+(i*8))>>2)];
|
|
var len = HEAP32[(((iov)+(i*8 + 4))>>2)];
|
|
var curr = FS.write(stream, HEAP8,ptr, len, offset);
|
|
if (curr < 0) return -1;
|
|
ret += curr;
|
|
}
|
|
return ret;
|
|
},varargs:0,get:function (varargs) {
|
|
SYSCALLS.varargs += 4;
|
|
var ret = HEAP32[(((SYSCALLS.varargs)-(4))>>2)];
|
|
return ret;
|
|
},getStr:function () {
|
|
var ret = Pointer_stringify(SYSCALLS.get());
|
|
return ret;
|
|
},getStreamFromFD:function () {
|
|
var stream = FS.getStream(SYSCALLS.get());
|
|
if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
return stream;
|
|
},getSocketFromFD:function () {
|
|
var socket = SOCKFS.getSocket(SYSCALLS.get());
|
|
if (!socket) throw new FS.ErrnoError(ERRNO_CODES.EBADF);
|
|
return socket;
|
|
},getSocketAddress:function (allowNull) {
|
|
var addrp = SYSCALLS.get(), addrlen = SYSCALLS.get();
|
|
if (allowNull && addrp === 0) return null;
|
|
var info = __read_sockaddr(addrp, addrlen);
|
|
if (info.errno) throw new FS.ErrnoError(info.errno);
|
|
info.addr = DNS.lookup_addr(info.addr) || info.addr;
|
|
return info;
|
|
},get64:function () {
|
|
var low = SYSCALLS.get(), high = SYSCALLS.get();
|
|
if (low >= 0) assert(high === 0);
|
|
else assert(high === -1);
|
|
return low;
|
|
},getZero:function () {
|
|
assert(SYSCALLS.get() === 0);
|
|
}};function ___syscall54(which, varargs) {if (ENVIRONMENT_IS_PTHREAD) { return _emscripten_sync_run_in_main_thread_2(138, 54, varargs) }
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
// ioctl
|
|
var stream = SYSCALLS.getStreamFromFD(), op = SYSCALLS.get();
|
|
switch (op) {
|
|
case 21505: {
|
|
if (!stream.tty) return -ERRNO_CODES.ENOTTY;
|
|
return 0;
|
|
}
|
|
case 21506: {
|
|
if (!stream.tty) return -ERRNO_CODES.ENOTTY;
|
|
return 0; // no-op, not actually adjusting terminal settings
|
|
}
|
|
case 21519: {
|
|
if (!stream.tty) return -ERRNO_CODES.ENOTTY;
|
|
var argp = SYSCALLS.get();
|
|
HEAP32[((argp)>>2)]=0;
|
|
return 0;
|
|
}
|
|
case 21520: {
|
|
if (!stream.tty) return -ERRNO_CODES.ENOTTY;
|
|
return -ERRNO_CODES.EINVAL; // not supported
|
|
}
|
|
case 21531: {
|
|
var argp = SYSCALLS.get();
|
|
return FS.ioctl(stream, op, argp);
|
|
}
|
|
case 21523: {
|
|
// TODO: in theory we should write to the winsize struct that gets
|
|
// passed in, but for now musl doesn't read anything on it
|
|
if (!stream.tty) return -ERRNO_CODES.ENOTTY;
|
|
return 0;
|
|
}
|
|
default: abort('bad ioctl syscall ' + op);
|
|
}
|
|
} catch (e) {
|
|
if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
|
|
function _emscripten_glSampleCoverage(value, invert) {
|
|
GLctx.sampleCoverage(value, !!invert);
|
|
}
|
|
|
|
function _glDeleteTextures(n, textures) {
|
|
for (var i = 0; i < n; i++) {
|
|
var id = HEAP32[(((textures)+(i*4))>>2)];
|
|
var texture = GL.textures[id];
|
|
if (!texture) continue; // GL spec: "glDeleteTextures silently ignores 0s and names that do not correspond to existing textures".
|
|
GLctx.deleteTexture(texture);
|
|
texture.name = 0;
|
|
GL.textures[id] = null;
|
|
}
|
|
}
|
|
|
|
function _emscripten_glFrustum() {
|
|
Module['printErr']('missing function: emscripten_glFrustum'); abort(-1);
|
|
}
|
|
|
|
function _glfwSetWindowSizeCallback(winid, cbfun) {
|
|
GLFW.setWindowSizeCallback(winid, cbfun);
|
|
}
|
|
|
|
function _emscripten_glGetTexParameterfv(target, pname, params) {
|
|
if (!params) {
|
|
// GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
|
|
// if p == null, issue a GL error to notify user about it.
|
|
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
HEAPF32[((params)>>2)]=GLctx.getTexParameter(target, pname);
|
|
}
|
|
|
|
function _emscripten_glUniform4i(location, v0, v1, v2, v3) {
|
|
GLctx.uniform4i(GL.uniforms[location], v0, v1, v2, v3);
|
|
}
|
|
|
|
function _emscripten_glBindRenderbuffer(target, renderbuffer) {
|
|
GLctx.bindRenderbuffer(target, renderbuffer ? GL.renderbuffers[renderbuffer] : null);
|
|
}
|
|
|
|
function _emscripten_glViewport(x0, x1, x2, x3) { GLctx['viewport'](x0, x1, x2, x3) }
|
|
|
|
|
|
|
|
var JSEvents={keyEvent:0,mouseEvent:0,wheelEvent:0,uiEvent:0,focusEvent:0,deviceOrientationEvent:0,deviceMotionEvent:0,fullscreenChangeEvent:0,pointerlockChangeEvent:0,visibilityChangeEvent:0,touchEvent:0,lastGamepadState:null,lastGamepadStateFrame:null,numGamepadsConnected:0,previousFullscreenElement:null,previousScreenX:null,previousScreenY:null,removeEventListenersRegistered:false,staticInit:function () {
|
|
if (typeof window !== 'undefined') {
|
|
window.addEventListener("gamepadconnected", function() { ++JSEvents.numGamepadsConnected; });
|
|
window.addEventListener("gamepaddisconnected", function() { --JSEvents.numGamepadsConnected; });
|
|
}
|
|
},registerRemoveEventListeners:function () {
|
|
if (!JSEvents.removeEventListenersRegistered) {
|
|
__ATEXIT__.push(function() {
|
|
for(var i = JSEvents.eventHandlers.length-1; i >= 0; --i) {
|
|
JSEvents._removeHandler(i);
|
|
}
|
|
});
|
|
JSEvents.removeEventListenersRegistered = true;
|
|
}
|
|
},findEventTarget:function (target) {
|
|
if (target) {
|
|
if (typeof target == "number") {
|
|
target = Pointer_stringify(target);
|
|
}
|
|
if (target == '#window') return window;
|
|
else if (target == '#document') return document;
|
|
else if (target == '#screen') return window.screen;
|
|
else if (target == '#canvas') return Module['canvas'];
|
|
|
|
if (typeof target == 'string') return document.getElementById(target);
|
|
else return target;
|
|
} else {
|
|
// The sensible target varies between events, but use window as the default
|
|
// since DOM events mostly can default to that. Specific callback registrations
|
|
// override their own defaults.
|
|
return window;
|
|
}
|
|
},deferredCalls:[],deferCall:function (targetFunction, precedence, argsList) {
|
|
function arraysHaveEqualContent(arrA, arrB) {
|
|
if (arrA.length != arrB.length) return false;
|
|
|
|
for(var i in arrA) {
|
|
if (arrA[i] != arrB[i]) return false;
|
|
}
|
|
return true;
|
|
}
|
|
// Test if the given call was already queued, and if so, don't add it again.
|
|
for(var i in JSEvents.deferredCalls) {
|
|
var call = JSEvents.deferredCalls[i];
|
|
if (call.targetFunction == targetFunction && arraysHaveEqualContent(call.argsList, argsList)) {
|
|
return;
|
|
}
|
|
}
|
|
JSEvents.deferredCalls.push({
|
|
targetFunction: targetFunction,
|
|
precedence: precedence,
|
|
argsList: argsList
|
|
});
|
|
|
|
JSEvents.deferredCalls.sort(function(x,y) { return x.precedence < y.precedence; });
|
|
},removeDeferredCalls:function (targetFunction) {
|
|
for(var i = 0; i < JSEvents.deferredCalls.length; ++i) {
|
|
if (JSEvents.deferredCalls[i].targetFunction == targetFunction) {
|
|
JSEvents.deferredCalls.splice(i, 1);
|
|
--i;
|
|
}
|
|
}
|
|
},canPerformEventHandlerRequests:function () {
|
|
return JSEvents.inEventHandler && JSEvents.currentEventHandler.allowsDeferredCalls;
|
|
},runDeferredCalls:function () {
|
|
if (!JSEvents.canPerformEventHandlerRequests()) {
|
|
return;
|
|
}
|
|
for(var i = 0; i < JSEvents.deferredCalls.length; ++i) {
|
|
var call = JSEvents.deferredCalls[i];
|
|
JSEvents.deferredCalls.splice(i, 1);
|
|
--i;
|
|
call.targetFunction.apply(this, call.argsList);
|
|
}
|
|
},inEventHandler:0,currentEventHandler:null,eventHandlers:[],isInternetExplorer:function () { return navigator.userAgent.indexOf('MSIE') !== -1 || navigator.appVersion.indexOf('Trident/') > 0; },removeAllHandlersOnTarget:function (target, eventTypeString) {
|
|
for(var i = 0; i < JSEvents.eventHandlers.length; ++i) {
|
|
if (JSEvents.eventHandlers[i].target == target &&
|
|
(!eventTypeString || eventTypeString == JSEvents.eventHandlers[i].eventTypeString)) {
|
|
JSEvents._removeHandler(i--);
|
|
}
|
|
}
|
|
},_removeHandler:function (i) {
|
|
var h = JSEvents.eventHandlers[i];
|
|
h.target.removeEventListener(h.eventTypeString, h.eventListenerFunc, h.useCapture);
|
|
JSEvents.eventHandlers.splice(i, 1);
|
|
},registerOrRemoveHandler:function (eventHandler) {
|
|
var jsEventHandler = function jsEventHandler(event) {
|
|
// Increment nesting count for the event handler.
|
|
++JSEvents.inEventHandler;
|
|
JSEvents.currentEventHandler = eventHandler;
|
|
// Process any old deferred calls the user has placed.
|
|
JSEvents.runDeferredCalls();
|
|
// Process the actual event, calls back to user C code handler.
|
|
eventHandler.handlerFunc(event);
|
|
// Process any new deferred calls that were placed right now from this event handler.
|
|
JSEvents.runDeferredCalls();
|
|
// Out of event handler - restore nesting count.
|
|
--JSEvents.inEventHandler;
|
|
}
|
|
|
|
if (eventHandler.callbackfunc) {
|
|
eventHandler.eventListenerFunc = jsEventHandler;
|
|
eventHandler.target.addEventListener(eventHandler.eventTypeString, jsEventHandler, eventHandler.useCapture);
|
|
JSEvents.eventHandlers.push(eventHandler);
|
|
JSEvents.registerRemoveEventListeners();
|
|
} else {
|
|
for(var i = 0; i < JSEvents.eventHandlers.length; ++i) {
|
|
if (JSEvents.eventHandlers[i].target == eventHandler.target
|
|
&& JSEvents.eventHandlers[i].eventTypeString == eventHandler.eventTypeString) {
|
|
JSEvents._removeHandler(i--);
|
|
}
|
|
}
|
|
}
|
|
},registerKeyEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
|
|
if (!JSEvents.keyEvent) {
|
|
JSEvents.keyEvent = _malloc( 164 );
|
|
}
|
|
var handlerFunc = function(event) {
|
|
var e = event || window.event;
|
|
stringToUTF8(e.key ? e.key : "", JSEvents.keyEvent + 0, 32);
|
|
stringToUTF8(e.code ? e.code : "", JSEvents.keyEvent + 32, 32);
|
|
HEAP32[(((JSEvents.keyEvent)+(64))>>2)]=e.location;
|
|
HEAP32[(((JSEvents.keyEvent)+(68))>>2)]=e.ctrlKey;
|
|
HEAP32[(((JSEvents.keyEvent)+(72))>>2)]=e.shiftKey;
|
|
HEAP32[(((JSEvents.keyEvent)+(76))>>2)]=e.altKey;
|
|
HEAP32[(((JSEvents.keyEvent)+(80))>>2)]=e.metaKey;
|
|
HEAP32[(((JSEvents.keyEvent)+(84))>>2)]=e.repeat;
|
|
stringToUTF8(e.locale ? e.locale : "", JSEvents.keyEvent + 88, 32);
|
|
stringToUTF8(e.char ? e.char : "", JSEvents.keyEvent + 120, 32);
|
|
HEAP32[(((JSEvents.keyEvent)+(152))>>2)]=e.charCode;
|
|
HEAP32[(((JSEvents.keyEvent)+(156))>>2)]=e.keyCode;
|
|
HEAP32[(((JSEvents.keyEvent)+(160))>>2)]=e.which;
|
|
var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.keyEvent, userData);
|
|
if (shouldCancel) {
|
|
e.preventDefault();
|
|
}
|
|
};
|
|
|
|
var eventHandler = {
|
|
target: JSEvents.findEventTarget(target),
|
|
allowsDeferredCalls: JSEvents.isInternetExplorer() ? false : true, // MSIE doesn't allow fullscreen and pointerlock requests from key handlers, others do.
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: handlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},getBoundingClientRectOrZeros:function (target) {
|
|
return target.getBoundingClientRect ? target.getBoundingClientRect() : { left: 0, top: 0 };
|
|
},fillMouseEventData:function (eventStruct, e, target) {
|
|
HEAPF64[((eventStruct)>>3)]=JSEvents.tick();
|
|
HEAP32[(((eventStruct)+(8))>>2)]=e.screenX;
|
|
HEAP32[(((eventStruct)+(12))>>2)]=e.screenY;
|
|
HEAP32[(((eventStruct)+(16))>>2)]=e.clientX;
|
|
HEAP32[(((eventStruct)+(20))>>2)]=e.clientY;
|
|
HEAP32[(((eventStruct)+(24))>>2)]=e.ctrlKey;
|
|
HEAP32[(((eventStruct)+(28))>>2)]=e.shiftKey;
|
|
HEAP32[(((eventStruct)+(32))>>2)]=e.altKey;
|
|
HEAP32[(((eventStruct)+(36))>>2)]=e.metaKey;
|
|
HEAP16[(((eventStruct)+(40))>>1)]=e.button;
|
|
HEAP16[(((eventStruct)+(42))>>1)]=e.buttons;
|
|
HEAP32[(((eventStruct)+(44))>>2)]=e["movementX"] || e["mozMovementX"] || e["webkitMovementX"] || (e.screenX-JSEvents.previousScreenX);
|
|
HEAP32[(((eventStruct)+(48))>>2)]=e["movementY"] || e["mozMovementY"] || e["webkitMovementY"] || (e.screenY-JSEvents.previousScreenY);
|
|
|
|
if (Module['canvas']) {
|
|
var rect = Module['canvas'].getBoundingClientRect();
|
|
HEAP32[(((eventStruct)+(60))>>2)]=e.clientX - rect.left;
|
|
HEAP32[(((eventStruct)+(64))>>2)]=e.clientY - rect.top;
|
|
} else { // Canvas is not initialized, return 0.
|
|
HEAP32[(((eventStruct)+(60))>>2)]=0;
|
|
HEAP32[(((eventStruct)+(64))>>2)]=0;
|
|
}
|
|
if (target) {
|
|
var rect = JSEvents.getBoundingClientRectOrZeros(target);
|
|
HEAP32[(((eventStruct)+(52))>>2)]=e.clientX - rect.left;
|
|
HEAP32[(((eventStruct)+(56))>>2)]=e.clientY - rect.top;
|
|
} else { // No specific target passed, return 0.
|
|
HEAP32[(((eventStruct)+(52))>>2)]=0;
|
|
HEAP32[(((eventStruct)+(56))>>2)]=0;
|
|
}
|
|
// wheel and mousewheel events contain wrong screenX/screenY on chrome/opera
|
|
// https://github.com/kripken/emscripten/pull/4997
|
|
// https://bugs.chromium.org/p/chromium/issues/detail?id=699956
|
|
if (e.type !== 'wheel' && e.type !== 'mousewheel') {
|
|
JSEvents.previousScreenX = e.screenX;
|
|
JSEvents.previousScreenY = e.screenY;
|
|
}
|
|
},registerMouseEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
|
|
if (!JSEvents.mouseEvent) {
|
|
JSEvents.mouseEvent = _malloc( 72 );
|
|
}
|
|
target = JSEvents.findEventTarget(target);
|
|
var handlerFunc = function(event) {
|
|
var e = event || window.event;
|
|
JSEvents.fillMouseEventData(JSEvents.mouseEvent, e, target);
|
|
var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.mouseEvent, userData);
|
|
if (shouldCancel) {
|
|
e.preventDefault();
|
|
}
|
|
};
|
|
|
|
var eventHandler = {
|
|
target: target,
|
|
allowsDeferredCalls: eventTypeString != 'mousemove' && eventTypeString != 'mouseenter' && eventTypeString != 'mouseleave', // Mouse move events do not allow fullscreen/pointer lock requests to be handled in them!
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: handlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
// In IE, mousedown events don't either allow deferred calls to be run!
|
|
if (JSEvents.isInternetExplorer() && eventTypeString == 'mousedown') eventHandler.allowsDeferredCalls = false;
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},registerWheelEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
|
|
if (!JSEvents.wheelEvent) {
|
|
JSEvents.wheelEvent = _malloc( 104 );
|
|
}
|
|
target = JSEvents.findEventTarget(target);
|
|
// The DOM Level 3 events spec event 'wheel'
|
|
var wheelHandlerFunc = function(event) {
|
|
var e = event || window.event;
|
|
JSEvents.fillMouseEventData(JSEvents.wheelEvent, e, target);
|
|
HEAPF64[(((JSEvents.wheelEvent)+(72))>>3)]=e["deltaX"];
|
|
HEAPF64[(((JSEvents.wheelEvent)+(80))>>3)]=e["deltaY"];
|
|
HEAPF64[(((JSEvents.wheelEvent)+(88))>>3)]=e["deltaZ"];
|
|
HEAP32[(((JSEvents.wheelEvent)+(96))>>2)]=e["deltaMode"];
|
|
var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.wheelEvent, userData);
|
|
if (shouldCancel) {
|
|
e.preventDefault();
|
|
}
|
|
};
|
|
// The 'mousewheel' event as implemented in Safari 6.0.5
|
|
var mouseWheelHandlerFunc = function(event) {
|
|
var e = event || window.event;
|
|
JSEvents.fillMouseEventData(JSEvents.wheelEvent, e, target);
|
|
HEAPF64[(((JSEvents.wheelEvent)+(72))>>3)]=e["wheelDeltaX"] || 0;
|
|
HEAPF64[(((JSEvents.wheelEvent)+(80))>>3)]=-(e["wheelDeltaY"] ? e["wheelDeltaY"] : e["wheelDelta"]) /* 1. Invert to unify direction with the DOM Level 3 wheel event. 2. MSIE does not provide wheelDeltaY, so wheelDelta is used as a fallback. */;
|
|
HEAPF64[(((JSEvents.wheelEvent)+(88))>>3)]=0 /* Not available */;
|
|
HEAP32[(((JSEvents.wheelEvent)+(96))>>2)]=0 /* DOM_DELTA_PIXEL */;
|
|
var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.wheelEvent, userData);
|
|
if (shouldCancel) {
|
|
e.preventDefault();
|
|
}
|
|
};
|
|
|
|
var eventHandler = {
|
|
target: target,
|
|
allowsDeferredCalls: true,
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: (eventTypeString == 'wheel') ? wheelHandlerFunc : mouseWheelHandlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},pageScrollPos:function () {
|
|
if (window.pageXOffset > 0 || window.pageYOffset > 0) {
|
|
return [window.pageXOffset, window.pageYOffset];
|
|
}
|
|
if (typeof document.documentElement.scrollLeft !== 'undefined' || typeof document.documentElement.scrollTop !== 'undefined') {
|
|
return [document.documentElement.scrollLeft, document.documentElement.scrollTop];
|
|
}
|
|
return [document.body.scrollLeft|0, document.body.scrollTop|0];
|
|
},registerUiEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
|
|
if (!JSEvents.uiEvent) {
|
|
JSEvents.uiEvent = _malloc( 36 );
|
|
}
|
|
|
|
if (eventTypeString == "scroll" && !target) {
|
|
target = document; // By default read scroll events on document rather than window.
|
|
} else {
|
|
target = JSEvents.findEventTarget(target);
|
|
}
|
|
|
|
var handlerFunc = function(event) {
|
|
var e = event || window.event;
|
|
if (e.target != target) {
|
|
// Never take ui events such as scroll via a 'bubbled' route, but always from the direct element that
|
|
// was targeted. Otherwise e.g. if app logs a message in response to a page scroll, the Emscripten log
|
|
// message box could cause to scroll, generating a new (bubbled) scroll message, causing a new log print,
|
|
// causing a new scroll, etc..
|
|
return;
|
|
}
|
|
var scrollPos = JSEvents.pageScrollPos();
|
|
HEAP32[((JSEvents.uiEvent)>>2)]=e.detail;
|
|
HEAP32[(((JSEvents.uiEvent)+(4))>>2)]=document.body.clientWidth;
|
|
HEAP32[(((JSEvents.uiEvent)+(8))>>2)]=document.body.clientHeight;
|
|
HEAP32[(((JSEvents.uiEvent)+(12))>>2)]=window.innerWidth;
|
|
HEAP32[(((JSEvents.uiEvent)+(16))>>2)]=window.innerHeight;
|
|
HEAP32[(((JSEvents.uiEvent)+(20))>>2)]=window.outerWidth;
|
|
HEAP32[(((JSEvents.uiEvent)+(24))>>2)]=window.outerHeight;
|
|
HEAP32[(((JSEvents.uiEvent)+(28))>>2)]=scrollPos[0];
|
|
HEAP32[(((JSEvents.uiEvent)+(32))>>2)]=scrollPos[1];
|
|
var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.uiEvent, userData);
|
|
if (shouldCancel) {
|
|
e.preventDefault();
|
|
}
|
|
};
|
|
|
|
var eventHandler = {
|
|
target: target,
|
|
allowsDeferredCalls: false, // Neither scroll or resize events allow running requests inside them.
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: handlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},getNodeNameForTarget:function (target) {
|
|
if (!target) return '';
|
|
if (target == window) return '#window';
|
|
if (target == window.screen) return '#screen';
|
|
return (target && target.nodeName) ? target.nodeName : '';
|
|
},registerFocusEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
|
|
if (!JSEvents.focusEvent) {
|
|
JSEvents.focusEvent = _malloc( 256 );
|
|
}
|
|
var handlerFunc = function(event) {
|
|
var e = event || window.event;
|
|
|
|
var nodeName = JSEvents.getNodeNameForTarget(e.target);
|
|
var id = e.target.id ? e.target.id : '';
|
|
stringToUTF8(nodeName, JSEvents.focusEvent + 0, 128);
|
|
stringToUTF8(id, JSEvents.focusEvent + 128, 128);
|
|
var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.focusEvent, userData);
|
|
if (shouldCancel) {
|
|
e.preventDefault();
|
|
}
|
|
};
|
|
|
|
var eventHandler = {
|
|
target: JSEvents.findEventTarget(target),
|
|
allowsDeferredCalls: false,
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: handlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},tick:function () {
|
|
if (window['performance'] && window['performance']['now']) return window['performance']['now']();
|
|
else return Date.now();
|
|
},registerDeviceOrientationEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
|
|
if (!JSEvents.deviceOrientationEvent) {
|
|
JSEvents.deviceOrientationEvent = _malloc( 40 );
|
|
}
|
|
var handlerFunc = function(event) {
|
|
var e = event || window.event;
|
|
|
|
HEAPF64[((JSEvents.deviceOrientationEvent)>>3)]=JSEvents.tick();
|
|
HEAPF64[(((JSEvents.deviceOrientationEvent)+(8))>>3)]=e.alpha;
|
|
HEAPF64[(((JSEvents.deviceOrientationEvent)+(16))>>3)]=e.beta;
|
|
HEAPF64[(((JSEvents.deviceOrientationEvent)+(24))>>3)]=e.gamma;
|
|
HEAP32[(((JSEvents.deviceOrientationEvent)+(32))>>2)]=e.absolute;
|
|
|
|
var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.deviceOrientationEvent, userData);
|
|
if (shouldCancel) {
|
|
e.preventDefault();
|
|
}
|
|
};
|
|
|
|
var eventHandler = {
|
|
target: JSEvents.findEventTarget(target),
|
|
allowsDeferredCalls: false,
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: handlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},registerDeviceMotionEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
|
|
if (!JSEvents.deviceMotionEvent) {
|
|
JSEvents.deviceMotionEvent = _malloc( 80 );
|
|
}
|
|
var handlerFunc = function(event) {
|
|
var e = event || window.event;
|
|
|
|
HEAPF64[((JSEvents.deviceOrientationEvent)>>3)]=JSEvents.tick();
|
|
HEAPF64[(((JSEvents.deviceMotionEvent)+(8))>>3)]=e.acceleration.x;
|
|
HEAPF64[(((JSEvents.deviceMotionEvent)+(16))>>3)]=e.acceleration.y;
|
|
HEAPF64[(((JSEvents.deviceMotionEvent)+(24))>>3)]=e.acceleration.z;
|
|
HEAPF64[(((JSEvents.deviceMotionEvent)+(32))>>3)]=e.accelerationIncludingGravity.x;
|
|
HEAPF64[(((JSEvents.deviceMotionEvent)+(40))>>3)]=e.accelerationIncludingGravity.y;
|
|
HEAPF64[(((JSEvents.deviceMotionEvent)+(48))>>3)]=e.accelerationIncludingGravity.z;
|
|
HEAPF64[(((JSEvents.deviceMotionEvent)+(56))>>3)]=e.rotationRate.alpha;
|
|
HEAPF64[(((JSEvents.deviceMotionEvent)+(64))>>3)]=e.rotationRate.beta;
|
|
HEAPF64[(((JSEvents.deviceMotionEvent)+(72))>>3)]=e.rotationRate.gamma;
|
|
|
|
var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.deviceMotionEvent, userData);
|
|
if (shouldCancel) {
|
|
e.preventDefault();
|
|
}
|
|
};
|
|
|
|
var eventHandler = {
|
|
target: JSEvents.findEventTarget(target),
|
|
allowsDeferredCalls: false,
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: handlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},screenOrientation:function () {
|
|
if (!window.screen) return undefined;
|
|
return window.screen.orientation || window.screen.mozOrientation || window.screen.webkitOrientation || window.screen.msOrientation;
|
|
},fillOrientationChangeEventData:function (eventStruct, e) {
|
|
var orientations = ["portrait-primary", "portrait-secondary", "landscape-primary", "landscape-secondary"];
|
|
var orientations2 = ["portrait", "portrait", "landscape", "landscape"];
|
|
|
|
var orientationString = JSEvents.screenOrientation();
|
|
var orientation = orientations.indexOf(orientationString);
|
|
if (orientation == -1) {
|
|
orientation = orientations2.indexOf(orientationString);
|
|
}
|
|
|
|
HEAP32[((eventStruct)>>2)]=1 << orientation;
|
|
HEAP32[(((eventStruct)+(4))>>2)]=window.orientation;
|
|
},registerOrientationChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
|
|
if (!JSEvents.orientationChangeEvent) {
|
|
JSEvents.orientationChangeEvent = _malloc( 8 );
|
|
}
|
|
|
|
if (!target) {
|
|
target = window.screen; // Orientation events need to be captured from 'window.screen' instead of 'window'
|
|
} else {
|
|
target = JSEvents.findEventTarget(target);
|
|
}
|
|
|
|
var handlerFunc = function(event) {
|
|
var e = event || window.event;
|
|
|
|
JSEvents.fillOrientationChangeEventData(JSEvents.orientationChangeEvent, e);
|
|
|
|
var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.orientationChangeEvent, userData);
|
|
if (shouldCancel) {
|
|
e.preventDefault();
|
|
}
|
|
};
|
|
|
|
if (eventTypeString == "orientationchange" && window.screen.mozOrientation !== undefined) {
|
|
eventTypeString = "mozorientationchange";
|
|
}
|
|
|
|
var eventHandler = {
|
|
target: target,
|
|
allowsDeferredCalls: false,
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: handlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},fullscreenEnabled:function () {
|
|
return document.fullscreenEnabled || document.mozFullScreenEnabled || document.webkitFullscreenEnabled || document.msFullscreenEnabled;
|
|
},fillFullscreenChangeEventData:function (eventStruct, e) {
|
|
var fullscreenElement = document.fullscreenElement || document.mozFullScreenElement || document.webkitFullscreenElement || document.msFullscreenElement;
|
|
var isFullscreen = !!fullscreenElement;
|
|
HEAP32[((eventStruct)>>2)]=isFullscreen;
|
|
HEAP32[(((eventStruct)+(4))>>2)]=JSEvents.fullscreenEnabled();
|
|
// If transitioning to fullscreen, report info about the element that is now fullscreen.
|
|
// If transitioning to windowed mode, report info about the element that just was fullscreen.
|
|
var reportedElement = isFullscreen ? fullscreenElement : JSEvents.previousFullscreenElement;
|
|
var nodeName = JSEvents.getNodeNameForTarget(reportedElement);
|
|
var id = (reportedElement && reportedElement.id) ? reportedElement.id : '';
|
|
stringToUTF8(nodeName, eventStruct + 8, 128);
|
|
stringToUTF8(id, eventStruct + 136, 128);
|
|
HEAP32[(((eventStruct)+(264))>>2)]=reportedElement ? reportedElement.clientWidth : 0;
|
|
HEAP32[(((eventStruct)+(268))>>2)]=reportedElement ? reportedElement.clientHeight : 0;
|
|
HEAP32[(((eventStruct)+(272))>>2)]=screen.width;
|
|
HEAP32[(((eventStruct)+(276))>>2)]=screen.height;
|
|
if (isFullscreen) {
|
|
JSEvents.previousFullscreenElement = fullscreenElement;
|
|
}
|
|
},registerFullscreenChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
|
|
if (!JSEvents.fullscreenChangeEvent) {
|
|
JSEvents.fullscreenChangeEvent = _malloc( 280 );
|
|
}
|
|
|
|
if (!target) {
|
|
target = document; // Fullscreen change events need to be captured from 'document' by default instead of 'window'
|
|
} else {
|
|
target = JSEvents.findEventTarget(target);
|
|
}
|
|
|
|
var handlerFunc = function(event) {
|
|
var e = event || window.event;
|
|
|
|
JSEvents.fillFullscreenChangeEventData(JSEvents.fullscreenChangeEvent, e);
|
|
|
|
var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.fullscreenChangeEvent, userData);
|
|
if (shouldCancel) {
|
|
e.preventDefault();
|
|
}
|
|
};
|
|
|
|
var eventHandler = {
|
|
target: target,
|
|
allowsDeferredCalls: false,
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: handlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},resizeCanvasForFullscreen:function (target, strategy) {
|
|
var restoreOldStyle = __registerRestoreOldStyle(target);
|
|
var cssWidth = strategy.softFullscreen ? window.innerWidth : screen.width;
|
|
var cssHeight = strategy.softFullscreen ? window.innerHeight : screen.height;
|
|
var rect = target.getBoundingClientRect();
|
|
var windowedCssWidth = rect.right - rect.left;
|
|
var windowedCssHeight = rect.bottom - rect.top;
|
|
var windowedRttWidth = target.width;
|
|
var windowedRttHeight = target.height;
|
|
|
|
if (strategy.scaleMode == 3) {
|
|
__setLetterbox(target, (cssHeight - windowedCssHeight) / 2, (cssWidth - windowedCssWidth) / 2);
|
|
cssWidth = windowedCssWidth;
|
|
cssHeight = windowedCssHeight;
|
|
} else if (strategy.scaleMode == 2) {
|
|
if (cssWidth*windowedRttHeight < windowedRttWidth*cssHeight) {
|
|
var desiredCssHeight = windowedRttHeight * cssWidth / windowedRttWidth;
|
|
__setLetterbox(target, (cssHeight - desiredCssHeight) / 2, 0);
|
|
cssHeight = desiredCssHeight;
|
|
} else {
|
|
var desiredCssWidth = windowedRttWidth * cssHeight / windowedRttHeight;
|
|
__setLetterbox(target, 0, (cssWidth - desiredCssWidth) / 2);
|
|
cssWidth = desiredCssWidth;
|
|
}
|
|
}
|
|
|
|
// If we are adding padding, must choose a background color or otherwise Chrome will give the
|
|
// padding a default white color. Do it only if user has not customized their own background color.
|
|
if (!target.style.backgroundColor) target.style.backgroundColor = 'black';
|
|
// IE11 does the same, but requires the color to be set in the document body.
|
|
if (!document.body.style.backgroundColor) document.body.style.backgroundColor = 'black'; // IE11
|
|
// Firefox always shows black letterboxes independent of style color.
|
|
|
|
target.style.width = cssWidth + 'px';
|
|
target.style.height = cssHeight + 'px';
|
|
|
|
if (strategy.filteringMode == 1) {
|
|
target.style.imageRendering = 'optimizeSpeed';
|
|
target.style.imageRendering = '-moz-crisp-edges';
|
|
target.style.imageRendering = '-o-crisp-edges';
|
|
target.style.imageRendering = '-webkit-optimize-contrast';
|
|
target.style.imageRendering = 'optimize-contrast';
|
|
target.style.imageRendering = 'crisp-edges';
|
|
target.style.imageRendering = 'pixelated';
|
|
}
|
|
|
|
var dpiScale = (strategy.canvasResolutionScaleMode == 2) ? window.devicePixelRatio : 1;
|
|
if (strategy.canvasResolutionScaleMode != 0) {
|
|
target.width = cssWidth * dpiScale;
|
|
target.height = cssHeight * dpiScale;
|
|
if (target.GLctxObject) target.GLctxObject.GLctx.viewport(0, 0, target.width, target.height);
|
|
}
|
|
return restoreOldStyle;
|
|
},requestFullscreen:function (target, strategy) {
|
|
// EMSCRIPTEN_FULLSCREEN_SCALE_DEFAULT + EMSCRIPTEN_FULLSCREEN_CANVAS_SCALE_NONE is a mode where no extra logic is performed to the DOM elements.
|
|
if (strategy.scaleMode != 0 || strategy.canvasResolutionScaleMode != 0) {
|
|
JSEvents.resizeCanvasForFullscreen(target, strategy);
|
|
}
|
|
|
|
if (target.requestFullscreen) {
|
|
target.requestFullscreen();
|
|
} else if (target.msRequestFullscreen) {
|
|
target.msRequestFullscreen();
|
|
} else if (target.mozRequestFullScreen) {
|
|
target.mozRequestFullScreen();
|
|
} else if (target.mozRequestFullscreen) {
|
|
target.mozRequestFullscreen();
|
|
} else if (target.webkitRequestFullscreen) {
|
|
target.webkitRequestFullscreen(Element.ALLOW_KEYBOARD_INPUT);
|
|
} else {
|
|
if (typeof JSEvents.fullscreenEnabled() === 'undefined') {
|
|
return -1;
|
|
} else {
|
|
return -3;
|
|
}
|
|
}
|
|
|
|
if (strategy.canvasResizedCallback) {
|
|
Module['dynCall_iiii'](strategy.canvasResizedCallback, 37, 0, strategy.canvasResizedCallbackUserData);
|
|
}
|
|
|
|
return 0;
|
|
},fillPointerlockChangeEventData:function (eventStruct, e) {
|
|
var pointerLockElement = document.pointerLockElement || document.mozPointerLockElement || document.webkitPointerLockElement || document.msPointerLockElement;
|
|
var isPointerlocked = !!pointerLockElement;
|
|
HEAP32[((eventStruct)>>2)]=isPointerlocked;
|
|
var nodeName = JSEvents.getNodeNameForTarget(pointerLockElement);
|
|
var id = (pointerLockElement && pointerLockElement.id) ? pointerLockElement.id : '';
|
|
stringToUTF8(nodeName, eventStruct + 4, 128);
|
|
stringToUTF8(id, eventStruct + 132, 128);
|
|
},registerPointerlockChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
|
|
if (!JSEvents.pointerlockChangeEvent) {
|
|
JSEvents.pointerlockChangeEvent = _malloc( 260 );
|
|
}
|
|
|
|
if (!target) {
|
|
target = document; // Pointer lock change events need to be captured from 'document' by default instead of 'window'
|
|
} else {
|
|
target = JSEvents.findEventTarget(target);
|
|
}
|
|
|
|
var handlerFunc = function(event) {
|
|
var e = event || window.event;
|
|
|
|
JSEvents.fillPointerlockChangeEventData(JSEvents.pointerlockChangeEvent, e);
|
|
|
|
var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.pointerlockChangeEvent, userData);
|
|
if (shouldCancel) {
|
|
e.preventDefault();
|
|
}
|
|
};
|
|
|
|
var eventHandler = {
|
|
target: target,
|
|
allowsDeferredCalls: false,
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: handlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},registerPointerlockErrorEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
|
|
if (!target) {
|
|
target = document; // Pointer lock events need to be captured from 'document' by default instead of 'window'
|
|
} else {
|
|
target = JSEvents.findEventTarget(target);
|
|
}
|
|
|
|
var handlerFunc = function(event) {
|
|
var e = event || window.event;
|
|
|
|
var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, 0, userData);
|
|
if (shouldCancel) {
|
|
e.preventDefault();
|
|
}
|
|
};
|
|
|
|
var eventHandler = {
|
|
target: target,
|
|
allowsDeferredCalls: false,
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: handlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},requestPointerLock:function (target) {
|
|
if (target.requestPointerLock) {
|
|
target.requestPointerLock();
|
|
} else if (target.mozRequestPointerLock) {
|
|
target.mozRequestPointerLock();
|
|
} else if (target.webkitRequestPointerLock) {
|
|
target.webkitRequestPointerLock();
|
|
} else if (target.msRequestPointerLock) {
|
|
target.msRequestPointerLock();
|
|
} else {
|
|
// document.body is known to accept pointer lock, so use that to differentiate if the user passed a bad element,
|
|
// or if the whole browser just doesn't support the feature.
|
|
if (document.body.requestPointerLock || document.body.mozRequestPointerLock || document.body.webkitRequestPointerLock || document.body.msRequestPointerLock) {
|
|
return -3;
|
|
} else {
|
|
return -1;
|
|
}
|
|
}
|
|
return 0;
|
|
},fillVisibilityChangeEventData:function (eventStruct, e) {
|
|
var visibilityStates = [ "hidden", "visible", "prerender", "unloaded" ];
|
|
var visibilityState = visibilityStates.indexOf(document.visibilityState);
|
|
|
|
HEAP32[((eventStruct)>>2)]=document.hidden;
|
|
HEAP32[(((eventStruct)+(4))>>2)]=visibilityState;
|
|
},registerVisibilityChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
|
|
if (!JSEvents.visibilityChangeEvent) {
|
|
JSEvents.visibilityChangeEvent = _malloc( 8 );
|
|
}
|
|
|
|
if (!target) {
|
|
target = document; // Visibility change events need to be captured from 'document' by default instead of 'window'
|
|
} else {
|
|
target = JSEvents.findEventTarget(target);
|
|
}
|
|
|
|
var handlerFunc = function(event) {
|
|
var e = event || window.event;
|
|
|
|
JSEvents.fillVisibilityChangeEventData(JSEvents.visibilityChangeEvent, e);
|
|
|
|
var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.visibilityChangeEvent, userData);
|
|
if (shouldCancel) {
|
|
e.preventDefault();
|
|
}
|
|
};
|
|
|
|
var eventHandler = {
|
|
target: target,
|
|
allowsDeferredCalls: false,
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: handlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},registerTouchEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
|
|
if (!JSEvents.touchEvent) {
|
|
JSEvents.touchEvent = _malloc( 1684 );
|
|
}
|
|
|
|
target = JSEvents.findEventTarget(target);
|
|
|
|
var handlerFunc = function(event) {
|
|
var e = event || window.event;
|
|
|
|
var touches = {};
|
|
for(var i = 0; i < e.touches.length; ++i) {
|
|
var touch = e.touches[i];
|
|
touches[touch.identifier] = touch;
|
|
}
|
|
for(var i = 0; i < e.changedTouches.length; ++i) {
|
|
var touch = e.changedTouches[i];
|
|
touches[touch.identifier] = touch;
|
|
touch.changed = true;
|
|
}
|
|
for(var i = 0; i < e.targetTouches.length; ++i) {
|
|
var touch = e.targetTouches[i];
|
|
touches[touch.identifier].onTarget = true;
|
|
}
|
|
|
|
var ptr = JSEvents.touchEvent;
|
|
HEAP32[(((ptr)+(4))>>2)]=e.ctrlKey;
|
|
HEAP32[(((ptr)+(8))>>2)]=e.shiftKey;
|
|
HEAP32[(((ptr)+(12))>>2)]=e.altKey;
|
|
HEAP32[(((ptr)+(16))>>2)]=e.metaKey;
|
|
ptr += 20; // Advance to the start of the touch array.
|
|
var canvasRect = Module['canvas'] ? Module['canvas'].getBoundingClientRect() : undefined;
|
|
var targetRect = JSEvents.getBoundingClientRectOrZeros(target);
|
|
var numTouches = 0;
|
|
for(var i in touches) {
|
|
var t = touches[i];
|
|
HEAP32[((ptr)>>2)]=t.identifier;
|
|
HEAP32[(((ptr)+(4))>>2)]=t.screenX;
|
|
HEAP32[(((ptr)+(8))>>2)]=t.screenY;
|
|
HEAP32[(((ptr)+(12))>>2)]=t.clientX;
|
|
HEAP32[(((ptr)+(16))>>2)]=t.clientY;
|
|
HEAP32[(((ptr)+(20))>>2)]=t.pageX;
|
|
HEAP32[(((ptr)+(24))>>2)]=t.pageY;
|
|
HEAP32[(((ptr)+(28))>>2)]=t.changed;
|
|
HEAP32[(((ptr)+(32))>>2)]=t.onTarget;
|
|
if (canvasRect) {
|
|
HEAP32[(((ptr)+(44))>>2)]=t.clientX - canvasRect.left;
|
|
HEAP32[(((ptr)+(48))>>2)]=t.clientY - canvasRect.top;
|
|
} else {
|
|
HEAP32[(((ptr)+(44))>>2)]=0;
|
|
HEAP32[(((ptr)+(48))>>2)]=0;
|
|
}
|
|
HEAP32[(((ptr)+(36))>>2)]=t.clientX - targetRect.left;
|
|
HEAP32[(((ptr)+(40))>>2)]=t.clientY - targetRect.top;
|
|
|
|
ptr += 52;
|
|
|
|
if (++numTouches >= 32) {
|
|
break;
|
|
}
|
|
}
|
|
HEAP32[((JSEvents.touchEvent)>>2)]=numTouches;
|
|
|
|
var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.touchEvent, userData);
|
|
if (shouldCancel) {
|
|
e.preventDefault();
|
|
}
|
|
};
|
|
|
|
var eventHandler = {
|
|
target: target,
|
|
allowsDeferredCalls: false, // XXX Currently disabled, see bug https://bugzilla.mozilla.org/show_bug.cgi?id=966493
|
|
// Once the above bug is resolved, enable the following condition if possible:
|
|
// allowsDeferredCalls: eventTypeString == 'touchstart',
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: handlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},fillGamepadEventData:function (eventStruct, e) {
|
|
HEAPF64[((eventStruct)>>3)]=e.timestamp;
|
|
for(var i = 0; i < e.axes.length; ++i) {
|
|
HEAPF64[(((eventStruct+i*8)+(16))>>3)]=e.axes[i];
|
|
}
|
|
for(var i = 0; i < e.buttons.length; ++i) {
|
|
if (typeof(e.buttons[i]) === 'object') {
|
|
HEAPF64[(((eventStruct+i*8)+(528))>>3)]=e.buttons[i].value;
|
|
} else {
|
|
HEAPF64[(((eventStruct+i*8)+(528))>>3)]=e.buttons[i];
|
|
}
|
|
}
|
|
for(var i = 0; i < e.buttons.length; ++i) {
|
|
if (typeof(e.buttons[i]) === 'object') {
|
|
HEAP32[(((eventStruct+i*4)+(1040))>>2)]=e.buttons[i].pressed;
|
|
} else {
|
|
HEAP32[(((eventStruct+i*4)+(1040))>>2)]=e.buttons[i] == 1.0;
|
|
}
|
|
}
|
|
HEAP32[(((eventStruct)+(1296))>>2)]=e.connected;
|
|
HEAP32[(((eventStruct)+(1300))>>2)]=e.index;
|
|
HEAP32[(((eventStruct)+(8))>>2)]=e.axes.length;
|
|
HEAP32[(((eventStruct)+(12))>>2)]=e.buttons.length;
|
|
stringToUTF8(e.id, eventStruct + 1304, 64);
|
|
stringToUTF8(e.mapping, eventStruct + 1368, 64);
|
|
},registerGamepadEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
|
|
if (!JSEvents.gamepadEvent) {
|
|
JSEvents.gamepadEvent = _malloc( 1432 );
|
|
}
|
|
|
|
var handlerFunc = function(event) {
|
|
var e = event || window.event;
|
|
|
|
JSEvents.fillGamepadEventData(JSEvents.gamepadEvent, e.gamepad);
|
|
|
|
var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.gamepadEvent, userData);
|
|
if (shouldCancel) {
|
|
e.preventDefault();
|
|
}
|
|
};
|
|
|
|
var eventHandler = {
|
|
target: JSEvents.findEventTarget(target),
|
|
allowsDeferredCalls: true,
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: handlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},registerBeforeUnloadEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
|
|
var handlerFunc = function(event) {
|
|
var e = event || window.event;
|
|
|
|
var confirmationMessage = Module['dynCall_iiii'](callbackfunc, eventTypeId, 0, userData);
|
|
|
|
if (confirmationMessage) {
|
|
confirmationMessage = Pointer_stringify(confirmationMessage);
|
|
}
|
|
if (confirmationMessage) {
|
|
e.preventDefault();
|
|
e.returnValue = confirmationMessage;
|
|
return confirmationMessage;
|
|
}
|
|
};
|
|
|
|
var eventHandler = {
|
|
target: JSEvents.findEventTarget(target),
|
|
allowsDeferredCalls: false,
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: handlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},battery:function () { return navigator.battery || navigator.mozBattery || navigator.webkitBattery; },fillBatteryEventData:function (eventStruct, e) {
|
|
HEAPF64[((eventStruct)>>3)]=e.chargingTime;
|
|
HEAPF64[(((eventStruct)+(8))>>3)]=e.dischargingTime;
|
|
HEAPF64[(((eventStruct)+(16))>>3)]=e.level;
|
|
HEAP32[(((eventStruct)+(24))>>2)]=e.charging;
|
|
},registerBatteryEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
|
|
if (!JSEvents.batteryEvent) {
|
|
JSEvents.batteryEvent = _malloc( 32 );
|
|
}
|
|
|
|
var handlerFunc = function(event) {
|
|
var e = event || window.event;
|
|
|
|
JSEvents.fillBatteryEventData(JSEvents.batteryEvent, JSEvents.battery());
|
|
|
|
var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.batteryEvent, userData);
|
|
if (shouldCancel) {
|
|
e.preventDefault();
|
|
}
|
|
};
|
|
|
|
var eventHandler = {
|
|
target: JSEvents.findEventTarget(target),
|
|
allowsDeferredCalls: false,
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: handlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
},registerWebGlEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) {
|
|
if (!target) {
|
|
target = Module['canvas'];
|
|
}
|
|
var handlerFunc = function(event) {
|
|
var e = event || window.event;
|
|
|
|
var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, 0, userData);
|
|
if (shouldCancel) {
|
|
e.preventDefault();
|
|
}
|
|
};
|
|
|
|
var eventHandler = {
|
|
target: JSEvents.findEventTarget(target),
|
|
allowsDeferredCalls: false,
|
|
eventTypeString: eventTypeString,
|
|
callbackfunc: callbackfunc,
|
|
handlerFunc: handlerFunc,
|
|
useCapture: useCapture
|
|
};
|
|
JSEvents.registerOrRemoveHandler(eventHandler);
|
|
}};function __emscripten_sample_gamepad_data() {
|
|
// Polling gamepads generates garbage, so don't do it when we know there are no gamepads connected.
|
|
if (!JSEvents.numGamepadsConnected) return;
|
|
|
|
// Produce a new Gamepad API sample if we are ticking a new game frame, or if not using emscripten_set_main_loop() at all to drive animation.
|
|
if (Browser.mainLoop.currentFrameNumber !== JSEvents.lastGamepadStateFrame || !Browser.mainLoop.currentFrameNumber) {
|
|
JSEvents.lastGamepadState = navigator.getGamepads ? navigator.getGamepads() : (navigator.webkitGetGamepads ? navigator.webkitGetGamepads : null);
|
|
JSEvents.lastGamepadStateFrame = Browser.mainLoop.currentFrameNumber;
|
|
}
|
|
}function _emscripten_get_gamepad_status(index, gamepadState) {
|
|
__emscripten_sample_gamepad_data();
|
|
if (!JSEvents.lastGamepadState) return -1;
|
|
|
|
// INVALID_PARAM is returned on a Gamepad index that never was there.
|
|
if (index < 0 || index >= JSEvents.lastGamepadState.length) return -5;
|
|
|
|
// NO_DATA is returned on a Gamepad index that was removed.
|
|
// For previously disconnected gamepads there should be an empty slot (null/undefined/false) at the index.
|
|
// This is because gamepads must keep their original position in the array.
|
|
// For example, removing the first of two gamepads produces [null/undefined/false, gamepad].
|
|
if (!JSEvents.lastGamepadState[index]) return -7;
|
|
|
|
JSEvents.fillGamepadEventData(gamepadState, JSEvents.lastGamepadState[index]);
|
|
return 0;
|
|
}
|
|
|
|
function _utime(path, times) {
|
|
if (ENVIRONMENT_IS_PTHREAD) return _emscripten_sync_run_in_main_thread_2(12, path, times);
|
|
// int utime(const char *path, const struct utimbuf *times);
|
|
// http://pubs.opengroup.org/onlinepubs/009695399/basedefs/utime.h.html
|
|
var time;
|
|
if (times) {
|
|
// NOTE: We don't keep track of access timestamps.
|
|
var offset = 4;
|
|
time = HEAP32[(((times)+(offset))>>2)];
|
|
time *= 1000;
|
|
} else {
|
|
time = Date.now();
|
|
}
|
|
path = Pointer_stringify(path);
|
|
try {
|
|
FS.utime(path, time, time);
|
|
return 0;
|
|
} catch (e) {
|
|
FS.handleFSError(e);
|
|
return -1;
|
|
}
|
|
}
|
|
|
|
function _emscripten_glCopyTexImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { GLctx['copyTexImage2D'](x0, x1, x2, x3, x4, x5, x6, x7) }
|
|
|
|
function _emscripten_glTexParameterfv(target, pname, params) {
|
|
var param = HEAPF32[((params)>>2)];
|
|
GLctx.texParameterf(target, pname, param);
|
|
}
|
|
|
|
|
|
|
|
|
|
var PROCINFO={ppid:1,pid:42,sid:42,pgid:42};
|
|
|
|
|
|
var __pthread_ptr=0;
|
|
|
|
var __pthread_is_main_browser_thread=0;function __register_pthread_ptr(pthreadPtr, isMainBrowserThread, isMainRuntimeThread) {
|
|
pthreadPtr = pthreadPtr|0;
|
|
isMainBrowserThread = isMainBrowserThread|0;
|
|
isMainRuntimeThread = isMainRuntimeThread|0;
|
|
__pthread_ptr = pthreadPtr;
|
|
__pthread_is_main_browser_thread = isMainBrowserThread;
|
|
__pthread_is_main_runtime_thread = isMainRuntimeThread;
|
|
}
|
|
|
|
var _emscripten_main_thread_process_queued_calls=undefined;var PThread={MAIN_THREAD_ID:1,mainThreadInfo:{schedPolicy:0,schedPrio:0},unusedWorkerPool:[],runningWorkers:[],initMainThreadBlock:function () {
|
|
if (ENVIRONMENT_IS_PTHREAD) return undefined;
|
|
PThread.mainThreadBlock = allocate(244, "i32*", ALLOC_STATIC);
|
|
__register_pthread_ptr(PThread.mainThreadBlock, /*isMainBrowserThread=*/!ENVIRONMENT_IS_WORKER, /*isMainRuntimeThread=*/1); // Pass the thread address inside the asm.js scope to store it for fast access that avoids the need for a FFI out.
|
|
|
|
for (var i = 0; i < 244/4; ++i) HEAPU32[PThread.mainThreadBlock/4+i] = 0;
|
|
|
|
// The pthread struct has a field that points to itself - this is used as a magic ID to detect whether the pthread_t
|
|
// structure is 'alive'.
|
|
HEAP32[(((PThread.mainThreadBlock)+(24))>>2)]=PThread.mainThreadBlock;
|
|
|
|
// Allocate memory for thread-local storage.
|
|
var tlsMemory = allocate(128 * 4, "i32*", ALLOC_STATIC);
|
|
for (var i = 0; i < 128; ++i) HEAPU32[tlsMemory/4+i] = 0;
|
|
Atomics.store(HEAPU32, (PThread.mainThreadBlock + 116 ) >> 2, tlsMemory); // Init thread-local-storage memory array.
|
|
Atomics.store(HEAPU32, (PThread.mainThreadBlock + 52 ) >> 2, PThread.mainThreadBlock); // Main thread ID.
|
|
Atomics.store(HEAPU32, (PThread.mainThreadBlock + 56 ) >> 2, PROCINFO.pid); // Process ID.
|
|
|
|
},pthreads:{},pthreadIdCounter:2,exitHandlers:null,setThreadStatus:function () {},runExitHandlers:function () {
|
|
if (PThread.exitHandlers !== null) {
|
|
while (PThread.exitHandlers.length > 0) {
|
|
PThread.exitHandlers.pop()();
|
|
}
|
|
PThread.exitHandlers = null;
|
|
}
|
|
|
|
// Call into the musl function that runs destructors of all thread-specific data.
|
|
if (ENVIRONMENT_IS_PTHREAD && threadInfoStruct) ___pthread_tsd_run_dtors();
|
|
},threadExit:function (exitCode) {
|
|
var tb = _pthread_self();
|
|
if (tb) { // If we haven't yet exited?
|
|
Atomics.store(HEAPU32, (tb + 4 ) >> 2, exitCode);
|
|
// When we publish this, the main thread is free to deallocate the thread object and we are done.
|
|
// Therefore set threadInfoStruct = 0; above to 'release' the object in this worker thread.
|
|
Atomics.store(HEAPU32, (tb + 0 ) >> 2, 1);
|
|
|
|
// Disable all cancellation so that executing the cleanup handlers won't trigger another JS
|
|
// canceled exception to be thrown.
|
|
Atomics.store(HEAPU32, (tb + 72 ) >> 2, 1/*PTHREAD_CANCEL_DISABLE*/);
|
|
Atomics.store(HEAPU32, (tb + 76 ) >> 2, 0/*PTHREAD_CANCEL_DEFERRED*/);
|
|
PThread.runExitHandlers();
|
|
|
|
_emscripten_futex_wake(tb + 0, 2147483647);
|
|
__register_pthread_ptr(0, 0, 0); // Unregister the thread block also inside the asm.js scope.
|
|
threadInfoStruct = 0;
|
|
if (ENVIRONMENT_IS_PTHREAD) {
|
|
// This worker no longer owns any WebGL OffscreenCanvases, so transfer them back to parent thread.
|
|
var transferList = [];
|
|
|
|
|
|
postMessage({ cmd: 'exit' });
|
|
}
|
|
}
|
|
},threadCancel:function () {
|
|
PThread.runExitHandlers();
|
|
Atomics.store(HEAPU32, (threadInfoStruct + 4 ) >> 2, -1/*PTHREAD_CANCELED*/);
|
|
Atomics.store(HEAPU32, (threadInfoStruct + 0 ) >> 2, 1); // Mark the thread as no longer running.
|
|
_emscripten_futex_wake(threadInfoStruct + 0, 2147483647); // wake all threads
|
|
threadInfoStruct = selfThreadId = 0; // Not hosting a pthread anymore in this worker, reset the info structures to null.
|
|
__register_pthread_ptr(0, 0, 0); // Unregister the thread block also inside the asm.js scope.
|
|
postMessage({ cmd: 'cancelDone' });
|
|
},terminateAllThreads:function () {
|
|
for (var t in PThread.pthreads) {
|
|
var pthread = PThread.pthreads[t];
|
|
if (pthread) {
|
|
PThread.freeThreadData(pthread);
|
|
if (pthread.worker) pthread.worker.terminate();
|
|
}
|
|
}
|
|
PThread.pthreads = {};
|
|
for (var t in PThread.unusedWorkerPool) {
|
|
var pthread = PThread.unusedWorkerPool[t];
|
|
if (pthread) {
|
|
PThread.freeThreadData(pthread);
|
|
if (pthread.worker) pthread.worker.terminate();
|
|
}
|
|
}
|
|
PThread.unusedWorkerPool = [];
|
|
for (var t in PThread.runningWorkers) {
|
|
var pthread = PThread.runningWorkers[t];
|
|
if (pthread) {
|
|
PThread.freeThreadData(pthread);
|
|
if (pthread.worker) pthread.worker.terminate();
|
|
}
|
|
}
|
|
PThread.runningWorkers = [];
|
|
},freeThreadData:function (pthread) {
|
|
if (!pthread) return;
|
|
if (pthread.threadInfoStruct) {
|
|
var tlsMemory = HEAP32[(((pthread.threadInfoStruct)+(116))>>2)];
|
|
HEAP32[(((pthread.threadInfoStruct)+(116))>>2)]=0;
|
|
_free(pthread.tlsMemory);
|
|
_free(pthread.threadInfoStruct);
|
|
}
|
|
pthread.threadInfoStruct = 0;
|
|
if (pthread.allocatedOwnStack && pthread.stackBase) _free(pthread.stackBase);
|
|
pthread.stackBase = 0;
|
|
if (pthread.worker) pthread.worker.pthread = null;
|
|
},receiveObjectTransfer:function (data) {
|
|
},allocateUnusedWorkers:function (numWorkers, onFinishedLoading) {
|
|
if (typeof SharedArrayBuffer === 'undefined') return; // No multithreading support, no-op.
|
|
Module['print']('Preallocating ' + numWorkers + ' workers for a pthread spawn pool.');
|
|
|
|
var numWorkersLoaded = 0;
|
|
for (var i = 0; i < numWorkers; ++i) {
|
|
var pthreadMainJs = 'pthread-main.js';
|
|
// Allow HTML module to configure the location where the 'pthread-main.js' file will be loaded from,
|
|
// either via Module.locateFile() function, or via Module.pthreadMainPrefixURL string. If neither
|
|
// of these are passed, then the default URL 'pthread-main.js' relative to the main html file is loaded.
|
|
if (typeof Module['locateFile'] === 'function') pthreadMainJs = Module['locateFile'](pthreadMainJs);
|
|
else if (Module['pthreadMainPrefixURL']) pthreadMainJs = Module['pthreadMainPrefixURL'] + pthreadMainJs;
|
|
var worker = new Worker(pthreadMainJs);
|
|
|
|
worker.onmessage = function(e) {
|
|
// If this message is intended to a recipient that is not the main thread, forward it to the target thread.
|
|
if (e.data.targetThread && e.data.targetThread != _pthread_self()) {
|
|
var thread = PThread.pthreads[e.data.targetThread];
|
|
if (thread) {
|
|
thread.worker.postMessage(e.data, e.data.transferList);
|
|
} else {
|
|
console.error('Internal error! Worker sent a message "' + e.data.cmd + '" to target pthread ' + e.data.targetThread + ', but that thread no longer exists!');
|
|
}
|
|
return;
|
|
}
|
|
|
|
if (e.data.cmd === 'processQueuedMainThreadWork') {
|
|
// TODO: Must post message to main Emscripten thread in PROXY_TO_WORKER mode.
|
|
_emscripten_main_thread_process_queued_calls();
|
|
} else if (e.data.cmd === 'spawnThread') {
|
|
__spawn_thread(e.data);
|
|
} else if (e.data.cmd === 'cleanupThread') {
|
|
__cleanup_thread(e.data.thread);
|
|
} else if (e.data.cmd === 'killThread') {
|
|
__kill_thread(e.data.thread);
|
|
} else if (e.data.cmd === 'cancelThread') {
|
|
__cancel_thread(e.data.thread);
|
|
} else if (e.data.cmd === 'loaded') {
|
|
++numWorkersLoaded;
|
|
if (numWorkersLoaded === numWorkers && onFinishedLoading) {
|
|
onFinishedLoading();
|
|
}
|
|
} else if (e.data.cmd === 'print') {
|
|
Module['print']('Thread ' + e.data.threadId + ': ' + e.data.text);
|
|
} else if (e.data.cmd === 'printErr') {
|
|
Module['printErr']('Thread ' + e.data.threadId + ': ' + e.data.text);
|
|
} else if (e.data.cmd === 'alert') {
|
|
alert('Thread ' + e.data.threadId + ': ' + e.data.text);
|
|
} else if (e.data.cmd === 'exit') {
|
|
// currently no-op
|
|
} else if (e.data.cmd === 'cancelDone') {
|
|
PThread.freeThreadData(worker.pthread);
|
|
worker.pthread = undefined; // Detach the worker from the pthread object, and return it to the worker pool as an unused worker.
|
|
PThread.unusedWorkerPool.push(worker);
|
|
// TODO: Free if detached.
|
|
PThread.runningWorkers.splice(PThread.runningWorkers.indexOf(worker.pthread), 1); // Not a running Worker anymore.
|
|
} else if (e.data.cmd === 'objectTransfer') {
|
|
PThread.receiveObjectTransfer(e.data);
|
|
} else {
|
|
Module['printErr']("worker sent an unknown command " + e.data.cmd);
|
|
}
|
|
};
|
|
|
|
worker.onerror = function(e) {
|
|
Module['printErr']('pthread sent an error! ' + e.filename + ':' + e.lineno + ': ' + e.message);
|
|
};
|
|
|
|
// Allocate tempDoublePtr for the worker. This is done here on the worker's behalf, since we may need to do this statically
|
|
// if the runtime has not been loaded yet, etc. - so we just use getMemory, which is main-thread only.
|
|
var tempDoublePtr = getMemory(8); // TODO: leaks. Cleanup after worker terminates.
|
|
|
|
// Ask the new worker to load up the Emscripten-compiled page. This is a heavy operation.
|
|
worker.postMessage({
|
|
cmd: 'load',
|
|
url: currentScriptUrl,
|
|
buffer: HEAPU8.buffer,
|
|
tempDoublePtr: tempDoublePtr,
|
|
TOTAL_MEMORY: TOTAL_MEMORY,
|
|
STATICTOP: STATICTOP,
|
|
DYNAMIC_BASE: DYNAMIC_BASE,
|
|
DYNAMICTOP_PTR: DYNAMICTOP_PTR,
|
|
PthreadWorkerInit: PthreadWorkerInit
|
|
});
|
|
PThread.unusedWorkerPool.push(worker);
|
|
}
|
|
},getNewWorker:function () {
|
|
if (PThread.unusedWorkerPool.length == 0) PThread.allocateUnusedWorkers(1);
|
|
if (PThread.unusedWorkerPool.length > 0) return PThread.unusedWorkerPool.pop();
|
|
else return null;
|
|
},busySpinWait:function (msecs) {
|
|
var t = performance.now() + msecs;
|
|
while(performance.now() < t) {
|
|
;
|
|
}
|
|
}};var __pthread_is_main_runtime_thread=0;function _emscripten_is_main_runtime_thread() {
|
|
return __pthread_is_main_runtime_thread|0; // Semantically the same as testing "!ENVIRONMENT_IS_PTHREAD" outside the asm.js scope
|
|
}
|
|
|
|
function _emscripten_glLinkProgram(program) {
|
|
GLctx.linkProgram(GL.programs[program]);
|
|
GL.programInfos[program] = null; // uniforms no longer keep the same names after linking
|
|
GL.populateUniformTable(program);
|
|
}
|
|
|
|
function _emscripten_glUniform3f(location, v0, v1, v2) {
|
|
GLctx.uniform3f(GL.uniforms[location], v0, v1, v2);
|
|
}
|
|
|
|
function _emscripten_glGetObjectParameterivARB() {
|
|
Module['printErr']('missing function: emscripten_glGetObjectParameterivARB'); abort(-1);
|
|
}
|
|
|
|
function _emscripten_glBlendFunc(x0, x1) { GLctx['blendFunc'](x0, x1) }
|
|
|
|
function _emscripten_glUniform3i(location, v0, v1, v2) {
|
|
GLctx.uniform3i(GL.uniforms[location], v0, v1, v2);
|
|
}
|
|
|
|
function _emscripten_glStencilOp(x0, x1, x2) { GLctx['stencilOp'](x0, x1, x2) }
|
|
|
|
function _glCreateShader(shaderType) {
|
|
var id = GL.getNewId(GL.shaders);
|
|
GL.shaders[id] = GLctx.createShader(shaderType);
|
|
return id;
|
|
}
|
|
|
|
function _glUniform1i(location, v0) {
|
|
GLctx.uniform1i(GL.uniforms[location], v0);
|
|
}
|
|
|
|
function _emscripten_glBindAttribLocation(program, index, name) {
|
|
name = Pointer_stringify(name);
|
|
GLctx.bindAttribLocation(GL.programs[program], index, name);
|
|
}
|
|
|
|
function _glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) {
|
|
GLctx['compressedTexImage2D'](target, level, internalFormat, width, height, border, data ? HEAPU8.subarray((data),(data+imageSize)) : null);
|
|
}
|
|
|
|
function _glDisable(x0) { GLctx['disable'](x0) }
|
|
|
|
function _emscripten_glEnableVertexAttribArray(index) {
|
|
GLctx.enableVertexAttribArray(index);
|
|
}
|
|
|
|
|
|
Module["_memset"] = _memset;
|
|
|
|
function _atexit(func, arg) {
|
|
if (ENVIRONMENT_IS_PTHREAD) return _emscripten_sync_run_in_main_thread_2(110, func, arg);
|
|
__ATEXIT__.unshift({ func: func, arg: arg });
|
|
}
|
|
|
|
function _glfwMakeContextCurrent(winid) {}
|
|
|
|
function _emscripten_set_touchcancel_callback(target, userData, useCapture, callbackfunc) {
|
|
JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 25, "touchcancel");
|
|
return 0;
|
|
}
|
|
|
|
function ___lock() {}
|
|
|
|
function _emscripten_glBlendFuncSeparate(x0, x1, x2, x3) { GLctx['blendFuncSeparate'](x0, x1, x2, x3) }
|
|
|
|
function _glCullFace(x0) { GLctx['cullFace'](x0) }
|
|
|
|
function _emscripten_glGetVertexAttribPointerv(index, pname, pointer) {
|
|
if (!pointer) {
|
|
// GLES2 specification does not specify how to behave if pointer is a null pointer. Since calling this function does not make sense
|
|
// if pointer == null, issue a GL error to notify user about it.
|
|
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
HEAP32[((pointer)>>2)]=GLctx.getVertexAttribOffset(index, pname);
|
|
}
|
|
|
|
function _emscripten_glVertexAttrib3f(x0, x1, x2, x3) { GLctx['vertexAttrib3f'](x0, x1, x2, x3) }
|
|
|
|
function _emscripten_glEnable(x0) { GLctx['enable'](x0) }
|
|
|
|
function _emscripten_glNormalPointer() {
|
|
Module['printErr']('missing function: emscripten_glNormalPointer'); abort(-1);
|
|
}
|
|
|
|
|
|
var _emscripten_GetProcAddress=undefined;
|
|
Module["_emscripten_GetProcAddress"] = _emscripten_GetProcAddress;
|
|
|
|
var EGL={errorCode:12288,defaultDisplayInitialized:false,currentContext:0,currentReadSurface:0,currentDrawSurface:0,stringCache:{},setErrorCode:function (code) {
|
|
EGL.errorCode = code;
|
|
},chooseConfig:function (display, attribList, config, config_size, numConfigs) {
|
|
if (display != 62000 /* Magic ID for Emscripten 'default display' */) {
|
|
EGL.setErrorCode(0x3008 /* EGL_BAD_DISPLAY */);
|
|
return 0;
|
|
}
|
|
// TODO: read attribList.
|
|
if ((!config || !config_size) && !numConfigs) {
|
|
EGL.setErrorCode(0x300C /* EGL_BAD_PARAMETER */);
|
|
return 0;
|
|
}
|
|
if (numConfigs) {
|
|
HEAP32[((numConfigs)>>2)]=1; // Total number of supported configs: 1.
|
|
}
|
|
if (config && config_size > 0) {
|
|
HEAP32[((config)>>2)]=62002;
|
|
}
|
|
|
|
EGL.setErrorCode(0x3000 /* EGL_SUCCESS */);
|
|
return 1;
|
|
}};function _eglGetProcAddress(name_) {
|
|
return _emscripten_GetProcAddress(name_);
|
|
}
|
|
|
|
function _glfwSetScrollCallback(winid, cbfun) {
|
|
GLFW.setScrollCallback(winid, cbfun);
|
|
}
|
|
|
|
function _emscripten_get_pointerlock_status(pointerlockStatus) {
|
|
if (pointerlockStatus) JSEvents.fillPointerlockChangeEventData(pointerlockStatus);
|
|
if (!document.body || (!document.body.requestPointerLock && !document.body.mozRequestPointerLock && !document.body.webkitRequestPointerLock && !document.body.msRequestPointerLock)) {
|
|
return -1;
|
|
}
|
|
return 0;
|
|
}
|
|
|
|
function _glAttachShader(program, shader) {
|
|
GLctx.attachShader(GL.programs[program],
|
|
GL.shaders[shader]);
|
|
}
|
|
|
|
function _glfwGetPrimaryMonitor() {
|
|
return 1;
|
|
}
|
|
|
|
|
|
function emscriptenWebGLGetVertexAttrib(index, pname, params, type) {
|
|
if (!params) {
|
|
// GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
|
|
// if params == null, issue a GL error to notify user about it.
|
|
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
var data = GLctx.getVertexAttrib(index, pname);
|
|
if (pname == 0x889F/*VERTEX_ATTRIB_ARRAY_BUFFER_BINDING*/) {
|
|
HEAP32[((params)>>2)]=data["name"];
|
|
} else if (typeof data == 'number' || typeof data == 'boolean') {
|
|
switch (type) {
|
|
case 'Integer': HEAP32[((params)>>2)]=data; break;
|
|
case 'Float': HEAPF32[((params)>>2)]=data; break;
|
|
case 'FloatToInteger': HEAP32[((params)>>2)]=Math.fround(data); break;
|
|
default: throw 'internal emscriptenWebGLGetVertexAttrib() error, bad type: ' + type;
|
|
}
|
|
} else {
|
|
for (var i = 0; i < data.length; i++) {
|
|
switch (type) {
|
|
case 'Integer': HEAP32[(((params)+(i))>>2)]=data[i]; break;
|
|
case 'Float': HEAPF32[(((params)+(i))>>2)]=data[i]; break;
|
|
case 'FloatToInteger': HEAP32[(((params)+(i))>>2)]=Math.fround(data[i]); break;
|
|
default: throw 'internal emscriptenWebGLGetVertexAttrib() error, bad type: ' + type;
|
|
}
|
|
}
|
|
}
|
|
}function _emscripten_glGetVertexAttribfv(index, pname, params) {
|
|
// N.B. This function may only be called if the vertex attribute was specified using the function glVertexAttrib*f(),
|
|
// otherwise the results are undefined. (GLES3 spec 6.1.12)
|
|
emscriptenWebGLGetVertexAttrib(index, pname, params, 'Float');
|
|
}
|
|
|
|
function _emscripten_set_touchstart_callback(target, userData, useCapture, callbackfunc) {
|
|
JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 22, "touchstart");
|
|
return 0;
|
|
}
|
|
|
|
function _emscripten_glDeleteShader(id) {
|
|
if (!id) return;
|
|
var shader = GL.shaders[id];
|
|
if (!shader) { // glDeleteShader actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
|
|
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
GLctx.deleteShader(shader);
|
|
GL.shaders[id] = null;
|
|
}
|
|
|
|
function _emscripten_glVertexPointer(){ throw 'Legacy GL function (glVertexPointer) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; }
|
|
|
|
function _emscripten_glDeleteBuffers(n, buffers) {
|
|
for (var i = 0; i < n; i++) {
|
|
var id = HEAP32[(((buffers)+(i*4))>>2)];
|
|
var buffer = GL.buffers[id];
|
|
|
|
// From spec: "glDeleteBuffers silently ignores 0's and names that do not
|
|
// correspond to existing buffer objects."
|
|
if (!buffer) continue;
|
|
|
|
GLctx.deleteBuffer(buffer);
|
|
buffer.name = 0;
|
|
GL.buffers[id] = null;
|
|
|
|
if (id == GL.currArrayBuffer) GL.currArrayBuffer = 0;
|
|
if (id == GL.currElementArrayBuffer) GL.currElementArrayBuffer = 0;
|
|
}
|
|
}
|
|
|
|
function _emscripten_glTexParameteriv(target, pname, params) {
|
|
var param = HEAP32[((params)>>2)];
|
|
GLctx.texParameteri(target, pname, param);
|
|
}
|
|
|
|
function _glDrawElements(mode, count, type, indices) {
|
|
|
|
GLctx.drawElements(mode, count, type, indices);
|
|
|
|
}
|
|
|
|
function _glfwTerminate() {
|
|
window.removeEventListener("keydown", GLFW.onKeydown, true);
|
|
window.removeEventListener("keypress", GLFW.onKeyPress, true);
|
|
window.removeEventListener("keyup", GLFW.onKeyup, true);
|
|
Module["canvas"].removeEventListener("mousemove", GLFW.onMousemove, true);
|
|
Module["canvas"].removeEventListener("mousedown", GLFW.onMouseButtonDown, true);
|
|
Module["canvas"].removeEventListener("mouseup", GLFW.onMouseButtonUp, true);
|
|
Module["canvas"].removeEventListener('wheel', GLFW.onMouseWheel, true);
|
|
Module["canvas"].removeEventListener('mousewheel', GLFW.onMouseWheel, true);
|
|
Module["canvas"].removeEventListener('mouseenter', GLFW.onMouseenter, true);
|
|
Module["canvas"].removeEventListener('mouseleave', GLFW.onMouseleave, true);
|
|
Module["canvas"].width = Module["canvas"].height = 1;
|
|
GLFW.windows = null;
|
|
GLFW.active = null;
|
|
}
|
|
|
|
function _emscripten_glUniformMatrix2fv(location, count, transpose, value) {
|
|
|
|
|
|
var view;
|
|
if (4*count <= GL.MINI_TEMP_BUFFER_SIZE) {
|
|
// avoid allocation when uploading few enough uniforms
|
|
view = GL.miniTempBufferViews[4*count-1];
|
|
for (var i = 0; i < 4*count; i += 4) {
|
|
view[i] = HEAPF32[(((value)+(4*i))>>2)];
|
|
view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
|
|
view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
|
|
view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
|
|
}
|
|
} else {
|
|
view = HEAPF32.subarray((value)>>2,(value+count*16)>>2);
|
|
}
|
|
GLctx.uniformMatrix2fv(GL.uniforms[location], !!transpose, view);
|
|
}
|
|
|
|
function ___syscall6(which, varargs) {if (ENVIRONMENT_IS_PTHREAD) { return _emscripten_sync_run_in_main_thread_2(138, 6, varargs) }
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
// close
|
|
var stream = SYSCALLS.getStreamFromFD();
|
|
FS.close(stream);
|
|
return 0;
|
|
} catch (e) {
|
|
if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
|
|
function _llvm_stacksave() {
|
|
var self = _llvm_stacksave;
|
|
if (!self.LLVM_SAVEDSTACKS) {
|
|
self.LLVM_SAVEDSTACKS = [];
|
|
}
|
|
self.LLVM_SAVEDSTACKS.push(Runtime.stackSave());
|
|
return self.LLVM_SAVEDSTACKS.length-1;
|
|
}
|
|
|
|
function _emscripten_glGetVertexAttribiv(index, pname, params) {
|
|
// N.B. This function may only be called if the vertex attribute was specified using the function glVertexAttrib*f(),
|
|
// otherwise the results are undefined. (GLES3 spec 6.1.12)
|
|
emscriptenWebGLGetVertexAttrib(index, pname, params, 'FloatToInteger');
|
|
}
|
|
|
|
function _emscripten_glUniformMatrix4fv(location, count, transpose, value) {
|
|
|
|
|
|
var view;
|
|
if (16*count <= GL.MINI_TEMP_BUFFER_SIZE) {
|
|
// avoid allocation when uploading few enough uniforms
|
|
view = GL.miniTempBufferViews[16*count-1];
|
|
for (var i = 0; i < 16*count; i += 16) {
|
|
view[i] = HEAPF32[(((value)+(4*i))>>2)];
|
|
view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
|
|
view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
|
|
view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
|
|
view[i+4] = HEAPF32[(((value)+(4*i+16))>>2)];
|
|
view[i+5] = HEAPF32[(((value)+(4*i+20))>>2)];
|
|
view[i+6] = HEAPF32[(((value)+(4*i+24))>>2)];
|
|
view[i+7] = HEAPF32[(((value)+(4*i+28))>>2)];
|
|
view[i+8] = HEAPF32[(((value)+(4*i+32))>>2)];
|
|
view[i+9] = HEAPF32[(((value)+(4*i+36))>>2)];
|
|
view[i+10] = HEAPF32[(((value)+(4*i+40))>>2)];
|
|
view[i+11] = HEAPF32[(((value)+(4*i+44))>>2)];
|
|
view[i+12] = HEAPF32[(((value)+(4*i+48))>>2)];
|
|
view[i+13] = HEAPF32[(((value)+(4*i+52))>>2)];
|
|
view[i+14] = HEAPF32[(((value)+(4*i+56))>>2)];
|
|
view[i+15] = HEAPF32[(((value)+(4*i+60))>>2)];
|
|
}
|
|
} else {
|
|
view = HEAPF32.subarray((value)>>2,(value+count*64)>>2);
|
|
}
|
|
GLctx.uniformMatrix4fv(GL.uniforms[location], !!transpose, view);
|
|
}
|
|
|
|
function _emscripten_glDrawArraysInstanced(mode, first, count, primcount) {
|
|
GLctx['drawArraysInstanced'](mode, first, count, primcount);
|
|
}
|
|
|
|
function _emscripten_glEnableClientState() {
|
|
Module['printErr']('missing function: emscripten_glEnableClientState'); abort(-1);
|
|
}
|
|
|
|
function _emscripten_glGetPointerv() {
|
|
Module['printErr']('missing function: emscripten_glGetPointerv'); abort(-1);
|
|
}
|
|
|
|
function ___syscall140(which, varargs) {if (ENVIRONMENT_IS_PTHREAD) { return _emscripten_sync_run_in_main_thread_2(138, 140, varargs) }
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
// llseek
|
|
var stream = SYSCALLS.getStreamFromFD(), offset_high = SYSCALLS.get(), offset_low = SYSCALLS.get(), result = SYSCALLS.get(), whence = SYSCALLS.get();
|
|
var offset = offset_low;
|
|
assert(offset_high === 0);
|
|
FS.llseek(stream, offset, whence);
|
|
HEAP32[((result)>>2)]=stream.position;
|
|
if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null; // reset readdir state
|
|
return 0;
|
|
} catch (e) {
|
|
if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
|
|
function ___syscall146(which, varargs) {if (ENVIRONMENT_IS_PTHREAD) { return _emscripten_sync_run_in_main_thread_2(138, 146, varargs) }
|
|
SYSCALLS.varargs = varargs;
|
|
try {
|
|
// writev
|
|
var stream = SYSCALLS.getStreamFromFD(), iov = SYSCALLS.get(), iovcnt = SYSCALLS.get();
|
|
return SYSCALLS.doWritev(stream, iov, iovcnt);
|
|
} catch (e) {
|
|
if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e);
|
|
return -e.errno;
|
|
}
|
|
}
|
|
|
|
function _emscripten_glUniform1i(location, v0) {
|
|
GLctx.uniform1i(GL.uniforms[location], v0);
|
|
}
|
|
|
|
function _emscripten_glStencilMask(x0) { GLctx['stencilMask'](x0) }
|
|
|
|
function _emscripten_glStencilFuncSeparate(x0, x1, x2, x3) { GLctx['stencilFuncSeparate'](x0, x1, x2, x3) }
|
|
|
|
|
|
var _tzname; if (ENVIRONMENT_IS_PTHREAD) _tzname = PthreadWorkerInit._tzname; else PthreadWorkerInit._tzname = _tzname = allocate(8, "i32*", ALLOC_STATIC);
|
|
|
|
var _daylight; if (ENVIRONMENT_IS_PTHREAD) _daylight = PthreadWorkerInit._daylight; else PthreadWorkerInit._daylight = _daylight = allocate(1, "i32*", ALLOC_STATIC);
|
|
|
|
var _timezone; if (ENVIRONMENT_IS_PTHREAD) _timezone = PthreadWorkerInit._timezone; else PthreadWorkerInit._timezone = _timezone = allocate(1, "i32*", ALLOC_STATIC);function _tzset() {
|
|
if (ENVIRONMENT_IS_PTHREAD) return _emscripten_sync_run_in_main_thread_0(119);
|
|
// TODO: Use (malleable) environment variables instead of system settings.
|
|
if (_tzset.called) return;
|
|
_tzset.called = true;
|
|
|
|
HEAP32[((_timezone)>>2)]=-(new Date()).getTimezoneOffset() * 60;
|
|
|
|
var winter = new Date(2000, 0, 1);
|
|
var summer = new Date(2000, 6, 1);
|
|
HEAP32[((_daylight)>>2)]=Number(winter.getTimezoneOffset() != summer.getTimezoneOffset());
|
|
|
|
function extractZone(date) {
|
|
var match = date.toTimeString().match(/\(([A-Za-z ]+)\)$/);
|
|
return match ? match[1] : "GMT";
|
|
};
|
|
var winterName = extractZone(winter);
|
|
var summerName = extractZone(summer);
|
|
var winterNamePtr = allocate(intArrayFromString(winterName), 'i8', ALLOC_NORMAL);
|
|
var summerNamePtr = allocate(intArrayFromString(summerName), 'i8', ALLOC_NORMAL);
|
|
if (summer.getTimezoneOffset() < winter.getTimezoneOffset()) {
|
|
// Northern hemisphere
|
|
HEAP32[((_tzname)>>2)]=winterNamePtr;
|
|
HEAP32[(((_tzname)+(4))>>2)]=summerNamePtr;
|
|
} else {
|
|
HEAP32[((_tzname)>>2)]=summerNamePtr;
|
|
HEAP32[(((_tzname)+(4))>>2)]=winterNamePtr;
|
|
}
|
|
}
|
|
|
|
|
|
Module["_i64Subtract"] = _i64Subtract;
|
|
|
|
|
|
Module["_i64Add"] = _i64Add;
|
|
|
|
function _emscripten_set_touchend_callback(target, userData, useCapture, callbackfunc) {
|
|
JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 23, "touchend");
|
|
return 0;
|
|
}
|
|
|
|
function _glUseProgram(program) {
|
|
GLctx.useProgram(program ? GL.programs[program] : null);
|
|
}
|
|
|
|
function _emscripten_glDisableVertexAttribArray(index) {
|
|
GLctx.disableVertexAttribArray(index);
|
|
}
|
|
|
|
function _emscripten_glVertexAttrib1f(x0, x1) { GLctx['vertexAttrib1f'](x0, x1) }
|
|
|
|
function _emscripten_glFinish() { GLctx['finish']() }
|
|
|
|
function _glDrawArrays(mode, first, count) {
|
|
|
|
GLctx.drawArrays(mode, first, count);
|
|
|
|
}
|
|
|
|
function _emscripten_glDepthFunc(x0) { GLctx['depthFunc'](x0) }
|
|
|
|
function _emscripten_get_num_gamepads() {
|
|
// Polling gamepads generates garbage, so don't do it when we know there are no gamepads connected.
|
|
if (!JSEvents.numGamepadsConnected) return 0;
|
|
|
|
__emscripten_sample_gamepad_data();
|
|
if (!JSEvents.lastGamepadState) return -1;
|
|
return JSEvents.lastGamepadState.length;
|
|
}
|
|
|
|
function _sysconf(name) {
|
|
if (ENVIRONMENT_IS_PTHREAD) return _emscripten_sync_run_in_main_thread_1(72, name);
|
|
// long sysconf(int name);
|
|
// http://pubs.opengroup.org/onlinepubs/009695399/functions/sysconf.html
|
|
switch(name) {
|
|
case 30: return PAGE_SIZE;
|
|
case 85:
|
|
var maxHeapSize = 2*1024*1024*1024 - 16777216;
|
|
maxHeapSize = HEAPU8.length;
|
|
return maxHeapSize / PAGE_SIZE;
|
|
case 132:
|
|
case 133:
|
|
case 12:
|
|
case 137:
|
|
case 138:
|
|
case 15:
|
|
case 235:
|
|
case 16:
|
|
case 17:
|
|
case 18:
|
|
case 19:
|
|
case 20:
|
|
case 149:
|
|
case 13:
|
|
case 10:
|
|
case 236:
|
|
case 153:
|
|
case 9:
|
|
case 21:
|
|
case 22:
|
|
case 159:
|
|
case 154:
|
|
case 14:
|
|
case 77:
|
|
case 78:
|
|
case 139:
|
|
case 80:
|
|
case 81:
|
|
case 82:
|
|
case 68:
|
|
case 67:
|
|
case 164:
|
|
case 11:
|
|
case 29:
|
|
case 47:
|
|
case 48:
|
|
case 95:
|
|
case 52:
|
|
case 51:
|
|
case 46:
|
|
return 200809;
|
|
case 79:
|
|
return 0;
|
|
case 27:
|
|
case 246:
|
|
case 127:
|
|
case 128:
|
|
case 23:
|
|
case 24:
|
|
case 160:
|
|
case 161:
|
|
case 181:
|
|
case 182:
|
|
case 242:
|
|
case 183:
|
|
case 184:
|
|
case 243:
|
|
case 244:
|
|
case 245:
|
|
case 165:
|
|
case 178:
|
|
case 179:
|
|
case 49:
|
|
case 50:
|
|
case 168:
|
|
case 169:
|
|
case 175:
|
|
case 170:
|
|
case 171:
|
|
case 172:
|
|
case 97:
|
|
case 76:
|
|
case 32:
|
|
case 173:
|
|
case 35:
|
|
return -1;
|
|
case 176:
|
|
case 177:
|
|
case 7:
|
|
case 155:
|
|
case 8:
|
|
case 157:
|
|
case 125:
|
|
case 126:
|
|
case 92:
|
|
case 93:
|
|
case 129:
|
|
case 130:
|
|
case 131:
|
|
case 94:
|
|
case 91:
|
|
return 1;
|
|
case 74:
|
|
case 60:
|
|
case 69:
|
|
case 70:
|
|
case 4:
|
|
return 1024;
|
|
case 31:
|
|
case 42:
|
|
case 72:
|
|
return 32;
|
|
case 87:
|
|
case 26:
|
|
case 33:
|
|
return 2147483647;
|
|
case 34:
|
|
case 1:
|
|
return 47839;
|
|
case 38:
|
|
case 36:
|
|
return 99;
|
|
case 43:
|
|
case 37:
|
|
return 2048;
|
|
case 0: return 2097152;
|
|
case 3: return 65536;
|
|
case 28: return 32768;
|
|
case 44: return 32767;
|
|
case 75: return 16384;
|
|
case 39: return 1000;
|
|
case 89: return 700;
|
|
case 71: return 256;
|
|
case 40: return 255;
|
|
case 2: return 100;
|
|
case 180: return 64;
|
|
case 25: return 20;
|
|
case 5: return 16;
|
|
case 6: return 6;
|
|
case 73: return 4;
|
|
case 84: {
|
|
if (typeof navigator === 'object') return navigator['hardwareConcurrency'] || 1;
|
|
return 1;
|
|
}
|
|
}
|
|
___setErrNo(ERRNO_CODES.EINVAL);
|
|
return -1;
|
|
}
|
|
|
|
function _emscripten_glUniform4iv(location, count, value) {
|
|
|
|
|
|
GLctx.uniform4iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*16)>>2));
|
|
}
|
|
|
|
function _glClear(x0) { GLctx['clear'](x0) }
|
|
|
|
function _emscripten_glLoadIdentity(){ throw 'Legacy GL function (glLoadIdentity) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; }
|
|
|
|
function _emscripten_glUniform3fv(location, count, value) {
|
|
|
|
|
|
var view;
|
|
if (3*count <= GL.MINI_TEMP_BUFFER_SIZE) {
|
|
// avoid allocation when uploading few enough uniforms
|
|
view = GL.miniTempBufferViews[3*count-1];
|
|
for (var i = 0; i < 3*count; i += 3) {
|
|
view[i] = HEAPF32[(((value)+(4*i))>>2)];
|
|
view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
|
|
view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
|
|
}
|
|
} else {
|
|
view = HEAPF32.subarray((value)>>2,(value+count*12)>>2);
|
|
}
|
|
GLctx.uniform3fv(GL.uniforms[location], view);
|
|
}
|
|
|
|
function _emscripten_glIsTexture(texture) {
|
|
var texture = GL.textures[texture];
|
|
if (!texture) return 0;
|
|
return GLctx.isTexture(texture);
|
|
}
|
|
|
|
function _glEnableVertexAttribArray(index) {
|
|
GLctx.enableVertexAttribArray(index);
|
|
}
|
|
|
|
function _emscripten_glAttachShader(program, shader) {
|
|
GLctx.attachShader(GL.programs[program],
|
|
GL.shaders[shader]);
|
|
}
|
|
|
|
|
|
function _glUniform4f(location, v0, v1, v2, v3) {
|
|
GLctx.uniform4f(GL.uniforms[location], v0, v1, v2, v3);
|
|
}
|
|
|
|
function _emscripten_request_pointerlock(target, deferUntilInEventHandler) {
|
|
if (!target) target = '#canvas';
|
|
target = JSEvents.findEventTarget(target);
|
|
if (!target) return -4;
|
|
if (!target.requestPointerLock && !target.mozRequestPointerLock && !target.webkitRequestPointerLock && !target.msRequestPointerLock) {
|
|
return -1;
|
|
}
|
|
|
|
var canPerformRequests = JSEvents.canPerformEventHandlerRequests();
|
|
|
|
// Queue this function call if we're not currently in an event handler and the user saw it appropriate to do so.
|
|
if (!canPerformRequests) {
|
|
if (deferUntilInEventHandler) {
|
|
JSEvents.deferCall(JSEvents.requestPointerLock, 2 /* priority below fullscreen */, [target]);
|
|
return 1;
|
|
} else {
|
|
return -2;
|
|
}
|
|
}
|
|
|
|
return JSEvents.requestPointerLock(target);
|
|
}
|
|
|
|
function _emscripten_glVertexAttrib2f(x0, x1, x2) { GLctx['vertexAttrib2f'](x0, x1, x2) }
|
|
|
|
function _glfwCreateWindow(width, height, title, monitor, share) {
|
|
return GLFW.createWindow(width, height, title, monitor, share);
|
|
}
|
|
|
|
function _glfwDefaultWindowHints() {
|
|
GLFW.hints = GLFW.defaultHints;
|
|
}
|
|
|
|
function _gettimeofday(ptr) {
|
|
var now = Date.now();
|
|
HEAP32[((ptr)>>2)]=(now/1000)|0; // seconds
|
|
HEAP32[(((ptr)+(4))>>2)]=((now % 1000)*1000)|0; // microseconds
|
|
return 0;
|
|
}
|
|
|
|
function _emscripten_glClearStencil(x0) { GLctx['clearStencil'](x0) }
|
|
|
|
function _emscripten_glDetachShader(program, shader) {
|
|
GLctx.detachShader(GL.programs[program],
|
|
GL.shaders[shader]);
|
|
}
|
|
|
|
function _emscripten_glDeleteVertexArrays(n, vaos) {
|
|
for (var i = 0; i < n; i++) {
|
|
var id = HEAP32[(((vaos)+(i*4))>>2)];
|
|
GLctx['deleteVertexArray'](GL.vaos[id]);
|
|
GL.vaos[id] = null;
|
|
}
|
|
}
|
|
|
|
function _glfwInit() {
|
|
if (GLFW.windows) return 1; // GL_TRUE
|
|
|
|
GLFW.initialTime = GLFW.getTime();
|
|
GLFW.hints = GLFW.defaultHints;
|
|
GLFW.windows = new Array()
|
|
GLFW.active = null;
|
|
|
|
window.addEventListener("keydown", GLFW.onKeydown, true);
|
|
window.addEventListener("keypress", GLFW.onKeyPress, true);
|
|
window.addEventListener("keyup", GLFW.onKeyup, true);
|
|
Module["canvas"].addEventListener("mousemove", GLFW.onMousemove, true);
|
|
Module["canvas"].addEventListener("mousedown", GLFW.onMouseButtonDown, true);
|
|
Module["canvas"].addEventListener("mouseup", GLFW.onMouseButtonUp, true);
|
|
Module["canvas"].addEventListener('wheel', GLFW.onMouseWheel, true);
|
|
Module["canvas"].addEventListener('mousewheel', GLFW.onMouseWheel, true);
|
|
Module["canvas"].addEventListener('mouseenter', GLFW.onMouseenter, true);
|
|
Module["canvas"].addEventListener('mouseleave', GLFW.onMouseleave, true);
|
|
|
|
Browser.resizeListeners.push(function(width, height) {
|
|
GLFW.onCanvasResize(width, height);
|
|
});
|
|
return 1; // GL_TRUE
|
|
}
|
|
|
|
function _emscripten_glGetTexParameteriv(target, pname, params) {
|
|
if (!params) {
|
|
// GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
|
|
// if p == null, issue a GL error to notify user about it.
|
|
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
HEAP32[((params)>>2)]=GLctx.getTexParameter(target, pname);
|
|
}
|
|
|
|
function _glfwSwapBuffers(winid) {
|
|
GLFW.swapBuffers(winid);
|
|
}
|
|
|
|
function _emscripten_glGenerateMipmap(x0) { GLctx['generateMipmap'](x0) }
|
|
|
|
|
|
|
|
|
|
|
|
var _environ; if (ENVIRONMENT_IS_PTHREAD) _environ = PthreadWorkerInit._environ; else PthreadWorkerInit._environ = _environ = allocate(1, "i32*", ALLOC_STATIC);var ___environ=_environ;function ___buildEnvironment(env) {
|
|
// WARNING: Arbitrary limit!
|
|
var MAX_ENV_VALUES = 64;
|
|
var TOTAL_ENV_SIZE = 1024;
|
|
|
|
// Statically allocate memory for the environment.
|
|
var poolPtr;
|
|
var envPtr;
|
|
if (!___buildEnvironment.called) {
|
|
___buildEnvironment.called = true;
|
|
// Set default values. Use string keys for Closure Compiler compatibility.
|
|
ENV['USER'] = ENV['LOGNAME'] = 'web_user';
|
|
ENV['PATH'] = '/';
|
|
ENV['PWD'] = '/';
|
|
ENV['HOME'] = '/home/web_user';
|
|
ENV['LANG'] = 'C';
|
|
ENV['_'] = Module['thisProgram'];
|
|
// Allocate memory.
|
|
poolPtr = allocate(TOTAL_ENV_SIZE, 'i8', ALLOC_STATIC);
|
|
envPtr = allocate(MAX_ENV_VALUES * 4,
|
|
'i8*', ALLOC_STATIC);
|
|
HEAP32[((envPtr)>>2)]=poolPtr;
|
|
HEAP32[((_environ)>>2)]=envPtr;
|
|
} else {
|
|
envPtr = HEAP32[((_environ)>>2)];
|
|
poolPtr = HEAP32[((envPtr)>>2)];
|
|
}
|
|
|
|
// Collect key=value lines.
|
|
var strings = [];
|
|
var totalSize = 0;
|
|
for (var key in env) {
|
|
if (typeof env[key] === 'string') {
|
|
var line = key + '=' + env[key];
|
|
strings.push(line);
|
|
totalSize += line.length;
|
|
}
|
|
}
|
|
if (totalSize > TOTAL_ENV_SIZE) {
|
|
throw new Error('Environment size exceeded TOTAL_ENV_SIZE!');
|
|
}
|
|
|
|
// Make new.
|
|
var ptrSize = 4;
|
|
for (var i = 0; i < strings.length; i++) {
|
|
var line = strings[i];
|
|
writeAsciiToMemory(line, poolPtr);
|
|
HEAP32[(((envPtr)+(i * ptrSize))>>2)]=poolPtr;
|
|
poolPtr += line.length + 1;
|
|
}
|
|
HEAP32[(((envPtr)+(strings.length * ptrSize))>>2)]=0;
|
|
}var ENV={};function _clearenv(name) {
|
|
if (ENVIRONMENT_IS_PTHREAD) return _emscripten_sync_run_in_main_thread_1(112, name);
|
|
// int clearenv (void);
|
|
// http://www.gnu.org/s/hello/manual/libc/Environment-Access.html#index-clearenv-3107
|
|
ENV = {};
|
|
___buildEnvironment(ENV);
|
|
return 0;
|
|
}
|
|
|
|
function _emscripten_glCullFace(x0) { GLctx['cullFace'](x0) }
|
|
|
|
function _emscripten_glUniform4f(location, v0, v1, v2, v3) {
|
|
GLctx.uniform4f(GL.uniforms[location], v0, v1, v2, v3);
|
|
}
|
|
|
|
function _glDisableVertexAttribArray(index) {
|
|
GLctx.disableVertexAttribArray(index);
|
|
}
|
|
|
|
function _emscripten_glUseProgram(program) {
|
|
GLctx.useProgram(program ? GL.programs[program] : null);
|
|
}
|
|
|
|
function _emscripten_glHint(x0, x1) { GLctx['hint'](x0, x1) }
|
|
|
|
function _emscripten_glUniform2fv(location, count, value) {
|
|
|
|
|
|
var view;
|
|
if (2*count <= GL.MINI_TEMP_BUFFER_SIZE) {
|
|
// avoid allocation when uploading few enough uniforms
|
|
view = GL.miniTempBufferViews[2*count-1];
|
|
for (var i = 0; i < 2*count; i += 2) {
|
|
view[i] = HEAPF32[(((value)+(4*i))>>2)];
|
|
view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
|
|
}
|
|
} else {
|
|
view = HEAPF32.subarray((value)>>2,(value+count*8)>>2);
|
|
}
|
|
GLctx.uniform2fv(GL.uniforms[location], view);
|
|
}
|
|
|
|
function _glfwSwapInterval(interval) {
|
|
interval = Math.abs(interval); // GLFW uses negative values to enable GLX_EXT_swap_control_tear, which we don't have, so just treat negative and positive the same.
|
|
if (interval == 0) _emscripten_set_main_loop_timing(0/*EM_TIMING_SETTIMEOUT*/, 0);
|
|
else _emscripten_set_main_loop_timing(1/*EM_TIMING_RAF*/, interval);
|
|
}
|
|
|
|
function _glGetShaderInfoLog(shader, maxLength, length, infoLog) {
|
|
var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
|
|
if (log === null) log = '(unknown error)';
|
|
if (maxLength > 0 && infoLog) {
|
|
var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength);
|
|
if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
|
|
} else {
|
|
if (length) HEAP32[((length)>>2)]=0;
|
|
}
|
|
}
|
|
|
|
function _emscripten_glMatrixMode(){ throw 'Legacy GL function (glMatrixMode) called. If you want legacy GL emulation, you need to compile with -s LEGACY_GL_EMULATION=1 to enable legacy GL emulation.'; }
|
|
|
|
function _abort() {
|
|
Module['abort']();
|
|
}
|
|
|
|
function _emscripten_glFramebufferRenderbuffer(target, attachment, renderbuffertarget, renderbuffer) {
|
|
GLctx.framebufferRenderbuffer(target, attachment, renderbuffertarget,
|
|
GL.renderbuffers[renderbuffer]);
|
|
}
|
|
|
|
function _emscripten_glDeleteFramebuffers(n, framebuffers) {
|
|
for (var i = 0; i < n; ++i) {
|
|
var id = HEAP32[(((framebuffers)+(i*4))>>2)];
|
|
var framebuffer = GL.framebuffers[id];
|
|
if (!framebuffer) continue; // GL spec: "glDeleteFramebuffers silently ignores 0s and names that do not correspond to existing framebuffer objects".
|
|
GLctx.deleteFramebuffer(framebuffer);
|
|
framebuffer.name = 0;
|
|
GL.framebuffers[id] = null;
|
|
}
|
|
}
|
|
|
|
function _emscripten_glIsBuffer(buffer) {
|
|
var b = GL.buffers[buffer];
|
|
if (!b) return 0;
|
|
return GLctx.isBuffer(b);
|
|
}
|
|
|
|
function _emscripten_glUniform2iv(location, count, value) {
|
|
|
|
|
|
GLctx.uniform2iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*8)>>2));
|
|
}
|
|
|
|
var _emscripten_asm_const=true;
|
|
|
|
function _chroot(path) {
|
|
if (ENVIRONMENT_IS_PTHREAD) return _emscripten_sync_run_in_main_thread_1(37, path);
|
|
// int chroot(const char *path);
|
|
// http://pubs.opengroup.org/onlinepubs/7908799/xsh/chroot.html
|
|
___setErrNo(ERRNO_CODES.EACCES);
|
|
return -1;
|
|
}
|
|
|
|
function _glEnable(x0) { GLctx['enable'](x0) }
|
|
|
|
|
|
|
|
function emscriptenWebGLComputeImageSize(width, height, sizePerPixel, alignment) {
|
|
function roundedToNextMultipleOf(x, y) {
|
|
return Math.floor((x + y - 1) / y) * y
|
|
}
|
|
var plainRowSize = width * sizePerPixel;
|
|
var alignedRowSize = roundedToNextMultipleOf(plainRowSize, alignment);
|
|
return (height <= 0) ? 0 :
|
|
((height - 1) * alignedRowSize + plainRowSize);
|
|
}function emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) {
|
|
var sizePerPixel;
|
|
var numChannels;
|
|
switch(format) {
|
|
case 0x1906 /* GL_ALPHA */:
|
|
case 0x1909 /* GL_LUMINANCE */:
|
|
case 0x1902 /* GL_DEPTH_COMPONENT */:
|
|
numChannels = 1;
|
|
break;
|
|
case 0x190A /* GL_LUMINANCE_ALPHA */:
|
|
numChannels = 2;
|
|
break;
|
|
case 0x1907 /* GL_RGB */:
|
|
case 0x8C40 /* GL_SRGB_EXT */:
|
|
numChannels = 3;
|
|
break;
|
|
case 0x1908 /* GL_RGBA */:
|
|
case 0x8C42 /* GL_SRGB_ALPHA_EXT */:
|
|
numChannels = 4;
|
|
break;
|
|
default:
|
|
GL.recordError(0x0500); // GL_INVALID_ENUM
|
|
return null;
|
|
}
|
|
switch (type) {
|
|
case 0x1401 /* GL_UNSIGNED_BYTE */:
|
|
sizePerPixel = numChannels*1;
|
|
break;
|
|
case 0x1403 /* GL_UNSIGNED_SHORT */:
|
|
case 0x8D61 /* GL_HALF_FLOAT_OES */:
|
|
sizePerPixel = numChannels*2;
|
|
break;
|
|
case 0x1405 /* GL_UNSIGNED_INT */:
|
|
case 0x1406 /* GL_FLOAT */:
|
|
sizePerPixel = numChannels*4;
|
|
break;
|
|
case 0x84FA /* GL_UNSIGNED_INT_24_8_WEBGL/GL_UNSIGNED_INT_24_8 */:
|
|
sizePerPixel = 4;
|
|
break;
|
|
case 0x8363 /* GL_UNSIGNED_SHORT_5_6_5 */:
|
|
case 0x8033 /* GL_UNSIGNED_SHORT_4_4_4_4 */:
|
|
case 0x8034 /* GL_UNSIGNED_SHORT_5_5_5_1 */:
|
|
sizePerPixel = 2;
|
|
break;
|
|
default:
|
|
GL.recordError(0x0500); // GL_INVALID_ENUM
|
|
return null;
|
|
}
|
|
var bytes = emscriptenWebGLComputeImageSize(width, height, sizePerPixel, GL.unpackAlignment);
|
|
switch(type) {
|
|
case 0x1401 /* GL_UNSIGNED_BYTE */:
|
|
return HEAPU8.subarray((pixels),(pixels+bytes));
|
|
case 0x1406 /* GL_FLOAT */:
|
|
return HEAPF32.subarray((pixels)>>2,(pixels+bytes)>>2);
|
|
case 0x1405 /* GL_UNSIGNED_INT */:
|
|
case 0x84FA /* GL_UNSIGNED_INT_24_8_WEBGL/GL_UNSIGNED_INT_24_8 */:
|
|
return HEAPU32.subarray((pixels)>>2,(pixels+bytes)>>2);
|
|
case 0x1403 /* GL_UNSIGNED_SHORT */:
|
|
case 0x8363 /* GL_UNSIGNED_SHORT_5_6_5 */:
|
|
case 0x8033 /* GL_UNSIGNED_SHORT_4_4_4_4 */:
|
|
case 0x8034 /* GL_UNSIGNED_SHORT_5_5_5_1 */:
|
|
case 0x8D61 /* GL_HALF_FLOAT_OES */:
|
|
return HEAPU16.subarray((pixels)>>1,(pixels+bytes)>>1);
|
|
default:
|
|
GL.recordError(0x0500); // GL_INVALID_ENUM
|
|
return null;
|
|
}
|
|
}function _emscripten_glTexSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixels) {
|
|
var pixelData = null;
|
|
if (pixels) pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, 0);
|
|
GLctx.texSubImage2D(target, level, xoffset, yoffset, width, height, format, type, pixelData);
|
|
}
|
|
|
|
function _emscripten_glPolygonOffset(x0, x1) { GLctx['polygonOffset'](x0, x1) }
|
|
|
|
var _emscripten_asm_const_int=true;
|
|
|
|
function _emscripten_glUniform2f(location, v0, v1) {
|
|
GLctx.uniform2f(GL.uniforms[location], v0, v1);
|
|
}
|
|
|
|
function _glGetAttribLocation(program, name) {
|
|
program = GL.programs[program];
|
|
name = Pointer_stringify(name);
|
|
return GLctx.getAttribLocation(program, name);
|
|
}
|
|
|
|
function _glfwWindowHint(target, hint) {
|
|
GLFW.hints[target] = hint;
|
|
}
|
|
|
|
function _emscripten_glUniform2i(location, v0, v1) {
|
|
GLctx.uniform2i(GL.uniforms[location], v0, v1);
|
|
}
|
|
|
|
function _glBlendFunc(x0, x1) { GLctx['blendFunc'](x0, x1) }
|
|
|
|
function _glCreateProgram() {
|
|
var id = GL.getNewId(GL.programs);
|
|
var program = GLctx.createProgram();
|
|
program.name = id;
|
|
GL.programs[id] = program;
|
|
return id;
|
|
}
|
|
|
|
function _emscripten_glDeleteRenderbuffers(n, renderbuffers) {
|
|
for (var i = 0; i < n; i++) {
|
|
var id = HEAP32[(((renderbuffers)+(i*4))>>2)];
|
|
var renderbuffer = GL.renderbuffers[id];
|
|
if (!renderbuffer) continue; // GL spec: "glDeleteRenderbuffers silently ignores 0s and names that do not correspond to existing renderbuffer objects".
|
|
GLctx.deleteRenderbuffer(renderbuffer);
|
|
renderbuffer.name = 0;
|
|
GL.renderbuffers[id] = null;
|
|
}
|
|
}
|
|
|
|
function _emscripten_glGetBufferParameteriv(target, value, data) {
|
|
if (!data) {
|
|
// GLES2 specification does not specify how to behave if data is a null pointer. Since calling this function does not make sense
|
|
// if data == null, issue a GL error to notify user about it.
|
|
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
HEAP32[((data)>>2)]=GLctx.getBufferParameter(target, value);
|
|
}
|
|
|
|
|
|
function emscriptenWebGLGetUniform(program, location, params, type) {
|
|
if (!params) {
|
|
// GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
|
|
// if params == null, issue a GL error to notify user about it.
|
|
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
var data = GLctx.getUniform(GL.programs[program], GL.uniforms[location]);
|
|
if (typeof data == 'number' || typeof data == 'boolean') {
|
|
switch (type) {
|
|
case 'Integer': HEAP32[((params)>>2)]=data; break;
|
|
case 'Float': HEAPF32[((params)>>2)]=data; break;
|
|
default: throw 'internal emscriptenWebGLGetUniform() error, bad type: ' + type;
|
|
}
|
|
} else {
|
|
for (var i = 0; i < data.length; i++) {
|
|
switch (type) {
|
|
case 'Integer': HEAP32[(((params)+(i))>>2)]=data[i]; break;
|
|
case 'Float': HEAPF32[(((params)+(i))>>2)]=data[i]; break;
|
|
default: throw 'internal emscriptenWebGLGetUniform() error, bad type: ' + type;
|
|
}
|
|
}
|
|
}
|
|
}function _emscripten_glGetUniformiv(program, location, params) {
|
|
emscriptenWebGLGetUniform(program, location, params, 'Integer');
|
|
}
|
|
|
|
function _unsetenv(name) {
|
|
if (ENVIRONMENT_IS_PTHREAD) return _emscripten_sync_run_in_main_thread_1(114, name);
|
|
// int unsetenv(const char *name);
|
|
// http://pubs.opengroup.org/onlinepubs/009695399/functions/unsetenv.html
|
|
if (name === 0) {
|
|
___setErrNo(ERRNO_CODES.EINVAL);
|
|
return -1;
|
|
}
|
|
name = Pointer_stringify(name);
|
|
if (name === '' || name.indexOf('=') !== -1) {
|
|
___setErrNo(ERRNO_CODES.EINVAL);
|
|
return -1;
|
|
}
|
|
if (ENV.hasOwnProperty(name)) {
|
|
delete ENV[name];
|
|
___buildEnvironment(ENV);
|
|
}
|
|
return 0;
|
|
}
|
|
|
|
function _emscripten_glDepthMask(flag) {
|
|
GLctx.depthMask(!!flag);
|
|
}
|
|
|
|
|
|
function _emscripten_glDepthRangef(x0, x1) { GLctx['depthRange'](x0, x1) }
|
|
|
|
|
|
|
|
function _emscripten_get_now_is_monotonic() {
|
|
// return whether emscripten_get_now is guaranteed monotonic; the Date.now
|
|
// implementation is not :(
|
|
return ENVIRONMENT_IS_NODE || (typeof dateNow !== 'undefined') ||
|
|
((ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) && self['performance'] && self['performance']['now']);
|
|
}function _clock_gettime(clk_id, tp) {
|
|
// int clock_gettime(clockid_t clk_id, struct timespec *tp);
|
|
var now;
|
|
if (clk_id === 0) {
|
|
now = Date.now();
|
|
} else if (clk_id === 1 && _emscripten_get_now_is_monotonic()) {
|
|
now = _emscripten_get_now();
|
|
} else {
|
|
___setErrNo(ERRNO_CODES.EINVAL);
|
|
return -1;
|
|
}
|
|
HEAP32[((tp)>>2)]=(now/1000)|0; // seconds
|
|
HEAP32[(((tp)+(4))>>2)]=((now % 1000)*1000*1000)|0; // nanoseconds
|
|
return 0;
|
|
}function ___clock_gettime() {
|
|
return _clock_gettime.apply(null, arguments)
|
|
}
|
|
|
|
function _emscripten_set_fullscreenchange_callback(target, userData, useCapture, callbackfunc) {
|
|
if (typeof JSEvents.fullscreenEnabled() === 'undefined') return -1;
|
|
if (!target) target = document;
|
|
else {
|
|
target = JSEvents.findEventTarget(target);
|
|
if (!target) return -4;
|
|
}
|
|
JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "fullscreenchange");
|
|
JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "mozfullscreenchange");
|
|
JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "webkitfullscreenchange");
|
|
JSEvents.registerFullscreenChangeEventCallback(target, userData, useCapture, callbackfunc, 19, "msfullscreenchange");
|
|
return 0;
|
|
}
|
|
|
|
function _emscripten_glVertexAttrib1fv(index, v) {
|
|
|
|
GLctx.vertexAttrib1f(index, HEAPF32[v>>2]);
|
|
}
|
|
|
|
|
|
function __cleanup_thread(pthread_ptr) {
|
|
if (ENVIRONMENT_IS_PTHREAD) throw 'Internal Error! _cleanup_thread() can only ever be called from main application thread!';
|
|
if (!pthread_ptr) throw 'Internal Error! Null pthread_ptr in _cleanup_thread!';
|
|
HEAP32[(((pthread_ptr)+(24))>>2)]=0;
|
|
var pthread = PThread.pthreads[pthread_ptr];
|
|
var worker = pthread.worker;
|
|
PThread.freeThreadData(pthread);
|
|
worker.pthread = undefined; // Detach the worker from the pthread object, and return it to the worker pool as an unused worker.
|
|
PThread.unusedWorkerPool.push(worker);
|
|
PThread.runningWorkers.splice(PThread.runningWorkers.indexOf(worker.pthread), 1); // Not a running Worker anymore.
|
|
}
|
|
|
|
function __pthread_testcancel_js() {
|
|
if (!ENVIRONMENT_IS_PTHREAD) return;
|
|
if (!threadInfoStruct) return;
|
|
var cancelDisabled = Atomics.load(HEAPU32, (threadInfoStruct + 72 ) >> 2);
|
|
if (cancelDisabled) return;
|
|
var canceled = Atomics.load(HEAPU32, (threadInfoStruct + 0 ) >> 2);
|
|
if (canceled == 2) throw 'Canceled!';
|
|
}function _pthread_join(thread, status) {
|
|
if (!thread) {
|
|
Module['printErr']('pthread_join attempted on a null thread pointer!');
|
|
return ERRNO_CODES.ESRCH;
|
|
}
|
|
if (ENVIRONMENT_IS_PTHREAD && selfThreadId == thread) {
|
|
Module['printErr']('PThread ' + thread + ' is attempting to join to itself!');
|
|
return ERRNO_CODES.EDEADLK;
|
|
}
|
|
else if (!ENVIRONMENT_IS_PTHREAD && PThread.mainThreadBlock == thread) {
|
|
Module['printErr']('Main thread ' + thread + ' is attempting to join to itself!');
|
|
return ERRNO_CODES.EDEADLK;
|
|
}
|
|
var self = HEAP32[(((thread)+(24))>>2)];
|
|
if (self != thread) {
|
|
Module['printErr']('pthread_join attempted on thread ' + thread + ', which does not point to a valid thread, or does not exist anymore!');
|
|
return ERRNO_CODES.ESRCH;
|
|
}
|
|
|
|
var detached = Atomics.load(HEAPU32, (thread + 80 ) >> 2);
|
|
if (detached) {
|
|
Module['printErr']('Attempted to join thread ' + thread + ', which was already detached!');
|
|
return ERRNO_CODES.EINVAL; // The thread is already detached, can no longer join it!
|
|
}
|
|
for (;;) {
|
|
var threadStatus = Atomics.load(HEAPU32, (thread + 0 ) >> 2);
|
|
if (threadStatus == 1) { // Exited?
|
|
var threadExitCode = Atomics.load(HEAPU32, (thread + 4 ) >> 2);
|
|
if (status) HEAP32[((status)>>2)]=threadExitCode;
|
|
Atomics.store(HEAPU32, (thread + 80 ) >> 2, 1); // Mark the thread as detached.
|
|
|
|
if (!ENVIRONMENT_IS_PTHREAD) __cleanup_thread(thread);
|
|
else postMessage({ cmd: 'cleanupThread', thread: thread});
|
|
return 0;
|
|
}
|
|
// TODO HACK! Replace the _js variant with just _pthread_testcancel:
|
|
//_pthread_testcancel();
|
|
__pthread_testcancel_js();
|
|
// In main runtime thread (the thread that initialized the Emscripten C runtime and launched main()), assist pthreads in performing operations
|
|
// that they need to access the Emscripten main runtime for.
|
|
if (!ENVIRONMENT_IS_PTHREAD) _emscripten_main_thread_process_queued_calls();
|
|
_emscripten_futex_wait(thread + 0, threadStatus, ENVIRONMENT_IS_PTHREAD ? 100 : 1);
|
|
}
|
|
}
|
|
|
|
|
|
|
|
Module["___muldsi3"] = ___muldsi3;
|
|
Module["___muldi3"] = ___muldi3;
|
|
|
|
function _emscripten_glGetShaderPrecisionFormat(shaderType, precisionType, range, precision) {
|
|
var result = GLctx.getShaderPrecisionFormat(shaderType, precisionType);
|
|
HEAP32[((range)>>2)]=result.rangeMin;
|
|
HEAP32[(((range)+(4))>>2)]=result.rangeMax;
|
|
HEAP32[((precision)>>2)]=result.precision;
|
|
}
|
|
|
|
function _emscripten_glUniform1fv(location, count, value) {
|
|
|
|
|
|
var view;
|
|
if (count <= GL.MINI_TEMP_BUFFER_SIZE) {
|
|
// avoid allocation when uploading few enough uniforms
|
|
view = GL.miniTempBufferViews[count-1];
|
|
for (var i = 0; i < count; ++i) {
|
|
view[i] = HEAPF32[(((value)+(4*i))>>2)];
|
|
}
|
|
} else {
|
|
view = HEAPF32.subarray((value)>>2,(value+count*4)>>2);
|
|
}
|
|
GLctx.uniform1fv(GL.uniforms[location], view);
|
|
}
|
|
|
|
function _glDeleteBuffers(n, buffers) {
|
|
for (var i = 0; i < n; i++) {
|
|
var id = HEAP32[(((buffers)+(i*4))>>2)];
|
|
var buffer = GL.buffers[id];
|
|
|
|
// From spec: "glDeleteBuffers silently ignores 0's and names that do not
|
|
// correspond to existing buffer objects."
|
|
if (!buffer) continue;
|
|
|
|
GLctx.deleteBuffer(buffer);
|
|
buffer.name = 0;
|
|
GL.buffers[id] = null;
|
|
|
|
if (id == GL.currArrayBuffer) GL.currArrayBuffer = 0;
|
|
if (id == GL.currElementArrayBuffer) GL.currElementArrayBuffer = 0;
|
|
}
|
|
}
|
|
|
|
function _emscripten_set_gamepaddisconnected_callback(userData, useCapture, callbackfunc) {
|
|
if (!navigator.getGamepads && !navigator.webkitGetGamepads) return -1;
|
|
JSEvents.registerGamepadEventCallback(window, userData, useCapture, callbackfunc, 27, "gamepaddisconnected");
|
|
return 0;
|
|
}
|
|
|
|
function _emscripten_glBindProgramARB() {
|
|
Module['printErr']('missing function: emscripten_glBindProgramARB'); abort(-1);
|
|
}
|
|
|
|
function _emscripten_glBindTexture(target, texture) {
|
|
GLctx.bindTexture(target, texture ? GL.textures[texture] : null);
|
|
}
|
|
|
|
function _emscripten_glCheckFramebufferStatus(x0) { return GLctx['checkFramebufferStatus'](x0) }
|
|
|
|
function _emscripten_glDeleteProgram(id) {
|
|
if (!id) return;
|
|
var program = GL.programs[id];
|
|
if (!program) { // glDeleteProgram actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
|
|
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
GLctx.deleteProgram(program);
|
|
program.name = 0;
|
|
GL.programs[id] = null;
|
|
GL.programInfos[id] = null;
|
|
}
|
|
|
|
function _emscripten_glDisable(x0) { GLctx['disable'](x0) }
|
|
|
|
function _emscripten_glVertexAttrib3fv(index, v) {
|
|
|
|
GLctx.vertexAttrib3f(index, HEAPF32[v>>2], HEAPF32[v+4>>2], HEAPF32[v+8>>2]);
|
|
}
|
|
|
|
function _glClearColor(x0, x1, x2, x3) { GLctx['clearColor'](x0, x1, x2, x3) }
|
|
|
|
function _emscripten_glGetActiveAttrib(program, index, bufSize, length, size, type, name) {
|
|
program = GL.programs[program];
|
|
var info = GLctx.getActiveAttrib(program, index);
|
|
if (!info) return; // If an error occurs, nothing will be written to length, size and type and name.
|
|
|
|
if (bufSize > 0 && name) {
|
|
var numBytesWrittenExclNull = stringToUTF8(info.name, name, bufSize);
|
|
if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
|
|
} else {
|
|
if (length) HEAP32[((length)>>2)]=0;
|
|
}
|
|
|
|
if (size) HEAP32[((size)>>2)]=info.size;
|
|
if (type) HEAP32[((type)>>2)]=info.type;
|
|
}
|
|
|
|
function _emscripten_glIsFramebuffer(framebuffer) {
|
|
var fb = GL.framebuffers[framebuffer];
|
|
if (!fb) return 0;
|
|
return GLctx.isFramebuffer(fb);
|
|
}
|
|
|
|
function _emscripten_glLineWidth(x0) { GLctx['lineWidth'](x0) }
|
|
|
|
function _glfwGetCursorPos(winid, x, y) {
|
|
GLFW.getCursorPos(winid, x, y);
|
|
}
|
|
|
|
function _emscripten_glGetString(name_) {
|
|
if (GL.stringCache[name_]) return GL.stringCache[name_];
|
|
var ret;
|
|
switch(name_) {
|
|
case 0x1F00 /* GL_VENDOR */:
|
|
case 0x1F01 /* GL_RENDERER */:
|
|
case 0x9245 /* UNMASKED_VENDOR_WEBGL */:
|
|
case 0x9246 /* UNMASKED_RENDERER_WEBGL */:
|
|
ret = allocate(intArrayFromString(GLctx.getParameter(name_)), 'i8', ALLOC_NORMAL);
|
|
break;
|
|
case 0x1F02 /* GL_VERSION */:
|
|
var glVersion = GLctx.getParameter(GLctx.VERSION);
|
|
// return GLES version string corresponding to the version of the WebGL context
|
|
{
|
|
glVersion = 'OpenGL ES 2.0 (' + glVersion + ')';
|
|
}
|
|
ret = allocate(intArrayFromString(glVersion), 'i8', ALLOC_NORMAL);
|
|
break;
|
|
case 0x1F03 /* GL_EXTENSIONS */:
|
|
var exts = GLctx.getSupportedExtensions();
|
|
var gl_exts = [];
|
|
for (var i = 0; i < exts.length; ++i) {
|
|
gl_exts.push(exts[i]);
|
|
gl_exts.push("GL_" + exts[i]);
|
|
}
|
|
ret = allocate(intArrayFromString(gl_exts.join(' ')), 'i8', ALLOC_NORMAL);
|
|
break;
|
|
case 0x8B8C /* GL_SHADING_LANGUAGE_VERSION */:
|
|
var glslVersion = GLctx.getParameter(GLctx.SHADING_LANGUAGE_VERSION);
|
|
// extract the version number 'N.M' from the string 'WebGL GLSL ES N.M ...'
|
|
var ver_re = /^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/;
|
|
var ver_num = glslVersion.match(ver_re);
|
|
if (ver_num !== null) {
|
|
if (ver_num[1].length == 3) ver_num[1] = ver_num[1] + '0'; // ensure minor version has 2 digits
|
|
glslVersion = 'OpenGL ES GLSL ES ' + ver_num[1] + ' (' + glslVersion + ')';
|
|
}
|
|
ret = allocate(intArrayFromString(glslVersion), 'i8', ALLOC_NORMAL);
|
|
break;
|
|
default:
|
|
GL.recordError(0x0500/*GL_INVALID_ENUM*/);
|
|
return 0;
|
|
}
|
|
GL.stringCache[name_] = ret;
|
|
return ret;
|
|
}
|
|
|
|
function _emscripten_glGetAttribLocation(program, name) {
|
|
program = GL.programs[program];
|
|
name = Pointer_stringify(name);
|
|
return GLctx.getAttribLocation(program, name);
|
|
}
|
|
|
|
function _emscripten_glRotatef() {
|
|
Module['printErr']('missing function: emscripten_glRotatef'); abort(-1);
|
|
}
|
|
|
|
|
|
function emscriptenWebGLGet(name_, p, type) {
|
|
// Guard against user passing a null pointer.
|
|
// Note that GLES2 spec does not say anything about how passing a null pointer should be treated.
|
|
// Testing on desktop core GL 3, the application crashes on glGetIntegerv to a null pointer, but
|
|
// better to report an error instead of doing anything random.
|
|
if (!p) {
|
|
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
var ret = undefined;
|
|
switch(name_) { // Handle a few trivial GLES values
|
|
case 0x8DFA: // GL_SHADER_COMPILER
|
|
ret = 1;
|
|
break;
|
|
case 0x8DF8: // GL_SHADER_BINARY_FORMATS
|
|
if (type !== 'Integer' && type !== 'Integer64') {
|
|
GL.recordError(0x0500); // GL_INVALID_ENUM
|
|
}
|
|
return; // Do not write anything to the out pointer, since no binary formats are supported.
|
|
case 0x8DF9: // GL_NUM_SHADER_BINARY_FORMATS
|
|
ret = 0;
|
|
break;
|
|
case 0x86A2: // GL_NUM_COMPRESSED_TEXTURE_FORMATS
|
|
// WebGL doesn't have GL_NUM_COMPRESSED_TEXTURE_FORMATS (it's obsolete since GL_COMPRESSED_TEXTURE_FORMATS returns a JS array that can be queried for length),
|
|
// so implement it ourselves to allow C++ GLES2 code get the length.
|
|
var formats = GLctx.getParameter(0x86A3 /*GL_COMPRESSED_TEXTURE_FORMATS*/);
|
|
ret = formats.length;
|
|
break;
|
|
}
|
|
|
|
if (ret === undefined) {
|
|
var result = GLctx.getParameter(name_);
|
|
switch (typeof(result)) {
|
|
case "number":
|
|
ret = result;
|
|
break;
|
|
case "boolean":
|
|
ret = result ? 1 : 0;
|
|
break;
|
|
case "string":
|
|
GL.recordError(0x0500); // GL_INVALID_ENUM
|
|
return;
|
|
case "object":
|
|
if (result === null) {
|
|
// null is a valid result for some (e.g., which buffer is bound - perhaps nothing is bound), but otherwise
|
|
// can mean an invalid name_, which we need to report as an error
|
|
switch(name_) {
|
|
case 0x8894: // ARRAY_BUFFER_BINDING
|
|
case 0x8B8D: // CURRENT_PROGRAM
|
|
case 0x8895: // ELEMENT_ARRAY_BUFFER_BINDING
|
|
case 0x8CA6: // FRAMEBUFFER_BINDING
|
|
case 0x8CA7: // RENDERBUFFER_BINDING
|
|
case 0x8069: // TEXTURE_BINDING_2D
|
|
case 0x8514: { // TEXTURE_BINDING_CUBE_MAP
|
|
ret = 0;
|
|
break;
|
|
}
|
|
default: {
|
|
GL.recordError(0x0500); // GL_INVALID_ENUM
|
|
return;
|
|
}
|
|
}
|
|
} else if (result instanceof Float32Array ||
|
|
result instanceof Uint32Array ||
|
|
result instanceof Int32Array ||
|
|
result instanceof Array) {
|
|
for (var i = 0; i < result.length; ++i) {
|
|
switch (type) {
|
|
case 'Integer': HEAP32[(((p)+(i*4))>>2)]=result[i]; break;
|
|
case 'Float': HEAPF32[(((p)+(i*4))>>2)]=result[i]; break;
|
|
case 'Boolean': HEAP8[(((p)+(i))>>0)]=result[i] ? 1 : 0; break;
|
|
default: throw 'internal glGet error, bad type: ' + type;
|
|
}
|
|
}
|
|
return;
|
|
} else if (result instanceof WebGLBuffer ||
|
|
result instanceof WebGLProgram ||
|
|
result instanceof WebGLFramebuffer ||
|
|
result instanceof WebGLRenderbuffer ||
|
|
result instanceof WebGLTexture) {
|
|
ret = result.name | 0;
|
|
} else {
|
|
GL.recordError(0x0500); // GL_INVALID_ENUM
|
|
return;
|
|
}
|
|
break;
|
|
default:
|
|
GL.recordError(0x0500); // GL_INVALID_ENUM
|
|
return;
|
|
}
|
|
}
|
|
|
|
switch (type) {
|
|
case 'Integer64': (tempI64 = [ret>>>0,(tempDouble=ret,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((p)>>2)]=tempI64[0],HEAP32[(((p)+(4))>>2)]=tempI64[1]); break;
|
|
case 'Integer': HEAP32[((p)>>2)]=ret; break;
|
|
case 'Float': HEAPF32[((p)>>2)]=ret; break;
|
|
case 'Boolean': HEAP8[((p)>>0)]=ret ? 1 : 0; break;
|
|
default: throw 'internal glGet error, bad type: ' + type;
|
|
}
|
|
}function _emscripten_glGetIntegerv(name_, p) {
|
|
emscriptenWebGLGet(name_, p, 'Integer');
|
|
}
|
|
|
|
function _emscripten_glGetFramebufferAttachmentParameteriv(target, attachment, pname, params) {
|
|
var result = GLctx.getFramebufferAttachmentParameter(target, attachment, pname);
|
|
HEAP32[((params)>>2)]=result;
|
|
}
|
|
|
|
function _llvm_stackrestore(p) {
|
|
var self = _llvm_stacksave;
|
|
var ret = self.LLVM_SAVEDSTACKS[p];
|
|
self.LLVM_SAVEDSTACKS.splice(p, 1);
|
|
Runtime.stackRestore(ret);
|
|
}
|
|
|
|
function _glfwSetWindowShouldClose(winid, value) {
|
|
var win = GLFW.WindowFromId(winid);
|
|
if (!win) return;
|
|
win.shouldClose = value;
|
|
}
|
|
|
|
function _emscripten_glClientActiveTexture() {
|
|
Module['printErr']('missing function: emscripten_glClientActiveTexture'); abort(-1);
|
|
}
|
|
|
|
function _glGenBuffers(n, buffers) {
|
|
for (var i = 0; i < n; i++) {
|
|
var buffer = GLctx.createBuffer();
|
|
if (!buffer) {
|
|
GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
|
|
while(i < n) HEAP32[(((buffers)+(i++*4))>>2)]=0;
|
|
return;
|
|
}
|
|
var id = GL.getNewId(GL.buffers);
|
|
buffer.name = id;
|
|
GL.buffers[id] = buffer;
|
|
HEAP32[(((buffers)+(i*4))>>2)]=id;
|
|
}
|
|
}
|
|
|
|
|
|
function _emscripten_memcpy_big(dest, src, num) {
|
|
HEAPU8.set(HEAPU8.subarray(src, src+num), dest);
|
|
return dest;
|
|
}
|
|
Module["_memcpy"] = _memcpy;
|
|
|
|
function _emscripten_glGetShaderInfoLog(shader, maxLength, length, infoLog) {
|
|
var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
|
|
if (log === null) log = '(unknown error)';
|
|
if (maxLength > 0 && infoLog) {
|
|
var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength);
|
|
if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
|
|
} else {
|
|
if (length) HEAP32[((length)>>2)]=0;
|
|
}
|
|
}
|
|
|
|
function _glfwGetTime() {
|
|
return GLFW.getTime() - GLFW.initialTime;
|
|
}
|
|
|
|
function _emscripten_glGetRenderbufferParameteriv(target, pname, params) {
|
|
if (!params) {
|
|
// GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense
|
|
// if params == null, issue a GL error to notify user about it.
|
|
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
HEAP32[((params)>>2)]=GLctx.getRenderbufferParameter(target, pname);
|
|
}
|
|
|
|
function _emscripten_glStencilOpSeparate(x0, x1, x2, x3) { GLctx['stencilOpSeparate'](x0, x1, x2, x3) }
|
|
|
|
function _emscripten_glReadPixels(x, y, width, height, format, type, pixels) {
|
|
var pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, format);
|
|
if (!pixelData) {
|
|
GL.recordError(0x0500/*GL_INVALID_ENUM*/);
|
|
return;
|
|
}
|
|
GLctx.readPixels(x, y, width, height, format, type, pixelData);
|
|
}
|
|
|
|
function _emscripten_glCompressedTexSubImage2D(target, level, xoffset, yoffset, width, height, format, imageSize, data) {
|
|
GLctx['compressedTexSubImage2D'](target, level, xoffset, yoffset, width, height, format, data ? HEAPU8.subarray((data),(data+imageSize)) : null);
|
|
}
|
|
|
|
function _emscripten_glGetError() {
|
|
// First return any GL error generated by the emscripten library_gl.js interop layer.
|
|
if (GL.lastError) {
|
|
var error = GL.lastError;
|
|
GL.lastError = 0/*GL_NO_ERROR*/;
|
|
return error;
|
|
} else { // If there were none, return the GL error from the browser GL context.
|
|
return GLctx.getError();
|
|
}
|
|
}
|
|
|
|
function _emscripten_glFramebufferTexture2D(target, attachment, textarget, texture, level) {
|
|
GLctx.framebufferTexture2D(target, attachment, textarget,
|
|
GL.textures[texture], level);
|
|
}
|
|
|
|
function _emscripten_glIsEnabled(x0) { return GLctx['isEnabled'](x0) }
|
|
|
|
function _glClearDepthf(x0) { GLctx['clearDepth'](x0) }
|
|
|
|
|
|
Module["_memmove"] = _memmove;
|
|
|
|
function _glGenTextures(n, textures) {
|
|
for (var i = 0; i < n; i++) {
|
|
var texture = GLctx.createTexture();
|
|
if (!texture) {
|
|
GL.recordError(0x0502 /* GL_INVALID_OPERATION */); // GLES + EGL specs don't specify what should happen here, so best to issue an error and create IDs with 0.
|
|
while(i < n) HEAP32[(((textures)+(i++*4))>>2)]=0;
|
|
return;
|
|
}
|
|
var id = GL.getNewId(GL.textures);
|
|
texture.name = id;
|
|
GL.textures[id] = texture;
|
|
HEAP32[(((textures)+(i*4))>>2)]=id;
|
|
}
|
|
}
|
|
|
|
function _emscripten_glVertexAttrib4f(x0, x1, x2, x3, x4) { GLctx['vertexAttrib4f'](x0, x1, x2, x3, x4) }
|
|
|
|
function _glDepthFunc(x0) { GLctx['depthFunc'](x0) }
|
|
|
|
|
|
var __main_thread_futex_wait_address; if (ENVIRONMENT_IS_PTHREAD) __main_thread_futex_wait_address = PthreadWorkerInit.__main_thread_futex_wait_address; else PthreadWorkerInit.__main_thread_futex_wait_address = __main_thread_futex_wait_address = allocate(1, "i32*", ALLOC_STATIC);function _emscripten_futex_wait(addr, val, timeout) {
|
|
if (addr <= 0 || addr > HEAP8.length || addr&3 != 0) return -22;
|
|
// dump('futex_wait addr:' + addr + ' by thread: ' + _pthread_self() + (ENVIRONMENT_IS_PTHREAD?'(pthread)':'') + '\n');
|
|
if (ENVIRONMENT_IS_WORKER) {
|
|
var ret = Atomics.wait(HEAP32, addr >> 2, val, timeout);
|
|
// dump('futex_wait done by thread: ' + _pthread_self() + (ENVIRONMENT_IS_PTHREAD?'(pthread)':'') + '\n');
|
|
if (ret === 'timed-out') return -110;
|
|
if (ret === 'not-equal') return -11;
|
|
if (ret === 'ok') return 0;
|
|
throw 'Atomics.wait returned an unexpected value ' + ret;
|
|
} else {
|
|
// Atomics.wait is not available in the main browser thread, so simulate it via busy spinning.
|
|
var loadedVal = Atomics.load(HEAP32, addr >> 2);
|
|
if (val != loadedVal) return -11;
|
|
|
|
var tNow = performance.now();
|
|
var tEnd = tNow + timeout;
|
|
|
|
|
|
// Register globally which address the main thread is simulating to be waiting on. When zero, main thread is not waiting on anything,
|
|
// and on nonzero, the contents of address pointed by __main_thread_futex_wait_address tell which address the main thread is simulating its wait on.
|
|
Atomics.store(HEAP32, __main_thread_futex_wait_address >> 2, addr);
|
|
var ourWaitAddress = addr; // We may recursively re-enter this function while processing queued calls, in which case we'll do a spurious wakeup of the older wait operation.
|
|
while (addr == ourWaitAddress) {
|
|
tNow = performance.now();
|
|
if (tNow > tEnd) {
|
|
return -110;
|
|
}
|
|
_emscripten_main_thread_process_queued_calls(); // We are performing a blocking loop here, so must pump any pthreads if they want to perform operations that are proxied.
|
|
addr = Atomics.load(HEAP32, __main_thread_futex_wait_address >> 2); // Look for a worker thread waking us up.
|
|
}
|
|
return 0;
|
|
}
|
|
}
|
|
|
|
function _emscripten_glClearDepthf(x0) { GLctx['clearDepth'](x0) }
|
|
|
|
function _emscripten_glClear(x0) { GLctx['clear'](x0) }
|
|
|
|
|
|
function _emscripten_glBindBuffer(target, buffer) {
|
|
var bufferObj = buffer ? GL.buffers[buffer] : null;
|
|
|
|
|
|
GLctx.bindBuffer(target, bufferObj);
|
|
}
|
|
|
|
function _emscripten_glGetUniformfv(program, location, params) {
|
|
emscriptenWebGLGetUniform(program, location, params, 'Float');
|
|
}
|
|
|
|
function _glGetProgramiv(program, pname, p) {
|
|
if (!p) {
|
|
// GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
|
|
// if p == null, issue a GL error to notify user about it.
|
|
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
|
|
if (program >= GL.counter) {
|
|
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
|
|
var ptable = GL.programInfos[program];
|
|
if (!ptable) {
|
|
GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
|
|
return;
|
|
}
|
|
|
|
if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
|
|
var log = GLctx.getProgramInfoLog(GL.programs[program]);
|
|
if (log === null) log = '(unknown error)';
|
|
HEAP32[((p)>>2)]=log.length + 1;
|
|
} else if (pname == 0x8B87 /* GL_ACTIVE_UNIFORM_MAX_LENGTH */) {
|
|
HEAP32[((p)>>2)]=ptable.maxUniformLength;
|
|
} else if (pname == 0x8B8A /* GL_ACTIVE_ATTRIBUTE_MAX_LENGTH */) {
|
|
if (ptable.maxAttributeLength == -1) {
|
|
var program = GL.programs[program];
|
|
var numAttribs = GLctx.getProgramParameter(program, GLctx.ACTIVE_ATTRIBUTES);
|
|
ptable.maxAttributeLength = 0; // Spec says if there are no active attribs, 0 must be returned.
|
|
for (var i = 0; i < numAttribs; ++i) {
|
|
var activeAttrib = GLctx.getActiveAttrib(program, i);
|
|
ptable.maxAttributeLength = Math.max(ptable.maxAttributeLength, activeAttrib.name.length+1);
|
|
}
|
|
}
|
|
HEAP32[((p)>>2)]=ptable.maxAttributeLength;
|
|
} else if (pname == 0x8A35 /* GL_ACTIVE_UNIFORM_BLOCK_MAX_NAME_LENGTH */) {
|
|
if (ptable.maxUniformBlockNameLength == -1) {
|
|
var program = GL.programs[program];
|
|
var numBlocks = GLctx.getProgramParameter(program, GLctx.ACTIVE_UNIFORM_BLOCKS);
|
|
ptable.maxUniformBlockNameLength = 0;
|
|
for (var i = 0; i < numBlocks; ++i) {
|
|
var activeBlockName = GLctx.getActiveUniformBlockName(program, i);
|
|
ptable.maxUniformBlockNameLength = Math.max(ptable.maxUniformBlockNameLength, activeBlockName.length+1);
|
|
}
|
|
}
|
|
HEAP32[((p)>>2)]=ptable.maxUniformBlockNameLength;
|
|
} else {
|
|
HEAP32[((p)>>2)]=GLctx.getProgramParameter(GL.programs[program], pname);
|
|
}
|
|
}
|
|
|
|
function _glVertexAttribPointer(index, size, type, normalized, stride, ptr) {
|
|
GLctx.vertexAttribPointer(index, size, type, !!normalized, stride, ptr);
|
|
}
|
|
|
|
function _emscripten_exit_pointerlock() {
|
|
// Make sure no queued up calls will fire after this.
|
|
JSEvents.removeDeferredCalls(JSEvents.requestPointerLock);
|
|
|
|
if (document.exitPointerLock) {
|
|
document.exitPointerLock();
|
|
} else if (document.msExitPointerLock) {
|
|
document.msExitPointerLock();
|
|
} else if (document.mozExitPointerLock) {
|
|
document.mozExitPointerLock();
|
|
} else if (document.webkitExitPointerLock) {
|
|
document.webkitExitPointerLock();
|
|
} else {
|
|
return -1;
|
|
}
|
|
return 0;
|
|
}
|
|
|
|
|
|
|
|
var cttz_i8; if (ENVIRONMENT_IS_PTHREAD) cttz_i8 = PthreadWorkerInit.cttz_i8; else PthreadWorkerInit.cttz_i8 = cttz_i8 = allocate([8,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,6,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,7,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,6,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,5,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0,4,0,1,0,2,0,1,0,3,0,1,0,2,0,1,0], "i8", ALLOC_STATIC);
|
|
Module["_llvm_cttz_i32"] = _llvm_cttz_i32;
|
|
Module["___udivmoddi4"] = ___udivmoddi4;
|
|
Module["___uremdi3"] = ___uremdi3;
|
|
|
|
function _glGetUniformLocation(program, name) {
|
|
name = Pointer_stringify(name);
|
|
|
|
var arrayOffset = 0;
|
|
// If user passed an array accessor "[index]", parse the array index off the accessor.
|
|
if (name.indexOf(']', name.length-1) !== -1) {
|
|
var ls = name.lastIndexOf('[');
|
|
var arrayIndex = name.slice(ls+1, -1);
|
|
if (arrayIndex.length > 0) {
|
|
arrayOffset = parseInt(arrayIndex);
|
|
if (arrayOffset < 0) {
|
|
return -1;
|
|
}
|
|
}
|
|
name = name.slice(0, ls);
|
|
}
|
|
|
|
var ptable = GL.programInfos[program];
|
|
if (!ptable) {
|
|
return -1;
|
|
}
|
|
var utable = ptable.uniforms;
|
|
var uniformInfo = utable[name]; // returns pair [ dimension_of_uniform_array, uniform_location ]
|
|
if (uniformInfo && arrayOffset < uniformInfo[0]) { // Check if user asked for an out-of-bounds element, i.e. for 'vec4 colors[3];' user could ask for 'colors[10]' which should return -1.
|
|
return uniformInfo[1]+arrayOffset;
|
|
} else {
|
|
return -1;
|
|
}
|
|
}
|
|
|
|
function _emscripten_glGetAttachedShaders(program, maxCount, count, shaders) {
|
|
var result = GLctx.getAttachedShaders(GL.programs[program]);
|
|
var len = result.length;
|
|
if (len > maxCount) {
|
|
len = maxCount;
|
|
}
|
|
HEAP32[((count)>>2)]=len;
|
|
for (var i = 0; i < len; ++i) {
|
|
var id = GL.shaders.indexOf(result[i]);
|
|
assert(id !== -1, 'shader not bound to local id');
|
|
HEAP32[(((shaders)+(i*4))>>2)]=id;
|
|
}
|
|
}
|
|
|
|
function _emscripten_glGenRenderbuffers(n, renderbuffers) {
|
|
for (var i = 0; i < n; i++) {
|
|
var renderbuffer = GLctx.createRenderbuffer();
|
|
if (!renderbuffer) {
|
|
GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
|
|
while(i < n) HEAP32[(((renderbuffers)+(i++*4))>>2)]=0;
|
|
return;
|
|
}
|
|
var id = GL.getNewId(GL.renderbuffers);
|
|
renderbuffer.name = id;
|
|
GL.renderbuffers[id] = renderbuffer;
|
|
HEAP32[(((renderbuffers)+(i*4))>>2)]=id;
|
|
}
|
|
}
|
|
|
|
function _emscripten_glFrontFace(x0) { GLctx['frontFace'](x0) }
|
|
|
|
function _emscripten_glActiveTexture(x0) { GLctx['activeTexture'](x0) }
|
|
|
|
function _emscripten_glUniform1iv(location, count, value) {
|
|
|
|
|
|
GLctx.uniform1iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*4)>>2));
|
|
}
|
|
|
|
function _emscripten_glTexCoordPointer() {
|
|
Module['printErr']('missing function: emscripten_glTexCoordPointer'); abort(-1);
|
|
}
|
|
|
|
function _emscripten_glGetInfoLogARB() {
|
|
Module['printErr']('missing function: emscripten_glGetInfoLogARB'); abort(-1);
|
|
}
|
|
|
|
|
|
function __exit(status) {
|
|
// void _exit(int status);
|
|
// http://pubs.opengroup.org/onlinepubs/000095399/functions/exit.html
|
|
Module['exit'](status);
|
|
}function _exit(status) {
|
|
__exit(status);
|
|
}
|
|
|
|
function _emscripten_glRenderbufferStorage(x0, x1, x2, x3) { GLctx['renderbufferStorage'](x0, x1, x2, x3) }
|
|
|
|
function _emscripten_glCopyTexSubImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { GLctx['copyTexSubImage2D'](x0, x1, x2, x3, x4, x5, x6, x7) }
|
|
|
|
function _glfwSetCursorPosCallback(winid, cbfun) {
|
|
GLFW.setCursorPosCallback(winid, cbfun);
|
|
}
|
|
|
|
function _emscripten_glDepthRange(x0, x1) { GLctx['depthRange'](x0, x1) }
|
|
|
|
function _glBindAttribLocation(program, index, name) {
|
|
name = Pointer_stringify(name);
|
|
GLctx.bindAttribLocation(GL.programs[program], index, name);
|
|
}
|
|
|
|
function _emscripten_glShaderBinary() {
|
|
GL.recordError(0x0500/*GL_INVALID_ENUM*/);
|
|
}
|
|
|
|
function _emscripten_glIsProgram(program) {
|
|
var program = GL.programs[program];
|
|
if (!program) return 0;
|
|
return GLctx.isProgram(program);
|
|
}
|
|
|
|
function _emscripten_glBlendColor(x0, x1, x2, x3) { GLctx['blendColor'](x0, x1, x2, x3) }
|
|
|
|
function _emscripten_glGetShaderiv(shader, pname, p) {
|
|
if (!p) {
|
|
// GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
|
|
// if p == null, issue a GL error to notify user about it.
|
|
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
|
|
var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
|
|
if (log === null) log = '(unknown error)';
|
|
HEAP32[((p)>>2)]=log.length + 1;
|
|
} else {
|
|
HEAP32[((p)>>2)]=GLctx.getShaderParameter(GL.shaders[shader], pname);
|
|
}
|
|
}
|
|
|
|
function _emscripten_glUniformMatrix3fv(location, count, transpose, value) {
|
|
|
|
|
|
var view;
|
|
if (9*count <= GL.MINI_TEMP_BUFFER_SIZE) {
|
|
// avoid allocation when uploading few enough uniforms
|
|
view = GL.miniTempBufferViews[9*count-1];
|
|
for (var i = 0; i < 9*count; i += 9) {
|
|
view[i] = HEAPF32[(((value)+(4*i))>>2)];
|
|
view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
|
|
view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
|
|
view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
|
|
view[i+4] = HEAPF32[(((value)+(4*i+16))>>2)];
|
|
view[i+5] = HEAPF32[(((value)+(4*i+20))>>2)];
|
|
view[i+6] = HEAPF32[(((value)+(4*i+24))>>2)];
|
|
view[i+7] = HEAPF32[(((value)+(4*i+28))>>2)];
|
|
view[i+8] = HEAPF32[(((value)+(4*i+32))>>2)];
|
|
}
|
|
} else {
|
|
view = HEAPF32.subarray((value)>>2,(value+count*36)>>2);
|
|
}
|
|
GLctx.uniformMatrix3fv(GL.uniforms[location], !!transpose, view);
|
|
}
|
|
|
|
|
|
Module["___udivdi3"] = ___udivdi3;
|
|
|
|
function _emscripten_glUniform4fv(location, count, value) {
|
|
|
|
|
|
var view;
|
|
if (4*count <= GL.MINI_TEMP_BUFFER_SIZE) {
|
|
// avoid allocation when uploading few enough uniforms
|
|
view = GL.miniTempBufferViews[4*count-1];
|
|
for (var i = 0; i < 4*count; i += 4) {
|
|
view[i] = HEAPF32[(((value)+(4*i))>>2)];
|
|
view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
|
|
view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
|
|
view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
|
|
}
|
|
} else {
|
|
view = HEAPF32.subarray((value)>>2,(value+count*16)>>2);
|
|
}
|
|
GLctx.uniform4fv(GL.uniforms[location], view);
|
|
}
|
|
|
|
function _glBufferSubData(target, offset, size, data) {
|
|
GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data+size));
|
|
}
|
|
|
|
function _emscripten_futex_wake(addr, count) {
|
|
if (addr <= 0 || addr > HEAP8.length || addr&3 != 0 || count < 0) return -22;
|
|
if (count == 0) return 0;
|
|
// dump('futex_wake addr:' + addr + ' by thread: ' + _pthread_self() + (ENVIRONMENT_IS_PTHREAD?'(pthread)':'') + '\n');
|
|
|
|
// See if main thread is waiting on this address? If so, wake it up by resetting its wake location to zero.
|
|
// Note that this is not a fair procedure, since we always wake main thread first before any workers, so
|
|
// this scheme does not adhere to real queue-based waiting.
|
|
var mainThreadWaitAddress = Atomics.load(HEAP32, __main_thread_futex_wait_address >> 2);
|
|
var mainThreadWoken = 0;
|
|
if (mainThreadWaitAddress == addr) {
|
|
var loadedAddr = Atomics.compareExchange(HEAP32, __main_thread_futex_wait_address >> 2, mainThreadWaitAddress, 0);
|
|
if (loadedAddr == mainThreadWaitAddress) {
|
|
--count;
|
|
mainThreadWoken = 1;
|
|
if (count <= 0) return 1;
|
|
}
|
|
}
|
|
|
|
// Wake any workers waiting on this address.
|
|
var ret = Atomics.wake(HEAP32, addr >> 2, count);
|
|
if (ret >= 0) return ret + mainThreadWoken;
|
|
throw 'Atomics.wake returned an unexpected value ' + ret;
|
|
}
|
|
|
|
function _glGetProgramInfoLog(program, maxLength, length, infoLog) {
|
|
var log = GLctx.getProgramInfoLog(GL.programs[program]);
|
|
if (log === null) log = '(unknown error)';
|
|
|
|
if (maxLength > 0 && infoLog) {
|
|
var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength);
|
|
if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
|
|
} else {
|
|
if (length) HEAP32[((length)>>2)]=0;
|
|
}
|
|
}
|
|
|
|
function _emscripten_glGenFramebuffers(n, ids) {
|
|
for (var i = 0; i < n; ++i) {
|
|
var framebuffer = GLctx.createFramebuffer();
|
|
if (!framebuffer) {
|
|
GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
|
|
while(i < n) HEAP32[(((ids)+(i++*4))>>2)]=0;
|
|
return;
|
|
}
|
|
var id = GL.getNewId(GL.framebuffers);
|
|
framebuffer.name = id;
|
|
GL.framebuffers[id] = framebuffer;
|
|
HEAP32[(((ids)+(i*4))>>2)]=id;
|
|
}
|
|
}
|
|
|
|
function _glGetShaderiv(shader, pname, p) {
|
|
if (!p) {
|
|
// GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
|
|
// if p == null, issue a GL error to notify user about it.
|
|
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
|
|
var log = GLctx.getShaderInfoLog(GL.shaders[shader]);
|
|
if (log === null) log = '(unknown error)';
|
|
HEAP32[((p)>>2)]=log.length + 1;
|
|
} else {
|
|
HEAP32[((p)>>2)]=GLctx.getShaderParameter(GL.shaders[shader], pname);
|
|
}
|
|
}
|
|
|
|
function _emscripten_glBlendEquationSeparate(x0, x1) { GLctx['blendEquationSeparate'](x0, x1) }
|
|
|
|
function _glfwSetWindowIconifyCallback(winid, cbfun) {
|
|
var win = GLFW.WindowFromId(winid);
|
|
if (!win) return;
|
|
win.windowIconifyFunc = cbfun;
|
|
}
|
|
|
|
function _emscripten_glDrawRangeElements() {
|
|
Module['printErr']('missing function: emscripten_glDrawRangeElements'); abort(-1);
|
|
}
|
|
|
|
function _emscripten_glGenTextures(n, textures) {
|
|
for (var i = 0; i < n; i++) {
|
|
var texture = GLctx.createTexture();
|
|
if (!texture) {
|
|
GL.recordError(0x0502 /* GL_INVALID_OPERATION */); // GLES + EGL specs don't specify what should happen here, so best to issue an error and create IDs with 0.
|
|
while(i < n) HEAP32[(((textures)+(i++*4))>>2)]=0;
|
|
return;
|
|
}
|
|
var id = GL.getNewId(GL.textures);
|
|
texture.name = id;
|
|
GL.textures[id] = texture;
|
|
HEAP32[(((textures)+(i*4))>>2)]=id;
|
|
}
|
|
}
|
|
|
|
function _emscripten_glVertexAttrib2fv(index, v) {
|
|
|
|
GLctx.vertexAttrib2f(index, HEAPF32[v>>2], HEAPF32[v+4>>2]);
|
|
}
|
|
|
|
function _emscripten_glGetActiveUniform(program, index, bufSize, length, size, type, name) {
|
|
program = GL.programs[program];
|
|
var info = GLctx.getActiveUniform(program, index);
|
|
if (!info) return; // If an error occurs, nothing will be written to length, size, type and name.
|
|
|
|
if (bufSize > 0 && name) {
|
|
var numBytesWrittenExclNull = stringToUTF8(info.name, name, bufSize);
|
|
if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
|
|
} else {
|
|
if (length) HEAP32[((length)>>2)]=0;
|
|
}
|
|
|
|
if (size) HEAP32[((size)>>2)]=info.size;
|
|
if (type) HEAP32[((type)>>2)]=info.type;
|
|
}
|
|
|
|
|
|
Module["_roundf"] = _roundf;
|
|
|
|
function _emscripten_glDeleteObjectARB() {
|
|
Module['printErr']('missing function: emscripten_glDeleteObjectARB'); abort(-1);
|
|
}
|
|
|
|
function _emscripten_set_touchmove_callback(target, userData, useCapture, callbackfunc) {
|
|
JSEvents.registerTouchEventCallback(target, userData, useCapture, callbackfunc, 24, "touchmove");
|
|
return 0;
|
|
}
|
|
|
|
function _emscripten_glUniform1f(location, v0) {
|
|
GLctx.uniform1f(GL.uniforms[location], v0);
|
|
}
|
|
|
|
function _emscripten_glVertexAttribPointer(index, size, type, normalized, stride, ptr) {
|
|
GLctx.vertexAttribPointer(index, size, type, !!normalized, stride, ptr);
|
|
}
|
|
|
|
function _glShaderSource(shader, count, string, length) {
|
|
var source = GL.getSource(shader, count, string, length);
|
|
|
|
|
|
GLctx.shaderSource(GL.shaders[shader], source);
|
|
}
|
|
|
|
|
|
function __spawn_thread(threadParams) {
|
|
if (ENVIRONMENT_IS_PTHREAD) throw 'Internal Error! _spawn_thread() can only ever be called from main application thread!';
|
|
|
|
var worker = PThread.getNewWorker();
|
|
if (worker.pthread !== undefined) throw 'Internal error!';
|
|
if (!threadParams.pthread_ptr) throw 'Internal error, no pthread ptr!';
|
|
PThread.runningWorkers.push(worker);
|
|
|
|
// Allocate memory for thread-local storage and initialize it to zero.
|
|
var tlsMemory = _malloc(128 * 4);
|
|
for (var i = 0; i < 128; ++i) {
|
|
HEAP32[(((tlsMemory)+(i*4))>>2)]=0;
|
|
}
|
|
|
|
var pthread = PThread.pthreads[threadParams.pthread_ptr] = { // Create a pthread info object to represent this thread.
|
|
worker: worker,
|
|
stackBase: threadParams.stackBase,
|
|
stackSize: threadParams.stackSize,
|
|
allocatedOwnStack: threadParams.allocatedOwnStack,
|
|
thread: threadParams.pthread_ptr,
|
|
threadInfoStruct: threadParams.pthread_ptr // Info area for this thread in Emscripten HEAP (shared)
|
|
};
|
|
Atomics.store(HEAPU32, (pthread.threadInfoStruct + 0 ) >> 2, 0); // threadStatus <- 0, meaning not yet exited.
|
|
Atomics.store(HEAPU32, (pthread.threadInfoStruct + 4 ) >> 2, 0); // threadExitCode <- 0.
|
|
Atomics.store(HEAPU32, (pthread.threadInfoStruct + 20 ) >> 2, 0); // profilerBlock <- 0.
|
|
Atomics.store(HEAPU32, (pthread.threadInfoStruct + 80 ) >> 2, threadParams.detached);
|
|
Atomics.store(HEAPU32, (pthread.threadInfoStruct + 116 ) >> 2, tlsMemory); // Init thread-local-storage memory array.
|
|
Atomics.store(HEAPU32, (pthread.threadInfoStruct + 60 ) >> 2, 0); // Mark initial status to unused.
|
|
Atomics.store(HEAPU32, (pthread.threadInfoStruct + 52 ) >> 2, pthread.threadInfoStruct); // Main thread ID.
|
|
Atomics.store(HEAPU32, (pthread.threadInfoStruct + 56 ) >> 2, PROCINFO.pid); // Process ID.
|
|
|
|
Atomics.store(HEAPU32, (pthread.threadInfoStruct + 120) >> 2, threadParams.stackSize);
|
|
Atomics.store(HEAPU32, (pthread.threadInfoStruct + 96) >> 2, threadParams.stackSize);
|
|
Atomics.store(HEAPU32, (pthread.threadInfoStruct + 92) >> 2, threadParams.stackBase);
|
|
Atomics.store(HEAPU32, (pthread.threadInfoStruct + 120 + 8) >> 2, threadParams.stackBase);
|
|
Atomics.store(HEAPU32, (pthread.threadInfoStruct + 120 + 12) >> 2, threadParams.detached);
|
|
Atomics.store(HEAPU32, (pthread.threadInfoStruct + 120 + 20) >> 2, threadParams.schedPolicy);
|
|
Atomics.store(HEAPU32, (pthread.threadInfoStruct + 120 + 24) >> 2, threadParams.schedPrio);
|
|
|
|
var global_libc = _emscripten_get_global_libc();
|
|
var global_locale = global_libc + 40;
|
|
Atomics.store(HEAPU32, (pthread.threadInfoStruct + 188) >> 2, global_locale);
|
|
|
|
|
|
worker.pthread = pthread;
|
|
|
|
// Ask the worker to start executing its pthread entry point function.
|
|
worker.postMessage({
|
|
cmd: 'run',
|
|
start_routine: threadParams.startRoutine,
|
|
arg: threadParams.arg,
|
|
threadInfoStruct: threadParams.pthread_ptr,
|
|
selfThreadId: threadParams.pthread_ptr, // TODO: Remove this since thread ID is now the same as the thread address.
|
|
parentThreadId: threadParams.parent_pthread_ptr,
|
|
stackBase: threadParams.stackBase,
|
|
stackSize: threadParams.stackSize,
|
|
}, threadParams.transferList);
|
|
}
|
|
|
|
function _pthread_getschedparam(thread, policy, schedparam) {
|
|
if (!policy && !schedparam) return ERRNO_CODES.EINVAL;
|
|
|
|
if (!thread) {
|
|
Module['printErr']('pthread_getschedparam called with a null thread pointer!');
|
|
return ERRNO_CODES.ESRCH;
|
|
}
|
|
var self = HEAP32[(((thread)+(24))>>2)];
|
|
if (self != thread) {
|
|
Module['printErr']('pthread_getschedparam attempted on thread ' + thread + ', which does not point to a valid thread, or does not exist anymore!');
|
|
return ERRNO_CODES.ESRCH;
|
|
}
|
|
|
|
var schedPolicy = Atomics.load(HEAPU32, (thread + 120 + 20 ) >> 2);
|
|
var schedPrio = Atomics.load(HEAPU32, (thread + 120 + 24 ) >> 2);
|
|
|
|
if (policy) HEAP32[((policy)>>2)]=schedPolicy;
|
|
if (schedparam) HEAP32[((schedparam)>>2)]=schedPrio;
|
|
return 0;
|
|
}
|
|
|
|
function _pthread_self() {
|
|
return __pthread_ptr|0;
|
|
}function _pthread_create(pthread_ptr, attr, start_routine, arg) {
|
|
if (typeof SharedArrayBuffer === 'undefined') {
|
|
Module['printErr']('Current environment does not support SharedArrayBuffer, pthreads are not available!');
|
|
return 11;
|
|
}
|
|
if (!pthread_ptr) {
|
|
Module['printErr']('pthread_create called with a null thread pointer!');
|
|
return 22;
|
|
}
|
|
|
|
var transferList = []; // List of JS objects that will transfer ownership to the Worker hosting the thread
|
|
|
|
|
|
// Synchronously proxy the thread creation to main thread if possible. If we need to transfer ownership of objects, then
|
|
// proxy asynchronously via postMessage.
|
|
if (ENVIRONMENT_IS_PTHREAD && transferList.length == 0) {
|
|
return _emscripten_sync_run_in_main_thread_4(137, pthread_ptr, attr, start_routine, arg);
|
|
}
|
|
|
|
var stackSize = 0;
|
|
var stackBase = 0;
|
|
var detached = 0; // Default thread attr is PTHREAD_CREATE_JOINABLE, i.e. start as not detached.
|
|
var schedPolicy = 0; /*SCHED_OTHER*/
|
|
var schedPrio = 0;
|
|
if (attr) {
|
|
stackSize = HEAP32[((attr)>>2)];
|
|
stackBase = HEAP32[(((attr)+(8))>>2)];
|
|
detached = HEAP32[(((attr)+(12))>>2)] != 0/*PTHREAD_CREATE_JOINABLE*/;
|
|
var inheritSched = HEAP32[(((attr)+(16))>>2)] == 0/*PTHREAD_INHERIT_SCHED*/;
|
|
if (inheritSched) {
|
|
var prevSchedPolicy = HEAP32[(((attr)+(20))>>2)];
|
|
var prevSchedPrio = HEAP32[(((attr)+(24))>>2)];
|
|
_pthread_getschedparam(_pthread_self(), attr + 20, attr + 24);
|
|
schedPolicy = HEAP32[(((attr)+(20))>>2)];
|
|
schedPrio = HEAP32[(((attr)+(24))>>2)];
|
|
HEAP32[(((attr)+(20))>>2)]=prevSchedPolicy;
|
|
HEAP32[(((attr)+(24))>>2)]=prevSchedPrio;
|
|
} else {
|
|
schedPolicy = HEAP32[(((attr)+(20))>>2)];
|
|
schedPrio = HEAP32[(((attr)+(24))>>2)];
|
|
}
|
|
}
|
|
stackSize += 81920 /*DEFAULT_STACK_SIZE*/;
|
|
var allocatedOwnStack = stackBase == 0; // If allocatedOwnStack == true, then the pthread impl maintains the stack allocation.
|
|
if (allocatedOwnStack) {
|
|
stackBase = _malloc(stackSize); // Allocate a stack if the user doesn't want to place the stack in a custom memory area.
|
|
} else {
|
|
// Musl stores the stack base address assuming stack grows downwards, so adjust it to Emscripten convention that the
|
|
// stack grows upwards instead.
|
|
stackBase -= stackSize;
|
|
assert(stackBase > 0);
|
|
}
|
|
|
|
// Allocate thread block (pthread_t structure).
|
|
var threadInfoStruct = _malloc(244);
|
|
for (var i = 0; i < 244 >> 2; ++i) HEAPU32[(threadInfoStruct>>2) + i] = 0; // zero-initialize thread structure.
|
|
HEAP32[((pthread_ptr)>>2)]=threadInfoStruct;
|
|
|
|
// The pthread struct has a field that points to itself - this is used as a magic ID to detect whether the pthread_t
|
|
// structure is 'alive'.
|
|
HEAP32[(((threadInfoStruct)+(24))>>2)]=threadInfoStruct;
|
|
|
|
// pthread struct robust_list head should point to itself.
|
|
var headPtr = threadInfoStruct + 168;
|
|
HEAP32[((headPtr)>>2)]=headPtr;
|
|
|
|
var threadParams = {
|
|
stackBase: stackBase,
|
|
stackSize: stackSize,
|
|
allocatedOwnStack: allocatedOwnStack,
|
|
schedPolicy: schedPolicy,
|
|
schedPrio: schedPrio,
|
|
detached: detached,
|
|
startRoutine: start_routine,
|
|
pthread_ptr: threadInfoStruct,
|
|
parent_pthread_ptr: _pthread_self(),
|
|
arg: arg,
|
|
transferList: transferList
|
|
};
|
|
|
|
if (ENVIRONMENT_IS_PTHREAD) {
|
|
// The prepopulated pool of web workers that can host pthreads is stored in the main JS thread. Therefore if a
|
|
// pthread is attempting to spawn a new thread, the thread creation must be deferred to the main JS thread.
|
|
threadParams.cmd = 'spawnThread';
|
|
postMessage(threadParams, transferList);
|
|
} else {
|
|
// We are the main thread, so we have the pthread warmup pool in this thread and can fire off JS thread creation
|
|
// directly ourselves.
|
|
__spawn_thread(threadParams);
|
|
}
|
|
|
|
return 0;
|
|
}
|
|
|
|
function _emscripten_glDrawArrays(mode, first, count) {
|
|
|
|
GLctx.drawArrays(mode, first, count);
|
|
|
|
}
|
|
|
|
function _emscripten_glGenBuffers(n, buffers) {
|
|
for (var i = 0; i < n; i++) {
|
|
var buffer = GLctx.createBuffer();
|
|
if (!buffer) {
|
|
GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
|
|
while(i < n) HEAP32[(((buffers)+(i++*4))>>2)]=0;
|
|
return;
|
|
}
|
|
var id = GL.getNewId(GL.buffers);
|
|
buffer.name = id;
|
|
GL.buffers[id] = buffer;
|
|
HEAP32[(((buffers)+(i*4))>>2)]=id;
|
|
}
|
|
}
|
|
|
|
function _emscripten_glClearDepth(x0) { GLctx['clearDepth'](x0) }
|
|
|
|
function _emscripten_set_keypress_callback(target, userData, useCapture, callbackfunc) {
|
|
JSEvents.registerKeyEventCallback(target, userData, useCapture, callbackfunc, 1, "keypress");
|
|
return 0;
|
|
}
|
|
|
|
function _glfwSetCharCallback(winid, cbfun) {
|
|
GLFW.setCharCallback(winid, cbfun);
|
|
}
|
|
|
|
function _emscripten_glGetUniformLocation(program, name) {
|
|
name = Pointer_stringify(name);
|
|
|
|
var arrayOffset = 0;
|
|
// If user passed an array accessor "[index]", parse the array index off the accessor.
|
|
if (name.indexOf(']', name.length-1) !== -1) {
|
|
var ls = name.lastIndexOf('[');
|
|
var arrayIndex = name.slice(ls+1, -1);
|
|
if (arrayIndex.length > 0) {
|
|
arrayOffset = parseInt(arrayIndex);
|
|
if (arrayOffset < 0) {
|
|
return -1;
|
|
}
|
|
}
|
|
name = name.slice(0, ls);
|
|
}
|
|
|
|
var ptable = GL.programInfos[program];
|
|
if (!ptable) {
|
|
return -1;
|
|
}
|
|
var utable = ptable.uniforms;
|
|
var uniformInfo = utable[name]; // returns pair [ dimension_of_uniform_array, uniform_location ]
|
|
if (uniformInfo && arrayOffset < uniformInfo[0]) { // Check if user asked for an out-of-bounds element, i.e. for 'vec4 colors[3];' user could ask for 'colors[10]' which should return -1.
|
|
return uniformInfo[1]+arrayOffset;
|
|
} else {
|
|
return -1;
|
|
}
|
|
}
|
|
|
|
function _glBindBuffer(target, buffer) {
|
|
var bufferObj = buffer ? GL.buffers[buffer] : null;
|
|
|
|
|
|
GLctx.bindBuffer(target, bufferObj);
|
|
}
|
|
|
|
|
|
function _emscripten_set_current_thread_status_js(newStatus) {
|
|
}
|
|
Module["_emscripten_set_current_thread_status"] = _emscripten_set_current_thread_status;
|
|
|
|
function _emscripten_glVertexAttrib4fv(index, v) {
|
|
|
|
GLctx.vertexAttrib4f(index, HEAPF32[v>>2], HEAPF32[v+4>>2], HEAPF32[v+8>>2], HEAPF32[v+12>>2]);
|
|
}
|
|
|
|
function _emscripten_glScissor(x0, x1, x2, x3) { GLctx['scissor'](x0, x1, x2, x3) }
|
|
|
|
function _glfwSetCursorEnterCallback(winid, cbfun) {
|
|
var win = GLFW.WindowFromId(winid);
|
|
if (!win) return;
|
|
win.cursorEnterFunc = cbfun;
|
|
}
|
|
|
|
|
|
Module["_bitshift64Lshr"] = _bitshift64Lshr;
|
|
|
|
function _confstr(name, buf, len) {
|
|
if (ENVIRONMENT_IS_PTHREAD) return _emscripten_sync_run_in_main_thread_3(68, name, buf, len);
|
|
// size_t confstr(int name, char *buf, size_t len);
|
|
// http://pubs.opengroup.org/onlinepubs/000095399/functions/confstr.html
|
|
var value;
|
|
switch (name) {
|
|
case 0:
|
|
value = ENV['PATH'] || '/';
|
|
break;
|
|
case 1:
|
|
// Mimicking glibc.
|
|
value = 'POSIX_V6_ILP32_OFF32\nPOSIX_V6_ILP32_OFFBIG';
|
|
break;
|
|
case 2:
|
|
// This JS implementation was tested against this glibc version.
|
|
value = 'glibc 2.14';
|
|
break;
|
|
case 3:
|
|
// We don't support pthreads.
|
|
value = '';
|
|
break;
|
|
case 1118:
|
|
case 1122:
|
|
case 1124:
|
|
case 1125:
|
|
case 1126:
|
|
case 1128:
|
|
case 1129:
|
|
case 1130:
|
|
value = '';
|
|
break;
|
|
case 1116:
|
|
case 1117:
|
|
case 1121:
|
|
value = '-m32';
|
|
break;
|
|
case 1120:
|
|
value = '-m32 -D_LARGEFILE_SOURCE -D_FILE_OFFSET_BITS=64';
|
|
break;
|
|
default:
|
|
___setErrNo(ERRNO_CODES.EINVAL);
|
|
return 0;
|
|
}
|
|
if (len == 0 || buf == 0) {
|
|
return value.length + 1;
|
|
} else {
|
|
var length = Math.min(len, value.length);
|
|
for (var i = 0; i < length; i++) {
|
|
HEAP8[(((buf)+(i))>>0)]=value.charCodeAt(i);
|
|
}
|
|
if (len > length) HEAP8[(((buf)+(i++))>>0)]=0;
|
|
return i;
|
|
}
|
|
}
|
|
|
|
function _glBufferData(target, size, data, usage) {
|
|
if (!data) {
|
|
GLctx.bufferData(target, size, usage);
|
|
} else {
|
|
GLctx.bufferData(target, HEAPU8.subarray(data, data+size), usage);
|
|
}
|
|
}
|
|
|
|
function _emscripten_glIsShader(shader) {
|
|
var s = GL.shaders[shader];
|
|
if (!s) return 0;
|
|
return GLctx.isShader(s);
|
|
}
|
|
|
|
function _getenv(name) {
|
|
if (ENVIRONMENT_IS_PTHREAD) return _emscripten_sync_run_in_main_thread_1(111, name);
|
|
// char *getenv(const char *name);
|
|
// http://pubs.opengroup.org/onlinepubs/009695399/functions/getenv.html
|
|
if (name === 0) return 0;
|
|
name = Pointer_stringify(name);
|
|
if (!ENV.hasOwnProperty(name)) return 0;
|
|
|
|
if (_getenv.ret) _free(_getenv.ret);
|
|
_getenv.ret = allocate(intArrayFromString(ENV[name]), 'i8', ALLOC_NORMAL);
|
|
return _getenv.ret;
|
|
}
|
|
|
|
|
|
function _emscripten_conditional_set_current_thread_status_js(expectedStatus, newStatus) {
|
|
}
|
|
Module["_emscripten_conditional_set_current_thread_status"] = _emscripten_conditional_set_current_thread_status;
|
|
|
|
function _emscripten_glDrawBuffers(n, bufs) {
|
|
|
|
var bufArray = GL.tempFixedLengthArray[n];
|
|
for (var i = 0; i < n; i++) {
|
|
bufArray[i] = HEAP32[(((bufs)+(i*4))>>2)];
|
|
}
|
|
|
|
GLctx['drawBuffers'](bufArray);
|
|
}
|
|
|
|
function _glGetFloatv(name_, p) {
|
|
emscriptenWebGLGet(name_, p, 'Float');
|
|
}
|
|
|
|
function _emscripten_glBindFramebuffer(target, framebuffer) {
|
|
GLctx.bindFramebuffer(target, framebuffer ? GL.framebuffers[framebuffer] : null);
|
|
}
|
|
|
|
function _emscripten_glBlendEquation(x0) { GLctx['blendEquation'](x0) }
|
|
|
|
function _emscripten_glBufferSubData(target, offset, size, data) {
|
|
GLctx.bufferSubData(target, offset, HEAPU8.subarray(data, data+size));
|
|
}
|
|
|
|
function _emscripten_glBufferData(target, size, data, usage) {
|
|
if (!data) {
|
|
GLctx.bufferData(target, size, usage);
|
|
} else {
|
|
GLctx.bufferData(target, HEAPU8.subarray(data, data+size), usage);
|
|
}
|
|
}
|
|
|
|
|
|
Module["_sbrk"] = _sbrk;
|
|
|
|
|
|
Module["_bitshift64Shl"] = _bitshift64Shl;
|
|
|
|
function _emscripten_glGetShaderSource(shader, bufSize, length, source) {
|
|
var result = GLctx.getShaderSource(GL.shaders[shader]);
|
|
if (!result) return; // If an error occurs, nothing will be written to length or source.
|
|
if (bufSize > 0 && source) {
|
|
var numBytesWrittenExclNull = stringToUTF8(result, source, bufSize);
|
|
if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
|
|
} else {
|
|
if (length) HEAP32[((length)>>2)]=0;
|
|
}
|
|
}
|
|
|
|
|
|
Module["_llvm_bswap_i32"] = _llvm_bswap_i32;
|
|
|
|
function _emscripten_set_click_callback(target, userData, useCapture, callbackfunc) {
|
|
JSEvents.registerMouseEventCallback(target, userData, useCapture, callbackfunc, 4, "click");
|
|
return 0;
|
|
}
|
|
|
|
function _glfwSetKeyCallback(winid, cbfun) {
|
|
GLFW.setKeyCallback(winid, cbfun);
|
|
}
|
|
|
|
function _emscripten_set_gamepadconnected_callback(userData, useCapture, callbackfunc) {
|
|
if (!navigator.getGamepads && !navigator.webkitGetGamepads) return -1;
|
|
JSEvents.registerGamepadEventCallback(window, userData, useCapture, callbackfunc, 26, "gamepadconnected");
|
|
return 0;
|
|
}
|
|
|
|
function _emscripten_glGetFloatv(name_, p) {
|
|
emscriptenWebGLGet(name_, p, 'Float');
|
|
}
|
|
|
|
function _glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) {
|
|
|
|
var pixelData = null;
|
|
if (pixels) pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat);
|
|
GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixelData);
|
|
}
|
|
|
|
function ___assert_fail(condition, filename, line, func) {
|
|
ABORT = true;
|
|
throw 'Assertion failed: ' + Pointer_stringify(condition) + ', at: ' + [filename ? Pointer_stringify(filename) : 'unknown filename', line, func ? Pointer_stringify(func) : 'unknown function'] + ' at ' + stackTrace();
|
|
}
|
|
|
|
function _emscripten_glVertexAttribDivisor(index, divisor) {
|
|
GLctx['vertexAttribDivisor'](index, divisor);
|
|
}
|
|
|
|
function _emscripten_glDrawElementsInstanced(mode, count, type, indices, primcount) {
|
|
GLctx['drawElementsInstanced'](mode, count, type, indices, primcount);
|
|
}
|
|
|
|
function _emscripten_glDrawElements(mode, count, type, indices) {
|
|
|
|
GLctx.drawElements(mode, count, type, indices);
|
|
|
|
}
|
|
|
|
function _glfwSetMouseButtonCallback(winid, cbfun) {
|
|
GLFW.setMouseButtonCallback(winid, cbfun);
|
|
}
|
|
|
|
function _emscripten_glCreateProgram() {
|
|
var id = GL.getNewId(GL.programs);
|
|
var program = GLctx.createProgram();
|
|
program.name = id;
|
|
GL.programs[id] = program;
|
|
return id;
|
|
}
|
|
|
|
function _emscripten_glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) {
|
|
GLctx['compressedTexImage2D'](target, level, internalFormat, width, height, border, data ? HEAPU8.subarray((data),(data+imageSize)) : null);
|
|
}
|
|
|
|
function _emscripten_glClearColor(x0, x1, x2, x3) { GLctx['clearColor'](x0, x1, x2, x3) }
|
|
|
|
function _emscripten_glBindVertexArray(vao) {
|
|
GLctx['bindVertexArray'](GL.vaos[vao]);
|
|
}
|
|
|
|
function _setenv(envname, envval, overwrite) {
|
|
if (ENVIRONMENT_IS_PTHREAD) return _emscripten_sync_run_in_main_thread_3(113, envname, envval, overwrite);
|
|
// int setenv(const char *envname, const char *envval, int overwrite);
|
|
// http://pubs.opengroup.org/onlinepubs/009695399/functions/setenv.html
|
|
if (envname === 0) {
|
|
___setErrNo(ERRNO_CODES.EINVAL);
|
|
return -1;
|
|
}
|
|
var name = Pointer_stringify(envname);
|
|
var val = Pointer_stringify(envval);
|
|
if (name === '' || name.indexOf('=') !== -1) {
|
|
___setErrNo(ERRNO_CODES.EINVAL);
|
|
return -1;
|
|
}
|
|
if (ENV.hasOwnProperty(name) && !overwrite) return 0;
|
|
ENV[name] = val;
|
|
___buildEnvironment(ENV);
|
|
return 0;
|
|
}
|
|
|
|
function _emscripten_glLoadMatrixf() {
|
|
Module['printErr']('missing function: emscripten_glLoadMatrixf'); abort(-1);
|
|
}
|
|
|
|
function _glDeleteShader(id) {
|
|
if (!id) return;
|
|
var shader = GL.shaders[id];
|
|
if (!shader) { // glDeleteShader actually signals an error when deleting a nonexisting object, unlike some other GL delete functions.
|
|
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
GLctx.deleteShader(shader);
|
|
GL.shaders[id] = null;
|
|
}
|
|
|
|
function _emscripten_glGetProgramiv(program, pname, p) {
|
|
if (!p) {
|
|
// GLES2 specification does not specify how to behave if p is a null pointer. Since calling this function does not make sense
|
|
// if p == null, issue a GL error to notify user about it.
|
|
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
|
|
if (program >= GL.counter) {
|
|
GL.recordError(0x0501 /* GL_INVALID_VALUE */);
|
|
return;
|
|
}
|
|
|
|
var ptable = GL.programInfos[program];
|
|
if (!ptable) {
|
|
GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
|
|
return;
|
|
}
|
|
|
|
if (pname == 0x8B84) { // GL_INFO_LOG_LENGTH
|
|
var log = GLctx.getProgramInfoLog(GL.programs[program]);
|
|
if (log === null) log = '(unknown error)';
|
|
HEAP32[((p)>>2)]=log.length + 1;
|
|
} else if (pname == 0x8B87 /* GL_ACTIVE_UNIFORM_MAX_LENGTH */) {
|
|
HEAP32[((p)>>2)]=ptable.maxUniformLength;
|
|
} else if (pname == 0x8B8A /* GL_ACTIVE_ATTRIBUTE_MAX_LENGTH */) {
|
|
if (ptable.maxAttributeLength == -1) {
|
|
var program = GL.programs[program];
|
|
var numAttribs = GLctx.getProgramParameter(program, GLctx.ACTIVE_ATTRIBUTES);
|
|
ptable.maxAttributeLength = 0; // Spec says if there are no active attribs, 0 must be returned.
|
|
for (var i = 0; i < numAttribs; ++i) {
|
|
var activeAttrib = GLctx.getActiveAttrib(program, i);
|
|
ptable.maxAttributeLength = Math.max(ptable.maxAttributeLength, activeAttrib.name.length+1);
|
|
}
|
|
}
|
|
HEAP32[((p)>>2)]=ptable.maxAttributeLength;
|
|
} else if (pname == 0x8A35 /* GL_ACTIVE_UNIFORM_BLOCK_MAX_NAME_LENGTH */) {
|
|
if (ptable.maxUniformBlockNameLength == -1) {
|
|
var program = GL.programs[program];
|
|
var numBlocks = GLctx.getProgramParameter(program, GLctx.ACTIVE_UNIFORM_BLOCKS);
|
|
ptable.maxUniformBlockNameLength = 0;
|
|
for (var i = 0; i < numBlocks; ++i) {
|
|
var activeBlockName = GLctx.getActiveUniformBlockName(program, i);
|
|
ptable.maxUniformBlockNameLength = Math.max(ptable.maxUniformBlockNameLength, activeBlockName.length+1);
|
|
}
|
|
}
|
|
HEAP32[((p)>>2)]=ptable.maxUniformBlockNameLength;
|
|
} else {
|
|
HEAP32[((p)>>2)]=GLctx.getProgramParameter(GL.programs[program], pname);
|
|
}
|
|
}
|
|
|
|
function _emscripten_glGetProgramInfoLog(program, maxLength, length, infoLog) {
|
|
var log = GLctx.getProgramInfoLog(GL.programs[program]);
|
|
if (log === null) log = '(unknown error)';
|
|
|
|
if (maxLength > 0 && infoLog) {
|
|
var numBytesWrittenExclNull = stringToUTF8(log, infoLog, maxLength);
|
|
if (length) HEAP32[((length)>>2)]=numBytesWrittenExclNull;
|
|
} else {
|
|
if (length) HEAP32[((length)>>2)]=0;
|
|
}
|
|
}
|
|
|
|
function _emscripten_glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) {
|
|
|
|
var pixelData = null;
|
|
if (pixels) pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat);
|
|
GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixelData);
|
|
}
|
|
|
|
function _glPixelStorei(pname, param) {
|
|
if (pname == 0x0D05 /* GL_PACK_ALIGNMENT */) {
|
|
GL.packAlignment = param;
|
|
} else if (pname == 0x0cf5 /* GL_UNPACK_ALIGNMENT */) {
|
|
GL.unpackAlignment = param;
|
|
}
|
|
GLctx.pixelStorei(pname, param);
|
|
}
|
|
|
|
function ___unlock() {}
|
|
|
|
function _emscripten_glColorPointer() {
|
|
Module['printErr']('missing function: emscripten_glColorPointer'); abort(-1);
|
|
}
|
|
|
|
function _glViewport(x0, x1, x2, x3) { GLctx['viewport'](x0, x1, x2, x3) }
|
|
|
|
function _glfwDestroyWindow(winid) {
|
|
return GLFW.destroyWindow(winid);
|
|
}
|
|
|
|
function _emscripten_glFlush() { GLctx['flush']() }
|
|
|
|
function _glfwSetErrorCallback(cbfun) {
|
|
GLFW.errorFunc = cbfun;
|
|
}
|
|
|
|
function _emscripten_glCreateShader(shaderType) {
|
|
var id = GL.getNewId(GL.shaders);
|
|
GL.shaders[id] = GLctx.createShader(shaderType);
|
|
return id;
|
|
}
|
|
|
|
function _glUniformMatrix4fv(location, count, transpose, value) {
|
|
|
|
|
|
var view;
|
|
if (16*count <= GL.MINI_TEMP_BUFFER_SIZE) {
|
|
// avoid allocation when uploading few enough uniforms
|
|
view = GL.miniTempBufferViews[16*count-1];
|
|
for (var i = 0; i < 16*count; i += 16) {
|
|
view[i] = HEAPF32[(((value)+(4*i))>>2)];
|
|
view[i+1] = HEAPF32[(((value)+(4*i+4))>>2)];
|
|
view[i+2] = HEAPF32[(((value)+(4*i+8))>>2)];
|
|
view[i+3] = HEAPF32[(((value)+(4*i+12))>>2)];
|
|
view[i+4] = HEAPF32[(((value)+(4*i+16))>>2)];
|
|
view[i+5] = HEAPF32[(((value)+(4*i+20))>>2)];
|
|
view[i+6] = HEAPF32[(((value)+(4*i+24))>>2)];
|
|
view[i+7] = HEAPF32[(((value)+(4*i+28))>>2)];
|
|
view[i+8] = HEAPF32[(((value)+(4*i+32))>>2)];
|
|
view[i+9] = HEAPF32[(((value)+(4*i+36))>>2)];
|
|
view[i+10] = HEAPF32[(((value)+(4*i+40))>>2)];
|
|
view[i+11] = HEAPF32[(((value)+(4*i+44))>>2)];
|
|
view[i+12] = HEAPF32[(((value)+(4*i+48))>>2)];
|
|
view[i+13] = HEAPF32[(((value)+(4*i+52))>>2)];
|
|
view[i+14] = HEAPF32[(((value)+(4*i+56))>>2)];
|
|
view[i+15] = HEAPF32[(((value)+(4*i+60))>>2)];
|
|
}
|
|
} else {
|
|
view = HEAPF32.subarray((value)>>2,(value+count*64)>>2);
|
|
}
|
|
GLctx.uniformMatrix4fv(GL.uniforms[location], !!transpose, view);
|
|
}
|
|
|
|
function _emscripten_glValidateProgram(program) {
|
|
GLctx.validateProgram(GL.programs[program]);
|
|
}
|
|
|
|
function _emscripten_syscall(which, varargs) {
|
|
switch (which) {
|
|
case 54: return ___syscall54(which, varargs);
|
|
case 6: return ___syscall6(which, varargs);
|
|
case 140: return ___syscall140(which, varargs);
|
|
case 146: return ___syscall146(which, varargs);
|
|
default: throw "surprising proxied syscall: " + which;
|
|
}
|
|
}
|
|
|
|
function _glTexParameteri(x0, x1, x2) { GLctx['texParameteri'](x0, x1, x2) }
|
|
|
|
function _glFrontFace(x0) { GLctx['frontFace'](x0) }
|
|
|
|
function _emscripten_glColorMask(red, green, blue, alpha) {
|
|
GLctx.colorMask(!!red, !!green, !!blue, !!alpha);
|
|
}
|
|
|
|
function _emscripten_glPixelStorei(pname, param) {
|
|
if (pname == 0x0D05 /* GL_PACK_ALIGNMENT */) {
|
|
GL.packAlignment = param;
|
|
} else if (pname == 0x0cf5 /* GL_UNPACK_ALIGNMENT */) {
|
|
GL.unpackAlignment = param;
|
|
}
|
|
GLctx.pixelStorei(pname, param);
|
|
}
|
|
|
|
function _emscripten_glDeleteTextures(n, textures) {
|
|
for (var i = 0; i < n; i++) {
|
|
var id = HEAP32[(((textures)+(i*4))>>2)];
|
|
var texture = GL.textures[id];
|
|
if (!texture) continue; // GL spec: "glDeleteTextures silently ignores 0s and names that do not correspond to existing textures".
|
|
GLctx.deleteTexture(texture);
|
|
texture.name = 0;
|
|
GL.textures[id] = null;
|
|
}
|
|
}
|
|
|
|
function _fpathconf(fildes, name) {
|
|
if (ENVIRONMENT_IS_PTHREAD) return _emscripten_sync_run_in_main_thread_2(46, fildes, name);
|
|
// long fpathconf(int fildes, int name);
|
|
// http://pubs.opengroup.org/onlinepubs/000095399/functions/encrypt.html
|
|
// NOTE: The first parameter is ignored, so pathconf == fpathconf.
|
|
// The constants here aren't real values. Just mimicking glibc.
|
|
switch (name) {
|
|
case 0:
|
|
return 32000;
|
|
case 1:
|
|
case 2:
|
|
case 3:
|
|
return 255;
|
|
case 4:
|
|
case 5:
|
|
case 16:
|
|
case 17:
|
|
case 18:
|
|
return 4096;
|
|
case 6:
|
|
case 7:
|
|
case 20:
|
|
return 1;
|
|
case 8:
|
|
return 0;
|
|
case 9:
|
|
case 10:
|
|
case 11:
|
|
case 12:
|
|
case 14:
|
|
case 15:
|
|
case 19:
|
|
return -1;
|
|
case 13:
|
|
return 64;
|
|
}
|
|
___setErrNo(ERRNO_CODES.EINVAL);
|
|
return -1;
|
|
}
|
|
|
|
function _putenv(string) {
|
|
if (ENVIRONMENT_IS_PTHREAD) return _emscripten_sync_run_in_main_thread_1(115, string);
|
|
// int putenv(char *string);
|
|
// http://pubs.opengroup.org/onlinepubs/009695399/functions/putenv.html
|
|
// WARNING: According to the standard (and the glibc implementation), the
|
|
// string is taken by reference so future changes are reflected.
|
|
// We copy it instead, possibly breaking some uses.
|
|
if (string === 0) {
|
|
___setErrNo(ERRNO_CODES.EINVAL);
|
|
return -1;
|
|
}
|
|
string = Pointer_stringify(string);
|
|
var splitPoint = string.indexOf('=')
|
|
if (string === '' || string.indexOf('=') === -1) {
|
|
___setErrNo(ERRNO_CODES.EINVAL);
|
|
return -1;
|
|
}
|
|
var name = string.slice(0, splitPoint);
|
|
var value = string.slice(splitPoint + 1);
|
|
if (!(name in ENV) || ENV[name] !== value) {
|
|
ENV[name] = value;
|
|
___buildEnvironment(ENV);
|
|
}
|
|
return 0;
|
|
}
|
|
|
|
function _emscripten_glGenVertexArrays(n, arrays) {
|
|
|
|
for (var i = 0; i < n; i++) {
|
|
var vao = GLctx['createVertexArray']();
|
|
if (!vao) {
|
|
GL.recordError(0x0502 /* GL_INVALID_OPERATION */);
|
|
while(i < n) HEAP32[(((arrays)+(i++*4))>>2)]=0;
|
|
return;
|
|
}
|
|
var id = GL.getNewId(GL.vaos);
|
|
vao.name = id;
|
|
GL.vaos[id] = vao;
|
|
HEAP32[(((arrays)+(i*4))>>2)]=id;
|
|
}
|
|
}
|
|
|
|
function _time(ptr) {
|
|
var ret = (Date.now()/1000)|0;
|
|
if (ptr) {
|
|
HEAP32[((ptr)>>2)]=ret;
|
|
}
|
|
return ret;
|
|
}
|
|
|
|
|
|
function _emscripten_glGetBooleanv(name_, p) {
|
|
emscriptenWebGLGet(name_, p, 'Boolean');
|
|
}
|
|
|
|
function _utimes(path, times) {
|
|
if (ENVIRONMENT_IS_PTHREAD) return _emscripten_sync_run_in_main_thread_2(13, path, times);
|
|
var time;
|
|
if (times) {
|
|
var offset = 8 + 0;
|
|
time = HEAP32[(((times)+(offset))>>2)] * 1000;
|
|
offset = 8 + 4;
|
|
time += HEAP32[(((times)+(offset))>>2)] / 1000;
|
|
} else {
|
|
time = Date.now();
|
|
}
|
|
path = Pointer_stringify(path);
|
|
try {
|
|
FS.utime(path, time, time);
|
|
return 0;
|
|
} catch (e) {
|
|
FS.handleFSError(e);
|
|
return -1;
|
|
}
|
|
}
|
|
|
|
function _emscripten_glCompileShader(shader) {
|
|
GLctx.compileShader(GL.shaders[shader]);
|
|
}
|
|
var GLctx; GL.init();
|
|
if (ENVIRONMENT_IS_NODE) {
|
|
_emscripten_get_now = function _emscripten_get_now_actual() {
|
|
var t = process['hrtime']();
|
|
return t[0] * 1e3 + t[1] / 1e6;
|
|
};
|
|
} else if (typeof dateNow !== 'undefined') {
|
|
_emscripten_get_now = dateNow;
|
|
} else if (typeof self === 'object' && self['performance'] && typeof self['performance']['now'] === 'function') {
|
|
_emscripten_get_now = function() { return self['performance']['now'](); };
|
|
} else if (typeof performance === 'object' && typeof performance['now'] === 'function') {
|
|
_emscripten_get_now = function() { return performance['now'](); };
|
|
} else {
|
|
_emscripten_get_now = Date.now;
|
|
};
|
|
Module["requestFullScreen"] = function Module_requestFullScreen(lockPointer, resizeCanvas, vrDevice) { Module.printErr("Module.requestFullScreen is deprecated. Please call Module.requestFullscreen instead."); Module["requestFullScreen"] = Module["requestFullscreen"]; Browser.requestFullScreen(lockPointer, resizeCanvas, vrDevice) };
|
|
Module["requestFullscreen"] = function Module_requestFullscreen(lockPointer, resizeCanvas, vrDevice) { Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice) };
|
|
Module["requestAnimationFrame"] = function Module_requestAnimationFrame(func) { Browser.requestAnimationFrame(func) };
|
|
Module["setCanvasSize"] = function Module_setCanvasSize(width, height, noUpdates) { Browser.setCanvasSize(width, height, noUpdates) };
|
|
Module["pauseMainLoop"] = function Module_pauseMainLoop() { Browser.mainLoop.pause() };
|
|
Module["resumeMainLoop"] = function Module_resumeMainLoop() { Browser.mainLoop.resume() };
|
|
Module["getUserMedia"] = function Module_getUserMedia() { Browser.getUserMedia() }
|
|
Module["createContext"] = function Module_createContext(canvas, useWebGL, setInModule, webGLContextAttributes) { return Browser.createContext(canvas, useWebGL, setInModule, webGLContextAttributes) };
|
|
FS.staticInit();__ATINIT__.unshift(function() { if (!Module["noFSInit"] && !FS.init.initialized) FS.init() });__ATMAIN__.push(function() { FS.ignorePermissions = false });__ATEXIT__.push(function() { FS.quit() });Module["FS_createFolder"] = FS.createFolder;Module["FS_createPath"] = FS.createPath;Module["FS_createDataFile"] = FS.createDataFile;Module["FS_createPreloadedFile"] = FS.createPreloadedFile;Module["FS_createLazyFile"] = FS.createLazyFile;Module["FS_createLink"] = FS.createLink;Module["FS_createDevice"] = FS.createDevice;Module["FS_unlink"] = FS.unlink;;
|
|
__ATINIT__.unshift(function() { TTY.init() });__ATEXIT__.push(function() { TTY.shutdown() });;
|
|
if (ENVIRONMENT_IS_NODE) { var fs = require("fs"); var NODEJS_PATH = require("path"); NODEFS.staticInit(); };
|
|
JSEvents.staticInit();;
|
|
if (!ENVIRONMENT_IS_PTHREAD) PThread.initMainThreadBlock();;
|
|
if (!ENVIRONMENT_IS_PTHREAD) ___buildEnvironment(ENV);;
|
|
if (!ENVIRONMENT_IS_PTHREAD) {
|
|
// Only main thread initializes these, pthreads copy them over at thread worker init time (in pthread-main.js)
|
|
DYNAMICTOP_PTR = allocate(1, "i32", ALLOC_STATIC);
|
|
|
|
STACK_BASE = STACKTOP = Runtime.alignMemory(STATICTOP);
|
|
|
|
STACK_MAX = STACK_BASE + TOTAL_STACK;
|
|
|
|
DYNAMIC_BASE = Runtime.alignMemory(STACK_MAX);
|
|
|
|
HEAP32[DYNAMICTOP_PTR>>2] = DYNAMIC_BASE;
|
|
|
|
staticSealed = true; // seal the static portion of memory
|
|
|
|
assert(DYNAMIC_BASE < TOTAL_MEMORY, "TOTAL_MEMORY not big enough for stack");
|
|
|
|
}
|
|
|
|
|
|
|
|
function nullFunc_viiiii(x) { Module["printErr"]("Invalid function pointer called with signature 'viiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
|
|
|
|
function nullFunc_vd(x) { Module["printErr"]("Invalid function pointer called with signature 'vd'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
|
|
|
|
function nullFunc_vid(x) { Module["printErr"]("Invalid function pointer called with signature 'vid'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
|
|
|
|
function nullFunc_vi(x) { Module["printErr"]("Invalid function pointer called with signature 'vi'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
|
|
|
|
function nullFunc_vii(x) { Module["printErr"]("Invalid function pointer called with signature 'vii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
|
|
|
|
function nullFunc_ii(x) { Module["printErr"]("Invalid function pointer called with signature 'ii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
|
|
|
|
function nullFunc_viddd(x) { Module["printErr"]("Invalid function pointer called with signature 'viddd'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
|
|
|
|
function nullFunc_vidd(x) { Module["printErr"]("Invalid function pointer called with signature 'vidd'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
|
|
|
|
function nullFunc_iiii(x) { Module["printErr"]("Invalid function pointer called with signature 'iiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
|
|
|
|
function nullFunc_viiiiiiii(x) { Module["printErr"]("Invalid function pointer called with signature 'viiiiiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
|
|
|
|
function nullFunc_viiiiii(x) { Module["printErr"]("Invalid function pointer called with signature 'viiiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
|
|
|
|
function nullFunc_viii(x) { Module["printErr"]("Invalid function pointer called with signature 'viii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
|
|
|
|
function nullFunc_vidddd(x) { Module["printErr"]("Invalid function pointer called with signature 'vidddd'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
|
|
|
|
function nullFunc_vdi(x) { Module["printErr"]("Invalid function pointer called with signature 'vdi'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
|
|
|
|
function nullFunc_viiiiiii(x) { Module["printErr"]("Invalid function pointer called with signature 'viiiiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
|
|
|
|
function nullFunc_viiiiiiiii(x) { Module["printErr"]("Invalid function pointer called with signature 'viiiiiiiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
|
|
|
|
function nullFunc_iii(x) { Module["printErr"]("Invalid function pointer called with signature 'iii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
|
|
|
|
function nullFunc_i(x) { Module["printErr"]("Invalid function pointer called with signature 'i'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
|
|
|
|
function nullFunc_vdddddd(x) { Module["printErr"]("Invalid function pointer called with signature 'vdddddd'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
|
|
|
|
function nullFunc_vdddd(x) { Module["printErr"]("Invalid function pointer called with signature 'vdddd'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
|
|
|
|
function nullFunc_vdd(x) { Module["printErr"]("Invalid function pointer called with signature 'vdd'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
|
|
|
|
function nullFunc_v(x) { Module["printErr"]("Invalid function pointer called with signature 'v'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
|
|
|
|
function nullFunc_viid(x) { Module["printErr"]("Invalid function pointer called with signature 'viid'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
|
|
|
|
function nullFunc_viiii(x) { Module["printErr"]("Invalid function pointer called with signature 'viiii'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this)"); Module["printErr"]("Build with ASSERTIONS=2 for more info.");abort(x) }
|
|
|
|
function invoke_viiiii(index,a1,a2,a3,a4,a5) {
|
|
try {
|
|
Module["dynCall_viiiii"](index,a1,a2,a3,a4,a5);
|
|
} catch(e) {
|
|
if (typeof e !== 'number' && e !== 'longjmp') throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
|
|
function invoke_vd(index,a1) {
|
|
try {
|
|
Module["dynCall_vd"](index,a1);
|
|
} catch(e) {
|
|
if (typeof e !== 'number' && e !== 'longjmp') throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
|
|
function invoke_vid(index,a1,a2) {
|
|
try {
|
|
Module["dynCall_vid"](index,a1,a2);
|
|
} catch(e) {
|
|
if (typeof e !== 'number' && e !== 'longjmp') throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
|
|
function invoke_vi(index,a1) {
|
|
try {
|
|
Module["dynCall_vi"](index,a1);
|
|
} catch(e) {
|
|
if (typeof e !== 'number' && e !== 'longjmp') throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
|
|
function invoke_vii(index,a1,a2) {
|
|
try {
|
|
Module["dynCall_vii"](index,a1,a2);
|
|
} catch(e) {
|
|
if (typeof e !== 'number' && e !== 'longjmp') throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
|
|
function invoke_ii(index,a1) {
|
|
try {
|
|
return Module["dynCall_ii"](index,a1);
|
|
} catch(e) {
|
|
if (typeof e !== 'number' && e !== 'longjmp') throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
|
|
function invoke_viddd(index,a1,a2,a3,a4) {
|
|
try {
|
|
Module["dynCall_viddd"](index,a1,a2,a3,a4);
|
|
} catch(e) {
|
|
if (typeof e !== 'number' && e !== 'longjmp') throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
|
|
function invoke_vidd(index,a1,a2,a3) {
|
|
try {
|
|
Module["dynCall_vidd"](index,a1,a2,a3);
|
|
} catch(e) {
|
|
if (typeof e !== 'number' && e !== 'longjmp') throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
|
|
function invoke_iiii(index,a1,a2,a3) {
|
|
try {
|
|
return Module["dynCall_iiii"](index,a1,a2,a3);
|
|
} catch(e) {
|
|
if (typeof e !== 'number' && e !== 'longjmp') throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8) {
|
|
try {
|
|
Module["dynCall_viiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8);
|
|
} catch(e) {
|
|
if (typeof e !== 'number' && e !== 'longjmp') throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiii(index,a1,a2,a3,a4,a5,a6) {
|
|
try {
|
|
Module["dynCall_viiiiii"](index,a1,a2,a3,a4,a5,a6);
|
|
} catch(e) {
|
|
if (typeof e !== 'number' && e !== 'longjmp') throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
|
|
function invoke_viii(index,a1,a2,a3) {
|
|
try {
|
|
Module["dynCall_viii"](index,a1,a2,a3);
|
|
} catch(e) {
|
|
if (typeof e !== 'number' && e !== 'longjmp') throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
|
|
function invoke_vidddd(index,a1,a2,a3,a4,a5) {
|
|
try {
|
|
Module["dynCall_vidddd"](index,a1,a2,a3,a4,a5);
|
|
} catch(e) {
|
|
if (typeof e !== 'number' && e !== 'longjmp') throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
|
|
function invoke_vdi(index,a1,a2) {
|
|
try {
|
|
Module["dynCall_vdi"](index,a1,a2);
|
|
} catch(e) {
|
|
if (typeof e !== 'number' && e !== 'longjmp') throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiii(index,a1,a2,a3,a4,a5,a6,a7) {
|
|
try {
|
|
Module["dynCall_viiiiiii"](index,a1,a2,a3,a4,a5,a6,a7);
|
|
} catch(e) {
|
|
if (typeof e !== 'number' && e !== 'longjmp') throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
|
|
function invoke_viiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) {
|
|
try {
|
|
Module["dynCall_viiiiiiiii"](index,a1,a2,a3,a4,a5,a6,a7,a8,a9);
|
|
} catch(e) {
|
|
if (typeof e !== 'number' && e !== 'longjmp') throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
|
|
function invoke_iii(index,a1,a2) {
|
|
try {
|
|
return Module["dynCall_iii"](index,a1,a2);
|
|
} catch(e) {
|
|
if (typeof e !== 'number' && e !== 'longjmp') throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
|
|
function invoke_i(index) {
|
|
try {
|
|
return Module["dynCall_i"](index);
|
|
} catch(e) {
|
|
if (typeof e !== 'number' && e !== 'longjmp') throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
|
|
function invoke_vdddddd(index,a1,a2,a3,a4,a5,a6) {
|
|
try {
|
|
Module["dynCall_vdddddd"](index,a1,a2,a3,a4,a5,a6);
|
|
} catch(e) {
|
|
if (typeof e !== 'number' && e !== 'longjmp') throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
|
|
function invoke_vdddd(index,a1,a2,a3,a4) {
|
|
try {
|
|
Module["dynCall_vdddd"](index,a1,a2,a3,a4);
|
|
} catch(e) {
|
|
if (typeof e !== 'number' && e !== 'longjmp') throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
|
|
function invoke_vdd(index,a1,a2) {
|
|
try {
|
|
Module["dynCall_vdd"](index,a1,a2);
|
|
} catch(e) {
|
|
if (typeof e !== 'number' && e !== 'longjmp') throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
|
|
function invoke_v(index) {
|
|
try {
|
|
Module["dynCall_v"](index);
|
|
} catch(e) {
|
|
if (typeof e !== 'number' && e !== 'longjmp') throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
|
|
function invoke_viid(index,a1,a2,a3) {
|
|
try {
|
|
Module["dynCall_viid"](index,a1,a2,a3);
|
|
} catch(e) {
|
|
if (typeof e !== 'number' && e !== 'longjmp') throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
|
|
function invoke_viiii(index,a1,a2,a3,a4) {
|
|
try {
|
|
Module["dynCall_viiii"](index,a1,a2,a3,a4);
|
|
} catch(e) {
|
|
if (typeof e !== 'number' && e !== 'longjmp') throw e;
|
|
Module["setThrew"](1, 0);
|
|
}
|
|
}
|
|
|
|
Module.asmGlobalArg = { "Math": Math, "Int8Array": Int8Array, "Int16Array": Int16Array, "Int32Array": Int32Array, "Uint8Array": Uint8Array, "Uint16Array": Uint16Array, "Uint32Array": Uint32Array, "Float32Array": Float32Array, "Float64Array": Float64Array, "NaN": NaN, "Infinity": Infinity };
|
|
Module.asmGlobalArg['Atomics'] = Atomics;
|
|
Module.asmLibraryArg = { "abort": abort, "assert": assert, "enlargeMemory": enlargeMemory, "getTotalMemory": getTotalMemory, "abortOnCannotGrowMemory": abortOnCannotGrowMemory, "abortStackOverflow": abortStackOverflow, "nullFunc_viiiii": nullFunc_viiiii, "nullFunc_vd": nullFunc_vd, "nullFunc_vid": nullFunc_vid, "nullFunc_vi": nullFunc_vi, "nullFunc_vii": nullFunc_vii, "nullFunc_ii": nullFunc_ii, "nullFunc_viddd": nullFunc_viddd, "nullFunc_vidd": nullFunc_vidd, "nullFunc_iiii": nullFunc_iiii, "nullFunc_viiiiiiii": nullFunc_viiiiiiii, "nullFunc_viiiiii": nullFunc_viiiiii, "nullFunc_viii": nullFunc_viii, "nullFunc_vidddd": nullFunc_vidddd, "nullFunc_vdi": nullFunc_vdi, "nullFunc_viiiiiii": nullFunc_viiiiiii, "nullFunc_viiiiiiiii": nullFunc_viiiiiiiii, "nullFunc_iii": nullFunc_iii, "nullFunc_i": nullFunc_i, "nullFunc_vdddddd": nullFunc_vdddddd, "nullFunc_vdddd": nullFunc_vdddd, "nullFunc_vdd": nullFunc_vdd, "nullFunc_v": nullFunc_v, "nullFunc_viid": nullFunc_viid, "nullFunc_viiii": nullFunc_viiii, "invoke_viiiii": invoke_viiiii, "invoke_vd": invoke_vd, "invoke_vid": invoke_vid, "invoke_vi": invoke_vi, "invoke_vii": invoke_vii, "invoke_ii": invoke_ii, "invoke_viddd": invoke_viddd, "invoke_vidd": invoke_vidd, "invoke_iiii": invoke_iiii, "invoke_viiiiiiii": invoke_viiiiiiii, "invoke_viiiiii": invoke_viiiiii, "invoke_viii": invoke_viii, "invoke_vidddd": invoke_vidddd, "invoke_vdi": invoke_vdi, "invoke_viiiiiii": invoke_viiiiiii, "invoke_viiiiiiiii": invoke_viiiiiiiii, "invoke_iii": invoke_iii, "invoke_i": invoke_i, "invoke_vdddddd": invoke_vdddddd, "invoke_vdddd": invoke_vdddd, "invoke_vdd": invoke_vdd, "invoke_v": invoke_v, "invoke_viid": invoke_viid, "invoke_viiii": invoke_viiii, "_emscripten_glGetTexParameterfv": _emscripten_glGetTexParameterfv, "_glUseProgram": _glUseProgram, "_glfwCreateWindow": _glfwCreateWindow, "_emscripten_glReleaseShaderCompiler": _emscripten_glReleaseShaderCompiler, "_emscripten_glBlendFuncSeparate": _emscripten_glBlendFuncSeparate, "_emscripten_glVertexAttribPointer": _emscripten_glVertexAttribPointer, "_emscripten_glGetIntegerv": _emscripten_glGetIntegerv, "_emscripten_glCullFace": _emscripten_glCullFace, "_emscripten_glIsProgram": _emscripten_glIsProgram, "_emscripten_glStencilMaskSeparate": _emscripten_glStencilMaskSeparate, "_emscripten_glViewport": _emscripten_glViewport, "_emscripten_glFrontFace": _emscripten_glFrontFace, "___assert_fail": ___assert_fail, "_glDeleteProgram": _glDeleteProgram, "_emscripten_glUniform3fv": _emscripten_glUniform3fv, "_emscripten_glPolygonOffset": _emscripten_glPolygonOffset, "_emscripten_glUseProgram": _emscripten_glUseProgram, "_emscripten_glBlendColor": _emscripten_glBlendColor, "_glBindBuffer": _glBindBuffer, "_emscripten_glDepthFunc": _emscripten_glDepthFunc, "_glGetShaderInfoLog": _glGetShaderInfoLog, "_clock_gettime": _clock_gettime, "_emscripten_set_fullscreenchange_callback": _emscripten_set_fullscreenchange_callback, "_emscripten_set_touchmove_callback": _emscripten_set_touchmove_callback, "_emscripten_set_main_loop_timing": _emscripten_set_main_loop_timing, "_glDisable": _glDisable, "_glBlendFunc": _glBlendFunc, "_emscripten_glDisableVertexAttribArray": _emscripten_glDisableVertexAttribArray, "_glGetAttribLocation": _glGetAttribLocation, "_glDisableVertexAttribArray": _glDisableVertexAttribArray, "_glCreateShader": _glCreateShader, "_emscripten_glCompileShader": _emscripten_glCompileShader, "_sysconf": _sysconf, "_utime": _utime, "_emscripten_glSampleCoverage": _emscripten_glSampleCoverage, "_emscripten_glVertexPointer": _emscripten_glVertexPointer, "_emscripten_set_touchstart_callback": _emscripten_set_touchstart_callback, "emscriptenWebGLComputeImageSize": emscriptenWebGLComputeImageSize, "_emscripten_glGetBooleanv": _emscripten_glGetBooleanv, "_emscripten_glGetShaderSource": _emscripten_glGetShaderSource, "_chroot": _chroot, "_glUniform4f": _glUniform4f, "_llvm_stacksave": _llvm_stacksave, "_emscripten_glUniform1i": _emscripten_glUniform1i, "_emscripten_glLoadMatrixf": _emscripten_glLoadMatrixf, "_emscripten_glGenBuffers": _emscripten_glGenBuffers, "_emscripten_glDeleteObjectARB": _emscripten_glDeleteObjectARB, "_glfwSetWindowSizeCallback": _glfwSetWindowSizeCallback, "_emscripten_glGetShaderPrecisionFormat": _emscripten_glGetShaderPrecisionFormat, "_glfwInit": _glfwInit, "_glGenBuffers": _glGenBuffers, "_glShaderSource": _glShaderSource, "_emscripten_glGetString": _emscripten_glGetString, "_emscripten_glIsFramebuffer": _emscripten_glIsFramebuffer, "_emscripten_glIsEnabled": _emscripten_glIsEnabled, "_emscripten_glScissor": _emscripten_glScissor, "__pthread_testcancel_js": __pthread_testcancel_js, "_emscripten_glVertexAttrib4fv": _emscripten_glVertexAttrib4fv, "_emscripten_glFramebufferTexture2D": _emscripten_glFramebufferTexture2D, "_emscripten_glTexParameteriv": _emscripten_glTexParameteriv, "_unsetenv": _unsetenv, "_emscripten_glBindProgramARB": _emscripten_glBindProgramARB, "_emscripten_glStencilOpSeparate": _emscripten_glStencilOpSeparate, "_emscripten_glFramebufferRenderbuffer": _emscripten_glFramebufferRenderbuffer, "___syscall140": ___syscall140, "_glfwSetErrorCallback": _glfwSetErrorCallback, "_glfwDefaultWindowHints": _glfwDefaultWindowHints, "_glfwDestroyWindow": _glfwDestroyWindow, "___syscall146": ___syscall146, "_emscripten_glGetActiveAttrib": _emscripten_glGetActiveAttrib, "_emscripten_glAttachShader": _emscripten_glAttachShader, "_emscripten_get_now_is_monotonic": _emscripten_get_now_is_monotonic, "_emscripten_glUniform2i": _emscripten_glUniform2i, "_emscripten_glUniform2f": _emscripten_glUniform2f, "_emscripten_glTexParameterfv": _emscripten_glTexParameterfv, "_emscripten_glIsBuffer": _emscripten_glIsBuffer, "_emscripten_glUniformMatrix2fv": _emscripten_glUniformMatrix2fv, "_glGetProgramInfoLog": _glGetProgramInfoLog, "_glfwSetScrollCallback": _glfwSetScrollCallback, "_emscripten_glTexParameterf": _emscripten_glTexParameterf, "_emscripten_glGetAttachedShaders": _emscripten_glGetAttachedShaders, "_emscripten_glGenTextures": _emscripten_glGenTextures, "_emscripten_glTexParameteri": _emscripten_glTexParameteri, "_llvm_stackrestore": _llvm_stackrestore, "_glfwMakeContextCurrent": _glfwMakeContextCurrent, "_emscripten_glClear": _emscripten_glClear, "_glDrawElements": _glDrawElements, "_glBufferSubData": _glBufferSubData, "_emscripten_glValidateProgram": _emscripten_glValidateProgram, "_emscripten_glVertexAttrib2fv": _emscripten_glVertexAttrib2fv, "_glViewport": _glViewport, "_emscripten_glUniform4iv": _emscripten_glUniform4iv, "_emscripten_glGetTexParameteriv": _emscripten_glGetTexParameteriv, "___setErrNo": ___setErrNo, "_eglGetProcAddress": _eglGetProcAddress, "_emscripten_glBindAttribLocation": _emscripten_glBindAttribLocation, "_glDeleteTextures": _glDeleteTextures, "_glDepthFunc": _glDepthFunc, "_emscripten_glClientActiveTexture": _emscripten_glClientActiveTexture, "_emscripten_glVertexAttrib2f": _emscripten_glVertexAttrib2f, "_emscripten_asm_const_v": _emscripten_asm_const_v, "_emscripten_glFlush": _emscripten_glFlush, "_emscripten_glBlendFunc": _emscripten_glBlendFunc, "_emscripten_glCheckFramebufferStatus": _emscripten_glCheckFramebufferStatus, "_emscripten_glGenerateMipmap": _emscripten_glGenerateMipmap, "_emscripten_glGetError": _emscripten_glGetError, "_emscripten_glClearDepthf": _emscripten_glClearDepthf, "_pthread_self": _pthread_self, "_emscripten_glBufferData": _emscripten_glBufferData, "_emscripten_glUniform3i": _emscripten_glUniform3i, "_emscripten_glGenRenderbuffers": _emscripten_glGenRenderbuffers, "_emscripten_glRotatef": _emscripten_glRotatef, "_emscripten_glDeleteShader": _emscripten_glDeleteShader, "_glEnable": _glEnable, "_emscripten_glGetShaderiv": _emscripten_glGetShaderiv, "_emscripten_glReadPixels": _emscripten_glReadPixels, "_emscripten_glMatrixMode": _emscripten_glMatrixMode, "_glGetString": _glGetString, "_emscripten_glClearStencil": _emscripten_glClearStencil, "_emscripten_glGetUniformLocation": _emscripten_glGetUniformLocation, "emscriptenWebGLGet": emscriptenWebGLGet, "_emscripten_glEnableVertexAttribArray": _emscripten_glEnableVertexAttribArray, "__register_pthread_ptr": __register_pthread_ptr, "_emscripten_get_now": _emscripten_get_now, "_emscripten_glNormalPointer": _emscripten_glNormalPointer, "_glAttachShader": _glAttachShader, "_emscripten_glTexCoordPointer": _emscripten_glTexCoordPointer, "_emscripten_glEnable": _emscripten_glEnable, "_glCreateProgram": _glCreateProgram, "_glUniformMatrix4fv": _glUniformMatrix4fv, "_emscripten_glClearDepth": _emscripten_glClearDepth, "___lock": ___lock, "emscriptenWebGLGetTexPixelData": emscriptenWebGLGetTexPixelData, "___syscall6": ___syscall6, "_emscripten_glStencilFuncSeparate": _emscripten_glStencilFuncSeparate, "_emscripten_glVertexAttrib3f": _emscripten_glVertexAttrib3f, "_time": _time, "_gettimeofday": _gettimeofday, "_emscripten_glVertexAttrib1f": _emscripten_glVertexAttrib1f, "_emscripten_glGetFramebufferAttachmentParameteriv": _emscripten_glGetFramebufferAttachmentParameteriv, "_emscripten_glBlendEquationSeparate": _emscripten_glBlendEquationSeparate, "_exit": _exit, "_emscripten_glEnableClientState": _emscripten_glEnableClientState, "__spawn_thread": __spawn_thread, "_emscripten_glUniform4i": _emscripten_glUniform4i, "_emscripten_conditional_set_current_thread_status_js": _emscripten_conditional_set_current_thread_status_js, "_putenv": _putenv, "_pthread_join": _pthread_join, "_glCullFace": _glCullFace, "_emscripten_glGetPointerv": _emscripten_glGetPointerv, "_emscripten_set_keypress_callback": _emscripten_set_keypress_callback, "__emscripten_sample_gamepad_data": __emscripten_sample_gamepad_data, "_fpathconf": _fpathconf, "_emscripten_get_gamepad_status": _emscripten_get_gamepad_status, "_emscripten_glUniform4f": _emscripten_glUniform4f, "_emscripten_glUniform2fv": _emscripten_glUniform2fv, "_glfwGetVideoModes": _glfwGetVideoModes, "___unlock": ___unlock, "_emscripten_set_click_callback": _emscripten_set_click_callback, "_emscripten_glFrustum": _emscripten_glFrustum, "_emscripten_is_main_runtime_thread": _emscripten_is_main_runtime_thread, "_emscripten_glShaderBinary": _emscripten_glShaderBinary, "_emscripten_glDrawElements": _emscripten_glDrawElements, "_glVertexAttribPointer": _glVertexAttribPointer, "_emscripten_get_num_gamepads": _emscripten_get_num_gamepads, "___buildEnvironment": ___buildEnvironment, "_glCompressedTexImage2D": _glCompressedTexImage2D, "_utimes": _utimes, "_emscripten_glUniform1iv": _emscripten_glUniform1iv, "_emscripten_glGetVertexAttribPointerv": _emscripten_glGetVertexAttribPointerv, "_glClearDepthf": _glClearDepthf, "_emscripten_glCompressedTexSubImage2D": _emscripten_glCompressedTexSubImage2D, "emscriptenWebGLGetUniform": emscriptenWebGLGetUniform, "_tzset": _tzset, "_emscripten_glDeleteVertexArrays": _emscripten_glDeleteVertexArrays, "_glfwSetWindowShouldClose": _glfwSetWindowShouldClose, "_emscripten_glUniform1fv": _emscripten_glUniform1fv, "_emscripten_glGetActiveUniform": _emscripten_glGetActiveUniform, "_glBindTexture": _glBindTexture, "_emscripten_glUniform3iv": _emscripten_glUniform3iv, "_emscripten_glUniform2iv": _emscripten_glUniform2iv, "_emscripten_glHint": _emscripten_glHint, "_glfwSetCharCallback": _glfwSetCharCallback, "emscriptenWebGLGetVertexAttrib": emscriptenWebGLGetVertexAttrib, "_glGetFloatv": _glGetFloatv, "_emscripten_glDeleteProgram": _emscripten_glDeleteProgram, "_emscripten_glDeleteRenderbuffers": _emscripten_glDeleteRenderbuffers, "___clock_gettime": ___clock_gettime, "_emscripten_glDrawElementsInstanced": _emscripten_glDrawElementsInstanced, "_emscripten_glVertexAttrib4f": _emscripten_glVertexAttrib4f, "_glDrawArrays": _glDrawArrays, "_emscripten_glTexSubImage2D": _emscripten_glTexSubImage2D, "_clearenv": _clearenv, "_emscripten_glPixelStorei": _emscripten_glPixelStorei, "_glCompileShader": _glCompileShader, "_emscripten_get_pointerlock_status": _emscripten_get_pointerlock_status, "_emscripten_memcpy_big": _emscripten_memcpy_big, "_emscripten_glUniformMatrix3fv": _emscripten_glUniformMatrix3fv, "_emscripten_glColorPointer": _emscripten_glColorPointer, "_getenv": _getenv, "_emscripten_glDepthRange": _emscripten_glDepthRange, "_emscripten_glGetBufferParameteriv": _emscripten_glGetBufferParameteriv, "_emscripten_glFinish": _emscripten_glFinish, "_emscripten_glRenderbufferStorage": _emscripten_glRenderbufferStorage, "_emscripten_set_gamepaddisconnected_callback": _emscripten_set_gamepaddisconnected_callback, "_emscripten_asm_const_iii": _emscripten_asm_const_iii, "_emscripten_glDepthMask": _emscripten_glDepthMask, "_glfwSetWindowIconifyCallback": _glfwSetWindowIconifyCallback, "_emscripten_glDrawBuffers": _emscripten_glDrawBuffers, "_glfwTerminate": _glfwTerminate, "_emscripten_futex_wake": _emscripten_futex_wake, "_glFrontFace": _glFrontFace, "_emscripten_glGetObjectParameterivARB": _emscripten_glGetObjectParameterivARB, "_emscripten_exit_pointerlock": _emscripten_exit_pointerlock, "_glfwSwapInterval": _glfwSwapInterval, "_glUniform1i": _glUniform1i, "_glEnableVertexAttribArray": _glEnableVertexAttribArray, "_emscripten_glStencilFunc": _emscripten_glStencilFunc, "_abort": _abort, "_emscripten_glGetUniformiv": _emscripten_glGetUniformiv, "__cleanup_thread": __cleanup_thread, "_glDeleteBuffers": _glDeleteBuffers, "_glBufferData": _glBufferData, "_glTexImage2D": _glTexImage2D, "_emscripten_set_current_thread_status_js": _emscripten_set_current_thread_status_js, "_glfwSetKeyCallback": _glfwSetKeyCallback, "_emscripten_glGenFramebuffers": _emscripten_glGenFramebuffers, "_emscripten_glUniformMatrix4fv": _emscripten_glUniformMatrix4fv, "_emscripten_glLoadIdentity": _emscripten_glLoadIdentity, "_glDeleteShader": _glDeleteShader, "_emscripten_glUniform1f": _emscripten_glUniform1f, "_glGetProgramiv": _glGetProgramiv, "_emscripten_glBindFramebuffer": _emscripten_glBindFramebuffer, "_emscripten_glIsRenderbuffer": _emscripten_glIsRenderbuffer, "_glfwGetTime": _glfwGetTime, "_emscripten_glShaderSource": _emscripten_glShaderSource, "_emscripten_set_gamepadconnected_callback": _emscripten_set_gamepadconnected_callback, "_emscripten_syscall": _emscripten_syscall, "_emscripten_glGetVertexAttribiv": _emscripten_glGetVertexAttribiv, "_emscripten_glBindVertexArray": _emscripten_glBindVertexArray, "_emscripten_glDrawArraysInstanced": _emscripten_glDrawArraysInstanced, "_emscripten_set_touchcancel_callback": _emscripten_set_touchcancel_callback, "_emscripten_glCreateShader": _emscripten_glCreateShader, "_emscripten_glStencilMask": _emscripten_glStencilMask, "_emscripten_glDeleteTextures": _emscripten_glDeleteTextures, "_emscripten_glBindRenderbuffer": _emscripten_glBindRenderbuffer, "_glfwGetPrimaryMonitor": _glfwGetPrimaryMonitor, "_glLinkProgram": _glLinkProgram, "_emscripten_glVertexAttribDivisor": _emscripten_glVertexAttribDivisor, "_emscripten_set_touchend_callback": _emscripten_set_touchend_callback, "_emscripten_glGetUniformfv": _emscripten_glGetUniformfv, "_emscripten_glGetVertexAttribfv": _emscripten_glGetVertexAttribfv, "_emscripten_glGetRenderbufferParameteriv": _emscripten_glGetRenderbufferParameteriv, "_emscripten_futex_wait": _emscripten_futex_wait, "_emscripten_glDeleteFramebuffers": _emscripten_glDeleteFramebuffers, "_glGetShaderiv": _glGetShaderiv, "_emscripten_glVertexAttrib3fv": _emscripten_glVertexAttrib3fv, "_glGetUniformLocation": _glGetUniformLocation, "_emscripten_glGetInfoLogARB": _emscripten_glGetInfoLogARB, "_emscripten_request_pointerlock": _emscripten_request_pointerlock, "_glClear": _glClear, "_glGenTextures": _glGenTextures, "_emscripten_glDisable": _emscripten_glDisable, "_emscripten_glDepthRangef": _emscripten_glDepthRangef, "__exit": __exit, "_emscripten_glLineWidth": _emscripten_glLineWidth, "_emscripten_glUniform3f": _emscripten_glUniform3f, "_emscripten_glGetShaderInfoLog": _emscripten_glGetShaderInfoLog, "_emscripten_glStencilOp": _emscripten_glStencilOp, "___pthread_setcancelstate": ___pthread_setcancelstate, "_glBindAttribLocation": _glBindAttribLocation, "_glPixelStorei": _glPixelStorei, "_emscripten_glColorMask": _emscripten_glColorMask, "_emscripten_glLinkProgram": _emscripten_glLinkProgram, "_emscripten_glBlendEquation": _emscripten_glBlendEquation, "_emscripten_glIsTexture": _emscripten_glIsTexture, "_confstr": _confstr, "_emscripten_glGetProgramiv": _emscripten_glGetProgramiv, "_emscripten_glVertexAttrib1fv": _emscripten_glVertexAttrib1fv, "_emscripten_glBindTexture": _emscripten_glBindTexture, "_glfwSetMouseButtonCallback": _glfwSetMouseButtonCallback, "_glfwGetCursorPos": _glfwGetCursorPos, "_emscripten_glActiveTexture": _emscripten_glActiveTexture, "_emscripten_glDrawRangeElements": _emscripten_glDrawRangeElements, "___syscall54": ___syscall54, "_emscripten_glDeleteBuffers": _emscripten_glDeleteBuffers, "_emscripten_glBufferSubData": _emscripten_glBufferSubData, "_glfwSwapBuffers": _glfwSwapBuffers, "_pthread_create": _pthread_create, "_emscripten_set_main_loop": _emscripten_set_main_loop, "_emscripten_glGetProgramInfoLog": _emscripten_glGetProgramInfoLog, "_glfwWindowHint": _glfwWindowHint, "_pthread_getschedparam": _pthread_getschedparam, "_emscripten_glIsShader": _emscripten_glIsShader, "_emscripten_glUniform4fv": _emscripten_glUniform4fv, "_emscripten_glGenVertexArrays": _emscripten_glGenVertexArrays, "_emscripten_glDrawArrays": _emscripten_glDrawArrays, "_emscripten_glCompressedTexImage2D": _emscripten_glCompressedTexImage2D, "_emscripten_glClearColor": _emscripten_glClearColor, "_glfwSetCursorEnterCallback": _glfwSetCursorEnterCallback, "_emscripten_glCreateProgram": _emscripten_glCreateProgram, "_emscripten_glCopyTexSubImage2D": _emscripten_glCopyTexSubImage2D, "_emscripten_glGetAttribLocation": _emscripten_glGetAttribLocation, "_glTexParameteri": _glTexParameteri, "_emscripten_glBindBuffer": _emscripten_glBindBuffer, "_atexit": _atexit, "_emscripten_glGetFloatv": _emscripten_glGetFloatv, "_emscripten_glDetachShader": _emscripten_glDetachShader, "_glClearColor": _glClearColor, "_glfwSetCursorPosCallback": _glfwSetCursorPosCallback, "_setenv": _setenv, "_emscripten_glCopyTexImage2D": _emscripten_glCopyTexImage2D, "_emscripten_glTexImage2D": _emscripten_glTexImage2D, "DYNAMICTOP_PTR": DYNAMICTOP_PTR, "tempDoublePtr": tempDoublePtr, "ABORT": ABORT, "STACKTOP": STACKTOP, "STACK_MAX": STACK_MAX, "cttz_i8": cttz_i8 };
|
|
// EMSCRIPTEN_START_ASM
|
|
var asm = (function(global, env, buffer) {
|
|
'use asm';
|
|
|
|
|
|
var HEAP8 = new global.Int8Array(buffer);
|
|
var HEAP16 = new global.Int16Array(buffer);
|
|
var HEAP32 = new global.Int32Array(buffer);
|
|
var HEAPU8 = new global.Uint8Array(buffer);
|
|
var HEAPU16 = new global.Uint16Array(buffer);
|
|
var HEAPU32 = new global.Uint32Array(buffer);
|
|
var HEAPF32 = new global.Float32Array(buffer);
|
|
var HEAPF64 = new global.Float64Array(buffer);
|
|
|
|
|
|
var DYNAMICTOP_PTR=env.DYNAMICTOP_PTR|0;
|
|
var tempDoublePtr=env.tempDoublePtr|0;
|
|
var ABORT=env.ABORT|0;
|
|
var STACKTOP=env.STACKTOP|0;
|
|
var STACK_MAX=env.STACK_MAX|0;
|
|
var cttz_i8=env.cttz_i8|0;
|
|
|
|
var __THREW__ = 0;
|
|
var threwValue = 0;
|
|
var setjmpId = 0;
|
|
var undef = 0;
|
|
var nan = global.NaN, inf = global.Infinity;
|
|
var tempInt = 0, tempBigInt = 0, tempBigIntP = 0, tempBigIntS = 0, tempBigIntR = 0.0, tempBigIntI = 0, tempBigIntD = 0, tempValue = 0, tempDouble = 0.0;
|
|
var tempRet0 = 0;
|
|
|
|
var Math_floor=global.Math.floor;
|
|
var Math_abs=global.Math.abs;
|
|
var Math_sqrt=global.Math.sqrt;
|
|
var Math_pow=global.Math.pow;
|
|
var Math_cos=global.Math.cos;
|
|
var Math_sin=global.Math.sin;
|
|
var Math_tan=global.Math.tan;
|
|
var Math_acos=global.Math.acos;
|
|
var Math_asin=global.Math.asin;
|
|
var Math_atan=global.Math.atan;
|
|
var Math_atan2=global.Math.atan2;
|
|
var Math_exp=global.Math.exp;
|
|
var Math_log=global.Math.log;
|
|
var Math_ceil=global.Math.ceil;
|
|
var Math_imul=global.Math.imul;
|
|
var Math_min=global.Math.min;
|
|
var Math_max=global.Math.max;
|
|
var Math_clz32=global.Math.clz32;
|
|
var abort=env.abort;
|
|
var assert=env.assert;
|
|
var enlargeMemory=env.enlargeMemory;
|
|
var getTotalMemory=env.getTotalMemory;
|
|
var abortOnCannotGrowMemory=env.abortOnCannotGrowMemory;
|
|
var abortStackOverflow=env.abortStackOverflow;
|
|
var nullFunc_viiiii=env.nullFunc_viiiii;
|
|
var nullFunc_vd=env.nullFunc_vd;
|
|
var nullFunc_vid=env.nullFunc_vid;
|
|
var nullFunc_vi=env.nullFunc_vi;
|
|
var nullFunc_vii=env.nullFunc_vii;
|
|
var nullFunc_ii=env.nullFunc_ii;
|
|
var nullFunc_viddd=env.nullFunc_viddd;
|
|
var nullFunc_vidd=env.nullFunc_vidd;
|
|
var nullFunc_iiii=env.nullFunc_iiii;
|
|
var nullFunc_viiiiiiii=env.nullFunc_viiiiiiii;
|
|
var nullFunc_viiiiii=env.nullFunc_viiiiii;
|
|
var nullFunc_viii=env.nullFunc_viii;
|
|
var nullFunc_vidddd=env.nullFunc_vidddd;
|
|
var nullFunc_vdi=env.nullFunc_vdi;
|
|
var nullFunc_viiiiiii=env.nullFunc_viiiiiii;
|
|
var nullFunc_viiiiiiiii=env.nullFunc_viiiiiiiii;
|
|
var nullFunc_iii=env.nullFunc_iii;
|
|
var nullFunc_i=env.nullFunc_i;
|
|
var nullFunc_vdddddd=env.nullFunc_vdddddd;
|
|
var nullFunc_vdddd=env.nullFunc_vdddd;
|
|
var nullFunc_vdd=env.nullFunc_vdd;
|
|
var nullFunc_v=env.nullFunc_v;
|
|
var nullFunc_viid=env.nullFunc_viid;
|
|
var nullFunc_viiii=env.nullFunc_viiii;
|
|
var invoke_viiiii=env.invoke_viiiii;
|
|
var invoke_vd=env.invoke_vd;
|
|
var invoke_vid=env.invoke_vid;
|
|
var invoke_vi=env.invoke_vi;
|
|
var invoke_vii=env.invoke_vii;
|
|
var invoke_ii=env.invoke_ii;
|
|
var invoke_viddd=env.invoke_viddd;
|
|
var invoke_vidd=env.invoke_vidd;
|
|
var invoke_iiii=env.invoke_iiii;
|
|
var invoke_viiiiiiii=env.invoke_viiiiiiii;
|
|
var invoke_viiiiii=env.invoke_viiiiii;
|
|
var invoke_viii=env.invoke_viii;
|
|
var invoke_vidddd=env.invoke_vidddd;
|
|
var invoke_vdi=env.invoke_vdi;
|
|
var invoke_viiiiiii=env.invoke_viiiiiii;
|
|
var invoke_viiiiiiiii=env.invoke_viiiiiiiii;
|
|
var invoke_iii=env.invoke_iii;
|
|
var invoke_i=env.invoke_i;
|
|
var invoke_vdddddd=env.invoke_vdddddd;
|
|
var invoke_vdddd=env.invoke_vdddd;
|
|
var invoke_vdd=env.invoke_vdd;
|
|
var invoke_v=env.invoke_v;
|
|
var invoke_viid=env.invoke_viid;
|
|
var invoke_viiii=env.invoke_viiii;
|
|
var _emscripten_glGetTexParameterfv=env._emscripten_glGetTexParameterfv;
|
|
var _glUseProgram=env._glUseProgram;
|
|
var _glfwCreateWindow=env._glfwCreateWindow;
|
|
var _emscripten_glReleaseShaderCompiler=env._emscripten_glReleaseShaderCompiler;
|
|
var _emscripten_glBlendFuncSeparate=env._emscripten_glBlendFuncSeparate;
|
|
var _emscripten_glVertexAttribPointer=env._emscripten_glVertexAttribPointer;
|
|
var _emscripten_glGetIntegerv=env._emscripten_glGetIntegerv;
|
|
var _emscripten_glCullFace=env._emscripten_glCullFace;
|
|
var _emscripten_glIsProgram=env._emscripten_glIsProgram;
|
|
var _emscripten_glStencilMaskSeparate=env._emscripten_glStencilMaskSeparate;
|
|
var _emscripten_glViewport=env._emscripten_glViewport;
|
|
var _emscripten_glFrontFace=env._emscripten_glFrontFace;
|
|
var ___assert_fail=env.___assert_fail;
|
|
var _glDeleteProgram=env._glDeleteProgram;
|
|
var _emscripten_glUniform3fv=env._emscripten_glUniform3fv;
|
|
var _emscripten_glPolygonOffset=env._emscripten_glPolygonOffset;
|
|
var _emscripten_glUseProgram=env._emscripten_glUseProgram;
|
|
var _emscripten_glBlendColor=env._emscripten_glBlendColor;
|
|
var _glBindBuffer=env._glBindBuffer;
|
|
var _emscripten_glDepthFunc=env._emscripten_glDepthFunc;
|
|
var _glGetShaderInfoLog=env._glGetShaderInfoLog;
|
|
var _clock_gettime=env._clock_gettime;
|
|
var _emscripten_set_fullscreenchange_callback=env._emscripten_set_fullscreenchange_callback;
|
|
var _emscripten_set_touchmove_callback=env._emscripten_set_touchmove_callback;
|
|
var _emscripten_set_main_loop_timing=env._emscripten_set_main_loop_timing;
|
|
var _glDisable=env._glDisable;
|
|
var _glBlendFunc=env._glBlendFunc;
|
|
var _emscripten_glDisableVertexAttribArray=env._emscripten_glDisableVertexAttribArray;
|
|
var _glGetAttribLocation=env._glGetAttribLocation;
|
|
var _glDisableVertexAttribArray=env._glDisableVertexAttribArray;
|
|
var _glCreateShader=env._glCreateShader;
|
|
var _emscripten_glCompileShader=env._emscripten_glCompileShader;
|
|
var _sysconf=env._sysconf;
|
|
var _utime=env._utime;
|
|
var _emscripten_glSampleCoverage=env._emscripten_glSampleCoverage;
|
|
var _emscripten_glVertexPointer=env._emscripten_glVertexPointer;
|
|
var _emscripten_set_touchstart_callback=env._emscripten_set_touchstart_callback;
|
|
var emscriptenWebGLComputeImageSize=env.emscriptenWebGLComputeImageSize;
|
|
var _emscripten_glGetBooleanv=env._emscripten_glGetBooleanv;
|
|
var _emscripten_glGetShaderSource=env._emscripten_glGetShaderSource;
|
|
var _chroot=env._chroot;
|
|
var _glUniform4f=env._glUniform4f;
|
|
var _llvm_stacksave=env._llvm_stacksave;
|
|
var _emscripten_glUniform1i=env._emscripten_glUniform1i;
|
|
var _emscripten_glLoadMatrixf=env._emscripten_glLoadMatrixf;
|
|
var _emscripten_glGenBuffers=env._emscripten_glGenBuffers;
|
|
var _emscripten_glDeleteObjectARB=env._emscripten_glDeleteObjectARB;
|
|
var _glfwSetWindowSizeCallback=env._glfwSetWindowSizeCallback;
|
|
var _emscripten_glGetShaderPrecisionFormat=env._emscripten_glGetShaderPrecisionFormat;
|
|
var _glfwInit=env._glfwInit;
|
|
var _glGenBuffers=env._glGenBuffers;
|
|
var _glShaderSource=env._glShaderSource;
|
|
var _emscripten_glGetString=env._emscripten_glGetString;
|
|
var _emscripten_glIsFramebuffer=env._emscripten_glIsFramebuffer;
|
|
var _emscripten_glIsEnabled=env._emscripten_glIsEnabled;
|
|
var _emscripten_glScissor=env._emscripten_glScissor;
|
|
var __pthread_testcancel_js=env.__pthread_testcancel_js;
|
|
var _emscripten_glVertexAttrib4fv=env._emscripten_glVertexAttrib4fv;
|
|
var _emscripten_glFramebufferTexture2D=env._emscripten_glFramebufferTexture2D;
|
|
var _emscripten_glTexParameteriv=env._emscripten_glTexParameteriv;
|
|
var _unsetenv=env._unsetenv;
|
|
var _emscripten_glBindProgramARB=env._emscripten_glBindProgramARB;
|
|
var _emscripten_glStencilOpSeparate=env._emscripten_glStencilOpSeparate;
|
|
var _emscripten_glFramebufferRenderbuffer=env._emscripten_glFramebufferRenderbuffer;
|
|
var ___syscall140=env.___syscall140;
|
|
var _glfwSetErrorCallback=env._glfwSetErrorCallback;
|
|
var _glfwDefaultWindowHints=env._glfwDefaultWindowHints;
|
|
var _glfwDestroyWindow=env._glfwDestroyWindow;
|
|
var ___syscall146=env.___syscall146;
|
|
var _emscripten_glGetActiveAttrib=env._emscripten_glGetActiveAttrib;
|
|
var _emscripten_glAttachShader=env._emscripten_glAttachShader;
|
|
var _emscripten_get_now_is_monotonic=env._emscripten_get_now_is_monotonic;
|
|
var _emscripten_glUniform2i=env._emscripten_glUniform2i;
|
|
var _emscripten_glUniform2f=env._emscripten_glUniform2f;
|
|
var _emscripten_glTexParameterfv=env._emscripten_glTexParameterfv;
|
|
var _emscripten_glIsBuffer=env._emscripten_glIsBuffer;
|
|
var _emscripten_glUniformMatrix2fv=env._emscripten_glUniformMatrix2fv;
|
|
var _glGetProgramInfoLog=env._glGetProgramInfoLog;
|
|
var _glfwSetScrollCallback=env._glfwSetScrollCallback;
|
|
var _emscripten_glTexParameterf=env._emscripten_glTexParameterf;
|
|
var _emscripten_glGetAttachedShaders=env._emscripten_glGetAttachedShaders;
|
|
var _emscripten_glGenTextures=env._emscripten_glGenTextures;
|
|
var _emscripten_glTexParameteri=env._emscripten_glTexParameteri;
|
|
var _llvm_stackrestore=env._llvm_stackrestore;
|
|
var _glfwMakeContextCurrent=env._glfwMakeContextCurrent;
|
|
var _emscripten_glClear=env._emscripten_glClear;
|
|
var _glDrawElements=env._glDrawElements;
|
|
var _glBufferSubData=env._glBufferSubData;
|
|
var _emscripten_glValidateProgram=env._emscripten_glValidateProgram;
|
|
var _emscripten_glVertexAttrib2fv=env._emscripten_glVertexAttrib2fv;
|
|
var _glViewport=env._glViewport;
|
|
var _emscripten_glUniform4iv=env._emscripten_glUniform4iv;
|
|
var _emscripten_glGetTexParameteriv=env._emscripten_glGetTexParameteriv;
|
|
var ___setErrNo=env.___setErrNo;
|
|
var _eglGetProcAddress=env._eglGetProcAddress;
|
|
var _emscripten_glBindAttribLocation=env._emscripten_glBindAttribLocation;
|
|
var _glDeleteTextures=env._glDeleteTextures;
|
|
var _glDepthFunc=env._glDepthFunc;
|
|
var _emscripten_glClientActiveTexture=env._emscripten_glClientActiveTexture;
|
|
var _emscripten_glVertexAttrib2f=env._emscripten_glVertexAttrib2f;
|
|
var _emscripten_asm_const_v=env._emscripten_asm_const_v;
|
|
var _emscripten_glFlush=env._emscripten_glFlush;
|
|
var _emscripten_glBlendFunc=env._emscripten_glBlendFunc;
|
|
var _emscripten_glCheckFramebufferStatus=env._emscripten_glCheckFramebufferStatus;
|
|
var _emscripten_glGenerateMipmap=env._emscripten_glGenerateMipmap;
|
|
var _emscripten_glGetError=env._emscripten_glGetError;
|
|
var _emscripten_glClearDepthf=env._emscripten_glClearDepthf;
|
|
var _pthread_self=env._pthread_self;
|
|
var _emscripten_glBufferData=env._emscripten_glBufferData;
|
|
var _emscripten_glUniform3i=env._emscripten_glUniform3i;
|
|
var _emscripten_glGenRenderbuffers=env._emscripten_glGenRenderbuffers;
|
|
var _emscripten_glRotatef=env._emscripten_glRotatef;
|
|
var _emscripten_glDeleteShader=env._emscripten_glDeleteShader;
|
|
var _glEnable=env._glEnable;
|
|
var _emscripten_glGetShaderiv=env._emscripten_glGetShaderiv;
|
|
var _emscripten_glReadPixels=env._emscripten_glReadPixels;
|
|
var _emscripten_glMatrixMode=env._emscripten_glMatrixMode;
|
|
var _glGetString=env._glGetString;
|
|
var _emscripten_glClearStencil=env._emscripten_glClearStencil;
|
|
var _emscripten_glGetUniformLocation=env._emscripten_glGetUniformLocation;
|
|
var emscriptenWebGLGet=env.emscriptenWebGLGet;
|
|
var _emscripten_glEnableVertexAttribArray=env._emscripten_glEnableVertexAttribArray;
|
|
var __register_pthread_ptr=env.__register_pthread_ptr;
|
|
var _emscripten_get_now=env._emscripten_get_now;
|
|
var _emscripten_glNormalPointer=env._emscripten_glNormalPointer;
|
|
var _glAttachShader=env._glAttachShader;
|
|
var _emscripten_glTexCoordPointer=env._emscripten_glTexCoordPointer;
|
|
var _emscripten_glEnable=env._emscripten_glEnable;
|
|
var _glCreateProgram=env._glCreateProgram;
|
|
var _glUniformMatrix4fv=env._glUniformMatrix4fv;
|
|
var _emscripten_glClearDepth=env._emscripten_glClearDepth;
|
|
var ___lock=env.___lock;
|
|
var emscriptenWebGLGetTexPixelData=env.emscriptenWebGLGetTexPixelData;
|
|
var ___syscall6=env.___syscall6;
|
|
var _emscripten_glStencilFuncSeparate=env._emscripten_glStencilFuncSeparate;
|
|
var _emscripten_glVertexAttrib3f=env._emscripten_glVertexAttrib3f;
|
|
var _time=env._time;
|
|
var _gettimeofday=env._gettimeofday;
|
|
var _emscripten_glVertexAttrib1f=env._emscripten_glVertexAttrib1f;
|
|
var _emscripten_glGetFramebufferAttachmentParameteriv=env._emscripten_glGetFramebufferAttachmentParameteriv;
|
|
var _emscripten_glBlendEquationSeparate=env._emscripten_glBlendEquationSeparate;
|
|
var _exit=env._exit;
|
|
var _emscripten_glEnableClientState=env._emscripten_glEnableClientState;
|
|
var __spawn_thread=env.__spawn_thread;
|
|
var _emscripten_glUniform4i=env._emscripten_glUniform4i;
|
|
var _emscripten_conditional_set_current_thread_status_js=env._emscripten_conditional_set_current_thread_status_js;
|
|
var _putenv=env._putenv;
|
|
var _pthread_join=env._pthread_join;
|
|
var _glCullFace=env._glCullFace;
|
|
var _emscripten_glGetPointerv=env._emscripten_glGetPointerv;
|
|
var _emscripten_set_keypress_callback=env._emscripten_set_keypress_callback;
|
|
var __emscripten_sample_gamepad_data=env.__emscripten_sample_gamepad_data;
|
|
var _fpathconf=env._fpathconf;
|
|
var _emscripten_get_gamepad_status=env._emscripten_get_gamepad_status;
|
|
var _emscripten_glUniform4f=env._emscripten_glUniform4f;
|
|
var _emscripten_glUniform2fv=env._emscripten_glUniform2fv;
|
|
var _glfwGetVideoModes=env._glfwGetVideoModes;
|
|
var ___unlock=env.___unlock;
|
|
var _emscripten_set_click_callback=env._emscripten_set_click_callback;
|
|
var _emscripten_glFrustum=env._emscripten_glFrustum;
|
|
var _emscripten_is_main_runtime_thread=env._emscripten_is_main_runtime_thread;
|
|
var _emscripten_glShaderBinary=env._emscripten_glShaderBinary;
|
|
var _emscripten_glDrawElements=env._emscripten_glDrawElements;
|
|
var _glVertexAttribPointer=env._glVertexAttribPointer;
|
|
var _emscripten_get_num_gamepads=env._emscripten_get_num_gamepads;
|
|
var ___buildEnvironment=env.___buildEnvironment;
|
|
var _glCompressedTexImage2D=env._glCompressedTexImage2D;
|
|
var _utimes=env._utimes;
|
|
var _emscripten_glUniform1iv=env._emscripten_glUniform1iv;
|
|
var _emscripten_glGetVertexAttribPointerv=env._emscripten_glGetVertexAttribPointerv;
|
|
var _glClearDepthf=env._glClearDepthf;
|
|
var _emscripten_glCompressedTexSubImage2D=env._emscripten_glCompressedTexSubImage2D;
|
|
var emscriptenWebGLGetUniform=env.emscriptenWebGLGetUniform;
|
|
var _tzset=env._tzset;
|
|
var _emscripten_glDeleteVertexArrays=env._emscripten_glDeleteVertexArrays;
|
|
var _glfwSetWindowShouldClose=env._glfwSetWindowShouldClose;
|
|
var _emscripten_glUniform1fv=env._emscripten_glUniform1fv;
|
|
var _emscripten_glGetActiveUniform=env._emscripten_glGetActiveUniform;
|
|
var _glBindTexture=env._glBindTexture;
|
|
var _emscripten_glUniform3iv=env._emscripten_glUniform3iv;
|
|
var _emscripten_glUniform2iv=env._emscripten_glUniform2iv;
|
|
var _emscripten_glHint=env._emscripten_glHint;
|
|
var _glfwSetCharCallback=env._glfwSetCharCallback;
|
|
var emscriptenWebGLGetVertexAttrib=env.emscriptenWebGLGetVertexAttrib;
|
|
var _glGetFloatv=env._glGetFloatv;
|
|
var _emscripten_glDeleteProgram=env._emscripten_glDeleteProgram;
|
|
var _emscripten_glDeleteRenderbuffers=env._emscripten_glDeleteRenderbuffers;
|
|
var ___clock_gettime=env.___clock_gettime;
|
|
var _emscripten_glDrawElementsInstanced=env._emscripten_glDrawElementsInstanced;
|
|
var _emscripten_glVertexAttrib4f=env._emscripten_glVertexAttrib4f;
|
|
var _glDrawArrays=env._glDrawArrays;
|
|
var _emscripten_glTexSubImage2D=env._emscripten_glTexSubImage2D;
|
|
var _clearenv=env._clearenv;
|
|
var _emscripten_glPixelStorei=env._emscripten_glPixelStorei;
|
|
var _glCompileShader=env._glCompileShader;
|
|
var _emscripten_get_pointerlock_status=env._emscripten_get_pointerlock_status;
|
|
var _emscripten_memcpy_big=env._emscripten_memcpy_big;
|
|
var _emscripten_glUniformMatrix3fv=env._emscripten_glUniformMatrix3fv;
|
|
var _emscripten_glColorPointer=env._emscripten_glColorPointer;
|
|
var _getenv=env._getenv;
|
|
var _emscripten_glDepthRange=env._emscripten_glDepthRange;
|
|
var _emscripten_glGetBufferParameteriv=env._emscripten_glGetBufferParameteriv;
|
|
var _emscripten_glFinish=env._emscripten_glFinish;
|
|
var _emscripten_glRenderbufferStorage=env._emscripten_glRenderbufferStorage;
|
|
var _emscripten_set_gamepaddisconnected_callback=env._emscripten_set_gamepaddisconnected_callback;
|
|
var _emscripten_asm_const_iii=env._emscripten_asm_const_iii;
|
|
var _emscripten_glDepthMask=env._emscripten_glDepthMask;
|
|
var _glfwSetWindowIconifyCallback=env._glfwSetWindowIconifyCallback;
|
|
var _emscripten_glDrawBuffers=env._emscripten_glDrawBuffers;
|
|
var _glfwTerminate=env._glfwTerminate;
|
|
var _emscripten_futex_wake=env._emscripten_futex_wake;
|
|
var _glFrontFace=env._glFrontFace;
|
|
var _emscripten_glGetObjectParameterivARB=env._emscripten_glGetObjectParameterivARB;
|
|
var _emscripten_exit_pointerlock=env._emscripten_exit_pointerlock;
|
|
var _glfwSwapInterval=env._glfwSwapInterval;
|
|
var _glUniform1i=env._glUniform1i;
|
|
var _glEnableVertexAttribArray=env._glEnableVertexAttribArray;
|
|
var _emscripten_glStencilFunc=env._emscripten_glStencilFunc;
|
|
var _abort=env._abort;
|
|
var _emscripten_glGetUniformiv=env._emscripten_glGetUniformiv;
|
|
var __cleanup_thread=env.__cleanup_thread;
|
|
var _glDeleteBuffers=env._glDeleteBuffers;
|
|
var _glBufferData=env._glBufferData;
|
|
var _glTexImage2D=env._glTexImage2D;
|
|
var _emscripten_set_current_thread_status_js=env._emscripten_set_current_thread_status_js;
|
|
var _glfwSetKeyCallback=env._glfwSetKeyCallback;
|
|
var _emscripten_glGenFramebuffers=env._emscripten_glGenFramebuffers;
|
|
var _emscripten_glUniformMatrix4fv=env._emscripten_glUniformMatrix4fv;
|
|
var _emscripten_glLoadIdentity=env._emscripten_glLoadIdentity;
|
|
var _glDeleteShader=env._glDeleteShader;
|
|
var _emscripten_glUniform1f=env._emscripten_glUniform1f;
|
|
var _glGetProgramiv=env._glGetProgramiv;
|
|
var _emscripten_glBindFramebuffer=env._emscripten_glBindFramebuffer;
|
|
var _emscripten_glIsRenderbuffer=env._emscripten_glIsRenderbuffer;
|
|
var _glfwGetTime=env._glfwGetTime;
|
|
var _emscripten_glShaderSource=env._emscripten_glShaderSource;
|
|
var _emscripten_set_gamepadconnected_callback=env._emscripten_set_gamepadconnected_callback;
|
|
var _emscripten_syscall=env._emscripten_syscall;
|
|
var _emscripten_glGetVertexAttribiv=env._emscripten_glGetVertexAttribiv;
|
|
var _emscripten_glBindVertexArray=env._emscripten_glBindVertexArray;
|
|
var _emscripten_glDrawArraysInstanced=env._emscripten_glDrawArraysInstanced;
|
|
var _emscripten_set_touchcancel_callback=env._emscripten_set_touchcancel_callback;
|
|
var _emscripten_glCreateShader=env._emscripten_glCreateShader;
|
|
var _emscripten_glStencilMask=env._emscripten_glStencilMask;
|
|
var _emscripten_glDeleteTextures=env._emscripten_glDeleteTextures;
|
|
var _emscripten_glBindRenderbuffer=env._emscripten_glBindRenderbuffer;
|
|
var _glfwGetPrimaryMonitor=env._glfwGetPrimaryMonitor;
|
|
var _glLinkProgram=env._glLinkProgram;
|
|
var _emscripten_glVertexAttribDivisor=env._emscripten_glVertexAttribDivisor;
|
|
var _emscripten_set_touchend_callback=env._emscripten_set_touchend_callback;
|
|
var _emscripten_glGetUniformfv=env._emscripten_glGetUniformfv;
|
|
var _emscripten_glGetVertexAttribfv=env._emscripten_glGetVertexAttribfv;
|
|
var _emscripten_glGetRenderbufferParameteriv=env._emscripten_glGetRenderbufferParameteriv;
|
|
var _emscripten_futex_wait=env._emscripten_futex_wait;
|
|
var _emscripten_glDeleteFramebuffers=env._emscripten_glDeleteFramebuffers;
|
|
var _glGetShaderiv=env._glGetShaderiv;
|
|
var _emscripten_glVertexAttrib3fv=env._emscripten_glVertexAttrib3fv;
|
|
var _glGetUniformLocation=env._glGetUniformLocation;
|
|
var _emscripten_glGetInfoLogARB=env._emscripten_glGetInfoLogARB;
|
|
var _emscripten_request_pointerlock=env._emscripten_request_pointerlock;
|
|
var _glClear=env._glClear;
|
|
var _glGenTextures=env._glGenTextures;
|
|
var _emscripten_glDisable=env._emscripten_glDisable;
|
|
var _emscripten_glDepthRangef=env._emscripten_glDepthRangef;
|
|
var __exit=env.__exit;
|
|
var _emscripten_glLineWidth=env._emscripten_glLineWidth;
|
|
var _emscripten_glUniform3f=env._emscripten_glUniform3f;
|
|
var _emscripten_glGetShaderInfoLog=env._emscripten_glGetShaderInfoLog;
|
|
var _emscripten_glStencilOp=env._emscripten_glStencilOp;
|
|
var ___pthread_setcancelstate=env.___pthread_setcancelstate;
|
|
var _glBindAttribLocation=env._glBindAttribLocation;
|
|
var _glPixelStorei=env._glPixelStorei;
|
|
var _emscripten_glColorMask=env._emscripten_glColorMask;
|
|
var _emscripten_glLinkProgram=env._emscripten_glLinkProgram;
|
|
var _emscripten_glBlendEquation=env._emscripten_glBlendEquation;
|
|
var _emscripten_glIsTexture=env._emscripten_glIsTexture;
|
|
var _confstr=env._confstr;
|
|
var _emscripten_glGetProgramiv=env._emscripten_glGetProgramiv;
|
|
var _emscripten_glVertexAttrib1fv=env._emscripten_glVertexAttrib1fv;
|
|
var _emscripten_glBindTexture=env._emscripten_glBindTexture;
|
|
var _glfwSetMouseButtonCallback=env._glfwSetMouseButtonCallback;
|
|
var _glfwGetCursorPos=env._glfwGetCursorPos;
|
|
var _emscripten_glActiveTexture=env._emscripten_glActiveTexture;
|
|
var _emscripten_glDrawRangeElements=env._emscripten_glDrawRangeElements;
|
|
var ___syscall54=env.___syscall54;
|
|
var _emscripten_glDeleteBuffers=env._emscripten_glDeleteBuffers;
|
|
var _emscripten_glBufferSubData=env._emscripten_glBufferSubData;
|
|
var _glfwSwapBuffers=env._glfwSwapBuffers;
|
|
var _pthread_create=env._pthread_create;
|
|
var _emscripten_set_main_loop=env._emscripten_set_main_loop;
|
|
var _emscripten_glGetProgramInfoLog=env._emscripten_glGetProgramInfoLog;
|
|
var _glfwWindowHint=env._glfwWindowHint;
|
|
var _pthread_getschedparam=env._pthread_getschedparam;
|
|
var _emscripten_glIsShader=env._emscripten_glIsShader;
|
|
var _emscripten_glUniform4fv=env._emscripten_glUniform4fv;
|
|
var _emscripten_glGenVertexArrays=env._emscripten_glGenVertexArrays;
|
|
var _emscripten_glDrawArrays=env._emscripten_glDrawArrays;
|
|
var _emscripten_glCompressedTexImage2D=env._emscripten_glCompressedTexImage2D;
|
|
var _emscripten_glClearColor=env._emscripten_glClearColor;
|
|
var _glfwSetCursorEnterCallback=env._glfwSetCursorEnterCallback;
|
|
var _emscripten_glCreateProgram=env._emscripten_glCreateProgram;
|
|
var _emscripten_glCopyTexSubImage2D=env._emscripten_glCopyTexSubImage2D;
|
|
var _emscripten_glGetAttribLocation=env._emscripten_glGetAttribLocation;
|
|
var _glTexParameteri=env._glTexParameteri;
|
|
var _emscripten_glBindBuffer=env._emscripten_glBindBuffer;
|
|
var _atexit=env._atexit;
|
|
var _emscripten_glGetFloatv=env._emscripten_glGetFloatv;
|
|
var _emscripten_glDetachShader=env._emscripten_glDetachShader;
|
|
var _glClearColor=env._glClearColor;
|
|
var _glfwSetCursorPosCallback=env._glfwSetCursorPosCallback;
|
|
var _setenv=env._setenv;
|
|
var _emscripten_glCopyTexImage2D=env._emscripten_glCopyTexImage2D;
|
|
var _emscripten_glTexImage2D=env._emscripten_glTexImage2D;
|
|
var Atomics_load=global.Atomics.load;
|
|
var Atomics_store=global.Atomics.store;
|
|
var Atomics_exchange=global.Atomics.exchange;
|
|
var Atomics_compareExchange=global.Atomics.compareExchange;
|
|
var Atomics_add=global.Atomics.add;
|
|
var Atomics_sub=global.Atomics.sub;
|
|
var Atomics_and=global.Atomics.and;
|
|
var Atomics_or=global.Atomics.or;
|
|
var Atomics_xor=global.Atomics.xor;
|
|
var tempFloat = 0.0;
|
|
|
|
// EMSCRIPTEN_START_FUNCS
|
|
|
|
function stackAlloc(size) {
|
|
size = size|0;
|
|
var ret = 0;
|
|
ret = STACKTOP;
|
|
STACKTOP = (STACKTOP + size)|0;
|
|
STACKTOP = (STACKTOP + 15)&-16;
|
|
if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(size|0);
|
|
|
|
return ret|0;
|
|
}
|
|
function stackSave() {
|
|
return STACKTOP|0;
|
|
}
|
|
function stackRestore(top) {
|
|
top = top|0;
|
|
STACKTOP = top;
|
|
}
|
|
function establishStackSpace(stackBase, stackMax) {
|
|
stackBase = stackBase|0;
|
|
stackMax = stackMax|0;
|
|
STACKTOP = stackBase;
|
|
STACK_MAX = stackMax;
|
|
}
|
|
|
|
function setThrew(threw, value) {
|
|
threw = threw|0;
|
|
value = value|0;
|
|
if ((__THREW__|0) == 0) {
|
|
__THREW__ = threw;
|
|
threwValue = value;
|
|
}
|
|
}
|
|
|
|
function setTempRet0(value) {
|
|
value = value|0;
|
|
tempRet0 = value;
|
|
}
|
|
function getTempRet0() {
|
|
return tempRet0|0;
|
|
}
|
|
|
|
function _InitPhysics() {
|
|
var label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
(_pthread_create((14280|0),(0|0),(2|0),(0|0))|0);
|
|
return;
|
|
}
|
|
function _PhysicsLoop($0) {
|
|
$0 = $0|0;
|
|
var $$0 = 0, $$010 = 0, $$011 = 0, $$09 = 0, $$0912 = 0, $$0913 = 0, $$pr = 0.0, $1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0, $13 = 0.0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0;
|
|
var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0.0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
HEAP32[3571] = 1;
|
|
HEAPF64[1747] = 0.0;
|
|
_InitTimer();
|
|
$1 = HEAP32[3571]|0;
|
|
$2 = ($1|0)==(0);
|
|
if (!($2)) {
|
|
while(1) {
|
|
$3 = (+_GetCurrentTime());
|
|
HEAPF64[1748] = $3;
|
|
$4 = +HEAPF64[1749];
|
|
$5 = $3 - $4;
|
|
HEAPF64[1750] = $5;
|
|
$6 = +HEAPF64[1747];
|
|
$7 = $5 + $6;
|
|
HEAPF64[1747] = $7;
|
|
_MathClamp();
|
|
$$pr = +HEAPF64[1747];
|
|
$8 = !($$pr >= 0.016666666666666666);
|
|
if (!($8)) {
|
|
while(1) {
|
|
_PhysicsStep();
|
|
$9 = +HEAPF64[1750];
|
|
$10 = +HEAPF64[1747];
|
|
$11 = $10 - $9;
|
|
HEAPF64[1747] = $11;
|
|
$12 = !($11 >= 0.016666666666666666);
|
|
if ($12) {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
$13 = +HEAPF64[1748];
|
|
HEAPF64[1749] = $13;
|
|
$14 = HEAP32[3571]|0;
|
|
$15 = ($14|0)==(0);
|
|
if ($15) {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
$16 = HEAP32[3638]|0;
|
|
$$0912 = (($16) + -1)|0;
|
|
$17 = ($$0912|0)>(-1);
|
|
if ($17) {
|
|
$$0913 = $$0912;
|
|
while(1) {
|
|
$20 = (14556 + ($$0913<<2)|0);
|
|
$21 = HEAP32[$20>>2]|0;
|
|
_DestroyPhysicsManifold($21);
|
|
$$09 = (($$0913) + -1)|0;
|
|
$22 = ($$09|0)>(-1);
|
|
if ($22) {
|
|
$$0913 = $$09;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
$18 = HEAP32[3573]|0;
|
|
$$010 = (($18) + -1)|0;
|
|
$19 = ($$010|0)>(-1);
|
|
if ($19) {
|
|
$$011 = $$010;
|
|
} else {
|
|
return (0|0);
|
|
}
|
|
while(1) {
|
|
$23 = (14296 + ($$011<<2)|0);
|
|
$24 = HEAP32[$23>>2]|0;
|
|
_DestroyPhysicsBody($24);
|
|
$$0 = (($$011) + -1)|0;
|
|
$25 = ($$0|0)>(-1);
|
|
if ($25) {
|
|
$$011 = $$0;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
return (0|0);
|
|
}
|
|
function _SetPhysicsGravity($0,$1) {
|
|
$0 = +$0;
|
|
$1 = +$1;
|
|
var label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
HEAPF32[7738] = $0;
|
|
HEAPF32[5] = $1;
|
|
return;
|
|
}
|
|
function _CreatePhysicsBodyPolygon($0,$1,$2,$3) {
|
|
$0 = $0|0;
|
|
$1 = +$1;
|
|
$2 = $2|0;
|
|
$3 = +$3;
|
|
var $$0116149 = 0, $$0116149158159 = 0, $$0119144 = 0, $$0120136 = 0, $$0121$lcssa161 = 0.0, $$0121134 = 0.0, $$0122$lcssa160 = 0.0, $$0122133 = 0.0, $$0131 = 0, $$sroa$0$0132 = 0.0, $$sroa$049$0$$sroa_idx = 0, $$sroa$8$0135 = 0.0, $10 = 0, $100 = 0.0, $101 = 0, $102 = 0.0, $103 = 0, $104 = 0, $105 = 0.0, $106 = 0.0;
|
|
var $107 = 0, $108 = 0.0, $109 = 0, $11 = 0, $110 = 0, $111 = 0.0, $112 = 0.0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0.0;
|
|
var $125 = 0.0, $126 = 0, $127 = 0.0, $128 = 0.0, $129 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
|
|
var $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0.0, $42 = 0.0, $43 = 0.0, $44 = 0.0, $45 = 0.0, $46 = 0.0;
|
|
var $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0;
|
|
var $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0.0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0, $80 = 0.0, $81 = 0.0, $82 = 0.0;
|
|
var $83 = 0.0, $84 = 0.0, $85 = 0.0, $86 = 0.0, $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0, $90 = 0.0, $91 = 0.0, $92 = 0.0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0.0, $97 = 0.0, $98 = 0.0, $99 = 0.0, $exitcond = 0, $tmpcast$byval_copy = 0;
|
|
var $tmpcast123$byval_copy = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 448|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(448|0);
|
|
$tmpcast123$byval_copy = sp + 432|0;
|
|
$tmpcast$byval_copy = sp + 424|0;
|
|
$4 = sp + 16|0;
|
|
$5 = sp + 8|0;
|
|
$6 = sp;
|
|
$7 = (_malloc(500)|0);
|
|
$8 = HEAP32[3572]|0;
|
|
$9 = (($8) + 500)|0;
|
|
HEAP32[3572] = $9;
|
|
$10 = HEAP32[3573]|0;
|
|
$11 = ($10|0)==(0);
|
|
$$0116149 = 0;
|
|
L1: while(1) {
|
|
if ($11) {
|
|
$$0116149158159 = 0;
|
|
break;
|
|
} else {
|
|
$$0119144 = 0;
|
|
}
|
|
while(1) {
|
|
$14 = (14296 + ($$0119144<<2)|0);
|
|
$15 = HEAP32[$14>>2]|0;
|
|
$16 = HEAP32[$15>>2]|0;
|
|
$17 = ($16|0)==($$0116149|0);
|
|
$13 = (($$0119144) + 1)|0;
|
|
if ($17) {
|
|
break;
|
|
}
|
|
$12 = ($13>>>0)<($10>>>0);
|
|
if ($12) {
|
|
$$0119144 = $13;
|
|
} else {
|
|
label = 6;
|
|
break L1;
|
|
}
|
|
}
|
|
$18 = (($$0116149) + 1)|0;
|
|
$19 = ($18|0)<(64);
|
|
if ($19) {
|
|
$$0116149 = $18;
|
|
} else {
|
|
label = 14;
|
|
break;
|
|
}
|
|
}
|
|
if ((label|0) == 14) {
|
|
STACKTOP = sp;return ($7|0);
|
|
}
|
|
if ((label|0) == 6) {
|
|
$20 = ($$0116149|0)==(-1);
|
|
if ($20) {
|
|
STACKTOP = sp;return ($7|0);
|
|
} else {
|
|
$$0116149158159 = $$0116149;
|
|
}
|
|
}
|
|
HEAP32[$7>>2] = $$0116149158159;
|
|
$21 = ((($7)) + 4|0);
|
|
HEAP32[$21>>2] = 1;
|
|
$22 = ((($7)) + 8|0);
|
|
$23 = $0;
|
|
$24 = $23;
|
|
$25 = HEAP32[$24>>2]|0;
|
|
$26 = (($23) + 4)|0;
|
|
$27 = $26;
|
|
$28 = HEAP32[$27>>2]|0;
|
|
$29 = $22;
|
|
$30 = $29;
|
|
HEAP32[$30>>2] = $25;
|
|
$31 = (($29) + 4)|0;
|
|
$32 = $31;
|
|
HEAP32[$32>>2] = $28;
|
|
$$sroa$049$0$$sroa_idx = ((($7)) + 16|0);
|
|
$33 = ((($7)) + 84|0);
|
|
;HEAP32[$$sroa$049$0$$sroa_idx>>2]=0|0;HEAP32[$$sroa$049$0$$sroa_idx+4>>2]=0|0;HEAP32[$$sroa$049$0$$sroa_idx+8>>2]=0|0;HEAP32[$$sroa$049$0$$sroa_idx+12>>2]=0|0;HEAP32[$$sroa$049$0$$sroa_idx+16>>2]=0|0;HEAP32[$$sroa$049$0$$sroa_idx+20>>2]=0|0;HEAP32[$$sroa$049$0$$sroa_idx+24>>2]=0|0;
|
|
HEAP32[$33>>2] = 1;
|
|
$34 = ((($7)) + 88|0);
|
|
HEAP32[$34>>2] = $7;
|
|
$35 = ((($7)) + 96|0);
|
|
_CreateRandomPolygon($4,$1,$2);
|
|
_memcpy(($35|0),($4|0),404)|0;
|
|
$36 = HEAP32[$35>>2]|0;
|
|
$37 = ($36|0)==(0);
|
|
if ($37) {
|
|
$$0121$lcssa161 = 0.0;$$0122$lcssa160 = 0.0;
|
|
} else {
|
|
$38 = ((($7)) + 100|0);
|
|
$39 = ((($5)) + 4|0);
|
|
$40 = ((($6)) + 4|0);
|
|
$$0120136 = 0;$$0121134 = 0.0;$$0122133 = 0.0;$$sroa$0$0132 = 0.0;$$sroa$8$0135 = 0.0;
|
|
while(1) {
|
|
$50 = (($38) + ($$0120136<<3)|0);
|
|
$51 = $50;
|
|
$52 = $51;
|
|
$53 = HEAP32[$52>>2]|0;
|
|
$54 = (($51) + 4)|0;
|
|
$55 = $54;
|
|
$56 = HEAP32[$55>>2]|0;
|
|
$57 = $5;
|
|
$58 = $57;
|
|
HEAP32[$58>>2] = $53;
|
|
$59 = (($57) + 4)|0;
|
|
$60 = $59;
|
|
HEAP32[$60>>2] = $56;
|
|
$61 = (($$0120136) + 1)|0;
|
|
$62 = HEAP32[$35>>2]|0;
|
|
$63 = ($61>>>0)<($62>>>0);
|
|
$64 = $63 ? $61 : 0;
|
|
$65 = (($38) + ($64<<3)|0);
|
|
$66 = $65;
|
|
$67 = $66;
|
|
$68 = HEAP32[$67>>2]|0;
|
|
$69 = (($66) + 4)|0;
|
|
$70 = $69;
|
|
$71 = HEAP32[$70>>2]|0;
|
|
$72 = $6;
|
|
$73 = $72;
|
|
HEAP32[$73>>2] = $68;
|
|
$74 = (($72) + 4)|0;
|
|
$75 = $74;
|
|
HEAP32[$75>>2] = $71;
|
|
;HEAP32[$tmpcast$byval_copy>>2]=HEAP32[$5>>2]|0;HEAP32[$tmpcast$byval_copy+4>>2]=HEAP32[$5+4>>2]|0;
|
|
;HEAP32[$tmpcast123$byval_copy>>2]=HEAP32[$6>>2]|0;HEAP32[$tmpcast123$byval_copy+4>>2]=HEAP32[$6+4>>2]|0;
|
|
$76 = (+_MathCrossVector2($tmpcast$byval_copy,$tmpcast123$byval_copy));
|
|
$77 = $76 * 0.5;
|
|
$42 = $$0122133 + $77;
|
|
$78 = $77 * 0.3333333432674408;
|
|
$79 = +HEAPF32[$5>>2];
|
|
$80 = +HEAPF32[$6>>2];
|
|
$81 = $79 + $80;
|
|
$82 = $78 * $81;
|
|
$44 = $$sroa$0$0132 + $82;
|
|
$83 = +HEAPF32[$39>>2];
|
|
$84 = +HEAPF32[$40>>2];
|
|
$85 = $83 + $84;
|
|
$86 = $78 * $85;
|
|
$46 = $$sroa$8$0135 + $86;
|
|
$87 = $79 * $79;
|
|
$88 = $79 * $80;
|
|
$89 = $87 + $88;
|
|
$90 = $80 * $80;
|
|
$91 = $90 + $89;
|
|
$92 = $83 * $83;
|
|
$93 = $83 * $84;
|
|
$94 = $92 + $93;
|
|
$95 = $84 * $84;
|
|
$96 = $95 + $94;
|
|
$97 = $76 * 0.083333335816860198;
|
|
$98 = $91 + $96;
|
|
$99 = $97 * $98;
|
|
$100 = $$0121134 + $99;
|
|
$48 = HEAP32[$35>>2]|0;
|
|
$101 = ($61>>>0)<($48>>>0);
|
|
if ($101) {
|
|
$$0120136 = $61;$$0121134 = $100;$$0122133 = $42;$$sroa$0$0132 = $44;$$sroa$8$0135 = $46;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
$41 = 1.0 / $42;
|
|
$43 = $44 * $41;
|
|
$45 = $41 * $46;
|
|
$47 = ($48|0)==(0);
|
|
if ($47) {
|
|
$$0121$lcssa161 = $100;$$0122$lcssa160 = $42;
|
|
} else {
|
|
$49 = ((($7)) + 100|0);
|
|
$$0131 = 0;
|
|
while(1) {
|
|
$123 = (($49) + ($$0131<<3)|0);
|
|
$124 = +HEAPF32[$123>>2];
|
|
$125 = $124 - $43;
|
|
HEAPF32[$123>>2] = $125;
|
|
$126 = (((($49) + ($$0131<<3)|0)) + 4|0);
|
|
$127 = +HEAPF32[$126>>2];
|
|
$128 = $127 - $45;
|
|
HEAPF32[$126>>2] = $128;
|
|
$129 = (($$0131) + 1)|0;
|
|
$exitcond = ($129|0)==($48|0);
|
|
if ($exitcond) {
|
|
$$0121$lcssa161 = $100;$$0122$lcssa160 = $42;
|
|
break;
|
|
} else {
|
|
$$0131 = $129;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
$102 = $$0122$lcssa160 * $3;
|
|
$103 = ((($7)) + 52|0);
|
|
HEAPF32[$103>>2] = $102;
|
|
$104 = $102 != 0.0;
|
|
$105 = 1.0 / $102;
|
|
$106 = $104 ? $105 : 0.0;
|
|
$107 = ((($7)) + 56|0);
|
|
HEAPF32[$107>>2] = $106;
|
|
$108 = $$0121$lcssa161 * $3;
|
|
$109 = ((($7)) + 44|0);
|
|
HEAPF32[$109>>2] = $108;
|
|
$110 = $108 != 0.0;
|
|
$111 = 1.0 / $108;
|
|
$112 = $110 ? $111 : 0.0;
|
|
$113 = ((($7)) + 48|0);
|
|
HEAPF32[$113>>2] = $112;
|
|
$114 = ((($7)) + 60|0);
|
|
HEAPF32[$114>>2] = 0.40000000596046448;
|
|
$115 = ((($7)) + 64|0);
|
|
HEAPF32[$115>>2] = 0.20000000298023224;
|
|
$116 = ((($7)) + 68|0);
|
|
HEAPF32[$116>>2] = 0.0;
|
|
$117 = ((($7)) + 72|0);
|
|
HEAP32[$117>>2] = 1;
|
|
$118 = ((($7)) + 76|0);
|
|
HEAP32[$118>>2] = 0;
|
|
$119 = ((($7)) + 80|0);
|
|
HEAP32[$119>>2] = 0;
|
|
$120 = HEAP32[3573]|0;
|
|
$121 = (14296 + ($120<<2)|0);
|
|
HEAP32[$121>>2] = $7;
|
|
$122 = (($120) + 1)|0;
|
|
HEAP32[3573] = $122;
|
|
STACKTOP = sp;return ($7|0);
|
|
}
|
|
function _MathCrossVector2($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $10 = 0.0, $2 = 0.0, $3 = 0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = +HEAPF32[$0>>2];
|
|
$3 = ((($1)) + 4|0);
|
|
$4 = +HEAPF32[$3>>2];
|
|
$5 = $2 * $4;
|
|
$6 = ((($0)) + 4|0);
|
|
$7 = +HEAPF32[$6>>2];
|
|
$8 = +HEAPF32[$1>>2];
|
|
$9 = $7 * $8;
|
|
$10 = $5 - $9;
|
|
return (+$10);
|
|
}
|
|
function _CreateRandomPolygon($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = +$1;
|
|
$2 = $2|0;
|
|
var $$02829 = 0, $$030 = 0, $$byval_copy = 0, $$byval_copy1 = 0, $$pr = 0, $$sroa$2$0$$sroa_idx1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0;
|
|
var $24 = 0.0, $25 = 0, $26 = 0.0, $27 = 0.0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0.0, $39 = 0.0, $4 = 0, $40 = 0, $41 = 0;
|
|
var $5 = 0, $6 = 0, $7 = 0, $8 = 0.0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 448|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(448|0);
|
|
$$byval_copy1 = sp + 440|0;
|
|
$$byval_copy = sp + 432|0;
|
|
$3 = sp + 24|0;
|
|
$4 = sp;
|
|
$5 = sp + 16|0;
|
|
$6 = ((($3)) + 4|0);
|
|
_memset(($6|0),0,400)|0;
|
|
HEAP32[$3>>2] = $2;
|
|
$7 = (_GetRandomNumber()|0);
|
|
$8 = (+($7|0));
|
|
$9 = ((($3)) + 388|0);
|
|
$10 = $8;
|
|
$11 = $10 * 0.017453292519943295;
|
|
$12 = $11;
|
|
_Mat2Radians($4,$12);
|
|
;HEAP32[$9>>2]=HEAP32[$4>>2]|0;HEAP32[$9+4>>2]=HEAP32[$4+4>>2]|0;HEAP32[$9+8>>2]=HEAP32[$4+8>>2]|0;HEAP32[$9+12>>2]=HEAP32[$4+12>>2]|0;
|
|
$13 = HEAP32[$3>>2]|0;
|
|
$14 = ($13|0)==(0);
|
|
if ($14) {
|
|
_memcpy(($0|0),($3|0),404)|0;
|
|
STACKTOP = sp;return;
|
|
}
|
|
$15 = (360 / ($2|0))&-1;
|
|
$16 = HEAP32[$3>>2]|0;
|
|
$$030 = 0;
|
|
while(1) {
|
|
$19 = Math_imul($15, $$030)|0;
|
|
$20 = (+($19|0));
|
|
$21 = $20 * 0.017453292519943295;
|
|
$22 = $21;
|
|
$23 = (+Math_cos((+$22)));
|
|
$24 = $23 * $1;
|
|
$25 = (((($3)) + 4|0) + ($$030<<3)|0);
|
|
HEAPF32[$25>>2] = $24;
|
|
$26 = (+Math_sin((+$22)));
|
|
$27 = $26 * $1;
|
|
$28 = (((((($3)) + 4|0) + ($$030<<3)|0)) + 4|0);
|
|
HEAPF32[$28>>2] = $27;
|
|
$29 = (($$030) + 1)|0;
|
|
$30 = ($29>>>0)<($16>>>0);
|
|
if ($30) {
|
|
$$030 = $29;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
$$pr = HEAP32[$3>>2]|0;
|
|
$17 = ($$pr|0)==(0);
|
|
if ($17) {
|
|
_memcpy(($0|0),($3|0),404)|0;
|
|
STACKTOP = sp;return;
|
|
}
|
|
$18 = ((($5)) + 4|0);
|
|
$$02829 = 0;
|
|
while(1) {
|
|
$31 = (($$02829) + 1)|0;
|
|
$32 = ($31|0)<($2|0);
|
|
$33 = $32 ? $31 : 0;
|
|
$34 = (((($3)) + 4|0) + ($33<<3)|0);
|
|
$35 = (((($3)) + 4|0) + ($$02829<<3)|0);
|
|
;HEAP32[$$byval_copy>>2]=HEAP32[$34>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$34+4>>2]|0;
|
|
;HEAP32[$$byval_copy1>>2]=HEAP32[$35>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$35+4>>2]|0;
|
|
_Vector2Subtract_4($5,$$byval_copy,$$byval_copy1);
|
|
$36 = (((($3)) + 196|0) + ($$02829<<3)|0);
|
|
$37 = HEAP32[$18>>2]|0;
|
|
$38 = +HEAPF32[$5>>2];
|
|
$39 = -$38;
|
|
HEAP32[$36>>2] = $37;
|
|
$$sroa$2$0$$sroa_idx1 = (((((($3)) + 196|0) + ($$02829<<3)|0)) + 4|0);
|
|
HEAPF32[$$sroa$2$0$$sroa_idx1>>2] = $39;
|
|
_MathNormalize($36);
|
|
$40 = HEAP32[$3>>2]|0;
|
|
$41 = ($31>>>0)<($40>>>0);
|
|
if ($41) {
|
|
$$02829 = $31;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
_memcpy(($0|0),($3|0),404)|0;
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _PhysicsAddForce($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$byval_copy = 0, $$byval_copy1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
|
|
$$byval_copy1 = sp + 16|0;
|
|
$$byval_copy = sp + 8|0;
|
|
$2 = sp;
|
|
$3 = ($0|0)==(0|0);
|
|
if ($3) {
|
|
STACKTOP = sp;return;
|
|
}
|
|
$4 = ((($0)) + 24|0);
|
|
;HEAP32[$$byval_copy>>2]=HEAP32[$4>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$4+4>>2]|0;
|
|
;HEAP32[$$byval_copy1>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$1+4>>2]|0;
|
|
_Vector2Add_2($2,$$byval_copy,$$byval_copy1);
|
|
$5 = $2;
|
|
$6 = $5;
|
|
$7 = HEAP32[$6>>2]|0;
|
|
$8 = (($5) + 4)|0;
|
|
$9 = $8;
|
|
$10 = HEAP32[$9>>2]|0;
|
|
$11 = $4;
|
|
$12 = $11;
|
|
HEAP32[$12>>2] = $7;
|
|
$13 = (($11) + 4)|0;
|
|
$14 = $13;
|
|
HEAP32[$14>>2] = $10;
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _Vector2Add_2($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0.0, $11 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0, $8 = 0.0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = +HEAPF32[$1>>2];
|
|
$4 = +HEAPF32[$2>>2];
|
|
$5 = $3 + $4;
|
|
HEAPF32[$0>>2] = $5;
|
|
$6 = ((($0)) + 4|0);
|
|
$7 = ((($1)) + 4|0);
|
|
$8 = +HEAPF32[$7>>2];
|
|
$9 = ((($2)) + 4|0);
|
|
$10 = +HEAPF32[$9>>2];
|
|
$11 = $8 + $10;
|
|
HEAPF32[$6>>2] = $11;
|
|
return;
|
|
}
|
|
function _PhysicsShatter($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = +$2;
|
|
var $$0139178 = 0, $$0142170 = 0, $$0143163 = 0, $$0144160 = 0, $$0145$lcssa = 0.0, $$0145162 = 0.0, $$0146$lcssa = 0.0, $$0146161 = 0.0, $$alloca_mul = 0, $$byval_copy8 = 0, $$sroa$0$0$$sroa_idx$promoted = 0.0, $$sroa$0110$0$$sroa_idx = 0, $$sroa$0110$0$copyload = 0.0, $$sroa$2$0$$sroa_idx35 = 0, $$sroa$2$0$$sroa_idx35$promoted = 0.0, $$sroa$237$0$$sroa_idx38 = 0, $$sroa$6$0$$sroa_idx114 = 0, $$sroa$6$0$copyload = 0.0, $10 = 0, $100 = 0;
|
|
var $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0;
|
|
var $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0;
|
|
var $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0.0, $148 = 0.0, $149 = 0.0, $15 = 0, $150 = 0.0, $151 = 0.0, $152 = 0.0, $153 = 0.0, $154 = 0.0, $155 = 0.0;
|
|
var $156 = 0.0, $157 = 0.0, $158 = 0.0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0.0, $173 = 0.0;
|
|
var $174 = 0, $175 = 0, $176 = 0.0, $177 = 0.0, $178 = 0.0, $179 = 0, $18 = 0, $180 = 0, $181 = 0.0, $182 = 0, $183 = 0, $184 = 0, $185 = 0.0, $186 = 0.0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0;
|
|
var $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0.0, $20 = 0, $200 = 0.0, $201 = 0.0, $202 = 0.0, $203 = 0.0, $204 = 0.0, $205 = 0.0, $206 = 0.0, $207 = 0, $208 = 0, $209 = 0, $21 = 0;
|
|
var $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0;
|
|
var $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0.0, $234 = 0.0, $235 = 0.0, $236 = 0.0, $237 = 0.0, $238 = 0.0, $239 = 0.0, $24 = 0, $240 = 0.0, $241 = 0.0, $242 = 0.0, $243 = 0.0, $244 = 0.0, $245 = 0.0, $246 = 0.0;
|
|
var $247 = 0.0, $248 = 0.0, $249 = 0.0, $25 = 0, $250 = 0.0, $251 = 0.0, $252 = 0.0, $253 = 0.0, $254 = 0.0, $255 = 0.0, $256 = 0.0, $257 = 0.0, $258 = 0.0, $259 = 0.0, $26 = 0, $260 = 0.0, $261 = 0.0, $262 = 0.0, $263 = 0.0, $264 = 0.0;
|
|
var $265 = 0, $266 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0.0, $4 = 0, $40 = 0.0, $41 = 0.0, $42 = 0.0;
|
|
var $43 = 0.0, $44 = 0.0, $45 = 0.0, $46 = 0.0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0, $50 = 0.0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0.0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0.0;
|
|
var $61 = 0.0, $62 = 0, $63 = 0.0, $64 = 0.0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0;
|
|
var $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0;
|
|
var $98 = 0, $99 = 0, $exitcond = 0, $scevgep = 0, $tmpcast153$byval_copy = 0, $tmpcast154$byval_copy = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 976|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(976|0);
|
|
$tmpcast154$byval_copy = sp + 968|0;
|
|
$tmpcast153$byval_copy = sp + 952|0;
|
|
$$byval_copy8 = sp + 904|0;
|
|
$3 = sp + 496|0;
|
|
$4 = sp + 944|0;
|
|
$5 = sp + 24|0;
|
|
$6 = sp + 936|0;
|
|
$7 = sp + 480|0;
|
|
$8 = sp + 16|0;
|
|
$9 = sp + 928|0;
|
|
$10 = sp + 56|0;
|
|
$11 = sp + 72|0;
|
|
$12 = sp + 48|0;
|
|
$13 = sp + 40|0;
|
|
$14 = sp + 32|0;
|
|
$15 = sp + 8|0;
|
|
$16 = sp;
|
|
$17 = sp + 64|0;
|
|
$18 = sp + 920|0;
|
|
$19 = sp + 912|0;
|
|
$20 = ($0|0)==(0|0);
|
|
if ($20) {
|
|
STACKTOP = sp;return;
|
|
}
|
|
$21 = ((($0)) + 84|0);
|
|
$22 = HEAP32[$21>>2]|0;
|
|
$23 = ($22|0)==(1);
|
|
if (!($23)) {
|
|
STACKTOP = sp;return;
|
|
}
|
|
$24 = ((($0)) + 96|0);
|
|
_memcpy(($3|0),($24|0),404)|0;
|
|
$25 = HEAP32[$3>>2]|0;
|
|
$26 = ($25|0)==(0);
|
|
L7: do {
|
|
if (!($26)) {
|
|
$$sroa$0110$0$$sroa_idx = ((($0)) + 8|0);
|
|
$$sroa$6$0$$sroa_idx114 = ((($0)) + 12|0);
|
|
$27 = ((($3)) + 388|0);
|
|
$28 = ((($0)) + 8|0);
|
|
$29 = ((($$byval_copy8)) + 4|0);
|
|
$30 = ((($5)) + 4|0);
|
|
$31 = +HEAPF32[$1>>2];
|
|
$32 = ((($1)) + 4|0);
|
|
$$0139178 = 0;
|
|
while(1) {
|
|
$$sroa$0110$0$copyload = +HEAPF32[$$sroa$0110$0$$sroa_idx>>2];
|
|
$$sroa$6$0$copyload = +HEAPF32[$$sroa$6$0$$sroa_idx114>>2];
|
|
$33 = (((($3)) + 4|0) + ($$0139178<<3)|0);
|
|
;HEAP32[$tmpcast153$byval_copy>>2]=HEAP32[$28>>2]|0;HEAP32[$tmpcast153$byval_copy+4>>2]=HEAP32[$28+4>>2]|0;
|
|
;HEAP32[$tmpcast154$byval_copy>>2]=HEAP32[$33>>2]|0;HEAP32[$tmpcast154$byval_copy+4>>2]=HEAP32[$33+4>>2]|0;
|
|
_Vector2Add_2($4,$tmpcast153$byval_copy,$tmpcast154$byval_copy);
|
|
;HEAP32[$tmpcast153$byval_copy>>2]=HEAP32[$27>>2]|0;HEAP32[$tmpcast153$byval_copy+4>>2]=HEAP32[$27+4>>2]|0;HEAP32[$tmpcast153$byval_copy+8>>2]=HEAP32[$27+8>>2]|0;HEAP32[$tmpcast153$byval_copy+12>>2]=HEAP32[$27+12>>2]|0;
|
|
;HEAP32[$tmpcast154$byval_copy>>2]=HEAP32[$4>>2]|0;HEAP32[$tmpcast154$byval_copy+4>>2]=HEAP32[$4+4>>2]|0;
|
|
_Mat2MultiplyVector2($$byval_copy8,$tmpcast153$byval_copy,$tmpcast154$byval_copy);
|
|
$34 = (($$0139178) + 1)|0;
|
|
$35 = HEAP32[$3>>2]|0;
|
|
$36 = ($34>>>0)<($35>>>0);
|
|
$37 = $36 ? $34 : 0;
|
|
$38 = (((($3)) + 4|0) + ($37<<3)|0);
|
|
;HEAP32[$tmpcast153$byval_copy>>2]=HEAP32[$28>>2]|0;HEAP32[$tmpcast153$byval_copy+4>>2]=HEAP32[$28+4>>2]|0;
|
|
;HEAP32[$tmpcast154$byval_copy>>2]=HEAP32[$38>>2]|0;HEAP32[$tmpcast154$byval_copy+4>>2]=HEAP32[$38+4>>2]|0;
|
|
_Vector2Add_2($6,$tmpcast153$byval_copy,$tmpcast154$byval_copy);
|
|
;HEAP32[$tmpcast153$byval_copy>>2]=HEAP32[$27>>2]|0;HEAP32[$tmpcast153$byval_copy+4>>2]=HEAP32[$27+4>>2]|0;HEAP32[$tmpcast153$byval_copy+8>>2]=HEAP32[$27+8>>2]|0;HEAP32[$tmpcast153$byval_copy+12>>2]=HEAP32[$27+12>>2]|0;
|
|
;HEAP32[$tmpcast154$byval_copy>>2]=HEAP32[$6>>2]|0;HEAP32[$tmpcast154$byval_copy+4>>2]=HEAP32[$6+4>>2]|0;
|
|
_Mat2MultiplyVector2($5,$tmpcast153$byval_copy,$tmpcast154$byval_copy);
|
|
$39 = +HEAPF32[$29>>2];
|
|
$40 = +HEAPF32[$30>>2];
|
|
$41 = $39 - $40;
|
|
$42 = +HEAPF32[$5>>2];
|
|
$43 = $31 - $42;
|
|
$44 = $41 * $43;
|
|
$45 = +HEAPF32[$$byval_copy8>>2];
|
|
$46 = $42 - $45;
|
|
$47 = +HEAPF32[$32>>2];
|
|
$48 = $47 - $40;
|
|
$49 = $46 * $48;
|
|
$50 = $44 + $49;
|
|
$51 = $$sroa$0110$0$copyload - $42;
|
|
$52 = $41 * $51;
|
|
$53 = $$sroa$6$0$copyload - $40;
|
|
$54 = $53 * $46;
|
|
$55 = $52 + $54;
|
|
$56 = $50 / $55;
|
|
$57 = $40 - $$sroa$6$0$copyload;
|
|
$58 = $57 * $43;
|
|
$59 = $51 * $48;
|
|
$60 = $58 + $59;
|
|
$61 = $60 / $55;
|
|
$62 = $56 > 0.0;
|
|
if ($62) {
|
|
$63 = 1.0 - $56;
|
|
$64 = $63 - $61;
|
|
$65 = $61 > 0.0;
|
|
$66 = $64 > 0.0;
|
|
$67 = $65 & $66;
|
|
if ($67) {
|
|
break;
|
|
}
|
|
}
|
|
$68 = HEAP32[$3>>2]|0;
|
|
$69 = ($34>>>0)<($68>>>0);
|
|
if ($69) {
|
|
$$0139178 = $34;
|
|
} else {
|
|
break L7;
|
|
}
|
|
}
|
|
$70 = HEAP32[$3>>2]|0;
|
|
$71 = ((($0)) + 8|0);
|
|
$72 = $71;
|
|
$73 = $72;
|
|
$74 = HEAP32[$73>>2]|0;
|
|
$75 = (($72) + 4)|0;
|
|
$76 = $75;
|
|
$77 = HEAP32[$76>>2]|0;
|
|
$78 = $5;
|
|
$79 = $78;
|
|
HEAP32[$79>>2] = $74;
|
|
$80 = (($78) + 4)|0;
|
|
$81 = $80;
|
|
HEAP32[$81>>2] = $77;
|
|
$82 = (_llvm_stacksave()|0);
|
|
$$alloca_mul = $70<<3;
|
|
$83 = STACKTOP; STACKTOP = STACKTOP + ((((1*$$alloca_mul)|0)+15)&-16)|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(((((1*$$alloca_mul)|0)+15)&-16)|0);;
|
|
$84 = ((($3)) + 388|0);
|
|
;HEAP32[$7>>2]=HEAP32[$84>>2]|0;HEAP32[$7+4>>2]=HEAP32[$84+4>>2]|0;HEAP32[$7+8>>2]=HEAP32[$84+8>>2]|0;HEAP32[$7+12>>2]=HEAP32[$84+12>>2]|0;
|
|
$85 = ($70|0)>(0);
|
|
if ($85) {
|
|
$scevgep = ((($3)) + 4|0);
|
|
$86 = $70 << 3;
|
|
_memcpy(($83|0),($scevgep|0),($86|0))|0;
|
|
_DestroyPhysicsBody($0);
|
|
$87 = ((($9)) + 4|0);
|
|
$88 = ((($11)) + 388|0);
|
|
$89 = ((($11)) + 4|0);
|
|
$90 = ((($11)) + 12|0);
|
|
$91 = ((($11)) + 20|0);
|
|
$92 = ((($11)) + 8|0);
|
|
$93 = ((($11)) + 16|0);
|
|
$94 = ((($11)) + 24|0);
|
|
$$sroa$2$0$$sroa_idx35 = ((($8)) + 4|0);
|
|
$95 = ((($16)) + 4|0);
|
|
$96 = ((($17)) + 4|0);
|
|
$97 = ((($15)) + 4|0);
|
|
$98 = ((($16)) + 4|0);
|
|
$99 = ((($15)) + 4|0);
|
|
$100 = ((($11)) + 28|0);
|
|
$$0142170 = 0;
|
|
while(1) {
|
|
$101 = (($$0142170) + 1)|0;
|
|
$102 = ($101|0)<($70|0);
|
|
$103 = $102 ? $101 : 0;
|
|
$104 = (($83) + ($$0142170<<3)|0);
|
|
$105 = (($83) + ($103<<3)|0);
|
|
HEAPF32[$9>>2] = 0.0;
|
|
HEAPF32[$87>>2] = 0.0;
|
|
;HEAP32[$$byval_copy8>>2]=HEAP32[$104>>2]|0;HEAP32[$$byval_copy8+4>>2]=HEAP32[$104+4>>2]|0;
|
|
;HEAP32[$tmpcast153$byval_copy>>2]=HEAP32[$105>>2]|0;HEAP32[$tmpcast153$byval_copy+4>>2]=HEAP32[$105+4>>2]|0;
|
|
;HEAP32[$tmpcast154$byval_copy>>2]=HEAP32[$9>>2]|0;HEAP32[$tmpcast154$byval_copy+4>>2]=HEAP32[$9+4>>2]|0;
|
|
_TriangleBarycenter($8,$$byval_copy8,$tmpcast153$byval_copy,$tmpcast154$byval_copy);
|
|
;HEAP32[$tmpcast153$byval_copy>>2]=HEAP32[$5>>2]|0;HEAP32[$tmpcast153$byval_copy+4>>2]=HEAP32[$5+4>>2]|0;
|
|
;HEAP32[$tmpcast154$byval_copy>>2]=HEAP32[$8>>2]|0;HEAP32[$tmpcast154$byval_copy+4>>2]=HEAP32[$8+4>>2]|0;
|
|
_Vector2Add_2($10,$tmpcast153$byval_copy,$tmpcast154$byval_copy);
|
|
$106 = $10;
|
|
$107 = $106;
|
|
$108 = HEAP32[$107>>2]|0;
|
|
$109 = (($106) + 4)|0;
|
|
$110 = $109;
|
|
$111 = HEAP32[$110>>2]|0;
|
|
$112 = $8;
|
|
$113 = $112;
|
|
HEAP32[$113>>2] = $108;
|
|
$114 = (($112) + 4)|0;
|
|
$115 = $114;
|
|
HEAP32[$115>>2] = $111;
|
|
;HEAP32[$tmpcast153$byval_copy>>2]=HEAP32[$8>>2]|0;HEAP32[$tmpcast153$byval_copy+4>>2]=HEAP32[$8+4>>2]|0;
|
|
;HEAP32[$tmpcast154$byval_copy>>2]=HEAP32[$5>>2]|0;HEAP32[$tmpcast154$byval_copy+4>>2]=HEAP32[$5+4>>2]|0;
|
|
_Vector2Subtract_4($$byval_copy8,$tmpcast153$byval_copy,$tmpcast154$byval_copy);
|
|
;HEAP32[$tmpcast154$byval_copy>>2]=HEAP32[$8>>2]|0;HEAP32[$tmpcast154$byval_copy+4>>2]=HEAP32[$8+4>>2]|0;
|
|
$116 = (_CreatePhysicsBodyPolygon($tmpcast154$byval_copy,10.0,3,10.0)|0);
|
|
_memset(($100|0),0,360)|0;
|
|
HEAP32[$11>>2] = 3;
|
|
;HEAP32[$88>>2]=HEAP32[$7>>2]|0;HEAP32[$88+4>>2]=HEAP32[$7+4>>2]|0;HEAP32[$88+8>>2]=HEAP32[$7+8>>2]|0;HEAP32[$88+12>>2]=HEAP32[$7+12>>2]|0;
|
|
;HEAP32[$tmpcast153$byval_copy>>2]=HEAP32[$104>>2]|0;HEAP32[$tmpcast153$byval_copy+4>>2]=HEAP32[$104+4>>2]|0;
|
|
;HEAP32[$tmpcast154$byval_copy>>2]=HEAP32[$$byval_copy8>>2]|0;HEAP32[$tmpcast154$byval_copy+4>>2]=HEAP32[$$byval_copy8+4>>2]|0;
|
|
_Vector2Subtract_4($12,$tmpcast153$byval_copy,$tmpcast154$byval_copy);
|
|
$117 = $12;
|
|
$118 = $117;
|
|
$119 = HEAP32[$118>>2]|0;
|
|
$120 = (($117) + 4)|0;
|
|
$121 = $120;
|
|
$122 = HEAP32[$121>>2]|0;
|
|
$123 = $89;
|
|
$124 = $123;
|
|
HEAP32[$124>>2] = $119;
|
|
$125 = (($123) + 4)|0;
|
|
$126 = $125;
|
|
HEAP32[$126>>2] = $122;
|
|
;HEAP32[$tmpcast153$byval_copy>>2]=HEAP32[$105>>2]|0;HEAP32[$tmpcast153$byval_copy+4>>2]=HEAP32[$105+4>>2]|0;
|
|
;HEAP32[$tmpcast154$byval_copy>>2]=HEAP32[$$byval_copy8>>2]|0;HEAP32[$tmpcast154$byval_copy+4>>2]=HEAP32[$$byval_copy8+4>>2]|0;
|
|
_Vector2Subtract_4($13,$tmpcast153$byval_copy,$tmpcast154$byval_copy);
|
|
$127 = $13;
|
|
$128 = $127;
|
|
$129 = HEAP32[$128>>2]|0;
|
|
$130 = (($127) + 4)|0;
|
|
$131 = $130;
|
|
$132 = HEAP32[$131>>2]|0;
|
|
$133 = $90;
|
|
$134 = $133;
|
|
HEAP32[$134>>2] = $129;
|
|
$135 = (($133) + 4)|0;
|
|
$136 = $135;
|
|
HEAP32[$136>>2] = $132;
|
|
;HEAP32[$tmpcast153$byval_copy>>2]=HEAP32[$1>>2]|0;HEAP32[$tmpcast153$byval_copy+4>>2]=HEAP32[$1+4>>2]|0;
|
|
;HEAP32[$tmpcast154$byval_copy>>2]=HEAP32[$8>>2]|0;HEAP32[$tmpcast154$byval_copy+4>>2]=HEAP32[$8+4>>2]|0;
|
|
_Vector2Subtract_4($14,$tmpcast153$byval_copy,$tmpcast154$byval_copy);
|
|
$137 = $14;
|
|
$138 = $137;
|
|
$139 = HEAP32[$138>>2]|0;
|
|
$140 = (($137) + 4)|0;
|
|
$141 = $140;
|
|
$142 = HEAP32[$141>>2]|0;
|
|
$143 = $91;
|
|
$144 = $143;
|
|
HEAP32[$144>>2] = $139;
|
|
$145 = (($143) + 4)|0;
|
|
$146 = $145;
|
|
HEAP32[$146>>2] = $142;
|
|
$147 = +HEAPF32[$89>>2];
|
|
$148 = $147 * 0.94999998807907104;
|
|
HEAPF32[$89>>2] = $148;
|
|
$149 = +HEAPF32[$92>>2];
|
|
$150 = $149 * 0.94999998807907104;
|
|
HEAPF32[$92>>2] = $150;
|
|
$151 = +HEAPF32[$90>>2];
|
|
$152 = $151 * 0.94999998807907104;
|
|
HEAPF32[$90>>2] = $152;
|
|
$153 = +HEAPF32[$93>>2];
|
|
$154 = $153 * 0.94999998807907104;
|
|
HEAPF32[$93>>2] = $154;
|
|
$155 = +HEAPF32[$91>>2];
|
|
$156 = $155 * 0.94999998807907104;
|
|
HEAPF32[$91>>2] = $156;
|
|
$157 = +HEAPF32[$94>>2];
|
|
$158 = $157 * 0.94999998807907104;
|
|
HEAPF32[$94>>2] = $158;
|
|
$159 = HEAP32[$11>>2]|0;
|
|
$160 = ($159|0)==(0);
|
|
if (!($160)) {
|
|
$$0144160 = 0;$166 = $159;
|
|
while(1) {
|
|
$164 = (($$0144160) + 1)|0;
|
|
$165 = ($164>>>0)<($166>>>0);
|
|
$167 = $165 ? $164 : 0;
|
|
$168 = (((($11)) + 4|0) + ($167<<3)|0);
|
|
$169 = (((($11)) + 4|0) + ($$0144160<<3)|0);
|
|
;HEAP32[$tmpcast153$byval_copy>>2]=HEAP32[$168>>2]|0;HEAP32[$tmpcast153$byval_copy+4>>2]=HEAP32[$168+4>>2]|0;
|
|
;HEAP32[$tmpcast154$byval_copy>>2]=HEAP32[$169>>2]|0;HEAP32[$tmpcast154$byval_copy+4>>2]=HEAP32[$169+4>>2]|0;
|
|
_Vector2Subtract_4($15,$tmpcast153$byval_copy,$tmpcast154$byval_copy);
|
|
$170 = (((($11)) + 196|0) + ($$0144160<<3)|0);
|
|
$171 = HEAP32[$99>>2]|0;
|
|
$172 = +HEAPF32[$15>>2];
|
|
$173 = -$172;
|
|
HEAP32[$170>>2] = $171;
|
|
$$sroa$237$0$$sroa_idx38 = (((((($11)) + 196|0) + ($$0144160<<3)|0)) + 4|0);
|
|
HEAPF32[$$sroa$237$0$$sroa_idx38>>2] = $173;
|
|
_MathNormalize($170);
|
|
$174 = HEAP32[$11>>2]|0;
|
|
$175 = ($164>>>0)<($174>>>0);
|
|
if ($175) {
|
|
$$0144160 = $164;$166 = $174;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
$161 = ((($116)) + 96|0);
|
|
_memcpy(($161|0),($11|0),404)|0;
|
|
HEAPF32[$8>>2] = 0.0;
|
|
HEAPF32[$$sroa$2$0$$sroa_idx35>>2] = 0.0;
|
|
$162 = HEAP32[$161>>2]|0;
|
|
$163 = ($162|0)==(0);
|
|
if ($163) {
|
|
$$0145$lcssa = 0.0;$$0146$lcssa = 0.0;
|
|
} else {
|
|
$$sroa$0$0$$sroa_idx$promoted = +HEAPF32[$8>>2];
|
|
$$sroa$2$0$$sroa_idx35$promoted = +HEAPF32[$$sroa$2$0$$sroa_idx35>>2];
|
|
$$0143163 = 0;$$0145162 = 0.0;$$0146161 = 0.0;$241 = $$sroa$0$0$$sroa_idx$promoted;$246 = $$sroa$2$0$$sroa_idx35$promoted;
|
|
while(1) {
|
|
$207 = (((($116)) + 100|0) + ($$0143163<<3)|0);
|
|
$208 = $207;
|
|
$209 = $208;
|
|
$210 = HEAP32[$209>>2]|0;
|
|
$211 = (($208) + 4)|0;
|
|
$212 = $211;
|
|
$213 = HEAP32[$212>>2]|0;
|
|
$214 = $15;
|
|
$215 = $214;
|
|
HEAP32[$215>>2] = $210;
|
|
$216 = (($214) + 4)|0;
|
|
$217 = $216;
|
|
HEAP32[$217>>2] = $213;
|
|
$218 = (($$0143163) + 1)|0;
|
|
$219 = HEAP32[$161>>2]|0;
|
|
$220 = ($218>>>0)<($219>>>0);
|
|
$221 = $220 ? $218 : 0;
|
|
$222 = (((($116)) + 100|0) + ($221<<3)|0);
|
|
$223 = $222;
|
|
$224 = $223;
|
|
$225 = HEAP32[$224>>2]|0;
|
|
$226 = (($223) + 4)|0;
|
|
$227 = $226;
|
|
$228 = HEAP32[$227>>2]|0;
|
|
$229 = $16;
|
|
$230 = $229;
|
|
HEAP32[$230>>2] = $225;
|
|
$231 = (($229) + 4)|0;
|
|
$232 = $231;
|
|
HEAP32[$232>>2] = $228;
|
|
;HEAP32[$tmpcast153$byval_copy>>2]=HEAP32[$15>>2]|0;HEAP32[$tmpcast153$byval_copy+4>>2]=HEAP32[$15+4>>2]|0;
|
|
;HEAP32[$tmpcast154$byval_copy>>2]=HEAP32[$16>>2]|0;HEAP32[$tmpcast154$byval_copy+4>>2]=HEAP32[$16+4>>2]|0;
|
|
$233 = (+_MathCrossVector2($tmpcast153$byval_copy,$tmpcast154$byval_copy));
|
|
$234 = $233 * 0.5;
|
|
$235 = $$0146161 + $234;
|
|
$236 = $234 * 0.3333333432674408;
|
|
$237 = +HEAPF32[$15>>2];
|
|
$238 = +HEAPF32[$16>>2];
|
|
$239 = $237 + $238;
|
|
$240 = $236 * $239;
|
|
$176 = $241 + $240;
|
|
$242 = +HEAPF32[$97>>2];
|
|
$243 = +HEAPF32[$98>>2];
|
|
$244 = $242 + $243;
|
|
$245 = $236 * $244;
|
|
$177 = $246 + $245;
|
|
$247 = +HEAPF32[$15>>2];
|
|
$248 = $247 * $247;
|
|
$249 = +HEAPF32[$16>>2];
|
|
$250 = $247 * $249;
|
|
$251 = $248 + $250;
|
|
$252 = $249 * $249;
|
|
$253 = $252 + $251;
|
|
$254 = +HEAPF32[$97>>2];
|
|
$255 = $254 * $254;
|
|
$256 = +HEAPF32[$98>>2];
|
|
$257 = $254 * $256;
|
|
$258 = $255 + $257;
|
|
$259 = $256 * $256;
|
|
$260 = $259 + $258;
|
|
$261 = $233 * 0.083333335816860198;
|
|
$262 = $253 + $260;
|
|
$263 = $261 * $262;
|
|
$264 = $$0145162 + $263;
|
|
$265 = HEAP32[$161>>2]|0;
|
|
$266 = ($218>>>0)<($265>>>0);
|
|
if ($266) {
|
|
$$0143163 = $218;$$0145162 = $264;$$0146161 = $235;$241 = $176;$246 = $177;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
HEAPF32[$8>>2] = $176;
|
|
HEAPF32[$$sroa$2$0$$sroa_idx35>>2] = $177;
|
|
$$0145$lcssa = $264;$$0146$lcssa = $235;
|
|
}
|
|
$178 = 1.0 / $$0146$lcssa;
|
|
$179 = ((($116)) + 52|0);
|
|
HEAPF32[$179>>2] = $$0146$lcssa;
|
|
$180 = $$0146$lcssa != 0.0;
|
|
$181 = $180 ? $178 : 0.0;
|
|
$182 = ((($116)) + 56|0);
|
|
HEAPF32[$182>>2] = $181;
|
|
$183 = ((($116)) + 44|0);
|
|
HEAPF32[$183>>2] = $$0145$lcssa;
|
|
$184 = $$0145$lcssa != 0.0;
|
|
$185 = 1.0 / $$0145$lcssa;
|
|
$186 = $184 ? $185 : 0.0;
|
|
$187 = ((($116)) + 48|0);
|
|
HEAPF32[$187>>2] = $186;
|
|
$188 = ((($116)) + 8|0);
|
|
$189 = $188;
|
|
$190 = $189;
|
|
$191 = HEAP32[$190>>2]|0;
|
|
$192 = (($189) + 4)|0;
|
|
$193 = $192;
|
|
$194 = HEAP32[$193>>2]|0;
|
|
$195 = $15;
|
|
$196 = $195;
|
|
HEAP32[$196>>2] = $191;
|
|
$197 = (($195) + 4)|0;
|
|
$198 = $197;
|
|
HEAP32[$198>>2] = $194;
|
|
;HEAP32[$tmpcast153$byval_copy>>2]=HEAP32[$90>>2]|0;HEAP32[$tmpcast153$byval_copy+4>>2]=HEAP32[$90+4>>2]|0;
|
|
;HEAP32[$tmpcast154$byval_copy>>2]=HEAP32[$89>>2]|0;HEAP32[$tmpcast154$byval_copy+4>>2]=HEAP32[$89+4>>2]|0;
|
|
_Vector2Subtract_4($16,$tmpcast153$byval_copy,$tmpcast154$byval_copy);
|
|
$199 = +HEAPF32[$16>>2];
|
|
$200 = $199 * 0.5;
|
|
HEAPF32[$16>>2] = $200;
|
|
$201 = +HEAPF32[$95>>2];
|
|
$202 = $201 * 0.5;
|
|
HEAPF32[$95>>2] = $202;
|
|
;HEAP32[$tmpcast153$byval_copy>>2]=HEAP32[$89>>2]|0;HEAP32[$tmpcast153$byval_copy+4>>2]=HEAP32[$89+4>>2]|0;
|
|
;HEAP32[$tmpcast154$byval_copy>>2]=HEAP32[$16>>2]|0;HEAP32[$tmpcast154$byval_copy+4>>2]=HEAP32[$16+4>>2]|0;
|
|
_Vector2Add_2($19,$tmpcast153$byval_copy,$tmpcast154$byval_copy);
|
|
;HEAP32[$tmpcast153$byval_copy>>2]=HEAP32[$15>>2]|0;HEAP32[$tmpcast153$byval_copy+4>>2]=HEAP32[$15+4>>2]|0;
|
|
;HEAP32[$tmpcast154$byval_copy>>2]=HEAP32[$19>>2]|0;HEAP32[$tmpcast154$byval_copy+4>>2]=HEAP32[$19+4>>2]|0;
|
|
_Vector2Add_2($18,$tmpcast153$byval_copy,$tmpcast154$byval_copy);
|
|
;HEAP32[$tmpcast153$byval_copy>>2]=HEAP32[$18>>2]|0;HEAP32[$tmpcast153$byval_copy+4>>2]=HEAP32[$18+4>>2]|0;
|
|
;HEAP32[$tmpcast154$byval_copy>>2]=HEAP32[$188>>2]|0;HEAP32[$tmpcast154$byval_copy+4>>2]=HEAP32[$188+4>>2]|0;
|
|
_Vector2Subtract_4($17,$tmpcast153$byval_copy,$tmpcast154$byval_copy);
|
|
_MathNormalize($17);
|
|
$203 = +HEAPF32[$17>>2];
|
|
$204 = $203 * $2;
|
|
HEAPF32[$17>>2] = $204;
|
|
$205 = +HEAPF32[$96>>2];
|
|
$206 = $205 * $2;
|
|
HEAPF32[$96>>2] = $206;
|
|
;HEAP32[$tmpcast154$byval_copy>>2]=HEAP32[$17>>2]|0;HEAP32[$tmpcast154$byval_copy+4>>2]=HEAP32[$17+4>>2]|0;
|
|
_PhysicsAddForce($116,$tmpcast154$byval_copy);
|
|
$exitcond = ($101|0)==($70|0);
|
|
if ($exitcond) {
|
|
break;
|
|
} else {
|
|
$$0142170 = $101;
|
|
}
|
|
}
|
|
} else {
|
|
_DestroyPhysicsBody($0);
|
|
}
|
|
_llvm_stackrestore(($82|0));
|
|
}
|
|
} while(0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _Mat2MultiplyVector2($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0.0, $11 = 0.0, $12 = 0, $13 = 0, $14 = 0.0, $15 = 0.0, $16 = 0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0, $9 = 0.0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = +HEAPF32[$1>>2];
|
|
$4 = +HEAPF32[$2>>2];
|
|
$5 = $3 * $4;
|
|
$6 = ((($1)) + 4|0);
|
|
$7 = +HEAPF32[$6>>2];
|
|
$8 = ((($2)) + 4|0);
|
|
$9 = +HEAPF32[$8>>2];
|
|
$10 = $7 * $9;
|
|
$11 = $5 + $10;
|
|
HEAPF32[$0>>2] = $11;
|
|
$12 = ((($0)) + 4|0);
|
|
$13 = ((($1)) + 8|0);
|
|
$14 = +HEAPF32[$13>>2];
|
|
$15 = $4 * $14;
|
|
$16 = ((($1)) + 12|0);
|
|
$17 = +HEAPF32[$16>>2];
|
|
$18 = $9 * $17;
|
|
$19 = $15 + $18;
|
|
HEAPF32[$12>>2] = $19;
|
|
return;
|
|
}
|
|
function _DestroyPhysicsBody($0) {
|
|
$0 = $0|0;
|
|
var $$02023 = 0, $$021 = 0, $$022 = 0, $$lcssa = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
|
|
var $24 = 0, $25 = 0, $26 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = ($0|0)==(0|0);
|
|
if ($1) {
|
|
return;
|
|
}
|
|
$2 = HEAP32[$0>>2]|0;
|
|
$3 = HEAP32[3573]|0;
|
|
$4 = ($3|0)==(0);
|
|
L4: do {
|
|
if ($4) {
|
|
$$021 = -1;
|
|
} else {
|
|
$5 = HEAP32[3573]|0;
|
|
$$02023 = 0;
|
|
while(1) {
|
|
$6 = (14296 + ($$02023<<2)|0);
|
|
$7 = HEAP32[$6>>2]|0;
|
|
$8 = HEAP32[$7>>2]|0;
|
|
$9 = ($8|0)==($2|0);
|
|
if ($9) {
|
|
$$021 = $$02023;
|
|
break L4;
|
|
}
|
|
$10 = (($$02023) + 1)|0;
|
|
$11 = ($10>>>0)<($5>>>0);
|
|
if ($11) {
|
|
$$02023 = $10;
|
|
} else {
|
|
$$021 = -1;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$12 = (14296 + ($$021<<2)|0);
|
|
$13 = HEAP32[$12>>2]|0;
|
|
_free($13);
|
|
$14 = HEAP32[3572]|0;
|
|
$15 = (($14) + -500)|0;
|
|
HEAP32[3572] = $15;
|
|
HEAP32[$12>>2] = 0;
|
|
$16 = HEAP32[3573]|0;
|
|
$17 = ($$021>>>0)<($16>>>0);
|
|
if ($17) {
|
|
$18 = HEAP32[3573]|0;
|
|
$$022 = $$021;$22 = $16;
|
|
while(1) {
|
|
$20 = (($$022) + 1)|0;
|
|
$21 = ($20>>>0)<($22>>>0);
|
|
if ($21) {
|
|
$24 = (14296 + ($$022<<2)|0);
|
|
$25 = (14296 + ($20<<2)|0);
|
|
$26 = HEAP32[$25>>2]|0;
|
|
HEAP32[$24>>2] = $26;
|
|
}
|
|
$23 = ($20>>>0)<($18>>>0);
|
|
if ($23) {
|
|
$$022 = $20;$22 = $18;
|
|
} else {
|
|
$$lcssa = $18;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$lcssa = $16;
|
|
}
|
|
$19 = (($$lcssa) + -1)|0;
|
|
HEAP32[3573] = $19;
|
|
return;
|
|
}
|
|
function _TriangleBarycenter($0,$1,$2,$3) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
var $$sroa$5$0$$sroa_idx2 = 0, $10 = 0, $11 = 0.0, $12 = 0, $13 = 0.0, $14 = 0.0, $15 = 0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$4 = +HEAPF32[$1>>2];
|
|
$5 = +HEAPF32[$2>>2];
|
|
$6 = $4 + $5;
|
|
$7 = +HEAPF32[$3>>2];
|
|
$8 = $6 + $7;
|
|
$9 = $8 / 3.0;
|
|
$10 = ((($1)) + 4|0);
|
|
$11 = +HEAPF32[$10>>2];
|
|
$12 = ((($2)) + 4|0);
|
|
$13 = +HEAPF32[$12>>2];
|
|
$14 = $11 + $13;
|
|
$15 = ((($3)) + 4|0);
|
|
$16 = +HEAPF32[$15>>2];
|
|
$17 = $14 + $16;
|
|
$18 = $17 / 3.0;
|
|
HEAPF32[$0>>2] = $9;
|
|
$$sroa$5$0$$sroa_idx2 = ((($0)) + 4|0);
|
|
HEAPF32[$$sroa$5$0$$sroa_idx2>>2] = $18;
|
|
return;
|
|
}
|
|
function _Vector2Subtract_4($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0.0, $11 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0, $8 = 0.0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = +HEAPF32[$1>>2];
|
|
$4 = +HEAPF32[$2>>2];
|
|
$5 = $3 - $4;
|
|
HEAPF32[$0>>2] = $5;
|
|
$6 = ((($0)) + 4|0);
|
|
$7 = ((($1)) + 4|0);
|
|
$8 = +HEAPF32[$7>>2];
|
|
$9 = ((($2)) + 4|0);
|
|
$10 = +HEAPF32[$9>>2];
|
|
$11 = $8 - $10;
|
|
HEAPF32[$6>>2] = $11;
|
|
return;
|
|
}
|
|
function _MathNormalize($0) {
|
|
$0 = $0|0;
|
|
var $$op = 0.0, $$sroa$0$0$copyload = 0.0, $$sroa$5$0$$sroa_idx3 = 0, $$sroa$5$0$copyload = 0.0, $1 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0.0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$$sroa$0$0$copyload = +HEAPF32[$0>>2];
|
|
$$sroa$5$0$$sroa_idx3 = ((($0)) + 4|0);
|
|
$$sroa$5$0$copyload = +HEAPF32[$$sroa$5$0$$sroa_idx3>>2];
|
|
$1 = $$sroa$0$0$copyload * $$sroa$0$0$copyload;
|
|
$2 = $$sroa$5$0$copyload * $$sroa$5$0$copyload;
|
|
$3 = $1 + $2;
|
|
$4 = (+Math_sqrt((+$3)));
|
|
$5 = $4 == 0.0;
|
|
$$op = 1.0 / $4;
|
|
$6 = $5 ? 1.0 : $$op;
|
|
$7 = $$sroa$0$0$copyload * $6;
|
|
HEAPF32[$0>>2] = $7;
|
|
$8 = $$sroa$5$0$copyload * $6;
|
|
HEAPF32[$$sroa$5$0$$sroa_idx3>>2] = $8;
|
|
return;
|
|
}
|
|
function _GetPhysicsBodiesCount() {
|
|
var $0 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$0 = HEAP32[3573]|0;
|
|
return ($0|0);
|
|
}
|
|
function _GetPhysicsBody($0) {
|
|
$0 = $0|0;
|
|
var $$0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = HEAP32[3573]|0;
|
|
$2 = ($1>>>0)>($0>>>0);
|
|
if (!($2)) {
|
|
$$0 = 0;
|
|
return ($$0|0);
|
|
}
|
|
$3 = (14296 + ($0<<2)|0);
|
|
$4 = HEAP32[$3>>2]|0;
|
|
$$0 = $4;
|
|
return ($$0|0);
|
|
}
|
|
function _GetPhysicsShapeVerticesCount($0) {
|
|
$0 = $0|0;
|
|
var $$1 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = HEAP32[3573]|0;
|
|
$2 = ($1>>>0)>($0>>>0);
|
|
L1: do {
|
|
if ($2) {
|
|
$3 = (14296 + ($0<<2)|0);
|
|
$4 = HEAP32[$3>>2]|0;
|
|
$5 = ($4|0)==(0|0);
|
|
if ($5) {
|
|
$$1 = 0;
|
|
} else {
|
|
$6 = ((($4)) + 84|0);
|
|
$7 = HEAP32[$6>>2]|0;
|
|
switch ($7|0) {
|
|
case 0: {
|
|
$$1 = 24;
|
|
break L1;
|
|
break;
|
|
}
|
|
case 1: {
|
|
$8 = ((($4)) + 96|0);
|
|
$9 = HEAP32[$8>>2]|0;
|
|
$$1 = $9;
|
|
break L1;
|
|
break;
|
|
}
|
|
default: {
|
|
$$1 = 0;
|
|
break L1;
|
|
}
|
|
}
|
|
}
|
|
} else {
|
|
$$1 = 0;
|
|
}
|
|
} while(0);
|
|
return ($$1|0);
|
|
}
|
|
function _GetPhysicsShapeVertex($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $$byval_copy2 = 0, $$byval_copy3 = 0, $$sroa$0$0 = 0.0, $$sroa$0$0$copyload = 0.0, $$sroa$6$0 = 0.0, $$sroa$6$0$$sroa_idx4 = 0, $$sroa$6$0$$sroa_idx5 = 0, $$sroa$6$0$copyload = 0.0, $10 = 0.0, $11 = 0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $20 = 0, $21 = 0.0;
|
|
var $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 448|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(448|0);
|
|
$$byval_copy3 = sp + 440|0;
|
|
$$byval_copy2 = sp + 424|0;
|
|
$3 = sp;
|
|
$4 = sp + 416|0;
|
|
$5 = sp + 408|0;
|
|
$6 = ($1|0)==(0|0);
|
|
L1: do {
|
|
if ($6) {
|
|
$$sroa$0$0 = 0.0;$$sroa$6$0 = 0.0;
|
|
} else {
|
|
$7 = ((($1)) + 84|0);
|
|
$8 = HEAP32[$7>>2]|0;
|
|
switch ($8|0) {
|
|
case 0: {
|
|
$9 = ((($1)) + 8|0);
|
|
$10 = +HEAPF32[$9>>2];
|
|
$11 = ($2*15)|0;
|
|
$12 = (+($11|0));
|
|
$13 = $12 * 0.017453292519943295;
|
|
$14 = $13;
|
|
$15 = (+Math_cos((+$14)));
|
|
$16 = ((($1)) + 92|0);
|
|
$17 = +HEAPF32[$16>>2];
|
|
$18 = $15 * $17;
|
|
$19 = $10 + $18;
|
|
$20 = ((($1)) + 12|0);
|
|
$21 = +HEAPF32[$20>>2];
|
|
$22 = (+Math_sin((+$14)));
|
|
$23 = $17 * $22;
|
|
$24 = $21 + $23;
|
|
$$sroa$0$0 = $19;$$sroa$6$0 = $24;
|
|
break L1;
|
|
break;
|
|
}
|
|
case 1: {
|
|
$25 = ((($1)) + 96|0);
|
|
_memcpy(($3|0),($25|0),404)|0;
|
|
$26 = ((($1)) + 8|0);
|
|
$27 = ((($3)) + 388|0);
|
|
$28 = (((($3)) + 4|0) + ($2<<3)|0);
|
|
;HEAP32[$$byval_copy2>>2]=HEAP32[$27>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$27+4>>2]|0;HEAP32[$$byval_copy2+8>>2]=HEAP32[$27+8>>2]|0;HEAP32[$$byval_copy2+12>>2]=HEAP32[$27+12>>2]|0;
|
|
;HEAP32[$$byval_copy3>>2]=HEAP32[$28>>2]|0;HEAP32[$$byval_copy3+4>>2]=HEAP32[$28+4>>2]|0;
|
|
_Mat2MultiplyVector2($4,$$byval_copy2,$$byval_copy3);
|
|
;HEAP32[$$byval_copy2>>2]=HEAP32[$26>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$26+4>>2]|0;
|
|
;HEAP32[$$byval_copy3>>2]=HEAP32[$4>>2]|0;HEAP32[$$byval_copy3+4>>2]=HEAP32[$4+4>>2]|0;
|
|
_Vector2Add_2($5,$$byval_copy2,$$byval_copy3);
|
|
$$sroa$0$0$copyload = +HEAPF32[$5>>2];
|
|
$$sroa$6$0$$sroa_idx4 = ((($5)) + 4|0);
|
|
$$sroa$6$0$copyload = +HEAPF32[$$sroa$6$0$$sroa_idx4>>2];
|
|
$$sroa$0$0 = $$sroa$0$0$copyload;$$sroa$6$0 = $$sroa$6$0$copyload;
|
|
break L1;
|
|
break;
|
|
}
|
|
default: {
|
|
$$sroa$0$0 = 0.0;$$sroa$6$0 = 0.0;
|
|
break L1;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
HEAPF32[$0>>2] = $$sroa$0$0;
|
|
$$sroa$6$0$$sroa_idx5 = ((($0)) + 4|0);
|
|
HEAPF32[$$sroa$6$0$$sroa_idx5>>2] = $$sroa$6$0;
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _Mat2Radians($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = +$1;
|
|
var $2 = 0.0, $3 = 0.0, $4 = 0, $5 = 0.0, $6 = 0, $7 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = (+Math_cos((+$1)));
|
|
$3 = (+Math_sin((+$1)));
|
|
HEAPF32[$0>>2] = $2;
|
|
$4 = ((($0)) + 4|0);
|
|
$5 = -$3;
|
|
HEAPF32[$4>>2] = $5;
|
|
$6 = ((($0)) + 8|0);
|
|
HEAPF32[$6>>2] = $3;
|
|
$7 = ((($0)) + 12|0);
|
|
HEAPF32[$7>>2] = $2;
|
|
return;
|
|
}
|
|
function _ResetPhysics() {
|
|
var $$0 = 0, $$016 = 0, $$01620 = 0, $$01621 = 0, $$018 = 0, $$019 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0;
|
|
var $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$0 = HEAP32[3573]|0;
|
|
$$01620 = (($0) + -1)|0;
|
|
$1 = ($$01620|0)>(-1);
|
|
if ($1) {
|
|
$$01621 = $$01620;
|
|
while(1) {
|
|
$4 = (14296 + ($$01621<<2)|0);
|
|
$5 = HEAP32[$4>>2]|0;
|
|
$6 = ($5|0)==(0|0);
|
|
if (!($6)) {
|
|
_free($5);
|
|
$8 = HEAP32[3572]|0;
|
|
$9 = (($8) + -500)|0;
|
|
HEAP32[3572] = $9;
|
|
}
|
|
$$016 = (($$01621) + -1)|0;
|
|
$7 = ($$016|0)>(-1);
|
|
if ($7) {
|
|
$$01621 = $$016;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
HEAP32[3573] = 0;
|
|
$2 = HEAP32[3638]|0;
|
|
$$018 = (($2) + -1)|0;
|
|
$3 = ($$018|0)>(-1);
|
|
if ($3) {
|
|
$$019 = $$018;
|
|
} else {
|
|
HEAP32[3638] = 0;
|
|
return;
|
|
}
|
|
while(1) {
|
|
$10 = (14556 + ($$019<<2)|0);
|
|
$11 = HEAP32[$10>>2]|0;
|
|
$12 = ($11|0)==(0|0);
|
|
if (!($12)) {
|
|
_free($11);
|
|
$14 = HEAP32[3572]|0;
|
|
$15 = (($14) + -56)|0;
|
|
HEAP32[3572] = $15;
|
|
}
|
|
$$0 = (($$019) + -1)|0;
|
|
$13 = ($$0|0)>(-1);
|
|
if ($13) {
|
|
$$019 = $$0;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
HEAP32[3638] = 0;
|
|
return;
|
|
}
|
|
function _ClosePhysics() {
|
|
var $0 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
HEAP32[3571] = 0;
|
|
$0 = HEAP32[3570]|0;
|
|
(_pthread_join(($0|0),(0|0))|0);
|
|
return;
|
|
}
|
|
function _main() {
|
|
var $$byval_copy = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0.0, $14 = 0, $15 = 0.0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0.0, label = 0;
|
|
var sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
|
|
$$byval_copy = sp + 8|0;
|
|
$0 = sp;
|
|
_SetConfigFlags(32);
|
|
$1 = HEAP32[2]|0;
|
|
$2 = HEAP32[3]|0;
|
|
_InitWindow($1,$2,3244);
|
|
$3 = HEAP32[2]|0;
|
|
$4 = (_MeasureText(3275,30)|0);
|
|
$5 = (($3) + -10)|0;
|
|
$6 = (($5) - ($4))|0;
|
|
HEAP32[7735] = $6;
|
|
_InitPhysics();
|
|
_SetPhysicsGravity(0.0,0.0);
|
|
$7 = HEAP32[2]|0;
|
|
$8 = (($7|0) / 2)&-1;
|
|
$9 = (+($8|0));
|
|
HEAPF32[$0>>2] = $9;
|
|
$10 = ((($0)) + 4|0);
|
|
$11 = HEAP32[3]|0;
|
|
$12 = (($11|0) / 2)&-1;
|
|
$13 = (+($12|0));
|
|
HEAPF32[$10>>2] = $13;
|
|
$14 = (_GetRandomValue(80,200)|0);
|
|
$15 = (+($14|0));
|
|
$16 = (_GetRandomValue(3,8)|0);
|
|
;HEAP32[$$byval_copy>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$0+4>>2]|0;
|
|
$17 = (_CreatePhysicsBodyPolygon($$byval_copy,$15,$16,10.0)|0);
|
|
HEAP32[7736] = $17;
|
|
_emscripten_set_main_loop((1|0),0,1);
|
|
_ClosePhysics();
|
|
_CloseWindow();
|
|
STACKTOP = sp;return 0;
|
|
}
|
|
function _UpdateDrawFrame() {
|
|
var $$03840 = 0, $$03941 = 0, $$046 = 0, $$046$in = 0, $$byval_copy3 = 0, $$byval_copy4 = 0, $$byval_copy5 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0.0, $14 = 0, $15 = 0, $16 = 0, $17 = 0.0, $18 = 0, $19 = 0.0, $2 = 0;
|
|
var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0.0, $31 = 0.0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0;
|
|
var $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
|
|
var $exitcond = 0, $exitcond49 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 80|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(80|0);
|
|
$$byval_copy5 = sp + 64|0;
|
|
$$byval_copy4 = sp + 56|0;
|
|
$$byval_copy3 = sp + 48|0;
|
|
$0 = sp + 40|0;
|
|
$1 = sp + 32|0;
|
|
$2 = sp + 76|0;
|
|
$3 = sp + 24|0;
|
|
$4 = sp + 8|0;
|
|
$5 = sp + 72|0;
|
|
$6 = sp + 20|0;
|
|
$7 = sp + 16|0;
|
|
$8 = sp;
|
|
$9 = (_IsKeyPressed(82)|0);
|
|
$10 = ($9|0)==(0);
|
|
if (!($10)) {
|
|
_ResetPhysics();
|
|
$11 = HEAP32[2]|0;
|
|
$12 = (($11|0) / 2)&-1;
|
|
$13 = (+($12|0));
|
|
HEAPF32[$0>>2] = $13;
|
|
$14 = ((($0)) + 4|0);
|
|
$15 = HEAP32[3]|0;
|
|
$16 = (($15|0) / 2)&-1;
|
|
$17 = (+($16|0));
|
|
HEAPF32[$14>>2] = $17;
|
|
$18 = (_GetRandomValue(80,200)|0);
|
|
$19 = (+($18|0));
|
|
$20 = (_GetRandomValue(3,8)|0);
|
|
;HEAP32[$$byval_copy5>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy5+4>>2]=HEAP32[$0+4>>2]|0;
|
|
$21 = (_CreatePhysicsBodyPolygon($$byval_copy5,$19,$20,10.0)|0);
|
|
HEAP32[7736] = $21;
|
|
}
|
|
$22 = (_IsMouseButtonPressed(0)|0);
|
|
$23 = ($22|0)==(0);
|
|
if (!($23)) {
|
|
$24 = (_GetPhysicsBodiesCount()|0);
|
|
$25 = ($24|0)>(0);
|
|
if ($25) {
|
|
$$046$in = $24;
|
|
while(1) {
|
|
$$046 = (($$046$in) + -1)|0;
|
|
$26 = (_GetPhysicsBody($$046)|0);
|
|
$27 = ($26|0)==(0|0);
|
|
if (!($27)) {
|
|
_GetMousePosition($1);
|
|
$29 = ((($26)) + 56|0);
|
|
$30 = +HEAPF32[$29>>2];
|
|
$31 = 10.0 / $30;
|
|
;HEAP32[$$byval_copy5>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy5+4>>2]=HEAP32[$1+4>>2]|0;
|
|
_PhysicsShatter($26,$$byval_copy5,$31);
|
|
}
|
|
$28 = ($$046$in|0)>(1);
|
|
if ($28) {
|
|
$$046$in = $$046;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
_BeginDrawing();
|
|
HEAP8[$2>>0] = 0;
|
|
$32 = ((($2)) + 1|0);
|
|
HEAP8[$32>>0] = 0;
|
|
$33 = ((($2)) + 2|0);
|
|
HEAP8[$33>>0] = 0;
|
|
$34 = ((($2)) + 3|0);
|
|
HEAP8[$34>>0] = -1;
|
|
;HEAP8[$$byval_copy5>>0]=HEAP8[$2>>0]|0;HEAP8[$$byval_copy5+1>>0]=HEAP8[$2+1>>0]|0;HEAP8[$$byval_copy5+2>>0]=HEAP8[$2+2>>0]|0;HEAP8[$$byval_copy5+3>>0]=HEAP8[$2+3>>0]|0;
|
|
_ClearBackground($$byval_copy5);
|
|
$35 = (_GetPhysicsBodiesCount()|0);
|
|
$36 = ($35|0)>(0);
|
|
if ($36) {
|
|
$37 = ((($5)) + 1|0);
|
|
$38 = ((($5)) + 2|0);
|
|
$39 = ((($5)) + 3|0);
|
|
$$03941 = 0;
|
|
while(1) {
|
|
$46 = (_GetPhysicsBody($$03941)|0);
|
|
$47 = (_GetPhysicsShapeVerticesCount($$03941)|0);
|
|
$48 = ($47|0)>(0);
|
|
if ($48) {
|
|
$$03840 = 0;
|
|
while(1) {
|
|
_GetPhysicsShapeVertex($3,$46,$$03840);
|
|
$50 = (($$03840) + 1)|0;
|
|
$51 = ($50|0)<($47|0);
|
|
$52 = $51 ? $50 : 0;
|
|
_GetPhysicsShapeVertex($4,$46,$52);
|
|
HEAP8[$5>>0] = 0;
|
|
HEAP8[$37>>0] = -28;
|
|
HEAP8[$38>>0] = 48;
|
|
HEAP8[$39>>0] = -1;
|
|
;HEAP32[$$byval_copy3>>2]=HEAP32[$3>>2]|0;HEAP32[$$byval_copy3+4>>2]=HEAP32[$3+4>>2]|0;
|
|
;HEAP32[$$byval_copy4>>2]=HEAP32[$4>>2]|0;HEAP32[$$byval_copy4+4>>2]=HEAP32[$4+4>>2]|0;
|
|
;HEAP8[$$byval_copy5>>0]=HEAP8[$5>>0]|0;HEAP8[$$byval_copy5+1>>0]=HEAP8[$5+1>>0]|0;HEAP8[$$byval_copy5+2>>0]=HEAP8[$5+2>>0]|0;HEAP8[$$byval_copy5+3>>0]=HEAP8[$5+3>>0]|0;
|
|
_DrawLineV($$byval_copy3,$$byval_copy4,$$byval_copy5);
|
|
$exitcond = ($50|0)==($47|0);
|
|
if ($exitcond) {
|
|
break;
|
|
} else {
|
|
$$03840 = $50;
|
|
}
|
|
}
|
|
}
|
|
$49 = (($$03941) + 1)|0;
|
|
$exitcond49 = ($49|0)==($35|0);
|
|
if ($exitcond49) {
|
|
break;
|
|
} else {
|
|
$$03941 = $49;
|
|
}
|
|
}
|
|
}
|
|
HEAP32[$6>>2] = -1;
|
|
;HEAP8[$$byval_copy5>>0]=HEAP8[$6>>0]|0;HEAP8[$$byval_copy5+1>>0]=HEAP8[$6+1>>0]|0;HEAP8[$$byval_copy5+2>>0]=HEAP8[$6+2>>0]|0;HEAP8[$$byval_copy5+3>>0]=HEAP8[$6+3>>0]|0;
|
|
_DrawText(3282,10,10,10,$$byval_copy5);
|
|
$40 = HEAP32[7735]|0;
|
|
$41 = HEAP32[4]|0;
|
|
HEAP32[$7>>2] = -1;
|
|
;HEAP8[$$byval_copy5>>0]=HEAP8[$7>>0]|0;HEAP8[$$byval_copy5+1>>0]=HEAP8[$7+1>>0]|0;HEAP8[$$byval_copy5+2>>0]=HEAP8[$7+2>>0]|0;HEAP8[$$byval_copy5+3>>0]=HEAP8[$7+3>>0]|0;
|
|
_DrawText(3275,$40,$41,30,$$byval_copy5);
|
|
$42 = HEAP32[7735]|0;
|
|
$43 = (($42) + 50)|0;
|
|
$44 = HEAP32[4]|0;
|
|
$45 = (($44) + -7)|0;
|
|
HEAP32[$8>>2] = -1;
|
|
;HEAP8[$$byval_copy5>>0]=HEAP8[$8>>0]|0;HEAP8[$$byval_copy5+1>>0]=HEAP8[$8+1>>0]|0;HEAP8[$$byval_copy5+2>>0]=HEAP8[$8+2>>0]|0;HEAP8[$$byval_copy5+3>>0]=HEAP8[$8+3>>0]|0;
|
|
_DrawText(3359,$43,$45,10,$$byval_copy5);
|
|
_EndDrawing();
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _GetRandomNumber() {
|
|
var $0 = 0, $1 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$0 = (_rand()|0);
|
|
$1 = (($0|0) % 361)&-1;
|
|
return ($1|0);
|
|
}
|
|
function _InitTimer() {
|
|
var $0 = 0, $1 = 0.0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$0 = (_time((0|0))|0);
|
|
_srand($0);
|
|
$1 = (+_GetCurrentTime());
|
|
HEAPF64[1749] = $1;
|
|
return;
|
|
}
|
|
function _GetCurrentTime() {
|
|
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0.0, $13 = 0.0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
|
|
$0 = sp;
|
|
(_clock_gettime(1,($0|0))|0);
|
|
$1 = HEAP32[$0>>2]|0;
|
|
$2 = ($1|0)<(0);
|
|
$3 = $2 << 31 >> 31;
|
|
$4 = (___muldi3(($1|0),($3|0),1000000000,0)|0);
|
|
$5 = tempRet0;
|
|
$6 = ((($0)) + 4|0);
|
|
$7 = HEAP32[$6>>2]|0;
|
|
$8 = ($7|0)<(0);
|
|
$9 = $8 << 31 >> 31;
|
|
$10 = (_i64Add(($4|0),($5|0),($7|0),($9|0))|0);
|
|
$11 = tempRet0;
|
|
$12 = (+($10>>>0)) + (4294967296.0*(+($11>>>0)));
|
|
$13 = $12 * 9.9999999999999995E-7;
|
|
STACKTOP = sp;return (+$13);
|
|
}
|
|
function _MathClamp() {
|
|
var $$sink = 0.0, $0 = 0.0, $1 = 0, $2 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$0 = +HEAPF64[1747];
|
|
$1 = $0 < 0.0;
|
|
if ($1) {
|
|
$$sink = 0.0;
|
|
} else {
|
|
$2 = $0 > 0.02;
|
|
if ($2) {
|
|
$$sink = 0.02;
|
|
} else {
|
|
return;
|
|
}
|
|
}
|
|
HEAPF64[1747] = $$sink;
|
|
return;
|
|
}
|
|
function _PhysicsStep() {
|
|
var $$0 = 0, $$0125165 = 0, $$0126163 = 0, $$0127147 = 0, $$0129148 = 0, $$0130 = 0, $$0130160 = 0, $$0130161 = 0, $$0131150 = 0, $$0132 = 0, $$0133152 = 0, $$0134155 = 0, $$0134155$ph = 0, $$0135158 = 0, $$0136156 = 0, $$0167 = 0, $$0168 = 0, $$pr = 0, $$pr172 = 0, $$sroa$0$0$$sroa_idx = 0;
|
|
var $$sroa$2$0$$sroa_idx1 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0;
|
|
var $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0;
|
|
var $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0;
|
|
var $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0, $33 = 0, $34 = 0.0, $35 = 0, $36 = 0, $37 = 0;
|
|
var $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0;
|
|
var $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0;
|
|
var $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0;
|
|
var $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $exitcond = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$0 = HEAP32[7737]|0;
|
|
$1 = (($0) + 1)|0;
|
|
HEAP32[7737] = $1;
|
|
$2 = HEAP32[3638]|0;
|
|
$$0167 = (($2) + -1)|0;
|
|
$3 = ($$0167|0)>(-1);
|
|
if ($3) {
|
|
$$0168 = $$0167;
|
|
while(1) {
|
|
$6 = (14556 + ($$0168<<2)|0);
|
|
$7 = HEAP32[$6>>2]|0;
|
|
$8 = ($7|0)==(0|0);
|
|
if (!($8)) {
|
|
_DestroyPhysicsManifold($7);
|
|
}
|
|
$$0 = (($$0168) + -1)|0;
|
|
$9 = ($$0|0)>(-1);
|
|
if ($9) {
|
|
$$0168 = $$0;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
$4 = HEAP32[3573]|0;
|
|
$5 = ($4|0)==(0);
|
|
if ($5) {
|
|
$17 = $4;
|
|
label = 8;
|
|
} else {
|
|
$$0125165 = 0;
|
|
while(1) {
|
|
$11 = (14296 + ($$0125165<<2)|0);
|
|
$12 = HEAP32[$11>>2]|0;
|
|
$13 = ((($12)) + 76|0);
|
|
HEAP32[$13>>2] = 0;
|
|
$14 = (($$0125165) + 1)|0;
|
|
$15 = ($14>>>0)<($4>>>0);
|
|
if ($15) {
|
|
$$0125165 = $14;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
$$pr = HEAP32[3573]|0;
|
|
$10 = ($$pr|0)==(0);
|
|
if (!($10)) {
|
|
$$0126163 = 0;
|
|
while(1) {
|
|
$19 = (14296 + ($$0126163<<2)|0);
|
|
$20 = HEAP32[$19>>2]|0;
|
|
$21 = ($20|0)==(0|0);
|
|
if (!($21)) {
|
|
$$0130160 = (($$0126163) + 1)|0;
|
|
$22 = HEAP32[3573]|0;
|
|
$23 = ($$0130160>>>0)<($22>>>0);
|
|
if ($23) {
|
|
$24 = ((($20)) + 56|0);
|
|
$25 = ((($20)) + 84|0);
|
|
$$0130161 = $$0130160;
|
|
while(1) {
|
|
$26 = (14296 + ($$0130161<<2)|0);
|
|
$27 = HEAP32[$26>>2]|0;
|
|
$28 = ($27|0)==(0|0);
|
|
do {
|
|
if (!($28)) {
|
|
$31 = +HEAPF32[$24>>2];
|
|
$32 = $31 == 0.0;
|
|
if ($32) {
|
|
$33 = ((($27)) + 56|0);
|
|
$34 = +HEAPF32[$33>>2];
|
|
$35 = $34 == 0.0;
|
|
if ($35) {
|
|
break;
|
|
}
|
|
}
|
|
$36 = HEAP32[$25>>2]|0;
|
|
$37 = ($36|0)==(1);
|
|
if ($37) {
|
|
$38 = ((($27)) + 84|0);
|
|
$39 = HEAP32[$38>>2]|0;
|
|
$40 = ($39|0)==(0);
|
|
if ($40) {
|
|
$41 = (_CreatePhysicsManifold($27,$20)|0);
|
|
$$0132 = $41;
|
|
} else {
|
|
label = 20;
|
|
}
|
|
} else {
|
|
label = 20;
|
|
}
|
|
if ((label|0) == 20) {
|
|
label = 0;
|
|
$42 = (_CreatePhysicsManifold($20,$27)|0);
|
|
$$0132 = $42;
|
|
}
|
|
_SolvePhysicsManifold($$0132);
|
|
$43 = ((($$0132)) + 40|0);
|
|
$44 = HEAP32[$43>>2]|0;
|
|
$45 = ($44|0)==(0);
|
|
if (!($45)) {
|
|
$46 = (_CreatePhysicsManifold($20,$27)|0);
|
|
$47 = ((($$0132)) + 12|0);
|
|
$48 = HEAP32[$47>>2]|0;
|
|
$49 = ((($46)) + 12|0);
|
|
HEAP32[$49>>2] = $48;
|
|
$50 = ((($46)) + 16|0);
|
|
$51 = ((($$0132)) + 16|0);
|
|
$52 = $51;
|
|
$53 = $52;
|
|
$54 = HEAP32[$53>>2]|0;
|
|
$55 = (($52) + 4)|0;
|
|
$56 = $55;
|
|
$57 = HEAP32[$56>>2]|0;
|
|
$58 = $50;
|
|
$59 = $58;
|
|
HEAP32[$59>>2] = $54;
|
|
$60 = (($58) + 4)|0;
|
|
$61 = $60;
|
|
HEAP32[$61>>2] = $57;
|
|
$62 = ((($46)) + 24|0);
|
|
$63 = ((($$0132)) + 24|0);
|
|
$64 = $63;
|
|
$65 = $64;
|
|
$66 = HEAP32[$65>>2]|0;
|
|
$67 = (($64) + 4)|0;
|
|
$68 = $67;
|
|
$69 = HEAP32[$68>>2]|0;
|
|
$70 = $62;
|
|
$71 = $70;
|
|
HEAP32[$71>>2] = $66;
|
|
$72 = (($70) + 4)|0;
|
|
$73 = $72;
|
|
HEAP32[$73>>2] = $69;
|
|
$74 = ((($46)) + 32|0);
|
|
$75 = ((($$0132)) + 32|0);
|
|
$76 = $75;
|
|
$77 = $76;
|
|
$78 = HEAP32[$77>>2]|0;
|
|
$79 = (($76) + 4)|0;
|
|
$80 = $79;
|
|
$81 = HEAP32[$80>>2]|0;
|
|
$82 = $74;
|
|
$83 = $82;
|
|
HEAP32[$83>>2] = $78;
|
|
$84 = (($82) + 4)|0;
|
|
$85 = $84;
|
|
HEAP32[$85>>2] = $81;
|
|
$86 = HEAP32[$43>>2]|0;
|
|
$87 = ((($46)) + 40|0);
|
|
HEAP32[$87>>2] = $86;
|
|
$88 = ((($$0132)) + 44|0);
|
|
$89 = HEAP32[$88>>2]|0;
|
|
$90 = ((($46)) + 44|0);
|
|
HEAP32[$90>>2] = $89;
|
|
$91 = ((($$0132)) + 48|0);
|
|
$92 = HEAP32[$91>>2]|0;
|
|
$93 = ((($46)) + 48|0);
|
|
HEAP32[$93>>2] = $92;
|
|
$94 = ((($$0132)) + 52|0);
|
|
$95 = HEAP32[$94>>2]|0;
|
|
$96 = ((($46)) + 52|0);
|
|
HEAP32[$96>>2] = $95;
|
|
}
|
|
}
|
|
} while(0);
|
|
$$0130 = (($$0130161) + 1)|0;
|
|
$29 = HEAP32[3573]|0;
|
|
$30 = ($$0130>>>0)<($29>>>0);
|
|
if ($30) {
|
|
$$0130161 = $$0130;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
$97 = (($$0126163) + 1)|0;
|
|
$98 = HEAP32[3573]|0;
|
|
$99 = ($97>>>0)<($98>>>0);
|
|
if ($99) {
|
|
$$0126163 = $97;
|
|
} else {
|
|
$17 = $98;
|
|
label = 8;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
if ((label|0) == 8) {
|
|
$16 = ($17|0)==(0);
|
|
if (!($16)) {
|
|
$18 = HEAP32[3573]|0;
|
|
$$0135158 = 0;
|
|
while(1) {
|
|
$103 = (14296 + ($$0135158<<2)|0);
|
|
$104 = HEAP32[$103>>2]|0;
|
|
$105 = ($104|0)==(0|0);
|
|
if (!($105)) {
|
|
_IntegratePhysicsForces($104);
|
|
}
|
|
$106 = (($$0135158) + 1)|0;
|
|
$107 = ($106>>>0)<($18>>>0);
|
|
if ($107) {
|
|
$$0135158 = $106;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
$100 = HEAP32[3638]|0;
|
|
$101 = ($100|0)==(0);
|
|
if ($101) {
|
|
$$0134155 = 0;$114 = 0;
|
|
} else {
|
|
$102 = HEAP32[3638]|0;
|
|
$$0136156 = 0;
|
|
while(1) {
|
|
$108 = (14556 + ($$0136156<<2)|0);
|
|
$109 = HEAP32[$108>>2]|0;
|
|
$110 = ($109|0)==(0|0);
|
|
if (!($110)) {
|
|
_InitializePhysicsManifolds($109);
|
|
}
|
|
$111 = (($$0136156) + 1)|0;
|
|
$112 = ($111>>>0)<($102>>>0);
|
|
if ($112) {
|
|
$$0136156 = $111;
|
|
} else {
|
|
$$0134155$ph = 0;
|
|
label = 32;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
while(1) {
|
|
if ((label|0) == 32) {
|
|
label = 0;
|
|
$$pr172 = HEAP32[3638]|0;
|
|
$$0134155 = $$0134155$ph;$114 = $$pr172;
|
|
}
|
|
$113 = ($114|0)==(0);
|
|
if (!($113)) {
|
|
$115 = (14556 + ($$0134155<<2)|0);
|
|
$$0133152 = 0;
|
|
while(1) {
|
|
$120 = HEAP32[$115>>2]|0;
|
|
$121 = ($120|0)==(0|0);
|
|
if (!($121)) {
|
|
_IntegratePhysicsImpulses($120);
|
|
}
|
|
$122 = (($$0133152) + 1)|0;
|
|
$123 = HEAP32[3638]|0;
|
|
$124 = ($122>>>0)<($123>>>0);
|
|
if ($124) {
|
|
$$0133152 = $122;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
$119 = (($$0134155) + 1)|0;
|
|
$exitcond = ($119|0)==(100);
|
|
if ($exitcond) {
|
|
break;
|
|
} else {
|
|
$$0134155$ph = $119;
|
|
label = 32;
|
|
}
|
|
}
|
|
$116 = HEAP32[3573]|0;
|
|
$117 = ($116|0)==(0);
|
|
if (!($117)) {
|
|
$118 = HEAP32[3573]|0;
|
|
$$0131150 = 0;
|
|
while(1) {
|
|
$128 = (14296 + ($$0131150<<2)|0);
|
|
$129 = HEAP32[$128>>2]|0;
|
|
$130 = ($129|0)==(0|0);
|
|
if (!($130)) {
|
|
_IntegratePhysicsVelocity($129);
|
|
}
|
|
$131 = (($$0131150) + 1)|0;
|
|
$132 = ($131>>>0)<($118>>>0);
|
|
if ($132) {
|
|
$$0131150 = $131;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
$125 = HEAP32[3638]|0;
|
|
$126 = ($125|0)==(0);
|
|
if (!($126)) {
|
|
$127 = HEAP32[3638]|0;
|
|
$$0129148 = 0;
|
|
while(1) {
|
|
$136 = (14556 + ($$0129148<<2)|0);
|
|
$137 = HEAP32[$136>>2]|0;
|
|
$138 = ($137|0)==(0|0);
|
|
if (!($138)) {
|
|
_CorrectPhysicsPositions($137);
|
|
}
|
|
$139 = (($$0129148) + 1)|0;
|
|
$140 = ($139>>>0)<($127>>>0);
|
|
if ($140) {
|
|
$$0129148 = $139;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
$133 = HEAP32[3573]|0;
|
|
$134 = ($133|0)==(0);
|
|
if ($134) {
|
|
return;
|
|
}
|
|
$135 = HEAP32[3573]|0;
|
|
$$0127147 = 0;
|
|
while(1) {
|
|
$141 = (14296 + ($$0127147<<2)|0);
|
|
$142 = HEAP32[$141>>2]|0;
|
|
$143 = ($142|0)==(0|0);
|
|
if (!($143)) {
|
|
$$sroa$0$0$$sroa_idx = ((($142)) + 24|0);
|
|
HEAPF32[$$sroa$0$0$$sroa_idx>>2] = 0.0;
|
|
$$sroa$2$0$$sroa_idx1 = ((($142)) + 28|0);
|
|
HEAPF32[$$sroa$2$0$$sroa_idx1>>2] = 0.0;
|
|
$144 = ((($142)) + 36|0);
|
|
HEAPF32[$144>>2] = 0.0;
|
|
}
|
|
$145 = (($$0127147) + 1)|0;
|
|
$146 = ($145>>>0)<($135>>>0);
|
|
if ($146) {
|
|
$$0127147 = $145;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
return;
|
|
}
|
|
function _DestroyPhysicsManifold($0) {
|
|
$0 = $0|0;
|
|
var $$02023 = 0, $$021 = 0, $$022 = 0, $$lcssa = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
|
|
var $24 = 0, $25 = 0, $26 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = ($0|0)==(0|0);
|
|
if ($1) {
|
|
return;
|
|
}
|
|
$2 = HEAP32[$0>>2]|0;
|
|
$3 = HEAP32[3638]|0;
|
|
$4 = ($3|0)==(0);
|
|
L4: do {
|
|
if ($4) {
|
|
$$021 = -1;
|
|
} else {
|
|
$5 = HEAP32[3638]|0;
|
|
$$02023 = 0;
|
|
while(1) {
|
|
$6 = (14556 + ($$02023<<2)|0);
|
|
$7 = HEAP32[$6>>2]|0;
|
|
$8 = HEAP32[$7>>2]|0;
|
|
$9 = ($8|0)==($2|0);
|
|
if ($9) {
|
|
$$021 = $$02023;
|
|
break L4;
|
|
}
|
|
$10 = (($$02023) + 1)|0;
|
|
$11 = ($10>>>0)<($5>>>0);
|
|
if ($11) {
|
|
$$02023 = $10;
|
|
} else {
|
|
$$021 = -1;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$12 = (14556 + ($$021<<2)|0);
|
|
$13 = HEAP32[$12>>2]|0;
|
|
_free($13);
|
|
$14 = HEAP32[3572]|0;
|
|
$15 = (($14) + -56)|0;
|
|
HEAP32[3572] = $15;
|
|
HEAP32[$12>>2] = 0;
|
|
$16 = HEAP32[3638]|0;
|
|
$17 = ($$021>>>0)<($16>>>0);
|
|
if ($17) {
|
|
$18 = HEAP32[3638]|0;
|
|
$$022 = $$021;$22 = $16;
|
|
while(1) {
|
|
$20 = (($$022) + 1)|0;
|
|
$21 = ($20>>>0)<($22>>>0);
|
|
if ($21) {
|
|
$24 = (14556 + ($$022<<2)|0);
|
|
$25 = (14556 + ($20<<2)|0);
|
|
$26 = HEAP32[$25>>2]|0;
|
|
HEAP32[$24>>2] = $26;
|
|
}
|
|
$23 = ($20>>>0)<($18>>>0);
|
|
if ($23) {
|
|
$$022 = $20;$22 = $18;
|
|
} else {
|
|
$$lcssa = $18;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$lcssa = $16;
|
|
}
|
|
$19 = (($$lcssa) + -1)|0;
|
|
HEAP32[3638] = $19;
|
|
return;
|
|
}
|
|
function _CreatePhysicsManifold($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$04457 = 0, $$044576162 = 0, $$04755 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0;
|
|
var $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
$2 = (_malloc(56)|0);
|
|
$3 = HEAP32[3572]|0;
|
|
$4 = (($3) + 56)|0;
|
|
HEAP32[3572] = $4;
|
|
$5 = HEAP32[3638]|0;
|
|
$6 = ($5|0)==(0);
|
|
$$04457 = 0;
|
|
L1: while(1) {
|
|
if ($6) {
|
|
$$044576162 = 0;
|
|
break;
|
|
} else {
|
|
$$04755 = 0;
|
|
}
|
|
while(1) {
|
|
$9 = (14556 + ($$04755<<2)|0);
|
|
$10 = HEAP32[$9>>2]|0;
|
|
$11 = HEAP32[$10>>2]|0;
|
|
$12 = ($11|0)==($$04457|0);
|
|
$8 = (($$04755) + 1)|0;
|
|
if ($12) {
|
|
break;
|
|
}
|
|
$7 = ($8>>>0)<($5>>>0);
|
|
if ($7) {
|
|
$$04755 = $8;
|
|
} else {
|
|
label = 6;
|
|
break L1;
|
|
}
|
|
}
|
|
$13 = (($$04457) + 1)|0;
|
|
$14 = ($13|0)<(4096);
|
|
if ($14) {
|
|
$$04457 = $13;
|
|
} else {
|
|
label = 8;
|
|
break;
|
|
}
|
|
}
|
|
if ((label|0) == 8) {
|
|
return ($2|0);
|
|
}
|
|
if ((label|0) == 6) {
|
|
$15 = ($$04457|0)==(-1);
|
|
if ($15) {
|
|
return ($2|0);
|
|
} else {
|
|
$$044576162 = $$04457;
|
|
}
|
|
}
|
|
HEAP32[$2>>2] = $$044576162;
|
|
$16 = ((($2)) + 4|0);
|
|
HEAP32[$16>>2] = $0;
|
|
$17 = ((($2)) + 8|0);
|
|
HEAP32[$17>>2] = $1;
|
|
$18 = ((($2)) + 12|0);
|
|
dest=$18; stop=dest+44|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
|
|
$19 = HEAP32[3638]|0;
|
|
$20 = (14556 + ($19<<2)|0);
|
|
HEAP32[$20>>2] = $2;
|
|
$21 = (($19) + 1)|0;
|
|
HEAP32[3638] = $21;
|
|
return ($2|0);
|
|
}
|
|
function _SolvePhysicsManifold($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0.0, $2 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
|
|
var $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = ((($0)) + 4|0);
|
|
$2 = HEAP32[$1>>2]|0;
|
|
$3 = ((($2)) + 84|0);
|
|
$4 = HEAP32[$3>>2]|0;
|
|
L1: do {
|
|
switch ($4|0) {
|
|
case 0: {
|
|
$5 = ((($0)) + 8|0);
|
|
$6 = HEAP32[$5>>2]|0;
|
|
$7 = ((($6)) + 84|0);
|
|
$8 = HEAP32[$7>>2]|0;
|
|
switch ($8|0) {
|
|
case 0: {
|
|
_SolveCircleToCircle($0);
|
|
break L1;
|
|
break;
|
|
}
|
|
case 1: {
|
|
_SolveCircleToPolygon($0);
|
|
break L1;
|
|
break;
|
|
}
|
|
default: {
|
|
break L1;
|
|
}
|
|
}
|
|
break;
|
|
}
|
|
case 1: {
|
|
$9 = ((($0)) + 8|0);
|
|
$10 = HEAP32[$9>>2]|0;
|
|
$11 = ((($10)) + 84|0);
|
|
$12 = HEAP32[$11>>2]|0;
|
|
switch ($12|0) {
|
|
case 0: {
|
|
_SolvePolygonToCircle($0);
|
|
break L1;
|
|
break;
|
|
}
|
|
case 1: {
|
|
_SolvePolygonToPolygon($0);
|
|
break L1;
|
|
break;
|
|
}
|
|
default: {
|
|
break L1;
|
|
}
|
|
}
|
|
break;
|
|
}
|
|
default: {
|
|
}
|
|
}
|
|
} while(0);
|
|
$13 = ((($0)) + 8|0);
|
|
$14 = HEAP32[$13>>2]|0;
|
|
$15 = ((($14)) + 76|0);
|
|
$16 = HEAP32[$15>>2]|0;
|
|
$17 = ($16|0)==(0);
|
|
if (!($17)) {
|
|
return;
|
|
}
|
|
$18 = ((($0)) + 20|0);
|
|
$19 = +HEAPF32[$18>>2];
|
|
$20 = $19 < 0.0;
|
|
$21 = $20&1;
|
|
HEAP32[$15>>2] = $21;
|
|
return;
|
|
}
|
|
function _IntegratePhysicsForces($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0, $2 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0, $25 = 0.0, $26 = 0.0, $27 = 0.0;
|
|
var $28 = 0.0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0.0, $39 = 0.0, $4 = 0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0.0, $44 = 0.0, $45 = 0.0;
|
|
var $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0.0, $51 = 0, $52 = 0.0, $53 = 0.0, $54 = 0.0, $55 = 0.0, $56 = 0, $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0.0, $7 = 0, $8 = 0.0, $9 = 0.0;
|
|
var label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = ((($0)) + 56|0);
|
|
$2 = +HEAPF32[$1>>2];
|
|
$3 = $2 == 0.0;
|
|
if ($3) {
|
|
return;
|
|
}
|
|
$4 = ((($0)) + 4|0);
|
|
$5 = HEAP32[$4>>2]|0;
|
|
$6 = ($5|0)==(0);
|
|
if ($6) {
|
|
return;
|
|
}
|
|
$7 = ((($0)) + 24|0);
|
|
$8 = +HEAPF32[$7>>2];
|
|
$9 = $2 * $8;
|
|
$10 = $9;
|
|
$11 = +HEAPF64[1750];
|
|
$12 = $11 * 0.5;
|
|
$13 = $10 * $12;
|
|
$14 = ((($0)) + 16|0);
|
|
$15 = +HEAPF32[$14>>2];
|
|
$16 = $15;
|
|
$17 = $16 + $13;
|
|
$18 = $17;
|
|
HEAPF32[$14>>2] = $18;
|
|
$19 = ((($0)) + 28|0);
|
|
$20 = +HEAPF32[$19>>2];
|
|
$21 = $2 * $20;
|
|
$22 = $21;
|
|
$23 = $12 * $22;
|
|
$24 = ((($0)) + 20|0);
|
|
$25 = +HEAPF32[$24>>2];
|
|
$26 = $25;
|
|
$27 = $26 + $23;
|
|
$28 = $27;
|
|
HEAPF32[$24>>2] = $28;
|
|
$29 = ((($0)) + 72|0);
|
|
$30 = HEAP32[$29>>2]|0;
|
|
$31 = ($30|0)==(0);
|
|
if (!($31)) {
|
|
$32 = +HEAPF32[7738];
|
|
$33 = $32;
|
|
$34 = $12 * $33;
|
|
$35 = +HEAPF32[$14>>2];
|
|
$36 = $35;
|
|
$37 = $36 + $34;
|
|
$38 = $37;
|
|
HEAPF32[$14>>2] = $38;
|
|
$39 = +HEAPF32[5];
|
|
$40 = $39;
|
|
$41 = $12 * $40;
|
|
$42 = +HEAPF32[$24>>2];
|
|
$43 = $42;
|
|
$44 = $43 + $41;
|
|
$45 = $44;
|
|
HEAPF32[$24>>2] = $45;
|
|
}
|
|
$46 = ((($0)) + 80|0);
|
|
$47 = HEAP32[$46>>2]|0;
|
|
$48 = ($47|0)==(0);
|
|
if (!($48)) {
|
|
return;
|
|
}
|
|
$49 = ((($0)) + 36|0);
|
|
$50 = +HEAPF32[$49>>2];
|
|
$51 = ((($0)) + 48|0);
|
|
$52 = +HEAPF32[$51>>2];
|
|
$53 = $50 * $52;
|
|
$54 = $53;
|
|
$55 = $12 * $54;
|
|
$56 = ((($0)) + 32|0);
|
|
$57 = +HEAPF32[$56>>2];
|
|
$58 = $57;
|
|
$59 = $58 + $55;
|
|
$60 = $59;
|
|
HEAPF32[$56>>2] = $60;
|
|
return;
|
|
}
|
|
function _InitializePhysicsManifolds($0) {
|
|
$0 = $0|0;
|
|
var $$byval_copy14 = 0, $$byval_copy9 = 0, $1 = 0, $10 = 0, $11 = 0.0, $12 = 0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0, $17 = 0, $18 = 0.0, $19 = 0, $2 = 0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0, $24 = 0, $25 = 0.0;
|
|
var $26 = 0, $27 = 0.0, $28 = 0.0, $29 = 0.0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0.0, $43 = 0.0;
|
|
var $44 = 0.0, $45 = 0.0, $46 = 0.0, $47 = 0, $48 = 0.0, $49 = 0.0, $5 = 0, $50 = 0.0, $51 = 0.0, $52 = 0, $53 = 0.0, $54 = 0.0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0.0, $61 = 0.0;
|
|
var $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0.0, $66 = 0.0, $67 = 0.0, $68 = 0.0, $69 = 0.0, $7 = 0, $70 = 0.0, $71 = 0.0, $72 = 0, $73 = 0, $74 = 0.0, $75 = 0.0, $76 = 0.0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0;
|
|
var $80 = 0.0, $81 = 0.0, $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0.0, $86 = 0.0, $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0, $90 = 0.0, $91 = 0.0, $92 = 0.0, $93 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
|
|
$$byval_copy14 = sp + 48|0;
|
|
$$byval_copy9 = sp + 40|0;
|
|
$1 = sp + 24|0;
|
|
$2 = sp + 16|0;
|
|
$3 = sp + 8|0;
|
|
$4 = sp;
|
|
$5 = sp + 32|0;
|
|
$6 = ((($0)) + 4|0);
|
|
$7 = HEAP32[$6>>2]|0;
|
|
$8 = ((($0)) + 8|0);
|
|
$9 = HEAP32[$8>>2]|0;
|
|
$10 = ((($7)) + 68|0);
|
|
$11 = +HEAPF32[$10>>2];
|
|
$12 = ((($9)) + 68|0);
|
|
$13 = +HEAPF32[$12>>2];
|
|
$14 = $11 * $13;
|
|
$15 = (+Math_sqrt((+$14)));
|
|
$16 = ((($0)) + 44|0);
|
|
HEAPF32[$16>>2] = $15;
|
|
$17 = ((($7)) + 60|0);
|
|
$18 = +HEAPF32[$17>>2];
|
|
$19 = ((($9)) + 60|0);
|
|
$20 = +HEAPF32[$19>>2];
|
|
$21 = $18 * $20;
|
|
$22 = (+Math_sqrt((+$21)));
|
|
$23 = ((($0)) + 52|0);
|
|
HEAPF32[$23>>2] = $22;
|
|
$24 = ((($7)) + 64|0);
|
|
$25 = +HEAPF32[$24>>2];
|
|
$26 = ((($9)) + 64|0);
|
|
$27 = +HEAPF32[$26>>2];
|
|
$28 = $25 * $27;
|
|
$29 = (+Math_sqrt((+$28)));
|
|
$30 = ((($0)) + 48|0);
|
|
HEAPF32[$30>>2] = $29;
|
|
$31 = ((($7)) + 8|0);
|
|
$32 = ((($9)) + 8|0);
|
|
$33 = ((($7)) + 32|0);
|
|
$34 = ((($9)) + 32|0);
|
|
$35 = ((($9)) + 16|0);
|
|
$36 = ((($7)) + 16|0);
|
|
$37 = ((($9)) + 20|0);
|
|
$38 = ((($3)) + 4|0);
|
|
$39 = ((($7)) + 20|0);
|
|
$40 = ((($$byval_copy9)) + 4|0);
|
|
$41 = ((($4)) + 4|0);
|
|
$42 = +HEAPF32[7738];
|
|
$43 = $42;
|
|
$44 = +HEAPF64[1750];
|
|
$45 = $43 * $44;
|
|
$46 = $45;
|
|
$47 = ((($5)) + 4|0);
|
|
$48 = +HEAPF32[5];
|
|
$49 = $48;
|
|
$50 = $49 * $44;
|
|
$51 = $50;
|
|
$52 = ((($0)) + 24|0);
|
|
;HEAP32[$$byval_copy9>>2]=HEAP32[$52>>2]|0;HEAP32[$$byval_copy9+4>>2]=HEAP32[$52+4>>2]|0;
|
|
;HEAP32[$$byval_copy14>>2]=HEAP32[$31>>2]|0;HEAP32[$$byval_copy14+4>>2]=HEAP32[$31+4>>2]|0;
|
|
_Vector2Subtract_4($1,$$byval_copy9,$$byval_copy14);
|
|
;HEAP32[$$byval_copy9>>2]=HEAP32[$52>>2]|0;HEAP32[$$byval_copy9+4>>2]=HEAP32[$52+4>>2]|0;
|
|
;HEAP32[$$byval_copy14>>2]=HEAP32[$32>>2]|0;HEAP32[$$byval_copy14+4>>2]=HEAP32[$32+4>>2]|0;
|
|
_Vector2Subtract_4($2,$$byval_copy9,$$byval_copy14);
|
|
$53 = +HEAPF32[$33>>2];
|
|
;HEAP32[$$byval_copy14>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy14+4>>2]=HEAP32[$1+4>>2]|0;
|
|
_MathCross($$byval_copy9,$53,$$byval_copy14);
|
|
$54 = +HEAPF32[$34>>2];
|
|
;HEAP32[$$byval_copy14>>2]=HEAP32[$2>>2]|0;HEAP32[$$byval_copy14+4>>2]=HEAP32[$2+4>>2]|0;
|
|
_MathCross($3,$54,$$byval_copy14);
|
|
$55 = +HEAPF32[$35>>2];
|
|
$56 = +HEAPF32[$3>>2];
|
|
$57 = $55 + $56;
|
|
$58 = +HEAPF32[$36>>2];
|
|
$59 = $57 - $58;
|
|
$60 = +HEAPF32[$$byval_copy9>>2];
|
|
$61 = $59 - $60;
|
|
HEAPF32[$4>>2] = $61;
|
|
$62 = +HEAPF32[$37>>2];
|
|
$63 = +HEAPF32[$38>>2];
|
|
$64 = $62 + $63;
|
|
$65 = +HEAPF32[$39>>2];
|
|
$66 = $64 - $65;
|
|
$67 = +HEAPF32[$40>>2];
|
|
$68 = $66 - $67;
|
|
HEAPF32[$41>>2] = $68;
|
|
;HEAP32[$$byval_copy14>>2]=HEAP32[$4>>2]|0;HEAP32[$$byval_copy14+4>>2]=HEAP32[$4+4>>2]|0;
|
|
$69 = (+_MathLenSqr($$byval_copy14));
|
|
HEAPF32[$5>>2] = $46;
|
|
HEAPF32[$47>>2] = $51;
|
|
;HEAP32[$$byval_copy14>>2]=HEAP32[$5>>2]|0;HEAP32[$$byval_copy14+4>>2]=HEAP32[$5+4>>2]|0;
|
|
$70 = (+_MathLenSqr($$byval_copy14));
|
|
$71 = $70 + 9.9999999747524271E-7;
|
|
$72 = $69 < $71;
|
|
if ($72) {
|
|
HEAPF32[$16>>2] = 0.0;
|
|
}
|
|
$73 = ((($0)) + 32|0);
|
|
;HEAP32[$$byval_copy9>>2]=HEAP32[$73>>2]|0;HEAP32[$$byval_copy9+4>>2]=HEAP32[$73+4>>2]|0;
|
|
;HEAP32[$$byval_copy14>>2]=HEAP32[$31>>2]|0;HEAP32[$$byval_copy14+4>>2]=HEAP32[$31+4>>2]|0;
|
|
_Vector2Subtract_4($1,$$byval_copy9,$$byval_copy14);
|
|
;HEAP32[$$byval_copy9>>2]=HEAP32[$73>>2]|0;HEAP32[$$byval_copy9+4>>2]=HEAP32[$73+4>>2]|0;
|
|
;HEAP32[$$byval_copy14>>2]=HEAP32[$32>>2]|0;HEAP32[$$byval_copy14+4>>2]=HEAP32[$32+4>>2]|0;
|
|
_Vector2Subtract_4($2,$$byval_copy9,$$byval_copy14);
|
|
$74 = +HEAPF32[$33>>2];
|
|
;HEAP32[$$byval_copy14>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy14+4>>2]=HEAP32[$1+4>>2]|0;
|
|
_MathCross($$byval_copy9,$74,$$byval_copy14);
|
|
$75 = +HEAPF32[$34>>2];
|
|
;HEAP32[$$byval_copy14>>2]=HEAP32[$2>>2]|0;HEAP32[$$byval_copy14+4>>2]=HEAP32[$2+4>>2]|0;
|
|
_MathCross($3,$75,$$byval_copy14);
|
|
$76 = +HEAPF32[$35>>2];
|
|
$77 = +HEAPF32[$3>>2];
|
|
$78 = $76 + $77;
|
|
$79 = +HEAPF32[$36>>2];
|
|
$80 = $78 - $79;
|
|
$81 = +HEAPF32[$$byval_copy9>>2];
|
|
$82 = $80 - $81;
|
|
HEAPF32[$4>>2] = $82;
|
|
$83 = +HEAPF32[$37>>2];
|
|
$84 = +HEAPF32[$38>>2];
|
|
$85 = $83 + $84;
|
|
$86 = +HEAPF32[$39>>2];
|
|
$87 = $85 - $86;
|
|
$88 = +HEAPF32[$40>>2];
|
|
$89 = $87 - $88;
|
|
HEAPF32[$41>>2] = $89;
|
|
;HEAP32[$$byval_copy14>>2]=HEAP32[$4>>2]|0;HEAP32[$$byval_copy14+4>>2]=HEAP32[$4+4>>2]|0;
|
|
$90 = (+_MathLenSqr($$byval_copy14));
|
|
HEAPF32[$5>>2] = $46;
|
|
HEAPF32[$47>>2] = $51;
|
|
;HEAP32[$$byval_copy14>>2]=HEAP32[$5>>2]|0;HEAP32[$$byval_copy14+4>>2]=HEAP32[$5+4>>2]|0;
|
|
$91 = (+_MathLenSqr($$byval_copy14));
|
|
$92 = $91 + 9.9999999747524271E-7;
|
|
$93 = $90 < $92;
|
|
if (!($93)) {
|
|
STACKTOP = sp;return;
|
|
}
|
|
HEAPF32[$16>>2] = 0.0;
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _IntegratePhysicsImpulses($0) {
|
|
$0 = $0|0;
|
|
var $$0 = 0, $$0135139 = 0, $$1 = 0, $$byval_copy29 = 0, $$sink = 0.0, $$sink138 = 0.0, $$sroa$047$0$$sroa_idx = 0, $$sroa$050$0$$sroa_idx = 0, $$sroa$2$0$$sroa_idx2 = 0, $$sroa$248$0$$sroa_idx49 = 0, $$sroa$251$0$$sroa_idx52 = 0, $1 = 0, $10 = 0, $100 = 0.0, $101 = 0.0, $102 = 0, $103 = 0.0, $104 = 0.0, $105 = 0.0, $106 = 0.0;
|
|
var $107 = 0.0, $108 = 0.0, $109 = 0, $11 = 0, $110 = 0, $111 = 0.0, $112 = 0.0, $113 = 0.0, $114 = 0.0, $115 = 0.0, $116 = 0.0, $117 = 0.0, $118 = 0.0, $119 = 0.0, $12 = 0, $120 = 0, $121 = 0, $122 = 0.0, $123 = 0.0, $124 = 0.0;
|
|
var $125 = 0.0, $126 = 0.0, $127 = 0.0, $128 = 0.0, $129 = 0.0, $13 = 0, $130 = 0.0, $131 = 0, $132 = 0, $133 = 0.0, $134 = 0.0, $135 = 0.0, $136 = 0.0, $137 = 0.0, $138 = 0.0, $139 = 0.0, $14 = 0, $140 = 0.0, $141 = 0.0, $142 = 0;
|
|
var $143 = 0, $144 = 0.0, $145 = 0.0, $146 = 0.0, $147 = 0.0, $148 = 0.0, $149 = 0.0, $15 = 0, $150 = 0.0, $151 = 0.0, $152 = 0.0, $153 = 0.0, $154 = 0.0, $155 = 0.0, $156 = 0.0, $157 = 0.0, $158 = 0.0, $159 = 0.0, $16 = 0, $160 = 0.0;
|
|
var $161 = 0.0, $162 = 0.0, $163 = 0.0, $164 = 0.0, $165 = 0.0, $166 = 0.0, $167 = 0.0, $168 = 0.0, $169 = 0.0, $17 = 0, $170 = 0.0, $171 = 0.0, $172 = 0.0, $173 = 0.0, $174 = 0.0, $175 = 0.0, $176 = 0.0, $177 = 0.0, $178 = 0.0, $179 = 0.0;
|
|
var $18 = 0, $180 = 0, $181 = 0.0, $182 = 0.0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0.0, $189 = 0.0, $19 = 0, $190 = 0, $191 = 0.0, $192 = 0.0, $193 = 0.0, $194 = 0.0, $195 = 0.0, $196 = 0.0, $197 = 0.0;
|
|
var $198 = 0.0, $199 = 0.0, $2 = 0, $20 = 0, $200 = 0.0, $201 = 0, $202 = 0, $203 = 0.0, $204 = 0.0, $205 = 0.0, $206 = 0.0, $207 = 0.0, $208 = 0.0, $209 = 0.0, $21 = 0, $210 = 0.0, $211 = 0.0, $212 = 0, $213 = 0, $214 = 0.0;
|
|
var $215 = 0.0, $216 = 0.0, $217 = 0.0, $218 = 0.0, $219 = 0.0, $22 = 0.0, $220 = 0.0, $221 = 0.0, $222 = 0.0, $223 = 0, $224 = 0, $225 = 0.0, $226 = 0.0, $227 = 0.0, $228 = 0.0, $229 = 0.0, $23 = 0, $230 = 0.0, $231 = 0.0, $232 = 0.0;
|
|
var $233 = 0.0, $234 = 0, $235 = 0, $236 = 0.0, $237 = 0.0, $238 = 0.0, $239 = 0.0, $24 = 0.0, $240 = 0.0, $25 = 0.0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0;
|
|
var $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0;
|
|
var $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0.0, $65 = 0.0, $66 = 0.0, $67 = 0.0, $68 = 0.0, $69 = 0.0, $7 = 0, $70 = 0.0;
|
|
var $71 = 0.0, $72 = 0.0, $73 = 0.0, $74 = 0.0, $75 = 0.0, $76 = 0.0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0, $80 = 0.0, $81 = 0.0, $82 = 0.0, $83 = 0, $84 = 0.0, $85 = 0.0, $86 = 0.0, $87 = 0.0, $88 = 0.0, $89 = 0.0;
|
|
var $9 = 0, $90 = 0.0, $91 = 0.0, $92 = 0.0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0.0, $97 = 0.0, $98 = 0.0, $99 = 0.0, $cond1 = 0, $fabsf = 0.0, $fabsf136 = 0.0, $tmpcast137$byval_copy = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 144|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(144|0);
|
|
$tmpcast137$byval_copy = sp + 136|0;
|
|
$$byval_copy29 = sp + 128|0;
|
|
$1 = sp + 40|0;
|
|
$2 = sp + 32|0;
|
|
$3 = sp + 8|0;
|
|
$4 = sp + 120|0;
|
|
$5 = sp + 112|0;
|
|
$6 = sp + 104|0;
|
|
$7 = sp + 96|0;
|
|
$8 = sp + 24|0;
|
|
$9 = sp + 88|0;
|
|
$10 = sp + 80|0;
|
|
$11 = sp + 72|0;
|
|
$12 = sp + 64|0;
|
|
$13 = sp + 56|0;
|
|
$14 = sp + 16|0;
|
|
$15 = sp;
|
|
$16 = sp + 48|0;
|
|
$17 = ((($0)) + 4|0);
|
|
$18 = HEAP32[$17>>2]|0;
|
|
$19 = ((($0)) + 8|0);
|
|
$20 = HEAP32[$19>>2]|0;
|
|
$21 = ((($18)) + 56|0);
|
|
$22 = +HEAPF32[$21>>2];
|
|
$23 = ((($20)) + 56|0);
|
|
$24 = +HEAPF32[$23>>2];
|
|
$25 = $22 + $24;
|
|
$fabsf = (+Math_abs((+$25)));
|
|
$26 = !($fabsf <= 9.9999999747524271E-7);
|
|
if (!($26)) {
|
|
$$sroa$050$0$$sroa_idx = ((($18)) + 16|0);
|
|
HEAPF32[$$sroa$050$0$$sroa_idx>>2] = 0.0;
|
|
$$sroa$251$0$$sroa_idx52 = ((($18)) + 20|0);
|
|
HEAPF32[$$sroa$251$0$$sroa_idx52>>2] = 0.0;
|
|
$$sroa$047$0$$sroa_idx = ((($20)) + 16|0);
|
|
HEAPF32[$$sroa$047$0$$sroa_idx>>2] = 0.0;
|
|
$$sroa$248$0$$sroa_idx49 = ((($20)) + 20|0);
|
|
HEAPF32[$$sroa$248$0$$sroa_idx49>>2] = 0.0;
|
|
STACKTOP = sp;return;
|
|
}
|
|
$27 = ((($0)) + 40|0);
|
|
$28 = HEAP32[$27>>2]|0;
|
|
$29 = ($28|0)==(0);
|
|
if ($29) {
|
|
STACKTOP = sp;return;
|
|
}
|
|
$30 = ((($18)) + 8|0);
|
|
$31 = ((($20)) + 8|0);
|
|
$32 = ((($20)) + 16|0);
|
|
$33 = ((($20)) + 32|0);
|
|
$34 = ((($18)) + 16|0);
|
|
$35 = ((($18)) + 32|0);
|
|
$36 = ((($20)) + 20|0);
|
|
$37 = ((($6)) + 4|0);
|
|
$38 = ((($18)) + 20|0);
|
|
$39 = ((($7)) + 4|0);
|
|
$40 = ((($3)) + 4|0);
|
|
$41 = ((($0)) + 16|0);
|
|
$42 = ((($18)) + 48|0);
|
|
$43 = ((($20)) + 48|0);
|
|
$44 = ((($0)) + 44|0);
|
|
$45 = ((($8)) + 4|0);
|
|
$46 = ((($0)) + 20|0);
|
|
$47 = ((($18)) + 4|0);
|
|
$48 = ((($20)) + 4|0);
|
|
$49 = ((($12)) + 4|0);
|
|
$50 = ((($13)) + 4|0);
|
|
$51 = ((($14)) + 4|0);
|
|
$52 = ((($0)) + 52|0);
|
|
$$sroa$2$0$$sroa_idx2 = ((($15)) + 4|0);
|
|
$53 = ((($20)) + 80|0);
|
|
$54 = ((($18)) + 80|0);
|
|
$55 = ((($16)) + 4|0);
|
|
$56 = ((($0)) + 48|0);
|
|
$57 = ((($20)) + 80|0);
|
|
$58 = ((($18)) + 80|0);
|
|
$59 = ((($9)) + 4|0);
|
|
$$0135139 = 0;
|
|
while(1) {
|
|
$63 = (((($0)) + 24|0) + ($$0135139<<3)|0);
|
|
;HEAP32[$$byval_copy29>>2]=HEAP32[$63>>2]|0;HEAP32[$$byval_copy29+4>>2]=HEAP32[$63+4>>2]|0;
|
|
;HEAP32[$tmpcast137$byval_copy>>2]=HEAP32[$30>>2]|0;HEAP32[$tmpcast137$byval_copy+4>>2]=HEAP32[$30+4>>2]|0;
|
|
_Vector2Subtract_4($1,$$byval_copy29,$tmpcast137$byval_copy);
|
|
;HEAP32[$$byval_copy29>>2]=HEAP32[$63>>2]|0;HEAP32[$$byval_copy29+4>>2]=HEAP32[$63+4>>2]|0;
|
|
;HEAP32[$tmpcast137$byval_copy>>2]=HEAP32[$31>>2]|0;HEAP32[$tmpcast137$byval_copy+4>>2]=HEAP32[$31+4>>2]|0;
|
|
_Vector2Subtract_4($2,$$byval_copy29,$tmpcast137$byval_copy);
|
|
$64 = +HEAPF32[$32>>2];
|
|
$65 = +HEAPF32[$33>>2];
|
|
;HEAP32[$tmpcast137$byval_copy>>2]=HEAP32[$2>>2]|0;HEAP32[$tmpcast137$byval_copy+4>>2]=HEAP32[$2+4>>2]|0;
|
|
_MathCross($4,$65,$tmpcast137$byval_copy);
|
|
$66 = +HEAPF32[$4>>2];
|
|
$67 = $64 + $66;
|
|
$68 = +HEAPF32[$34>>2];
|
|
$69 = $67 - $68;
|
|
$70 = +HEAPF32[$35>>2];
|
|
;HEAP32[$tmpcast137$byval_copy>>2]=HEAP32[$1>>2]|0;HEAP32[$tmpcast137$byval_copy+4>>2]=HEAP32[$1+4>>2]|0;
|
|
_MathCross($5,$70,$tmpcast137$byval_copy);
|
|
$71 = +HEAPF32[$5>>2];
|
|
$72 = $69 - $71;
|
|
HEAPF32[$3>>2] = $72;
|
|
$73 = +HEAPF32[$36>>2];
|
|
$74 = +HEAPF32[$33>>2];
|
|
;HEAP32[$tmpcast137$byval_copy>>2]=HEAP32[$2>>2]|0;HEAP32[$tmpcast137$byval_copy+4>>2]=HEAP32[$2+4>>2]|0;
|
|
_MathCross($6,$74,$tmpcast137$byval_copy);
|
|
$75 = +HEAPF32[$37>>2];
|
|
$76 = $73 + $75;
|
|
$77 = +HEAPF32[$38>>2];
|
|
$78 = $76 - $77;
|
|
$79 = +HEAPF32[$35>>2];
|
|
;HEAP32[$tmpcast137$byval_copy>>2]=HEAP32[$1>>2]|0;HEAP32[$tmpcast137$byval_copy+4>>2]=HEAP32[$1+4>>2]|0;
|
|
_MathCross($7,$79,$tmpcast137$byval_copy);
|
|
$80 = +HEAPF32[$39>>2];
|
|
$81 = $78 - $80;
|
|
HEAPF32[$40>>2] = $81;
|
|
;HEAP32[$$byval_copy29>>2]=HEAP32[$3>>2]|0;HEAP32[$$byval_copy29+4>>2]=HEAP32[$3+4>>2]|0;
|
|
;HEAP32[$tmpcast137$byval_copy>>2]=HEAP32[$41>>2]|0;HEAP32[$tmpcast137$byval_copy+4>>2]=HEAP32[$41+4>>2]|0;
|
|
$82 = (+_MathDot($$byval_copy29,$tmpcast137$byval_copy));
|
|
$83 = $82 > 0.0;
|
|
if ($83) {
|
|
$$1 = 1;
|
|
} else {
|
|
;HEAP32[$$byval_copy29>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy29+4>>2]=HEAP32[$1+4>>2]|0;
|
|
;HEAP32[$tmpcast137$byval_copy>>2]=HEAP32[$41>>2]|0;HEAP32[$tmpcast137$byval_copy+4>>2]=HEAP32[$41+4>>2]|0;
|
|
$84 = (+_MathCrossVector2($$byval_copy29,$tmpcast137$byval_copy));
|
|
;HEAP32[$$byval_copy29>>2]=HEAP32[$2>>2]|0;HEAP32[$$byval_copy29+4>>2]=HEAP32[$2+4>>2]|0;
|
|
;HEAP32[$tmpcast137$byval_copy>>2]=HEAP32[$41>>2]|0;HEAP32[$tmpcast137$byval_copy+4>>2]=HEAP32[$41+4>>2]|0;
|
|
$85 = (+_MathCrossVector2($$byval_copy29,$tmpcast137$byval_copy));
|
|
$86 = +HEAPF32[$21>>2];
|
|
$87 = +HEAPF32[$23>>2];
|
|
$88 = $86 + $87;
|
|
$89 = $84 * $84;
|
|
$90 = +HEAPF32[$42>>2];
|
|
$91 = $89 * $90;
|
|
$92 = $88 + $91;
|
|
$93 = $85 * $85;
|
|
$94 = +HEAPF32[$43>>2];
|
|
$95 = $93 * $94;
|
|
$96 = $92 + $95;
|
|
$97 = +HEAPF32[$44>>2];
|
|
$98 = $97 + 1.0;
|
|
$99 = $82 * $98;
|
|
$100 = -$99;
|
|
$101 = $100 / $96;
|
|
$102 = HEAP32[$27>>2]|0;
|
|
$103 = (+($102>>>0));
|
|
$104 = $101 / $103;
|
|
$105 = +HEAPF32[$41>>2];
|
|
$106 = $105 * $104;
|
|
HEAPF32[$8>>2] = $106;
|
|
$107 = +HEAPF32[$46>>2];
|
|
$108 = $104 * $107;
|
|
HEAPF32[$45>>2] = $108;
|
|
$109 = HEAP32[$47>>2]|0;
|
|
$110 = ($109|0)==(0);
|
|
if (!($110)) {
|
|
$111 = +HEAPF32[$21>>2];
|
|
$112 = +HEAPF32[$8>>2];
|
|
$113 = $111 * $112;
|
|
$114 = +HEAPF32[$34>>2];
|
|
$115 = $114 - $113;
|
|
HEAPF32[$34>>2] = $115;
|
|
$116 = +HEAPF32[$45>>2];
|
|
$117 = $111 * $116;
|
|
$118 = +HEAPF32[$38>>2];
|
|
$119 = $118 - $117;
|
|
HEAPF32[$38>>2] = $119;
|
|
$120 = HEAP32[$58>>2]|0;
|
|
$121 = ($120|0)==(0);
|
|
if ($121) {
|
|
$122 = +HEAPF32[$42>>2];
|
|
$123 = +HEAPF32[$8>>2];
|
|
$124 = -$123;
|
|
HEAPF32[$9>>2] = $124;
|
|
$125 = +HEAPF32[$45>>2];
|
|
$126 = -$125;
|
|
HEAPF32[$59>>2] = $126;
|
|
;HEAP32[$$byval_copy29>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy29+4>>2]=HEAP32[$1+4>>2]|0;
|
|
;HEAP32[$tmpcast137$byval_copy>>2]=HEAP32[$9>>2]|0;HEAP32[$tmpcast137$byval_copy+4>>2]=HEAP32[$9+4>>2]|0;
|
|
$127 = (+_MathCrossVector2($$byval_copy29,$tmpcast137$byval_copy));
|
|
$128 = $122 * $127;
|
|
$129 = +HEAPF32[$35>>2];
|
|
$130 = $129 + $128;
|
|
HEAPF32[$35>>2] = $130;
|
|
}
|
|
}
|
|
$131 = HEAP32[$48>>2]|0;
|
|
$132 = ($131|0)==(0);
|
|
if (!($132)) {
|
|
$133 = +HEAPF32[$23>>2];
|
|
$134 = +HEAPF32[$8>>2];
|
|
$135 = $133 * $134;
|
|
$136 = +HEAPF32[$32>>2];
|
|
$137 = $136 + $135;
|
|
HEAPF32[$32>>2] = $137;
|
|
$138 = +HEAPF32[$45>>2];
|
|
$139 = $133 * $138;
|
|
$140 = +HEAPF32[$36>>2];
|
|
$141 = $140 + $139;
|
|
HEAPF32[$36>>2] = $141;
|
|
$142 = HEAP32[$57>>2]|0;
|
|
$143 = ($142|0)==(0);
|
|
if ($143) {
|
|
$144 = +HEAPF32[$43>>2];
|
|
;HEAP32[$$byval_copy29>>2]=HEAP32[$2>>2]|0;HEAP32[$$byval_copy29+4>>2]=HEAP32[$2+4>>2]|0;
|
|
;HEAP32[$tmpcast137$byval_copy>>2]=HEAP32[$8>>2]|0;HEAP32[$tmpcast137$byval_copy+4>>2]=HEAP32[$8+4>>2]|0;
|
|
$145 = (+_MathCrossVector2($$byval_copy29,$tmpcast137$byval_copy));
|
|
$146 = $144 * $145;
|
|
$147 = +HEAPF32[$33>>2];
|
|
$148 = $147 + $146;
|
|
HEAPF32[$33>>2] = $148;
|
|
}
|
|
}
|
|
$149 = +HEAPF32[$32>>2];
|
|
$150 = +HEAPF32[$33>>2];
|
|
;HEAP32[$tmpcast137$byval_copy>>2]=HEAP32[$2>>2]|0;HEAP32[$tmpcast137$byval_copy+4>>2]=HEAP32[$2+4>>2]|0;
|
|
_MathCross($10,$150,$tmpcast137$byval_copy);
|
|
$151 = +HEAPF32[$10>>2];
|
|
$152 = $149 + $151;
|
|
$153 = +HEAPF32[$34>>2];
|
|
$154 = $152 - $153;
|
|
$155 = +HEAPF32[$35>>2];
|
|
;HEAP32[$tmpcast137$byval_copy>>2]=HEAP32[$1>>2]|0;HEAP32[$tmpcast137$byval_copy+4>>2]=HEAP32[$1+4>>2]|0;
|
|
_MathCross($11,$155,$tmpcast137$byval_copy);
|
|
$156 = +HEAPF32[$11>>2];
|
|
$157 = $154 - $156;
|
|
HEAPF32[$3>>2] = $157;
|
|
$158 = +HEAPF32[$36>>2];
|
|
$159 = +HEAPF32[$33>>2];
|
|
;HEAP32[$tmpcast137$byval_copy>>2]=HEAP32[$2>>2]|0;HEAP32[$tmpcast137$byval_copy+4>>2]=HEAP32[$2+4>>2]|0;
|
|
_MathCross($12,$159,$tmpcast137$byval_copy);
|
|
$160 = +HEAPF32[$49>>2];
|
|
$161 = $158 + $160;
|
|
$162 = +HEAPF32[$38>>2];
|
|
$163 = $161 - $162;
|
|
$164 = +HEAPF32[$35>>2];
|
|
;HEAP32[$tmpcast137$byval_copy>>2]=HEAP32[$1>>2]|0;HEAP32[$tmpcast137$byval_copy+4>>2]=HEAP32[$1+4>>2]|0;
|
|
_MathCross($13,$164,$tmpcast137$byval_copy);
|
|
$165 = +HEAPF32[$50>>2];
|
|
$166 = $163 - $165;
|
|
HEAPF32[$40>>2] = $166;
|
|
$167 = +HEAPF32[$3>>2];
|
|
$168 = +HEAPF32[$41>>2];
|
|
;HEAP32[$$byval_copy29>>2]=HEAP32[$3>>2]|0;HEAP32[$$byval_copy29+4>>2]=HEAP32[$3+4>>2]|0;
|
|
;HEAP32[$tmpcast137$byval_copy>>2]=HEAP32[$41>>2]|0;HEAP32[$tmpcast137$byval_copy+4>>2]=HEAP32[$41+4>>2]|0;
|
|
$169 = (+_MathDot($$byval_copy29,$tmpcast137$byval_copy));
|
|
$170 = $168 * $169;
|
|
$171 = $167 - $170;
|
|
HEAPF32[$14>>2] = $171;
|
|
$172 = +HEAPF32[$40>>2];
|
|
$173 = +HEAPF32[$46>>2];
|
|
;HEAP32[$$byval_copy29>>2]=HEAP32[$3>>2]|0;HEAP32[$$byval_copy29+4>>2]=HEAP32[$3+4>>2]|0;
|
|
;HEAP32[$tmpcast137$byval_copy>>2]=HEAP32[$41>>2]|0;HEAP32[$tmpcast137$byval_copy+4>>2]=HEAP32[$41+4>>2]|0;
|
|
$174 = (+_MathDot($$byval_copy29,$tmpcast137$byval_copy));
|
|
$175 = $173 * $174;
|
|
$176 = $172 - $175;
|
|
HEAPF32[$51>>2] = $176;
|
|
_MathNormalize($14);
|
|
;HEAP32[$$byval_copy29>>2]=HEAP32[$3>>2]|0;HEAP32[$$byval_copy29+4>>2]=HEAP32[$3+4>>2]|0;
|
|
;HEAP32[$tmpcast137$byval_copy>>2]=HEAP32[$14>>2]|0;HEAP32[$tmpcast137$byval_copy+4>>2]=HEAP32[$14+4>>2]|0;
|
|
$177 = (+_MathDot($$byval_copy29,$tmpcast137$byval_copy));
|
|
$178 = -$177;
|
|
$179 = $178 / $96;
|
|
$180 = HEAP32[$27>>2]|0;
|
|
$181 = (+($180>>>0));
|
|
$182 = $179 / $181;
|
|
$fabsf136 = (+Math_abs((+$182)));
|
|
$183 = !($fabsf136 <= 9.9999999747524271E-7);
|
|
if ($183) {
|
|
$184 = $15;
|
|
$185 = $184;
|
|
HEAP32[$185>>2] = 0;
|
|
$186 = (($184) + 4)|0;
|
|
$187 = $186;
|
|
HEAP32[$187>>2] = 0;
|
|
$188 = +HEAPF32[$52>>2];
|
|
$189 = $104 * $188;
|
|
$190 = $fabsf136 < $189;
|
|
$191 = +HEAPF32[$14>>2];
|
|
$192 = +HEAPF32[$51>>2];
|
|
if ($190) {
|
|
$193 = $182 * $191;
|
|
$194 = $182 * $192;
|
|
$$sink = $194;$$sink138 = $193;
|
|
} else {
|
|
$195 = -$104;
|
|
$196 = $191 * $195;
|
|
$197 = +HEAPF32[$56>>2];
|
|
$198 = $196 * $197;
|
|
$199 = $192 * $195;
|
|
$200 = $199 * $197;
|
|
$$sink = $200;$$sink138 = $198;
|
|
}
|
|
HEAPF32[$15>>2] = $$sink138;
|
|
HEAPF32[$$sroa$2$0$$sroa_idx2>>2] = $$sink;
|
|
$201 = HEAP32[$47>>2]|0;
|
|
$202 = ($201|0)==(0);
|
|
if (!($202)) {
|
|
$203 = +HEAPF32[$21>>2];
|
|
$204 = +HEAPF32[$15>>2];
|
|
$205 = $203 * $204;
|
|
$206 = +HEAPF32[$34>>2];
|
|
$207 = $206 - $205;
|
|
HEAPF32[$34>>2] = $207;
|
|
$208 = +HEAPF32[$$sroa$2$0$$sroa_idx2>>2];
|
|
$209 = $203 * $208;
|
|
$210 = +HEAPF32[$38>>2];
|
|
$211 = $210 - $209;
|
|
HEAPF32[$38>>2] = $211;
|
|
$212 = HEAP32[$54>>2]|0;
|
|
$213 = ($212|0)==(0);
|
|
if ($213) {
|
|
$214 = +HEAPF32[$42>>2];
|
|
$215 = +HEAPF32[$15>>2];
|
|
$216 = -$215;
|
|
HEAPF32[$16>>2] = $216;
|
|
$217 = +HEAPF32[$$sroa$2$0$$sroa_idx2>>2];
|
|
$218 = -$217;
|
|
HEAPF32[$55>>2] = $218;
|
|
;HEAP32[$$byval_copy29>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy29+4>>2]=HEAP32[$1+4>>2]|0;
|
|
;HEAP32[$tmpcast137$byval_copy>>2]=HEAP32[$16>>2]|0;HEAP32[$tmpcast137$byval_copy+4>>2]=HEAP32[$16+4>>2]|0;
|
|
$219 = (+_MathCrossVector2($$byval_copy29,$tmpcast137$byval_copy));
|
|
$220 = $214 * $219;
|
|
$221 = +HEAPF32[$35>>2];
|
|
$222 = $221 + $220;
|
|
HEAPF32[$35>>2] = $222;
|
|
}
|
|
}
|
|
$223 = HEAP32[$48>>2]|0;
|
|
$224 = ($223|0)==(0);
|
|
if (!($224)) {
|
|
$225 = +HEAPF32[$23>>2];
|
|
$226 = +HEAPF32[$15>>2];
|
|
$227 = $225 * $226;
|
|
$228 = +HEAPF32[$32>>2];
|
|
$229 = $228 + $227;
|
|
HEAPF32[$32>>2] = $229;
|
|
$230 = +HEAPF32[$$sroa$2$0$$sroa_idx2>>2];
|
|
$231 = $225 * $230;
|
|
$232 = +HEAPF32[$36>>2];
|
|
$233 = $232 + $231;
|
|
HEAPF32[$36>>2] = $233;
|
|
$234 = HEAP32[$53>>2]|0;
|
|
$235 = ($234|0)==(0);
|
|
if ($235) {
|
|
$236 = +HEAPF32[$43>>2];
|
|
;HEAP32[$$byval_copy29>>2]=HEAP32[$2>>2]|0;HEAP32[$$byval_copy29+4>>2]=HEAP32[$2+4>>2]|0;
|
|
;HEAP32[$tmpcast137$byval_copy>>2]=HEAP32[$15>>2]|0;HEAP32[$tmpcast137$byval_copy+4>>2]=HEAP32[$15+4>>2]|0;
|
|
$237 = (+_MathCrossVector2($$byval_copy29,$tmpcast137$byval_copy));
|
|
$238 = $236 * $237;
|
|
$239 = +HEAPF32[$33>>2];
|
|
$240 = $239 + $238;
|
|
HEAPF32[$33>>2] = $240;
|
|
}
|
|
}
|
|
$$0 = 0;
|
|
} else {
|
|
$$0 = 1;
|
|
}
|
|
$$1 = $$0;
|
|
}
|
|
$cond1 = ($$1|0)==(0);
|
|
$62 = (($$0135139) + 1)|0;
|
|
if (!($cond1)) {
|
|
label = 26;
|
|
break;
|
|
}
|
|
$60 = HEAP32[$27>>2]|0;
|
|
$61 = ($62>>>0)<($60>>>0);
|
|
if ($61) {
|
|
$$0135139 = $62;
|
|
} else {
|
|
label = 26;
|
|
break;
|
|
}
|
|
}
|
|
if ((label|0) == 26) {
|
|
STACKTOP = sp;return;
|
|
}
|
|
}
|
|
function _IntegratePhysicsVelocity($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0, $19 = 0.0, $2 = 0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0.0;
|
|
var $28 = 0.0, $29 = 0.0, $3 = 0, $30 = 0, $31 = 0.0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0, $36 = 0, $37 = 0.0, $4 = 0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = ((($0)) + 4|0);
|
|
$2 = HEAP32[$1>>2]|0;
|
|
$3 = ($2|0)==(0);
|
|
if ($3) {
|
|
return;
|
|
}
|
|
$4 = ((($0)) + 16|0);
|
|
$5 = +HEAPF32[$4>>2];
|
|
$6 = $5;
|
|
$7 = +HEAPF64[1750];
|
|
$8 = $6 * $7;
|
|
$9 = ((($0)) + 8|0);
|
|
$10 = +HEAPF32[$9>>2];
|
|
$11 = $10;
|
|
$12 = $8 + $11;
|
|
$13 = $12;
|
|
HEAPF32[$9>>2] = $13;
|
|
$14 = ((($0)) + 20|0);
|
|
$15 = +HEAPF32[$14>>2];
|
|
$16 = $15;
|
|
$17 = $7 * $16;
|
|
$18 = ((($0)) + 12|0);
|
|
$19 = +HEAPF32[$18>>2];
|
|
$20 = $19;
|
|
$21 = $20 + $17;
|
|
$22 = $21;
|
|
HEAPF32[$18>>2] = $22;
|
|
$23 = ((($0)) + 80|0);
|
|
$24 = HEAP32[$23>>2]|0;
|
|
$25 = ($24|0)==(0);
|
|
if ($25) {
|
|
$26 = ((($0)) + 32|0);
|
|
$27 = +HEAPF32[$26>>2];
|
|
$28 = $27;
|
|
$29 = $7 * $28;
|
|
$30 = ((($0)) + 40|0);
|
|
$31 = +HEAPF32[$30>>2];
|
|
$32 = $31;
|
|
$33 = $32 + $29;
|
|
$34 = $33;
|
|
HEAPF32[$30>>2] = $34;
|
|
}
|
|
$35 = ((($0)) + 484|0);
|
|
$36 = ((($0)) + 40|0);
|
|
$37 = +HEAPF32[$36>>2];
|
|
_Mat2Set($35,$37);
|
|
_IntegratePhysicsForces($0);
|
|
return;
|
|
}
|
|
function _CorrectPhysicsPositions($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $10 = 0, $11 = 0.0, $12 = 0, $13 = 0.0, $14 = 0.0, $15 = 0.0, $16 = 0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $2 = 0, $20 = 0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0, $25 = 0, $26 = 0, $27 = 0.0;
|
|
var $28 = 0, $29 = 0.0, $3 = 0, $30 = 0.0, $31 = 0.0, $32 = 0, $33 = 0.0, $34 = 0.0, $35 = 0, $36 = 0, $37 = 0, $38 = 0.0, $39 = 0.0, $4 = 0, $40 = 0, $41 = 0.0, $42 = 0.0, $43 = 0.0, $44 = 0, $45 = 0.0;
|
|
var $46 = 0.0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0.0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = ((($0)) + 4|0);
|
|
$2 = HEAP32[$1>>2]|0;
|
|
$3 = ((($0)) + 8|0);
|
|
$4 = HEAP32[$3>>2]|0;
|
|
$5 = ((($0)) + 12|0);
|
|
$6 = +HEAPF32[$5>>2];
|
|
$7 = $6 + -0.05000000074505806;
|
|
$8 = $7 > 0.0;
|
|
$9 = $8 ? $7 : 0.0;
|
|
$10 = ((($2)) + 56|0);
|
|
$11 = +HEAPF32[$10>>2];
|
|
$12 = ((($4)) + 56|0);
|
|
$13 = +HEAPF32[$12>>2];
|
|
$14 = $11 + $13;
|
|
$15 = $9 / $14;
|
|
$16 = ((($0)) + 16|0);
|
|
$17 = +HEAPF32[$16>>2];
|
|
$18 = $17 * $15;
|
|
$19 = $18 * 0.40000000596046448;
|
|
$20 = ((($0)) + 20|0);
|
|
$21 = +HEAPF32[$20>>2];
|
|
$22 = $15 * $21;
|
|
$23 = $22 * 0.40000000596046448;
|
|
$24 = ((($2)) + 4|0);
|
|
$25 = HEAP32[$24>>2]|0;
|
|
$26 = ($25|0)==(0);
|
|
if (!($26)) {
|
|
$27 = $11 * $19;
|
|
$28 = ((($2)) + 8|0);
|
|
$29 = +HEAPF32[$28>>2];
|
|
$30 = $29 - $27;
|
|
HEAPF32[$28>>2] = $30;
|
|
$31 = $11 * $23;
|
|
$32 = ((($2)) + 12|0);
|
|
$33 = +HEAPF32[$32>>2];
|
|
$34 = $33 - $31;
|
|
HEAPF32[$32>>2] = $34;
|
|
}
|
|
$35 = ((($4)) + 4|0);
|
|
$36 = HEAP32[$35>>2]|0;
|
|
$37 = ($36|0)==(0);
|
|
if ($37) {
|
|
return;
|
|
}
|
|
$38 = +HEAPF32[$12>>2];
|
|
$39 = $19 * $38;
|
|
$40 = ((($4)) + 8|0);
|
|
$41 = +HEAPF32[$40>>2];
|
|
$42 = $41 + $39;
|
|
HEAPF32[$40>>2] = $42;
|
|
$43 = $23 * $38;
|
|
$44 = ((($4)) + 12|0);
|
|
$45 = +HEAPF32[$44>>2];
|
|
$46 = $43 + $45;
|
|
HEAPF32[$44>>2] = $46;
|
|
return;
|
|
}
|
|
function _SolveCircleToCircle($0) {
|
|
$0 = $0|0;
|
|
var $$byval_copy = 0, $$byval_copy2 = 0, $$sroa$0$0$$sroa_idx = 0, $$sroa$02$0$$sroa_idx = 0, $$sroa$05$0$$sroa_idx = 0, $$sroa$2$0$$sroa_idx1 = 0, $$sroa$23$0$$sroa_idx4 = 0, $$sroa$26$0$$sroa_idx7 = 0, $1 = 0, $10 = 0.0, $11 = 0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $15 = 0, $16 = 0, $17 = 0.0, $18 = 0, $19 = 0, $2 = 0;
|
|
var $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0.0, $34 = 0, $35 = 0.0, $36 = 0.0, $37 = 0, $38 = 0.0;
|
|
var $39 = 0.0, $4 = 0, $40 = 0.0, $41 = 0.0, $42 = 0.0, $43 = 0.0, $44 = 0.0, $45 = 0, $46 = 0.0, $47 = 0.0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0.0, $53 = 0, $54 = 0, $6 = 0, $7 = 0;
|
|
var $8 = 0.0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
|
|
$$byval_copy2 = sp + 16|0;
|
|
$$byval_copy = sp + 8|0;
|
|
$1 = sp;
|
|
$2 = ((($0)) + 4|0);
|
|
$3 = HEAP32[$2>>2]|0;
|
|
$4 = ((($0)) + 8|0);
|
|
$5 = HEAP32[$4>>2]|0;
|
|
$6 = ((($5)) + 8|0);
|
|
$7 = ((($3)) + 8|0);
|
|
;HEAP32[$$byval_copy>>2]=HEAP32[$6>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$6+4>>2]|0;
|
|
;HEAP32[$$byval_copy2>>2]=HEAP32[$7>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$7+4>>2]|0;
|
|
_Vector2Subtract_4($1,$$byval_copy,$$byval_copy2);
|
|
;HEAP32[$$byval_copy2>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$1+4>>2]|0;
|
|
$8 = (+_MathLenSqr($$byval_copy2));
|
|
$9 = ((($3)) + 92|0);
|
|
$10 = +HEAPF32[$9>>2];
|
|
$11 = ((($5)) + 92|0);
|
|
$12 = +HEAPF32[$11>>2];
|
|
$13 = $10 + $12;
|
|
$14 = $13 * $13;
|
|
$15 = !($8 >= $14);
|
|
if (!($15)) {
|
|
$16 = ((($0)) + 40|0);
|
|
HEAP32[$16>>2] = 0;
|
|
STACKTOP = sp;return;
|
|
}
|
|
$17 = (+Math_sqrt((+$8)));
|
|
$18 = ((($0)) + 40|0);
|
|
HEAP32[$18>>2] = 1;
|
|
$19 = $17 == 0.0;
|
|
if ($19) {
|
|
$20 = HEAP32[$9>>2]|0;
|
|
$21 = ((($0)) + 12|0);
|
|
HEAP32[$21>>2] = $20;
|
|
$$sroa$05$0$$sroa_idx = ((($0)) + 16|0);
|
|
HEAPF32[$$sroa$05$0$$sroa_idx>>2] = 1.0;
|
|
$$sroa$26$0$$sroa_idx7 = ((($0)) + 20|0);
|
|
HEAPF32[$$sroa$26$0$$sroa_idx7>>2] = 0.0;
|
|
$22 = ((($0)) + 24|0);
|
|
$23 = $7;
|
|
$24 = $23;
|
|
$25 = HEAP32[$24>>2]|0;
|
|
$26 = (($23) + 4)|0;
|
|
$27 = $26;
|
|
$28 = HEAP32[$27>>2]|0;
|
|
$29 = $22;
|
|
$30 = $29;
|
|
HEAP32[$30>>2] = $25;
|
|
$31 = (($29) + 4)|0;
|
|
$32 = $31;
|
|
HEAP32[$32>>2] = $28;
|
|
} else {
|
|
$33 = $13 - $17;
|
|
$34 = ((($0)) + 12|0);
|
|
HEAPF32[$34>>2] = $33;
|
|
$35 = +HEAPF32[$1>>2];
|
|
$36 = $35 / $17;
|
|
$37 = ((($1)) + 4|0);
|
|
$38 = +HEAPF32[$37>>2];
|
|
$39 = $38 / $17;
|
|
$$sroa$02$0$$sroa_idx = ((($0)) + 16|0);
|
|
HEAPF32[$$sroa$02$0$$sroa_idx>>2] = $36;
|
|
$$sroa$23$0$$sroa_idx4 = ((($0)) + 20|0);
|
|
HEAPF32[$$sroa$23$0$$sroa_idx4>>2] = $39;
|
|
$40 = +HEAPF32[$9>>2];
|
|
$41 = $36 * $40;
|
|
$42 = +HEAPF32[$7>>2];
|
|
$43 = $41 + $42;
|
|
$44 = $39 * $40;
|
|
$45 = ((($3)) + 12|0);
|
|
$46 = +HEAPF32[$45>>2];
|
|
$47 = $44 + $46;
|
|
$$sroa$0$0$$sroa_idx = ((($0)) + 24|0);
|
|
HEAPF32[$$sroa$0$0$$sroa_idx>>2] = $43;
|
|
$$sroa$2$0$$sroa_idx1 = ((($0)) + 28|0);
|
|
HEAPF32[$$sroa$2$0$$sroa_idx1>>2] = $47;
|
|
}
|
|
$48 = ((($3)) + 76|0);
|
|
$49 = HEAP32[$48>>2]|0;
|
|
$50 = ($49|0)==(0);
|
|
if (!($50)) {
|
|
STACKTOP = sp;return;
|
|
}
|
|
$51 = ((($0)) + 20|0);
|
|
$52 = +HEAPF32[$51>>2];
|
|
$53 = $52 < 0.0;
|
|
$54 = $53&1;
|
|
HEAP32[$48>>2] = $54;
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _SolveCircleToPolygon($0) {
|
|
$0 = $0|0;
|
|
var $$0$lcssa = 0.0, $$0125 = 0.0, $$093$lcssa = 0, $$093124 = 0, $$097123 = 0, $$1 = 0.0, $$194 = 0, $$byval_copy41 = 0, $$sroa$0$0$$sroa_idx = 0, $$sroa$011$0$$sroa_idx = 0, $$sroa$014$0$$sroa_idx = 0, $$sroa$04$0$$sroa_idx = 0, $$sroa$2$0$$sroa_idx3 = 0, $$sroa$212$0$$sroa_idx13 = 0, $$sroa$215$0$$sroa_idx16 = 0, $$sroa$25$0$$sroa_idx6 = 0, $1 = 0, $10 = 0, $100 = 0.0, $101 = 0.0;
|
|
var $102 = 0, $103 = 0, $104 = 0.0, $105 = 0.0, $106 = 0.0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0;
|
|
var $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0;
|
|
var $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0.0;
|
|
var $157 = 0.0, $158 = 0.0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0;
|
|
var $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0;
|
|
var $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0;
|
|
var $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0.0, $219 = 0.0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0;
|
|
var $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0.0, $233 = 0.0, $234 = 0, $235 = 0.0, $236 = 0.0, $237 = 0.0, $238 = 0.0, $239 = 0.0, $24 = 0, $240 = 0.0, $241 = 0.0, $242 = 0, $243 = 0.0, $244 = 0.0, $25 = 0, $26 = 0;
|
|
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
|
|
var $45 = 0.0, $46 = 0.0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
|
|
var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0;
|
|
var $81 = 0.0, $82 = 0.0, $83 = 0, $84 = 0.0, $85 = 0.0, $86 = 0, $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0, $90 = 0.0, $91 = 0.0, $92 = 0, $93 = 0.0, $94 = 0.0, $95 = 0, $96 = 0, $97 = 0.0, $98 = 0.0, $99 = 0;
|
|
var $tmpcast104$byval_copy42 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 608|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(608|0);
|
|
$tmpcast104$byval_copy42 = sp + 584|0;
|
|
$$byval_copy41 = sp + 568|0;
|
|
$1 = sp + 24|0;
|
|
$2 = sp + 552|0;
|
|
$3 = sp + 544|0;
|
|
$4 = sp + 88|0;
|
|
$5 = sp + 536|0;
|
|
$6 = sp + 16|0;
|
|
$7 = sp + 8|0;
|
|
$8 = sp;
|
|
$9 = sp + 528|0;
|
|
$10 = sp + 520|0;
|
|
$11 = sp + 512|0;
|
|
$12 = sp + 504|0;
|
|
$13 = sp + 80|0;
|
|
$14 = sp + 72|0;
|
|
$15 = sp + 64|0;
|
|
$16 = sp + 56|0;
|
|
$17 = sp + 48|0;
|
|
$18 = sp + 40|0;
|
|
$19 = sp + 496|0;
|
|
$20 = sp + 32|0;
|
|
$21 = ((($0)) + 4|0);
|
|
$22 = HEAP32[$21>>2]|0;
|
|
$23 = ((($0)) + 8|0);
|
|
$24 = HEAP32[$23>>2]|0;
|
|
$25 = ((($0)) + 40|0);
|
|
HEAP32[$25>>2] = 0;
|
|
$26 = ((($22)) + 8|0);
|
|
$27 = $26;
|
|
$28 = $27;
|
|
$29 = HEAP32[$28>>2]|0;
|
|
$30 = (($27) + 4)|0;
|
|
$31 = $30;
|
|
$32 = HEAP32[$31>>2]|0;
|
|
$33 = $1;
|
|
$34 = $33;
|
|
HEAP32[$34>>2] = $29;
|
|
$35 = (($33) + 4)|0;
|
|
$36 = $35;
|
|
HEAP32[$36>>2] = $32;
|
|
$37 = ((($24)) + 96|0);
|
|
$38 = ((($24)) + 484|0);
|
|
;HEAP32[$tmpcast104$byval_copy42>>2]=HEAP32[$38>>2]|0;HEAP32[$tmpcast104$byval_copy42+4>>2]=HEAP32[$38+4>>2]|0;HEAP32[$tmpcast104$byval_copy42+8>>2]=HEAP32[$38+8>>2]|0;HEAP32[$tmpcast104$byval_copy42+12>>2]=HEAP32[$38+12>>2]|0;
|
|
_Mat2Transpose($2,$tmpcast104$byval_copy42);
|
|
$39 = ((($24)) + 8|0);
|
|
;HEAP32[$$byval_copy41>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy41+4>>2]=HEAP32[$1+4>>2]|0;
|
|
;HEAP32[$tmpcast104$byval_copy42>>2]=HEAP32[$39>>2]|0;HEAP32[$tmpcast104$byval_copy42+4>>2]=HEAP32[$39+4>>2]|0;
|
|
_Vector2Subtract_4($3,$$byval_copy41,$tmpcast104$byval_copy42);
|
|
;HEAP32[$$byval_copy41>>2]=HEAP32[$2>>2]|0;HEAP32[$$byval_copy41+4>>2]=HEAP32[$2+4>>2]|0;HEAP32[$$byval_copy41+8>>2]=HEAP32[$2+8>>2]|0;HEAP32[$$byval_copy41+12>>2]=HEAP32[$2+12>>2]|0;
|
|
;HEAP32[$tmpcast104$byval_copy42>>2]=HEAP32[$3>>2]|0;HEAP32[$tmpcast104$byval_copy42+4>>2]=HEAP32[$3+4>>2]|0;
|
|
_Mat2MultiplyVector2($1,$$byval_copy41,$tmpcast104$byval_copy42);
|
|
_memcpy(($4|0),($37|0),404)|0;
|
|
$40 = HEAP32[$4>>2]|0;
|
|
$41 = ($40|0)==(0);
|
|
L1: do {
|
|
if ($41) {
|
|
$$0$lcssa = -3.4028234663852886E+38;$$093$lcssa = 0;
|
|
} else {
|
|
$42 = ((($22)) + 92|0);
|
|
$$0125 = -3.4028234663852886E+38;$$093124 = 0;$$097123 = 0;
|
|
while(1) {
|
|
$43 = (((($4)) + 196|0) + ($$097123<<3)|0);
|
|
$44 = (((($4)) + 4|0) + ($$097123<<3)|0);
|
|
;HEAP32[$$byval_copy41>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy41+4>>2]=HEAP32[$1+4>>2]|0;
|
|
;HEAP32[$tmpcast104$byval_copy42>>2]=HEAP32[$44>>2]|0;HEAP32[$tmpcast104$byval_copy42+4>>2]=HEAP32[$44+4>>2]|0;
|
|
_Vector2Subtract_4($5,$$byval_copy41,$tmpcast104$byval_copy42);
|
|
;HEAP32[$$byval_copy41>>2]=HEAP32[$43>>2]|0;HEAP32[$$byval_copy41+4>>2]=HEAP32[$43+4>>2]|0;
|
|
;HEAP32[$tmpcast104$byval_copy42>>2]=HEAP32[$5>>2]|0;HEAP32[$tmpcast104$byval_copy42+4>>2]=HEAP32[$5+4>>2]|0;
|
|
$45 = (+_MathDot($$byval_copy41,$tmpcast104$byval_copy42));
|
|
$46 = +HEAPF32[$42>>2];
|
|
$47 = $45 > $46;
|
|
$48 = $45 > $$0125;
|
|
if ($47) {
|
|
break;
|
|
}
|
|
$$1 = $48 ? $45 : $$0125;
|
|
$$194 = $48 ? $$097123 : $$093124;
|
|
$49 = (($$097123) + 1)|0;
|
|
$50 = HEAP32[$4>>2]|0;
|
|
$51 = ($49>>>0)<($50>>>0);
|
|
if ($51) {
|
|
$$0125 = $$1;$$093124 = $$194;$$097123 = $49;
|
|
} else {
|
|
$$0$lcssa = $$1;$$093$lcssa = $$194;
|
|
break L1;
|
|
}
|
|
}
|
|
STACKTOP = sp;return;
|
|
}
|
|
} while(0);
|
|
$52 = (((($4)) + 4|0) + ($$093$lcssa<<3)|0);
|
|
$53 = $52;
|
|
$54 = $53;
|
|
$55 = HEAP32[$54>>2]|0;
|
|
$56 = (($53) + 4)|0;
|
|
$57 = $56;
|
|
$58 = HEAP32[$57>>2]|0;
|
|
$59 = $6;
|
|
$60 = $59;
|
|
HEAP32[$60>>2] = $55;
|
|
$61 = (($59) + 4)|0;
|
|
$62 = $61;
|
|
HEAP32[$62>>2] = $58;
|
|
$63 = (($$093$lcssa) + 1)|0;
|
|
$64 = HEAP32[$4>>2]|0;
|
|
$65 = ($63>>>0)<($64>>>0);
|
|
$66 = $65 ? $63 : 0;
|
|
$67 = (((($4)) + 4|0) + ($66<<3)|0);
|
|
$68 = $67;
|
|
$69 = $68;
|
|
$70 = HEAP32[$69>>2]|0;
|
|
$71 = (($68) + 4)|0;
|
|
$72 = $71;
|
|
$73 = HEAP32[$72>>2]|0;
|
|
$74 = $7;
|
|
$75 = $74;
|
|
HEAP32[$75>>2] = $70;
|
|
$76 = (($74) + 4)|0;
|
|
$77 = $76;
|
|
HEAP32[$77>>2] = $73;
|
|
$78 = $$0$lcssa < 9.9999999747524271E-7;
|
|
do {
|
|
if ($78) {
|
|
HEAP32[$25>>2] = 1;
|
|
$79 = ((($4)) + 388|0);
|
|
$80 = (((($4)) + 196|0) + ($$093$lcssa<<3)|0);
|
|
;HEAP32[$$byval_copy41>>2]=HEAP32[$79>>2]|0;HEAP32[$$byval_copy41+4>>2]=HEAP32[$79+4>>2]|0;HEAP32[$$byval_copy41+8>>2]=HEAP32[$79+8>>2]|0;HEAP32[$$byval_copy41+12>>2]=HEAP32[$79+12>>2]|0;
|
|
;HEAP32[$tmpcast104$byval_copy42>>2]=HEAP32[$80>>2]|0;HEAP32[$tmpcast104$byval_copy42+4>>2]=HEAP32[$80+4>>2]|0;
|
|
_Mat2MultiplyVector2($8,$$byval_copy41,$tmpcast104$byval_copy42);
|
|
$81 = +HEAPF32[$8>>2];
|
|
$82 = -$81;
|
|
$83 = ((($8)) + 4|0);
|
|
$84 = +HEAPF32[$83>>2];
|
|
$85 = -$84;
|
|
$$sroa$014$0$$sroa_idx = ((($0)) + 16|0);
|
|
HEAPF32[$$sroa$014$0$$sroa_idx>>2] = $82;
|
|
$$sroa$215$0$$sroa_idx16 = ((($0)) + 20|0);
|
|
HEAPF32[$$sroa$215$0$$sroa_idx16>>2] = $85;
|
|
$86 = ((($22)) + 92|0);
|
|
$87 = +HEAPF32[$86>>2];
|
|
$88 = $87 * $82;
|
|
$89 = +HEAPF32[$26>>2];
|
|
$90 = $88 + $89;
|
|
$91 = $87 * $85;
|
|
$92 = ((($22)) + 12|0);
|
|
$93 = +HEAPF32[$92>>2];
|
|
$94 = $91 + $93;
|
|
$$sroa$011$0$$sroa_idx = ((($0)) + 24|0);
|
|
HEAPF32[$$sroa$011$0$$sroa_idx>>2] = $90;
|
|
$$sroa$212$0$$sroa_idx13 = ((($0)) + 28|0);
|
|
HEAPF32[$$sroa$212$0$$sroa_idx13>>2] = $94;
|
|
$95 = HEAP32[$86>>2]|0;
|
|
$96 = ((($0)) + 12|0);
|
|
HEAP32[$96>>2] = $95;
|
|
} else {
|
|
;HEAP32[$$byval_copy41>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy41+4>>2]=HEAP32[$1+4>>2]|0;
|
|
;HEAP32[$tmpcast104$byval_copy42>>2]=HEAP32[$6>>2]|0;HEAP32[$tmpcast104$byval_copy42+4>>2]=HEAP32[$6+4>>2]|0;
|
|
_Vector2Subtract_4($9,$$byval_copy41,$tmpcast104$byval_copy42);
|
|
;HEAP32[$$byval_copy41>>2]=HEAP32[$7>>2]|0;HEAP32[$$byval_copy41+4>>2]=HEAP32[$7+4>>2]|0;
|
|
;HEAP32[$tmpcast104$byval_copy42>>2]=HEAP32[$6>>2]|0;HEAP32[$tmpcast104$byval_copy42+4>>2]=HEAP32[$6+4>>2]|0;
|
|
_Vector2Subtract_4($10,$$byval_copy41,$tmpcast104$byval_copy42);
|
|
;HEAP32[$$byval_copy41>>2]=HEAP32[$9>>2]|0;HEAP32[$$byval_copy41+4>>2]=HEAP32[$9+4>>2]|0;
|
|
;HEAP32[$tmpcast104$byval_copy42>>2]=HEAP32[$10>>2]|0;HEAP32[$tmpcast104$byval_copy42+4>>2]=HEAP32[$10+4>>2]|0;
|
|
$97 = (+_MathDot($$byval_copy41,$tmpcast104$byval_copy42));
|
|
;HEAP32[$$byval_copy41>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy41+4>>2]=HEAP32[$1+4>>2]|0;
|
|
;HEAP32[$tmpcast104$byval_copy42>>2]=HEAP32[$7>>2]|0;HEAP32[$tmpcast104$byval_copy42+4>>2]=HEAP32[$7+4>>2]|0;
|
|
_Vector2Subtract_4($11,$$byval_copy41,$tmpcast104$byval_copy42);
|
|
;HEAP32[$$byval_copy41>>2]=HEAP32[$6>>2]|0;HEAP32[$$byval_copy41+4>>2]=HEAP32[$6+4>>2]|0;
|
|
;HEAP32[$tmpcast104$byval_copy42>>2]=HEAP32[$7>>2]|0;HEAP32[$tmpcast104$byval_copy42+4>>2]=HEAP32[$7+4>>2]|0;
|
|
_Vector2Subtract_4($12,$$byval_copy41,$tmpcast104$byval_copy42);
|
|
;HEAP32[$$byval_copy41>>2]=HEAP32[$11>>2]|0;HEAP32[$$byval_copy41+4>>2]=HEAP32[$11+4>>2]|0;
|
|
;HEAP32[$tmpcast104$byval_copy42>>2]=HEAP32[$12>>2]|0;HEAP32[$tmpcast104$byval_copy42+4>>2]=HEAP32[$12+4>>2]|0;
|
|
$98 = (+_MathDot($$byval_copy41,$tmpcast104$byval_copy42));
|
|
$99 = ((($22)) + 92|0);
|
|
$100 = +HEAPF32[$99>>2];
|
|
$101 = $100 - $$0$lcssa;
|
|
$102 = ((($0)) + 12|0);
|
|
HEAPF32[$102>>2] = $101;
|
|
$103 = !($97 <= 0.0);
|
|
if (!($103)) {
|
|
;HEAP32[$$byval_copy41>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy41+4>>2]=HEAP32[$1+4>>2]|0;
|
|
;HEAP32[$tmpcast104$byval_copy42>>2]=HEAP32[$6>>2]|0;HEAP32[$tmpcast104$byval_copy42+4>>2]=HEAP32[$6+4>>2]|0;
|
|
$104 = (+_DistSqr($$byval_copy41,$tmpcast104$byval_copy42));
|
|
$105 = +HEAPF32[$99>>2];
|
|
$106 = $105 * $105;
|
|
$107 = $104 > $106;
|
|
if ($107) {
|
|
break;
|
|
}
|
|
HEAP32[$25>>2] = 1;
|
|
;HEAP32[$$byval_copy41>>2]=HEAP32[$6>>2]|0;HEAP32[$$byval_copy41+4>>2]=HEAP32[$6+4>>2]|0;
|
|
;HEAP32[$tmpcast104$byval_copy42>>2]=HEAP32[$1>>2]|0;HEAP32[$tmpcast104$byval_copy42+4>>2]=HEAP32[$1+4>>2]|0;
|
|
_Vector2Subtract_4($8,$$byval_copy41,$tmpcast104$byval_copy42);
|
|
$108 = ((($4)) + 388|0);
|
|
;HEAP32[$$byval_copy41>>2]=HEAP32[$108>>2]|0;HEAP32[$$byval_copy41+4>>2]=HEAP32[$108+4>>2]|0;HEAP32[$$byval_copy41+8>>2]=HEAP32[$108+8>>2]|0;HEAP32[$$byval_copy41+12>>2]=HEAP32[$108+12>>2]|0;
|
|
;HEAP32[$tmpcast104$byval_copy42>>2]=HEAP32[$8>>2]|0;HEAP32[$tmpcast104$byval_copy42+4>>2]=HEAP32[$8+4>>2]|0;
|
|
_Mat2MultiplyVector2($13,$$byval_copy41,$tmpcast104$byval_copy42);
|
|
$109 = $13;
|
|
$110 = $109;
|
|
$111 = HEAP32[$110>>2]|0;
|
|
$112 = (($109) + 4)|0;
|
|
$113 = $112;
|
|
$114 = HEAP32[$113>>2]|0;
|
|
$115 = $8;
|
|
$116 = $115;
|
|
HEAP32[$116>>2] = $111;
|
|
$117 = (($115) + 4)|0;
|
|
$118 = $117;
|
|
HEAP32[$118>>2] = $114;
|
|
_MathNormalize($8);
|
|
$119 = ((($0)) + 16|0);
|
|
$120 = $8;
|
|
$121 = $120;
|
|
$122 = HEAP32[$121>>2]|0;
|
|
$123 = (($120) + 4)|0;
|
|
$124 = $123;
|
|
$125 = HEAP32[$124>>2]|0;
|
|
$126 = $119;
|
|
$127 = $126;
|
|
HEAP32[$127>>2] = $122;
|
|
$128 = (($126) + 4)|0;
|
|
$129 = $128;
|
|
HEAP32[$129>>2] = $125;
|
|
;HEAP32[$$byval_copy41>>2]=HEAP32[$108>>2]|0;HEAP32[$$byval_copy41+4>>2]=HEAP32[$108+4>>2]|0;HEAP32[$$byval_copy41+8>>2]=HEAP32[$108+8>>2]|0;HEAP32[$$byval_copy41+12>>2]=HEAP32[$108+12>>2]|0;
|
|
;HEAP32[$tmpcast104$byval_copy42>>2]=HEAP32[$6>>2]|0;HEAP32[$tmpcast104$byval_copy42+4>>2]=HEAP32[$6+4>>2]|0;
|
|
_Mat2MultiplyVector2($14,$$byval_copy41,$tmpcast104$byval_copy42);
|
|
$130 = $14;
|
|
$131 = $130;
|
|
$132 = HEAP32[$131>>2]|0;
|
|
$133 = (($130) + 4)|0;
|
|
$134 = $133;
|
|
$135 = HEAP32[$134>>2]|0;
|
|
$136 = $6;
|
|
$137 = $136;
|
|
HEAP32[$137>>2] = $132;
|
|
$138 = (($136) + 4)|0;
|
|
$139 = $138;
|
|
HEAP32[$139>>2] = $135;
|
|
;HEAP32[$$byval_copy41>>2]=HEAP32[$6>>2]|0;HEAP32[$$byval_copy41+4>>2]=HEAP32[$6+4>>2]|0;
|
|
;HEAP32[$tmpcast104$byval_copy42>>2]=HEAP32[$39>>2]|0;HEAP32[$tmpcast104$byval_copy42+4>>2]=HEAP32[$39+4>>2]|0;
|
|
_Vector2Add_2($15,$$byval_copy41,$tmpcast104$byval_copy42);
|
|
$140 = $15;
|
|
$141 = $140;
|
|
$142 = HEAP32[$141>>2]|0;
|
|
$143 = (($140) + 4)|0;
|
|
$144 = $143;
|
|
$145 = HEAP32[$144>>2]|0;
|
|
$146 = $6;
|
|
$147 = $146;
|
|
HEAP32[$147>>2] = $142;
|
|
$148 = (($146) + 4)|0;
|
|
$149 = $148;
|
|
HEAP32[$149>>2] = $145;
|
|
$150 = ((($0)) + 24|0);
|
|
$151 = $150;
|
|
$152 = $151;
|
|
HEAP32[$152>>2] = $142;
|
|
$153 = (($151) + 4)|0;
|
|
$154 = $153;
|
|
HEAP32[$154>>2] = $145;
|
|
break;
|
|
}
|
|
$155 = !($98 <= 0.0);
|
|
if (!($155)) {
|
|
;HEAP32[$$byval_copy41>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy41+4>>2]=HEAP32[$1+4>>2]|0;
|
|
;HEAP32[$tmpcast104$byval_copy42>>2]=HEAP32[$7>>2]|0;HEAP32[$tmpcast104$byval_copy42+4>>2]=HEAP32[$7+4>>2]|0;
|
|
$156 = (+_DistSqr($$byval_copy41,$tmpcast104$byval_copy42));
|
|
$157 = +HEAPF32[$99>>2];
|
|
$158 = $157 * $157;
|
|
$159 = $156 > $158;
|
|
if ($159) {
|
|
break;
|
|
}
|
|
HEAP32[$25>>2] = 1;
|
|
;HEAP32[$$byval_copy41>>2]=HEAP32[$7>>2]|0;HEAP32[$$byval_copy41+4>>2]=HEAP32[$7+4>>2]|0;
|
|
;HEAP32[$tmpcast104$byval_copy42>>2]=HEAP32[$1>>2]|0;HEAP32[$tmpcast104$byval_copy42+4>>2]=HEAP32[$1+4>>2]|0;
|
|
_Vector2Subtract_4($8,$$byval_copy41,$tmpcast104$byval_copy42);
|
|
$160 = ((($4)) + 388|0);
|
|
;HEAP32[$$byval_copy41>>2]=HEAP32[$160>>2]|0;HEAP32[$$byval_copy41+4>>2]=HEAP32[$160+4>>2]|0;HEAP32[$$byval_copy41+8>>2]=HEAP32[$160+8>>2]|0;HEAP32[$$byval_copy41+12>>2]=HEAP32[$160+12>>2]|0;
|
|
;HEAP32[$tmpcast104$byval_copy42>>2]=HEAP32[$7>>2]|0;HEAP32[$tmpcast104$byval_copy42+4>>2]=HEAP32[$7+4>>2]|0;
|
|
_Mat2MultiplyVector2($16,$$byval_copy41,$tmpcast104$byval_copy42);
|
|
$161 = $16;
|
|
$162 = $161;
|
|
$163 = HEAP32[$162>>2]|0;
|
|
$164 = (($161) + 4)|0;
|
|
$165 = $164;
|
|
$166 = HEAP32[$165>>2]|0;
|
|
$167 = $7;
|
|
$168 = $167;
|
|
HEAP32[$168>>2] = $163;
|
|
$169 = (($167) + 4)|0;
|
|
$170 = $169;
|
|
HEAP32[$170>>2] = $166;
|
|
;HEAP32[$$byval_copy41>>2]=HEAP32[$7>>2]|0;HEAP32[$$byval_copy41+4>>2]=HEAP32[$7+4>>2]|0;
|
|
;HEAP32[$tmpcast104$byval_copy42>>2]=HEAP32[$39>>2]|0;HEAP32[$tmpcast104$byval_copy42+4>>2]=HEAP32[$39+4>>2]|0;
|
|
_Vector2Add_2($17,$$byval_copy41,$tmpcast104$byval_copy42);
|
|
$171 = $17;
|
|
$172 = $171;
|
|
$173 = HEAP32[$172>>2]|0;
|
|
$174 = (($171) + 4)|0;
|
|
$175 = $174;
|
|
$176 = HEAP32[$175>>2]|0;
|
|
$177 = $7;
|
|
$178 = $177;
|
|
HEAP32[$178>>2] = $173;
|
|
$179 = (($177) + 4)|0;
|
|
$180 = $179;
|
|
HEAP32[$180>>2] = $176;
|
|
$181 = ((($0)) + 24|0);
|
|
$182 = $181;
|
|
$183 = $182;
|
|
HEAP32[$183>>2] = $173;
|
|
$184 = (($182) + 4)|0;
|
|
$185 = $184;
|
|
HEAP32[$185>>2] = $176;
|
|
;HEAP32[$$byval_copy41>>2]=HEAP32[$160>>2]|0;HEAP32[$$byval_copy41+4>>2]=HEAP32[$160+4>>2]|0;HEAP32[$$byval_copy41+8>>2]=HEAP32[$160+8>>2]|0;HEAP32[$$byval_copy41+12>>2]=HEAP32[$160+12>>2]|0;
|
|
;HEAP32[$tmpcast104$byval_copy42>>2]=HEAP32[$8>>2]|0;HEAP32[$tmpcast104$byval_copy42+4>>2]=HEAP32[$8+4>>2]|0;
|
|
_Mat2MultiplyVector2($18,$$byval_copy41,$tmpcast104$byval_copy42);
|
|
$186 = $18;
|
|
$187 = $186;
|
|
$188 = HEAP32[$187>>2]|0;
|
|
$189 = (($186) + 4)|0;
|
|
$190 = $189;
|
|
$191 = HEAP32[$190>>2]|0;
|
|
$192 = $8;
|
|
$193 = $192;
|
|
HEAP32[$193>>2] = $188;
|
|
$194 = (($192) + 4)|0;
|
|
$195 = $194;
|
|
HEAP32[$195>>2] = $191;
|
|
_MathNormalize($8);
|
|
$196 = ((($0)) + 16|0);
|
|
$197 = $8;
|
|
$198 = $197;
|
|
$199 = HEAP32[$198>>2]|0;
|
|
$200 = (($197) + 4)|0;
|
|
$201 = $200;
|
|
$202 = HEAP32[$201>>2]|0;
|
|
$203 = $196;
|
|
$204 = $203;
|
|
HEAP32[$204>>2] = $199;
|
|
$205 = (($203) + 4)|0;
|
|
$206 = $205;
|
|
HEAP32[$206>>2] = $202;
|
|
break;
|
|
}
|
|
$207 = (((($4)) + 196|0) + ($$093$lcssa<<3)|0);
|
|
$208 = $207;
|
|
$209 = $208;
|
|
$210 = HEAP32[$209>>2]|0;
|
|
$211 = (($208) + 4)|0;
|
|
$212 = $211;
|
|
$213 = HEAP32[$212>>2]|0;
|
|
$214 = $8;
|
|
$215 = $214;
|
|
HEAP32[$215>>2] = $210;
|
|
$216 = (($214) + 4)|0;
|
|
$217 = $216;
|
|
HEAP32[$217>>2] = $213;
|
|
;HEAP32[$$byval_copy41>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy41+4>>2]=HEAP32[$1+4>>2]|0;
|
|
;HEAP32[$tmpcast104$byval_copy42>>2]=HEAP32[$6>>2]|0;HEAP32[$tmpcast104$byval_copy42+4>>2]=HEAP32[$6+4>>2]|0;
|
|
_Vector2Subtract_4($19,$$byval_copy41,$tmpcast104$byval_copy42);
|
|
;HEAP32[$$byval_copy41>>2]=HEAP32[$19>>2]|0;HEAP32[$$byval_copy41+4>>2]=HEAP32[$19+4>>2]|0;
|
|
;HEAP32[$tmpcast104$byval_copy42>>2]=HEAP32[$8>>2]|0;HEAP32[$tmpcast104$byval_copy42+4>>2]=HEAP32[$8+4>>2]|0;
|
|
$218 = (+_MathDot($$byval_copy41,$tmpcast104$byval_copy42));
|
|
$219 = +HEAPF32[$99>>2];
|
|
$220 = $218 > $219;
|
|
if ($220) {
|
|
break;
|
|
} else {
|
|
$221 = ((($4)) + 388|0);
|
|
;HEAP32[$$byval_copy41>>2]=HEAP32[$221>>2]|0;HEAP32[$$byval_copy41+4>>2]=HEAP32[$221+4>>2]|0;HEAP32[$$byval_copy41+8>>2]=HEAP32[$221+8>>2]|0;HEAP32[$$byval_copy41+12>>2]=HEAP32[$221+12>>2]|0;
|
|
;HEAP32[$tmpcast104$byval_copy42>>2]=HEAP32[$8>>2]|0;HEAP32[$tmpcast104$byval_copy42+4>>2]=HEAP32[$8+4>>2]|0;
|
|
_Mat2MultiplyVector2($20,$$byval_copy41,$tmpcast104$byval_copy42);
|
|
$222 = $20;
|
|
$223 = $222;
|
|
$224 = HEAP32[$223>>2]|0;
|
|
$225 = (($222) + 4)|0;
|
|
$226 = $225;
|
|
$227 = HEAP32[$226>>2]|0;
|
|
$228 = $8;
|
|
$229 = $228;
|
|
HEAP32[$229>>2] = $224;
|
|
$230 = (($228) + 4)|0;
|
|
$231 = $230;
|
|
HEAP32[$231>>2] = $227;
|
|
$232 = +HEAPF32[$8>>2];
|
|
$233 = -$232;
|
|
$234 = ((($8)) + 4|0);
|
|
$235 = +HEAPF32[$234>>2];
|
|
$236 = -$235;
|
|
$$sroa$04$0$$sroa_idx = ((($0)) + 16|0);
|
|
HEAPF32[$$sroa$04$0$$sroa_idx>>2] = $233;
|
|
$$sroa$25$0$$sroa_idx6 = ((($0)) + 20|0);
|
|
HEAPF32[$$sroa$25$0$$sroa_idx6>>2] = $236;
|
|
$237 = +HEAPF32[$99>>2];
|
|
$238 = $237 * $233;
|
|
$239 = +HEAPF32[$26>>2];
|
|
$240 = $238 + $239;
|
|
$241 = $237 * $236;
|
|
$242 = ((($22)) + 12|0);
|
|
$243 = +HEAPF32[$242>>2];
|
|
$244 = $241 + $243;
|
|
$$sroa$0$0$$sroa_idx = ((($0)) + 24|0);
|
|
HEAPF32[$$sroa$0$0$$sroa_idx>>2] = $240;
|
|
$$sroa$2$0$$sroa_idx3 = ((($0)) + 28|0);
|
|
HEAPF32[$$sroa$2$0$$sroa_idx3>>2] = $244;
|
|
HEAP32[$25>>2] = 1;
|
|
break;
|
|
}
|
|
}
|
|
} while(0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _SolvePolygonToCircle($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $10 = 0.0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0.0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = ((($0)) + 4|0);
|
|
$2 = HEAP32[$1>>2]|0;
|
|
$3 = ((($0)) + 8|0);
|
|
$4 = HEAP32[$3>>2]|0;
|
|
HEAP32[$1>>2] = $4;
|
|
HEAP32[$3>>2] = $2;
|
|
_SolveCircleToPolygon($0);
|
|
$5 = ((($0)) + 16|0);
|
|
$6 = +HEAPF32[$5>>2];
|
|
$7 = -$6;
|
|
HEAPF32[$5>>2] = $7;
|
|
$8 = ((($0)) + 20|0);
|
|
$9 = +HEAPF32[$8>>2];
|
|
$10 = -$9;
|
|
HEAPF32[$8>>2] = $10;
|
|
return;
|
|
}
|
|
function _SolvePolygonToPolygon($0) {
|
|
$0 = $0|0;
|
|
var $$0 = 0, $$051 = 0, $$051$in = 0, $$052 = 0, $$1 = 0, $$byval_copy24 = 0, $$sink = 0.0, $$sroa$0$0$$sroa_idx = 0, $$sroa$2$0$$sroa_idx12 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0.0;
|
|
var $109 = 0.0, $11 = 0, $110 = 0.0, $111 = 0.0, $112 = 0.0, $113 = 0.0, $114 = 0.0, $115 = 0.0, $116 = 0, $117 = 0.0, $118 = 0.0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0.0, $125 = 0.0, $126 = 0.0;
|
|
var $127 = 0.0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0.0, $14 = 0, $140 = 0.0, $141 = 0, $142 = 0.0, $143 = 0, $144 = 0;
|
|
var $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0.0, $156 = 0.0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0;
|
|
var $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0.0, $17 = 0, $170 = 0.0, $171 = 0, $172 = 0.0, $173 = 0.0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
|
|
var $25 = 0.0, $26 = 0, $27 = 0.0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0;
|
|
var $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0;
|
|
var $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0;
|
|
var $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0;
|
|
var $98 = 0, $99 = 0, $tmpcast58$byval_copy23 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 3008|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(3008|0);
|
|
$$byval_copy24 = sp + 2584|0;
|
|
$tmpcast58$byval_copy23 = sp + 2168|0;
|
|
$1 = sp + 1744|0;
|
|
$2 = sp + 1328|0;
|
|
$3 = sp + 1324|0;
|
|
$4 = sp + 1320|0;
|
|
$5 = sp + 904|0;
|
|
$6 = sp + 488|0;
|
|
$7 = sp + 24|0;
|
|
$8 = sp + 80|0;
|
|
$9 = sp + 16|0;
|
|
$10 = sp + 8|0;
|
|
$11 = sp + 64|0;
|
|
$12 = sp + 56|0;
|
|
$13 = sp + 48|0;
|
|
$14 = sp + 40|0;
|
|
$15 = sp + 72|0;
|
|
$16 = sp;
|
|
$17 = sp + 2160|0;
|
|
$18 = ((($0)) + 4|0);
|
|
$19 = HEAP32[$18>>2]|0;
|
|
$20 = ((($19)) + 84|0);
|
|
_memcpy(($1|0),($20|0),416)|0;
|
|
$21 = ((($0)) + 8|0);
|
|
$22 = HEAP32[$21>>2]|0;
|
|
$23 = ((($22)) + 84|0);
|
|
_memcpy(($2|0),($23|0),416)|0;
|
|
$24 = ((($0)) + 40|0);
|
|
HEAP32[$24>>2] = 0;
|
|
HEAP32[$3>>2] = 0;
|
|
_memcpy(($tmpcast58$byval_copy23|0),($1|0),416)|0;
|
|
_memcpy(($$byval_copy24|0),($2|0),416)|0;
|
|
$25 = (+_FindAxisLeastPenetration($3,$tmpcast58$byval_copy23,$$byval_copy24));
|
|
$26 = !($25 >= 0.0);
|
|
if (!($26)) {
|
|
STACKTOP = sp;return;
|
|
}
|
|
HEAP32[$4>>2] = 0;
|
|
_memcpy(($tmpcast58$byval_copy23|0),($2|0),416)|0;
|
|
_memcpy(($$byval_copy24|0),($1|0),416)|0;
|
|
$27 = (+_FindAxisLeastPenetration($4,$tmpcast58$byval_copy23,$$byval_copy24));
|
|
$28 = !($27 >= 0.0);
|
|
if ($28) {
|
|
$29 = (_BiasGreaterThan($25,$27)|0);
|
|
$30 = ($29|0)==(0);
|
|
if ($30) {
|
|
_memcpy(($5|0),($2|0),416)|0;
|
|
_memcpy(($6|0),($1|0),416)|0;
|
|
$$051$in = $4;$$052 = 1;
|
|
} else {
|
|
_memcpy(($5|0),($1|0),416)|0;
|
|
_memcpy(($6|0),($2|0),416)|0;
|
|
$$051$in = $3;$$052 = 0;
|
|
}
|
|
$$051 = HEAP32[$$051$in>>2]|0;
|
|
$31 = ((($7)) + 8|0);
|
|
_memcpy(($tmpcast58$byval_copy23|0),($5|0),416)|0;
|
|
_memcpy(($$byval_copy24|0),($6|0),416)|0;
|
|
_FindIncidentFace($7,$31,$tmpcast58$byval_copy23,$$byval_copy24,$$051);
|
|
$32 = ((($5)) + 12|0);
|
|
_memcpy(($8|0),($32|0),404)|0;
|
|
$33 = (((($8)) + 4|0) + ($$051<<3)|0);
|
|
$34 = $33;
|
|
$35 = $34;
|
|
$36 = HEAP32[$35>>2]|0;
|
|
$37 = (($34) + 4)|0;
|
|
$38 = $37;
|
|
$39 = HEAP32[$38>>2]|0;
|
|
$40 = $9;
|
|
$41 = $40;
|
|
HEAP32[$41>>2] = $36;
|
|
$42 = (($40) + 4)|0;
|
|
$43 = $42;
|
|
HEAP32[$43>>2] = $39;
|
|
$44 = (($$051) + 1)|0;
|
|
$45 = HEAP32[$8>>2]|0;
|
|
$46 = ($44>>>0)<($45>>>0);
|
|
$47 = $46 ? $44 : 0;
|
|
$48 = (((($8)) + 4|0) + ($47<<3)|0);
|
|
$49 = $48;
|
|
$50 = $49;
|
|
$51 = HEAP32[$50>>2]|0;
|
|
$52 = (($49) + 4)|0;
|
|
$53 = $52;
|
|
$54 = HEAP32[$53>>2]|0;
|
|
$55 = $10;
|
|
$56 = $55;
|
|
HEAP32[$56>>2] = $51;
|
|
$57 = (($55) + 4)|0;
|
|
$58 = $57;
|
|
HEAP32[$58>>2] = $54;
|
|
$59 = ((($8)) + 388|0);
|
|
;HEAP32[$tmpcast58$byval_copy23>>2]=HEAP32[$59>>2]|0;HEAP32[$tmpcast58$byval_copy23+4>>2]=HEAP32[$59+4>>2]|0;HEAP32[$tmpcast58$byval_copy23+8>>2]=HEAP32[$59+8>>2]|0;HEAP32[$tmpcast58$byval_copy23+12>>2]=HEAP32[$59+12>>2]|0;
|
|
;HEAP32[$$byval_copy24>>2]=HEAP32[$9>>2]|0;HEAP32[$$byval_copy24+4>>2]=HEAP32[$9+4>>2]|0;
|
|
_Mat2MultiplyVector2($11,$tmpcast58$byval_copy23,$$byval_copy24);
|
|
$60 = $11;
|
|
$61 = $60;
|
|
$62 = HEAP32[$61>>2]|0;
|
|
$63 = (($60) + 4)|0;
|
|
$64 = $63;
|
|
$65 = HEAP32[$64>>2]|0;
|
|
$66 = $9;
|
|
$67 = $66;
|
|
HEAP32[$67>>2] = $62;
|
|
$68 = (($66) + 4)|0;
|
|
$69 = $68;
|
|
HEAP32[$69>>2] = $65;
|
|
$70 = ((($5)) + 4|0);
|
|
$71 = HEAP32[$70>>2]|0;
|
|
$72 = ((($71)) + 8|0);
|
|
;HEAP32[$tmpcast58$byval_copy23>>2]=HEAP32[$9>>2]|0;HEAP32[$tmpcast58$byval_copy23+4>>2]=HEAP32[$9+4>>2]|0;
|
|
;HEAP32[$$byval_copy24>>2]=HEAP32[$72>>2]|0;HEAP32[$$byval_copy24+4>>2]=HEAP32[$72+4>>2]|0;
|
|
_Vector2Add_2($12,$tmpcast58$byval_copy23,$$byval_copy24);
|
|
$73 = $12;
|
|
$74 = $73;
|
|
$75 = HEAP32[$74>>2]|0;
|
|
$76 = (($73) + 4)|0;
|
|
$77 = $76;
|
|
$78 = HEAP32[$77>>2]|0;
|
|
$79 = $9;
|
|
$80 = $79;
|
|
HEAP32[$80>>2] = $75;
|
|
$81 = (($79) + 4)|0;
|
|
$82 = $81;
|
|
HEAP32[$82>>2] = $78;
|
|
;HEAP32[$tmpcast58$byval_copy23>>2]=HEAP32[$59>>2]|0;HEAP32[$tmpcast58$byval_copy23+4>>2]=HEAP32[$59+4>>2]|0;HEAP32[$tmpcast58$byval_copy23+8>>2]=HEAP32[$59+8>>2]|0;HEAP32[$tmpcast58$byval_copy23+12>>2]=HEAP32[$59+12>>2]|0;
|
|
;HEAP32[$$byval_copy24>>2]=HEAP32[$10>>2]|0;HEAP32[$$byval_copy24+4>>2]=HEAP32[$10+4>>2]|0;
|
|
_Mat2MultiplyVector2($13,$tmpcast58$byval_copy23,$$byval_copy24);
|
|
$83 = $13;
|
|
$84 = $83;
|
|
$85 = HEAP32[$84>>2]|0;
|
|
$86 = (($83) + 4)|0;
|
|
$87 = $86;
|
|
$88 = HEAP32[$87>>2]|0;
|
|
$89 = $10;
|
|
$90 = $89;
|
|
HEAP32[$90>>2] = $85;
|
|
$91 = (($89) + 4)|0;
|
|
$92 = $91;
|
|
HEAP32[$92>>2] = $88;
|
|
$93 = HEAP32[$70>>2]|0;
|
|
$94 = ((($93)) + 8|0);
|
|
;HEAP32[$tmpcast58$byval_copy23>>2]=HEAP32[$10>>2]|0;HEAP32[$tmpcast58$byval_copy23+4>>2]=HEAP32[$10+4>>2]|0;
|
|
;HEAP32[$$byval_copy24>>2]=HEAP32[$94>>2]|0;HEAP32[$$byval_copy24+4>>2]=HEAP32[$94+4>>2]|0;
|
|
_Vector2Add_2($14,$tmpcast58$byval_copy23,$$byval_copy24);
|
|
$95 = $14;
|
|
$96 = $95;
|
|
$97 = HEAP32[$96>>2]|0;
|
|
$98 = (($95) + 4)|0;
|
|
$99 = $98;
|
|
$100 = HEAP32[$99>>2]|0;
|
|
$101 = $10;
|
|
$102 = $101;
|
|
HEAP32[$102>>2] = $97;
|
|
$103 = (($101) + 4)|0;
|
|
$104 = $103;
|
|
HEAP32[$104>>2] = $100;
|
|
;HEAP32[$tmpcast58$byval_copy23>>2]=HEAP32[$10>>2]|0;HEAP32[$tmpcast58$byval_copy23+4>>2]=HEAP32[$10+4>>2]|0;
|
|
;HEAP32[$$byval_copy24>>2]=HEAP32[$9>>2]|0;HEAP32[$$byval_copy24+4>>2]=HEAP32[$9+4>>2]|0;
|
|
_Vector2Subtract_4($15,$tmpcast58$byval_copy23,$$byval_copy24);
|
|
_MathNormalize($15);
|
|
$105 = ((($15)) + 4|0);
|
|
$106 = HEAP32[$105>>2]|0;
|
|
HEAP32[$16>>2] = $106;
|
|
$107 = ((($16)) + 4|0);
|
|
$108 = +HEAPF32[$15>>2];
|
|
$109 = -$108;
|
|
HEAPF32[$107>>2] = $109;
|
|
;HEAP32[$tmpcast58$byval_copy23>>2]=HEAP32[$16>>2]|0;HEAP32[$tmpcast58$byval_copy23+4>>2]=HEAP32[$16+4>>2]|0;
|
|
;HEAP32[$$byval_copy24>>2]=HEAP32[$9>>2]|0;HEAP32[$$byval_copy24+4>>2]=HEAP32[$9+4>>2]|0;
|
|
$110 = (+_MathDot($tmpcast58$byval_copy23,$$byval_copy24));
|
|
;HEAP32[$tmpcast58$byval_copy23>>2]=HEAP32[$15>>2]|0;HEAP32[$tmpcast58$byval_copy23+4>>2]=HEAP32[$15+4>>2]|0;
|
|
;HEAP32[$$byval_copy24>>2]=HEAP32[$9>>2]|0;HEAP32[$$byval_copy24+4>>2]=HEAP32[$9+4>>2]|0;
|
|
$111 = (+_MathDot($tmpcast58$byval_copy23,$$byval_copy24));
|
|
$112 = -$111;
|
|
;HEAP32[$tmpcast58$byval_copy23>>2]=HEAP32[$15>>2]|0;HEAP32[$tmpcast58$byval_copy23+4>>2]=HEAP32[$15+4>>2]|0;
|
|
;HEAP32[$$byval_copy24>>2]=HEAP32[$10>>2]|0;HEAP32[$$byval_copy24+4>>2]=HEAP32[$10+4>>2]|0;
|
|
$113 = (+_MathDot($tmpcast58$byval_copy23,$$byval_copy24));
|
|
$114 = +HEAPF32[$15>>2];
|
|
$115 = -$114;
|
|
HEAPF32[$17>>2] = $115;
|
|
$116 = ((($17)) + 4|0);
|
|
$117 = +HEAPF32[$105>>2];
|
|
$118 = -$117;
|
|
HEAPF32[$116>>2] = $118;
|
|
;HEAP32[$$byval_copy24>>2]=HEAP32[$17>>2]|0;HEAP32[$$byval_copy24+4>>2]=HEAP32[$17+4>>2]|0;
|
|
$119 = (_Clip($$byval_copy24,$112,$7,$31)|0);
|
|
$120 = ($119|0)<(2);
|
|
if (!($120)) {
|
|
;HEAP32[$$byval_copy24>>2]=HEAP32[$15>>2]|0;HEAP32[$$byval_copy24+4>>2]=HEAP32[$15+4>>2]|0;
|
|
$121 = (_Clip($$byval_copy24,$113,$7,$31)|0);
|
|
$122 = ($121|0)<(2);
|
|
if (!($122)) {
|
|
$123 = ($$052|0)==(0);
|
|
if ($123) {
|
|
$128 = ((($0)) + 16|0);
|
|
$129 = $16;
|
|
$130 = $129;
|
|
$131 = HEAP32[$130>>2]|0;
|
|
$132 = (($129) + 4)|0;
|
|
$133 = $132;
|
|
$134 = HEAP32[$133>>2]|0;
|
|
$135 = $128;
|
|
$136 = $135;
|
|
HEAP32[$136>>2] = $131;
|
|
$137 = (($135) + 4)|0;
|
|
$138 = $137;
|
|
HEAP32[$138>>2] = $134;
|
|
} else {
|
|
$124 = +HEAPF32[$16>>2];
|
|
$125 = -$124;
|
|
$126 = +HEAPF32[$107>>2];
|
|
$127 = -$126;
|
|
$$sroa$0$0$$sroa_idx = ((($0)) + 16|0);
|
|
HEAPF32[$$sroa$0$0$$sroa_idx>>2] = $125;
|
|
$$sroa$2$0$$sroa_idx12 = ((($0)) + 20|0);
|
|
HEAPF32[$$sroa$2$0$$sroa_idx12>>2] = $127;
|
|
}
|
|
;HEAP32[$tmpcast58$byval_copy23>>2]=HEAP32[$16>>2]|0;HEAP32[$tmpcast58$byval_copy23+4>>2]=HEAP32[$16+4>>2]|0;
|
|
;HEAP32[$$byval_copy24>>2]=HEAP32[$7>>2]|0;HEAP32[$$byval_copy24+4>>2]=HEAP32[$7+4>>2]|0;
|
|
$139 = (+_MathDot($tmpcast58$byval_copy23,$$byval_copy24));
|
|
$140 = $139 - $110;
|
|
$141 = !($140 <= 0.0);
|
|
if ($141) {
|
|
$$0 = 0;$$sink = 0.0;
|
|
} else {
|
|
$142 = -$140;
|
|
$143 = ((($0)) + 24|0);
|
|
$144 = $7;
|
|
$145 = $144;
|
|
$146 = HEAP32[$145>>2]|0;
|
|
$147 = (($144) + 4)|0;
|
|
$148 = $147;
|
|
$149 = HEAP32[$148>>2]|0;
|
|
$150 = $143;
|
|
$151 = $150;
|
|
HEAP32[$151>>2] = $146;
|
|
$152 = (($150) + 4)|0;
|
|
$153 = $152;
|
|
HEAP32[$153>>2] = $149;
|
|
$$0 = 1;$$sink = $142;
|
|
}
|
|
$154 = ((($0)) + 12|0);
|
|
HEAPF32[$154>>2] = $$sink;
|
|
;HEAP32[$tmpcast58$byval_copy23>>2]=HEAP32[$16>>2]|0;HEAP32[$tmpcast58$byval_copy23+4>>2]=HEAP32[$16+4>>2]|0;
|
|
;HEAP32[$$byval_copy24>>2]=HEAP32[$31>>2]|0;HEAP32[$$byval_copy24+4>>2]=HEAP32[$31+4>>2]|0;
|
|
$155 = (+_MathDot($tmpcast58$byval_copy23,$$byval_copy24));
|
|
$156 = $155 - $110;
|
|
$157 = !($156 <= 0.0);
|
|
if ($157) {
|
|
$$1 = $$0;
|
|
} else {
|
|
$158 = (((($0)) + 24|0) + ($$0<<3)|0);
|
|
$159 = $31;
|
|
$160 = $159;
|
|
$161 = HEAP32[$160>>2]|0;
|
|
$162 = (($159) + 4)|0;
|
|
$163 = $162;
|
|
$164 = HEAP32[$163>>2]|0;
|
|
$165 = $158;
|
|
$166 = $165;
|
|
HEAP32[$166>>2] = $161;
|
|
$167 = (($165) + 4)|0;
|
|
$168 = $167;
|
|
HEAP32[$168>>2] = $164;
|
|
$169 = +HEAPF32[$154>>2];
|
|
$170 = $169 - $156;
|
|
$171 = (($$0) + 1)|0;
|
|
$172 = (+($171|0));
|
|
$173 = $170 / $172;
|
|
HEAPF32[$154>>2] = $173;
|
|
$$1 = $171;
|
|
}
|
|
HEAP32[$24>>2] = $$1;
|
|
}
|
|
}
|
|
}
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _MathLenSqr($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0.0, $2 = 0.0, $3 = 0, $4 = 0.0, $5 = 0.0, $6 = 0.0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = +HEAPF32[$0>>2];
|
|
$2 = $1 * $1;
|
|
$3 = ((($0)) + 4|0);
|
|
$4 = +HEAPF32[$3>>2];
|
|
$5 = $4 * $4;
|
|
$6 = $2 + $5;
|
|
return (+$6);
|
|
}
|
|
function _Mat2Transpose($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $10 = 0, $11 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = HEAP32[$1>>2]|0;
|
|
HEAP32[$0>>2] = $2;
|
|
$3 = ((($0)) + 4|0);
|
|
$4 = ((($1)) + 8|0);
|
|
$5 = HEAP32[$4>>2]|0;
|
|
HEAP32[$3>>2] = $5;
|
|
$6 = ((($0)) + 8|0);
|
|
$7 = ((($1)) + 4|0);
|
|
$8 = HEAP32[$7>>2]|0;
|
|
HEAP32[$6>>2] = $8;
|
|
$9 = ((($0)) + 12|0);
|
|
$10 = ((($1)) + 12|0);
|
|
$11 = HEAP32[$10>>2]|0;
|
|
HEAP32[$9>>2] = $11;
|
|
return;
|
|
}
|
|
function _MathDot($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $10 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0, $6 = 0.0, $7 = 0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = +HEAPF32[$0>>2];
|
|
$3 = +HEAPF32[$1>>2];
|
|
$4 = $2 * $3;
|
|
$5 = ((($0)) + 4|0);
|
|
$6 = +HEAPF32[$5>>2];
|
|
$7 = ((($1)) + 4|0);
|
|
$8 = +HEAPF32[$7>>2];
|
|
$9 = $6 * $8;
|
|
$10 = $4 + $9;
|
|
return (+$10);
|
|
}
|
|
function _DistSqr($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$byval_copy2 = 0, $$byval_copy3 = 0, $2 = 0, $3 = 0.0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
|
|
$$byval_copy3 = sp + 16|0;
|
|
$$byval_copy2 = sp + 8|0;
|
|
$2 = sp;
|
|
;HEAP32[$$byval_copy2>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$0+4>>2]|0;
|
|
;HEAP32[$$byval_copy3>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy3+4>>2]=HEAP32[$1+4>>2]|0;
|
|
_Vector2Subtract_4($2,$$byval_copy2,$$byval_copy3);
|
|
;HEAP32[$$byval_copy2>>2]=HEAP32[$2>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$2+4>>2]|0;
|
|
;HEAP32[$$byval_copy3>>2]=HEAP32[$2>>2]|0;HEAP32[$$byval_copy3+4>>2]=HEAP32[$2+4>>2]|0;
|
|
$3 = (+_MathDot($$byval_copy2,$$byval_copy3));
|
|
STACKTOP = sp;return (+$3);
|
|
}
|
|
function _FindAxisLeastPenetration($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $$0$lcssa = 0.0, $$01727 = 0, $$018$lcssa = 0, $$01826 = 0, $$028 = 0.0, $$1 = 0.0, $$119 = 0, $$byval_copy16 = 0, $10 = 0, $100 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0;
|
|
var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0.0, $38 = 0.0, $39 = 0.0;
|
|
var $4 = 0, $40 = 0.0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0;
|
|
var $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0;
|
|
var $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0;
|
|
var $94 = 0, $95 = 0, $96 = 0.0, $97 = 0, $98 = 0, $99 = 0, $tmpcast$byval_copy15 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 1344|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(1344|0);
|
|
$$byval_copy16 = sp + 1320|0;
|
|
$tmpcast$byval_copy15 = sp + 904|0;
|
|
$3 = sp + 484|0;
|
|
$4 = sp + 80|0;
|
|
$5 = sp + 8|0;
|
|
$6 = sp + 72|0;
|
|
$7 = sp + 56|0;
|
|
$8 = sp + 48|0;
|
|
$9 = sp + 896|0;
|
|
$10 = sp;
|
|
$11 = sp + 40|0;
|
|
$12 = sp + 32|0;
|
|
$13 = sp + 24|0;
|
|
$14 = sp + 16|0;
|
|
$15 = sp + 888|0;
|
|
$16 = ((($1)) + 12|0);
|
|
_memcpy(($3|0),($16|0),404)|0;
|
|
$17 = ((($2)) + 12|0);
|
|
_memcpy(($4|0),($17|0),404)|0;
|
|
$18 = HEAP32[$3>>2]|0;
|
|
$19 = ($18|0)==(0);
|
|
if ($19) {
|
|
$$0$lcssa = -3.4028234663852886E+38;$$018$lcssa = 0;
|
|
HEAP32[$0>>2] = $$018$lcssa;
|
|
STACKTOP = sp;return (+$$0$lcssa);
|
|
}
|
|
$20 = ((($3)) + 388|0);
|
|
$21 = ((($4)) + 388|0);
|
|
$22 = ((($9)) + 4|0);
|
|
$23 = ((($5)) + 4|0);
|
|
$24 = ((($1)) + 4|0);
|
|
$25 = ((($2)) + 4|0);
|
|
$$01727 = 0;$$01826 = 0;$$028 = -3.4028234663852886E+38;
|
|
while(1) {
|
|
$26 = (((($3)) + 196|0) + ($$01727<<3)|0);
|
|
$27 = $26;
|
|
$28 = $27;
|
|
$29 = HEAP32[$28>>2]|0;
|
|
$30 = (($27) + 4)|0;
|
|
$31 = $30;
|
|
$32 = HEAP32[$31>>2]|0;
|
|
$33 = $5;
|
|
$34 = $33;
|
|
HEAP32[$34>>2] = $29;
|
|
$35 = (($33) + 4)|0;
|
|
$36 = $35;
|
|
HEAP32[$36>>2] = $32;
|
|
;HEAP32[$tmpcast$byval_copy15>>2]=HEAP32[$20>>2]|0;HEAP32[$tmpcast$byval_copy15+4>>2]=HEAP32[$20+4>>2]|0;HEAP32[$tmpcast$byval_copy15+8>>2]=HEAP32[$20+8>>2]|0;HEAP32[$tmpcast$byval_copy15+12>>2]=HEAP32[$20+12>>2]|0;
|
|
;HEAP32[$$byval_copy16>>2]=HEAP32[$5>>2]|0;HEAP32[$$byval_copy16+4>>2]=HEAP32[$5+4>>2]|0;
|
|
_Mat2MultiplyVector2($6,$tmpcast$byval_copy15,$$byval_copy16);
|
|
;HEAP32[$$byval_copy16>>2]=HEAP32[$21>>2]|0;HEAP32[$$byval_copy16+4>>2]=HEAP32[$21+4>>2]|0;HEAP32[$$byval_copy16+8>>2]=HEAP32[$21+8>>2]|0;HEAP32[$$byval_copy16+12>>2]=HEAP32[$21+12>>2]|0;
|
|
_Mat2Transpose($7,$$byval_copy16);
|
|
;HEAP32[$tmpcast$byval_copy15>>2]=HEAP32[$7>>2]|0;HEAP32[$tmpcast$byval_copy15+4>>2]=HEAP32[$7+4>>2]|0;HEAP32[$tmpcast$byval_copy15+8>>2]=HEAP32[$7+8>>2]|0;HEAP32[$tmpcast$byval_copy15+12>>2]=HEAP32[$7+12>>2]|0;
|
|
;HEAP32[$$byval_copy16>>2]=HEAP32[$6>>2]|0;HEAP32[$$byval_copy16+4>>2]=HEAP32[$6+4>>2]|0;
|
|
_Mat2MultiplyVector2($5,$tmpcast$byval_copy15,$$byval_copy16);
|
|
$37 = +HEAPF32[$5>>2];
|
|
$38 = -$37;
|
|
HEAPF32[$9>>2] = $38;
|
|
$39 = +HEAPF32[$23>>2];
|
|
$40 = -$39;
|
|
HEAPF32[$22>>2] = $40;
|
|
_memcpy(($tmpcast$byval_copy15|0),($2|0),416)|0;
|
|
;HEAP32[$$byval_copy16>>2]=HEAP32[$9>>2]|0;HEAP32[$$byval_copy16+4>>2]=HEAP32[$9+4>>2]|0;
|
|
_GetSupport($8,$tmpcast$byval_copy15,$$byval_copy16);
|
|
$41 = (((($3)) + 4|0) + ($$01727<<3)|0);
|
|
$42 = $41;
|
|
$43 = $42;
|
|
$44 = HEAP32[$43>>2]|0;
|
|
$45 = (($42) + 4)|0;
|
|
$46 = $45;
|
|
$47 = HEAP32[$46>>2]|0;
|
|
$48 = $10;
|
|
$49 = $48;
|
|
HEAP32[$49>>2] = $44;
|
|
$50 = (($48) + 4)|0;
|
|
$51 = $50;
|
|
HEAP32[$51>>2] = $47;
|
|
;HEAP32[$tmpcast$byval_copy15>>2]=HEAP32[$20>>2]|0;HEAP32[$tmpcast$byval_copy15+4>>2]=HEAP32[$20+4>>2]|0;HEAP32[$tmpcast$byval_copy15+8>>2]=HEAP32[$20+8>>2]|0;HEAP32[$tmpcast$byval_copy15+12>>2]=HEAP32[$20+12>>2]|0;
|
|
;HEAP32[$$byval_copy16>>2]=HEAP32[$10>>2]|0;HEAP32[$$byval_copy16+4>>2]=HEAP32[$10+4>>2]|0;
|
|
_Mat2MultiplyVector2($11,$tmpcast$byval_copy15,$$byval_copy16);
|
|
$52 = $11;
|
|
$53 = $52;
|
|
$54 = HEAP32[$53>>2]|0;
|
|
$55 = (($52) + 4)|0;
|
|
$56 = $55;
|
|
$57 = HEAP32[$56>>2]|0;
|
|
$58 = $10;
|
|
$59 = $58;
|
|
HEAP32[$59>>2] = $54;
|
|
$60 = (($58) + 4)|0;
|
|
$61 = $60;
|
|
HEAP32[$61>>2] = $57;
|
|
$62 = HEAP32[$24>>2]|0;
|
|
$63 = ((($62)) + 8|0);
|
|
;HEAP32[$tmpcast$byval_copy15>>2]=HEAP32[$10>>2]|0;HEAP32[$tmpcast$byval_copy15+4>>2]=HEAP32[$10+4>>2]|0;
|
|
;HEAP32[$$byval_copy16>>2]=HEAP32[$63>>2]|0;HEAP32[$$byval_copy16+4>>2]=HEAP32[$63+4>>2]|0;
|
|
_Vector2Add_2($12,$tmpcast$byval_copy15,$$byval_copy16);
|
|
$64 = $12;
|
|
$65 = $64;
|
|
$66 = HEAP32[$65>>2]|0;
|
|
$67 = (($64) + 4)|0;
|
|
$68 = $67;
|
|
$69 = HEAP32[$68>>2]|0;
|
|
$70 = $10;
|
|
$71 = $70;
|
|
HEAP32[$71>>2] = $66;
|
|
$72 = (($70) + 4)|0;
|
|
$73 = $72;
|
|
HEAP32[$73>>2] = $69;
|
|
$74 = HEAP32[$25>>2]|0;
|
|
$75 = ((($74)) + 8|0);
|
|
;HEAP32[$tmpcast$byval_copy15>>2]=HEAP32[$10>>2]|0;HEAP32[$tmpcast$byval_copy15+4>>2]=HEAP32[$10+4>>2]|0;
|
|
;HEAP32[$$byval_copy16>>2]=HEAP32[$75>>2]|0;HEAP32[$$byval_copy16+4>>2]=HEAP32[$75+4>>2]|0;
|
|
_Vector2Subtract_4($13,$tmpcast$byval_copy15,$$byval_copy16);
|
|
$76 = $13;
|
|
$77 = $76;
|
|
$78 = HEAP32[$77>>2]|0;
|
|
$79 = (($76) + 4)|0;
|
|
$80 = $79;
|
|
$81 = HEAP32[$80>>2]|0;
|
|
$82 = $10;
|
|
$83 = $82;
|
|
HEAP32[$83>>2] = $78;
|
|
$84 = (($82) + 4)|0;
|
|
$85 = $84;
|
|
HEAP32[$85>>2] = $81;
|
|
;HEAP32[$tmpcast$byval_copy15>>2]=HEAP32[$7>>2]|0;HEAP32[$tmpcast$byval_copy15+4>>2]=HEAP32[$7+4>>2]|0;HEAP32[$tmpcast$byval_copy15+8>>2]=HEAP32[$7+8>>2]|0;HEAP32[$tmpcast$byval_copy15+12>>2]=HEAP32[$7+12>>2]|0;
|
|
;HEAP32[$$byval_copy16>>2]=HEAP32[$10>>2]|0;HEAP32[$$byval_copy16+4>>2]=HEAP32[$10+4>>2]|0;
|
|
_Mat2MultiplyVector2($14,$tmpcast$byval_copy15,$$byval_copy16);
|
|
$86 = $14;
|
|
$87 = $86;
|
|
$88 = HEAP32[$87>>2]|0;
|
|
$89 = (($86) + 4)|0;
|
|
$90 = $89;
|
|
$91 = HEAP32[$90>>2]|0;
|
|
$92 = $10;
|
|
$93 = $92;
|
|
HEAP32[$93>>2] = $88;
|
|
$94 = (($92) + 4)|0;
|
|
$95 = $94;
|
|
HEAP32[$95>>2] = $91;
|
|
;HEAP32[$tmpcast$byval_copy15>>2]=HEAP32[$8>>2]|0;HEAP32[$tmpcast$byval_copy15+4>>2]=HEAP32[$8+4>>2]|0;
|
|
;HEAP32[$$byval_copy16>>2]=HEAP32[$10>>2]|0;HEAP32[$$byval_copy16+4>>2]=HEAP32[$10+4>>2]|0;
|
|
_Vector2Subtract_4($15,$tmpcast$byval_copy15,$$byval_copy16);
|
|
;HEAP32[$tmpcast$byval_copy15>>2]=HEAP32[$5>>2]|0;HEAP32[$tmpcast$byval_copy15+4>>2]=HEAP32[$5+4>>2]|0;
|
|
;HEAP32[$$byval_copy16>>2]=HEAP32[$15>>2]|0;HEAP32[$$byval_copy16+4>>2]=HEAP32[$15+4>>2]|0;
|
|
$96 = (+_MathDot($tmpcast$byval_copy15,$$byval_copy16));
|
|
$97 = $96 > $$028;
|
|
$$119 = $97 ? $$01727 : $$01826;
|
|
$$1 = $97 ? $96 : $$028;
|
|
$98 = (($$01727) + 1)|0;
|
|
$99 = HEAP32[$3>>2]|0;
|
|
$100 = ($98>>>0)<($99>>>0);
|
|
if ($100) {
|
|
$$01727 = $98;$$01826 = $$119;$$028 = $$1;
|
|
} else {
|
|
$$0$lcssa = $$1;$$018$lcssa = $$119;
|
|
break;
|
|
}
|
|
}
|
|
HEAP32[$0>>2] = $$018$lcssa;
|
|
STACKTOP = sp;return (+$$0$lcssa);
|
|
}
|
|
function _BiasGreaterThan($0,$1) {
|
|
$0 = +$0;
|
|
$1 = +$1;
|
|
var $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0, $6 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = $1 * 0.94999998807907104;
|
|
$3 = $0 * 0.0099999997764825821;
|
|
$4 = $3 + $2;
|
|
$5 = $4 <= $0;
|
|
$6 = $5&1;
|
|
return ($6|0);
|
|
}
|
|
function _FindIncidentFace($0,$1,$2,$3,$4) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
$4 = $4|0;
|
|
var $$0$lcssa = 0, $$02434 = 0, $$02533 = 0.0, $$035 = 0, $$1 = 0, $$126 = 0.0, $$byval_copy13 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0.0, $106 = 0, $107 = 0, $108 = 0, $11 = 0, $12 = 0, $13 = 0;
|
|
var $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0;
|
|
var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0;
|
|
var $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0;
|
|
var $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0;
|
|
var $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $tmpcast$byval_copy12 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 912|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(912|0);
|
|
$$byval_copy13 = sp + 896|0;
|
|
$tmpcast$byval_copy12 = sp + 880|0;
|
|
$5 = sp + 460|0;
|
|
$6 = sp + 56|0;
|
|
$7 = sp;
|
|
$8 = sp + 48|0;
|
|
$9 = sp + 864|0;
|
|
$10 = sp + 40|0;
|
|
$11 = sp + 32|0;
|
|
$12 = sp + 24|0;
|
|
$13 = sp + 16|0;
|
|
$14 = sp + 8|0;
|
|
$15 = ((($2)) + 12|0);
|
|
_memcpy(($5|0),($15|0),404)|0;
|
|
$16 = ((($3)) + 12|0);
|
|
_memcpy(($6|0),($16|0),404)|0;
|
|
$17 = (((($5)) + 196|0) + ($4<<3)|0);
|
|
$18 = $17;
|
|
$19 = $18;
|
|
$20 = HEAP32[$19>>2]|0;
|
|
$21 = (($18) + 4)|0;
|
|
$22 = $21;
|
|
$23 = HEAP32[$22>>2]|0;
|
|
$24 = $7;
|
|
$25 = $24;
|
|
HEAP32[$25>>2] = $20;
|
|
$26 = (($24) + 4)|0;
|
|
$27 = $26;
|
|
HEAP32[$27>>2] = $23;
|
|
$28 = ((($5)) + 388|0);
|
|
;HEAP32[$tmpcast$byval_copy12>>2]=HEAP32[$28>>2]|0;HEAP32[$tmpcast$byval_copy12+4>>2]=HEAP32[$28+4>>2]|0;HEAP32[$tmpcast$byval_copy12+8>>2]=HEAP32[$28+8>>2]|0;HEAP32[$tmpcast$byval_copy12+12>>2]=HEAP32[$28+12>>2]|0;
|
|
;HEAP32[$$byval_copy13>>2]=HEAP32[$7>>2]|0;HEAP32[$$byval_copy13+4>>2]=HEAP32[$7+4>>2]|0;
|
|
_Mat2MultiplyVector2($8,$tmpcast$byval_copy12,$$byval_copy13);
|
|
$29 = $8;
|
|
$30 = $29;
|
|
$31 = HEAP32[$30>>2]|0;
|
|
$32 = (($29) + 4)|0;
|
|
$33 = $32;
|
|
$34 = HEAP32[$33>>2]|0;
|
|
$35 = $7;
|
|
$36 = $35;
|
|
HEAP32[$36>>2] = $31;
|
|
$37 = (($35) + 4)|0;
|
|
$38 = $37;
|
|
HEAP32[$38>>2] = $34;
|
|
$39 = ((($6)) + 388|0);
|
|
;HEAP32[$$byval_copy13>>2]=HEAP32[$39>>2]|0;HEAP32[$$byval_copy13+4>>2]=HEAP32[$39+4>>2]|0;HEAP32[$$byval_copy13+8>>2]=HEAP32[$39+8>>2]|0;HEAP32[$$byval_copy13+12>>2]=HEAP32[$39+12>>2]|0;
|
|
_Mat2Transpose($9,$$byval_copy13);
|
|
;HEAP32[$tmpcast$byval_copy12>>2]=HEAP32[$9>>2]|0;HEAP32[$tmpcast$byval_copy12+4>>2]=HEAP32[$9+4>>2]|0;HEAP32[$tmpcast$byval_copy12+8>>2]=HEAP32[$9+8>>2]|0;HEAP32[$tmpcast$byval_copy12+12>>2]=HEAP32[$9+12>>2]|0;
|
|
;HEAP32[$$byval_copy13>>2]=HEAP32[$7>>2]|0;HEAP32[$$byval_copy13+4>>2]=HEAP32[$7+4>>2]|0;
|
|
_Mat2MultiplyVector2($10,$tmpcast$byval_copy12,$$byval_copy13);
|
|
$40 = $10;
|
|
$41 = $40;
|
|
$42 = HEAP32[$41>>2]|0;
|
|
$43 = (($40) + 4)|0;
|
|
$44 = $43;
|
|
$45 = HEAP32[$44>>2]|0;
|
|
$46 = $7;
|
|
$47 = $46;
|
|
HEAP32[$47>>2] = $42;
|
|
$48 = (($46) + 4)|0;
|
|
$49 = $48;
|
|
HEAP32[$49>>2] = $45;
|
|
$50 = HEAP32[$6>>2]|0;
|
|
$51 = ($50|0)==(0);
|
|
if ($51) {
|
|
$$0$lcssa = 0;
|
|
} else {
|
|
$52 = HEAP32[$6>>2]|0;
|
|
$$02434 = 0;$$02533 = 3.4028234663852886E+38;$$035 = 0;
|
|
while(1) {
|
|
$104 = (((($6)) + 196|0) + ($$02434<<3)|0);
|
|
;HEAP32[$tmpcast$byval_copy12>>2]=HEAP32[$7>>2]|0;HEAP32[$tmpcast$byval_copy12+4>>2]=HEAP32[$7+4>>2]|0;
|
|
;HEAP32[$$byval_copy13>>2]=HEAP32[$104>>2]|0;HEAP32[$$byval_copy13+4>>2]=HEAP32[$104+4>>2]|0;
|
|
$105 = (+_MathDot($tmpcast$byval_copy12,$$byval_copy13));
|
|
$106 = $105 < $$02533;
|
|
$$126 = $106 ? $105 : $$02533;
|
|
$$1 = $106 ? $$02434 : $$035;
|
|
$107 = (($$02434) + 1)|0;
|
|
$108 = ($107>>>0)<($52>>>0);
|
|
if ($108) {
|
|
$$02434 = $107;$$02533 = $$126;$$035 = $$1;
|
|
} else {
|
|
$$0$lcssa = $$1;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
$53 = (((($6)) + 4|0) + ($$0$lcssa<<3)|0);
|
|
;HEAP32[$tmpcast$byval_copy12>>2]=HEAP32[$39>>2]|0;HEAP32[$tmpcast$byval_copy12+4>>2]=HEAP32[$39+4>>2]|0;HEAP32[$tmpcast$byval_copy12+8>>2]=HEAP32[$39+8>>2]|0;HEAP32[$tmpcast$byval_copy12+12>>2]=HEAP32[$39+12>>2]|0;
|
|
;HEAP32[$$byval_copy13>>2]=HEAP32[$53>>2]|0;HEAP32[$$byval_copy13+4>>2]=HEAP32[$53+4>>2]|0;
|
|
_Mat2MultiplyVector2($11,$tmpcast$byval_copy12,$$byval_copy13);
|
|
$54 = $11;
|
|
$55 = $54;
|
|
$56 = HEAP32[$55>>2]|0;
|
|
$57 = (($54) + 4)|0;
|
|
$58 = $57;
|
|
$59 = HEAP32[$58>>2]|0;
|
|
$60 = $0;
|
|
$61 = $60;
|
|
HEAP32[$61>>2] = $56;
|
|
$62 = (($60) + 4)|0;
|
|
$63 = $62;
|
|
HEAP32[$63>>2] = $59;
|
|
$64 = ((($3)) + 4|0);
|
|
$65 = HEAP32[$64>>2]|0;
|
|
$66 = ((($65)) + 8|0);
|
|
;HEAP32[$tmpcast$byval_copy12>>2]=HEAP32[$0>>2]|0;HEAP32[$tmpcast$byval_copy12+4>>2]=HEAP32[$0+4>>2]|0;
|
|
;HEAP32[$$byval_copy13>>2]=HEAP32[$66>>2]|0;HEAP32[$$byval_copy13+4>>2]=HEAP32[$66+4>>2]|0;
|
|
_Vector2Add_2($12,$tmpcast$byval_copy12,$$byval_copy13);
|
|
$67 = $12;
|
|
$68 = $67;
|
|
$69 = HEAP32[$68>>2]|0;
|
|
$70 = (($67) + 4)|0;
|
|
$71 = $70;
|
|
$72 = HEAP32[$71>>2]|0;
|
|
$73 = $0;
|
|
$74 = $73;
|
|
HEAP32[$74>>2] = $69;
|
|
$75 = (($73) + 4)|0;
|
|
$76 = $75;
|
|
HEAP32[$76>>2] = $72;
|
|
$77 = (($$0$lcssa) + 1)|0;
|
|
$78 = HEAP32[$6>>2]|0;
|
|
$79 = ($77>>>0)<($78>>>0);
|
|
$80 = $79 ? $77 : 0;
|
|
$81 = (((($6)) + 4|0) + ($80<<3)|0);
|
|
;HEAP32[$tmpcast$byval_copy12>>2]=HEAP32[$39>>2]|0;HEAP32[$tmpcast$byval_copy12+4>>2]=HEAP32[$39+4>>2]|0;HEAP32[$tmpcast$byval_copy12+8>>2]=HEAP32[$39+8>>2]|0;HEAP32[$tmpcast$byval_copy12+12>>2]=HEAP32[$39+12>>2]|0;
|
|
;HEAP32[$$byval_copy13>>2]=HEAP32[$81>>2]|0;HEAP32[$$byval_copy13+4>>2]=HEAP32[$81+4>>2]|0;
|
|
_Mat2MultiplyVector2($13,$tmpcast$byval_copy12,$$byval_copy13);
|
|
$82 = $13;
|
|
$83 = $82;
|
|
$84 = HEAP32[$83>>2]|0;
|
|
$85 = (($82) + 4)|0;
|
|
$86 = $85;
|
|
$87 = HEAP32[$86>>2]|0;
|
|
$88 = $1;
|
|
$89 = $88;
|
|
HEAP32[$89>>2] = $84;
|
|
$90 = (($88) + 4)|0;
|
|
$91 = $90;
|
|
HEAP32[$91>>2] = $87;
|
|
$92 = HEAP32[$64>>2]|0;
|
|
$93 = ((($92)) + 8|0);
|
|
;HEAP32[$tmpcast$byval_copy12>>2]=HEAP32[$1>>2]|0;HEAP32[$tmpcast$byval_copy12+4>>2]=HEAP32[$1+4>>2]|0;
|
|
;HEAP32[$$byval_copy13>>2]=HEAP32[$93>>2]|0;HEAP32[$$byval_copy13+4>>2]=HEAP32[$93+4>>2]|0;
|
|
_Vector2Add_2($14,$tmpcast$byval_copy12,$$byval_copy13);
|
|
$94 = $14;
|
|
$95 = $94;
|
|
$96 = HEAP32[$95>>2]|0;
|
|
$97 = (($94) + 4)|0;
|
|
$98 = $97;
|
|
$99 = HEAP32[$98>>2]|0;
|
|
$100 = $1;
|
|
$101 = $100;
|
|
HEAP32[$101>>2] = $96;
|
|
$102 = (($100) + 4)|0;
|
|
$103 = $102;
|
|
HEAP32[$103>>2] = $99;
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _Clip($0,$1,$2,$3) {
|
|
$0 = $0|0;
|
|
$1 = +$1;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
var $$0 = 0, $$1 = 0, $$2 = 0, $$byval_copy6 = 0, $$byval_copy7 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0;
|
|
var $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0.0, $29 = 0.0, $30 = 0.0, $31 = 0.0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0;
|
|
var $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0;
|
|
var $56 = 0.0, $57 = 0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0.0, $72 = 0.0, $73 = 0;
|
|
var $74 = 0.0, $75 = 0.0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0;
|
|
var $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(48|0);
|
|
$$byval_copy7 = sp + 40|0;
|
|
$$byval_copy6 = sp + 32|0;
|
|
$4 = sp;
|
|
$5 = sp + 24|0;
|
|
$6 = sp + 16|0;
|
|
$7 = $2;
|
|
$8 = $7;
|
|
$9 = HEAP32[$8>>2]|0;
|
|
$10 = (($7) + 4)|0;
|
|
$11 = $10;
|
|
$12 = HEAP32[$11>>2]|0;
|
|
$13 = $4;
|
|
$14 = $13;
|
|
HEAP32[$14>>2] = $9;
|
|
$15 = (($13) + 4)|0;
|
|
$16 = $15;
|
|
HEAP32[$16>>2] = $12;
|
|
$17 = ((($4)) + 8|0);
|
|
$18 = $3;
|
|
$19 = $18;
|
|
$20 = HEAP32[$19>>2]|0;
|
|
$21 = (($18) + 4)|0;
|
|
$22 = $21;
|
|
$23 = HEAP32[$22>>2]|0;
|
|
$24 = $17;
|
|
$25 = $24;
|
|
HEAP32[$25>>2] = $20;
|
|
$26 = (($24) + 4)|0;
|
|
$27 = $26;
|
|
HEAP32[$27>>2] = $23;
|
|
;HEAP32[$$byval_copy6>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy6+4>>2]=HEAP32[$0+4>>2]|0;
|
|
;HEAP32[$$byval_copy7>>2]=HEAP32[$2>>2]|0;HEAP32[$$byval_copy7+4>>2]=HEAP32[$2+4>>2]|0;
|
|
$28 = (+_MathDot($$byval_copy6,$$byval_copy7));
|
|
$29 = $28 - $1;
|
|
;HEAP32[$$byval_copy6>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy6+4>>2]=HEAP32[$0+4>>2]|0;
|
|
;HEAP32[$$byval_copy7>>2]=HEAP32[$3>>2]|0;HEAP32[$$byval_copy7+4>>2]=HEAP32[$3+4>>2]|0;
|
|
$30 = (+_MathDot($$byval_copy6,$$byval_copy7));
|
|
$31 = $30 - $1;
|
|
$32 = !($29 <= 0.0);
|
|
if ($32) {
|
|
$$0 = 0;
|
|
} else {
|
|
$33 = $2;
|
|
$34 = $33;
|
|
$35 = HEAP32[$34>>2]|0;
|
|
$36 = (($33) + 4)|0;
|
|
$37 = $36;
|
|
$38 = HEAP32[$37>>2]|0;
|
|
$39 = $4;
|
|
$40 = $39;
|
|
HEAP32[$40>>2] = $35;
|
|
$41 = (($39) + 4)|0;
|
|
$42 = $41;
|
|
HEAP32[$42>>2] = $38;
|
|
$$0 = 1;
|
|
}
|
|
$43 = !($31 <= 0.0);
|
|
if ($43) {
|
|
$$1 = $$0;
|
|
} else {
|
|
$44 = (($4) + ($$0<<3)|0);
|
|
$45 = (($$0) + 1)|0;
|
|
$46 = $3;
|
|
$47 = $46;
|
|
$48 = HEAP32[$47>>2]|0;
|
|
$49 = (($46) + 4)|0;
|
|
$50 = $49;
|
|
$51 = HEAP32[$50>>2]|0;
|
|
$52 = $44;
|
|
$53 = $52;
|
|
HEAP32[$53>>2] = $48;
|
|
$54 = (($52) + 4)|0;
|
|
$55 = $54;
|
|
HEAP32[$55>>2] = $51;
|
|
$$1 = $45;
|
|
}
|
|
$56 = $29 * $31;
|
|
$57 = $56 < 0.0;
|
|
if (!($57)) {
|
|
$$2 = $$1;
|
|
$87 = $4;
|
|
$88 = $87;
|
|
$89 = HEAP32[$88>>2]|0;
|
|
$90 = (($87) + 4)|0;
|
|
$91 = $90;
|
|
$92 = HEAP32[$91>>2]|0;
|
|
$93 = $2;
|
|
$94 = $93;
|
|
HEAP32[$94>>2] = $89;
|
|
$95 = (($93) + 4)|0;
|
|
$96 = $95;
|
|
HEAP32[$96>>2] = $92;
|
|
$97 = $17;
|
|
$98 = $97;
|
|
$99 = HEAP32[$98>>2]|0;
|
|
$100 = (($97) + 4)|0;
|
|
$101 = $100;
|
|
$102 = HEAP32[$101>>2]|0;
|
|
$103 = $3;
|
|
$104 = $103;
|
|
HEAP32[$104>>2] = $99;
|
|
$105 = (($103) + 4)|0;
|
|
$106 = $105;
|
|
HEAP32[$106>>2] = $102;
|
|
STACKTOP = sp;return ($$2|0);
|
|
}
|
|
$58 = $29 - $31;
|
|
$59 = $29 / $58;
|
|
$60 = (($4) + ($$1<<3)|0);
|
|
$61 = $2;
|
|
$62 = $61;
|
|
$63 = HEAP32[$62>>2]|0;
|
|
$64 = (($61) + 4)|0;
|
|
$65 = $64;
|
|
$66 = HEAP32[$65>>2]|0;
|
|
$67 = $60;
|
|
$68 = $67;
|
|
HEAP32[$68>>2] = $63;
|
|
$69 = (($67) + 4)|0;
|
|
$70 = $69;
|
|
HEAP32[$70>>2] = $66;
|
|
;HEAP32[$$byval_copy6>>2]=HEAP32[$3>>2]|0;HEAP32[$$byval_copy6+4>>2]=HEAP32[$3+4>>2]|0;
|
|
;HEAP32[$$byval_copy7>>2]=HEAP32[$2>>2]|0;HEAP32[$$byval_copy7+4>>2]=HEAP32[$2+4>>2]|0;
|
|
_Vector2Subtract_4($5,$$byval_copy6,$$byval_copy7);
|
|
$71 = +HEAPF32[$5>>2];
|
|
$72 = $59 * $71;
|
|
HEAPF32[$5>>2] = $72;
|
|
$73 = ((($5)) + 4|0);
|
|
$74 = +HEAPF32[$73>>2];
|
|
$75 = $59 * $74;
|
|
HEAPF32[$73>>2] = $75;
|
|
;HEAP32[$$byval_copy6>>2]=HEAP32[$60>>2]|0;HEAP32[$$byval_copy6+4>>2]=HEAP32[$60+4>>2]|0;
|
|
;HEAP32[$$byval_copy7>>2]=HEAP32[$5>>2]|0;HEAP32[$$byval_copy7+4>>2]=HEAP32[$5+4>>2]|0;
|
|
_Vector2Add_2($6,$$byval_copy6,$$byval_copy7);
|
|
$76 = $6;
|
|
$77 = $76;
|
|
$78 = HEAP32[$77>>2]|0;
|
|
$79 = (($76) + 4)|0;
|
|
$80 = $79;
|
|
$81 = HEAP32[$80>>2]|0;
|
|
$82 = $60;
|
|
$83 = $82;
|
|
HEAP32[$83>>2] = $78;
|
|
$84 = (($82) + 4)|0;
|
|
$85 = $84;
|
|
HEAP32[$85>>2] = $81;
|
|
$86 = (($$1) + 1)|0;
|
|
$$2 = $86;
|
|
$87 = $4;
|
|
$88 = $87;
|
|
$89 = HEAP32[$88>>2]|0;
|
|
$90 = (($87) + 4)|0;
|
|
$91 = $90;
|
|
$92 = HEAP32[$91>>2]|0;
|
|
$93 = $2;
|
|
$94 = $93;
|
|
HEAP32[$94>>2] = $89;
|
|
$95 = (($93) + 4)|0;
|
|
$96 = $95;
|
|
HEAP32[$96>>2] = $92;
|
|
$97 = $17;
|
|
$98 = $97;
|
|
$99 = HEAP32[$98>>2]|0;
|
|
$100 = (($97) + 4)|0;
|
|
$101 = $100;
|
|
$102 = HEAP32[$101>>2]|0;
|
|
$103 = $3;
|
|
$104 = $103;
|
|
HEAP32[$104>>2] = $99;
|
|
$105 = (($103) + 4)|0;
|
|
$106 = $105;
|
|
HEAP32[$106>>2] = $102;
|
|
STACKTOP = sp;return ($$2|0);
|
|
}
|
|
function _GetSupport($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $$01318 = 0, $$019 = 0.0, $$1 = 0.0, $$byval_copy = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
|
|
var $26 = 0.0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $tmpcast$byval_copy = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 432|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(432|0);
|
|
$$byval_copy = sp + 424|0;
|
|
$tmpcast$byval_copy = sp + 416|0;
|
|
$3 = sp + 8|0;
|
|
$4 = sp;
|
|
$5 = ((($1)) + 12|0);
|
|
_memcpy(($3|0),($5|0),404)|0;
|
|
$6 = HEAP32[$3>>2]|0;
|
|
$7 = ($6|0)==(0);
|
|
if ($7) {
|
|
$11 = 0;$14 = 0;
|
|
$9 = $0;
|
|
$10 = $9;
|
|
HEAP32[$10>>2] = $11;
|
|
$12 = (($9) + 4)|0;
|
|
$13 = $12;
|
|
HEAP32[$13>>2] = $14;
|
|
STACKTOP = sp;return;
|
|
}
|
|
$8 = HEAP32[$3>>2]|0;
|
|
$$01318 = 0;$$019 = -3.4028234663852886E+38;$29 = 0;$31 = 0;
|
|
while(1) {
|
|
$15 = (((($3)) + 4|0) + ($$01318<<3)|0);
|
|
$16 = $15;
|
|
$17 = $16;
|
|
$18 = HEAP32[$17>>2]|0;
|
|
$19 = (($16) + 4)|0;
|
|
$20 = $19;
|
|
$21 = HEAP32[$20>>2]|0;
|
|
$22 = $4;
|
|
$23 = $22;
|
|
HEAP32[$23>>2] = $18;
|
|
$24 = (($22) + 4)|0;
|
|
$25 = $24;
|
|
HEAP32[$25>>2] = $21;
|
|
;HEAP32[$tmpcast$byval_copy>>2]=HEAP32[$4>>2]|0;HEAP32[$tmpcast$byval_copy+4>>2]=HEAP32[$4+4>>2]|0;
|
|
;HEAP32[$$byval_copy>>2]=HEAP32[$2>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$2+4>>2]|0;
|
|
$26 = (+_MathDot($tmpcast$byval_copy,$$byval_copy));
|
|
$27 = $26 > $$019;
|
|
$28 = $27 ? $18 : $29;
|
|
$30 = $27 ? $21 : $31;
|
|
$$1 = $27 ? $26 : $$019;
|
|
$32 = (($$01318) + 1)|0;
|
|
$33 = ($32>>>0)<($8>>>0);
|
|
if ($33) {
|
|
$$01318 = $32;$$019 = $$1;$29 = $28;$31 = $30;
|
|
} else {
|
|
$11 = $28;$14 = $30;
|
|
break;
|
|
}
|
|
}
|
|
$9 = $0;
|
|
$10 = $9;
|
|
HEAP32[$10>>2] = $11;
|
|
$12 = (($9) + 4)|0;
|
|
$13 = $12;
|
|
HEAP32[$13>>2] = $14;
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _MathCross($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = +$1;
|
|
$2 = $2|0;
|
|
var $3 = 0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = ((($2)) + 4|0);
|
|
$4 = +HEAPF32[$3>>2];
|
|
$5 = $4 * $1;
|
|
$6 = -$5;
|
|
HEAPF32[$0>>2] = $6;
|
|
$7 = ((($0)) + 4|0);
|
|
$8 = +HEAPF32[$2>>2];
|
|
$9 = $8 * $1;
|
|
HEAPF32[$7>>2] = $9;
|
|
return;
|
|
}
|
|
function _Mat2Set($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = +$1;
|
|
var $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = (+Math_cos((+$1)));
|
|
$3 = (+Math_sin((+$1)));
|
|
HEAPF32[$0>>2] = $2;
|
|
$4 = -$3;
|
|
$5 = ((($0)) + 4|0);
|
|
HEAPF32[$5>>2] = $4;
|
|
$6 = ((($0)) + 8|0);
|
|
HEAPF32[$6>>2] = $3;
|
|
$7 = ((($0)) + 12|0);
|
|
HEAPF32[$7>>2] = $2;
|
|
return;
|
|
}
|
|
function _Vector2Distance($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0, $9 = 0.0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = +HEAPF32[$0>>2];
|
|
$3 = +HEAPF32[$1>>2];
|
|
$4 = $2 - $3;
|
|
$5 = $4 * $4;
|
|
$6 = ((($0)) + 4|0);
|
|
$7 = +HEAPF32[$6>>2];
|
|
$8 = ((($1)) + 4|0);
|
|
$9 = +HEAPF32[$8>>2];
|
|
$10 = $7 - $9;
|
|
$11 = $10 * $10;
|
|
$12 = $5 + $11;
|
|
$13 = (+Math_sqrt((+$12)));
|
|
return (+$13);
|
|
}
|
|
function _Vector2Angle($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$0 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0, $13 = 0.0, $2 = 0, $3 = 0.0, $4 = 0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = ((($1)) + 4|0);
|
|
$3 = +HEAPF32[$2>>2];
|
|
$4 = ((($0)) + 4|0);
|
|
$5 = +HEAPF32[$4>>2];
|
|
$6 = $3 - $5;
|
|
$7 = +HEAPF32[$1>>2];
|
|
$8 = +HEAPF32[$0>>2];
|
|
$9 = $7 - $8;
|
|
$10 = (+Math_atan2((+$6),(+$9)));
|
|
$11 = $10 * 57.2957763671875;
|
|
$12 = $11 < 0.0;
|
|
$13 = $11 + 360.0;
|
|
$$0 = $12 ? $13 : $11;
|
|
return (+$$0);
|
|
}
|
|
function _VectorZero($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
HEAPF32[$0>>2] = 0.0;
|
|
$1 = ((($0)) + 4|0);
|
|
HEAPF32[$1>>2] = 0.0;
|
|
$2 = ((($0)) + 8|0);
|
|
HEAPF32[$2>>2] = 0.0;
|
|
return;
|
|
}
|
|
function _VectorLength($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0.0, $10 = 0.0, $11 = 0.0, $2 = 0.0, $3 = 0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = +HEAPF32[$0>>2];
|
|
$2 = $1 * $1;
|
|
$3 = ((($0)) + 4|0);
|
|
$4 = +HEAPF32[$3>>2];
|
|
$5 = $4 * $4;
|
|
$6 = $2 + $5;
|
|
$7 = ((($0)) + 8|0);
|
|
$8 = +HEAPF32[$7>>2];
|
|
$9 = $8 * $8;
|
|
$10 = $6 + $9;
|
|
$11 = (+Math_sqrt((+$10)));
|
|
return (+$11);
|
|
}
|
|
function _VectorNormalize($0) {
|
|
$0 = $0|0;
|
|
var $$byval_copy = 0, $$op = 0.0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $2 = 0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0.0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
|
|
$$byval_copy = sp;
|
|
;HEAP32[$$byval_copy>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$0+8>>2]|0;
|
|
$1 = (+_VectorLength($$byval_copy));
|
|
$2 = $1 == 0.0;
|
|
$$op = 1.0 / $1;
|
|
$3 = $2 ? 1.0 : $$op;
|
|
$4 = +HEAPF32[$0>>2];
|
|
$5 = $4 * $3;
|
|
HEAPF32[$0>>2] = $5;
|
|
$6 = ((($0)) + 4|0);
|
|
$7 = +HEAPF32[$6>>2];
|
|
$8 = $3 * $7;
|
|
HEAPF32[$6>>2] = $8;
|
|
$9 = ((($0)) + 8|0);
|
|
$10 = +HEAPF32[$9>>2];
|
|
$11 = $3 * $10;
|
|
HEAPF32[$9>>2] = $11;
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _VectorTransform($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0, $14 = 0.0, $15 = 0.0, $16 = 0.0, $17 = 0, $18 = 0.0, $19 = 0.0, $2 = 0.0, $20 = 0, $21 = 0.0, $22 = 0.0, $23 = 0, $24 = 0.0, $25 = 0.0, $26 = 0.0, $27 = 0, $28 = 0.0;
|
|
var $29 = 0.0, $3 = 0, $30 = 0.0, $31 = 0, $32 = 0.0, $33 = 0.0, $34 = 0, $35 = 0.0, $36 = 0.0, $37 = 0, $38 = 0.0, $39 = 0.0, $4 = 0.0, $40 = 0.0, $41 = 0, $42 = 0.0, $43 = 0.0, $44 = 0.0, $45 = 0, $46 = 0.0;
|
|
var $47 = 0.0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = +HEAPF32[$0>>2];
|
|
$3 = ((($0)) + 4|0);
|
|
$4 = +HEAPF32[$3>>2];
|
|
$5 = ((($0)) + 8|0);
|
|
$6 = +HEAPF32[$5>>2];
|
|
$7 = +HEAPF32[$1>>2];
|
|
$8 = $2 * $7;
|
|
$9 = ((($1)) + 4|0);
|
|
$10 = +HEAPF32[$9>>2];
|
|
$11 = $4 * $10;
|
|
$12 = $8 + $11;
|
|
$13 = ((($1)) + 8|0);
|
|
$14 = +HEAPF32[$13>>2];
|
|
$15 = $6 * $14;
|
|
$16 = $12 + $15;
|
|
$17 = ((($1)) + 12|0);
|
|
$18 = +HEAPF32[$17>>2];
|
|
$19 = $18 + $16;
|
|
HEAPF32[$0>>2] = $19;
|
|
$20 = ((($1)) + 16|0);
|
|
$21 = +HEAPF32[$20>>2];
|
|
$22 = $2 * $21;
|
|
$23 = ((($1)) + 20|0);
|
|
$24 = +HEAPF32[$23>>2];
|
|
$25 = $4 * $24;
|
|
$26 = $22 + $25;
|
|
$27 = ((($1)) + 24|0);
|
|
$28 = +HEAPF32[$27>>2];
|
|
$29 = $6 * $28;
|
|
$30 = $26 + $29;
|
|
$31 = ((($1)) + 28|0);
|
|
$32 = +HEAPF32[$31>>2];
|
|
$33 = $32 + $30;
|
|
HEAPF32[$3>>2] = $33;
|
|
$34 = ((($1)) + 32|0);
|
|
$35 = +HEAPF32[$34>>2];
|
|
$36 = $2 * $35;
|
|
$37 = ((($1)) + 36|0);
|
|
$38 = +HEAPF32[$37>>2];
|
|
$39 = $4 * $38;
|
|
$40 = $36 + $39;
|
|
$41 = ((($1)) + 40|0);
|
|
$42 = +HEAPF32[$41>>2];
|
|
$43 = $6 * $42;
|
|
$44 = $40 + $43;
|
|
$45 = ((($1)) + 44|0);
|
|
$46 = +HEAPF32[$45>>2];
|
|
$47 = $46 + $44;
|
|
HEAPF32[$5>>2] = $47;
|
|
return;
|
|
}
|
|
function _MatrixTranspose($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $3 = 0, $4 = 0, $5 = 0;
|
|
var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = ((($0)) + 4|0);
|
|
$2 = HEAP32[$1>>2]|0;
|
|
$3 = ((($0)) + 8|0);
|
|
$4 = HEAP32[$3>>2]|0;
|
|
$5 = ((($0)) + 12|0);
|
|
$6 = HEAP32[$5>>2]|0;
|
|
$7 = ((($0)) + 16|0);
|
|
$8 = HEAP32[$7>>2]|0;
|
|
$9 = ((($0)) + 24|0);
|
|
$10 = HEAP32[$9>>2]|0;
|
|
$11 = ((($0)) + 28|0);
|
|
$12 = HEAP32[$11>>2]|0;
|
|
$13 = ((($0)) + 32|0);
|
|
$14 = HEAP32[$13>>2]|0;
|
|
$15 = ((($0)) + 36|0);
|
|
$16 = HEAP32[$15>>2]|0;
|
|
$17 = ((($0)) + 44|0);
|
|
$18 = HEAP32[$17>>2]|0;
|
|
$19 = ((($0)) + 48|0);
|
|
$20 = HEAP32[$19>>2]|0;
|
|
$21 = ((($0)) + 52|0);
|
|
$22 = HEAP32[$21>>2]|0;
|
|
$23 = ((($0)) + 56|0);
|
|
$24 = HEAP32[$23>>2]|0;
|
|
HEAP32[$1>>2] = $8;
|
|
HEAP32[$3>>2] = $14;
|
|
HEAP32[$5>>2] = $20;
|
|
HEAP32[$7>>2] = $2;
|
|
HEAP32[$9>>2] = $16;
|
|
HEAP32[$11>>2] = $22;
|
|
HEAP32[$13>>2] = $4;
|
|
HEAP32[$15>>2] = $10;
|
|
HEAP32[$17>>2] = $24;
|
|
HEAP32[$19>>2] = $6;
|
|
HEAP32[$21>>2] = $12;
|
|
HEAP32[$23>>2] = $18;
|
|
return;
|
|
}
|
|
function _MatrixIdentity($0) {
|
|
$0 = $0|0;
|
|
var $$sroa$5$0$$sroa_idx = 0, $$sroa$55$0$$sroa_idx6 = 0, $$sroa$6$0$$sroa_idx = 0, $$sroa$611$0$$sroa_idx12 = 0, $$sroa$7$0$$sroa_idx = 0, $$sroa$717$0$$sroa_idx18 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
HEAPF32[$0>>2] = 1.0;
|
|
$$sroa$5$0$$sroa_idx = ((($0)) + 4|0);
|
|
;HEAP32[$$sroa$5$0$$sroa_idx>>2]=0|0;HEAP32[$$sroa$5$0$$sroa_idx+4>>2]=0|0;HEAP32[$$sroa$5$0$$sroa_idx+8>>2]=0|0;HEAP32[$$sroa$5$0$$sroa_idx+12>>2]=0|0;
|
|
$$sroa$55$0$$sroa_idx6 = ((($0)) + 20|0);
|
|
HEAPF32[$$sroa$55$0$$sroa_idx6>>2] = 1.0;
|
|
$$sroa$6$0$$sroa_idx = ((($0)) + 24|0);
|
|
;HEAP32[$$sroa$6$0$$sroa_idx>>2]=0|0;HEAP32[$$sroa$6$0$$sroa_idx+4>>2]=0|0;HEAP32[$$sroa$6$0$$sroa_idx+8>>2]=0|0;HEAP32[$$sroa$6$0$$sroa_idx+12>>2]=0|0;
|
|
$$sroa$611$0$$sroa_idx12 = ((($0)) + 40|0);
|
|
HEAPF32[$$sroa$611$0$$sroa_idx12>>2] = 1.0;
|
|
$$sroa$7$0$$sroa_idx = ((($0)) + 44|0);
|
|
;HEAP32[$$sroa$7$0$$sroa_idx>>2]=0|0;HEAP32[$$sroa$7$0$$sroa_idx+4>>2]=0|0;HEAP32[$$sroa$7$0$$sroa_idx+8>>2]=0|0;HEAP32[$$sroa$7$0$$sroa_idx+12>>2]=0|0;
|
|
$$sroa$717$0$$sroa_idx18 = ((($0)) + 60|0);
|
|
HEAPF32[$$sroa$717$0$$sroa_idx18>>2] = 1.0;
|
|
return;
|
|
}
|
|
function _MatrixTranslate($0,$1,$2,$3) {
|
|
$0 = $0|0;
|
|
$1 = +$1;
|
|
$2 = +$2;
|
|
$3 = +$3;
|
|
var $$sroa$13$0$$sroa_idx20 = 0, $$sroa$14$0$$sroa_idx22 = 0, $$sroa$15$0$$sroa_idx24 = 0, $$sroa$16$0$$sroa_idx26 = 0, $$sroa$17$0$$sroa_idx28 = 0, $$sroa$18$0$$sroa_idx30 = 0, $$sroa$4$0$$sroa_idx2 = 0, $$sroa$8$0$$sroa_idx10 = 0, $$sroa$9$0$$sroa_idx12 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
HEAPF32[$0>>2] = 1.0;
|
|
$$sroa$4$0$$sroa_idx2 = ((($0)) + 4|0);
|
|
$$sroa$8$0$$sroa_idx10 = ((($0)) + 20|0);
|
|
;HEAP32[$$sroa$4$0$$sroa_idx2>>2]=0|0;HEAP32[$$sroa$4$0$$sroa_idx2+4>>2]=0|0;HEAP32[$$sroa$4$0$$sroa_idx2+8>>2]=0|0;HEAP32[$$sroa$4$0$$sroa_idx2+12>>2]=0|0;
|
|
HEAPF32[$$sroa$8$0$$sroa_idx10>>2] = 1.0;
|
|
$$sroa$9$0$$sroa_idx12 = ((($0)) + 24|0);
|
|
$$sroa$13$0$$sroa_idx20 = ((($0)) + 40|0);
|
|
;HEAP32[$$sroa$9$0$$sroa_idx12>>2]=0|0;HEAP32[$$sroa$9$0$$sroa_idx12+4>>2]=0|0;HEAP32[$$sroa$9$0$$sroa_idx12+8>>2]=0|0;HEAP32[$$sroa$9$0$$sroa_idx12+12>>2]=0|0;
|
|
HEAPF32[$$sroa$13$0$$sroa_idx20>>2] = 1.0;
|
|
$$sroa$14$0$$sroa_idx22 = ((($0)) + 44|0);
|
|
HEAPF32[$$sroa$14$0$$sroa_idx22>>2] = 0.0;
|
|
$$sroa$15$0$$sroa_idx24 = ((($0)) + 48|0);
|
|
HEAPF32[$$sroa$15$0$$sroa_idx24>>2] = $1;
|
|
$$sroa$16$0$$sroa_idx26 = ((($0)) + 52|0);
|
|
HEAPF32[$$sroa$16$0$$sroa_idx26>>2] = $2;
|
|
$$sroa$17$0$$sroa_idx28 = ((($0)) + 56|0);
|
|
HEAPF32[$$sroa$17$0$$sroa_idx28>>2] = $3;
|
|
$$sroa$18$0$$sroa_idx30 = ((($0)) + 60|0);
|
|
HEAPF32[$$sroa$18$0$$sroa_idx30>>2] = 1.0;
|
|
return;
|
|
}
|
|
function _MatrixRotate($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = +$2;
|
|
var $$ = 0.0, $$221 = 0.0, $$222 = 0.0, $$sroa$10$0$$sroa_idx199 = 0, $$sroa$11$0$$sroa_idx201 = 0, $$sroa$12$0$$sroa_idx203 = 0, $$sroa$13$0$$sroa_idx205 = 0, $$sroa$14$0$$sroa_idx207 = 0, $$sroa$15$0$$sroa_idx209 = 0, $$sroa$16$0$$sroa_idx211 = 0, $$sroa$17$0$$sroa_idx213 = 0, $$sroa$18$0$$sroa_idx215 = 0, $$sroa$4$0$$sroa_idx187 = 0, $$sroa$5$0$$sroa_idx189 = 0, $$sroa$6$0$$sroa_idx191 = 0, $$sroa$7$0$$sroa_idx193 = 0, $$sroa$8$0$$sroa_idx195 = 0, $$sroa$9$0$$sroa_idx197 = 0, $10 = 0.0, $100 = 0.0;
|
|
var $101 = 0.0, $102 = 0.0, $103 = 0.0, $104 = 0.0, $105 = 0.0, $106 = 0.0, $107 = 0.0, $108 = 0.0, $109 = 0.0, $11 = 0.0, $110 = 0.0, $111 = 0.0, $112 = 0.0, $113 = 0.0, $114 = 0.0, $115 = 0.0, $116 = 0.0, $117 = 0.0, $118 = 0.0, $119 = 0.0;
|
|
var $12 = 0.0, $120 = 0.0, $121 = 0.0, $122 = 0.0, $123 = 0.0, $124 = 0.0, $125 = 0.0, $126 = 0.0, $127 = 0.0, $128 = 0.0, $129 = 0.0, $13 = 0.0, $130 = 0.0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0;
|
|
var $138 = 0, $14 = 0.0, $15 = 0, $16 = 0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0, $26 = 0.0, $27 = 0, $28 = 0.0, $29 = 0, $3 = 0, $30 = 0.0, $31 = 0;
|
|
var $32 = 0.0, $33 = 0, $34 = 0.0, $35 = 0, $36 = 0.0, $37 = 0, $38 = 0.0, $39 = 0, $4 = 0.0, $40 = 0.0, $41 = 0, $42 = 0.0, $43 = 0, $44 = 0.0, $45 = 0, $46 = 0.0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0;
|
|
var $50 = 0.0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0.0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0.0, $60 = 0.0, $61 = 0.0, $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0.0, $66 = 0.0, $67 = 0.0, $68 = 0.0;
|
|
var $69 = 0.0, $7 = 0, $70 = 0.0, $71 = 0.0, $72 = 0.0, $73 = 0.0, $74 = 0.0, $75 = 0.0, $76 = 0.0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0.0, $80 = 0.0, $81 = 0.0, $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0.0, $86 = 0.0;
|
|
var $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0.0, $90 = 0.0, $91 = 0.0, $92 = 0.0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0.0, $97 = 0.0, $98 = 0.0, $99 = 0.0, $or$cond = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
|
|
$3 = sp;
|
|
_MatrixIdentity($3);
|
|
$4 = +HEAPF32[$1>>2];
|
|
$5 = ((($1)) + 4|0);
|
|
$6 = +HEAPF32[$5>>2];
|
|
$7 = ((($1)) + 8|0);
|
|
$8 = +HEAPF32[$7>>2];
|
|
$9 = $4 * $4;
|
|
$10 = $6 * $6;
|
|
$11 = $9 + $10;
|
|
$12 = $8 * $8;
|
|
$13 = $11 + $12;
|
|
$14 = (+Math_sqrt((+$13)));
|
|
$15 = $14 != 1.0;
|
|
$16 = $14 != 0.0;
|
|
$or$cond = $15 & $16;
|
|
$17 = 1.0 / $14;
|
|
$18 = $4 * $17;
|
|
$19 = $6 * $17;
|
|
$20 = $8 * $17;
|
|
$$ = $or$cond ? $20 : $8;
|
|
$$221 = $or$cond ? $19 : $6;
|
|
$$222 = $or$cond ? $18 : $4;
|
|
$21 = (+Math_sin((+$2)));
|
|
$22 = (+Math_cos((+$2)));
|
|
$23 = 1.0 - $22;
|
|
$24 = +HEAPF32[$3>>2];
|
|
$25 = ((($3)) + 16|0);
|
|
$26 = +HEAPF32[$25>>2];
|
|
$27 = ((($3)) + 32|0);
|
|
$28 = +HEAPF32[$27>>2];
|
|
$29 = ((($3)) + 48|0);
|
|
$30 = +HEAPF32[$29>>2];
|
|
$31 = ((($3)) + 4|0);
|
|
$32 = +HEAPF32[$31>>2];
|
|
$33 = ((($3)) + 20|0);
|
|
$34 = +HEAPF32[$33>>2];
|
|
$35 = ((($3)) + 36|0);
|
|
$36 = +HEAPF32[$35>>2];
|
|
$37 = ((($3)) + 52|0);
|
|
$38 = +HEAPF32[$37>>2];
|
|
$39 = ((($3)) + 8|0);
|
|
$40 = +HEAPF32[$39>>2];
|
|
$41 = ((($3)) + 24|0);
|
|
$42 = +HEAPF32[$41>>2];
|
|
$43 = ((($3)) + 40|0);
|
|
$44 = +HEAPF32[$43>>2];
|
|
$45 = ((($3)) + 56|0);
|
|
$46 = +HEAPF32[$45>>2];
|
|
$47 = $$222 * $$222;
|
|
$48 = $23 * $47;
|
|
$49 = $22 + $48;
|
|
$50 = $$221 * $$222;
|
|
$51 = $23 * $50;
|
|
$52 = $21 * $$;
|
|
$53 = $52 + $51;
|
|
$54 = $$ * $$222;
|
|
$55 = $23 * $54;
|
|
$56 = $21 * $$221;
|
|
$57 = $55 - $56;
|
|
$58 = $51 - $52;
|
|
$59 = $$221 * $$221;
|
|
$60 = $23 * $59;
|
|
$61 = $22 + $60;
|
|
$62 = $$ * $$221;
|
|
$63 = $23 * $62;
|
|
$64 = $21 * $$222;
|
|
$65 = $64 + $63;
|
|
$66 = $56 + $55;
|
|
$67 = $63 - $64;
|
|
$68 = $$ * $$;
|
|
$69 = $23 * $68;
|
|
$70 = $22 + $69;
|
|
$71 = $24 * $49;
|
|
$72 = $53 * $32;
|
|
$73 = $71 + $72;
|
|
$74 = $57 * $40;
|
|
$75 = $73 + $74;
|
|
$76 = $26 * $49;
|
|
$77 = $53 * $34;
|
|
$78 = $76 + $77;
|
|
$79 = $57 * $42;
|
|
$80 = $78 + $79;
|
|
$81 = $28 * $49;
|
|
$82 = $53 * $36;
|
|
$83 = $81 + $82;
|
|
$84 = $57 * $44;
|
|
$85 = $83 + $84;
|
|
$86 = $30 * $49;
|
|
$87 = $53 * $38;
|
|
$88 = $86 + $87;
|
|
$89 = $57 * $46;
|
|
$90 = $88 + $89;
|
|
$91 = $24 * $58;
|
|
$92 = $61 * $32;
|
|
$93 = $91 + $92;
|
|
$94 = $65 * $40;
|
|
$95 = $93 + $94;
|
|
$96 = $26 * $58;
|
|
$97 = $61 * $34;
|
|
$98 = $96 + $97;
|
|
$99 = $65 * $42;
|
|
$100 = $98 + $99;
|
|
$101 = $28 * $58;
|
|
$102 = $61 * $36;
|
|
$103 = $101 + $102;
|
|
$104 = $65 * $44;
|
|
$105 = $103 + $104;
|
|
$106 = $30 * $58;
|
|
$107 = $61 * $38;
|
|
$108 = $106 + $107;
|
|
$109 = $65 * $46;
|
|
$110 = $108 + $109;
|
|
$111 = $24 * $66;
|
|
$112 = $67 * $32;
|
|
$113 = $111 + $112;
|
|
$114 = $70 * $40;
|
|
$115 = $113 + $114;
|
|
$116 = $26 * $66;
|
|
$117 = $67 * $34;
|
|
$118 = $116 + $117;
|
|
$119 = $70 * $42;
|
|
$120 = $118 + $119;
|
|
$121 = $28 * $66;
|
|
$122 = $67 * $36;
|
|
$123 = $121 + $122;
|
|
$124 = $70 * $44;
|
|
$125 = $123 + $124;
|
|
$126 = $30 * $66;
|
|
$127 = $67 * $38;
|
|
$128 = $126 + $127;
|
|
$129 = $70 * $46;
|
|
$130 = $128 + $129;
|
|
$131 = ((($3)) + 12|0);
|
|
$132 = HEAP32[$131>>2]|0;
|
|
$133 = ((($3)) + 28|0);
|
|
$134 = HEAP32[$133>>2]|0;
|
|
$135 = ((($3)) + 44|0);
|
|
$136 = HEAP32[$135>>2]|0;
|
|
$137 = ((($3)) + 60|0);
|
|
$138 = HEAP32[$137>>2]|0;
|
|
HEAPF32[$0>>2] = $75;
|
|
$$sroa$4$0$$sroa_idx187 = ((($0)) + 4|0);
|
|
HEAPF32[$$sroa$4$0$$sroa_idx187>>2] = $95;
|
|
$$sroa$5$0$$sroa_idx189 = ((($0)) + 8|0);
|
|
HEAPF32[$$sroa$5$0$$sroa_idx189>>2] = $115;
|
|
$$sroa$6$0$$sroa_idx191 = ((($0)) + 12|0);
|
|
HEAP32[$$sroa$6$0$$sroa_idx191>>2] = $132;
|
|
$$sroa$7$0$$sroa_idx193 = ((($0)) + 16|0);
|
|
HEAPF32[$$sroa$7$0$$sroa_idx193>>2] = $80;
|
|
$$sroa$8$0$$sroa_idx195 = ((($0)) + 20|0);
|
|
HEAPF32[$$sroa$8$0$$sroa_idx195>>2] = $100;
|
|
$$sroa$9$0$$sroa_idx197 = ((($0)) + 24|0);
|
|
HEAPF32[$$sroa$9$0$$sroa_idx197>>2] = $120;
|
|
$$sroa$10$0$$sroa_idx199 = ((($0)) + 28|0);
|
|
HEAP32[$$sroa$10$0$$sroa_idx199>>2] = $134;
|
|
$$sroa$11$0$$sroa_idx201 = ((($0)) + 32|0);
|
|
HEAPF32[$$sroa$11$0$$sroa_idx201>>2] = $85;
|
|
$$sroa$12$0$$sroa_idx203 = ((($0)) + 36|0);
|
|
HEAPF32[$$sroa$12$0$$sroa_idx203>>2] = $105;
|
|
$$sroa$13$0$$sroa_idx205 = ((($0)) + 40|0);
|
|
HEAPF32[$$sroa$13$0$$sroa_idx205>>2] = $125;
|
|
$$sroa$14$0$$sroa_idx207 = ((($0)) + 44|0);
|
|
HEAP32[$$sroa$14$0$$sroa_idx207>>2] = $136;
|
|
$$sroa$15$0$$sroa_idx209 = ((($0)) + 48|0);
|
|
HEAPF32[$$sroa$15$0$$sroa_idx209>>2] = $90;
|
|
$$sroa$16$0$$sroa_idx211 = ((($0)) + 52|0);
|
|
HEAPF32[$$sroa$16$0$$sroa_idx211>>2] = $110;
|
|
$$sroa$17$0$$sroa_idx213 = ((($0)) + 56|0);
|
|
HEAPF32[$$sroa$17$0$$sroa_idx213>>2] = $130;
|
|
$$sroa$18$0$$sroa_idx215 = ((($0)) + 60|0);
|
|
HEAP32[$$sroa$18$0$$sroa_idx215>>2] = $138;
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _MatrixScale($0,$1,$2,$3) {
|
|
$0 = $0|0;
|
|
$1 = +$1;
|
|
$2 = +$2;
|
|
$3 = +$3;
|
|
var $$sroa$5$0$$sroa_idx = 0, $$sroa$55$0$$sroa_idx6 = 0, $$sroa$6$0$$sroa_idx = 0, $$sroa$611$0$$sroa_idx12 = 0, $$sroa$7$0$$sroa_idx = 0, $$sroa$717$0$$sroa_idx18 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
HEAPF32[$0>>2] = $1;
|
|
$$sroa$5$0$$sroa_idx = ((($0)) + 4|0);
|
|
;HEAP32[$$sroa$5$0$$sroa_idx>>2]=0|0;HEAP32[$$sroa$5$0$$sroa_idx+4>>2]=0|0;HEAP32[$$sroa$5$0$$sroa_idx+8>>2]=0|0;HEAP32[$$sroa$5$0$$sroa_idx+12>>2]=0|0;
|
|
$$sroa$55$0$$sroa_idx6 = ((($0)) + 20|0);
|
|
HEAPF32[$$sroa$55$0$$sroa_idx6>>2] = $2;
|
|
$$sroa$6$0$$sroa_idx = ((($0)) + 24|0);
|
|
;HEAP32[$$sroa$6$0$$sroa_idx>>2]=0|0;HEAP32[$$sroa$6$0$$sroa_idx+4>>2]=0|0;HEAP32[$$sroa$6$0$$sroa_idx+8>>2]=0|0;HEAP32[$$sroa$6$0$$sroa_idx+12>>2]=0|0;
|
|
$$sroa$611$0$$sroa_idx12 = ((($0)) + 40|0);
|
|
HEAPF32[$$sroa$611$0$$sroa_idx12>>2] = $3;
|
|
$$sroa$7$0$$sroa_idx = ((($0)) + 44|0);
|
|
;HEAP32[$$sroa$7$0$$sroa_idx>>2]=0|0;HEAP32[$$sroa$7$0$$sroa_idx+4>>2]=0|0;HEAP32[$$sroa$7$0$$sroa_idx+8>>2]=0|0;HEAP32[$$sroa$7$0$$sroa_idx+12>>2]=0|0;
|
|
$$sroa$717$0$$sroa_idx18 = ((($0)) + 60|0);
|
|
HEAPF32[$$sroa$717$0$$sroa_idx18>>2] = 1.0;
|
|
return;
|
|
}
|
|
function _MatrixMultiply($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $$sroa$10$0$$sroa_idx14 = 0, $$sroa$11$0$$sroa_idx16 = 0, $$sroa$12$0$$sroa_idx18 = 0, $$sroa$13$0$$sroa_idx20 = 0, $$sroa$14$0$$sroa_idx22 = 0, $$sroa$15$0$$sroa_idx24 = 0, $$sroa$16$0$$sroa_idx26 = 0, $$sroa$17$0$$sroa_idx28 = 0, $$sroa$18$0$$sroa_idx30 = 0, $$sroa$4$0$$sroa_idx2 = 0, $$sroa$5$0$$sroa_idx4 = 0, $$sroa$6$0$$sroa_idx6 = 0, $$sroa$7$0$$sroa_idx8 = 0, $$sroa$8$0$$sroa_idx10 = 0, $$sroa$9$0$$sroa_idx12 = 0, $10 = 0.0, $100 = 0.0, $101 = 0.0, $102 = 0.0, $103 = 0.0;
|
|
var $104 = 0.0, $105 = 0, $106 = 0.0, $107 = 0.0, $108 = 0, $109 = 0.0, $11 = 0.0, $110 = 0.0, $111 = 0.0, $112 = 0, $113 = 0.0, $114 = 0.0, $115 = 0.0, $116 = 0, $117 = 0.0, $118 = 0.0, $119 = 0.0, $12 = 0, $120 = 0.0, $121 = 0.0;
|
|
var $122 = 0.0, $123 = 0.0, $124 = 0.0, $125 = 0.0, $126 = 0.0, $127 = 0.0, $128 = 0.0, $129 = 0.0, $13 = 0.0, $130 = 0.0, $131 = 0.0, $132 = 0.0, $133 = 0.0, $134 = 0.0, $135 = 0.0, $136 = 0.0, $137 = 0.0, $138 = 0.0, $139 = 0.0, $14 = 0;
|
|
var $140 = 0.0, $141 = 0, $142 = 0.0, $143 = 0.0, $144 = 0, $145 = 0.0, $146 = 0.0, $147 = 0.0, $148 = 0, $149 = 0.0, $15 = 0.0, $150 = 0.0, $151 = 0.0, $152 = 0, $153 = 0.0, $154 = 0.0, $155 = 0.0, $156 = 0.0, $157 = 0.0, $158 = 0.0;
|
|
var $159 = 0.0, $16 = 0.0, $160 = 0.0, $161 = 0.0, $162 = 0.0, $163 = 0.0, $164 = 0.0, $165 = 0.0, $166 = 0.0, $167 = 0.0, $168 = 0.0, $169 = 0.0, $17 = 0.0, $170 = 0.0, $171 = 0.0, $172 = 0.0, $173 = 0.0, $174 = 0.0, $175 = 0.0, $176 = 0.0;
|
|
var $18 = 0, $19 = 0.0, $20 = 0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0, $25 = 0.0, $26 = 0.0, $27 = 0, $28 = 0.0, $29 = 0.0, $3 = 0.0, $30 = 0.0, $31 = 0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0, $36 = 0.0;
|
|
var $37 = 0.0, $38 = 0.0, $39 = 0, $4 = 0.0, $40 = 0.0, $41 = 0.0, $42 = 0, $43 = 0.0, $44 = 0.0, $45 = 0.0, $46 = 0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0.0, $50 = 0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0;
|
|
var $55 = 0.0, $56 = 0.0, $57 = 0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0.0, $61 = 0, $62 = 0.0, $63 = 0.0, $64 = 0.0, $65 = 0, $66 = 0.0, $67 = 0.0, $68 = 0.0, $69 = 0, $7 = 0.0, $70 = 0.0, $71 = 0.0, $72 = 0;
|
|
var $73 = 0.0, $74 = 0.0, $75 = 0.0, $76 = 0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0, $80 = 0, $81 = 0.0, $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0.0, $86 = 0.0, $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0.0, $90 = 0.0;
|
|
var $91 = 0.0, $92 = 0.0, $93 = 0.0, $94 = 0.0, $95 = 0.0, $96 = 0.0, $97 = 0.0, $98 = 0.0, $99 = 0.0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = +HEAPF32[$2>>2];
|
|
$4 = +HEAPF32[$1>>2];
|
|
$5 = $3 * $4;
|
|
$6 = ((($2)) + 16|0);
|
|
$7 = +HEAPF32[$6>>2];
|
|
$8 = ((($1)) + 4|0);
|
|
$9 = +HEAPF32[$8>>2];
|
|
$10 = $7 * $9;
|
|
$11 = $5 + $10;
|
|
$12 = ((($2)) + 32|0);
|
|
$13 = +HEAPF32[$12>>2];
|
|
$14 = ((($1)) + 8|0);
|
|
$15 = +HEAPF32[$14>>2];
|
|
$16 = $13 * $15;
|
|
$17 = $11 + $16;
|
|
$18 = ((($2)) + 48|0);
|
|
$19 = +HEAPF32[$18>>2];
|
|
$20 = ((($1)) + 12|0);
|
|
$21 = +HEAPF32[$20>>2];
|
|
$22 = $19 * $21;
|
|
$23 = $17 + $22;
|
|
$24 = ((($1)) + 16|0);
|
|
$25 = +HEAPF32[$24>>2];
|
|
$26 = $3 * $25;
|
|
$27 = ((($1)) + 20|0);
|
|
$28 = +HEAPF32[$27>>2];
|
|
$29 = $7 * $28;
|
|
$30 = $26 + $29;
|
|
$31 = ((($1)) + 24|0);
|
|
$32 = +HEAPF32[$31>>2];
|
|
$33 = $13 * $32;
|
|
$34 = $30 + $33;
|
|
$35 = ((($1)) + 28|0);
|
|
$36 = +HEAPF32[$35>>2];
|
|
$37 = $19 * $36;
|
|
$38 = $34 + $37;
|
|
$39 = ((($1)) + 32|0);
|
|
$40 = +HEAPF32[$39>>2];
|
|
$41 = $3 * $40;
|
|
$42 = ((($1)) + 36|0);
|
|
$43 = +HEAPF32[$42>>2];
|
|
$44 = $7 * $43;
|
|
$45 = $41 + $44;
|
|
$46 = ((($1)) + 40|0);
|
|
$47 = +HEAPF32[$46>>2];
|
|
$48 = $13 * $47;
|
|
$49 = $45 + $48;
|
|
$50 = ((($1)) + 44|0);
|
|
$51 = +HEAPF32[$50>>2];
|
|
$52 = $19 * $51;
|
|
$53 = $49 + $52;
|
|
$54 = ((($1)) + 48|0);
|
|
$55 = +HEAPF32[$54>>2];
|
|
$56 = $3 * $55;
|
|
$57 = ((($1)) + 52|0);
|
|
$58 = +HEAPF32[$57>>2];
|
|
$59 = $7 * $58;
|
|
$60 = $56 + $59;
|
|
$61 = ((($1)) + 56|0);
|
|
$62 = +HEAPF32[$61>>2];
|
|
$63 = $13 * $62;
|
|
$64 = $60 + $63;
|
|
$65 = ((($1)) + 60|0);
|
|
$66 = +HEAPF32[$65>>2];
|
|
$67 = $19 * $66;
|
|
$68 = $64 + $67;
|
|
$69 = ((($2)) + 4|0);
|
|
$70 = +HEAPF32[$69>>2];
|
|
$71 = $4 * $70;
|
|
$72 = ((($2)) + 20|0);
|
|
$73 = +HEAPF32[$72>>2];
|
|
$74 = $9 * $73;
|
|
$75 = $71 + $74;
|
|
$76 = ((($2)) + 36|0);
|
|
$77 = +HEAPF32[$76>>2];
|
|
$78 = $15 * $77;
|
|
$79 = $75 + $78;
|
|
$80 = ((($2)) + 52|0);
|
|
$81 = +HEAPF32[$80>>2];
|
|
$82 = $21 * $81;
|
|
$83 = $79 + $82;
|
|
$84 = $25 * $70;
|
|
$85 = $28 * $73;
|
|
$86 = $84 + $85;
|
|
$87 = $32 * $77;
|
|
$88 = $86 + $87;
|
|
$89 = $36 * $81;
|
|
$90 = $88 + $89;
|
|
$91 = $40 * $70;
|
|
$92 = $43 * $73;
|
|
$93 = $91 + $92;
|
|
$94 = $47 * $77;
|
|
$95 = $93 + $94;
|
|
$96 = $51 * $81;
|
|
$97 = $95 + $96;
|
|
$98 = $55 * $70;
|
|
$99 = $58 * $73;
|
|
$100 = $98 + $99;
|
|
$101 = $62 * $77;
|
|
$102 = $100 + $101;
|
|
$103 = $66 * $81;
|
|
$104 = $102 + $103;
|
|
$105 = ((($2)) + 8|0);
|
|
$106 = +HEAPF32[$105>>2];
|
|
$107 = $4 * $106;
|
|
$108 = ((($2)) + 24|0);
|
|
$109 = +HEAPF32[$108>>2];
|
|
$110 = $9 * $109;
|
|
$111 = $107 + $110;
|
|
$112 = ((($2)) + 40|0);
|
|
$113 = +HEAPF32[$112>>2];
|
|
$114 = $15 * $113;
|
|
$115 = $111 + $114;
|
|
$116 = ((($2)) + 56|0);
|
|
$117 = +HEAPF32[$116>>2];
|
|
$118 = $21 * $117;
|
|
$119 = $115 + $118;
|
|
$120 = $25 * $106;
|
|
$121 = $28 * $109;
|
|
$122 = $120 + $121;
|
|
$123 = $32 * $113;
|
|
$124 = $122 + $123;
|
|
$125 = $36 * $117;
|
|
$126 = $124 + $125;
|
|
$127 = $40 * $106;
|
|
$128 = $43 * $109;
|
|
$129 = $127 + $128;
|
|
$130 = $47 * $113;
|
|
$131 = $129 + $130;
|
|
$132 = $51 * $117;
|
|
$133 = $131 + $132;
|
|
$134 = $55 * $106;
|
|
$135 = $58 * $109;
|
|
$136 = $134 + $135;
|
|
$137 = $62 * $113;
|
|
$138 = $136 + $137;
|
|
$139 = $66 * $117;
|
|
$140 = $138 + $139;
|
|
$141 = ((($2)) + 12|0);
|
|
$142 = +HEAPF32[$141>>2];
|
|
$143 = $4 * $142;
|
|
$144 = ((($2)) + 28|0);
|
|
$145 = +HEAPF32[$144>>2];
|
|
$146 = $9 * $145;
|
|
$147 = $143 + $146;
|
|
$148 = ((($2)) + 44|0);
|
|
$149 = +HEAPF32[$148>>2];
|
|
$150 = $15 * $149;
|
|
$151 = $147 + $150;
|
|
$152 = ((($2)) + 60|0);
|
|
$153 = +HEAPF32[$152>>2];
|
|
$154 = $21 * $153;
|
|
$155 = $151 + $154;
|
|
$156 = $25 * $142;
|
|
$157 = $28 * $145;
|
|
$158 = $156 + $157;
|
|
$159 = $32 * $149;
|
|
$160 = $158 + $159;
|
|
$161 = $36 * $153;
|
|
$162 = $160 + $161;
|
|
$163 = $40 * $142;
|
|
$164 = $43 * $145;
|
|
$165 = $163 + $164;
|
|
$166 = $47 * $149;
|
|
$167 = $165 + $166;
|
|
$168 = $51 * $153;
|
|
$169 = $167 + $168;
|
|
$170 = $55 * $142;
|
|
$171 = $58 * $145;
|
|
$172 = $170 + $171;
|
|
$173 = $62 * $149;
|
|
$174 = $172 + $173;
|
|
$175 = $66 * $153;
|
|
$176 = $174 + $175;
|
|
HEAPF32[$0>>2] = $23;
|
|
$$sroa$4$0$$sroa_idx2 = ((($0)) + 4|0);
|
|
HEAPF32[$$sroa$4$0$$sroa_idx2>>2] = $83;
|
|
$$sroa$5$0$$sroa_idx4 = ((($0)) + 8|0);
|
|
HEAPF32[$$sroa$5$0$$sroa_idx4>>2] = $119;
|
|
$$sroa$6$0$$sroa_idx6 = ((($0)) + 12|0);
|
|
HEAPF32[$$sroa$6$0$$sroa_idx6>>2] = $155;
|
|
$$sroa$7$0$$sroa_idx8 = ((($0)) + 16|0);
|
|
HEAPF32[$$sroa$7$0$$sroa_idx8>>2] = $38;
|
|
$$sroa$8$0$$sroa_idx10 = ((($0)) + 20|0);
|
|
HEAPF32[$$sroa$8$0$$sroa_idx10>>2] = $90;
|
|
$$sroa$9$0$$sroa_idx12 = ((($0)) + 24|0);
|
|
HEAPF32[$$sroa$9$0$$sroa_idx12>>2] = $126;
|
|
$$sroa$10$0$$sroa_idx14 = ((($0)) + 28|0);
|
|
HEAPF32[$$sroa$10$0$$sroa_idx14>>2] = $162;
|
|
$$sroa$11$0$$sroa_idx16 = ((($0)) + 32|0);
|
|
HEAPF32[$$sroa$11$0$$sroa_idx16>>2] = $53;
|
|
$$sroa$12$0$$sroa_idx18 = ((($0)) + 36|0);
|
|
HEAPF32[$$sroa$12$0$$sroa_idx18>>2] = $97;
|
|
$$sroa$13$0$$sroa_idx20 = ((($0)) + 40|0);
|
|
HEAPF32[$$sroa$13$0$$sroa_idx20>>2] = $133;
|
|
$$sroa$14$0$$sroa_idx22 = ((($0)) + 44|0);
|
|
HEAPF32[$$sroa$14$0$$sroa_idx22>>2] = $169;
|
|
$$sroa$15$0$$sroa_idx24 = ((($0)) + 48|0);
|
|
HEAPF32[$$sroa$15$0$$sroa_idx24>>2] = $68;
|
|
$$sroa$16$0$$sroa_idx26 = ((($0)) + 52|0);
|
|
HEAPF32[$$sroa$16$0$$sroa_idx26>>2] = $104;
|
|
$$sroa$17$0$$sroa_idx28 = ((($0)) + 56|0);
|
|
HEAPF32[$$sroa$17$0$$sroa_idx28>>2] = $140;
|
|
$$sroa$18$0$$sroa_idx30 = ((($0)) + 60|0);
|
|
HEAPF32[$$sroa$18$0$$sroa_idx30>>2] = $176;
|
|
return;
|
|
}
|
|
function _MatrixOrtho($0,$1,$2,$3,$4,$5,$6) {
|
|
$0 = $0|0;
|
|
$1 = +$1;
|
|
$2 = +$2;
|
|
$3 = +$3;
|
|
$4 = +$4;
|
|
$5 = +$5;
|
|
$6 = +$6;
|
|
var $$sroa$10$0$$sroa_idx24 = 0, $$sroa$11$0$$sroa_idx26 = 0, $$sroa$12$0$$sroa_idx28 = 0, $$sroa$13$0$$sroa_idx30 = 0, $$sroa$14$0$$sroa_idx32 = 0, $$sroa$15$0$$sroa_idx34 = 0, $$sroa$16$0$$sroa_idx36 = 0, $$sroa$17$0$$sroa_idx38 = 0, $$sroa$18$0$$sroa_idx40 = 0, $$sroa$4$0$$sroa_idx12 = 0, $$sroa$5$0$$sroa_idx14 = 0, $$sroa$6$0$$sroa_idx16 = 0, $$sroa$7$0$$sroa_idx18 = 0, $$sroa$8$0$$sroa_idx20 = 0, $$sroa$9$0$$sroa_idx22 = 0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0;
|
|
var $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $19 = 0.0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0.0, $24 = 0.0, $25 = 0.0, $26 = 0.0, $27 = 0.0, $28 = 0.0, $29 = 0.0, $30 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, label = 0;
|
|
var sp = 0;
|
|
sp = STACKTOP;
|
|
$7 = $2 - $1;
|
|
$8 = $7;
|
|
$9 = $4 - $3;
|
|
$10 = $9;
|
|
$11 = $6 - $5;
|
|
$12 = $11;
|
|
$13 = 2.0 / $8;
|
|
$14 = 2.0 / $10;
|
|
$15 = -2.0 / $12;
|
|
$16 = $1 + $2;
|
|
$17 = -$16;
|
|
$18 = $8;
|
|
$19 = $17 / $18;
|
|
$20 = $19;
|
|
$21 = $3 + $4;
|
|
$22 = -$21;
|
|
$23 = $10;
|
|
$24 = $22 / $23;
|
|
$25 = $24;
|
|
$26 = $5 + $6;
|
|
$27 = -$26;
|
|
$28 = $12;
|
|
$29 = $27 / $28;
|
|
$30 = $29;
|
|
HEAPF32[$0>>2] = $13;
|
|
$$sroa$4$0$$sroa_idx12 = ((($0)) + 4|0);
|
|
HEAPF32[$$sroa$4$0$$sroa_idx12>>2] = 0.0;
|
|
$$sroa$5$0$$sroa_idx14 = ((($0)) + 8|0);
|
|
HEAPF32[$$sroa$5$0$$sroa_idx14>>2] = 0.0;
|
|
$$sroa$6$0$$sroa_idx16 = ((($0)) + 12|0);
|
|
HEAPF32[$$sroa$6$0$$sroa_idx16>>2] = $20;
|
|
$$sroa$7$0$$sroa_idx18 = ((($0)) + 16|0);
|
|
HEAPF32[$$sroa$7$0$$sroa_idx18>>2] = 0.0;
|
|
$$sroa$8$0$$sroa_idx20 = ((($0)) + 20|0);
|
|
HEAPF32[$$sroa$8$0$$sroa_idx20>>2] = $14;
|
|
$$sroa$9$0$$sroa_idx22 = ((($0)) + 24|0);
|
|
HEAPF32[$$sroa$9$0$$sroa_idx22>>2] = 0.0;
|
|
$$sroa$10$0$$sroa_idx24 = ((($0)) + 28|0);
|
|
HEAPF32[$$sroa$10$0$$sroa_idx24>>2] = $25;
|
|
$$sroa$11$0$$sroa_idx26 = ((($0)) + 32|0);
|
|
HEAPF32[$$sroa$11$0$$sroa_idx26>>2] = 0.0;
|
|
$$sroa$12$0$$sroa_idx28 = ((($0)) + 36|0);
|
|
HEAPF32[$$sroa$12$0$$sroa_idx28>>2] = 0.0;
|
|
$$sroa$13$0$$sroa_idx30 = ((($0)) + 40|0);
|
|
HEAPF32[$$sroa$13$0$$sroa_idx30>>2] = $15;
|
|
$$sroa$14$0$$sroa_idx32 = ((($0)) + 44|0);
|
|
HEAPF32[$$sroa$14$0$$sroa_idx32>>2] = $30;
|
|
$$sroa$15$0$$sroa_idx34 = ((($0)) + 48|0);
|
|
HEAPF32[$$sroa$15$0$$sroa_idx34>>2] = 0.0;
|
|
$$sroa$16$0$$sroa_idx36 = ((($0)) + 52|0);
|
|
HEAPF32[$$sroa$16$0$$sroa_idx36>>2] = 0.0;
|
|
$$sroa$17$0$$sroa_idx38 = ((($0)) + 56|0);
|
|
HEAPF32[$$sroa$17$0$$sroa_idx38>>2] = 0.0;
|
|
$$sroa$18$0$$sroa_idx40 = ((($0)) + 60|0);
|
|
HEAPF32[$$sroa$18$0$$sroa_idx40>>2] = 1.0;
|
|
return;
|
|
}
|
|
function _ProcessGestureEvent($0) {
|
|
$0 = $0|0;
|
|
var $$$sink = 0, $$sink = 0, $$sink10 = 0, $$sink11 = 0, $$sink16 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0.0, $111 = 0.0;
|
|
var $112 = 0.0, $113 = 0.0, $114 = 0.0, $115 = 0.0, $116 = 0.0, $117 = 0, $118 = 0, $119 = 0, $12 = 0.0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0;
|
|
var $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0;
|
|
var $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0.0, $16 = 0, $160 = 0.0, $161 = 0.0, $162 = 0.0, $163 = 0.0, $164 = 0.0, $165 = 0.0, $166 = 0;
|
|
var $167 = 0.0, $168 = 0, $169 = 0.0, $17 = 0, $170 = 0.0, $171 = 0.0, $172 = 0, $173 = 0.0, $174 = 0.0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
|
|
var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0;
|
|
var $46 = 0, $47 = 0, $48 = 0.0, $49 = 0.0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0.0, $56 = 0.0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0;
|
|
var $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0.0, $81 = 0;
|
|
var $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0.0, $86 = 0.0, $87 = 0.0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $moveDownPosition$byval_copy11 = 0;
|
|
var $moveDownPosition2$byval_copy12 = 0, $or$cond = 0, $or$cond3 = 0, $or$cond5 = 0, $or$cond7 = 0, $or$cond9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
|
|
$moveDownPosition2$byval_copy12 = sp + 8|0;
|
|
$moveDownPosition$byval_copy11 = sp;
|
|
$1 = ((($0)) + 4|0);
|
|
$2 = HEAP32[$1>>2]|0;
|
|
HEAP32[7740] = $2;
|
|
$3 = ($2|0)<(2);
|
|
$4 = HEAP32[$0>>2]|0;
|
|
$5 = ($4|0)==(1);
|
|
if (!($3)) {
|
|
if ($5) {
|
|
$88 = ((($0)) + 24|0);
|
|
$89 = $88;
|
|
$90 = $89;
|
|
$91 = HEAP32[$90>>2]|0;
|
|
$92 = (($89) + 4)|0;
|
|
$93 = $92;
|
|
$94 = HEAP32[$93>>2]|0;
|
|
$95 = 14008;
|
|
$96 = $95;
|
|
HEAP32[$96>>2] = $91;
|
|
$97 = (($95) + 4)|0;
|
|
$98 = $97;
|
|
HEAP32[$98>>2] = $94;
|
|
$99 = ((($0)) + 32|0);
|
|
$100 = $99;
|
|
$101 = $100;
|
|
$102 = HEAP32[$101>>2]|0;
|
|
$103 = (($100) + 4)|0;
|
|
$104 = $103;
|
|
$105 = HEAP32[$104>>2]|0;
|
|
$106 = 14048;
|
|
$107 = $106;
|
|
HEAP32[$107>>2] = $102;
|
|
$108 = (($106) + 4)|0;
|
|
$109 = $108;
|
|
HEAP32[$109>>2] = $105;
|
|
$110 = +HEAPF32[3512];
|
|
$111 = +HEAPF32[3502];
|
|
$112 = $110 - $111;
|
|
HEAPF32[3514] = $112;
|
|
$113 = +HEAPF32[(14052)>>2];
|
|
$114 = +HEAPF32[(14012)>>2];
|
|
$115 = $113 - $114;
|
|
HEAPF32[(14060)>>2] = $115;
|
|
HEAP32[7739] = 4;
|
|
STACKTOP = sp;return;
|
|
}
|
|
switch ($4|0) {
|
|
case 2: {
|
|
;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[14040>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[14040+4>>2]|0;
|
|
;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[14064>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[14064+4>>2]|0;
|
|
$116 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
|
|
HEAPF32[7745] = $116;
|
|
$117 = 14040;
|
|
$118 = $117;
|
|
$119 = HEAP32[$118>>2]|0;
|
|
$120 = (($117) + 4)|0;
|
|
$121 = $120;
|
|
$122 = HEAP32[$121>>2]|0;
|
|
$123 = 14008;
|
|
$124 = $123;
|
|
HEAP32[$124>>2] = $119;
|
|
$125 = (($123) + 4)|0;
|
|
$126 = $125;
|
|
HEAP32[$126>>2] = $122;
|
|
$127 = 14064;
|
|
$128 = $127;
|
|
$129 = HEAP32[$128>>2]|0;
|
|
$130 = (($127) + 4)|0;
|
|
$131 = $130;
|
|
$132 = HEAP32[$131>>2]|0;
|
|
$133 = 14048;
|
|
$134 = $133;
|
|
HEAP32[$134>>2] = $129;
|
|
$135 = (($133) + 4)|0;
|
|
$136 = $135;
|
|
HEAP32[$136>>2] = $132;
|
|
$137 = ((($0)) + 24|0);
|
|
$138 = $137;
|
|
$139 = $138;
|
|
$140 = HEAP32[$139>>2]|0;
|
|
$141 = (($138) + 4)|0;
|
|
$142 = $141;
|
|
$143 = HEAP32[$142>>2]|0;
|
|
$144 = 14040;
|
|
$145 = $144;
|
|
HEAP32[$145>>2] = $140;
|
|
$146 = (($144) + 4)|0;
|
|
$147 = $146;
|
|
HEAP32[$147>>2] = $143;
|
|
$148 = ((($0)) + 32|0);
|
|
$149 = $148;
|
|
$150 = $149;
|
|
$151 = HEAP32[$150>>2]|0;
|
|
$152 = (($149) + 4)|0;
|
|
$153 = $152;
|
|
$154 = HEAP32[$153>>2]|0;
|
|
$155 = 14064;
|
|
$156 = $155;
|
|
HEAP32[$156>>2] = $151;
|
|
$157 = (($155) + 4)|0;
|
|
$158 = $157;
|
|
HEAP32[$158>>2] = $154;
|
|
$159 = +HEAPF32[3516];
|
|
$160 = +HEAPF32[3510];
|
|
$161 = $159 - $160;
|
|
HEAPF32[3514] = $161;
|
|
$162 = +HEAPF32[(14068)>>2];
|
|
$163 = +HEAPF32[(14044)>>2];
|
|
$164 = $162 - $163;
|
|
HEAPF32[(14060)>>2] = $164;
|
|
;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[14008>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[14008+4>>2]|0;
|
|
;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[14040>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[14040+4>>2]|0;
|
|
$165 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
|
|
$166 = !($165 >= 0.004999999888241291);
|
|
if ($166) {
|
|
;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[14048>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[14048+4>>2]|0;
|
|
;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[14064>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[14064+4>>2]|0;
|
|
$167 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
|
|
$168 = !($167 >= 0.004999999888241291);
|
|
if ($168) {
|
|
$$sink16 = 4;
|
|
} else {
|
|
label = 29;
|
|
}
|
|
} else {
|
|
label = 29;
|
|
}
|
|
if ((label|0) == 29) {
|
|
;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[14040>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[14040+4>>2]|0;
|
|
;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[14064>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[14064+4>>2]|0;
|
|
$169 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
|
|
$170 = +HEAPF32[7745];
|
|
$171 = $169 - $170;
|
|
$172 = $171 < 0.0;
|
|
$$sink11 = $172 ? 256 : 512;
|
|
$$sink16 = $$sink11;
|
|
}
|
|
HEAP32[7739] = $$sink16;
|
|
;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[14040>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[14040+4>>2]|0;
|
|
;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[14064>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[14064+4>>2]|0;
|
|
$173 = (+_Vector2Angle($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
|
|
$174 = 360.0 - $173;
|
|
HEAPF32[7746] = $174;
|
|
STACKTOP = sp;return;
|
|
break;
|
|
}
|
|
case 0: {
|
|
HEAPF32[7745] = 0.0;
|
|
HEAPF32[7746] = 0.0;
|
|
HEAPF32[3514] = 0.0;
|
|
HEAPF32[(14060)>>2] = 0.0;
|
|
HEAP32[7740] = 0;
|
|
HEAP32[7739] = 0;
|
|
STACKTOP = sp;return;
|
|
break;
|
|
}
|
|
default: {
|
|
STACKTOP = sp;return;
|
|
}
|
|
}
|
|
}
|
|
if ($5) {
|
|
$6 = HEAP32[7741]|0;
|
|
$7 = (($6) + 1)|0;
|
|
HEAP32[7741] = $7;
|
|
$8 = HEAP32[7739]|0;
|
|
$9 = ($8|0)==(0);
|
|
$10 = ($6|0)>(0);
|
|
$or$cond = $10 & $9;
|
|
if ($or$cond) {
|
|
$11 = ((($0)) + 24|0);
|
|
;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[14008>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[14008+4>>2]|0;
|
|
;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[$11>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[$11+4>>2]|0;
|
|
$12 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
|
|
$13 = $12 < 0.029999999329447746;
|
|
if ($13) {
|
|
HEAP32[7739] = 2;
|
|
HEAP32[7741] = 0;
|
|
} else {
|
|
label = 6;
|
|
}
|
|
} else {
|
|
label = 6;
|
|
}
|
|
if ((label|0) == 6) {
|
|
HEAP32[7741] = 1;
|
|
HEAP32[7739] = 1;
|
|
}
|
|
$14 = ((($0)) + 24|0);
|
|
$15 = $14;
|
|
$16 = $15;
|
|
$17 = HEAP32[$16>>2]|0;
|
|
$18 = (($15) + 4)|0;
|
|
$19 = $18;
|
|
$20 = HEAP32[$19>>2]|0;
|
|
$21 = 14008;
|
|
$22 = $21;
|
|
HEAP32[$22>>2] = $17;
|
|
$23 = (($21) + 4)|0;
|
|
$24 = $23;
|
|
HEAP32[$24>>2] = $20;
|
|
$25 = 14016;
|
|
$26 = $25;
|
|
HEAP32[$26>>2] = $17;
|
|
$27 = (($25) + 4)|0;
|
|
$28 = $27;
|
|
HEAP32[$28>>2] = $20;
|
|
$29 = 14024;
|
|
$30 = $29;
|
|
HEAP32[$30>>2] = $17;
|
|
$31 = (($29) + 4)|0;
|
|
$32 = $31;
|
|
HEAP32[$32>>2] = $20;
|
|
$33 = ((($0)) + 8|0);
|
|
$34 = HEAP32[$33>>2]|0;
|
|
HEAP32[6] = $34;
|
|
HEAPF32[3508] = 0.0;
|
|
HEAPF32[(14036)>>2] = 0.0;
|
|
STACKTOP = sp;return;
|
|
}
|
|
switch ($4|0) {
|
|
case 0: {
|
|
$35 = HEAP32[7739]|0;
|
|
$36 = ($35|0)==(8);
|
|
if ($36) {
|
|
$37 = ((($0)) + 24|0);
|
|
$38 = $37;
|
|
$39 = $38;
|
|
$40 = HEAP32[$39>>2]|0;
|
|
$41 = (($38) + 4)|0;
|
|
$42 = $41;
|
|
$43 = HEAP32[$42>>2]|0;
|
|
$44 = 14024;
|
|
$45 = $44;
|
|
HEAP32[$45>>2] = $40;
|
|
$46 = (($44) + 4)|0;
|
|
$47 = $46;
|
|
HEAP32[$47>>2] = $43;
|
|
}
|
|
;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[14008>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[14008+4>>2]|0;
|
|
;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[14024>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[14024+4>>2]|0;
|
|
$48 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
|
|
$49 = $48 / 0.0;
|
|
HEAPF32[7742] = $49;
|
|
HEAP32[7743] = 0;
|
|
$50 = $49 > 5.0000002374872565E-4;
|
|
if ($50) {
|
|
$51 = HEAP32[6]|0;
|
|
$52 = ((($0)) + 8|0);
|
|
$53 = HEAP32[$52>>2]|0;
|
|
$54 = ($51|0)==($53|0);
|
|
if ($54) {
|
|
;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[14008>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[14008+4>>2]|0;
|
|
;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[14024>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[14024+4>>2]|0;
|
|
$55 = (+_Vector2Angle($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
|
|
$56 = 360.0 - $55;
|
|
HEAPF32[7744] = $56;
|
|
$57 = $56 < 30.0;
|
|
$58 = $56 > 330.0;
|
|
$or$cond3 = $57 | $58;
|
|
if ($or$cond3) {
|
|
$$sink10 = 16;
|
|
} else {
|
|
$59 = $56 > 30.0;
|
|
$60 = $56 < 120.0;
|
|
$or$cond5 = $59 & $60;
|
|
if ($or$cond5) {
|
|
$$sink10 = 64;
|
|
} else {
|
|
$61 = $56 > 120.0;
|
|
$62 = $56 < 210.0;
|
|
$or$cond7 = $61 & $62;
|
|
$63 = $56 > 210.0;
|
|
$64 = $56 < 300.0;
|
|
$or$cond9 = $63 & $64;
|
|
$$sink = $or$cond9 ? 128 : 0;
|
|
$$$sink = $or$cond7 ? 32 : $$sink;
|
|
$$sink10 = $$$sink;
|
|
}
|
|
}
|
|
} else {
|
|
label = 16;
|
|
}
|
|
} else {
|
|
label = 16;
|
|
}
|
|
if ((label|0) == 16) {
|
|
HEAPF32[7742] = 0.0;
|
|
HEAPF32[7744] = 0.0;
|
|
$$sink10 = 0;
|
|
}
|
|
HEAP32[7739] = $$sink10;
|
|
HEAPF32[3504] = 0.0;
|
|
HEAPF32[(14020)>>2] = 0.0;
|
|
HEAP32[7740] = 0;
|
|
STACKTOP = sp;return;
|
|
break;
|
|
}
|
|
case 2: {
|
|
$65 = HEAP32[7743]|0;
|
|
$66 = ($65|0)==(0);
|
|
if ($66) {
|
|
HEAP32[7743] = 1;
|
|
}
|
|
$67 = ((($0)) + 24|0);
|
|
$68 = $67;
|
|
$69 = $68;
|
|
$70 = HEAP32[$69>>2]|0;
|
|
$71 = (($68) + 4)|0;
|
|
$72 = $71;
|
|
$73 = HEAP32[$72>>2]|0;
|
|
$74 = 14040;
|
|
$75 = $74;
|
|
HEAP32[$75>>2] = $70;
|
|
$76 = (($74) + 4)|0;
|
|
$77 = $76;
|
|
HEAP32[$77>>2] = $73;
|
|
$78 = HEAP32[7739]|0;
|
|
$79 = ($78|0)==(4);
|
|
if ($79) {
|
|
;HEAP32[$moveDownPosition$byval_copy11>>2]=HEAP32[14008>>2]|0;HEAP32[$moveDownPosition$byval_copy11+4>>2]=HEAP32[14008+4>>2]|0;
|
|
;HEAP32[$moveDownPosition2$byval_copy12>>2]=HEAP32[14040>>2]|0;HEAP32[$moveDownPosition2$byval_copy12+4>>2]=HEAP32[14040+4>>2]|0;
|
|
$80 = (+_Vector2Distance($moveDownPosition$byval_copy11,$moveDownPosition2$byval_copy12));
|
|
$81 = !($80 >= 0.014999999664723873);
|
|
if (!($81)) {
|
|
HEAP32[7739] = 8;
|
|
}
|
|
}
|
|
$82 = +HEAPF32[3510];
|
|
$83 = +HEAPF32[3504];
|
|
$84 = $82 - $83;
|
|
HEAPF32[3508] = $84;
|
|
$85 = +HEAPF32[(14044)>>2];
|
|
$86 = +HEAPF32[(14020)>>2];
|
|
$87 = $85 - $86;
|
|
HEAPF32[(14036)>>2] = $87;
|
|
STACKTOP = sp;return;
|
|
break;
|
|
}
|
|
default: {
|
|
STACKTOP = sp;return;
|
|
}
|
|
}
|
|
}
|
|
function _UpdateGestures() {
|
|
var $$off = 0, $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $or$cond3 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$0 = HEAP32[7739]|0;
|
|
$$off = (($0) + -1)|0;
|
|
$1 = ($$off>>>0)<(2);
|
|
$2 = HEAP32[7740]|0;
|
|
$3 = ($2|0)<(2);
|
|
$or$cond3 = $1 & $3;
|
|
if ($or$cond3) {
|
|
HEAP32[7739] = 4;
|
|
}
|
|
$4 = HEAP32[7739]|0;
|
|
$5 = (($4) + -16)|0;
|
|
$6 = $5 >>> 4;
|
|
$7 = $5 << 28;
|
|
$8 = $6 | $7;
|
|
switch ($8|0) {
|
|
case 0: case 1: case 3: case 7: {
|
|
break;
|
|
}
|
|
default: {
|
|
return;
|
|
}
|
|
}
|
|
HEAP32[7739] = 0;
|
|
return;
|
|
}
|
|
function _GetMousePosition($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = 14072;
|
|
$2 = $1;
|
|
$3 = HEAP32[$2>>2]|0;
|
|
$4 = (($1) + 4)|0;
|
|
$5 = $4;
|
|
$6 = HEAP32[$5>>2]|0;
|
|
$7 = $0;
|
|
$8 = $7;
|
|
HEAP32[$8>>2] = $3;
|
|
$9 = (($7) + 4)|0;
|
|
$10 = $9;
|
|
HEAP32[$10>>2] = $6;
|
|
return;
|
|
}
|
|
function _GetScreenWidth() {
|
|
var $0 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$0 = HEAP32[7749]|0;
|
|
return ($0|0);
|
|
}
|
|
function _GetScreenHeight() {
|
|
var $0 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$0 = HEAP32[7748]|0;
|
|
return ($0|0);
|
|
}
|
|
function _InitWindow($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0, $3 = 0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0.0, $9 = 0, $vararg_buffer = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
|
|
$vararg_buffer = sp;
|
|
_TraceLog(0,3370,$vararg_buffer);
|
|
HEAP32[7751] = $2;
|
|
_InitGraphicsDevice($0,$1);
|
|
_LoadDefaultFont();
|
|
_InitTimer_12();
|
|
(_emscripten_set_fullscreenchange_callback((0|0),(0|0),1,(4|0))|0);
|
|
(_emscripten_set_keypress_callback((3399|0),(0|0),1,(5|0))|0);
|
|
(_emscripten_set_click_callback((3399|0),(0|0),1,(6|0))|0);
|
|
(_emscripten_set_touchstart_callback((3399|0),(0|0),1,(7|0))|0);
|
|
(_emscripten_set_touchend_callback((3399|0),(0|0),1,(7|0))|0);
|
|
(_emscripten_set_touchmove_callback((3399|0),(0|0),1,(7|0))|0);
|
|
(_emscripten_set_touchcancel_callback((3399|0),(0|0),1,(7|0))|0);
|
|
(_emscripten_set_gamepadconnected_callback((0|0),1,(8|0))|0);
|
|
(_emscripten_set_gamepaddisconnected_callback((0|0),1,(8|0))|0);
|
|
$3 = HEAP32[7749]|0;
|
|
$4 = (+($3|0));
|
|
$5 = $4 * 0.5;
|
|
HEAPF32[3518] = $5;
|
|
$6 = HEAP32[7748]|0;
|
|
$7 = (+($6|0));
|
|
$8 = $7 * 0.5;
|
|
HEAPF32[(14076)>>2] = $8;
|
|
$9 = HEAP32[7752]|0;
|
|
$10 = ($9|0)==(0);
|
|
if ($10) {
|
|
STACKTOP = sp;return;
|
|
}
|
|
_SetTargetFPS(60);
|
|
_LogoAnimation();
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _TraceLog($0,$1,$varargs) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$varargs = $varargs|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $endptr = 0, $strlen = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
|
|
$2 = sp;
|
|
switch ($0|0) {
|
|
case 0: {
|
|
;HEAP8[14112>>0]=HEAP8[7928>>0]|0;HEAP8[14112+1>>0]=HEAP8[7928+1>>0]|0;HEAP8[14112+2>>0]=HEAP8[7928+2>>0]|0;HEAP8[14112+3>>0]=HEAP8[7928+3>>0]|0;HEAP8[14112+4>>0]=HEAP8[7928+4>>0]|0;HEAP8[14112+5>>0]=HEAP8[7928+5>>0]|0;HEAP8[14112+6>>0]=HEAP8[7928+6>>0]|0;
|
|
break;
|
|
}
|
|
case 1: {
|
|
$3 = 14112;
|
|
$4 = $3;
|
|
HEAP32[$4>>2] = 1330795077;
|
|
$5 = (($3) + 4)|0;
|
|
$6 = $5;
|
|
HEAP32[$6>>2] = 2112082;
|
|
break;
|
|
}
|
|
case 2: {
|
|
dest=14112; src=7935; stop=dest+10|0; do { HEAP8[dest>>0]=HEAP8[src>>0]|0; dest=dest+1|0; src=src+1|0; } while ((dest|0) < (stop|0));
|
|
break;
|
|
}
|
|
case 3: {
|
|
$7 = 14112;
|
|
$8 = $7;
|
|
HEAP32[$8>>2] = 1430406468;
|
|
$9 = (($7) + 4)|0;
|
|
$10 = $9;
|
|
HEAP32[$10>>2] = 2112071;
|
|
break;
|
|
}
|
|
default: {
|
|
}
|
|
}
|
|
(_strcat(14112,$1)|0);
|
|
$strlen = (_strlen(14112)|0);
|
|
$endptr = (14112 + ($strlen)|0);
|
|
HEAP8[$endptr>>0]=10&255;HEAP8[$endptr+1>>0]=10>>8;
|
|
HEAP32[$2>>2] = $varargs;
|
|
$11 = ($0|0)==(3);
|
|
if ($11) {
|
|
STACKTOP = sp;return;
|
|
}
|
|
(_vprintf(14112,$2)|0);
|
|
$12 = ($0|0)==(1);
|
|
if ($12) {
|
|
_exit(1);
|
|
// unreachable;
|
|
} else {
|
|
STACKTOP = sp;return;
|
|
}
|
|
}
|
|
function _InitGraphicsDevice($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$015 = 0, $$byval_copy = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
|
|
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
|
|
var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
|
|
var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0.0, $79 = 0, $8 = 0, $80 = 0;
|
|
var $81 = 0, $82 = 0.0, $83 = 0, $84 = 0, $85 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer14 = 0, $vararg_buffer18 = 0, $vararg_buffer22 = 0, $vararg_buffer3 = 0, $vararg_buffer6 = 0, $vararg_buffer8 = 0, $vararg_ptr13 = 0, $vararg_ptr17 = 0, $vararg_ptr21 = 0, $vararg_ptr5 = 0, dest = 0;
|
|
var label = 0, sp = 0, src = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 144|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(144|0);
|
|
$$byval_copy = sp + 136|0;
|
|
$vararg_buffer22 = sp + 64|0;
|
|
$vararg_buffer18 = sp + 56|0;
|
|
$vararg_buffer14 = sp + 48|0;
|
|
$vararg_buffer10 = sp + 40|0;
|
|
$vararg_buffer8 = sp + 32|0;
|
|
$vararg_buffer6 = sp + 24|0;
|
|
$vararg_buffer3 = sp + 16|0;
|
|
$vararg_buffer1 = sp + 8|0;
|
|
$vararg_buffer = sp;
|
|
$2 = sp + 72|0;
|
|
$3 = sp + 140|0;
|
|
HEAP32[7749] = $0;
|
|
HEAP32[7748] = $1;
|
|
_MatrixIdentity($2);
|
|
dest=31084; src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
(_glfwSetErrorCallback((1|0))|0);
|
|
$4 = (_glfwInit()|0);
|
|
$5 = ($4|0)==(0);
|
|
if ($5) {
|
|
_TraceLog(1,4070,$vararg_buffer);
|
|
}
|
|
$6 = HEAP32[7749]|0;
|
|
HEAP32[7787] = $6;
|
|
$7 = HEAP32[7748]|0;
|
|
HEAP32[7788] = $7;
|
|
_glfwDefaultWindowHints();
|
|
$8 = HEAP8[35952]|0;
|
|
$9 = $8 & 4;
|
|
$10 = ($9<<24>>24)==(0);
|
|
if ($10) {
|
|
_glfwWindowHint(131075,0);
|
|
} else {
|
|
_glfwWindowHint(131075,1);
|
|
}
|
|
$11 = HEAP8[35952]|0;
|
|
$12 = $11 & 8;
|
|
$13 = ($12<<24>>24)==(0);
|
|
if (!($13)) {
|
|
_glfwWindowHint(131077,1);
|
|
}
|
|
$14 = HEAP8[35952]|0;
|
|
$15 = $14 & 32;
|
|
$16 = ($15<<24>>24)==(0);
|
|
if (!($16)) {
|
|
_glfwWindowHint(135181,4);
|
|
_TraceLog(0,4096,$vararg_buffer1);
|
|
}
|
|
$17 = (_rlGetVersion()|0);
|
|
$18 = ($17|0)==(2);
|
|
if ($18) {
|
|
_glfwWindowHint(139266,2);
|
|
_glfwWindowHint(139267,1);
|
|
} else {
|
|
$19 = (_rlGetVersion()|0);
|
|
$20 = ($19|0)==(3);
|
|
if ($20) {
|
|
_glfwWindowHint(139266,3);
|
|
_glfwWindowHint(139267,3);
|
|
_glfwWindowHint(139272,204801);
|
|
_glfwWindowHint(139270,0);
|
|
}
|
|
}
|
|
$21 = HEAP32[7789]|0;
|
|
$22 = ($21|0)==(0);
|
|
if ($22) {
|
|
$47 = HEAP32[7749]|0;
|
|
$48 = HEAP32[7748]|0;
|
|
$49 = HEAP32[7751]|0;
|
|
$50 = (_glfwCreateWindow(($47|0),($48|0),($49|0),(0|0),(0|0))|0);
|
|
HEAP32[7747] = $50;
|
|
$51 = HEAP32[7749]|0;
|
|
HEAP32[7790] = $51;
|
|
$52 = HEAP32[7748]|0;
|
|
HEAP32[7791] = $52;
|
|
$54 = $50;
|
|
} else {
|
|
$23 = (_glfwGetPrimaryMonitor()|0);
|
|
$24 = (_glfwGetVideoModes(($23|0),($$byval_copy|0))|0);
|
|
$25 = HEAP32[$$byval_copy>>2]|0;
|
|
$26 = ($25|0)>(0);
|
|
L22: do {
|
|
if ($26) {
|
|
$27 = HEAP32[7749]|0;
|
|
$28 = HEAP32[$$byval_copy>>2]|0;
|
|
$29 = HEAP32[7748]|0;
|
|
$$015 = 0;
|
|
while(1) {
|
|
$30 = (($24) + (($$015*24)|0)|0);
|
|
$31 = HEAP32[$30>>2]|0;
|
|
$32 = ($31|0)<($27|0);
|
|
if (!($32)) {
|
|
$33 = (((($24) + (($$015*24)|0)|0)) + 4|0);
|
|
$34 = HEAP32[$33>>2]|0;
|
|
$35 = ($34|0)<($29|0);
|
|
if (!($35)) {
|
|
break;
|
|
}
|
|
}
|
|
$36 = (($$015) + 1)|0;
|
|
$37 = ($36|0)<($28|0);
|
|
if ($37) {
|
|
$$015 = $36;
|
|
} else {
|
|
break L22;
|
|
}
|
|
}
|
|
HEAP32[7787] = $31;
|
|
HEAP32[7788] = $34;
|
|
}
|
|
} while(0);
|
|
$38 = HEAP32[7787]|0;
|
|
$39 = HEAP32[7788]|0;
|
|
HEAP32[$vararg_buffer3>>2] = $38;
|
|
$vararg_ptr5 = ((($vararg_buffer3)) + 4|0);
|
|
HEAP32[$vararg_ptr5>>2] = $39;
|
|
_TraceLog(2,4121,$vararg_buffer3);
|
|
$40 = HEAP32[7787]|0;
|
|
$41 = HEAP32[7788]|0;
|
|
_SetupFramebufferSize($40,$41);
|
|
$42 = HEAP32[7787]|0;
|
|
$43 = HEAP32[7788]|0;
|
|
$44 = HEAP32[7751]|0;
|
|
$45 = (_glfwGetPrimaryMonitor()|0);
|
|
$46 = (_glfwCreateWindow(($42|0),($43|0),($44|0),($45|0),(0|0))|0);
|
|
HEAP32[7747] = $46;
|
|
$54 = $46;
|
|
}
|
|
$53 = ($54|0)==(0|0);
|
|
if ($53) {
|
|
_glfwTerminate();
|
|
_TraceLog(1,4159,$vararg_buffer6);
|
|
} else {
|
|
_TraceLog(0,4192,$vararg_buffer8);
|
|
$55 = HEAP32[7790]|0;
|
|
$56 = HEAP32[7791]|0;
|
|
HEAP32[$vararg_buffer10>>2] = $55;
|
|
$vararg_ptr13 = ((($vararg_buffer10)) + 4|0);
|
|
HEAP32[$vararg_ptr13>>2] = $56;
|
|
_TraceLog(0,4232,$vararg_buffer10);
|
|
$57 = HEAP32[7749]|0;
|
|
$58 = HEAP32[7748]|0;
|
|
HEAP32[$vararg_buffer14>>2] = $57;
|
|
$vararg_ptr17 = ((($vararg_buffer14)) + 4|0);
|
|
HEAP32[$vararg_ptr17>>2] = $58;
|
|
_TraceLog(0,4253,$vararg_buffer14);
|
|
$59 = HEAP32[7792]|0;
|
|
$60 = HEAP32[7793]|0;
|
|
HEAP32[$vararg_buffer18>>2] = $59;
|
|
$vararg_ptr21 = ((($vararg_buffer18)) + 4|0);
|
|
HEAP32[$vararg_ptr21>>2] = $60;
|
|
_TraceLog(0,4274,$vararg_buffer18);
|
|
}
|
|
$61 = HEAP32[7747]|0;
|
|
(_glfwSetWindowSizeCallback(($61|0),(1|0))|0);
|
|
$62 = HEAP32[7747]|0;
|
|
(_glfwSetCursorEnterCallback(($62|0),(2|0))|0);
|
|
$63 = HEAP32[7747]|0;
|
|
(_glfwSetKeyCallback(($63|0),(1|0))|0);
|
|
$64 = HEAP32[7747]|0;
|
|
(_glfwSetMouseButtonCallback(($64|0),(1|0))|0);
|
|
$65 = HEAP32[7747]|0;
|
|
(_glfwSetCursorPosCallback(($65|0),(1|0))|0);
|
|
$66 = HEAP32[7747]|0;
|
|
(_glfwSetCharCallback(($66|0),(3|0))|0);
|
|
$67 = HEAP32[7747]|0;
|
|
(_glfwSetScrollCallback(($67|0),(2|0))|0);
|
|
$68 = HEAP32[7747]|0;
|
|
(_glfwSetWindowIconifyCallback(($68|0),(4|0))|0);
|
|
$69 = HEAP32[7747]|0;
|
|
_glfwMakeContextCurrent(($69|0));
|
|
_glfwSwapInterval(0);
|
|
$70 = HEAP8[35952]|0;
|
|
$71 = $70 & 64;
|
|
$72 = ($71<<24>>24)==(0);
|
|
if ($72) {
|
|
$73 = HEAP32[7749]|0;
|
|
$74 = HEAP32[7748]|0;
|
|
_rlglInit($73,$74);
|
|
_SetupViewport();
|
|
_rlMatrixMode(5889);
|
|
_rlLoadIdentity();
|
|
$75 = HEAP32[7790]|0;
|
|
$76 = HEAP32[7792]|0;
|
|
$77 = (($75) - ($76))|0;
|
|
$78 = (+($77|0));
|
|
$79 = HEAP32[7791]|0;
|
|
$80 = HEAP32[7793]|0;
|
|
$81 = (($79) - ($80))|0;
|
|
$82 = (+($81|0));
|
|
_rlOrtho(0.0,$78,$82,0.0,0.0,1.0);
|
|
_rlMatrixMode(5888);
|
|
_rlLoadIdentity();
|
|
HEAP8[$3>>0] = -11;
|
|
$83 = ((($3)) + 1|0);
|
|
HEAP8[$83>>0] = -11;
|
|
$84 = ((($3)) + 2|0);
|
|
HEAP8[$84>>0] = -11;
|
|
$85 = ((($3)) + 3|0);
|
|
HEAP8[$85>>0] = -1;
|
|
;HEAP8[$$byval_copy>>0]=HEAP8[$3>>0]|0;HEAP8[$$byval_copy+1>>0]=HEAP8[$3+1>>0]|0;HEAP8[$$byval_copy+2>>0]=HEAP8[$3+2>>0]|0;HEAP8[$$byval_copy+3>>0]=HEAP8[$3+3>>0]|0;
|
|
_ClearBackground($$byval_copy);
|
|
STACKTOP = sp;return;
|
|
}
|
|
_glfwSwapInterval(1);
|
|
_TraceLog(0,4299,$vararg_buffer22);
|
|
$73 = HEAP32[7749]|0;
|
|
$74 = HEAP32[7748]|0;
|
|
_rlglInit($73,$74);
|
|
_SetupViewport();
|
|
_rlMatrixMode(5889);
|
|
_rlLoadIdentity();
|
|
$75 = HEAP32[7790]|0;
|
|
$76 = HEAP32[7792]|0;
|
|
$77 = (($75) - ($76))|0;
|
|
$78 = (+($77|0));
|
|
$79 = HEAP32[7791]|0;
|
|
$80 = HEAP32[7793]|0;
|
|
$81 = (($79) - ($80))|0;
|
|
$82 = (+($81|0));
|
|
_rlOrtho(0.0,$78,$82,0.0,0.0,1.0);
|
|
_rlMatrixMode(5888);
|
|
_rlLoadIdentity();
|
|
HEAP8[$3>>0] = -11;
|
|
$83 = ((($3)) + 1|0);
|
|
HEAP8[$83>>0] = -11;
|
|
$84 = ((($3)) + 2|0);
|
|
HEAP8[$84>>0] = -11;
|
|
$85 = ((($3)) + 3|0);
|
|
HEAP8[$85>>0] = -1;
|
|
;HEAP8[$$byval_copy>>0]=HEAP8[$3>>0]|0;HEAP8[$$byval_copy+1>>0]=HEAP8[$3+1>>0]|0;HEAP8[$$byval_copy+2>>0]=HEAP8[$3+2>>0]|0;HEAP8[$$byval_copy+3>>0]=HEAP8[$3+3>>0]|0;
|
|
_ClearBackground($$byval_copy);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _LoadDefaultFont() {
|
|
var $$ = 0, $$0101 = 0, $$090100 = 0, $$09299 = 0, $$095104 = 0, $$096103 = 0, $$097102 = 0, $$191 = 0, $$193 = 0, $$byval_copy1 = 0, $$lcssa = 0, $$sroa$0$0$$sroa_idx = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0;
|
|
var $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0;
|
|
var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
|
|
var $vararg_buffer = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
|
|
$$byval_copy1 = sp + 44|0;
|
|
$vararg_buffer = sp;
|
|
$0 = sp + 4|0;
|
|
$1 = sp + 24|0;
|
|
HEAP32[(31052)>>2] = 224;
|
|
$2 = (_malloc(65536)|0);
|
|
_memset(($2|0),0,65536)|0;
|
|
$$095104 = 0;$$096103 = 0;
|
|
while(1) {
|
|
$3 = (28 + ($$095104<<2)|0);
|
|
$4 = HEAP32[$3>>2]|0;
|
|
$$097102 = 31;
|
|
while(1) {
|
|
$16 = 1 << $$097102;
|
|
$17 = $4 & $16;
|
|
$18 = ($17|0)==(0);
|
|
if (!($18)) {
|
|
$19 = (($$097102) + ($$096103))|0;
|
|
$$sroa$0$0$$sroa_idx = (($2) + ($19<<2)|0);
|
|
HEAP8[$$sroa$0$0$$sroa_idx>>0]=-1&255;HEAP8[$$sroa$0$0$$sroa_idx+1>>0]=(-1>>8)&255;HEAP8[$$sroa$0$0$$sroa_idx+2>>0]=(-1>>16)&255;HEAP8[$$sroa$0$0$$sroa_idx+3>>0]=-1>>24;
|
|
}
|
|
$20 = (($$097102) + -1)|0;
|
|
$21 = ($$097102|0)>(0);
|
|
if ($21) {
|
|
$$097102 = $20;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
$12 = (($$095104) + 1)|0;
|
|
$13 = ($$095104|0)>(511);
|
|
$$ = $13 ? 0 : $12;
|
|
$14 = (($$096103) + 32)|0;
|
|
$15 = ($14|0)<(16384);
|
|
if ($15) {
|
|
$$095104 = $$;$$096103 = $14;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
_LoadImageEx($0,$2,128,128);
|
|
_ImageFormat($0,2);
|
|
_free($2);
|
|
;HEAP32[$$byval_copy1>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[$$byval_copy1+12>>2]=HEAP32[$0+12>>2]|0;HEAP32[$$byval_copy1+16>>2]=HEAP32[$0+16>>2]|0;
|
|
_LoadTextureFromImage($1,$$byval_copy1);
|
|
;HEAP32[31028>>2]=HEAP32[$1>>2]|0;HEAP32[31028+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[31028+8>>2]=HEAP32[$1+8>>2]|0;HEAP32[31028+12>>2]=HEAP32[$1+12>>2]|0;HEAP32[31028+16>>2]=HEAP32[$1+16>>2]|0;
|
|
;HEAP32[$$byval_copy1>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[$$byval_copy1+12>>2]=HEAP32[$0+12>>2]|0;HEAP32[$$byval_copy1+16>>2]=HEAP32[$0+16>>2]|0;
|
|
_UnloadImage($$byval_copy1);
|
|
$5 = HEAP32[(31052)>>2]|0;
|
|
$6 = $5 << 5;
|
|
$7 = (_malloc($6)|0);
|
|
HEAP32[(31056)>>2] = $7;
|
|
$8 = ($5|0)>(0);
|
|
if (!($8)) {
|
|
$$lcssa = $7;
|
|
$22 = ((($$lcssa)) + 16|0);
|
|
$23 = HEAP32[$22>>2]|0;
|
|
HEAP32[(31048)>>2] = $23;
|
|
$24 = HEAP32[7757]|0;
|
|
HEAP32[$vararg_buffer>>2] = $24;
|
|
_TraceLog(0,3594,$vararg_buffer);
|
|
STACKTOP = sp;return;
|
|
}
|
|
$9 = HEAP32[(31032)>>2]|0;
|
|
$10 = HEAP32[(31052)>>2]|0;
|
|
$11 = HEAP32[(31056)>>2]|0;
|
|
$$0101 = 0;$$090100 = 1;$$09299 = 0;$27 = $7;
|
|
while(1) {
|
|
$25 = (($$0101) + 32)|0;
|
|
$26 = (($27) + ($$0101<<5)|0);
|
|
HEAP32[$26>>2] = $25;
|
|
$28 = (((($27) + ($$0101<<5)|0)) + 4|0);
|
|
HEAP32[$28>>2] = $$090100;
|
|
$29 = ($$09299*11)|0;
|
|
$30 = (($29) + 1)|0;
|
|
$31 = (((($27) + ($$0101<<5)|0)) + 8|0);
|
|
HEAP32[$31>>2] = $30;
|
|
$32 = (2076 + ($$0101<<2)|0);
|
|
$33 = HEAP32[$32>>2]|0;
|
|
$34 = (((($27) + ($$0101<<5)|0)) + 12|0);
|
|
HEAP32[$34>>2] = $33;
|
|
$35 = (((($27) + ($$0101<<5)|0)) + 16|0);
|
|
HEAP32[$35>>2] = 10;
|
|
$36 = (($$090100) + 1)|0;
|
|
$37 = (($36) + ($33))|0;
|
|
$38 = ($37|0)<($9|0);
|
|
$39 = (($$09299) + 1)|0;
|
|
if ($38) {
|
|
$$191 = $37;$$193 = $$09299;
|
|
} else {
|
|
$40 = ($39*11)|0;
|
|
$41 = (($40) + 1)|0;
|
|
$42 = (($33) + 2)|0;
|
|
HEAP32[$28>>2] = 1;
|
|
HEAP32[$31>>2] = $41;
|
|
$$191 = $42;$$193 = $39;
|
|
}
|
|
$43 = (((($27) + ($$0101<<5)|0)) + 20|0);
|
|
HEAP32[$43>>2] = 0;
|
|
$44 = (((($27) + ($$0101<<5)|0)) + 24|0);
|
|
HEAP32[$44>>2] = 0;
|
|
$45 = (((($27) + ($$0101<<5)|0)) + 28|0);
|
|
HEAP32[$45>>2] = 0;
|
|
$46 = (($$0101) + 1)|0;
|
|
$47 = ($46|0)<($10|0);
|
|
if ($47) {
|
|
$$0101 = $46;$$090100 = $$191;$$09299 = $$193;$27 = $11;
|
|
} else {
|
|
$$lcssa = $11;
|
|
break;
|
|
}
|
|
}
|
|
$22 = ((($$lcssa)) + 16|0);
|
|
$23 = HEAP32[$22>>2]|0;
|
|
HEAP32[(31048)>>2] = $23;
|
|
$24 = HEAP32[7757]|0;
|
|
HEAP32[$vararg_buffer>>2] = $24;
|
|
_TraceLog(0,3594,$vararg_buffer);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _InitTimer_12() {
|
|
var $0 = 0, $1 = 0.0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$0 = (_time((0|0))|0);
|
|
_srand($0);
|
|
$1 = (+_GetTime());
|
|
HEAPF64[1763] = $1;
|
|
return;
|
|
}
|
|
function _EmscriptenFullscreenChangeCallback($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer4 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr3 = 0, $vararg_ptr7 = 0, $vararg_ptr8 = 0, $vararg_ptr9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
|
|
$vararg_buffer4 = sp + 16|0;
|
|
$vararg_buffer = sp;
|
|
$3 = HEAP32[$1>>2]|0;
|
|
$4 = ($3|0)==(0);
|
|
$5 = ((($1)) + 264|0);
|
|
$6 = HEAP32[$5>>2]|0;
|
|
$7 = ((($1)) + 268|0);
|
|
$8 = HEAP32[$7>>2]|0;
|
|
$9 = ((($1)) + 272|0);
|
|
$10 = HEAP32[$9>>2]|0;
|
|
$11 = ((($1)) + 276|0);
|
|
$12 = HEAP32[$11>>2]|0;
|
|
if ($4) {
|
|
HEAP32[$vararg_buffer4>>2] = $6;
|
|
$vararg_ptr7 = ((($vararg_buffer4)) + 4|0);
|
|
HEAP32[$vararg_ptr7>>2] = $8;
|
|
$vararg_ptr8 = ((($vararg_buffer4)) + 8|0);
|
|
HEAP32[$vararg_ptr8>>2] = $10;
|
|
$vararg_ptr9 = ((($vararg_buffer4)) + 12|0);
|
|
HEAP32[$vararg_ptr9>>2] = $12;
|
|
_TraceLog(0,3527,$vararg_buffer4);
|
|
STACKTOP = sp;return 0;
|
|
} else {
|
|
HEAP32[$vararg_buffer>>2] = $6;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $8;
|
|
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
|
|
HEAP32[$vararg_ptr2>>2] = $10;
|
|
$vararg_ptr3 = ((($vararg_buffer)) + 12|0);
|
|
HEAP32[$vararg_ptr3>>2] = $12;
|
|
_TraceLog(0,3458,$vararg_buffer);
|
|
STACKTOP = sp;return 0;
|
|
}
|
|
return (0)|0;
|
|
}
|
|
function _EmscriptenKeyboardCallback($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = ($0|0)==(1);
|
|
if (!($3)) {
|
|
return 0;
|
|
}
|
|
$4 = ((($1)) + 32|0);
|
|
$5 = (_strcmp($4,3451)|0);
|
|
$6 = ($5|0)==(0);
|
|
if (!($6)) {
|
|
return 0;
|
|
}
|
|
(_emscripten_exit_pointerlock()|0);
|
|
return 0;
|
|
}
|
|
function _EmscriptenMouseCallback($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 272|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(272|0);
|
|
$3 = sp;
|
|
$4 = ($0|0)==(4);
|
|
if (!($4)) {
|
|
STACKTOP = sp;return 0;
|
|
}
|
|
(_emscripten_get_pointerlock_status(($3|0))|0);
|
|
$5 = HEAP32[$3>>2]|0;
|
|
$6 = ($5|0)==(0);
|
|
if ($6) {
|
|
(_emscripten_request_pointerlock((0|0),1)|0);
|
|
} else {
|
|
(_emscripten_exit_pointerlock()|0);
|
|
(_emscripten_get_pointerlock_status(($3|0))|0);
|
|
}
|
|
STACKTOP = sp;return 0;
|
|
}
|
|
function _EmscriptenTouchCallback($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $$byval_copy = 0, $$sink = 0, $$sroa$0$0$$sroa_idx = 0, $$sroa$03$0$$sroa_idx = 0, $$sroa$2$0$$sroa_idx2 = 0, $$sroa$24$0$$sroa_idx5 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0.0, $15 = 0, $16 = 0, $17 = 0.0, $18 = 0, $19 = 0, $20 = 0.0, $21 = 0, $22 = 0, $23 = 0.0;
|
|
var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
|
|
var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0.0, $48 = 0.0, $49 = 0.0, $5 = 0, $50 = 0, $51 = 0.0, $52 = 0.0, $53 = 0.0, $54 = 0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0, $59 = 0.0, $6 = 0;
|
|
var $60 = 0.0, $61 = 0.0, $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 112|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(112|0);
|
|
$$byval_copy = sp + 56|0;
|
|
$3 = sp;
|
|
switch ($0|0) {
|
|
case 22: {
|
|
$$sink = 1;
|
|
label = 4;
|
|
break;
|
|
}
|
|
case 23: {
|
|
$$sink = 0;
|
|
label = 4;
|
|
break;
|
|
}
|
|
case 24: {
|
|
$$sink = 2;
|
|
label = 4;
|
|
break;
|
|
}
|
|
default: {
|
|
}
|
|
}
|
|
if ((label|0) == 4) {
|
|
HEAP32[$3>>2] = $$sink;
|
|
}
|
|
$4 = HEAP32[$1>>2]|0;
|
|
$5 = ((($3)) + 4|0);
|
|
HEAP32[$5>>2] = $4;
|
|
$6 = ((($1)) + 20|0);
|
|
$7 = HEAP32[$6>>2]|0;
|
|
$8 = ((($3)) + 8|0);
|
|
HEAP32[$8>>2] = $7;
|
|
$9 = ((($1)) + 72|0);
|
|
$10 = HEAP32[$9>>2]|0;
|
|
$11 = ((($3)) + 12|0);
|
|
HEAP32[$11>>2] = $10;
|
|
$12 = ((($1)) + 56|0);
|
|
$13 = HEAP32[$12>>2]|0;
|
|
$14 = (+($13|0));
|
|
$15 = ((($1)) + 60|0);
|
|
$16 = HEAP32[$15>>2]|0;
|
|
$17 = (+($16|0));
|
|
$$sroa$03$0$$sroa_idx = ((($3)) + 24|0);
|
|
HEAPF32[$$sroa$03$0$$sroa_idx>>2] = $14;
|
|
$$sroa$24$0$$sroa_idx5 = ((($3)) + 28|0);
|
|
HEAPF32[$$sroa$24$0$$sroa_idx5>>2] = $17;
|
|
$18 = ((($1)) + 108|0);
|
|
$19 = HEAP32[$18>>2]|0;
|
|
$20 = (+($19|0));
|
|
$21 = ((($1)) + 112|0);
|
|
$22 = HEAP32[$21>>2]|0;
|
|
$23 = (+($22|0));
|
|
$$sroa$0$0$$sroa_idx = ((($3)) + 32|0);
|
|
HEAPF32[$$sroa$0$0$$sroa_idx>>2] = $20;
|
|
$$sroa$2$0$$sroa_idx2 = ((($3)) + 36|0);
|
|
HEAPF32[$$sroa$2$0$$sroa_idx2>>2] = $23;
|
|
$24 = ((($3)) + 24|0);
|
|
$25 = $24;
|
|
$26 = $25;
|
|
$27 = HEAP32[$26>>2]|0;
|
|
$28 = (($25) + 4)|0;
|
|
$29 = $28;
|
|
$30 = HEAP32[$29>>2]|0;
|
|
$31 = 14088;
|
|
$32 = $31;
|
|
HEAP32[$32>>2] = $27;
|
|
$33 = (($31) + 4)|0;
|
|
$34 = $33;
|
|
HEAP32[$34>>2] = $30;
|
|
$35 = ((($3)) + 32|0);
|
|
$36 = $35;
|
|
$37 = $36;
|
|
$38 = HEAP32[$37>>2]|0;
|
|
$39 = (($36) + 4)|0;
|
|
$40 = $39;
|
|
$41 = HEAP32[$40>>2]|0;
|
|
$42 = (14096);
|
|
$43 = $42;
|
|
HEAP32[$43>>2] = $38;
|
|
$44 = (($42) + 4)|0;
|
|
$45 = $44;
|
|
HEAP32[$45>>2] = $41;
|
|
$46 = (_GetScreenWidth()|0);
|
|
$47 = (+($46|0));
|
|
$48 = +HEAPF32[$24>>2];
|
|
$49 = $48 / $47;
|
|
HEAPF32[$24>>2] = $49;
|
|
$50 = (_GetScreenHeight()|0);
|
|
$51 = (+($50|0));
|
|
$52 = +HEAPF32[$$sroa$24$0$$sroa_idx5>>2];
|
|
$53 = $52 / $51;
|
|
HEAPF32[$$sroa$24$0$$sroa_idx5>>2] = $53;
|
|
$54 = (_GetScreenWidth()|0);
|
|
$55 = (+($54|0));
|
|
$56 = +HEAPF32[$35>>2];
|
|
$57 = $56 / $55;
|
|
HEAPF32[$35>>2] = $57;
|
|
$58 = (_GetScreenHeight()|0);
|
|
$59 = (+($58|0));
|
|
$60 = +HEAPF32[$$sroa$2$0$$sroa_idx2>>2];
|
|
$61 = $60 / $59;
|
|
HEAPF32[$$sroa$2$0$$sroa_idx2>>2] = $61;
|
|
dest=$$byval_copy; src=$3; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_ProcessGestureEvent($$byval_copy);
|
|
STACKTOP = sp;return 1;
|
|
}
|
|
function _EmscriptenGamepadCallback($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $$sink = 0, $10 = 0, $11 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = ((($1)) + 1296|0);
|
|
$4 = HEAP32[$3>>2]|0;
|
|
$5 = ($4|0)==(0);
|
|
if ($5) {
|
|
label = 3;
|
|
} else {
|
|
$6 = ((($1)) + 1300|0);
|
|
$7 = HEAP32[$6>>2]|0;
|
|
$8 = ($7|0)<(4);
|
|
if ($8) {
|
|
$$sink = 1;
|
|
} else {
|
|
label = 3;
|
|
}
|
|
}
|
|
if ((label|0) == 3) {
|
|
$$sink = 0;
|
|
}
|
|
$9 = ((($1)) + 1300|0);
|
|
$10 = HEAP32[$9>>2]|0;
|
|
$11 = (31012 + ($10<<2)|0);
|
|
HEAP32[$11>>2] = $$sink;
|
|
return 0;
|
|
}
|
|
function _SetTargetFPS($0) {
|
|
$0 = $0|0;
|
|
var $$ = 0.0, $$op = 0.0, $1 = 0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $vararg_buffer = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
|
|
$vararg_buffer = sp;
|
|
$1 = ($0|0)<(1);
|
|
$2 = (+($0|0));
|
|
$3 = 1.0 / $2;
|
|
$$ = $1 ? 0.0 : $3;
|
|
HEAPF64[1760] = $$;
|
|
$4 = $3;
|
|
$$op = $4 * 1000.0;
|
|
$5 = $$op;
|
|
$6 = $1 ? 0.0 : $5;
|
|
HEAPF64[$vararg_buffer>>3] = $6;
|
|
_TraceLog(0,3407,$vararg_buffer);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _LogoAnimation() {
|
|
var label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
HEAP32[7752] = 0;
|
|
return;
|
|
}
|
|
function _GetTime() {
|
|
var $0 = 0.0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$0 = (+_glfwGetTime());
|
|
return (+$0);
|
|
}
|
|
function _LoadImageEx($0,$1,$2,$3) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
var $$03334 = 0, $$035 = 0, $$sroa$12$0$$sroa_idx21 = 0, $$sroa$15$0$$sroa_idx24 = 0, $$sroa$16$0$$sroa_idx26 = 0, $$sroa$9$0$$sroa_idx18 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
|
|
var $24 = 0, $25 = 0, $26 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $exitcond = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$4 = $2 << 2;
|
|
$5 = Math_imul($4, $3)|0;
|
|
$6 = (_malloc($5)|0);
|
|
$7 = ($5|0)>(0);
|
|
if ($7) {
|
|
$8 = (($5) + -1)|0;
|
|
$9 = $8 >>> 2;
|
|
$$03334 = 0;$$035 = 0;
|
|
while(1) {
|
|
$10 = (($1) + ($$03334<<2)|0);
|
|
$11 = HEAP8[$10>>0]|0;
|
|
$12 = (($6) + ($$035)|0);
|
|
HEAP8[$12>>0] = $11;
|
|
$13 = (((($1) + ($$03334<<2)|0)) + 1|0);
|
|
$14 = HEAP8[$13>>0]|0;
|
|
$15 = $$035 | 1;
|
|
$16 = (($6) + ($15)|0);
|
|
HEAP8[$16>>0] = $14;
|
|
$17 = (((($1) + ($$03334<<2)|0)) + 2|0);
|
|
$18 = HEAP8[$17>>0]|0;
|
|
$19 = $$035 | 2;
|
|
$20 = (($6) + ($19)|0);
|
|
HEAP8[$20>>0] = $18;
|
|
$21 = (((($1) + ($$03334<<2)|0)) + 3|0);
|
|
$22 = HEAP8[$21>>0]|0;
|
|
$23 = $$035 | 3;
|
|
$24 = (($6) + ($23)|0);
|
|
HEAP8[$24>>0] = $22;
|
|
$25 = (($$03334) + 1)|0;
|
|
$26 = (($$035) + 4)|0;
|
|
$exitcond = ($$03334|0)==($9|0);
|
|
if ($exitcond) {
|
|
break;
|
|
} else {
|
|
$$03334 = $25;$$035 = $26;
|
|
}
|
|
}
|
|
}
|
|
HEAP32[$0>>2] = $6;
|
|
$$sroa$9$0$$sroa_idx18 = ((($0)) + 4|0);
|
|
HEAP32[$$sroa$9$0$$sroa_idx18>>2] = $2;
|
|
$$sroa$12$0$$sroa_idx21 = ((($0)) + 8|0);
|
|
HEAP32[$$sroa$12$0$$sroa_idx21>>2] = $3;
|
|
$$sroa$15$0$$sroa_idx24 = ((($0)) + 12|0);
|
|
HEAP32[$$sroa$15$0$$sroa_idx24>>2] = 1;
|
|
$$sroa$16$0$$sroa_idx26 = ((($0)) + 16|0);
|
|
HEAP32[$$sroa$16$0$$sroa_idx26>>2] = 7;
|
|
return;
|
|
}
|
|
function _ImageFormat($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$0166199 = 0, $$0167197 = 0, $$0168195 = 0, $$0169192 = 0, $$0170190 = 0, $$0171188 = 0, $$0172189 = 0, $$0202 = 0, $$1194 = 0, $$2201 = 0, $$byval_copy = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0.0, $103 = 0.0, $104 = 0.0, $105 = 0, $106 = 0, $107 = 0;
|
|
var $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0;
|
|
var $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0;
|
|
var $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0;
|
|
var $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0.0, $17 = 0, $170 = 0.0, $171 = 0.0, $172 = 0, $173 = 0, $174 = 0, $175 = 0.0, $176 = 0.0, $177 = 0.0, $178 = 0, $179 = 0, $18 = 0;
|
|
var $180 = 0, $181 = 0.0, $182 = 0.0, $183 = 0.0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0.0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0;
|
|
var $199 = 0, $2 = 0, $20 = 0.0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0;
|
|
var $216 = 0, $217 = 0, $218 = 0.0, $219 = 0.0, $22 = 0, $220 = 0.0, $221 = 0, $222 = 0, $223 = 0, $224 = 0.0, $225 = 0.0, $226 = 0.0, $227 = 0, $228 = 0, $229 = 0, $23 = 0.0, $230 = 0.0, $231 = 0.0, $232 = 0.0, $233 = 0;
|
|
var $234 = 0, $235 = 0, $236 = 0.0, $237 = 0.0, $238 = 0.0, $239 = 0, $24 = 0.0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0.0, $250 = 0, $251 = 0;
|
|
var $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0;
|
|
var $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0.0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0;
|
|
var $289 = 0, $29 = 0.0, $290 = 0, $3 = 0, $30 = 0.0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
|
|
var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0.0, $53 = 0.0, $54 = 0, $55 = 0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0, $6 = 0, $60 = 0, $61 = 0.0, $62 = 0.0;
|
|
var $63 = 0.0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0;
|
|
var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0.0, $91 = 0.0, $92 = 0.0, $93 = 0, $94 = 0, $95 = 0, $96 = 0.0, $97 = 0.0, $98 = 0.0, $99 = 0;
|
|
var $or$cond = 0, $roundf = 0.0, $roundf173 = 0.0, $roundf174 = 0.0, $roundf175 = 0.0, $roundf176 = 0.0, $roundf177 = 0.0, $roundf178 = 0.0, $roundf179 = 0.0, $roundf180 = 0.0, $roundf181 = 0.0, $vararg_buffer = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
|
|
$$byval_copy = sp + 4|0;
|
|
$vararg_buffer = sp;
|
|
$2 = ((($0)) + 16|0);
|
|
$3 = HEAP32[$2>>2]|0;
|
|
$4 = ($3|0)==($1|0);
|
|
if ($4) {
|
|
STACKTOP = sp;return;
|
|
}
|
|
$5 = ($3|0)<(8);
|
|
$6 = ($1|0)<(8);
|
|
$or$cond = $6 & $5;
|
|
if (!($or$cond)) {
|
|
_TraceLog(2,3970,$vararg_buffer);
|
|
STACKTOP = sp;return;
|
|
}
|
|
;HEAP32[$$byval_copy>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$0+12>>2]|0;HEAP32[$$byval_copy+16>>2]=HEAP32[$0+16>>2]|0;
|
|
$7 = (_GetImageData($$byval_copy)|0);
|
|
$8 = HEAP32[$0>>2]|0;
|
|
_free($8);
|
|
HEAP32[$2>>2] = $1;
|
|
switch ($1|0) {
|
|
case 1: {
|
|
$9 = ((($0)) + 4|0);
|
|
$10 = HEAP32[$9>>2]|0;
|
|
$11 = ((($0)) + 8|0);
|
|
$12 = HEAP32[$11>>2]|0;
|
|
$13 = Math_imul($12, $10)|0;
|
|
$14 = (_malloc($13)|0);
|
|
HEAP32[$0>>2] = $14;
|
|
$15 = Math_imul($12, $10)|0;
|
|
$16 = ($15|0)>(0);
|
|
if ($16) {
|
|
$$0171188 = 0;
|
|
while(1) {
|
|
$17 = (($7) + ($$0171188<<2)|0);
|
|
$18 = HEAP8[$17>>0]|0;
|
|
$19 = (+($18&255));
|
|
$20 = $19 * 0.29899999499320984;
|
|
$21 = (((($7) + ($$0171188<<2)|0)) + 1|0);
|
|
$22 = HEAP8[$21>>0]|0;
|
|
$23 = (+($22&255));
|
|
$24 = $23 * 0.58700001239776611;
|
|
$25 = $20 + $24;
|
|
$26 = (((($7) + ($$0171188<<2)|0)) + 2|0);
|
|
$27 = HEAP8[$26>>0]|0;
|
|
$28 = (+($27&255));
|
|
$29 = $28 * 0.11400000005960464;
|
|
$30 = $25 + $29;
|
|
$31 = (~~(($30))&255);
|
|
$32 = HEAP32[$0>>2]|0;
|
|
$33 = (($32) + ($$0171188)|0);
|
|
HEAP8[$33>>0] = $31;
|
|
$34 = (($$0171188) + 1)|0;
|
|
$35 = HEAP32[$9>>2]|0;
|
|
$36 = HEAP32[$11>>2]|0;
|
|
$37 = Math_imul($36, $35)|0;
|
|
$38 = ($34|0)<($37|0);
|
|
if ($38) {
|
|
$$0171188 = $34;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
break;
|
|
}
|
|
case 2: {
|
|
$39 = ((($0)) + 4|0);
|
|
$40 = HEAP32[$39>>2]|0;
|
|
$41 = ((($0)) + 8|0);
|
|
$42 = HEAP32[$41>>2]|0;
|
|
$43 = $40 << 1;
|
|
$44 = Math_imul($43, $42)|0;
|
|
$45 = (_malloc($44)|0);
|
|
HEAP32[$0>>2] = $45;
|
|
$46 = HEAP32[$39>>2]|0;
|
|
$47 = $46 << 1;
|
|
$48 = Math_imul($47, $42)|0;
|
|
$49 = ($48|0)>(0);
|
|
if ($49) {
|
|
$$0170190 = 0;$$0172189 = 0;
|
|
while(1) {
|
|
$50 = (($7) + ($$0172189<<2)|0);
|
|
$51 = HEAP8[$50>>0]|0;
|
|
$52 = (+($51&255));
|
|
$53 = $52 * 0.29899999499320984;
|
|
$54 = (((($7) + ($$0172189<<2)|0)) + 1|0);
|
|
$55 = HEAP8[$54>>0]|0;
|
|
$56 = (+($55&255));
|
|
$57 = $56 * 0.58700001239776611;
|
|
$58 = $53 + $57;
|
|
$59 = (((($7) + ($$0172189<<2)|0)) + 2|0);
|
|
$60 = HEAP8[$59>>0]|0;
|
|
$61 = (+($60&255));
|
|
$62 = $61 * 0.11400000005960464;
|
|
$63 = $58 + $62;
|
|
$64 = (~~(($63))&255);
|
|
$65 = HEAP32[$0>>2]|0;
|
|
$66 = (($65) + ($$0170190)|0);
|
|
HEAP8[$66>>0] = $64;
|
|
$67 = (((($7) + ($$0172189<<2)|0)) + 3|0);
|
|
$68 = HEAP8[$67>>0]|0;
|
|
$69 = HEAP32[$0>>2]|0;
|
|
$70 = $$0170190 | 1;
|
|
$71 = (($69) + ($70)|0);
|
|
HEAP8[$71>>0] = $68;
|
|
$72 = (($$0172189) + 1)|0;
|
|
$73 = (($$0170190) + 2)|0;
|
|
$74 = HEAP32[$39>>2]|0;
|
|
$75 = HEAP32[$41>>2]|0;
|
|
$76 = $74 << 1;
|
|
$77 = Math_imul($76, $75)|0;
|
|
$78 = ($73|0)<($77|0);
|
|
if ($78) {
|
|
$$0170190 = $73;$$0172189 = $72;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
break;
|
|
}
|
|
case 3: {
|
|
$79 = ((($0)) + 4|0);
|
|
$80 = HEAP32[$79>>2]|0;
|
|
$81 = ((($0)) + 8|0);
|
|
$82 = HEAP32[$81>>2]|0;
|
|
$83 = $80 << 1;
|
|
$84 = Math_imul($83, $82)|0;
|
|
$85 = (_malloc($84)|0);
|
|
HEAP32[$0>>2] = $85;
|
|
$86 = HEAP32[$79>>2]|0;
|
|
$87 = Math_imul($82, $86)|0;
|
|
$88 = ($87|0)>(0);
|
|
if ($88) {
|
|
$89 = HEAP8[$7>>0]|0;
|
|
$90 = (+($89&255));
|
|
$91 = $90 * 31.0;
|
|
$92 = $91 / 255.0;
|
|
$roundf179 = (+_roundf((+$92)));
|
|
$93 = (~~(($roundf179))&255);
|
|
$94 = ((($7)) + 1|0);
|
|
$95 = HEAP8[$94>>0]|0;
|
|
$96 = (+($95&255));
|
|
$97 = $96 * 63.0;
|
|
$98 = $97 / 255.0;
|
|
$roundf180 = (+_roundf((+$98)));
|
|
$99 = (~~(($roundf180))&255);
|
|
$100 = ((($7)) + 2|0);
|
|
$101 = HEAP8[$100>>0]|0;
|
|
$102 = (+($101&255));
|
|
$103 = $102 * 31.0;
|
|
$104 = $103 / 255.0;
|
|
$roundf181 = (+_roundf((+$104)));
|
|
$105 = (~~(($roundf181))&255);
|
|
$106 = $93&255;
|
|
$107 = $106 << 11;
|
|
$108 = $99&255;
|
|
$109 = $108 << 5;
|
|
$110 = $109 | $107;
|
|
$111 = $105&255;
|
|
$112 = $110 | $111;
|
|
$113 = $112&65535;
|
|
$114 = HEAP32[$0>>2]|0;
|
|
$115 = HEAP32[$79>>2]|0;
|
|
$116 = HEAP32[$81>>2]|0;
|
|
$117 = Math_imul($116, $115)|0;
|
|
$$0169192 = 0;
|
|
while(1) {
|
|
$118 = (($114) + ($$0169192<<1)|0);
|
|
HEAP16[$118>>1] = $113;
|
|
$119 = (($$0169192) + 1)|0;
|
|
$120 = ($119|0)<($117|0);
|
|
if ($120) {
|
|
$$0169192 = $119;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
break;
|
|
}
|
|
case 4: {
|
|
$121 = ((($0)) + 4|0);
|
|
$122 = HEAP32[$121>>2]|0;
|
|
$123 = ((($0)) + 8|0);
|
|
$124 = HEAP32[$123>>2]|0;
|
|
$125 = ($122*3)|0;
|
|
$126 = Math_imul($125, $124)|0;
|
|
$127 = (_malloc($126)|0);
|
|
HEAP32[$0>>2] = $127;
|
|
$128 = HEAP32[$121>>2]|0;
|
|
$129 = ($128*3)|0;
|
|
$130 = Math_imul($129, $124)|0;
|
|
$131 = ($130|0)>(0);
|
|
if ($131) {
|
|
$$0168195 = 0;$$1194 = 0;
|
|
while(1) {
|
|
$132 = (($7) + ($$1194<<2)|0);
|
|
$133 = HEAP8[$132>>0]|0;
|
|
$134 = HEAP32[$0>>2]|0;
|
|
$135 = (($134) + ($$0168195)|0);
|
|
HEAP8[$135>>0] = $133;
|
|
$136 = (((($7) + ($$1194<<2)|0)) + 1|0);
|
|
$137 = HEAP8[$136>>0]|0;
|
|
$138 = HEAP32[$0>>2]|0;
|
|
$139 = (($$0168195) + 1)|0;
|
|
$140 = (($138) + ($139)|0);
|
|
HEAP8[$140>>0] = $137;
|
|
$141 = (((($7) + ($$1194<<2)|0)) + 2|0);
|
|
$142 = HEAP8[$141>>0]|0;
|
|
$143 = HEAP32[$0>>2]|0;
|
|
$144 = (($$0168195) + 2)|0;
|
|
$145 = (($143) + ($144)|0);
|
|
HEAP8[$145>>0] = $142;
|
|
$146 = (($$1194) + 1)|0;
|
|
$147 = (($$0168195) + 3)|0;
|
|
$148 = HEAP32[$121>>2]|0;
|
|
$149 = HEAP32[$123>>2]|0;
|
|
$150 = ($148*3)|0;
|
|
$151 = Math_imul($150, $149)|0;
|
|
$152 = ($147|0)<($151|0);
|
|
if ($152) {
|
|
$$0168195 = $147;$$1194 = $146;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
break;
|
|
}
|
|
case 5: {
|
|
$153 = ((($0)) + 4|0);
|
|
$154 = HEAP32[$153>>2]|0;
|
|
$155 = ((($0)) + 8|0);
|
|
$156 = HEAP32[$155>>2]|0;
|
|
$157 = $154 << 1;
|
|
$158 = Math_imul($157, $156)|0;
|
|
$159 = (_malloc($158)|0);
|
|
HEAP32[$0>>2] = $159;
|
|
$160 = HEAP32[$153>>2]|0;
|
|
$161 = Math_imul($156, $160)|0;
|
|
$162 = ($161|0)>(0);
|
|
if ($162) {
|
|
$163 = HEAP32[$0>>2]|0;
|
|
$164 = HEAP32[$153>>2]|0;
|
|
$165 = HEAP32[$155>>2]|0;
|
|
$166 = Math_imul($165, $164)|0;
|
|
$$0167197 = 0;
|
|
while(1) {
|
|
$167 = (($7) + ($$0167197<<2)|0);
|
|
$168 = HEAP8[$167>>0]|0;
|
|
$169 = (+($168&255));
|
|
$170 = $169 * 31.0;
|
|
$171 = $170 / 255.0;
|
|
$roundf176 = (+_roundf((+$171)));
|
|
$172 = (~~(($roundf176))&255);
|
|
$173 = (((($7) + ($$0167197<<2)|0)) + 1|0);
|
|
$174 = HEAP8[$173>>0]|0;
|
|
$175 = (+($174&255));
|
|
$176 = $175 * 31.0;
|
|
$177 = $176 / 255.0;
|
|
$roundf177 = (+_roundf((+$177)));
|
|
$178 = (~~(($roundf177))&255);
|
|
$179 = (((($7) + ($$0167197<<2)|0)) + 2|0);
|
|
$180 = HEAP8[$179>>0]|0;
|
|
$181 = (+($180&255));
|
|
$182 = $181 * 31.0;
|
|
$183 = $182 / 255.0;
|
|
$roundf178 = (+_roundf((+$183)));
|
|
$184 = (~~(($roundf178))&255);
|
|
$185 = (((($7) + ($$0167197<<2)|0)) + 3|0);
|
|
$186 = HEAP8[$185>>0]|0;
|
|
$187 = ($186&255)>(50);
|
|
$188 = $172&255;
|
|
$189 = $188 << 11;
|
|
$190 = $178&255;
|
|
$191 = $190 << 6;
|
|
$192 = $191 | $189;
|
|
$193 = $184&255;
|
|
$194 = $193 << 1;
|
|
$195 = $192 | $194;
|
|
$196 = $187&1;
|
|
$197 = $195 | $196;
|
|
$198 = $197&65535;
|
|
$199 = (($163) + ($$0167197<<1)|0);
|
|
HEAP16[$199>>1] = $198;
|
|
$200 = (($$0167197) + 1)|0;
|
|
$201 = ($200|0)<($166|0);
|
|
if ($201) {
|
|
$$0167197 = $200;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
break;
|
|
}
|
|
case 6: {
|
|
$202 = ((($0)) + 4|0);
|
|
$203 = HEAP32[$202>>2]|0;
|
|
$204 = ((($0)) + 8|0);
|
|
$205 = HEAP32[$204>>2]|0;
|
|
$206 = $203 << 1;
|
|
$207 = Math_imul($206, $205)|0;
|
|
$208 = (_malloc($207)|0);
|
|
HEAP32[$0>>2] = $208;
|
|
$209 = HEAP32[$202>>2]|0;
|
|
$210 = Math_imul($205, $209)|0;
|
|
$211 = ($210|0)>(0);
|
|
if ($211) {
|
|
$212 = HEAP32[$0>>2]|0;
|
|
$213 = HEAP32[$202>>2]|0;
|
|
$214 = HEAP32[$204>>2]|0;
|
|
$215 = Math_imul($214, $213)|0;
|
|
$$0166199 = 0;
|
|
while(1) {
|
|
$216 = (($7) + ($$0166199<<2)|0);
|
|
$217 = HEAP8[$216>>0]|0;
|
|
$218 = (+($217&255));
|
|
$219 = $218 * 15.0;
|
|
$220 = $219 / 255.0;
|
|
$roundf = (+_roundf((+$220)));
|
|
$221 = (~~(($roundf))&255);
|
|
$222 = (((($7) + ($$0166199<<2)|0)) + 1|0);
|
|
$223 = HEAP8[$222>>0]|0;
|
|
$224 = (+($223&255));
|
|
$225 = $224 * 15.0;
|
|
$226 = $225 / 255.0;
|
|
$roundf173 = (+_roundf((+$226)));
|
|
$227 = (~~(($roundf173))&255);
|
|
$228 = (((($7) + ($$0166199<<2)|0)) + 2|0);
|
|
$229 = HEAP8[$228>>0]|0;
|
|
$230 = (+($229&255));
|
|
$231 = $230 * 15.0;
|
|
$232 = $231 / 255.0;
|
|
$roundf174 = (+_roundf((+$232)));
|
|
$233 = (~~(($roundf174))&255);
|
|
$234 = (((($7) + ($$0166199<<2)|0)) + 3|0);
|
|
$235 = HEAP8[$234>>0]|0;
|
|
$236 = (+($235&255));
|
|
$237 = $236 * 15.0;
|
|
$238 = $237 / 255.0;
|
|
$roundf175 = (+_roundf((+$238)));
|
|
$239 = (~~(($roundf175))&255);
|
|
$240 = $221&255;
|
|
$241 = $240 << 12;
|
|
$242 = $227&255;
|
|
$243 = $242 << 8;
|
|
$244 = $243 | $241;
|
|
$245 = $233&255;
|
|
$246 = $245 << 4;
|
|
$247 = $244 | $246;
|
|
$248 = $239&255;
|
|
$249 = $247 | $248;
|
|
$250 = $249&65535;
|
|
$251 = (($212) + ($$0166199<<1)|0);
|
|
HEAP16[$251>>1] = $250;
|
|
$252 = (($$0166199) + 1)|0;
|
|
$253 = ($252|0)<($215|0);
|
|
if ($253) {
|
|
$$0166199 = $252;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
break;
|
|
}
|
|
case 7: {
|
|
$254 = ((($0)) + 4|0);
|
|
$255 = HEAP32[$254>>2]|0;
|
|
$256 = ((($0)) + 8|0);
|
|
$257 = HEAP32[$256>>2]|0;
|
|
$258 = $255 << 2;
|
|
$259 = Math_imul($258, $257)|0;
|
|
$260 = (_malloc($259)|0);
|
|
HEAP32[$0>>2] = $260;
|
|
$261 = HEAP32[$254>>2]|0;
|
|
$262 = $261 << 2;
|
|
$263 = Math_imul($262, $257)|0;
|
|
$264 = ($263|0)>(0);
|
|
if ($264) {
|
|
$$0202 = 0;$$2201 = 0;
|
|
while(1) {
|
|
$265 = (($7) + ($$2201<<2)|0);
|
|
$266 = HEAP8[$265>>0]|0;
|
|
$267 = HEAP32[$0>>2]|0;
|
|
$268 = (($267) + ($$0202)|0);
|
|
HEAP8[$268>>0] = $266;
|
|
$269 = (((($7) + ($$2201<<2)|0)) + 1|0);
|
|
$270 = HEAP8[$269>>0]|0;
|
|
$271 = HEAP32[$0>>2]|0;
|
|
$272 = $$0202 | 1;
|
|
$273 = (($271) + ($272)|0);
|
|
HEAP8[$273>>0] = $270;
|
|
$274 = (((($7) + ($$2201<<2)|0)) + 2|0);
|
|
$275 = HEAP8[$274>>0]|0;
|
|
$276 = HEAP32[$0>>2]|0;
|
|
$277 = $$0202 | 2;
|
|
$278 = (($276) + ($277)|0);
|
|
HEAP8[$278>>0] = $275;
|
|
$279 = (((($7) + ($$2201<<2)|0)) + 3|0);
|
|
$280 = HEAP8[$279>>0]|0;
|
|
$281 = HEAP32[$0>>2]|0;
|
|
$282 = $$0202 | 3;
|
|
$283 = (($281) + ($282)|0);
|
|
HEAP8[$283>>0] = $280;
|
|
$284 = (($$2201) + 1)|0;
|
|
$285 = (($$0202) + 4)|0;
|
|
$286 = HEAP32[$254>>2]|0;
|
|
$287 = HEAP32[$256>>2]|0;
|
|
$288 = $286 << 2;
|
|
$289 = Math_imul($288, $287)|0;
|
|
$290 = ($285|0)<($289|0);
|
|
if ($290) {
|
|
$$0202 = $285;$$2201 = $284;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
break;
|
|
}
|
|
default: {
|
|
}
|
|
}
|
|
_free($7);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _LoadTextureFromImage($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$sroa$11$0$$sroa_idx8 = 0, $$sroa$5$0$$sroa_idx2 = 0, $$sroa$7$0$$sroa_idx4 = 0, $$sroa$9$0$$sroa_idx6 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = HEAP32[$1>>2]|0;
|
|
$3 = ((($1)) + 4|0);
|
|
$4 = HEAP32[$3>>2]|0;
|
|
$5 = ((($1)) + 8|0);
|
|
$6 = HEAP32[$5>>2]|0;
|
|
$7 = ((($1)) + 16|0);
|
|
$8 = HEAP32[$7>>2]|0;
|
|
$9 = ((($1)) + 12|0);
|
|
$10 = HEAP32[$9>>2]|0;
|
|
$11 = (_rlglLoadTexture($2,$4,$6,$8,$10)|0);
|
|
$12 = HEAP32[$3>>2]|0;
|
|
$13 = HEAP32[$5>>2]|0;
|
|
HEAP32[$0>>2] = $11;
|
|
$$sroa$5$0$$sroa_idx2 = ((($0)) + 4|0);
|
|
HEAP32[$$sroa$5$0$$sroa_idx2>>2] = $12;
|
|
$$sroa$7$0$$sroa_idx4 = ((($0)) + 8|0);
|
|
HEAP32[$$sroa$7$0$$sroa_idx4>>2] = $13;
|
|
$$sroa$9$0$$sroa_idx6 = ((($0)) + 12|0);
|
|
HEAP32[$$sroa$9$0$$sroa_idx6>>2] = $10;
|
|
$$sroa$11$0$$sroa_idx8 = ((($0)) + 16|0);
|
|
HEAP32[$$sroa$11$0$$sroa_idx8>>2] = $8;
|
|
return;
|
|
}
|
|
function _UnloadImage($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = HEAP32[$0>>2]|0;
|
|
_free($1);
|
|
return;
|
|
}
|
|
function _rlglLoadTexture($0,$1,$2,$3,$4) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
$4 = $4|0;
|
|
var $$0 = 0, $$off = 0, $$off92 = 0, $$off93 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
|
|
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0;
|
|
var $46 = 0, $47 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond100 = 0, $or$cond7 = 0, $or$cond96 = 0, $or$cond98 = 0, $switch = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer11 = 0, $vararg_buffer15 = 0, $vararg_buffer3 = 0, $vararg_buffer5 = 0, $vararg_buffer7 = 0;
|
|
var $vararg_buffer9 = 0, $vararg_ptr13 = 0, $vararg_ptr14 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 80|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(80|0);
|
|
$vararg_buffer15 = sp + 64|0;
|
|
$vararg_buffer11 = sp + 48|0;
|
|
$vararg_buffer9 = sp + 40|0;
|
|
$vararg_buffer7 = sp + 32|0;
|
|
$vararg_buffer5 = sp + 24|0;
|
|
$vararg_buffer3 = sp + 16|0;
|
|
$vararg_buffer1 = sp + 8|0;
|
|
$vararg_buffer = sp;
|
|
$5 = sp + 68|0;
|
|
_glBindTexture(3553,0);
|
|
HEAP32[$5>>2] = 0;
|
|
$6 = HEAP32[7765]|0;
|
|
$7 = ($6|0)==(0);
|
|
$8 = $3 & -4;
|
|
$switch = ($8|0)==(8);
|
|
$or$cond100 = $switch & $7;
|
|
if ($or$cond100) {
|
|
_TraceLog(2,3639,$vararg_buffer);
|
|
$$0 = HEAP32[$5>>2]|0;
|
|
STACKTOP = sp;return ($$0|0);
|
|
}
|
|
$9 = HEAP32[7766]|0;
|
|
$10 = ($9|0)==(0);
|
|
$11 = ($3|0)==(12);
|
|
$or$cond7 = $11 & $10;
|
|
if ($or$cond7) {
|
|
_TraceLog(2,3683,$vararg_buffer1);
|
|
$$0 = HEAP32[$5>>2]|0;
|
|
STACKTOP = sp;return ($$0|0);
|
|
}
|
|
$12 = HEAP32[7767]|0;
|
|
$13 = ($12|0)==(0);
|
|
$$off = (($3) + -13)|0;
|
|
$14 = ($$off>>>0)<(2);
|
|
$or$cond = $14 & $13;
|
|
if ($or$cond) {
|
|
_TraceLog(2,3728,$vararg_buffer3);
|
|
$$0 = HEAP32[$5>>2]|0;
|
|
STACKTOP = sp;return ($$0|0);
|
|
}
|
|
$15 = HEAP32[7768]|0;
|
|
$16 = ($15|0)==(0);
|
|
$$off92 = (($3) + -15)|0;
|
|
$17 = ($$off92>>>0)<(2);
|
|
$or$cond96 = $17 & $16;
|
|
if ($or$cond96) {
|
|
_TraceLog(2,3773,$vararg_buffer5);
|
|
$$0 = HEAP32[$5>>2]|0;
|
|
STACKTOP = sp;return ($$0|0);
|
|
}
|
|
$18 = HEAP32[7769]|0;
|
|
$19 = ($18|0)==(0);
|
|
$$off93 = (($3) + -17)|0;
|
|
$20 = ($$off93>>>0)<(2);
|
|
$or$cond98 = $20 & $19;
|
|
if ($or$cond98) {
|
|
_TraceLog(2,3818,$vararg_buffer7);
|
|
$$0 = HEAP32[$5>>2]|0;
|
|
STACKTOP = sp;return ($$0|0);
|
|
}
|
|
_glGenTextures(1,($5|0));
|
|
$21 = HEAP32[$5>>2]|0;
|
|
_glBindTexture(3553,($21|0));
|
|
do {
|
|
switch ($3|0) {
|
|
case 1: {
|
|
_glTexImage2D(3553,0,6409,($1|0),($2|0),0,6409,5121,($0|0));
|
|
break;
|
|
}
|
|
case 2: {
|
|
_glTexImage2D(3553,0,6410,($1|0),($2|0),0,6410,5121,($0|0));
|
|
break;
|
|
}
|
|
case 3: {
|
|
_glTexImage2D(3553,0,6407,($1|0),($2|0),0,6407,33635,($0|0));
|
|
break;
|
|
}
|
|
case 4: {
|
|
_glTexImage2D(3553,0,6407,($1|0),($2|0),0,6407,5121,($0|0));
|
|
break;
|
|
}
|
|
case 5: {
|
|
_glTexImage2D(3553,0,6408,($1|0),($2|0),0,6408,32820,($0|0));
|
|
break;
|
|
}
|
|
case 6: {
|
|
_glTexImage2D(3553,0,6408,($1|0),($2|0),0,6408,32819,($0|0));
|
|
break;
|
|
}
|
|
case 7: {
|
|
_glTexImage2D(3553,0,6408,($1|0),($2|0),0,6408,5121,($0|0));
|
|
break;
|
|
}
|
|
case 8: {
|
|
$22 = HEAP32[7765]|0;
|
|
$23 = ($22|0)==(0);
|
|
if (!($23)) {
|
|
_LoadCompressedTexture($0,$1,$2,$4,33776);
|
|
}
|
|
break;
|
|
}
|
|
case 9: {
|
|
$24 = HEAP32[7765]|0;
|
|
$25 = ($24|0)==(0);
|
|
if (!($25)) {
|
|
_LoadCompressedTexture($0,$1,$2,$4,33777);
|
|
}
|
|
break;
|
|
}
|
|
case 10: {
|
|
$26 = HEAP32[7765]|0;
|
|
$27 = ($26|0)==(0);
|
|
if (!($27)) {
|
|
_LoadCompressedTexture($0,$1,$2,$4,33778);
|
|
}
|
|
break;
|
|
}
|
|
case 11: {
|
|
$28 = HEAP32[7765]|0;
|
|
$29 = ($28|0)==(0);
|
|
if (!($29)) {
|
|
_LoadCompressedTexture($0,$1,$2,$4,33779);
|
|
}
|
|
break;
|
|
}
|
|
case 12: {
|
|
$30 = HEAP32[7766]|0;
|
|
$31 = ($30|0)==(0);
|
|
if (!($31)) {
|
|
_LoadCompressedTexture($0,$1,$2,$4,36196);
|
|
}
|
|
break;
|
|
}
|
|
case 13: {
|
|
$32 = HEAP32[7767]|0;
|
|
$33 = ($32|0)==(0);
|
|
if (!($33)) {
|
|
_LoadCompressedTexture($0,$1,$2,$4,37492);
|
|
}
|
|
break;
|
|
}
|
|
case 14: {
|
|
$34 = HEAP32[7767]|0;
|
|
$35 = ($34|0)==(0);
|
|
if (!($35)) {
|
|
_LoadCompressedTexture($0,$1,$2,$4,37496);
|
|
}
|
|
break;
|
|
}
|
|
case 15: {
|
|
$36 = HEAP32[7768]|0;
|
|
$37 = ($36|0)==(0);
|
|
if (!($37)) {
|
|
_LoadCompressedTexture($0,$1,$2,$4,35840);
|
|
}
|
|
break;
|
|
}
|
|
case 16: {
|
|
$38 = HEAP32[7768]|0;
|
|
$39 = ($38|0)==(0);
|
|
if (!($39)) {
|
|
_LoadCompressedTexture($0,$1,$2,$4,35842);
|
|
}
|
|
break;
|
|
}
|
|
case 17: {
|
|
$40 = HEAP32[7769]|0;
|
|
$41 = ($40|0)==(0);
|
|
if (!($41)) {
|
|
_LoadCompressedTexture($0,$1,$2,$4,37808);
|
|
}
|
|
break;
|
|
}
|
|
case 18: {
|
|
$42 = HEAP32[7769]|0;
|
|
$43 = ($42|0)==(0);
|
|
if (!($43)) {
|
|
_LoadCompressedTexture($0,$1,$2,$4,37815);
|
|
}
|
|
break;
|
|
}
|
|
default: {
|
|
_TraceLog(2,3863,$vararg_buffer9);
|
|
}
|
|
}
|
|
} while(0);
|
|
$44 = HEAP32[7770]|0;
|
|
$45 = ($44|0)==(0);
|
|
if ($45) {
|
|
_glTexParameteri(3553,10242,33071);
|
|
_glTexParameteri(3553,10243,33071);
|
|
} else {
|
|
_glTexParameteri(3553,10242,10497);
|
|
_glTexParameteri(3553,10243,10497);
|
|
}
|
|
_glTexParameteri(3553,10240,9728);
|
|
_glTexParameteri(3553,10241,9728);
|
|
_glBindTexture(3553,0);
|
|
$46 = HEAP32[$5>>2]|0;
|
|
$47 = ($46|0)==(0);
|
|
if ($47) {
|
|
_TraceLog(2,3941,$vararg_buffer15);
|
|
$$0 = HEAP32[$5>>2]|0;
|
|
STACKTOP = sp;return ($$0|0);
|
|
} else {
|
|
HEAP32[$vararg_buffer11>>2] = $46;
|
|
$vararg_ptr13 = ((($vararg_buffer11)) + 4|0);
|
|
HEAP32[$vararg_ptr13>>2] = $1;
|
|
$vararg_ptr14 = ((($vararg_buffer11)) + 8|0);
|
|
HEAP32[$vararg_ptr14>>2] = $2;
|
|
_TraceLog(0,3892,$vararg_buffer11);
|
|
$$0 = HEAP32[$5>>2]|0;
|
|
STACKTOP = sp;return ($$0|0);
|
|
}
|
|
return (0)|0;
|
|
}
|
|
function _LoadCompressedTexture($0,$1,$2,$3,$4) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
$4 = $4|0;
|
|
var $$ = 0, $$03645 = 0, $$03744 = 0, $$038 = 0, $$03943 = 0, $$046 = 0, $$140 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0;
|
|
var $23 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond42 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
_glPixelStorei(3317,1);
|
|
switch ($4|0) {
|
|
case 33776: case 33777: case 36196: case 37492: {
|
|
$$038 = 8;
|
|
break;
|
|
}
|
|
default: {
|
|
$$038 = 16;
|
|
}
|
|
}
|
|
$5 = ($3|0)<(1);
|
|
$6 = $1 | $2;
|
|
$7 = ($6|0)==(0);
|
|
$or$cond42 = $5 | $7;
|
|
if ($or$cond42) {
|
|
return;
|
|
} else {
|
|
$$03645 = 0;$$03744 = 0;$$03943 = $2;$$046 = $1;
|
|
}
|
|
while(1) {
|
|
$8 = (($$046) + 3)|0;
|
|
$9 = (($8|0) / 4)&-1;
|
|
$10 = (($$03943) + 3)|0;
|
|
$11 = (($10|0) / 4)&-1;
|
|
$12 = Math_imul($11, $$038)|0;
|
|
$13 = Math_imul($12, $9)|0;
|
|
$14 = (($0) + ($$03744)|0);
|
|
_glCompressedTexImage2D(3553,($$03645|0),($4|0),($$046|0),($$03943|0),0,($13|0),($14|0));
|
|
$15 = (($13) + ($$03744))|0;
|
|
$16 = (($$046|0) / 2)&-1;
|
|
$17 = (($$03943|0) / 2)&-1;
|
|
$18 = ($$046|0)<(2);
|
|
$$ = $18 ? 1 : $16;
|
|
$19 = ($$03943|0)<(2);
|
|
$$140 = $19 ? 1 : $17;
|
|
$20 = (($$03645) + 1)|0;
|
|
$21 = ($20|0)>=($3|0);
|
|
$22 = $$ | $$140;
|
|
$23 = ($22|0)==(0);
|
|
$or$cond = $21 | $23;
|
|
if ($or$cond) {
|
|
break;
|
|
} else {
|
|
$$03645 = $20;$$03744 = $15;$$03943 = $$140;$$046 = $$;
|
|
}
|
|
}
|
|
return;
|
|
}
|
|
function _GetImageData($0) {
|
|
$0 = $0|0;
|
|
var $$0104105 = 0, $$0106 = 0, $$1 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0.0, $103 = 0.0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0;
|
|
var $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0;
|
|
var $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
|
|
var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0.0, $4 = 0, $40 = 0.0, $41 = 0;
|
|
var $42 = 0, $43 = 0, $44 = 0, $45 = 0.0, $46 = 0.0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0.0, $52 = 0.0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0;
|
|
var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0.0, $65 = 0.0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0.0, $71 = 0.0, $72 = 0, $73 = 0, $74 = 0, $75 = 0.0, $76 = 0.0, $77 = 0, $78 = 0;
|
|
var $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0.0, $86 = 0.0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0.0, $92 = 0.0, $93 = 0, $94 = 0, $95 = 0, $96 = 0;
|
|
var $97 = 0.0, $98 = 0.0, $99 = 0, $vararg_buffer = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
|
|
$vararg_buffer = sp;
|
|
$1 = ((($0)) + 4|0);
|
|
$2 = HEAP32[$1>>2]|0;
|
|
$3 = ((($0)) + 8|0);
|
|
$4 = HEAP32[$3>>2]|0;
|
|
$5 = $2 << 2;
|
|
$6 = Math_imul($5, $4)|0;
|
|
$7 = (_malloc($6)|0);
|
|
$8 = HEAP32[$1>>2]|0;
|
|
$9 = Math_imul($4, $8)|0;
|
|
$10 = ($9|0)>(0);
|
|
if (!($10)) {
|
|
STACKTOP = sp;return ($7|0);
|
|
}
|
|
$11 = ((($0)) + 16|0);
|
|
$12 = HEAP32[$11>>2]|0;
|
|
$13 = HEAP32[$0>>2]|0;
|
|
$$0104105 = 0;$$0106 = 0;
|
|
while(1) {
|
|
switch ($12|0) {
|
|
case 1: {
|
|
$14 = (($13) + ($$0106)|0);
|
|
$15 = HEAP8[$14>>0]|0;
|
|
$16 = (($7) + ($$0104105<<2)|0);
|
|
HEAP8[$16>>0] = $15;
|
|
$17 = HEAP8[$14>>0]|0;
|
|
$18 = (((($7) + ($$0104105<<2)|0)) + 1|0);
|
|
HEAP8[$18>>0] = $17;
|
|
$19 = HEAP8[$14>>0]|0;
|
|
$20 = (((($7) + ($$0104105<<2)|0)) + 2|0);
|
|
HEAP8[$20>>0] = $19;
|
|
$21 = (((($7) + ($$0104105<<2)|0)) + 3|0);
|
|
HEAP8[$21>>0] = -1;
|
|
$22 = (($$0106) + 1)|0;
|
|
$$1 = $22;
|
|
break;
|
|
}
|
|
case 2: {
|
|
$23 = (($13) + ($$0106)|0);
|
|
$24 = HEAP8[$23>>0]|0;
|
|
$25 = (($7) + ($$0104105<<2)|0);
|
|
HEAP8[$25>>0] = $24;
|
|
$26 = HEAP8[$23>>0]|0;
|
|
$27 = (((($7) + ($$0104105<<2)|0)) + 1|0);
|
|
HEAP8[$27>>0] = $26;
|
|
$28 = HEAP8[$23>>0]|0;
|
|
$29 = (((($7) + ($$0104105<<2)|0)) + 2|0);
|
|
HEAP8[$29>>0] = $28;
|
|
$30 = (($$0106) + 1)|0;
|
|
$31 = (($13) + ($30)|0);
|
|
$32 = HEAP8[$31>>0]|0;
|
|
$33 = (((($7) + ($$0104105<<2)|0)) + 3|0);
|
|
HEAP8[$33>>0] = $32;
|
|
$34 = (($$0106) + 2)|0;
|
|
$$1 = $34;
|
|
break;
|
|
}
|
|
case 5: {
|
|
$35 = (($13) + ($$0106<<1)|0);
|
|
$36 = HEAP16[$35>>1]|0;
|
|
$37 = $36&65535;
|
|
$38 = $37 >>> 11;
|
|
$39 = (+($38|0));
|
|
$40 = $39 * 8.0;
|
|
$41 = (~~(($40))&255);
|
|
$42 = (($7) + ($$0104105<<2)|0);
|
|
HEAP8[$42>>0] = $41;
|
|
$43 = $37 >>> 6;
|
|
$44 = $43 & 31;
|
|
$45 = (+($44|0));
|
|
$46 = $45 * 8.0;
|
|
$47 = (~~(($46))&255);
|
|
$48 = (((($7) + ($$0104105<<2)|0)) + 1|0);
|
|
HEAP8[$48>>0] = $47;
|
|
$49 = $37 >>> 1;
|
|
$50 = $49 & 31;
|
|
$51 = (+($50|0));
|
|
$52 = $51 * 8.0;
|
|
$53 = (~~(($52))&255);
|
|
$54 = (((($7) + ($$0104105<<2)|0)) + 2|0);
|
|
HEAP8[$54>>0] = $53;
|
|
$55 = $37 & 1;
|
|
$56 = (0 - ($55))|0;
|
|
$57 = $56&255;
|
|
$58 = (((($7) + ($$0104105<<2)|0)) + 3|0);
|
|
HEAP8[$58>>0] = $57;
|
|
$59 = (($$0106) + 1)|0;
|
|
$$1 = $59;
|
|
break;
|
|
}
|
|
case 3: {
|
|
$60 = (($13) + ($$0106<<1)|0);
|
|
$61 = HEAP16[$60>>1]|0;
|
|
$62 = $61&65535;
|
|
$63 = $62 >>> 11;
|
|
$64 = (+($63|0));
|
|
$65 = $64 * 8.0;
|
|
$66 = (~~(($65))&255);
|
|
$67 = (($7) + ($$0104105<<2)|0);
|
|
HEAP8[$67>>0] = $66;
|
|
$68 = $62 >>> 5;
|
|
$69 = $68 & 63;
|
|
$70 = (+($69|0));
|
|
$71 = $70 * 4.0;
|
|
$72 = (~~(($71))&255);
|
|
$73 = (((($7) + ($$0104105<<2)|0)) + 1|0);
|
|
HEAP8[$73>>0] = $72;
|
|
$74 = $62 & 31;
|
|
$75 = (+($74|0));
|
|
$76 = $75 * 8.0;
|
|
$77 = (~~(($76))&255);
|
|
$78 = (((($7) + ($$0104105<<2)|0)) + 2|0);
|
|
HEAP8[$78>>0] = $77;
|
|
$79 = (((($7) + ($$0104105<<2)|0)) + 3|0);
|
|
HEAP8[$79>>0] = -1;
|
|
$80 = (($$0106) + 1)|0;
|
|
$$1 = $80;
|
|
break;
|
|
}
|
|
case 6: {
|
|
$81 = (($13) + ($$0106<<1)|0);
|
|
$82 = HEAP16[$81>>1]|0;
|
|
$83 = $82&65535;
|
|
$84 = $83 >>> 12;
|
|
$85 = (+($84|0));
|
|
$86 = $85 * 17.0;
|
|
$87 = (~~(($86))&255);
|
|
$88 = (($7) + ($$0104105<<2)|0);
|
|
HEAP8[$88>>0] = $87;
|
|
$89 = $83 >>> 8;
|
|
$90 = $89 & 15;
|
|
$91 = (+($90|0));
|
|
$92 = $91 * 17.0;
|
|
$93 = (~~(($92))&255);
|
|
$94 = (((($7) + ($$0104105<<2)|0)) + 1|0);
|
|
HEAP8[$94>>0] = $93;
|
|
$95 = $83 >>> 4;
|
|
$96 = $95 & 15;
|
|
$97 = (+($96|0));
|
|
$98 = $97 * 17.0;
|
|
$99 = (~~(($98))&255);
|
|
$100 = (((($7) + ($$0104105<<2)|0)) + 2|0);
|
|
HEAP8[$100>>0] = $99;
|
|
$101 = $83 & 15;
|
|
$102 = (+($101|0));
|
|
$103 = $102 * 17.0;
|
|
$104 = (~~(($103))&255);
|
|
$105 = (((($7) + ($$0104105<<2)|0)) + 3|0);
|
|
HEAP8[$105>>0] = $104;
|
|
$106 = (($$0106) + 1)|0;
|
|
$$1 = $106;
|
|
break;
|
|
}
|
|
case 7: {
|
|
$107 = (($13) + ($$0106)|0);
|
|
$108 = HEAP8[$107>>0]|0;
|
|
$109 = (($7) + ($$0104105<<2)|0);
|
|
HEAP8[$109>>0] = $108;
|
|
$110 = (($$0106) + 1)|0;
|
|
$111 = (($13) + ($110)|0);
|
|
$112 = HEAP8[$111>>0]|0;
|
|
$113 = (((($7) + ($$0104105<<2)|0)) + 1|0);
|
|
HEAP8[$113>>0] = $112;
|
|
$114 = (($$0106) + 2)|0;
|
|
$115 = (($13) + ($114)|0);
|
|
$116 = HEAP8[$115>>0]|0;
|
|
$117 = (((($7) + ($$0104105<<2)|0)) + 2|0);
|
|
HEAP8[$117>>0] = $116;
|
|
$118 = (($$0106) + 3)|0;
|
|
$119 = (($13) + ($118)|0);
|
|
$120 = HEAP8[$119>>0]|0;
|
|
$121 = (((($7) + ($$0104105<<2)|0)) + 3|0);
|
|
HEAP8[$121>>0] = $120;
|
|
$122 = (($$0106) + 4)|0;
|
|
$$1 = $122;
|
|
break;
|
|
}
|
|
case 4: {
|
|
$123 = (($13) + ($$0106)|0);
|
|
$124 = HEAP8[$123>>0]|0;
|
|
$125 = (($7) + ($$0104105<<2)|0);
|
|
HEAP8[$125>>0] = $124;
|
|
$126 = (($$0106) + 1)|0;
|
|
$127 = (($13) + ($126)|0);
|
|
$128 = HEAP8[$127>>0]|0;
|
|
$129 = (((($7) + ($$0104105<<2)|0)) + 1|0);
|
|
HEAP8[$129>>0] = $128;
|
|
$130 = (($$0106) + 2)|0;
|
|
$131 = (($13) + ($130)|0);
|
|
$132 = HEAP8[$131>>0]|0;
|
|
$133 = (((($7) + ($$0104105<<2)|0)) + 2|0);
|
|
HEAP8[$133>>0] = $132;
|
|
$134 = (((($7) + ($$0104105<<2)|0)) + 3|0);
|
|
HEAP8[$134>>0] = -1;
|
|
$135 = (($$0106) + 3)|0;
|
|
$$1 = $135;
|
|
break;
|
|
}
|
|
default: {
|
|
_TraceLog(2,4024,$vararg_buffer);
|
|
$$1 = $$0106;
|
|
}
|
|
}
|
|
$136 = (($$0104105) + 1)|0;
|
|
$137 = HEAP32[$1>>2]|0;
|
|
$138 = HEAP32[$3>>2]|0;
|
|
$139 = Math_imul($138, $137)|0;
|
|
$140 = ($136|0)<($139|0);
|
|
if ($140) {
|
|
$$0104105 = $136;$$0106 = $$1;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
STACKTOP = sp;return ($7|0);
|
|
}
|
|
function _ErrorCallback($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $vararg_buffer = 0, $vararg_ptr1 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
|
|
$vararg_buffer = sp;
|
|
HEAP32[$vararg_buffer>>2] = $0;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $1;
|
|
_TraceLog(2,7890,$vararg_buffer);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _rlGetVersion() {
|
|
var label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
return 4;
|
|
}
|
|
function _SetupFramebufferSize($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$sink = 0, $$sink1 = 0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0, $14 = 0.0, $15 = 0.0, $16 = 0, $17 = 0, $18 = 0.0, $19 = 0.0, $2 = 0, $20 = 0, $21 = 0, $22 = 0.0, $23 = 0, $24 = 0, $25 = 0, $26 = 0.0;
|
|
var $27 = 0, $28 = 0.0, $29 = 0.0, $3 = 0, $30 = 0, $31 = 0, $32 = 0.0, $33 = 0.0, $34 = 0.0, $35 = 0, $36 = 0.0, $37 = 0, $38 = 0.0, $39 = 0.0, $4 = 0, $40 = 0, $41 = 0.0, $42 = 0, $43 = 0, $44 = 0.0;
|
|
var $45 = 0, $46 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0.0, $9 = 0, $or$cond = 0, $roundf = 0.0, $roundf38 = 0.0, $roundf39 = 0.0, $roundf40 = 0.0, $vararg_buffer = 0, $vararg_buffer4 = 0, $vararg_buffer8 = 0, $vararg_ptr1 = 0, $vararg_ptr11 = 0, $vararg_ptr12 = 0, $vararg_ptr13 = 0, $vararg_ptr2 = 0;
|
|
var $vararg_ptr3 = 0, $vararg_ptr7 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 112|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(112|0);
|
|
$vararg_buffer8 = sp + 24|0;
|
|
$vararg_buffer4 = sp + 16|0;
|
|
$vararg_buffer = sp;
|
|
$2 = sp + 40|0;
|
|
$3 = HEAP32[7749]|0;
|
|
$4 = ($3|0)>($0|0);
|
|
if (!($4)) {
|
|
$5 = HEAP32[7748]|0;
|
|
$6 = ($5|0)>($1|0);
|
|
if (!($6)) {
|
|
$30 = ($3|0)<($0|0);
|
|
$31 = ($5|0)<($1|0);
|
|
$or$cond = $30 | $31;
|
|
if (!($or$cond)) {
|
|
HEAP32[7790] = $3;
|
|
HEAP32[7791] = $5;
|
|
HEAP32[7792] = 0;
|
|
HEAP32[7793] = 0;
|
|
STACKTOP = sp;return;
|
|
}
|
|
HEAP32[$vararg_buffer8>>2] = $3;
|
|
$vararg_ptr11 = ((($vararg_buffer8)) + 4|0);
|
|
HEAP32[$vararg_ptr11>>2] = $5;
|
|
$vararg_ptr12 = ((($vararg_buffer8)) + 8|0);
|
|
HEAP32[$vararg_ptr12>>2] = $0;
|
|
$vararg_ptr13 = ((($vararg_buffer8)) + 12|0);
|
|
HEAP32[$vararg_ptr13>>2] = $1;
|
|
_TraceLog(0,7824,$vararg_buffer8);
|
|
$32 = (+($0|0));
|
|
$33 = (+($1|0));
|
|
$34 = $32 / $33;
|
|
$35 = HEAP32[7749]|0;
|
|
$36 = (+($35|0));
|
|
$37 = HEAP32[7748]|0;
|
|
$38 = (+($37|0));
|
|
$39 = $36 / $38;
|
|
$40 = !($34 <= $39);
|
|
if ($40) {
|
|
$44 = $34 * $38;
|
|
$roundf = (+_roundf((+$44)));
|
|
$45 = (~~(($roundf)));
|
|
HEAP32[7790] = $45;
|
|
HEAP32[7791] = $37;
|
|
$46 = (($45) - ($35))|0;
|
|
HEAP32[7792] = $46;
|
|
$$sink1 = 0;
|
|
} else {
|
|
HEAP32[7790] = $35;
|
|
$41 = $36 / $34;
|
|
$roundf38 = (+_roundf((+$41)));
|
|
$42 = (~~(($roundf38)));
|
|
HEAP32[7791] = $42;
|
|
HEAP32[7792] = 0;
|
|
$43 = (($42) - ($37))|0;
|
|
$$sink1 = $43;
|
|
}
|
|
HEAP32[7793] = $$sink1;
|
|
STACKTOP = sp;return;
|
|
}
|
|
}
|
|
$7 = HEAP32[7748]|0;
|
|
HEAP32[$vararg_buffer>>2] = $3;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $7;
|
|
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
|
|
HEAP32[$vararg_ptr2>>2] = $0;
|
|
$vararg_ptr3 = ((($vararg_buffer)) + 12|0);
|
|
HEAP32[$vararg_ptr3>>2] = $1;
|
|
_TraceLog(2,7681,$vararg_buffer);
|
|
$8 = (+($0|0));
|
|
$9 = HEAP32[7749]|0;
|
|
$10 = (+($9|0));
|
|
$11 = $8 / $10;
|
|
$12 = (+($1|0));
|
|
$13 = HEAP32[7748]|0;
|
|
$14 = (+($13|0));
|
|
$15 = $12 / $14;
|
|
$16 = !($11 <= $15);
|
|
if ($16) {
|
|
$22 = $10 * $15;
|
|
$roundf39 = (+_roundf((+$22)));
|
|
$23 = (~~(($roundf39)));
|
|
HEAP32[7790] = $23;
|
|
HEAP32[7791] = $1;
|
|
$24 = (($0) - ($23))|0;
|
|
HEAP32[7792] = $24;
|
|
$$sink = 0;
|
|
} else {
|
|
HEAP32[7790] = $0;
|
|
$17 = HEAP32[7748]|0;
|
|
$18 = (+($17|0));
|
|
$19 = $11 * $18;
|
|
$roundf40 = (+_roundf((+$19)));
|
|
$20 = (~~(($roundf40)));
|
|
HEAP32[7791] = $20;
|
|
HEAP32[7792] = 0;
|
|
$21 = (($1) - ($20))|0;
|
|
$$sink = $21;
|
|
}
|
|
HEAP32[7793] = $$sink;
|
|
$25 = HEAP32[7790]|0;
|
|
$26 = (+($25|0));
|
|
$27 = HEAP32[7749]|0;
|
|
$28 = (+($27|0));
|
|
$29 = $26 / $28;
|
|
_MatrixScale($2,$29,$29,$29);
|
|
dest=31084; src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
HEAP32[7790] = $0;
|
|
HEAP32[7791] = $1;
|
|
HEAP32[$vararg_buffer4>>2] = $0;
|
|
$vararg_ptr7 = ((($vararg_buffer4)) + 4|0);
|
|
HEAP32[$vararg_ptr7>>2] = $1;
|
|
_TraceLog(2,7759,$vararg_buffer4);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _WindowSizeCallback($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $3 = 0.0, $4 = 0.0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
_rlViewport(0,0,$1,$2);
|
|
_rlMatrixMode(5889);
|
|
_rlLoadIdentity();
|
|
$3 = (+($1|0));
|
|
$4 = (+($2|0));
|
|
_rlOrtho(0.0,$3,$4,0.0,0.0,1.0);
|
|
_rlMatrixMode(5888);
|
|
_rlLoadIdentity();
|
|
_rlClearScreenBuffers();
|
|
HEAP32[7749] = $1;
|
|
HEAP32[7748] = $2;
|
|
HEAP32[7790] = $1;
|
|
HEAP32[7791] = $2;
|
|
return;
|
|
}
|
|
function _CursorEnterCallback($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
return;
|
|
}
|
|
function _KeyCallback($0,$1,$2,$3,$4) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
$4 = $4|0;
|
|
var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$5 = HEAP32[744]|0;
|
|
$6 = ($5|0)==($1|0);
|
|
$7 = ($3|0)==(1);
|
|
$or$cond = $7 & $6;
|
|
if ($or$cond) {
|
|
_glfwSetWindowShouldClose(($0|0),1);
|
|
return;
|
|
}
|
|
$8 = $3&255;
|
|
$9 = (35959 + ($1)|0);
|
|
HEAP8[$9>>0] = $8;
|
|
if (!($7)) {
|
|
return;
|
|
}
|
|
HEAP32[743] = $1;
|
|
return;
|
|
}
|
|
function _MouseButtonCallback($0,$1,$2,$3) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
var $$byval_copy = 0, $$sink = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0.0, $27 = 0.0;
|
|
var $28 = 0.0, $29 = 0, $30 = 0.0, $31 = 0, $32 = 0.0, $33 = 0.0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 128|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(128|0);
|
|
$$byval_copy = sp + 64|0;
|
|
$4 = sp + 8|0;
|
|
$5 = sp;
|
|
$6 = $2&255;
|
|
$7 = (35953 + ($1)|0);
|
|
HEAP8[$7>>0] = $6;
|
|
$8 = (_IsMouseButtonPressed(0)|0);
|
|
$9 = ($8|0)==(0);
|
|
if ($9) {
|
|
$10 = (_IsMouseButtonReleased(0)|0);
|
|
$11 = ($10|0)==(0);
|
|
if (!($11)) {
|
|
$$sink = 0;
|
|
label = 3;
|
|
}
|
|
} else {
|
|
$$sink = 1;
|
|
label = 3;
|
|
}
|
|
if ((label|0) == 3) {
|
|
HEAP32[$4>>2] = $$sink;
|
|
}
|
|
$12 = ((($4)) + 8|0);
|
|
HEAP32[$12>>2] = 0;
|
|
$13 = ((($4)) + 4|0);
|
|
HEAP32[$13>>2] = 1;
|
|
$14 = ((($4)) + 24|0);
|
|
_GetMousePosition($5);
|
|
$15 = $5;
|
|
$16 = $15;
|
|
$17 = HEAP32[$16>>2]|0;
|
|
$18 = (($15) + 4)|0;
|
|
$19 = $18;
|
|
$20 = HEAP32[$19>>2]|0;
|
|
$21 = $14;
|
|
$22 = $21;
|
|
HEAP32[$22>>2] = $17;
|
|
$23 = (($21) + 4)|0;
|
|
$24 = $23;
|
|
HEAP32[$24>>2] = $20;
|
|
$25 = (_GetScreenWidth()|0);
|
|
$26 = (+($25|0));
|
|
$27 = +HEAPF32[$14>>2];
|
|
$28 = $27 / $26;
|
|
HEAPF32[$14>>2] = $28;
|
|
$29 = (_GetScreenHeight()|0);
|
|
$30 = (+($29|0));
|
|
$31 = ((($4)) + 28|0);
|
|
$32 = +HEAPF32[$31>>2];
|
|
$33 = $32 / $30;
|
|
HEAPF32[$31>>2] = $33;
|
|
dest=$$byval_copy; src=$4; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_ProcessGestureEvent($$byval_copy);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _MouseCursorPosCallback($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = +$1;
|
|
$2 = +$2;
|
|
var $$byval_copy = 0, $$sroa$0$0$$sroa_idx = 0, $$sroa$2$0$$sroa_idx1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0.0, $21 = 0.0, $22 = 0.0, $23 = 0, $24 = 0.0, $25 = 0.0, $26 = 0.0;
|
|
var $3 = 0, $4 = 0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 112|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(112|0);
|
|
$$byval_copy = sp + 56|0;
|
|
$3 = sp;
|
|
HEAP32[$3>>2] = 2;
|
|
$4 = ((($3)) + 8|0);
|
|
HEAP32[$4>>2] = 0;
|
|
$5 = ((($3)) + 4|0);
|
|
HEAP32[$5>>2] = 1;
|
|
$6 = $1;
|
|
$7 = $2;
|
|
$$sroa$0$0$$sroa_idx = ((($3)) + 24|0);
|
|
HEAPF32[$$sroa$0$0$$sroa_idx>>2] = $6;
|
|
$$sroa$2$0$$sroa_idx1 = ((($3)) + 28|0);
|
|
HEAPF32[$$sroa$2$0$$sroa_idx1>>2] = $7;
|
|
$8 = ((($3)) + 24|0);
|
|
$9 = $8;
|
|
$10 = $9;
|
|
$11 = HEAP32[$10>>2]|0;
|
|
$12 = (($9) + 4)|0;
|
|
$13 = $12;
|
|
$14 = HEAP32[$13>>2]|0;
|
|
$15 = 14088;
|
|
$16 = $15;
|
|
HEAP32[$16>>2] = $11;
|
|
$17 = (($15) + 4)|0;
|
|
$18 = $17;
|
|
HEAP32[$18>>2] = $14;
|
|
$19 = (_GetScreenWidth()|0);
|
|
$20 = (+($19|0));
|
|
$21 = +HEAPF32[$8>>2];
|
|
$22 = $21 / $20;
|
|
HEAPF32[$8>>2] = $22;
|
|
$23 = (_GetScreenHeight()|0);
|
|
$24 = (+($23|0));
|
|
$25 = +HEAPF32[$$sroa$2$0$$sroa_idx1>>2];
|
|
$26 = $25 / $24;
|
|
HEAPF32[$$sroa$2$0$$sroa_idx1>>2] = $26;
|
|
dest=$$byval_copy; src=$3; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_ProcessGestureEvent($$byval_copy);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _CharCallback($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
HEAP32[743] = $1;
|
|
return;
|
|
}
|
|
function _ScrollCallback($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = +$1;
|
|
$2 = +$2;
|
|
var $3 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = (~~(($2)));
|
|
HEAP32[8163] = $3;
|
|
return;
|
|
}
|
|
function _WindowIconifyCallback($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$sink = 0, $2 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = ($1|0)!=(0);
|
|
$$sink = $2&1;
|
|
HEAP32[8162] = $$sink;
|
|
return;
|
|
}
|
|
function _rlglInit($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$05965 = 0, $$06066 = 0, $$06167 = 0, $$062 = 0, $$sink63 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
|
|
var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
|
|
var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0;
|
|
var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0.0, $72 = 0.0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0;
|
|
var $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $9 = 0, $exitcond = 0, $exitcond69 = 0, $exitcond70 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer13 = 0, $vararg_buffer15 = 0, $vararg_buffer17 = 0, $vararg_buffer19 = 0;
|
|
var $vararg_buffer21 = 0, $vararg_buffer23 = 0, $vararg_buffer25 = 0, $vararg_buffer27 = 0, $vararg_buffer29 = 0, $vararg_buffer31 = 0, $vararg_buffer34 = 0, $vararg_buffer36 = 0, $vararg_buffer39 = 0, $vararg_buffer4 = 0, $vararg_buffer41 = 0, $vararg_buffer7 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 2464|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(2464|0);
|
|
$vararg_buffer41 = sp + 2184|0;
|
|
$vararg_buffer39 = sp + 2176|0;
|
|
$vararg_buffer36 = sp + 2168|0;
|
|
$vararg_buffer34 = sp + 2160|0;
|
|
$vararg_buffer31 = sp + 2152|0;
|
|
$vararg_buffer29 = sp + 2144|0;
|
|
$vararg_buffer27 = sp + 2136|0;
|
|
$vararg_buffer25 = sp + 2128|0;
|
|
$vararg_buffer23 = sp + 2120|0;
|
|
$vararg_buffer21 = sp + 2112|0;
|
|
$vararg_buffer19 = sp + 2104|0;
|
|
$vararg_buffer17 = sp + 2096|0;
|
|
$vararg_buffer15 = sp + 2088|0;
|
|
$vararg_buffer13 = sp + 2080|0;
|
|
$vararg_buffer10 = sp + 2072|0;
|
|
$vararg_buffer7 = sp + 24|0;
|
|
$vararg_buffer4 = sp + 16|0;
|
|
$vararg_buffer1 = sp + 8|0;
|
|
$vararg_buffer = sp;
|
|
$2 = sp + 2400|0;
|
|
$3 = sp + 2384|0;
|
|
$4 = sp + 2320|0;
|
|
$5 = sp + 2256|0;
|
|
$6 = sp + 2192|0;
|
|
$7 = (_glGetString(7936)|0);
|
|
HEAP32[$vararg_buffer>>2] = $7;
|
|
_TraceLog(0,4322,$vararg_buffer);
|
|
$8 = (_glGetString(7937)|0);
|
|
HEAP32[$vararg_buffer1>>2] = $8;
|
|
_TraceLog(0,4340,$vararg_buffer1);
|
|
$9 = (_glGetString(7938)|0);
|
|
HEAP32[$vararg_buffer4>>2] = $9;
|
|
_TraceLog(0,4358,$vararg_buffer4);
|
|
$10 = (_glGetString(35724)|0);
|
|
HEAP32[$vararg_buffer7>>2] = $10;
|
|
_TraceLog(0,4376,$vararg_buffer7);
|
|
$11 = (_glGetString(7939)|0);
|
|
$12 = (_strlen($11)|0);
|
|
$13 = (($12) + 1)|0;
|
|
$14 = (_malloc($13)|0);
|
|
_memcpy(($14|0),($11|0),($13|0))|0;
|
|
$$062 = 0;$$sink63 = $14;
|
|
while(1) {
|
|
$15 = (_strtok($$sink63,4394)|0);
|
|
$16 = (($vararg_buffer7) + ($$062<<2)|0);
|
|
HEAP32[$16>>2] = $15;
|
|
$17 = ($15|0)==(0|0);
|
|
$18 = (($$062) + 1)|0;
|
|
if ($17) {
|
|
break;
|
|
} else {
|
|
$$062 = $18;$$sink63 = 0;
|
|
}
|
|
}
|
|
_free($14);
|
|
$19 = (($$062) + -1)|0;
|
|
HEAP32[$vararg_buffer10>>2] = $19;
|
|
_TraceLog(0,4396,$vararg_buffer10);
|
|
$20 = ($$062|0)>(1);
|
|
if ($20) {
|
|
$$06167 = 0;
|
|
while(1) {
|
|
$23 = (($vararg_buffer7) + ($$06167<<2)|0);
|
|
$24 = HEAP32[$23>>2]|0;
|
|
$25 = (_strcmp($24,4431)|0);
|
|
$26 = ($25|0)==(0);
|
|
if ($26) {
|
|
HEAP32[7828] = 1;
|
|
$27 = (_eglGetProcAddress((4458|0))|0);
|
|
HEAP32[7829] = $27;
|
|
$28 = (_eglGetProcAddress((4479|0))|0);
|
|
HEAP32[7830] = $28;
|
|
$29 = (_eglGetProcAddress((4500|0))|0);
|
|
HEAP32[7831] = $29;
|
|
}
|
|
$30 = (_strcmp($24,4524)|0);
|
|
$31 = ($30|0)==(0);
|
|
if ($31) {
|
|
HEAP32[7770] = 1;
|
|
}
|
|
$32 = (_strcmp($24,4544)|0);
|
|
$33 = ($32|0)==(0);
|
|
if ($33) {
|
|
label = 12;
|
|
} else {
|
|
$34 = HEAP32[$23>>2]|0;
|
|
$35 = (_strcmp($34,4576)|0);
|
|
$36 = ($35|0)==(0);
|
|
if ($36) {
|
|
label = 12;
|
|
} else {
|
|
$37 = (_strcmp($34,4609)|0);
|
|
$38 = ($37|0)==(0);
|
|
if ($38) {
|
|
label = 12;
|
|
}
|
|
}
|
|
}
|
|
if ((label|0) == 12) {
|
|
label = 0;
|
|
HEAP32[7765] = 1;
|
|
}
|
|
$39 = (_strcmp($24,4649)|0);
|
|
$40 = ($39|0)==(0);
|
|
if ($40) {
|
|
label = 15;
|
|
} else {
|
|
$41 = HEAP32[$23>>2]|0;
|
|
$42 = (_strcmp($41,4685)|0);
|
|
$43 = ($42|0)==(0);
|
|
if ($43) {
|
|
label = 15;
|
|
}
|
|
}
|
|
if ((label|0) == 15) {
|
|
label = 0;
|
|
HEAP32[7766] = 1;
|
|
}
|
|
$44 = HEAP32[$23>>2]|0;
|
|
$45 = (_strcmp($44,4718)|0);
|
|
$46 = ($45|0)==(0);
|
|
if ($46) {
|
|
HEAP32[7767] = 1;
|
|
}
|
|
$47 = (_strcmp($44,4743)|0);
|
|
$48 = ($47|0)==(0);
|
|
if ($48) {
|
|
HEAP32[7768] = 1;
|
|
}
|
|
$49 = (_strcmp($44,4776)|0);
|
|
$50 = ($49|0)==(0);
|
|
if ($50) {
|
|
HEAP32[7769] = 1;
|
|
}
|
|
$51 = (_strcmp($44,4812)|0);
|
|
$52 = ($51|0)==(0);
|
|
if ($52) {
|
|
HEAP32[7832] = 1;
|
|
_glGetFloatv(34047,(31332|0));
|
|
}
|
|
$53 = HEAP32[$23>>2]|0;
|
|
$54 = (_strcmp($53,4846)|0);
|
|
$55 = ($54|0)==(0);
|
|
if ($55) {
|
|
HEAP32[7834] = 1;
|
|
}
|
|
$56 = (($$06167) + 1)|0;
|
|
$exitcond70 = ($56|0)==($19|0);
|
|
if ($exitcond70) {
|
|
break;
|
|
} else {
|
|
$$06167 = $56;
|
|
}
|
|
}
|
|
}
|
|
$21 = HEAP32[7828]|0;
|
|
$22 = ($21|0)==(0);
|
|
if ($22) {
|
|
_TraceLog(2,4949,$vararg_buffer15);
|
|
} else {
|
|
_TraceLog(0,4874,$vararg_buffer13);
|
|
}
|
|
$57 = HEAP32[7770]|0;
|
|
$58 = ($57|0)==(0);
|
|
if ($58) {
|
|
_TraceLog(2,5085,$vararg_buffer19);
|
|
} else {
|
|
_TraceLog(0,5010,$vararg_buffer17);
|
|
}
|
|
$59 = HEAP32[7765]|0;
|
|
$60 = ($59|0)==(0);
|
|
if (!($60)) {
|
|
_TraceLog(0,5177,$vararg_buffer21);
|
|
}
|
|
$61 = HEAP32[7766]|0;
|
|
$62 = ($61|0)==(0);
|
|
if (!($62)) {
|
|
_TraceLog(0,5223,$vararg_buffer23);
|
|
}
|
|
$63 = HEAP32[7767]|0;
|
|
$64 = ($63|0)==(0);
|
|
if (!($64)) {
|
|
_TraceLog(0,5270,$vararg_buffer25);
|
|
}
|
|
$65 = HEAP32[7768]|0;
|
|
$66 = ($65|0)==(0);
|
|
if (!($66)) {
|
|
_TraceLog(0,5321,$vararg_buffer27);
|
|
}
|
|
$67 = HEAP32[7769]|0;
|
|
$68 = ($67|0)==(0);
|
|
if (!($68)) {
|
|
_TraceLog(0,5368,$vararg_buffer29);
|
|
}
|
|
$69 = HEAP32[7832]|0;
|
|
$70 = ($69|0)==(0);
|
|
if (!($70)) {
|
|
$71 = +HEAPF32[7833];
|
|
$72 = $71;
|
|
HEAPF64[$vararg_buffer31>>3] = $72;
|
|
_TraceLog(0,5415,$vararg_buffer31);
|
|
}
|
|
$73 = HEAP32[7834]|0;
|
|
$74 = ($73|0)==(0);
|
|
if (!($74)) {
|
|
_TraceLog(0,5481,$vararg_buffer34);
|
|
}
|
|
HEAP32[$vararg_buffer10>>2] = -1;
|
|
$75 = (_rlglLoadTexture($vararg_buffer10,1,1,7,1)|0);
|
|
HEAP32[7835] = $75;
|
|
$76 = ($75|0)==(0);
|
|
if ($76) {
|
|
_TraceLog(2,5585,$vararg_buffer39);
|
|
} else {
|
|
HEAP32[$vararg_buffer36>>2] = $75;
|
|
_TraceLog(0,5534,$vararg_buffer36);
|
|
}
|
|
_LoadDefaultShader($2);
|
|
dest=31344; src=$2; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
dest=31400; src=$2; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_LoadDefaultBuffers();
|
|
$77 = (_malloc(49152)|0);
|
|
HEAP32[7864] = $77;
|
|
$$06066 = 0;
|
|
while(1) {
|
|
$79 = HEAP32[7864]|0;
|
|
$80 = (($79) + (($$06066*12)|0)|0);
|
|
_VectorZero($3);
|
|
;HEAP32[$80>>2]=HEAP32[$3>>2]|0;HEAP32[$80+4>>2]=HEAP32[$3+4>>2]|0;HEAP32[$80+8>>2]=HEAP32[$3+8>>2]|0;
|
|
$81 = (($$06066) + 1)|0;
|
|
$exitcond69 = ($81|0)==(4096);
|
|
if ($exitcond69) {
|
|
break;
|
|
} else {
|
|
$$06066 = $81;
|
|
}
|
|
}
|
|
$78 = (_malloc(36864)|0);
|
|
HEAP32[7865] = $78;
|
|
$$05965 = 0;
|
|
while(1) {
|
|
$82 = (((($78) + (($$05965*144)|0)|0)) + 8|0);
|
|
HEAP32[$82>>2] = 0;
|
|
$83 = (($78) + (($$05965*144)|0)|0);
|
|
HEAP32[$83>>2] = 0;
|
|
$84 = (($$05965) + 1)|0;
|
|
$exitcond = ($84|0)==(256);
|
|
if ($exitcond) {
|
|
break;
|
|
} else {
|
|
$$05965 = $84;
|
|
}
|
|
}
|
|
HEAP32[7866] = 1;
|
|
$85 = HEAP32[7835]|0;
|
|
$86 = ((($78)) + 8|0);
|
|
HEAP32[$86>>2] = $85;
|
|
HEAP32[7867] = 4;
|
|
_MatrixIdentity($4);
|
|
dest=31472; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_MatrixIdentity($4);
|
|
dest=(31536); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_MatrixIdentity($4);
|
|
dest=(31600); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_MatrixIdentity($4);
|
|
dest=(31664); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_MatrixIdentity($4);
|
|
dest=(31728); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_MatrixIdentity($4);
|
|
dest=(31792); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_MatrixIdentity($4);
|
|
dest=(31856); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_MatrixIdentity($4);
|
|
dest=(31920); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_MatrixIdentity($4);
|
|
dest=(31984); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_MatrixIdentity($4);
|
|
dest=(32048); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_MatrixIdentity($4);
|
|
dest=(32112); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_MatrixIdentity($4);
|
|
dest=(32176); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_MatrixIdentity($4);
|
|
dest=(32240); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_MatrixIdentity($4);
|
|
dest=(32304); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_MatrixIdentity($4);
|
|
dest=(32368); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_MatrixIdentity($4);
|
|
dest=(32432); src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_MatrixIdentity($5);
|
|
dest=31180; src=$5; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_MatrixIdentity($6);
|
|
dest=31244; src=$6; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
HEAP32[7794] = 31244;
|
|
_glDepthFunc(515);
|
|
_glDisable(2929);
|
|
_glBlendFunc(770,771);
|
|
_glEnable(3042);
|
|
_glCullFace(1029);
|
|
_glFrontFace(2305);
|
|
_glEnable(2884);
|
|
_glClearColor(0.0,0.0,0.0,1.0);
|
|
_glClearDepthf(1.0);
|
|
_glClear(16640);
|
|
HEAP32[8124] = $0;
|
|
HEAP32[8125] = $1;
|
|
_TraceLog(0,5624,$vararg_buffer41);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _SetupViewport() {
|
|
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$0 = HEAP32[7792]|0;
|
|
$1 = (($0|0) / 2)&-1;
|
|
$2 = HEAP32[7793]|0;
|
|
$3 = (($2|0) / 2)&-1;
|
|
$4 = HEAP32[7790]|0;
|
|
$5 = (($4) - ($0))|0;
|
|
$6 = HEAP32[7791]|0;
|
|
$7 = (($6) - ($2))|0;
|
|
_rlViewport($1,$3,$5,$7);
|
|
return;
|
|
}
|
|
function _rlMatrixMode($0) {
|
|
$0 = $0|0;
|
|
var $modelview$sink = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
switch ($0|0) {
|
|
case 5889: {
|
|
$modelview$sink = 31180;
|
|
label = 3;
|
|
break;
|
|
}
|
|
case 5888: {
|
|
$modelview$sink = 31244;
|
|
label = 3;
|
|
break;
|
|
}
|
|
default: {
|
|
}
|
|
}
|
|
if ((label|0) == 3) {
|
|
HEAP32[7794] = $modelview$sink;
|
|
}
|
|
HEAP32[7827] = $0;
|
|
return;
|
|
}
|
|
function _rlLoadIdentity() {
|
|
var $0 = 0, $1 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
|
|
$0 = sp;
|
|
$1 = HEAP32[7794]|0;
|
|
_MatrixIdentity($0);
|
|
dest=$1; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _rlOrtho($0,$1,$2,$3,$4,$5) {
|
|
$0 = +$0;
|
|
$1 = +$1;
|
|
$2 = +$2;
|
|
$3 = +$3;
|
|
$4 = +$4;
|
|
$5 = +$5;
|
|
var $$byval_copy = 0, $$byval_copy1 = 0, $6 = 0, $7 = 0, $8 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 256|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(256|0);
|
|
$$byval_copy1 = sp + 192|0;
|
|
$$byval_copy = sp + 128|0;
|
|
$6 = sp + 64|0;
|
|
$7 = sp;
|
|
_MatrixOrtho($6,$0,$1,$2,$3,$4,$5);
|
|
_MatrixTranspose($6);
|
|
$8 = HEAP32[7794]|0;
|
|
dest=$$byval_copy; src=$8; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
dest=$$byval_copy1; src=$6; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_MatrixMultiply($7,$$byval_copy,$$byval_copy1);
|
|
dest=$8; src=$7; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _ClearBackground($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = HEAP8[$0>>0]|0;
|
|
$2 = ((($0)) + 1|0);
|
|
$3 = HEAP8[$2>>0]|0;
|
|
$4 = ((($0)) + 2|0);
|
|
$5 = HEAP8[$4>>0]|0;
|
|
$6 = ((($0)) + 3|0);
|
|
$7 = HEAP8[$6>>0]|0;
|
|
_rlClearColor($1,$3,$5,$7);
|
|
return;
|
|
}
|
|
function _rlClearColor($0,$1,$2,$3) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
var $10 = 0.0, $11 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$4 = (+($0&255));
|
|
$5 = $4 / 255.0;
|
|
$6 = (+($1&255));
|
|
$7 = $6 / 255.0;
|
|
$8 = (+($2&255));
|
|
$9 = $8 / 255.0;
|
|
$10 = (+($3&255));
|
|
$11 = $10 / 255.0;
|
|
_glClearColor((+$5),(+$7),(+$9),(+$11));
|
|
return;
|
|
}
|
|
function _rlViewport($0,$1,$2,$3) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
var label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
_glViewport(($0|0),($1|0),($2|0),($3|0));
|
|
return;
|
|
}
|
|
function _LoadDefaultShader($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 1008|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(1008|0);
|
|
$vararg_buffer1 = sp + 8|0;
|
|
$vararg_buffer = sp;
|
|
$1 = sp + 16|0;
|
|
$2 = sp + 513|0;
|
|
$3 = sp + 72|0;
|
|
_memcpy(($2|0),(6200|0),489)|0;
|
|
_memcpy(($3|0),(6689|0),441)|0;
|
|
$4 = (_LoadShaderProgram($2,$3)|0);
|
|
HEAP32[$1>>2] = $4;
|
|
$5 = ($4|0)==(0);
|
|
if ($5) {
|
|
HEAP32[$vararg_buffer1>>2] = $4;
|
|
_TraceLog(2,7178,$vararg_buffer1);
|
|
} else {
|
|
HEAP32[$vararg_buffer>>2] = $4;
|
|
_TraceLog(0,7130,$vararg_buffer);
|
|
}
|
|
$6 = HEAP32[$1>>2]|0;
|
|
$7 = ($6|0)==(0);
|
|
if (!($7)) {
|
|
_LoadDefaultShaderLocations($1);
|
|
}
|
|
dest=$0; src=$1; stop=dest+56|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _LoadDefaultBuffers() {
|
|
var $$05365 = 0, $$05467 = 0, $$05770 = 0, $$05972 = 0, $$066 = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0;
|
|
var $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0;
|
|
var $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0;
|
|
var $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0;
|
|
var $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0;
|
|
var $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $exitcond = 0, $exitcond75 = 0, $exitcond78 = 0, $exitcond80 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer14 = 0, $vararg_buffer17 = 0;
|
|
var $vararg_buffer3 = 0, $vararg_buffer7 = 0, $vararg_ptr13 = 0, $vararg_ptr20 = 0, $vararg_ptr21 = 0, $vararg_ptr22 = 0, $vararg_ptr6 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
|
|
$vararg_buffer17 = sp + 48|0;
|
|
$vararg_buffer14 = sp + 40|0;
|
|
$vararg_buffer10 = sp + 32|0;
|
|
$vararg_buffer7 = sp + 24|0;
|
|
$vararg_buffer3 = sp + 16|0;
|
|
$vararg_buffer1 = sp + 8|0;
|
|
$vararg_buffer = sp;
|
|
$0 = (_malloc(24576)|0);
|
|
HEAP32[(32516)>>2] = $0;
|
|
$1 = (_malloc(8192)|0);
|
|
HEAP32[(32524)>>2] = $1;
|
|
HEAP32[(32520)>>2] = 0;
|
|
HEAP32[(32528)>>2] = 0;
|
|
_memset(($0|0),0,24576)|0;
|
|
$$05972 = 0;
|
|
while(1) {
|
|
$2 = HEAP32[(32524)>>2]|0;
|
|
$3 = (($2) + ($$05972)|0);
|
|
HEAP8[$3>>0] = 0;
|
|
$4 = (($$05972) + 1)|0;
|
|
$exitcond80 = ($4|0)==(8192);
|
|
if ($exitcond80) {
|
|
break;
|
|
} else {
|
|
$$05972 = $4;
|
|
}
|
|
}
|
|
HEAP32[8126] = 0;
|
|
HEAP32[(32512)>>2] = 0;
|
|
HEAP32[(32508)>>2] = 0;
|
|
$5 = (_malloc(73728)|0);
|
|
HEAP32[(32564)>>2] = $5;
|
|
$6 = (_malloc(24576)|0);
|
|
HEAP32[(32572)>>2] = $6;
|
|
HEAP32[(32568)>>2] = 0;
|
|
HEAP32[(32576)>>2] = 0;
|
|
_memset(($5|0),0,73728)|0;
|
|
$$05770 = 0;
|
|
while(1) {
|
|
$7 = HEAP32[(32572)>>2]|0;
|
|
$8 = (($7) + ($$05770)|0);
|
|
HEAP8[$8>>0] = 0;
|
|
$9 = (($$05770) + 1)|0;
|
|
$exitcond78 = ($9|0)==(24576);
|
|
if ($exitcond78) {
|
|
break;
|
|
} else {
|
|
$$05770 = $9;
|
|
}
|
|
}
|
|
HEAP32[8138] = 0;
|
|
HEAP32[(32560)>>2] = 0;
|
|
HEAP32[(32556)>>2] = 0;
|
|
$10 = (_malloc(49152)|0);
|
|
HEAP32[(32612)>>2] = $10;
|
|
$11 = (_malloc(32768)|0);
|
|
HEAP32[(32616)>>2] = $11;
|
|
$12 = (_malloc(16384)|0);
|
|
HEAP32[(32620)>>2] = $12;
|
|
$13 = (_malloc(12288)|0);
|
|
HEAP32[(32624)>>2] = $13;
|
|
$14 = HEAP32[(32612)>>2]|0;
|
|
_memset(($14|0),0,49152)|0;
|
|
$15 = HEAP32[(32616)>>2]|0;
|
|
_memset(($15|0),0,32768)|0;
|
|
$$05467 = 0;
|
|
while(1) {
|
|
$17 = HEAP32[(32620)>>2]|0;
|
|
$18 = (($17) + ($$05467)|0);
|
|
HEAP8[$18>>0] = 0;
|
|
$19 = (($$05467) + 1)|0;
|
|
$exitcond75 = ($19|0)==(16384);
|
|
if ($exitcond75) {
|
|
break;
|
|
} else {
|
|
$$05467 = $19;
|
|
}
|
|
}
|
|
$16 = HEAP32[(32624)>>2]|0;
|
|
$$05365 = 0;$$066 = 0;
|
|
while(1) {
|
|
$22 = $$05365 << 2;
|
|
$23 = $22&65535;
|
|
$24 = (($16) + ($$066<<1)|0);
|
|
HEAP16[$24>>1] = $23;
|
|
$25 = $22 | 1;
|
|
$26 = $25&65535;
|
|
$27 = $$066 | 1;
|
|
$28 = (($16) + ($27<<1)|0);
|
|
HEAP16[$28>>1] = $26;
|
|
$29 = $22 | 2;
|
|
$30 = $29&65535;
|
|
$31 = (($$066) + 2)|0;
|
|
$32 = (($16) + ($31<<1)|0);
|
|
HEAP16[$32>>1] = $30;
|
|
$33 = (($$066) + 3)|0;
|
|
$34 = (($16) + ($33<<1)|0);
|
|
HEAP16[$34>>1] = $23;
|
|
$35 = (($$066) + 4)|0;
|
|
$36 = (($16) + ($35<<1)|0);
|
|
HEAP16[$36>>1] = $30;
|
|
$37 = $22 | 3;
|
|
$38 = $37&65535;
|
|
$39 = (($$066) + 5)|0;
|
|
$40 = (($16) + ($39<<1)|0);
|
|
HEAP16[$40>>1] = $38;
|
|
$41 = (($$05365) + 1)|0;
|
|
$42 = (($$066) + 6)|0;
|
|
$exitcond = ($41|0)==(1024);
|
|
if ($exitcond) {
|
|
break;
|
|
} else {
|
|
$$05365 = $41;$$066 = $42;
|
|
}
|
|
}
|
|
HEAP32[8150] = 0;
|
|
HEAP32[(32604)>>2] = 0;
|
|
HEAP32[(32608)>>2] = 0;
|
|
_TraceLog(0,5671,$vararg_buffer);
|
|
$20 = HEAP32[7828]|0;
|
|
$21 = ($20|0)==(0);
|
|
if (!($21)) {
|
|
$43 = HEAP32[7829]|0;
|
|
FUNCTION_TABLE_vii[$43 & 63](1,(32532));
|
|
$44 = HEAP32[7830]|0;
|
|
$45 = HEAP32[(32532)>>2]|0;
|
|
FUNCTION_TABLE_vi[$44 & 31]($45);
|
|
}
|
|
_glGenBuffers(2,((32536)|0));
|
|
$46 = HEAP32[(32536)>>2]|0;
|
|
_glBindBuffer(34962,($46|0));
|
|
$47 = HEAP32[(32516)>>2]|0;
|
|
_glBufferData(34962,24576,($47|0),35048);
|
|
$48 = HEAP32[(31404)>>2]|0;
|
|
_glEnableVertexAttribArray(($48|0));
|
|
$49 = HEAP32[(31404)>>2]|0;
|
|
_glVertexAttribPointer(($49|0),3,5126,0,0,(0|0));
|
|
_glGenBuffers(2,((32540)|0));
|
|
$50 = HEAP32[(32540)>>2]|0;
|
|
_glBindBuffer(34962,($50|0));
|
|
$51 = HEAP32[(32524)>>2]|0;
|
|
_glBufferData(34962,8192,($51|0),35048);
|
|
$52 = HEAP32[(31424)>>2]|0;
|
|
_glEnableVertexAttribArray(($52|0));
|
|
$53 = HEAP32[(31424)>>2]|0;
|
|
_glVertexAttribPointer(($53|0),4,5121,1,0,(0|0));
|
|
$54 = HEAP32[7828]|0;
|
|
$55 = ($54|0)==(0);
|
|
if ($55) {
|
|
$57 = HEAP32[(32536)>>2]|0;
|
|
$58 = HEAP32[(32540)>>2]|0;
|
|
HEAP32[$vararg_buffer3>>2] = $57;
|
|
$vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
|
|
HEAP32[$vararg_ptr6>>2] = $58;
|
|
_TraceLog(0,5809,$vararg_buffer3);
|
|
} else {
|
|
$56 = HEAP32[(32532)>>2]|0;
|
|
HEAP32[$vararg_buffer1>>2] = $56;
|
|
_TraceLog(0,5744,$vararg_buffer1);
|
|
}
|
|
$59 = HEAP32[7828]|0;
|
|
$60 = ($59|0)==(0);
|
|
if (!($60)) {
|
|
$61 = HEAP32[7829]|0;
|
|
FUNCTION_TABLE_vii[$61 & 63](1,(32580));
|
|
$62 = HEAP32[7830]|0;
|
|
$63 = HEAP32[(32580)>>2]|0;
|
|
FUNCTION_TABLE_vi[$62 & 31]($63);
|
|
}
|
|
_glGenBuffers(1,((32584)|0));
|
|
$64 = HEAP32[(32584)>>2]|0;
|
|
_glBindBuffer(34962,($64|0));
|
|
$65 = HEAP32[(32564)>>2]|0;
|
|
_glBufferData(34962,73728,($65|0),35048);
|
|
$66 = HEAP32[(31404)>>2]|0;
|
|
_glEnableVertexAttribArray(($66|0));
|
|
$67 = HEAP32[(31404)>>2]|0;
|
|
_glVertexAttribPointer(($67|0),3,5126,0,0,(0|0));
|
|
_glGenBuffers(1,((32588)|0));
|
|
$68 = HEAP32[(32588)>>2]|0;
|
|
_glBindBuffer(34962,($68|0));
|
|
$69 = HEAP32[(32572)>>2]|0;
|
|
_glBufferData(34962,24576,($69|0),35048);
|
|
$70 = HEAP32[(31424)>>2]|0;
|
|
_glEnableVertexAttribArray(($70|0));
|
|
$71 = HEAP32[(31424)>>2]|0;
|
|
_glVertexAttribPointer(($71|0),4,5121,1,0,(0|0));
|
|
$72 = HEAP32[7828]|0;
|
|
$73 = ($72|0)==(0);
|
|
if ($73) {
|
|
$75 = HEAP32[(32584)>>2]|0;
|
|
$76 = HEAP32[(32588)>>2]|0;
|
|
HEAP32[$vararg_buffer10>>2] = $75;
|
|
$vararg_ptr13 = ((($vararg_buffer10)) + 4|0);
|
|
HEAP32[$vararg_ptr13>>2] = $76;
|
|
_TraceLog(0,5955,$vararg_buffer10);
|
|
} else {
|
|
$74 = HEAP32[(32580)>>2]|0;
|
|
HEAP32[$vararg_buffer7>>2] = $74;
|
|
_TraceLog(0,5886,$vararg_buffer7);
|
|
}
|
|
$77 = HEAP32[7828]|0;
|
|
$78 = ($77|0)==(0);
|
|
if (!($78)) {
|
|
$79 = HEAP32[7829]|0;
|
|
FUNCTION_TABLE_vii[$79 & 63](1,(32628));
|
|
$80 = HEAP32[7830]|0;
|
|
$81 = HEAP32[(32628)>>2]|0;
|
|
FUNCTION_TABLE_vi[$80 & 31]($81);
|
|
}
|
|
_glGenBuffers(1,((32632)|0));
|
|
$82 = HEAP32[(32632)>>2]|0;
|
|
_glBindBuffer(34962,($82|0));
|
|
$83 = HEAP32[(32612)>>2]|0;
|
|
_glBufferData(34962,49152,($83|0),35048);
|
|
$84 = HEAP32[(31404)>>2]|0;
|
|
_glEnableVertexAttribArray(($84|0));
|
|
$85 = HEAP32[(31404)>>2]|0;
|
|
_glVertexAttribPointer(($85|0),3,5126,0,0,(0|0));
|
|
_glGenBuffers(1,((32636)|0));
|
|
$86 = HEAP32[(32636)>>2]|0;
|
|
_glBindBuffer(34962,($86|0));
|
|
$87 = HEAP32[(32616)>>2]|0;
|
|
_glBufferData(34962,32768,($87|0),35048);
|
|
$88 = HEAP32[(31408)>>2]|0;
|
|
_glEnableVertexAttribArray(($88|0));
|
|
$89 = HEAP32[(31408)>>2]|0;
|
|
_glVertexAttribPointer(($89|0),2,5126,0,0,(0|0));
|
|
_glGenBuffers(1,((32640)|0));
|
|
$90 = HEAP32[(32640)>>2]|0;
|
|
_glBindBuffer(34962,($90|0));
|
|
$91 = HEAP32[(32620)>>2]|0;
|
|
_glBufferData(34962,16384,($91|0),35048);
|
|
$92 = HEAP32[(31424)>>2]|0;
|
|
_glEnableVertexAttribArray(($92|0));
|
|
$93 = HEAP32[(31424)>>2]|0;
|
|
_glVertexAttribPointer(($93|0),4,5121,1,0,(0|0));
|
|
_glGenBuffers(1,((32644)|0));
|
|
$94 = HEAP32[(32644)>>2]|0;
|
|
_glBindBuffer(34963,($94|0));
|
|
$95 = HEAP32[(32624)>>2]|0;
|
|
_glBufferData(34963,12288,($95|0),35044);
|
|
$96 = HEAP32[7828]|0;
|
|
$97 = ($96|0)==(0);
|
|
if ($97) {
|
|
$99 = HEAP32[(32632)>>2]|0;
|
|
$100 = HEAP32[(32636)>>2]|0;
|
|
$101 = HEAP32[(32640)>>2]|0;
|
|
$102 = HEAP32[(32644)>>2]|0;
|
|
HEAP32[$vararg_buffer17>>2] = $99;
|
|
$vararg_ptr20 = ((($vararg_buffer17)) + 4|0);
|
|
HEAP32[$vararg_ptr20>>2] = $100;
|
|
$vararg_ptr21 = ((($vararg_buffer17)) + 8|0);
|
|
HEAP32[$vararg_ptr21>>2] = $101;
|
|
$vararg_ptr22 = ((($vararg_buffer17)) + 12|0);
|
|
HEAP32[$vararg_ptr22>>2] = $102;
|
|
_TraceLog(0,6101,$vararg_buffer17);
|
|
} else {
|
|
$98 = HEAP32[(32628)>>2]|0;
|
|
HEAP32[$vararg_buffer14>>2] = $98;
|
|
_TraceLog(0,6036,$vararg_buffer14);
|
|
}
|
|
$103 = HEAP32[7828]|0;
|
|
$104 = ($103|0)==(0);
|
|
if ($104) {
|
|
STACKTOP = sp;return;
|
|
}
|
|
$105 = HEAP32[7830]|0;
|
|
FUNCTION_TABLE_vi[$105 & 31](0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _LoadShaderProgram($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$0 = 0, $$alloca_mul = 0, $$alloca_mul34 = 0, $$alloca_mul36 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
|
|
var $25 = 0, $26 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer10 = 0, $vararg_buffer13 = 0, $vararg_buffer16 = 0, $vararg_buffer19 = 0, $vararg_buffer22 = 0, $vararg_buffer4 = 0, $vararg_buffer7 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 96|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(96|0);
|
|
$vararg_buffer22 = sp + 64|0;
|
|
$vararg_buffer19 = sp + 56|0;
|
|
$vararg_buffer16 = sp + 48|0;
|
|
$vararg_buffer13 = sp + 40|0;
|
|
$vararg_buffer10 = sp + 32|0;
|
|
$vararg_buffer7 = sp + 24|0;
|
|
$vararg_buffer4 = sp + 16|0;
|
|
$vararg_buffer1 = sp + 8|0;
|
|
$vararg_buffer = sp;
|
|
$2 = sp + 80|0;
|
|
$3 = sp + 76|0;
|
|
$4 = sp + 72|0;
|
|
$5 = sp + 68|0;
|
|
$6 = (_glCreateShader(35633)|0);
|
|
$7 = (_glCreateShader(35632)|0);
|
|
HEAP32[$2>>2] = $0;
|
|
HEAP32[$3>>2] = $1;
|
|
_glShaderSource(($6|0),1,($2|0),(0|0));
|
|
_glShaderSource(($7|0),1,($3|0),(0|0));
|
|
HEAP32[$4>>2] = 0;
|
|
_glCompileShader(($6|0));
|
|
_glGetShaderiv(($6|0),35713,($4|0));
|
|
$8 = HEAP32[$4>>2]|0;
|
|
$9 = ($8|0)==(1);
|
|
if ($9) {
|
|
HEAP32[$vararg_buffer4>>2] = $6;
|
|
_TraceLog(0,7434,$vararg_buffer4);
|
|
} else {
|
|
HEAP32[$vararg_buffer>>2] = $6;
|
|
_TraceLog(2,7382,$vararg_buffer);
|
|
HEAP32[$vararg_buffer>>2] = 0;
|
|
_glGetShaderiv(($6|0),35716,($vararg_buffer|0));
|
|
$10 = HEAP32[$vararg_buffer>>2]|0;
|
|
$11 = (_llvm_stacksave()|0);
|
|
$$alloca_mul = $10;
|
|
$12 = STACKTOP; STACKTOP = STACKTOP + ((((1*$$alloca_mul)|0)+15)&-16)|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(((((1*$$alloca_mul)|0)+15)&-16)|0);;
|
|
$13 = HEAP32[$vararg_buffer>>2]|0;
|
|
_glGetShaderInfoLog(($6|0),($13|0),($5|0),($12|0));
|
|
HEAP32[$vararg_buffer1>>2] = $12;
|
|
_TraceLog(0,7431,$vararg_buffer1);
|
|
_llvm_stackrestore(($11|0));
|
|
}
|
|
_glCompileShader(($7|0));
|
|
_glGetShaderiv(($7|0),35713,($4|0));
|
|
$14 = HEAP32[$4>>2]|0;
|
|
$15 = ($14|0)==(1);
|
|
if ($15) {
|
|
HEAP32[$vararg_buffer13>>2] = $7;
|
|
_TraceLog(0,7535,$vararg_buffer13);
|
|
} else {
|
|
HEAP32[$vararg_buffer7>>2] = $7;
|
|
_TraceLog(2,7484,$vararg_buffer7);
|
|
HEAP32[$vararg_buffer7>>2] = 0;
|
|
_glGetShaderiv(($7|0),35716,($vararg_buffer7|0));
|
|
$16 = HEAP32[$vararg_buffer7>>2]|0;
|
|
$17 = (_llvm_stacksave()|0);
|
|
$$alloca_mul34 = $16;
|
|
$18 = STACKTOP; STACKTOP = STACKTOP + ((((1*$$alloca_mul34)|0)+15)&-16)|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(((((1*$$alloca_mul34)|0)+15)&-16)|0);;
|
|
$19 = HEAP32[$vararg_buffer7>>2]|0;
|
|
_glGetShaderInfoLog(($7|0),($19|0),($5|0),($18|0));
|
|
HEAP32[$vararg_buffer10>>2] = $18;
|
|
_TraceLog(0,7431,$vararg_buffer10);
|
|
_llvm_stackrestore(($17|0));
|
|
}
|
|
$20 = (_glCreateProgram()|0);
|
|
_glAttachShader(($20|0),($6|0));
|
|
_glAttachShader(($20|0),($7|0));
|
|
_glBindAttribLocation(($20|0),0,(7226|0));
|
|
_glBindAttribLocation(($20|0),1,(7241|0));
|
|
_glBindAttribLocation(($20|0),2,(7272|0));
|
|
_glBindAttribLocation(($20|0),3,(7299|0));
|
|
_glBindAttribLocation(($20|0),4,(7285|0));
|
|
_glBindAttribLocation(($20|0),5,(7256|0));
|
|
_glLinkProgram(($20|0));
|
|
_glGetProgramiv(($20|0),35714,($4|0));
|
|
$21 = HEAP32[$4>>2]|0;
|
|
$22 = ($21|0)==(0);
|
|
if ($22) {
|
|
HEAP32[$vararg_buffer16>>2] = $20;
|
|
_TraceLog(2,7587,$vararg_buffer16);
|
|
HEAP32[$vararg_buffer16>>2] = 0;
|
|
_glGetProgramiv(($20|0),35716,($vararg_buffer16|0));
|
|
$23 = HEAP32[$vararg_buffer16>>2]|0;
|
|
$24 = (_llvm_stacksave()|0);
|
|
$$alloca_mul36 = $23;
|
|
$25 = STACKTOP; STACKTOP = STACKTOP + ((((1*$$alloca_mul36)|0)+15)&-16)|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(((((1*$$alloca_mul36)|0)+15)&-16)|0);;
|
|
$26 = HEAP32[$vararg_buffer16>>2]|0;
|
|
_glGetProgramInfoLog(($20|0),($26|0),($5|0),($25|0));
|
|
HEAP32[$vararg_buffer19>>2] = $25;
|
|
_TraceLog(0,7431,$vararg_buffer19);
|
|
_glDeleteProgram(($20|0));
|
|
_llvm_stackrestore(($24|0));
|
|
$$0 = 0;
|
|
_glDeleteShader(($6|0));
|
|
_glDeleteShader(($7|0));
|
|
STACKTOP = sp;return ($$0|0);
|
|
} else {
|
|
HEAP32[$vararg_buffer22>>2] = $20;
|
|
_TraceLog(0,7633,$vararg_buffer22);
|
|
$$0 = $20;
|
|
_glDeleteShader(($6|0));
|
|
_glDeleteShader(($7|0));
|
|
STACKTOP = sp;return ($$0|0);
|
|
}
|
|
return (0)|0;
|
|
}
|
|
function _LoadDefaultShaderLocations($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
|
|
var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0;
|
|
var sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = HEAP32[$0>>2]|0;
|
|
$2 = (_glGetAttribLocation(($1|0),(7226|0))|0);
|
|
$3 = ((($0)) + 4|0);
|
|
HEAP32[$3>>2] = $2;
|
|
$4 = HEAP32[$0>>2]|0;
|
|
$5 = (_glGetAttribLocation(($4|0),(7241|0))|0);
|
|
$6 = ((($0)) + 8|0);
|
|
HEAP32[$6>>2] = $5;
|
|
$7 = HEAP32[$0>>2]|0;
|
|
$8 = (_glGetAttribLocation(($7|0),(7256|0))|0);
|
|
$9 = ((($0)) + 12|0);
|
|
HEAP32[$9>>2] = $8;
|
|
$10 = HEAP32[$0>>2]|0;
|
|
$11 = (_glGetAttribLocation(($10|0),(7272|0))|0);
|
|
$12 = ((($0)) + 16|0);
|
|
HEAP32[$12>>2] = $11;
|
|
$13 = HEAP32[$0>>2]|0;
|
|
$14 = (_glGetAttribLocation(($13|0),(7285|0))|0);
|
|
$15 = ((($0)) + 20|0);
|
|
HEAP32[$15>>2] = $14;
|
|
$16 = HEAP32[$0>>2]|0;
|
|
$17 = (_glGetAttribLocation(($16|0),(7299|0))|0);
|
|
$18 = ((($0)) + 24|0);
|
|
HEAP32[$18>>2] = $17;
|
|
$19 = HEAP32[$0>>2]|0;
|
|
$20 = (_glGetUniformLocation(($19|0),(7311|0))|0);
|
|
$21 = ((($0)) + 28|0);
|
|
HEAP32[$21>>2] = $20;
|
|
$22 = HEAP32[$0>>2]|0;
|
|
$23 = (_glGetUniformLocation(($22|0),(7321|0))|0);
|
|
$24 = ((($0)) + 32|0);
|
|
HEAP32[$24>>2] = $23;
|
|
$25 = HEAP32[$0>>2]|0;
|
|
$26 = (_glGetUniformLocation(($25|0),(7332|0))|0);
|
|
$27 = ((($0)) + 36|0);
|
|
HEAP32[$27>>2] = $26;
|
|
$28 = HEAP32[$0>>2]|0;
|
|
$29 = (_glGetUniformLocation(($28|0),(7343|0))|0);
|
|
$30 = ((($0)) + 40|0);
|
|
HEAP32[$30>>2] = $29;
|
|
$31 = HEAP32[$0>>2]|0;
|
|
$32 = (_glGetUniformLocation(($31|0),(7355|0))|0);
|
|
$33 = ((($0)) + 44|0);
|
|
HEAP32[$33>>2] = $32;
|
|
$34 = HEAP32[$0>>2]|0;
|
|
$35 = (_glGetUniformLocation(($34|0),(7364|0))|0);
|
|
$36 = ((($0)) + 48|0);
|
|
HEAP32[$36>>2] = $35;
|
|
$37 = HEAP32[$0>>2]|0;
|
|
$38 = (_glGetUniformLocation(($37|0),(7373|0))|0);
|
|
$39 = ((($0)) + 52|0);
|
|
HEAP32[$39>>2] = $38;
|
|
return;
|
|
}
|
|
function _IsMouseButtonPressed($0) {
|
|
$0 = $0|0;
|
|
var $$0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $or$cond = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = (35953 + ($0)|0);
|
|
$2 = HEAP8[$1>>0]|0;
|
|
$3 = (35956 + ($0)|0);
|
|
$4 = HEAP8[$3>>0]|0;
|
|
$5 = ($2<<24>>24)!=($4<<24>>24);
|
|
$6 = ($2<<24>>24)==(1);
|
|
$or$cond = $6 & $5;
|
|
$$0 = $or$cond&1;
|
|
return ($$0|0);
|
|
}
|
|
function _IsMouseButtonReleased($0) {
|
|
$0 = $0|0;
|
|
var $$0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $or$cond = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = (35953 + ($0)|0);
|
|
$2 = HEAP8[$1>>0]|0;
|
|
$3 = (35956 + ($0)|0);
|
|
$4 = HEAP8[$3>>0]|0;
|
|
$5 = ($2<<24>>24)!=($4<<24>>24);
|
|
$6 = ($2<<24>>24)==(0);
|
|
$or$cond = $6 & $5;
|
|
$$0 = $or$cond&1;
|
|
return ($$0|0);
|
|
}
|
|
function _rlClearScreenBuffers() {
|
|
var label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
_glClear(16640);
|
|
return;
|
|
}
|
|
function _CloseWindow() {
|
|
var $0 = 0, $vararg_buffer = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
|
|
$vararg_buffer = sp;
|
|
_UnloadDefaultFont();
|
|
_rlglClose();
|
|
$0 = HEAP32[7747]|0;
|
|
_glfwDestroyWindow(($0|0));
|
|
_glfwTerminate();
|
|
_TraceLog(0,7945,$vararg_buffer);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _UnloadDefaultFont() {
|
|
var $$byval_copy = 0, $0 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
|
|
$$byval_copy = sp;
|
|
;HEAP32[$$byval_copy>>2]=HEAP32[31028>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[31028+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[31028+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[31028+12>>2]|0;HEAP32[$$byval_copy+16>>2]=HEAP32[31028+16>>2]|0;
|
|
_UnloadTexture($$byval_copy);
|
|
$0 = HEAP32[(31056)>>2]|0;
|
|
_free($0);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _rlglClose() {
|
|
var $0 = 0, $1 = 0, $vararg_buffer = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
|
|
$vararg_buffer = sp;
|
|
_UnloadDefaultShader();
|
|
_UnloadDefaultBuffers();
|
|
_glDeleteTextures(1,(31340|0));
|
|
$0 = HEAP32[7835]|0;
|
|
HEAP32[$vararg_buffer>>2] = $0;
|
|
_TraceLog(0,7972,$vararg_buffer);
|
|
$1 = HEAP32[7865]|0;
|
|
_free($1);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _UnloadDefaultShader() {
|
|
var $0 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
_glUseProgram(0);
|
|
$0 = HEAP32[7836]|0;
|
|
_glDeleteProgram(($0|0));
|
|
return;
|
|
}
|
|
function _UnloadDefaultBuffers() {
|
|
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$0 = HEAP32[7828]|0;
|
|
$1 = ($0|0)==(0);
|
|
if (!($1)) {
|
|
$2 = HEAP32[7830]|0;
|
|
FUNCTION_TABLE_vi[$2 & 31](0);
|
|
}
|
|
_glDisableVertexAttribArray(0);
|
|
_glDisableVertexAttribArray(1);
|
|
_glDisableVertexAttribArray(2);
|
|
_glDisableVertexAttribArray(3);
|
|
_glBindBuffer(34962,0);
|
|
_glBindBuffer(34963,0);
|
|
_glDeleteBuffers(1,((32536)|0));
|
|
_glDeleteBuffers(1,((32540)|0));
|
|
_glDeleteBuffers(1,((32584)|0));
|
|
_glDeleteBuffers(1,((32588)|0));
|
|
_glDeleteBuffers(1,((32632)|0));
|
|
_glDeleteBuffers(1,((32636)|0));
|
|
_glDeleteBuffers(1,((32640)|0));
|
|
_glDeleteBuffers(1,((32644)|0));
|
|
$3 = HEAP32[7828]|0;
|
|
$4 = ($3|0)==(0);
|
|
if (!($4)) {
|
|
$5 = HEAP32[7831]|0;
|
|
FUNCTION_TABLE_vii[$5 & 63](1,(32532));
|
|
$6 = HEAP32[7831]|0;
|
|
FUNCTION_TABLE_vii[$6 & 63](1,(32580));
|
|
$7 = HEAP32[7831]|0;
|
|
FUNCTION_TABLE_vii[$7 & 63](1,(32628));
|
|
}
|
|
$8 = HEAP32[(32516)>>2]|0;
|
|
_free($8);
|
|
$9 = HEAP32[(32524)>>2]|0;
|
|
_free($9);
|
|
$10 = HEAP32[(32564)>>2]|0;
|
|
_free($10);
|
|
$11 = HEAP32[(32572)>>2]|0;
|
|
_free($11);
|
|
$12 = HEAP32[(32612)>>2]|0;
|
|
_free($12);
|
|
$13 = HEAP32[(32616)>>2]|0;
|
|
_free($13);
|
|
$14 = HEAP32[(32620)>>2]|0;
|
|
_free($14);
|
|
$15 = HEAP32[(32624)>>2]|0;
|
|
_free($15);
|
|
return;
|
|
}
|
|
function _UnloadTexture($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, $3 = 0, $vararg_buffer = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
|
|
$vararg_buffer = sp;
|
|
$1 = HEAP32[$0>>2]|0;
|
|
$2 = ($1|0)==(0);
|
|
if ($2) {
|
|
STACKTOP = sp;return;
|
|
}
|
|
_rlDeleteTextures($1);
|
|
$3 = HEAP32[$0>>2]|0;
|
|
HEAP32[$vararg_buffer>>2] = $3;
|
|
_TraceLog(0,8037,$vararg_buffer);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _rlDeleteTextures($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
|
|
$1 = sp;
|
|
HEAP32[$1>>2] = $0;
|
|
$2 = ($0|0)==(0);
|
|
if (!($2)) {
|
|
_glDeleteTextures(1,($1|0));
|
|
}
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _BeginDrawing() {
|
|
var $0 = 0.0, $1 = 0.0, $2 = 0.0, $downscaleView$byval_copy = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
|
|
$downscaleView$byval_copy = sp;
|
|
$0 = (+_GetTime());
|
|
HEAPF64[1780] = $0;
|
|
$1 = +HEAPF64[1763];
|
|
$2 = $0 - $1;
|
|
HEAPF64[1781] = $2;
|
|
HEAPF64[1763] = $0;
|
|
_rlClearScreenBuffers();
|
|
_rlLoadIdentity();
|
|
dest=$downscaleView$byval_copy; src=31084; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
(_MatrixToFloat($downscaleView$byval_copy)|0);
|
|
_rlMultMatrixf(32656);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _MatrixToFloat($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
|
|
var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = HEAP32[$0>>2]|0;
|
|
HEAP32[8164] = $1;
|
|
$2 = ((($0)) + 4|0);
|
|
$3 = HEAP32[$2>>2]|0;
|
|
HEAP32[(32660)>>2] = $3;
|
|
$4 = ((($0)) + 8|0);
|
|
$5 = HEAP32[$4>>2]|0;
|
|
HEAP32[(32664)>>2] = $5;
|
|
$6 = ((($0)) + 12|0);
|
|
$7 = HEAP32[$6>>2]|0;
|
|
HEAP32[(32668)>>2] = $7;
|
|
$8 = ((($0)) + 16|0);
|
|
$9 = HEAP32[$8>>2]|0;
|
|
HEAP32[(32672)>>2] = $9;
|
|
$10 = ((($0)) + 20|0);
|
|
$11 = HEAP32[$10>>2]|0;
|
|
HEAP32[(32676)>>2] = $11;
|
|
$12 = ((($0)) + 24|0);
|
|
$13 = HEAP32[$12>>2]|0;
|
|
HEAP32[(32680)>>2] = $13;
|
|
$14 = ((($0)) + 28|0);
|
|
$15 = HEAP32[$14>>2]|0;
|
|
HEAP32[(32684)>>2] = $15;
|
|
$16 = ((($0)) + 32|0);
|
|
$17 = HEAP32[$16>>2]|0;
|
|
HEAP32[(32688)>>2] = $17;
|
|
$18 = ((($0)) + 36|0);
|
|
$19 = HEAP32[$18>>2]|0;
|
|
HEAP32[(32692)>>2] = $19;
|
|
$20 = ((($0)) + 40|0);
|
|
$21 = HEAP32[$20>>2]|0;
|
|
HEAP32[(32696)>>2] = $21;
|
|
$22 = ((($0)) + 44|0);
|
|
$23 = HEAP32[$22>>2]|0;
|
|
HEAP32[(32700)>>2] = $23;
|
|
$24 = ((($0)) + 48|0);
|
|
$25 = HEAP32[$24>>2]|0;
|
|
HEAP32[(32704)>>2] = $25;
|
|
$26 = ((($0)) + 52|0);
|
|
$27 = HEAP32[$26>>2]|0;
|
|
HEAP32[(32708)>>2] = $27;
|
|
$28 = ((($0)) + 56|0);
|
|
$29 = HEAP32[$28>>2]|0;
|
|
HEAP32[(32712)>>2] = $29;
|
|
$30 = ((($0)) + 60|0);
|
|
$31 = HEAP32[$30>>2]|0;
|
|
HEAP32[(32716)>>2] = $31;
|
|
return (32656|0);
|
|
}
|
|
function _rlMultMatrixf($0) {
|
|
$0 = $0|0;
|
|
var $$byval_copy = 0, $$byval_copy1 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
|
|
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
|
|
var $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 256|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(256|0);
|
|
$$byval_copy1 = sp + 192|0;
|
|
$$byval_copy = sp + 128|0;
|
|
$1 = sp + 64|0;
|
|
$2 = sp;
|
|
$3 = HEAP32[$0>>2]|0;
|
|
HEAP32[$1>>2] = $3;
|
|
$4 = ((($1)) + 4|0);
|
|
$5 = ((($0)) + 4|0);
|
|
$6 = HEAP32[$5>>2]|0;
|
|
HEAP32[$4>>2] = $6;
|
|
$7 = ((($1)) + 8|0);
|
|
$8 = ((($0)) + 8|0);
|
|
$9 = HEAP32[$8>>2]|0;
|
|
HEAP32[$7>>2] = $9;
|
|
$10 = ((($1)) + 12|0);
|
|
$11 = ((($0)) + 12|0);
|
|
$12 = HEAP32[$11>>2]|0;
|
|
HEAP32[$10>>2] = $12;
|
|
$13 = ((($1)) + 16|0);
|
|
$14 = ((($0)) + 16|0);
|
|
$15 = HEAP32[$14>>2]|0;
|
|
HEAP32[$13>>2] = $15;
|
|
$16 = ((($1)) + 20|0);
|
|
$17 = ((($0)) + 20|0);
|
|
$18 = HEAP32[$17>>2]|0;
|
|
HEAP32[$16>>2] = $18;
|
|
$19 = ((($1)) + 24|0);
|
|
$20 = ((($0)) + 24|0);
|
|
$21 = HEAP32[$20>>2]|0;
|
|
HEAP32[$19>>2] = $21;
|
|
$22 = ((($1)) + 28|0);
|
|
$23 = ((($0)) + 28|0);
|
|
$24 = HEAP32[$23>>2]|0;
|
|
HEAP32[$22>>2] = $24;
|
|
$25 = ((($1)) + 32|0);
|
|
$26 = ((($0)) + 32|0);
|
|
$27 = HEAP32[$26>>2]|0;
|
|
HEAP32[$25>>2] = $27;
|
|
$28 = ((($1)) + 36|0);
|
|
$29 = ((($0)) + 36|0);
|
|
$30 = HEAP32[$29>>2]|0;
|
|
HEAP32[$28>>2] = $30;
|
|
$31 = ((($1)) + 40|0);
|
|
$32 = ((($0)) + 40|0);
|
|
$33 = HEAP32[$32>>2]|0;
|
|
HEAP32[$31>>2] = $33;
|
|
$34 = ((($1)) + 44|0);
|
|
$35 = ((($0)) + 44|0);
|
|
$36 = HEAP32[$35>>2]|0;
|
|
HEAP32[$34>>2] = $36;
|
|
$37 = ((($1)) + 48|0);
|
|
$38 = ((($0)) + 48|0);
|
|
$39 = HEAP32[$38>>2]|0;
|
|
HEAP32[$37>>2] = $39;
|
|
$40 = ((($1)) + 52|0);
|
|
$41 = ((($0)) + 52|0);
|
|
$42 = HEAP32[$41>>2]|0;
|
|
HEAP32[$40>>2] = $42;
|
|
$43 = ((($1)) + 56|0);
|
|
$44 = ((($0)) + 56|0);
|
|
$45 = HEAP32[$44>>2]|0;
|
|
HEAP32[$43>>2] = $45;
|
|
$46 = ((($1)) + 60|0);
|
|
$47 = ((($0)) + 60|0);
|
|
$48 = HEAP32[$47>>2]|0;
|
|
HEAP32[$46>>2] = $48;
|
|
$49 = HEAP32[7794]|0;
|
|
dest=$$byval_copy; src=$49; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
dest=$$byval_copy1; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_MatrixMultiply($2,$$byval_copy,$$byval_copy1);
|
|
dest=$49; src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _EndDrawing() {
|
|
var $0 = 0.0, $1 = 0.0, $10 = 0.0, $11 = 0.0, $12 = 0.0, $13 = 0.0, $14 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0.0, $6 = 0, $7 = 0.0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
_rlglDraw();
|
|
_SwapBuffers();
|
|
_PollInputEvents();
|
|
$0 = (+_GetTime());
|
|
HEAPF64[1780] = $0;
|
|
$1 = +HEAPF64[1763];
|
|
$2 = $0 - $1;
|
|
HEAPF64[1782] = $2;
|
|
HEAPF64[1763] = $0;
|
|
$3 = +HEAPF64[1781];
|
|
$4 = $2 + $3;
|
|
HEAPF64[1783] = $4;
|
|
$5 = +HEAPF64[1760];
|
|
$6 = $4 < $5;
|
|
if (!($6)) {
|
|
return;
|
|
}
|
|
$7 = $5 - $4;
|
|
$8 = $7 * 1000.0;
|
|
$9 = $8;
|
|
_Wait($9);
|
|
$10 = (+_GetTime());
|
|
HEAPF64[1780] = $10;
|
|
$11 = +HEAPF64[1763];
|
|
$12 = $10 - $11;
|
|
HEAPF64[1763] = $10;
|
|
$13 = +HEAPF64[1783];
|
|
$14 = $12 + $13;
|
|
HEAPF64[1783] = $14;
|
|
return;
|
|
}
|
|
function _rlglDraw() {
|
|
var label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
_UpdateDefaultBuffers();
|
|
_DrawDefaultBuffers();
|
|
return;
|
|
}
|
|
function _SwapBuffers() {
|
|
var $0 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$0 = HEAP32[7747]|0;
|
|
_glfwSwapBuffers(($0|0));
|
|
return;
|
|
}
|
|
function _PollInputEvents() {
|
|
var $$04857 = 0, $$05160 = 0, $$058 = 0, $$lcssa = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0;
|
|
var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0.0, $31 = 0.0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0.0, $40 = 0;
|
|
var $5 = 0.0, $6 = 0.0, $7 = 0.0, $8 = 0, $9 = 0, $scevgep = 0, $scevgep67 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 1456|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(1456|0);
|
|
$0 = sp + 1440|0;
|
|
$1 = sp + 1432|0;
|
|
$2 = sp;
|
|
_UpdateGestures();
|
|
HEAP32[743] = -1;
|
|
HEAP32[745] = -1;
|
|
HEAP32[8180] = 0;
|
|
$3 = HEAP32[7747]|0;
|
|
_glfwGetCursorPos(($3|0),($0|0),($1|0));
|
|
$4 = +HEAPF64[$0>>3];
|
|
$5 = $4;
|
|
HEAPF32[3518] = $5;
|
|
$6 = +HEAPF64[$1>>3];
|
|
$7 = $6;
|
|
HEAPF32[(14076)>>2] = $7;
|
|
_memcpy((36471|0),(35959|0),512)|0;
|
|
;HEAP8[35956>>0]=HEAP8[35953>>0]|0;HEAP8[35956+1>>0]=HEAP8[35953+1>>0]|0;HEAP8[35956+2>>0]=HEAP8[35953+2>>0]|0;
|
|
$8 = HEAP32[8163]|0;
|
|
HEAP32[7750] = $8;
|
|
HEAP32[8163] = 0;
|
|
$9 = (_emscripten_get_num_gamepads()|0);
|
|
$10 = ($9|0)>(0);
|
|
if (!($10)) {
|
|
STACKTOP = sp;return;
|
|
}
|
|
$11 = ((($2)) + 12|0);
|
|
$12 = ((($2)) + 8|0);
|
|
$$05160 = 0;
|
|
while(1) {
|
|
$scevgep = (36983 + ($$05160<<5)|0);
|
|
$scevgep67 = (37111 + ($$05160<<5)|0);
|
|
dest=$scevgep; src=$scevgep67; stop=dest+32|0; do { HEAP8[dest>>0]=HEAP8[src>>0]|0; dest=dest+1|0; src=src+1|0; } while ((dest|0) < (stop|0));
|
|
$13 = (_emscripten_get_gamepad_status(($$05160|0),($2|0))|0);
|
|
$14 = ($13|0)==(0);
|
|
if ($14) {
|
|
$15 = HEAP32[$11>>2]|0;
|
|
$16 = ($15|0)>(0);
|
|
if ($16) {
|
|
$17 = HEAP32[$11>>2]|0;
|
|
$$04857 = 0;
|
|
while(1) {
|
|
$21 = (((($2)) + 1040|0) + ($$04857<<2)|0);
|
|
$22 = HEAP32[$21>>2]|0;
|
|
$23 = ($22|0)==(1);
|
|
$24 = ((37111 + ($$05160<<5)|0) + ($$04857)|0);
|
|
if ($23) {
|
|
HEAP8[$24>>0] = 1;
|
|
HEAP32[745] = $$04857;
|
|
} else {
|
|
HEAP8[$24>>0] = 0;
|
|
}
|
|
$25 = (($$04857) + 1)|0;
|
|
$26 = ($25|0)<($17|0);
|
|
$27 = ($25|0)<(32);
|
|
$28 = $27 & $26;
|
|
if ($28) {
|
|
$$04857 = $25;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
$18 = HEAP32[$12>>2]|0;
|
|
$19 = ($18|0)>(0);
|
|
if ($19) {
|
|
$20 = HEAP32[$12>>2]|0;
|
|
$$058 = 0;
|
|
while(1) {
|
|
$29 = (((($2)) + 16|0) + ($$058<<3)|0);
|
|
$30 = +HEAPF64[$29>>3];
|
|
$31 = $30;
|
|
$32 = ((32724 + ($$05160<<5)|0) + ($$058<<2)|0);
|
|
HEAPF32[$32>>2] = $31;
|
|
$33 = (($$058) + 1)|0;
|
|
$34 = ($33|0)<($20|0);
|
|
$35 = ($33|0)<(8);
|
|
$36 = $35 & $34;
|
|
if ($36) {
|
|
$$058 = $33;
|
|
} else {
|
|
$$lcssa = $20;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$lcssa = $18;
|
|
}
|
|
HEAP32[8180] = $$lcssa;
|
|
}
|
|
$37 = (($$05160) + 1)|0;
|
|
$38 = ($37|0)<($9|0);
|
|
$39 = ($37|0)<(4);
|
|
$40 = $38 & $39;
|
|
if ($40) {
|
|
$$05160 = $37;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _Wait($0) {
|
|
$0 = +$0;
|
|
var $1 = 0.0, $2 = 0.0, $3 = 0.0, $4 = 0.0, $5 = 0, $6 = 0.0, $7 = 0.0, $8 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = (+_GetTime());
|
|
$2 = 0.0 - $1;
|
|
$3 = $0 / 1000.0;
|
|
$4 = $3;
|
|
$5 = $2 < $4;
|
|
if (!($5)) {
|
|
return;
|
|
}
|
|
while(1) {
|
|
$6 = (+_GetTime());
|
|
$7 = $6 - $1;
|
|
$8 = $7 < $4;
|
|
if (!($8)) {
|
|
break;
|
|
}
|
|
}
|
|
return;
|
|
}
|
|
function _UpdateDefaultBuffers() {
|
|
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0;
|
|
var $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
|
|
var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$0 = HEAP32[8126]|0;
|
|
$1 = ($0|0)>(0);
|
|
if ($1) {
|
|
$2 = HEAP32[7828]|0;
|
|
$3 = ($2|0)==(0);
|
|
if (!($3)) {
|
|
$4 = HEAP32[7830]|0;
|
|
$5 = HEAP32[(32532)>>2]|0;
|
|
FUNCTION_TABLE_vi[$4 & 31]($5);
|
|
}
|
|
$6 = HEAP32[(32536)>>2]|0;
|
|
_glBindBuffer(34962,($6|0));
|
|
$7 = HEAP32[8126]|0;
|
|
$8 = ($7*12)|0;
|
|
$9 = HEAP32[(32516)>>2]|0;
|
|
_glBufferSubData(34962,0,($8|0),($9|0));
|
|
$10 = HEAP32[(32540)>>2]|0;
|
|
_glBindBuffer(34962,($10|0));
|
|
$11 = HEAP32[(32512)>>2]|0;
|
|
$12 = $11 << 2;
|
|
$13 = HEAP32[(32524)>>2]|0;
|
|
_glBufferSubData(34962,0,($12|0),($13|0));
|
|
}
|
|
$14 = HEAP32[8138]|0;
|
|
$15 = ($14|0)>(0);
|
|
if ($15) {
|
|
$16 = HEAP32[7828]|0;
|
|
$17 = ($16|0)==(0);
|
|
if (!($17)) {
|
|
$18 = HEAP32[7830]|0;
|
|
$19 = HEAP32[(32580)>>2]|0;
|
|
FUNCTION_TABLE_vi[$18 & 31]($19);
|
|
}
|
|
$20 = HEAP32[(32584)>>2]|0;
|
|
_glBindBuffer(34962,($20|0));
|
|
$21 = HEAP32[8138]|0;
|
|
$22 = ($21*12)|0;
|
|
$23 = HEAP32[(32564)>>2]|0;
|
|
_glBufferSubData(34962,0,($22|0),($23|0));
|
|
$24 = HEAP32[(32588)>>2]|0;
|
|
_glBindBuffer(34962,($24|0));
|
|
$25 = HEAP32[(32560)>>2]|0;
|
|
$26 = $25 << 2;
|
|
$27 = HEAP32[(32572)>>2]|0;
|
|
_glBufferSubData(34962,0,($26|0),($27|0));
|
|
}
|
|
$28 = HEAP32[8150]|0;
|
|
$29 = ($28|0)>(0);
|
|
if ($29) {
|
|
$30 = HEAP32[7828]|0;
|
|
$31 = ($30|0)==(0);
|
|
if (!($31)) {
|
|
$32 = HEAP32[7830]|0;
|
|
$33 = HEAP32[(32628)>>2]|0;
|
|
FUNCTION_TABLE_vi[$32 & 31]($33);
|
|
}
|
|
$34 = HEAP32[(32632)>>2]|0;
|
|
_glBindBuffer(34962,($34|0));
|
|
$35 = HEAP32[8150]|0;
|
|
$36 = ($35*12)|0;
|
|
$37 = HEAP32[(32612)>>2]|0;
|
|
_glBufferSubData(34962,0,($36|0),($37|0));
|
|
$38 = HEAP32[(32636)>>2]|0;
|
|
_glBindBuffer(34962,($38|0));
|
|
$39 = HEAP32[8150]|0;
|
|
$40 = $39 << 3;
|
|
$41 = HEAP32[(32616)>>2]|0;
|
|
_glBufferSubData(34962,0,($40|0),($41|0));
|
|
$42 = HEAP32[(32640)>>2]|0;
|
|
_glBindBuffer(34962,($42|0));
|
|
$43 = HEAP32[8150]|0;
|
|
$44 = $43 << 2;
|
|
$45 = HEAP32[(32620)>>2]|0;
|
|
_glBufferSubData(34962,0,($44|0),($45|0));
|
|
}
|
|
$46 = HEAP32[7828]|0;
|
|
$47 = ($46|0)==(0);
|
|
if ($47) {
|
|
return;
|
|
}
|
|
$48 = HEAP32[7830]|0;
|
|
FUNCTION_TABLE_vi[$48 & 31](0);
|
|
return;
|
|
}
|
|
function _DrawDefaultBuffers() {
|
|
var $$ = 0, $$02830 = 0, $$02932 = 0, $$031 = 0, $$byval_copy2 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0;
|
|
var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0;
|
|
var $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0;
|
|
var $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0;
|
|
var $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $modelview$byval_copy = 0;
|
|
var $or$cond = 0, $or$cond3 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 320|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(320|0);
|
|
$$byval_copy2 = sp + 256|0;
|
|
$modelview$byval_copy = sp + 192|0;
|
|
$0 = sp + 128|0;
|
|
$1 = sp + 64|0;
|
|
$2 = sp;
|
|
dest=$0; src=31180; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
dest=$1; src=31244; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
$3 = HEAP32[8213]|0;
|
|
$4 = ($3|0)!=(0);
|
|
$$ = $4 ? 2 : 1;
|
|
$$02932 = 0;
|
|
while(1) {
|
|
if ($4) {
|
|
dest=$modelview$byval_copy; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
dest=$$byval_copy2; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_SetStereoView($$02932,$modelview$byval_copy,$$byval_copy2);
|
|
}
|
|
$8 = HEAP32[8126]|0;
|
|
$9 = ($8|0)>(0);
|
|
$10 = HEAP32[8138]|0;
|
|
$11 = ($10|0)>(0);
|
|
$or$cond = $9 | $11;
|
|
$12 = HEAP32[8150]|0;
|
|
$13 = ($12|0)>(0);
|
|
$or$cond3 = $or$cond | $13;
|
|
if ($or$cond3) {
|
|
$14 = HEAP32[7850]|0;
|
|
_glUseProgram(($14|0));
|
|
dest=$modelview$byval_copy; src=31244; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
dest=$$byval_copy2; src=31180; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_MatrixMultiply($2,$modelview$byval_copy,$$byval_copy2);
|
|
$15 = HEAP32[(31428)>>2]|0;
|
|
dest=$$byval_copy2; src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
$16 = (_MatrixToFloat($$byval_copy2)|0);
|
|
_glUniformMatrix4fv(($15|0),1,0,($16|0));
|
|
$17 = HEAP32[(31432)>>2]|0;
|
|
_glUniform4f(($17|0),1.0,1.0,1.0,1.0);
|
|
$18 = HEAP32[(31444)>>2]|0;
|
|
_glUniform1i(($18|0),0);
|
|
}
|
|
$19 = HEAP32[8126]|0;
|
|
$20 = ($19|0)>(0);
|
|
if ($20) {
|
|
$21 = HEAP32[7835]|0;
|
|
_glBindTexture(3553,($21|0));
|
|
$22 = HEAP32[7828]|0;
|
|
$23 = ($22|0)==(0);
|
|
if ($23) {
|
|
$26 = HEAP32[(32536)>>2]|0;
|
|
_glBindBuffer(34962,($26|0));
|
|
$27 = HEAP32[(31404)>>2]|0;
|
|
_glVertexAttribPointer(($27|0),3,5126,0,0,(0|0));
|
|
$28 = HEAP32[(31404)>>2]|0;
|
|
_glEnableVertexAttribArray(($28|0));
|
|
$29 = HEAP32[(32540)>>2]|0;
|
|
_glBindBuffer(34962,($29|0));
|
|
$30 = HEAP32[(31424)>>2]|0;
|
|
_glVertexAttribPointer(($30|0),4,5121,1,0,(0|0));
|
|
$31 = HEAP32[(31424)>>2]|0;
|
|
_glEnableVertexAttribArray(($31|0));
|
|
} else {
|
|
$24 = HEAP32[7830]|0;
|
|
$25 = HEAP32[(32532)>>2]|0;
|
|
FUNCTION_TABLE_vi[$24 & 31]($25);
|
|
}
|
|
$32 = HEAP32[8126]|0;
|
|
_glDrawArrays(1,0,($32|0));
|
|
$33 = HEAP32[7828]|0;
|
|
$34 = ($33|0)==(0);
|
|
if ($34) {
|
|
_glBindBuffer(34962,0);
|
|
}
|
|
_glBindTexture(3553,0);
|
|
}
|
|
$35 = HEAP32[8138]|0;
|
|
$36 = ($35|0)>(0);
|
|
if ($36) {
|
|
$37 = HEAP32[7835]|0;
|
|
_glBindTexture(3553,($37|0));
|
|
$38 = HEAP32[7828]|0;
|
|
$39 = ($38|0)==(0);
|
|
if ($39) {
|
|
$42 = HEAP32[(32584)>>2]|0;
|
|
_glBindBuffer(34962,($42|0));
|
|
$43 = HEAP32[(31404)>>2]|0;
|
|
_glVertexAttribPointer(($43|0),3,5126,0,0,(0|0));
|
|
$44 = HEAP32[(31404)>>2]|0;
|
|
_glEnableVertexAttribArray(($44|0));
|
|
$45 = HEAP32[(32588)>>2]|0;
|
|
_glBindBuffer(34962,($45|0));
|
|
$46 = HEAP32[(31424)>>2]|0;
|
|
_glVertexAttribPointer(($46|0),4,5121,1,0,(0|0));
|
|
$47 = HEAP32[(31424)>>2]|0;
|
|
_glEnableVertexAttribArray(($47|0));
|
|
} else {
|
|
$40 = HEAP32[7830]|0;
|
|
$41 = HEAP32[(32580)>>2]|0;
|
|
FUNCTION_TABLE_vi[$40 & 31]($41);
|
|
}
|
|
$48 = HEAP32[8138]|0;
|
|
_glDrawArrays(4,0,($48|0));
|
|
$49 = HEAP32[7828]|0;
|
|
$50 = ($49|0)==(0);
|
|
if ($50) {
|
|
_glBindBuffer(34962,0);
|
|
}
|
|
_glBindTexture(3553,0);
|
|
}
|
|
$51 = HEAP32[8150]|0;
|
|
$52 = ($51|0)>(0);
|
|
if ($52) {
|
|
$53 = HEAP32[7828]|0;
|
|
$54 = ($53|0)==(0);
|
|
if ($54) {
|
|
$57 = HEAP32[(32632)>>2]|0;
|
|
_glBindBuffer(34962,($57|0));
|
|
$58 = HEAP32[(31404)>>2]|0;
|
|
_glVertexAttribPointer(($58|0),3,5126,0,0,(0|0));
|
|
$59 = HEAP32[(31404)>>2]|0;
|
|
_glEnableVertexAttribArray(($59|0));
|
|
$60 = HEAP32[(32636)>>2]|0;
|
|
_glBindBuffer(34962,($60|0));
|
|
$61 = HEAP32[(31408)>>2]|0;
|
|
_glVertexAttribPointer(($61|0),2,5126,0,0,(0|0));
|
|
$62 = HEAP32[(31408)>>2]|0;
|
|
_glEnableVertexAttribArray(($62|0));
|
|
$63 = HEAP32[(32640)>>2]|0;
|
|
_glBindBuffer(34962,($63|0));
|
|
$64 = HEAP32[(31424)>>2]|0;
|
|
_glVertexAttribPointer(($64|0),4,5121,1,0,(0|0));
|
|
$65 = HEAP32[(31424)>>2]|0;
|
|
_glEnableVertexAttribArray(($65|0));
|
|
$66 = HEAP32[(32644)>>2]|0;
|
|
_glBindBuffer(34963,($66|0));
|
|
} else {
|
|
$55 = HEAP32[7830]|0;
|
|
$56 = HEAP32[(32628)>>2]|0;
|
|
FUNCTION_TABLE_vi[$55 & 31]($56);
|
|
}
|
|
$67 = HEAP32[7866]|0;
|
|
$68 = ($67|0)>(0);
|
|
if ($68) {
|
|
$$02830 = 0;$$031 = 0;
|
|
while(1) {
|
|
$71 = HEAP32[7865]|0;
|
|
$72 = (($71) + (($$031*144)|0)|0);
|
|
$73 = HEAP32[$72>>2]|0;
|
|
$74 = (($73|0) / 4)&-1;
|
|
$75 = ($74*6)|0;
|
|
$76 = (((($71) + (($$031*144)|0)|0)) + 8|0);
|
|
$77 = HEAP32[$76>>2]|0;
|
|
_glBindTexture(3553,($77|0));
|
|
$78 = $$02830 << 1;
|
|
$79 = $78;
|
|
_glDrawElements(4,($75|0),5123,($79|0));
|
|
$80 = HEAP32[7865]|0;
|
|
$81 = (($80) + (($$031*144)|0)|0);
|
|
$82 = HEAP32[$81>>2]|0;
|
|
$83 = (($82|0) / 4)&-1;
|
|
$84 = ($83*6)|0;
|
|
$85 = (($84) + ($$02830))|0;
|
|
$86 = (($$031) + 1)|0;
|
|
$87 = HEAP32[7866]|0;
|
|
$88 = ($86|0)<($87|0);
|
|
if ($88) {
|
|
$$02830 = $85;$$031 = $86;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
$69 = HEAP32[7828]|0;
|
|
$70 = ($69|0)==(0);
|
|
if ($70) {
|
|
_glBindBuffer(34962,0);
|
|
_glBindBuffer(34963,0);
|
|
}
|
|
_glBindTexture(3553,0);
|
|
}
|
|
$89 = HEAP32[7828]|0;
|
|
$90 = ($89|0)==(0);
|
|
if (!($90)) {
|
|
$91 = HEAP32[7830]|0;
|
|
FUNCTION_TABLE_vi[$91 & 31](0);
|
|
}
|
|
_glUseProgram(0);
|
|
$92 = (($$02932) + 1)|0;
|
|
$93 = ($92|0)<($$|0);
|
|
if ($93) {
|
|
$$02932 = $92;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
HEAP32[7866] = 1;
|
|
$5 = HEAP32[7835]|0;
|
|
$6 = HEAP32[7865]|0;
|
|
$7 = ((($6)) + 8|0);
|
|
HEAP32[$7>>2] = $5;
|
|
HEAP32[$6>>2] = 0;
|
|
HEAP32[8126] = 0;
|
|
HEAP32[(32512)>>2] = 0;
|
|
HEAP32[8138] = 0;
|
|
HEAP32[(32560)>>2] = 0;
|
|
HEAP32[8150] = 0;
|
|
HEAP32[(32604)>>2] = 0;
|
|
HEAP32[(32608)>>2] = 0;
|
|
HEAPF32[746] = -1.0;
|
|
dest=31180; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
dest=31244; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _SetStereoView($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $$byval_copy = 0, $$byval_copy3 = 0, $10 = 0, $11 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 256|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(256|0);
|
|
$$byval_copy3 = sp + 192|0;
|
|
$$byval_copy = sp + 64|0;
|
|
$3 = sp;
|
|
$4 = sp + 128|0;
|
|
dest=$3; src=$1; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
$5 = HEAP32[8124]|0;
|
|
$6 = Math_imul($5, $0)|0;
|
|
$7 = (($6|0) / 2)&-1;
|
|
$8 = (($5|0) / 2)&-1;
|
|
$9 = HEAP32[8125]|0;
|
|
_rlViewport($7,0,$8,$9);
|
|
$10 = (33084 + ($0<<6)|0);
|
|
dest=$$byval_copy; src=$2; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
dest=$$byval_copy3; src=$10; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_MatrixMultiply($4,$$byval_copy,$$byval_copy3);
|
|
$11 = (32956 + ($0<<6)|0);
|
|
dest=$3; src=$11; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
dest=$$byval_copy3; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_SetMatrixModelview($$byval_copy3);
|
|
dest=$$byval_copy3; src=$3; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_SetMatrixProjection($$byval_copy3);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _SetMatrixModelview($0) {
|
|
$0 = $0|0;
|
|
var dest = 0, label = 0, sp = 0, src = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
dest=31244; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
return;
|
|
}
|
|
function _SetMatrixProjection($0) {
|
|
$0 = $0|0;
|
|
var dest = 0, label = 0, sp = 0, src = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
dest=31180; src=$0; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
return;
|
|
}
|
|
function _rlPushMatrix() {
|
|
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $vararg_buffer = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
|
|
$vararg_buffer = sp;
|
|
$0 = HEAP32[8303]|0;
|
|
$1 = ($0|0)==(15);
|
|
if ($1) {
|
|
HEAP32[$vararg_buffer>>2] = 16;
|
|
_TraceLog(1,8087,$vararg_buffer);
|
|
}
|
|
$2 = HEAP32[8303]|0;
|
|
$3 = (31472 + ($2<<6)|0);
|
|
$4 = HEAP32[7794]|0;
|
|
dest=$3; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_rlLoadIdentity();
|
|
$5 = HEAP32[8303]|0;
|
|
$6 = (($5) + 1)|0;
|
|
HEAP32[8303] = $6;
|
|
$7 = HEAP32[7827]|0;
|
|
$8 = ($7|0)==(5888);
|
|
if (!($8)) {
|
|
STACKTOP = sp;return;
|
|
}
|
|
HEAP32[8304] = 1;
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _rlPopMatrix() {
|
|
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$0 = HEAP32[8303]|0;
|
|
$1 = ($0|0)>(0);
|
|
if (!($1)) {
|
|
return;
|
|
}
|
|
$2 = HEAP32[8303]|0;
|
|
$3 = (($2) + -1)|0;
|
|
$4 = (31472 + ($3<<6)|0);
|
|
$5 = HEAP32[7794]|0;
|
|
_memmove(($5|0),($4|0),64)|0;
|
|
$6 = (($2) + -1)|0;
|
|
HEAP32[8303] = $6;
|
|
return;
|
|
}
|
|
function _GetRandomValue($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$ = 0, $$10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $ispos = 0, $neg = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = ($0|0)>($1|0);
|
|
$$ = $2 ? $0 : $1;
|
|
$$10 = $2 ? $1 : $0;
|
|
$3 = (_rand()|0);
|
|
$4 = (($$) - ($$10))|0;
|
|
$ispos = ($4|0)>(-1);
|
|
$neg = (0 - ($4))|0;
|
|
$5 = $ispos ? $4 : $neg;
|
|
$6 = (($5) + 1)|0;
|
|
$7 = (($3|0) % ($6|0))&-1;
|
|
$8 = (($7) + ($$10))|0;
|
|
return ($8|0);
|
|
}
|
|
function _SetConfigFlags($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
HEAP8[35952] = $0;
|
|
$1 = $0 & 1;
|
|
$2 = ($1<<24>>24)==(0);
|
|
if (!($2)) {
|
|
HEAP32[7752] = 1;
|
|
}
|
|
$3 = HEAP8[35952]|0;
|
|
$4 = $3 & 2;
|
|
$5 = ($4<<24>>24)==(0);
|
|
if ($5) {
|
|
return;
|
|
}
|
|
HEAP32[7789] = 1;
|
|
return;
|
|
}
|
|
function _IsKeyPressed($0) {
|
|
$0 = $0|0;
|
|
var $$0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $or$cond = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = (35959 + ($0)|0);
|
|
$2 = HEAP8[$1>>0]|0;
|
|
$3 = (36471 + ($0)|0);
|
|
$4 = HEAP8[$3>>0]|0;
|
|
$5 = ($2<<24>>24)!=($4<<24>>24);
|
|
$6 = ($2<<24>>24)==(1);
|
|
$or$cond = $6 & $5;
|
|
$$0 = $or$cond&1;
|
|
return ($$0|0);
|
|
}
|
|
function _rlTranslatef($0,$1,$2) {
|
|
$0 = +$0;
|
|
$1 = +$1;
|
|
$2 = +$2;
|
|
var $$byval_copy = 0, $$byval_copy1 = 0, $3 = 0, $4 = 0, $5 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 256|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(256|0);
|
|
$$byval_copy1 = sp + 192|0;
|
|
$$byval_copy = sp + 128|0;
|
|
$3 = sp + 64|0;
|
|
$4 = sp;
|
|
_MatrixTranslate($3,$0,$1,$2);
|
|
_MatrixTranspose($3);
|
|
$5 = HEAP32[7794]|0;
|
|
dest=$$byval_copy; src=$5; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
dest=$$byval_copy1; src=$3; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_MatrixMultiply($4,$$byval_copy,$$byval_copy1);
|
|
dest=$5; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _rlRotatef($0,$1,$2,$3) {
|
|
$0 = +$0;
|
|
$1 = +$1;
|
|
$2 = +$2;
|
|
$3 = +$3;
|
|
var $$byval_copy1 = 0, $$byval_copy2 = 0, $10 = 0.0, $11 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 336|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(336|0);
|
|
$$byval_copy2 = sp + 272|0;
|
|
$$byval_copy1 = sp + 208|0;
|
|
$4 = sp + 144|0;
|
|
$5 = sp + 64|0;
|
|
$6 = sp + 80|0;
|
|
$7 = sp;
|
|
_MatrixIdentity($4);
|
|
HEAPF32[$5>>2] = $1;
|
|
$8 = ((($5)) + 4|0);
|
|
HEAPF32[$8>>2] = $2;
|
|
$9 = ((($5)) + 8|0);
|
|
HEAPF32[$9>>2] = $3;
|
|
_VectorNormalize($5);
|
|
$10 = $0 * 0.01745329238474369;
|
|
;HEAP32[$$byval_copy2>>2]=HEAP32[$5>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$5+4>>2]|0;HEAP32[$$byval_copy2+8>>2]=HEAP32[$5+8>>2]|0;
|
|
_MatrixRotate($6,$$byval_copy2,$10);
|
|
dest=$4; src=$6; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_MatrixTranspose($4);
|
|
$11 = HEAP32[7794]|0;
|
|
dest=$$byval_copy1; src=$11; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
dest=$$byval_copy2; src=$4; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_MatrixMultiply($7,$$byval_copy1,$$byval_copy2);
|
|
dest=$11; src=$7; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _rlBegin($0) {
|
|
$0 = $0|0;
|
|
var label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
HEAP32[7867] = $0;
|
|
return;
|
|
}
|
|
function _rlEnd() {
|
|
var $$03956 = 0, $$04052 = 0, $$04154 = 0, $$04248 = 0, $$04347 = 0, $$byval_copy = 0, $$promoted = 0, $0 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0;
|
|
var $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0;
|
|
var $128 = 0, $129 = 0, $13 = 0.0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0;
|
|
var $146 = 0, $147 = 0, $148 = 0.0, $149 = 0.0, $15 = 0.0, $16 = 0, $17 = 0.0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0;
|
|
var $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0;
|
|
var $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0;
|
|
var $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0;
|
|
var $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $exitcond = 0, $exitcond60 = 0, $exitcond63 = 0;
|
|
var $scevgep = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
|
|
$$byval_copy = sp;
|
|
$0 = HEAP32[8304]|0;
|
|
$1 = ($0|0)==(0);
|
|
if (!($1)) {
|
|
$2 = HEAP32[8305]|0;
|
|
$3 = ($2|0)>(0);
|
|
if ($3) {
|
|
$$03956 = 0;
|
|
while(1) {
|
|
$6 = HEAP32[7864]|0;
|
|
$7 = (($6) + (($$03956*12)|0)|0);
|
|
$8 = HEAP32[7794]|0;
|
|
dest=$$byval_copy; src=$8; stop=dest+64|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
_VectorTransform($7,$$byval_copy);
|
|
$9 = (($$03956) + 1)|0;
|
|
$5 = HEAP32[8305]|0;
|
|
$10 = ($9|0)<($5|0);
|
|
if ($10) {
|
|
$$03956 = $9;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
HEAP32[8304] = 0;
|
|
$4 = ($5|0)>(0);
|
|
if ($4) {
|
|
$$04154 = 0;
|
|
while(1) {
|
|
$11 = HEAP32[7864]|0;
|
|
$12 = (($11) + (($$04154*12)|0)|0);
|
|
$13 = +HEAPF32[$12>>2];
|
|
$14 = (((($11) + (($$04154*12)|0)|0)) + 4|0);
|
|
$15 = +HEAPF32[$14>>2];
|
|
$16 = (((($11) + (($$04154*12)|0)|0)) + 8|0);
|
|
$17 = +HEAPF32[$16>>2];
|
|
_rlVertex3f($13,$15,$17);
|
|
$18 = (($$04154) + 1)|0;
|
|
$19 = HEAP32[8305]|0;
|
|
$20 = ($18|0)<($19|0);
|
|
if ($20) {
|
|
$$04154 = $18;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
} else {
|
|
HEAP32[8304] = 0;
|
|
}
|
|
HEAP32[8305] = 0;
|
|
}
|
|
$21 = HEAP32[7867]|0;
|
|
switch ($21|0) {
|
|
case 1: {
|
|
$22 = HEAP32[8126]|0;
|
|
$23 = HEAP32[(32512)>>2]|0;
|
|
$24 = ($22|0)==($23|0);
|
|
if ($24) {
|
|
$148 = +HEAPF32[746];
|
|
$149 = $148 + 4.9999998736893758E-5;
|
|
HEAPF32[746] = $149;
|
|
STACKTOP = sp;return;
|
|
}
|
|
$25 = (($22) - ($23))|0;
|
|
$26 = ($25|0)>(0);
|
|
if ($26) {
|
|
$$04347 = 0;
|
|
} else {
|
|
$148 = +HEAPF32[746];
|
|
$149 = $148 + 4.9999998736893758E-5;
|
|
HEAPF32[746] = $149;
|
|
STACKTOP = sp;return;
|
|
}
|
|
while(1) {
|
|
$27 = HEAP32[(32524)>>2]|0;
|
|
$28 = HEAP32[(32512)>>2]|0;
|
|
$29 = $28 << 2;
|
|
$30 = (($29) + -4)|0;
|
|
$31 = (($27) + ($30)|0);
|
|
$32 = HEAP8[$31>>0]|0;
|
|
$33 = (($27) + ($29)|0);
|
|
HEAP8[$33>>0] = $32;
|
|
$34 = HEAP32[(32524)>>2]|0;
|
|
$35 = HEAP32[(32512)>>2]|0;
|
|
$36 = $35 << 2;
|
|
$37 = (($36) + -3)|0;
|
|
$38 = (($34) + ($37)|0);
|
|
$39 = HEAP8[$38>>0]|0;
|
|
$40 = $36 | 1;
|
|
$41 = (($34) + ($40)|0);
|
|
HEAP8[$41>>0] = $39;
|
|
$42 = HEAP32[(32524)>>2]|0;
|
|
$43 = HEAP32[(32512)>>2]|0;
|
|
$44 = $43 << 2;
|
|
$45 = (($44) + -2)|0;
|
|
$46 = (($42) + ($45)|0);
|
|
$47 = HEAP8[$46>>0]|0;
|
|
$48 = $44 | 2;
|
|
$49 = (($42) + ($48)|0);
|
|
HEAP8[$49>>0] = $47;
|
|
$50 = HEAP32[(32524)>>2]|0;
|
|
$51 = HEAP32[(32512)>>2]|0;
|
|
$52 = $51 << 2;
|
|
$53 = (($52) + -1)|0;
|
|
$54 = (($50) + ($53)|0);
|
|
$55 = HEAP8[$54>>0]|0;
|
|
$56 = $52 | 3;
|
|
$57 = (($50) + ($56)|0);
|
|
HEAP8[$57>>0] = $55;
|
|
$58 = HEAP32[(32512)>>2]|0;
|
|
$59 = (($58) + 1)|0;
|
|
HEAP32[(32512)>>2] = $59;
|
|
$60 = (($$04347) + 1)|0;
|
|
$exitcond = ($60|0)==($25|0);
|
|
if ($exitcond) {
|
|
break;
|
|
} else {
|
|
$$04347 = $60;
|
|
}
|
|
}
|
|
$148 = +HEAPF32[746];
|
|
$149 = $148 + 4.9999998736893758E-5;
|
|
HEAPF32[746] = $149;
|
|
STACKTOP = sp;return;
|
|
break;
|
|
}
|
|
case 4: {
|
|
$61 = HEAP32[8138]|0;
|
|
$62 = HEAP32[(32560)>>2]|0;
|
|
$63 = ($61|0)==($62|0);
|
|
if ($63) {
|
|
$148 = +HEAPF32[746];
|
|
$149 = $148 + 4.9999998736893758E-5;
|
|
HEAPF32[746] = $149;
|
|
STACKTOP = sp;return;
|
|
}
|
|
$64 = (($61) - ($62))|0;
|
|
$65 = ($64|0)>(0);
|
|
if ($65) {
|
|
$$04248 = 0;
|
|
} else {
|
|
$148 = +HEAPF32[746];
|
|
$149 = $148 + 4.9999998736893758E-5;
|
|
HEAPF32[746] = $149;
|
|
STACKTOP = sp;return;
|
|
}
|
|
while(1) {
|
|
$66 = HEAP32[(32572)>>2]|0;
|
|
$67 = HEAP32[(32560)>>2]|0;
|
|
$68 = $67 << 2;
|
|
$69 = (($68) + -4)|0;
|
|
$70 = (($66) + ($69)|0);
|
|
$71 = HEAP8[$70>>0]|0;
|
|
$72 = (($66) + ($68)|0);
|
|
HEAP8[$72>>0] = $71;
|
|
$73 = HEAP32[(32572)>>2]|0;
|
|
$74 = HEAP32[(32560)>>2]|0;
|
|
$75 = $74 << 2;
|
|
$76 = (($75) + -3)|0;
|
|
$77 = (($73) + ($76)|0);
|
|
$78 = HEAP8[$77>>0]|0;
|
|
$79 = $75 | 1;
|
|
$80 = (($73) + ($79)|0);
|
|
HEAP8[$80>>0] = $78;
|
|
$81 = HEAP32[(32572)>>2]|0;
|
|
$82 = HEAP32[(32560)>>2]|0;
|
|
$83 = $82 << 2;
|
|
$84 = (($83) + -2)|0;
|
|
$85 = (($81) + ($84)|0);
|
|
$86 = HEAP8[$85>>0]|0;
|
|
$87 = $83 | 2;
|
|
$88 = (($81) + ($87)|0);
|
|
HEAP8[$88>>0] = $86;
|
|
$89 = HEAP32[(32572)>>2]|0;
|
|
$90 = HEAP32[(32560)>>2]|0;
|
|
$91 = $90 << 2;
|
|
$92 = (($91) + -1)|0;
|
|
$93 = (($89) + ($92)|0);
|
|
$94 = HEAP8[$93>>0]|0;
|
|
$95 = $91 | 3;
|
|
$96 = (($89) + ($95)|0);
|
|
HEAP8[$96>>0] = $94;
|
|
$97 = HEAP32[(32560)>>2]|0;
|
|
$98 = (($97) + 1)|0;
|
|
HEAP32[(32560)>>2] = $98;
|
|
$99 = (($$04248) + 1)|0;
|
|
$exitcond60 = ($99|0)==($64|0);
|
|
if ($exitcond60) {
|
|
break;
|
|
} else {
|
|
$$04248 = $99;
|
|
}
|
|
}
|
|
$148 = +HEAPF32[746];
|
|
$149 = $148 + 4.9999998736893758E-5;
|
|
HEAPF32[746] = $149;
|
|
STACKTOP = sp;return;
|
|
break;
|
|
}
|
|
case 7: {
|
|
$100 = HEAP32[8150]|0;
|
|
$101 = HEAP32[(32608)>>2]|0;
|
|
$102 = ($100|0)==($101|0);
|
|
if (!($102)) {
|
|
$103 = (($100) - ($101))|0;
|
|
$104 = ($103|0)>(0);
|
|
if ($104) {
|
|
$$04052 = 0;
|
|
while(1) {
|
|
$105 = HEAP32[(32620)>>2]|0;
|
|
$106 = HEAP32[(32608)>>2]|0;
|
|
$107 = $106 << 2;
|
|
$108 = (($107) + -4)|0;
|
|
$109 = (($105) + ($108)|0);
|
|
$110 = HEAP8[$109>>0]|0;
|
|
$111 = (($105) + ($107)|0);
|
|
HEAP8[$111>>0] = $110;
|
|
$112 = HEAP32[(32620)>>2]|0;
|
|
$113 = HEAP32[(32608)>>2]|0;
|
|
$114 = $113 << 2;
|
|
$115 = (($114) + -3)|0;
|
|
$116 = (($112) + ($115)|0);
|
|
$117 = HEAP8[$116>>0]|0;
|
|
$118 = $114 | 1;
|
|
$119 = (($112) + ($118)|0);
|
|
HEAP8[$119>>0] = $117;
|
|
$120 = HEAP32[(32620)>>2]|0;
|
|
$121 = HEAP32[(32608)>>2]|0;
|
|
$122 = $121 << 2;
|
|
$123 = (($122) + -2)|0;
|
|
$124 = (($120) + ($123)|0);
|
|
$125 = HEAP8[$124>>0]|0;
|
|
$126 = $122 | 2;
|
|
$127 = (($120) + ($126)|0);
|
|
HEAP8[$127>>0] = $125;
|
|
$128 = HEAP32[(32620)>>2]|0;
|
|
$129 = HEAP32[(32608)>>2]|0;
|
|
$130 = $129 << 2;
|
|
$131 = (($130) + -1)|0;
|
|
$132 = (($128) + ($131)|0);
|
|
$133 = HEAP8[$132>>0]|0;
|
|
$134 = $130 | 3;
|
|
$135 = (($128) + ($134)|0);
|
|
HEAP8[$135>>0] = $133;
|
|
$136 = HEAP32[(32608)>>2]|0;
|
|
$137 = (($136) + 1)|0;
|
|
HEAP32[(32608)>>2] = $137;
|
|
$138 = (($$04052) + 1)|0;
|
|
$exitcond63 = ($138|0)==($103|0);
|
|
if ($exitcond63) {
|
|
break;
|
|
} else {
|
|
$$04052 = $138;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
$139 = HEAP32[8150]|0;
|
|
$140 = HEAP32[(32604)>>2]|0;
|
|
$141 = ($139|0)>($140|0);
|
|
if (!($141)) {
|
|
$148 = +HEAPF32[746];
|
|
$149 = $148 + 4.9999998736893758E-5;
|
|
HEAPF32[746] = $149;
|
|
STACKTOP = sp;return;
|
|
}
|
|
$142 = HEAP32[(32616)>>2]|0;
|
|
$$promoted = HEAP32[(32604)>>2]|0;
|
|
$143 = $$promoted << 1;
|
|
$scevgep = (($142) + ($143<<2)|0);
|
|
$144 = (($139) - ($140))|0;
|
|
$145 = $144 << 3;
|
|
_memset(($scevgep|0),0,($145|0))|0;
|
|
$146 = (($139) + ($$promoted))|0;
|
|
$147 = (($146) - ($140))|0;
|
|
HEAP32[(32604)>>2] = $147;
|
|
$148 = +HEAPF32[746];
|
|
$149 = $148 + 4.9999998736893758E-5;
|
|
HEAPF32[746] = $149;
|
|
STACKTOP = sp;return;
|
|
break;
|
|
}
|
|
default: {
|
|
$148 = +HEAPF32[746];
|
|
$149 = $148 + 4.9999998736893758E-5;
|
|
HEAPF32[746] = $149;
|
|
STACKTOP = sp;return;
|
|
}
|
|
}
|
|
}
|
|
function _rlVertex3f($0,$1,$2) {
|
|
$0 = +$0;
|
|
$1 = +$1;
|
|
$2 = +$2;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0;
|
|
var $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0;
|
|
var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer1 = 0, $vararg_buffer3 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
|
|
$vararg_buffer3 = sp + 16|0;
|
|
$vararg_buffer1 = sp + 8|0;
|
|
$vararg_buffer = sp;
|
|
$3 = HEAP32[8304]|0;
|
|
$4 = ($3|0)==(0);
|
|
if (!($4)) {
|
|
$5 = HEAP32[7864]|0;
|
|
$6 = HEAP32[8305]|0;
|
|
$7 = (($5) + (($6*12)|0)|0);
|
|
HEAPF32[$7>>2] = $0;
|
|
$8 = (((($5) + (($6*12)|0)|0)) + 4|0);
|
|
HEAPF32[$8>>2] = $1;
|
|
$9 = (((($5) + (($6*12)|0)|0)) + 8|0);
|
|
HEAPF32[$9>>2] = $2;
|
|
$10 = (($6) + 1)|0;
|
|
HEAP32[8305] = $10;
|
|
STACKTOP = sp;return;
|
|
}
|
|
$11 = HEAP32[7867]|0;
|
|
switch ($11|0) {
|
|
case 1: {
|
|
$12 = HEAP32[8126]|0;
|
|
$13 = ($12|0)<(2048);
|
|
if ($13) {
|
|
$14 = HEAP32[(32516)>>2]|0;
|
|
$15 = ($12*3)|0;
|
|
$16 = (($14) + ($15<<2)|0);
|
|
HEAPF32[$16>>2] = $0;
|
|
$17 = (($15) + 1)|0;
|
|
$18 = (($14) + ($17<<2)|0);
|
|
HEAPF32[$18>>2] = $1;
|
|
$19 = (($15) + 2)|0;
|
|
$20 = (($14) + ($19<<2)|0);
|
|
HEAPF32[$20>>2] = $2;
|
|
$21 = (($12) + 1)|0;
|
|
HEAP32[8126] = $21;
|
|
STACKTOP = sp;return;
|
|
} else {
|
|
_TraceLog(1,8125,$vararg_buffer);
|
|
STACKTOP = sp;return;
|
|
}
|
|
break;
|
|
}
|
|
case 4: {
|
|
$22 = HEAP32[8138]|0;
|
|
$23 = ($22|0)<(6144);
|
|
if ($23) {
|
|
$24 = HEAP32[(32564)>>2]|0;
|
|
$25 = ($22*3)|0;
|
|
$26 = (($24) + ($25<<2)|0);
|
|
HEAPF32[$26>>2] = $0;
|
|
$27 = (($25) + 1)|0;
|
|
$28 = (($24) + ($27<<2)|0);
|
|
HEAPF32[$28>>2] = $1;
|
|
$29 = (($25) + 2)|0;
|
|
$30 = (($24) + ($29<<2)|0);
|
|
HEAPF32[$30>>2] = $2;
|
|
$31 = (($22) + 1)|0;
|
|
HEAP32[8138] = $31;
|
|
STACKTOP = sp;return;
|
|
} else {
|
|
_TraceLog(1,8150,$vararg_buffer1);
|
|
STACKTOP = sp;return;
|
|
}
|
|
break;
|
|
}
|
|
case 7: {
|
|
$32 = HEAP32[8150]|0;
|
|
$33 = ($32|0)<(4096);
|
|
if ($33) {
|
|
$34 = HEAP32[(32612)>>2]|0;
|
|
$35 = ($32*3)|0;
|
|
$36 = (($34) + ($35<<2)|0);
|
|
HEAPF32[$36>>2] = $0;
|
|
$37 = (($35) + 1)|0;
|
|
$38 = (($34) + ($37<<2)|0);
|
|
HEAPF32[$38>>2] = $1;
|
|
$39 = (($35) + 2)|0;
|
|
$40 = (($34) + ($39<<2)|0);
|
|
HEAPF32[$40>>2] = $2;
|
|
$41 = (($32) + 1)|0;
|
|
HEAP32[8150] = $41;
|
|
$42 = HEAP32[7865]|0;
|
|
$43 = HEAP32[7866]|0;
|
|
$44 = (($43) + -1)|0;
|
|
$45 = (($42) + (($44*144)|0)|0);
|
|
$46 = HEAP32[$45>>2]|0;
|
|
$47 = (($46) + 1)|0;
|
|
HEAP32[$45>>2] = $47;
|
|
STACKTOP = sp;return;
|
|
} else {
|
|
_TraceLog(1,8179,$vararg_buffer3);
|
|
STACKTOP = sp;return;
|
|
}
|
|
break;
|
|
}
|
|
default: {
|
|
STACKTOP = sp;return;
|
|
}
|
|
}
|
|
}
|
|
function _rlVertex2f($0,$1) {
|
|
$0 = +$0;
|
|
$1 = +$1;
|
|
var $2 = 0.0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = +HEAPF32[746];
|
|
_rlVertex3f($0,$1,$2);
|
|
return;
|
|
}
|
|
function _rlTexCoord2f($0,$1) {
|
|
$0 = +$0;
|
|
$1 = +$1;
|
|
var $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = HEAP32[7867]|0;
|
|
$3 = ($2|0)==(7);
|
|
if (!($3)) {
|
|
return;
|
|
}
|
|
$4 = HEAP32[(32616)>>2]|0;
|
|
$5 = HEAP32[(32604)>>2]|0;
|
|
$6 = $5 << 1;
|
|
$7 = (($4) + ($6<<2)|0);
|
|
HEAPF32[$7>>2] = $0;
|
|
$8 = $6 | 1;
|
|
$9 = (($4) + ($8<<2)|0);
|
|
HEAPF32[$9>>2] = $1;
|
|
$10 = (($5) + 1)|0;
|
|
HEAP32[(32604)>>2] = $10;
|
|
return;
|
|
}
|
|
function _rlNormal3f($0,$1,$2) {
|
|
$0 = +$0;
|
|
$1 = +$1;
|
|
$2 = +$2;
|
|
var label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
return;
|
|
}
|
|
function _rlColor4ub($0,$1,$2,$3) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
var $$sink37 = 0, $$sink38 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $4 = 0, $5 = 0;
|
|
var $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$4 = HEAP32[7867]|0;
|
|
switch ($4|0) {
|
|
case 1: {
|
|
$$sink37 = (32512);$$sink38 = (32524);
|
|
break;
|
|
}
|
|
case 4: {
|
|
$$sink37 = (32560);$$sink38 = (32572);
|
|
break;
|
|
}
|
|
case 7: {
|
|
$$sink37 = (32608);$$sink38 = (32620);
|
|
break;
|
|
}
|
|
default: {
|
|
return;
|
|
}
|
|
}
|
|
$5 = HEAP32[$$sink38>>2]|0;
|
|
$6 = HEAP32[$$sink37>>2]|0;
|
|
$7 = $6 << 2;
|
|
$8 = (($5) + ($7)|0);
|
|
HEAP8[$8>>0] = $0;
|
|
$9 = HEAP32[$$sink38>>2]|0;
|
|
$10 = HEAP32[$$sink37>>2]|0;
|
|
$11 = $10 << 2;
|
|
$12 = $11 | 1;
|
|
$13 = (($9) + ($12)|0);
|
|
HEAP8[$13>>0] = $1;
|
|
$14 = HEAP32[$$sink38>>2]|0;
|
|
$15 = HEAP32[$$sink37>>2]|0;
|
|
$16 = $15 << 2;
|
|
$17 = $16 | 2;
|
|
$18 = (($14) + ($17)|0);
|
|
HEAP8[$18>>0] = $2;
|
|
$19 = HEAP32[$$sink38>>2]|0;
|
|
$20 = HEAP32[$$sink37>>2]|0;
|
|
$21 = $20 << 2;
|
|
$22 = $21 | 3;
|
|
$23 = (($19) + ($22)|0);
|
|
HEAP8[$23>>0] = $3;
|
|
$24 = HEAP32[$$sink37>>2]|0;
|
|
$25 = (($24) + 1)|0;
|
|
HEAP32[$$sink37>>2] = $25;
|
|
return;
|
|
}
|
|
function _rlEnableTexture($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = HEAP32[7865]|0;
|
|
$2 = HEAP32[7866]|0;
|
|
$3 = (($2) + -1)|0;
|
|
$4 = (((($1) + (($3*144)|0)|0)) + 8|0);
|
|
$5 = HEAP32[$4>>2]|0;
|
|
$6 = ($5|0)==($0|0);
|
|
if ($6) {
|
|
return;
|
|
}
|
|
$7 = (($1) + (($3*144)|0)|0);
|
|
$8 = HEAP32[$7>>2]|0;
|
|
$9 = ($8|0)>(0);
|
|
if ($9) {
|
|
$10 = (($2) + 1)|0;
|
|
HEAP32[7866] = $10;
|
|
}
|
|
$11 = HEAP32[7866]|0;
|
|
$12 = (($11) + -1)|0;
|
|
$13 = (((($1) + (($12*144)|0)|0)) + 8|0);
|
|
HEAP32[$13>>2] = $0;
|
|
$14 = (($1) + (($12*144)|0)|0);
|
|
HEAP32[$14>>2] = 0;
|
|
return;
|
|
}
|
|
function _rlDisableTexture() {
|
|
var $0 = 0, $1 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$0 = HEAP32[8150]|0;
|
|
$1 = ($0|0)>(4095);
|
|
if (!($1)) {
|
|
return;
|
|
}
|
|
_rlglDraw();
|
|
return;
|
|
}
|
|
function _DrawLineV($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0.0, $11 = 0, $12 = 0.0, $13 = 0.0, $14 = 0, $15 = 0.0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
_rlBegin(1);
|
|
$3 = HEAP8[$2>>0]|0;
|
|
$4 = ((($2)) + 1|0);
|
|
$5 = HEAP8[$4>>0]|0;
|
|
$6 = ((($2)) + 2|0);
|
|
$7 = HEAP8[$6>>0]|0;
|
|
$8 = ((($2)) + 3|0);
|
|
$9 = HEAP8[$8>>0]|0;
|
|
_rlColor4ub($3,$5,$7,$9);
|
|
$10 = +HEAPF32[$0>>2];
|
|
$11 = ((($0)) + 4|0);
|
|
$12 = +HEAPF32[$11>>2];
|
|
_rlVertex2f($10,$12);
|
|
$13 = +HEAPF32[$1>>2];
|
|
$14 = ((($1)) + 4|0);
|
|
$15 = +HEAPF32[$14>>2];
|
|
_rlVertex2f($13,$15);
|
|
_rlEnd();
|
|
return;
|
|
}
|
|
function _GetDefaultFont($0) {
|
|
$0 = $0|0;
|
|
var label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
;HEAP32[$0>>2]=HEAP32[31028>>2]|0;HEAP32[$0+4>>2]=HEAP32[31028+4>>2]|0;HEAP32[$0+8>>2]=HEAP32[31028+8>>2]|0;HEAP32[$0+12>>2]=HEAP32[31028+12>>2]|0;HEAP32[$0+16>>2]=HEAP32[31028+16>>2]|0;HEAP32[$0+20>>2]=HEAP32[31028+20>>2]|0;HEAP32[$0+24>>2]=HEAP32[31028+24>>2]|0;HEAP32[$0+28>>2]=HEAP32[31028+28>>2]|0;
|
|
return;
|
|
}
|
|
function _MeasureTextEx($0,$1,$2,$3,$4) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = +$3;
|
|
$4 = $4|0;
|
|
var $$0$lcssa = 0, $$05064 = 0, $$052$lcssa = 0.0, $$05263 = 0.0, $$05462 = 0, $$055$lcssa = 0.0, $$05561 = 0.0, $$058$lcssa = 0.0, $$05860 = 0.0, $$065 = 0, $$151 = 0, $$151$$0 = 0, $$153 = 0.0, $$156 = 0.0, $$159 = 0.0, $$2 = 0.0, $$257 = 0.0, $$3 = 0.0, $$byval_copy = 0, $$pn = 0.0;
|
|
var $$pn$in = 0, $$sroa$4$0$$sroa_idx2 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0.0, $14 = 0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
|
|
var $28 = 0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0.0, $36 = 0.0, $37 = 0.0, $38 = 0, $39 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0.0, $9 = 0.0, $exitcond = 0, $phitmp = 0, label = 0;
|
|
var sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
|
|
$$byval_copy = sp;
|
|
$5 = (_strlen($2)|0);
|
|
$6 = ((($1)) + 20|0);
|
|
$7 = HEAP32[$6>>2]|0;
|
|
$8 = (+($7|0));
|
|
$9 = $3 / $8;
|
|
$10 = ($5|0)>(0);
|
|
if (!($10)) {
|
|
$$0$lcssa = -1;$$052$lcssa = 0.0;$$055$lcssa = 0.0;$$058$lcssa = $8;
|
|
$12 = $$055$lcssa < $$052$lcssa;
|
|
$$3 = $12 ? $$052$lcssa : $$055$lcssa;
|
|
$13 = $9 * $$3;
|
|
$14 = Math_imul($$0$lcssa, $4)|0;
|
|
$15 = (+($14|0));
|
|
$16 = $13 + $15;
|
|
$17 = $9 * $$058$lcssa;
|
|
HEAPF32[$0>>2] = $16;
|
|
$$sroa$4$0$$sroa_idx2 = ((($0)) + 4|0);
|
|
HEAPF32[$$sroa$4$0$$sroa_idx2>>2] = $17;
|
|
STACKTOP = sp;return;
|
|
}
|
|
$11 = ((($1)) + 28|0);
|
|
$$05064 = 0;$$05263 = 0.0;$$05462 = 0;$$05561 = 0.0;$$05860 = $8;$$065 = 0;
|
|
while(1) {
|
|
$18 = (($$05064) + 1)|0;
|
|
$19 = (($2) + ($$05462)|0);
|
|
$20 = HEAP8[$19>>0]|0;
|
|
$21 = ($20<<24>>24)==(10);
|
|
if ($21) {
|
|
$33 = $$05561 < $$05263;
|
|
$$156 = $33 ? $$05263 : $$05561;
|
|
$34 = HEAP32[$6>>2]|0;
|
|
$35 = (+($34|0));
|
|
$36 = $35 * 1.5;
|
|
$37 = $$05860 + $36;
|
|
$$151 = 0;$$159 = $37;$$2 = 0.0;$$257 = $$156;
|
|
} else {
|
|
$22 = $20 << 24 >> 24;
|
|
;HEAP32[$$byval_copy>>2]=HEAP32[$1>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$1+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$1+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$1+12>>2]|0;HEAP32[$$byval_copy+16>>2]=HEAP32[$1+16>>2]|0;HEAP32[$$byval_copy+20>>2]=HEAP32[$1+20>>2]|0;HEAP32[$$byval_copy+24>>2]=HEAP32[$1+24>>2]|0;HEAP32[$$byval_copy+28>>2]=HEAP32[$1+28>>2]|0;
|
|
$23 = (_GetCharIndex($$byval_copy,$22)|0);
|
|
$24 = HEAP32[$11>>2]|0;
|
|
$25 = (((($24) + ($23<<5)|0)) + 28|0);
|
|
$26 = HEAP32[$25>>2]|0;
|
|
$27 = ($26|0)==(0);
|
|
if ($27) {
|
|
$28 = (((($24) + ($23<<5)|0)) + 20|0);
|
|
$29 = (((($24) + ($23<<5)|0)) + 12|0);
|
|
$30 = HEAP32[$29>>2]|0;
|
|
$31 = HEAP32[$28>>2]|0;
|
|
$32 = (($31) + ($30))|0;
|
|
$$pn$in = $32;
|
|
} else {
|
|
$$pn$in = $26;
|
|
}
|
|
$$pn = (+($$pn$in|0));
|
|
$$153 = $$05263 + $$pn;
|
|
$$151 = $18;$$159 = $$05860;$$2 = $$153;$$257 = $$05561;
|
|
}
|
|
$38 = ($$065|0)<($$151|0);
|
|
$$151$$0 = $38 ? $$151 : $$065;
|
|
$39 = (($$05462) + 1)|0;
|
|
$exitcond = ($39|0)==($5|0);
|
|
if ($exitcond) {
|
|
break;
|
|
} else {
|
|
$$05064 = $$151;$$05263 = $$2;$$05462 = $39;$$05561 = $$257;$$05860 = $$159;$$065 = $$151$$0;
|
|
}
|
|
}
|
|
$phitmp = (($$151$$0) + -1)|0;
|
|
$$0$lcssa = $phitmp;$$052$lcssa = $$2;$$055$lcssa = $$257;$$058$lcssa = $$159;
|
|
$12 = $$055$lcssa < $$052$lcssa;
|
|
$$3 = $12 ? $$052$lcssa : $$055$lcssa;
|
|
$13 = $9 * $$3;
|
|
$14 = Math_imul($$0$lcssa, $4)|0;
|
|
$15 = (+($14|0));
|
|
$16 = $13 + $15;
|
|
$17 = $9 * $$058$lcssa;
|
|
HEAPF32[$0>>2] = $16;
|
|
$$sroa$4$0$$sroa_idx2 = ((($0)) + 4|0);
|
|
HEAPF32[$$sroa$4$0$$sroa_idx2>>2] = $17;
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _GetCharIndex($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$08 = 0, $$09 = 0, $10 = 0, $11 = 0, $12 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = ((($0)) + 24|0);
|
|
$3 = HEAP32[$2>>2]|0;
|
|
$4 = ($3|0)>(0);
|
|
if (!($4)) {
|
|
$$08 = 0;
|
|
return ($$08|0);
|
|
}
|
|
$5 = ((($0)) + 28|0);
|
|
$6 = HEAP32[$5>>2]|0;
|
|
$$09 = 0;
|
|
while(1) {
|
|
$7 = (($6) + ($$09<<5)|0);
|
|
$8 = HEAP32[$7>>2]|0;
|
|
$9 = ($8|0)==($1|0);
|
|
if ($9) {
|
|
$$08 = $$09;
|
|
label = 5;
|
|
break;
|
|
}
|
|
$10 = (($$09) + 1)|0;
|
|
$11 = HEAP32[$2>>2]|0;
|
|
$12 = ($10|0)<($11|0);
|
|
if ($12) {
|
|
$$09 = $10;
|
|
} else {
|
|
$$08 = 0;
|
|
label = 5;
|
|
break;
|
|
}
|
|
}
|
|
if ((label|0) == 5) {
|
|
return ($$08|0);
|
|
}
|
|
return (0)|0;
|
|
}
|
|
function _DrawTexturePro($0,$1,$2,$3,$4,$5) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
$4 = +$4;
|
|
$5 = $5|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0, $24 = 0.0, $25 = 0.0, $26 = 0.0, $27 = 0, $28 = 0.0, $29 = 0.0;
|
|
var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0.0, $39 = 0, $40 = 0, $41 = 0.0, $42 = 0.0, $43 = 0, $44 = 0, $45 = 0.0, $46 = 0, $47 = 0, $48 = 0.0, $49 = 0.0;
|
|
var $50 = 0, $51 = 0.0, $52 = 0, $53 = 0.0, $54 = 0.0, $55 = 0, $56 = 0, $57 = 0, $58 = 0.0, $59 = 0, $6 = 0, $60 = 0.0, $61 = 0.0, $62 = 0, $63 = 0, $64 = 0.0, $65 = 0, $66 = 0, $67 = 0, $68 = 0.0;
|
|
var $69 = 0, $7 = 0, $70 = 0.0, $71 = 0.0, $72 = 0, $73 = 0, $74 = 0, $75 = 0.0, $76 = 0, $77 = 0.0, $78 = 0.0, $79 = 0, $8 = 0, $80 = 0, $81 = 0.0, $82 = 0, $83 = 0.0, $84 = 0, $85 = 0, $86 = 0;
|
|
var $87 = 0.0, $88 = 0, $89 = 0.0, $9 = 0, $90 = 0.0, $91 = 0, $92 = 0.0, $93 = 0, $94 = 0.0, $95 = 0.0, $96 = 0, $97 = 0.0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$6 = HEAP32[$0>>2]|0;
|
|
$7 = ($6|0)==(0);
|
|
if ($7) {
|
|
return;
|
|
}
|
|
$8 = ((($1)) + 8|0);
|
|
$9 = HEAP32[$8>>2]|0;
|
|
$10 = ($9|0)<(0);
|
|
if ($10) {
|
|
$11 = HEAP32[$1>>2]|0;
|
|
$12 = (($11) - ($9))|0;
|
|
HEAP32[$1>>2] = $12;
|
|
}
|
|
$13 = ((($1)) + 12|0);
|
|
$14 = HEAP32[$13>>2]|0;
|
|
$15 = ($14|0)<(0);
|
|
if ($15) {
|
|
$16 = ((($1)) + 4|0);
|
|
$17 = HEAP32[$16>>2]|0;
|
|
$18 = (($17) - ($14))|0;
|
|
HEAP32[$16>>2] = $18;
|
|
}
|
|
$19 = HEAP32[$0>>2]|0;
|
|
_rlEnableTexture($19);
|
|
_rlPushMatrix();
|
|
$20 = HEAP32[$2>>2]|0;
|
|
$21 = (+($20|0));
|
|
$22 = ((($2)) + 4|0);
|
|
$23 = HEAP32[$22>>2]|0;
|
|
$24 = (+($23|0));
|
|
_rlTranslatef($21,$24,0.0);
|
|
_rlRotatef($4,0.0,0.0,1.0);
|
|
$25 = +HEAPF32[$3>>2];
|
|
$26 = -$25;
|
|
$27 = ((($3)) + 4|0);
|
|
$28 = +HEAPF32[$27>>2];
|
|
$29 = -$28;
|
|
_rlTranslatef($26,$29,0.0);
|
|
_rlBegin(7);
|
|
$30 = HEAP8[$5>>0]|0;
|
|
$31 = ((($5)) + 1|0);
|
|
$32 = HEAP8[$31>>0]|0;
|
|
$33 = ((($5)) + 2|0);
|
|
$34 = HEAP8[$33>>0]|0;
|
|
$35 = ((($5)) + 3|0);
|
|
$36 = HEAP8[$35>>0]|0;
|
|
_rlColor4ub($30,$32,$34,$36);
|
|
$37 = HEAP32[$1>>2]|0;
|
|
$38 = (+($37|0));
|
|
$39 = ((($0)) + 4|0);
|
|
$40 = HEAP32[$39>>2]|0;
|
|
$41 = (+($40|0));
|
|
$42 = $38 / $41;
|
|
$43 = ((($1)) + 4|0);
|
|
$44 = HEAP32[$43>>2]|0;
|
|
$45 = (+($44|0));
|
|
$46 = ((($0)) + 8|0);
|
|
$47 = HEAP32[$46>>2]|0;
|
|
$48 = (+($47|0));
|
|
$49 = $45 / $48;
|
|
_rlTexCoord2f($42,$49);
|
|
_rlVertex2f(0.0,0.0);
|
|
$50 = HEAP32[$1>>2]|0;
|
|
$51 = (+($50|0));
|
|
$52 = HEAP32[$39>>2]|0;
|
|
$53 = (+($52|0));
|
|
$54 = $51 / $53;
|
|
$55 = HEAP32[$43>>2]|0;
|
|
$56 = HEAP32[$13>>2]|0;
|
|
$57 = (($56) + ($55))|0;
|
|
$58 = (+($57|0));
|
|
$59 = HEAP32[$46>>2]|0;
|
|
$60 = (+($59|0));
|
|
$61 = $58 / $60;
|
|
_rlTexCoord2f($54,$61);
|
|
$62 = ((($2)) + 12|0);
|
|
$63 = HEAP32[$62>>2]|0;
|
|
$64 = (+($63|0));
|
|
_rlVertex2f(0.0,$64);
|
|
$65 = HEAP32[$1>>2]|0;
|
|
$66 = HEAP32[$8>>2]|0;
|
|
$67 = (($66) + ($65))|0;
|
|
$68 = (+($67|0));
|
|
$69 = HEAP32[$39>>2]|0;
|
|
$70 = (+($69|0));
|
|
$71 = $68 / $70;
|
|
$72 = HEAP32[$43>>2]|0;
|
|
$73 = HEAP32[$13>>2]|0;
|
|
$74 = (($73) + ($72))|0;
|
|
$75 = (+($74|0));
|
|
$76 = HEAP32[$46>>2]|0;
|
|
$77 = (+($76|0));
|
|
$78 = $75 / $77;
|
|
_rlTexCoord2f($71,$78);
|
|
$79 = ((($2)) + 8|0);
|
|
$80 = HEAP32[$79>>2]|0;
|
|
$81 = (+($80|0));
|
|
$82 = HEAP32[$62>>2]|0;
|
|
$83 = (+($82|0));
|
|
_rlVertex2f($81,$83);
|
|
$84 = HEAP32[$1>>2]|0;
|
|
$85 = HEAP32[$8>>2]|0;
|
|
$86 = (($85) + ($84))|0;
|
|
$87 = (+($86|0));
|
|
$88 = HEAP32[$39>>2]|0;
|
|
$89 = (+($88|0));
|
|
$90 = $87 / $89;
|
|
$91 = HEAP32[$43>>2]|0;
|
|
$92 = (+($91|0));
|
|
$93 = HEAP32[$46>>2]|0;
|
|
$94 = (+($93|0));
|
|
$95 = $92 / $94;
|
|
_rlTexCoord2f($90,$95);
|
|
$96 = HEAP32[$79>>2]|0;
|
|
$97 = (+($96|0));
|
|
_rlVertex2f($97,0.0);
|
|
_rlEnd();
|
|
_rlPopMatrix();
|
|
_rlDisableTexture();
|
|
return;
|
|
}
|
|
function _DrawText($0,$1,$2,$3,$4) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
$4 = $4|0;
|
|
var $$ = 0, $$byval_copy = 0, $$byval_copy1 = 0, $$byval_copy2 = 0, $10 = 0.0, $11 = 0, $12 = 0.0, $13 = 0, $14 = 0, $15 = 0.0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 128|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(128|0);
|
|
$$byval_copy2 = sp + 112|0;
|
|
$$byval_copy1 = sp + 104|0;
|
|
$$byval_copy = sp + 72|0;
|
|
$5 = sp + 32|0;
|
|
$6 = sp + 64|0;
|
|
$7 = sp;
|
|
_GetDefaultFont($5);
|
|
$8 = HEAP32[$5>>2]|0;
|
|
$9 = ($8|0)==(0);
|
|
if ($9) {
|
|
STACKTOP = sp;return;
|
|
}
|
|
$10 = (+($1|0));
|
|
HEAPF32[$6>>2] = $10;
|
|
$11 = ((($6)) + 4|0);
|
|
$12 = (+($2|0));
|
|
HEAPF32[$11>>2] = $12;
|
|
$13 = ($3|0)>(10);
|
|
$$ = $13 ? $3 : 10;
|
|
$14 = (($$>>>0) / 10)&-1;
|
|
_GetDefaultFont($7);
|
|
$15 = (+($$|0));
|
|
;HEAP32[$$byval_copy>>2]=HEAP32[$7>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$7+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$7+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$7+12>>2]|0;HEAP32[$$byval_copy+16>>2]=HEAP32[$7+16>>2]|0;HEAP32[$$byval_copy+20>>2]=HEAP32[$7+20>>2]|0;HEAP32[$$byval_copy+24>>2]=HEAP32[$7+24>>2]|0;HEAP32[$$byval_copy+28>>2]=HEAP32[$7+28>>2]|0;
|
|
;HEAP32[$$byval_copy1>>2]=HEAP32[$6>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$6+4>>2]|0;
|
|
;HEAP8[$$byval_copy2>>0]=HEAP8[$4>>0]|0;HEAP8[$$byval_copy2+1>>0]=HEAP8[$4+1>>0]|0;HEAP8[$$byval_copy2+2>>0]=HEAP8[$4+2>>0]|0;HEAP8[$$byval_copy2+3>>0]=HEAP8[$4+3>>0]|0;
|
|
_DrawTextEx($$byval_copy,$0,$$byval_copy1,$15,$14,$$byval_copy2);
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _DrawTextEx($0,$1,$2,$3,$4,$5) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = +$3;
|
|
$4 = $4|0;
|
|
$5 = $5|0;
|
|
var $$04954 = 0, $$05153 = 0, $$055 = 0, $$1 = 0, $$150 = 0, $$152 = 0, $$2 = 0, $$byval_copy1 = 0, $$byval_copy2 = 0, $$byval_copy3 = 0, $$byval_copy4 = 0, $$byval_copy5 = 0, $$sink = 0, $10 = 0, $11 = 0.0, $12 = 0.0, $13 = 0, $14 = 0, $15 = 0.0, $16 = 0;
|
|
var $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0.0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0.0, $28 = 0.0, $29 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0;
|
|
var $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0.0, $45 = 0.0, $46 = 0, $47 = 0, $48 = 0.0, $49 = 0.0, $50 = 0.0, $51 = 0, $52 = 0.0, $53 = 0.0, $54 = 0.0, $55 = 0, $56 = 0;
|
|
var $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0.0, $64 = 0.0, $65 = 0, $66 = 0, $67 = 0, $68 = 0.0, $69 = 0.0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0;
|
|
var $75 = 0, $76 = 0, $77 = 0.0, $78 = 0.0, $79 = 0.0, $8 = 0, $80 = 0, $81 = 0, $82 = 0.0, $83 = 0.0, $84 = 0.0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 128|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(128|0);
|
|
$$byval_copy5 = sp + 88|0;
|
|
$$byval_copy4 = sp + 80|0;
|
|
$$byval_copy3 = sp + 64|0;
|
|
$$byval_copy2 = sp + 48|0;
|
|
$$byval_copy1 = sp + 24|0;
|
|
$6 = sp + 8|0;
|
|
$7 = sp;
|
|
$8 = (_strlen($1)|0);
|
|
$9 = ((($0)) + 20|0);
|
|
$10 = HEAP32[$9>>2]|0;
|
|
$11 = (+($10|0));
|
|
$12 = $3 / $11;
|
|
$13 = ($8|0)>(0);
|
|
if (!($13)) {
|
|
STACKTOP = sp;return;
|
|
}
|
|
$14 = ((($0)) + 28|0);
|
|
$15 = +HEAPF32[$2>>2];
|
|
$16 = ((($6)) + 4|0);
|
|
$17 = ((($2)) + 4|0);
|
|
$18 = ((($6)) + 8|0);
|
|
$19 = ((($6)) + 12|0);
|
|
$20 = ((($7)) + 4|0);
|
|
$21 = (+($4|0));
|
|
$$04954 = 0;$$05153 = 0;$$055 = 0;
|
|
while(1) {
|
|
$22 = (($1) + ($$055)|0);
|
|
$23 = HEAP8[$22>>0]|0;
|
|
switch ($23<<24>>24) {
|
|
case 10: {
|
|
$24 = HEAP32[$9>>2]|0;
|
|
$25 = (($24|0) / 2)&-1;
|
|
$26 = (($25) + ($24))|0;
|
|
$27 = (+($26|0));
|
|
$28 = $12 * $27;
|
|
$29 = (~~(($28)));
|
|
$30 = (($29) + ($$05153))|0;
|
|
$$150 = 0;$$152 = $30;$$2 = $$055;
|
|
break;
|
|
}
|
|
case -62: {
|
|
$31 = (($$055) + 1)|0;
|
|
$32 = (($1) + ($31)|0);
|
|
$33 = HEAP8[$32>>0]|0;
|
|
$34 = $33&255;
|
|
$$1 = $31;$$sink = $34;
|
|
label = 9;
|
|
break;
|
|
}
|
|
case -61: {
|
|
$35 = (($$055) + 1)|0;
|
|
$36 = (($1) + ($35)|0);
|
|
$37 = HEAP8[$36>>0]|0;
|
|
$38 = $37&255;
|
|
$39 = (($38) + 64)|0;
|
|
$$1 = $35;$$sink = $39;
|
|
label = 9;
|
|
break;
|
|
}
|
|
default: {
|
|
$40 = $23 << 24 >> 24;
|
|
$$1 = $$055;$$sink = $40;
|
|
label = 9;
|
|
}
|
|
}
|
|
do {
|
|
if ((label|0) == 9) {
|
|
label = 0;
|
|
;HEAP32[$$byval_copy5>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy5+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy5+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[$$byval_copy5+12>>2]=HEAP32[$0+12>>2]|0;HEAP32[$$byval_copy5+16>>2]=HEAP32[$0+16>>2]|0;HEAP32[$$byval_copy5+20>>2]=HEAP32[$0+20>>2]|0;HEAP32[$$byval_copy5+24>>2]=HEAP32[$0+24>>2]|0;HEAP32[$$byval_copy5+28>>2]=HEAP32[$0+28>>2]|0;
|
|
$41 = (_GetCharIndex($$byval_copy5,$$sink)|0);
|
|
$42 = HEAP32[$14>>2]|0;
|
|
$43 = (((($42) + ($41<<5)|0)) + 4|0);
|
|
$44 = (+($$04954|0));
|
|
$45 = $44 + $15;
|
|
$46 = (((($42) + ($41<<5)|0)) + 20|0);
|
|
$47 = HEAP32[$46>>2]|0;
|
|
$48 = (+($47|0));
|
|
$49 = $12 * $48;
|
|
$50 = $45 + $49;
|
|
$51 = (~~(($50)));
|
|
HEAP32[$6>>2] = $51;
|
|
$52 = +HEAPF32[$17>>2];
|
|
$53 = (+($$05153|0));
|
|
$54 = $53 + $52;
|
|
$55 = (((($42) + ($41<<5)|0)) + 24|0);
|
|
$56 = HEAP32[$55>>2]|0;
|
|
$57 = (+($56|0));
|
|
$58 = $12 * $57;
|
|
$59 = $54 + $58;
|
|
$60 = (~~(($59)));
|
|
HEAP32[$16>>2] = $60;
|
|
$61 = (((($42) + ($41<<5)|0)) + 12|0);
|
|
$62 = HEAP32[$61>>2]|0;
|
|
$63 = (+($62|0));
|
|
$64 = $12 * $63;
|
|
$65 = (~~(($64)));
|
|
HEAP32[$18>>2] = $65;
|
|
$66 = (((($42) + ($41<<5)|0)) + 16|0);
|
|
$67 = HEAP32[$66>>2]|0;
|
|
$68 = (+($67|0));
|
|
$69 = $12 * $68;
|
|
$70 = (~~(($69)));
|
|
HEAP32[$19>>2] = $70;
|
|
HEAPF32[$7>>2] = 0.0;
|
|
HEAPF32[$20>>2] = 0.0;
|
|
;HEAP32[$$byval_copy1>>2]=HEAP32[$0>>2]|0;HEAP32[$$byval_copy1+4>>2]=HEAP32[$0+4>>2]|0;HEAP32[$$byval_copy1+8>>2]=HEAP32[$0+8>>2]|0;HEAP32[$$byval_copy1+12>>2]=HEAP32[$0+12>>2]|0;HEAP32[$$byval_copy1+16>>2]=HEAP32[$0+16>>2]|0;
|
|
;HEAP32[$$byval_copy2>>2]=HEAP32[$43>>2]|0;HEAP32[$$byval_copy2+4>>2]=HEAP32[$43+4>>2]|0;HEAP32[$$byval_copy2+8>>2]=HEAP32[$43+8>>2]|0;HEAP32[$$byval_copy2+12>>2]=HEAP32[$43+12>>2]|0;
|
|
;HEAP32[$$byval_copy3>>2]=HEAP32[$6>>2]|0;HEAP32[$$byval_copy3+4>>2]=HEAP32[$6+4>>2]|0;HEAP32[$$byval_copy3+8>>2]=HEAP32[$6+8>>2]|0;HEAP32[$$byval_copy3+12>>2]=HEAP32[$6+12>>2]|0;
|
|
;HEAP32[$$byval_copy4>>2]=HEAP32[$7>>2]|0;HEAP32[$$byval_copy4+4>>2]=HEAP32[$7+4>>2]|0;
|
|
;HEAP8[$$byval_copy5>>0]=HEAP8[$5>>0]|0;HEAP8[$$byval_copy5+1>>0]=HEAP8[$5+1>>0]|0;HEAP8[$$byval_copy5+2>>0]=HEAP8[$5+2>>0]|0;HEAP8[$$byval_copy5+3>>0]=HEAP8[$5+3>>0]|0;
|
|
_DrawTexturePro($$byval_copy1,$$byval_copy2,$$byval_copy3,$$byval_copy4,0.0,$$byval_copy5);
|
|
$71 = HEAP32[$14>>2]|0;
|
|
$72 = (((($71) + ($41<<5)|0)) + 28|0);
|
|
$73 = HEAP32[$72>>2]|0;
|
|
$74 = ($73|0)==(0);
|
|
if ($74) {
|
|
$75 = (((($71) + ($41<<5)|0)) + 12|0);
|
|
$76 = HEAP32[$75>>2]|0;
|
|
$77 = (+($76|0));
|
|
$78 = $12 * $77;
|
|
$79 = $21 + $78;
|
|
$80 = (~~(($79)));
|
|
$81 = (($80) + ($$04954))|0;
|
|
$$150 = $81;$$152 = $$05153;$$2 = $$1;
|
|
break;
|
|
} else {
|
|
$82 = (+($73|0));
|
|
$83 = $12 * $82;
|
|
$84 = $21 + $83;
|
|
$85 = (~~(($84)));
|
|
$86 = (($85) + ($$04954))|0;
|
|
$$150 = $86;$$152 = $$05153;$$2 = $$1;
|
|
break;
|
|
}
|
|
}
|
|
} while(0);
|
|
$87 = (($$2) + 1)|0;
|
|
$88 = ($87|0)<($8|0);
|
|
if ($88) {
|
|
$$04954 = $$150;$$05153 = $$152;$$055 = $87;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _MeasureText($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$ = 0, $$byval_copy = 0, $$sroa$0$0 = 0, $$sroa$0$0$copyload = 0.0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0.0, $phitmp = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 112|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(112|0);
|
|
$$byval_copy = sp + 72|0;
|
|
$2 = sp + 40|0;
|
|
$3 = sp + 8|0;
|
|
$4 = sp;
|
|
_GetDefaultFont($2);
|
|
$5 = HEAP32[$2>>2]|0;
|
|
$6 = ($5|0)==(0);
|
|
if ($6) {
|
|
$$sroa$0$0 = 0;
|
|
STACKTOP = sp;return ($$sroa$0$0|0);
|
|
}
|
|
$7 = ($1|0)>(10);
|
|
$$ = $7 ? $1 : 10;
|
|
$8 = (($$>>>0) / 10)&-1;
|
|
_GetDefaultFont($3);
|
|
$9 = (+($$|0));
|
|
;HEAP32[$$byval_copy>>2]=HEAP32[$3>>2]|0;HEAP32[$$byval_copy+4>>2]=HEAP32[$3+4>>2]|0;HEAP32[$$byval_copy+8>>2]=HEAP32[$3+8>>2]|0;HEAP32[$$byval_copy+12>>2]=HEAP32[$3+12>>2]|0;HEAP32[$$byval_copy+16>>2]=HEAP32[$3+16>>2]|0;HEAP32[$$byval_copy+20>>2]=HEAP32[$3+20>>2]|0;HEAP32[$$byval_copy+24>>2]=HEAP32[$3+24>>2]|0;HEAP32[$$byval_copy+28>>2]=HEAP32[$3+28>>2]|0;
|
|
_MeasureTextEx($4,$$byval_copy,$0,$9,$8);
|
|
$$sroa$0$0$copyload = +HEAPF32[$4>>2];
|
|
$phitmp = (~~(($$sroa$0$0$copyload)));
|
|
$$sroa$0$0 = $phitmp;
|
|
STACKTOP = sp;return ($$sroa$0$0|0);
|
|
}
|
|
function _emscripten_GetProcAddress($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0;
|
|
var $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0;
|
|
var $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0;
|
|
var $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0;
|
|
var $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0;
|
|
var $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0;
|
|
var $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0;
|
|
var $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0;
|
|
var $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0;
|
|
var $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0;
|
|
var $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0;
|
|
var $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0;
|
|
var $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0;
|
|
var $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0;
|
|
var $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0;
|
|
var $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0;
|
|
var $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0, $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0;
|
|
var $405 = 0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0;
|
|
var $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0;
|
|
var $441 = 0, $442 = 0, $443 = 0, $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0, $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0;
|
|
var $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0;
|
|
var $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0;
|
|
var $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0, $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0;
|
|
var $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0;
|
|
var $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0;
|
|
var $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0;
|
|
var $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0;
|
|
var $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
|
|
$1 = sp + 12|0;
|
|
$2 = sp + 8|0;
|
|
$3 = sp + 4|0;
|
|
$4 = sp;
|
|
HEAP32[$2>>2] = $0;
|
|
$5 = HEAP32[$2>>2]|0;
|
|
$6 = (_strlen($5)|0);
|
|
$7 = (($6) + 1)|0;
|
|
$8 = (_malloc($7)|0);
|
|
HEAP32[$3>>2] = $8;
|
|
$9 = HEAP32[$3>>2]|0;
|
|
$10 = HEAP32[$2>>2]|0;
|
|
(_strcpy($9,$10)|0);
|
|
$11 = HEAP32[$3>>2]|0;
|
|
$12 = (_strstr($11,8204)|0);
|
|
HEAP32[$4>>2] = $12;
|
|
$13 = HEAP32[$4>>2]|0;
|
|
$14 = ($13|0)!=(0|0);
|
|
if ($14) {
|
|
$15 = HEAP32[$4>>2]|0;
|
|
HEAP8[$15>>0] = 0;
|
|
}
|
|
$16 = HEAP32[$3>>2]|0;
|
|
$17 = (_strstr($16,8208)|0);
|
|
HEAP32[$4>>2] = $17;
|
|
$18 = HEAP32[$4>>2]|0;
|
|
$19 = ($18|0)!=(0|0);
|
|
if ($19) {
|
|
$20 = HEAP32[$4>>2]|0;
|
|
HEAP8[$20>>0] = 0;
|
|
}
|
|
$21 = HEAP32[$3>>2]|0;
|
|
$22 = (_strstr($21,8212)|0);
|
|
HEAP32[$4>>2] = $22;
|
|
$23 = HEAP32[$4>>2]|0;
|
|
$24 = ($23|0)!=(0|0);
|
|
if ($24) {
|
|
$25 = HEAP32[$4>>2]|0;
|
|
HEAP8[$25>>0] = 0;
|
|
}
|
|
$26 = HEAP32[$3>>2]|0;
|
|
$27 = (_strstr($26,8216)|0);
|
|
HEAP32[$4>>2] = $27;
|
|
$28 = HEAP32[$4>>2]|0;
|
|
$29 = ($28|0)!=(0|0);
|
|
if ($29) {
|
|
$30 = HEAP32[$4>>2]|0;
|
|
HEAP8[$30>>0] = 0;
|
|
}
|
|
$31 = HEAP32[$3>>2]|0;
|
|
$32 = (_strcmp($31,8222)|0);
|
|
$33 = ($32|0)!=(0);
|
|
do {
|
|
if ($33) {
|
|
$34 = HEAP32[$3>>2]|0;
|
|
$35 = (_strcmp($34,8260)|0);
|
|
$36 = ($35|0)!=(0);
|
|
if (!($36)) {
|
|
HEAP32[$3>>2] = 8279;
|
|
break;
|
|
}
|
|
$37 = HEAP32[$3>>2]|0;
|
|
$38 = (_strcmp($37,8292)|0);
|
|
$39 = ($38|0)!=(0);
|
|
if (!($39)) {
|
|
HEAP32[$3>>2] = 8313;
|
|
break;
|
|
}
|
|
$40 = HEAP32[$3>>2]|0;
|
|
$41 = (_strcmp($40,8328)|0);
|
|
$42 = ($41|0)!=(0);
|
|
if (!($42)) {
|
|
HEAP32[$3>>2] = 8343;
|
|
break;
|
|
}
|
|
$43 = HEAP32[$3>>2]|0;
|
|
$44 = (_strcmp($43,8358)|0);
|
|
$45 = ($44|0)!=(0);
|
|
if (!($45)) {
|
|
HEAP32[$3>>2] = 8373;
|
|
}
|
|
} else {
|
|
HEAP32[$3>>2] = 8244;
|
|
}
|
|
} while(0);
|
|
$46 = HEAP32[$3>>2]|0;
|
|
$47 = (_strcmp($46,8388)|0);
|
|
$48 = ($47|0)!=(0);
|
|
do {
|
|
if ($48) {
|
|
$49 = HEAP32[$3>>2]|0;
|
|
$50 = (_strcmp($49,8402)|0);
|
|
$51 = ($50|0)!=(0);
|
|
if (!($51)) {
|
|
HEAP32[$1>>2] = 3;
|
|
break;
|
|
}
|
|
$52 = HEAP32[$3>>2]|0;
|
|
$53 = (_strcmp($52,8414)|0);
|
|
$54 = ($53|0)!=(0);
|
|
if (!($54)) {
|
|
HEAP32[$1>>2] = 6;
|
|
break;
|
|
}
|
|
$55 = HEAP32[$3>>2]|0;
|
|
$56 = (_strcmp($55,8428)|0);
|
|
$57 = ($56|0)!=(0);
|
|
if (!($57)) {
|
|
HEAP32[$1>>2] = 7;
|
|
break;
|
|
}
|
|
$58 = HEAP32[$3>>2]|0;
|
|
$59 = (_strcmp($58,8440)|0);
|
|
$60 = ($59|0)!=(0);
|
|
if (!($60)) {
|
|
HEAP32[$1>>2] = 8;
|
|
break;
|
|
}
|
|
$61 = HEAP32[$3>>2]|0;
|
|
$62 = (_strcmp($61,8454)|0);
|
|
$63 = ($62|0)!=(0);
|
|
if (!($63)) {
|
|
HEAP32[$1>>2] = 9;
|
|
break;
|
|
}
|
|
$64 = HEAP32[$3>>2]|0;
|
|
$65 = (_strcmp($64,8468)|0);
|
|
$66 = ($65|0)!=(0);
|
|
if (!($66)) {
|
|
HEAP32[$1>>2] = 10;
|
|
break;
|
|
}
|
|
$67 = HEAP32[$3>>2]|0;
|
|
$68 = (_strcmp($67,8485)|0);
|
|
$69 = ($68|0)!=(0);
|
|
if (!($69)) {
|
|
HEAP32[$1>>2] = 1;
|
|
break;
|
|
}
|
|
$70 = HEAP32[$3>>2]|0;
|
|
$71 = (_strcmp($70,8508)|0);
|
|
$72 = ($71|0)!=(0);
|
|
if (!($72)) {
|
|
HEAP32[$1>>2] = 1;
|
|
break;
|
|
}
|
|
$73 = HEAP32[$3>>2]|0;
|
|
$74 = (_strcmp($73,8534)|0);
|
|
$75 = ($74|0)!=(0);
|
|
if (!($75)) {
|
|
HEAP32[$1>>2] = 2;
|
|
break;
|
|
}
|
|
$76 = HEAP32[$3>>2]|0;
|
|
$77 = (_strcmp($76,8547)|0);
|
|
$78 = ($77|0)!=(0);
|
|
if (!($78)) {
|
|
HEAP32[$1>>2] = 3;
|
|
break;
|
|
}
|
|
$79 = HEAP32[$3>>2]|0;
|
|
$80 = (_strcmp($79,8563)|0);
|
|
$81 = ($80|0)!=(0);
|
|
if (!($81)) {
|
|
HEAP32[$1>>2] = 1;
|
|
break;
|
|
}
|
|
$82 = HEAP32[$3>>2]|0;
|
|
$83 = (_strcmp($82,8576)|0);
|
|
$84 = ($83|0)!=(0);
|
|
if (!($84)) {
|
|
HEAP32[$1>>2] = 11;
|
|
break;
|
|
}
|
|
$85 = HEAP32[$3>>2]|0;
|
|
$86 = (_strcmp($85,8590)|0);
|
|
$87 = ($86|0)!=(0);
|
|
if (!($87)) {
|
|
HEAP32[$1>>2] = 2;
|
|
break;
|
|
}
|
|
$88 = HEAP32[$3>>2]|0;
|
|
$89 = (_strcmp($88,8610)|0);
|
|
$90 = ($89|0)!=(0);
|
|
if (!($90)) {
|
|
HEAP32[$1>>2] = 3;
|
|
break;
|
|
}
|
|
$91 = HEAP32[$3>>2]|0;
|
|
$92 = (_strcmp($91,8630)|0);
|
|
$93 = ($92|0)!=(0);
|
|
if (!($93)) {
|
|
HEAP32[$1>>2] = 4;
|
|
break;
|
|
}
|
|
$94 = HEAP32[$3>>2]|0;
|
|
$95 = (_strcmp($94,8647)|0);
|
|
$96 = ($95|0)!=(0);
|
|
if (!($96)) {
|
|
HEAP32[$1>>2] = 5;
|
|
break;
|
|
}
|
|
$97 = HEAP32[$3>>2]|0;
|
|
$98 = (_strcmp($97,8664)|0);
|
|
$99 = ($98|0)!=(0);
|
|
if (!($99)) {
|
|
HEAP32[$1>>2] = 4;
|
|
break;
|
|
}
|
|
$100 = HEAP32[$3>>2]|0;
|
|
$101 = (_strcmp($100,8676)|0);
|
|
$102 = ($101|0)!=(0);
|
|
if (!($102)) {
|
|
HEAP32[$1>>2] = 12;
|
|
break;
|
|
}
|
|
$103 = HEAP32[$3>>2]|0;
|
|
$104 = (_strcmp($103,8689)|0);
|
|
$105 = ($104|0)!=(0);
|
|
if (!($105)) {
|
|
HEAP32[$1>>2] = 13;
|
|
break;
|
|
}
|
|
$106 = HEAP32[$3>>2]|0;
|
|
$107 = (_strcmp($106,8705)|0);
|
|
$108 = ($107|0)!=(0);
|
|
if (!($108)) {
|
|
HEAP32[$1>>2] = 6;
|
|
break;
|
|
}
|
|
$109 = HEAP32[$3>>2]|0;
|
|
$110 = (_strcmp($109,8728)|0);
|
|
$111 = ($110|0)!=(0);
|
|
if (!($111)) {
|
|
HEAP32[$1>>2] = 2;
|
|
break;
|
|
}
|
|
$112 = HEAP32[$3>>2]|0;
|
|
$113 = (_strcmp($112,8741)|0);
|
|
$114 = ($113|0)!=(0);
|
|
if (!($114)) {
|
|
HEAP32[$1>>2] = 3;
|
|
break;
|
|
}
|
|
$115 = HEAP32[$3>>2]|0;
|
|
$116 = (_strcmp($115,8757)|0);
|
|
$117 = ($116|0)!=(0);
|
|
if (!($117)) {
|
|
HEAP32[$1>>2] = 5;
|
|
break;
|
|
}
|
|
$118 = HEAP32[$3>>2]|0;
|
|
$119 = (_strcmp($118,8768)|0);
|
|
$120 = ($119|0)!=(0);
|
|
if (!($120)) {
|
|
HEAP32[$1>>2] = 14;
|
|
break;
|
|
}
|
|
$121 = HEAP32[$3>>2]|0;
|
|
$122 = (_strcmp($121,8787)|0);
|
|
$123 = ($122|0)!=(0);
|
|
if (!($123)) {
|
|
HEAP32[$1>>2] = 15;
|
|
break;
|
|
}
|
|
$124 = HEAP32[$3>>2]|0;
|
|
$125 = (_strcmp($124,8809)|0);
|
|
$126 = ($125|0)!=(0);
|
|
if (!($126)) {
|
|
HEAP32[$1>>2] = 16;
|
|
break;
|
|
}
|
|
$127 = HEAP32[$3>>2]|0;
|
|
$128 = (_strcmp($127,8828)|0);
|
|
$129 = ($128|0)!=(0);
|
|
if (!($129)) {
|
|
HEAP32[$1>>2] = 7;
|
|
break;
|
|
}
|
|
$130 = HEAP32[$3>>2]|0;
|
|
$131 = (_strcmp($130,8857)|0);
|
|
$132 = ($131|0)!=(0);
|
|
if (!($132)) {
|
|
HEAP32[$1>>2] = 6;
|
|
break;
|
|
}
|
|
$133 = HEAP32[$3>>2]|0;
|
|
$134 = (_strcmp($133,8874)|0);
|
|
$135 = ($134|0)!=(0);
|
|
if (!($135)) {
|
|
HEAP32[$1>>2] = 8;
|
|
break;
|
|
}
|
|
$136 = HEAP32[$3>>2]|0;
|
|
$137 = (_strcmp($136,8889)|0);
|
|
$138 = ($137|0)!=(0);
|
|
if (!($138)) {
|
|
HEAP32[$1>>2] = 9;
|
|
break;
|
|
}
|
|
$139 = HEAP32[$3>>2]|0;
|
|
$140 = (_strcmp($139,8904)|0);
|
|
$141 = ($140|0)!=(0);
|
|
if (!($141)) {
|
|
HEAP32[$1>>2] = 1;
|
|
break;
|
|
}
|
|
$142 = HEAP32[$3>>2]|0;
|
|
$143 = (_strcmp($142,8925)|0);
|
|
$144 = ($143|0)!=(0);
|
|
if (!($144)) {
|
|
HEAP32[$1>>2] = 10;
|
|
break;
|
|
}
|
|
$145 = HEAP32[$3>>2]|0;
|
|
$146 = (_strcmp($145,8945)|0);
|
|
$147 = ($146|0)!=(0);
|
|
if (!($147)) {
|
|
HEAP32[$1>>2] = 11;
|
|
break;
|
|
}
|
|
$148 = HEAP32[$3>>2]|0;
|
|
$149 = (_strcmp($148,8965)|0);
|
|
$150 = ($149|0)!=(0);
|
|
if (!($150)) {
|
|
HEAP32[$1>>2] = 12;
|
|
break;
|
|
}
|
|
$151 = HEAP32[$3>>2]|0;
|
|
$152 = (_strcmp($151,8991)|0);
|
|
$153 = ($152|0)!=(0);
|
|
if (!($153)) {
|
|
HEAP32[$1>>2] = 2;
|
|
break;
|
|
}
|
|
$154 = HEAP32[$3>>2]|0;
|
|
$155 = (_strcmp($154,9010)|0);
|
|
$156 = ($155|0)!=(0);
|
|
if (!($156)) {
|
|
HEAP32[$1>>2] = 1;
|
|
break;
|
|
}
|
|
$157 = HEAP32[$3>>2]|0;
|
|
$158 = (_strcmp($157,9022)|0);
|
|
$159 = ($158|0)!=(0);
|
|
if (!($159)) {
|
|
HEAP32[$1>>2] = 3;
|
|
break;
|
|
}
|
|
$160 = HEAP32[$3>>2]|0;
|
|
$161 = (_strcmp($160,9034)|0);
|
|
$162 = ($161|0)!=(0);
|
|
if (!($162)) {
|
|
HEAP32[$1>>2] = 1;
|
|
break;
|
|
}
|
|
$163 = HEAP32[$3>>2]|0;
|
|
$164 = (_strcmp($163,9046)|0);
|
|
$165 = ($164|0)!=(0);
|
|
if (!($165)) {
|
|
HEAP32[$1>>2] = 1;
|
|
break;
|
|
}
|
|
$166 = HEAP32[$3>>2]|0;
|
|
$167 = (_strcmp($166,9058)|0);
|
|
$168 = ($167|0)!=(0);
|
|
if (!($168)) {
|
|
HEAP32[$1>>2] = 17;
|
|
break;
|
|
}
|
|
$169 = HEAP32[$3>>2]|0;
|
|
$170 = (_strcmp($169,9070)|0);
|
|
$171 = ($170|0)!=(0);
|
|
if (!($171)) {
|
|
HEAP32[$1>>2] = 13;
|
|
break;
|
|
}
|
|
$172 = HEAP32[$3>>2]|0;
|
|
$173 = (_strcmp($172,9082)|0);
|
|
$174 = ($173|0)!=(0);
|
|
if (!($174)) {
|
|
HEAP32[$1>>2] = 4;
|
|
break;
|
|
}
|
|
$175 = HEAP32[$3>>2]|0;
|
|
$176 = (_strcmp($175,9094)|0);
|
|
$177 = ($176|0)!=(0);
|
|
if (!($177)) {
|
|
HEAP32[$1>>2] = 2;
|
|
break;
|
|
}
|
|
$178 = HEAP32[$3>>2]|0;
|
|
$179 = (_strcmp($178,9106)|0);
|
|
$180 = ($179|0)!=(0);
|
|
if (!($180)) {
|
|
HEAP32[$1>>2] = 14;
|
|
break;
|
|
}
|
|
$181 = HEAP32[$3>>2]|0;
|
|
$182 = (_strcmp($181,9119)|0);
|
|
$183 = ($182|0)!=(0);
|
|
if (!($183)) {
|
|
HEAP32[$1>>2] = 15;
|
|
break;
|
|
}
|
|
$184 = HEAP32[$3>>2]|0;
|
|
$185 = (_strcmp($184,9132)|0);
|
|
$186 = ($185|0)!=(0);
|
|
if (!($186)) {
|
|
HEAP32[$1>>2] = 16;
|
|
break;
|
|
}
|
|
$187 = HEAP32[$3>>2]|0;
|
|
$188 = (_strcmp($187,9145)|0);
|
|
$189 = ($188|0)!=(0);
|
|
if (!($189)) {
|
|
HEAP32[$1>>2] = 17;
|
|
break;
|
|
}
|
|
$190 = HEAP32[$3>>2]|0;
|
|
$191 = (_strcmp($190,9158)|0);
|
|
$192 = ($191|0)!=(0);
|
|
if (!($192)) {
|
|
HEAP32[$1>>2] = 18;
|
|
break;
|
|
}
|
|
$193 = HEAP32[$3>>2]|0;
|
|
$194 = (_strcmp($193,9171)|0);
|
|
$195 = ($194|0)!=(0);
|
|
if (!($195)) {
|
|
HEAP32[$1>>2] = 19;
|
|
break;
|
|
}
|
|
$196 = HEAP32[$3>>2]|0;
|
|
$197 = (_strcmp($196,9184)|0);
|
|
$198 = ($197|0)!=(0);
|
|
if (!($198)) {
|
|
HEAP32[$1>>2] = 20;
|
|
break;
|
|
}
|
|
$199 = HEAP32[$3>>2]|0;
|
|
$200 = (_strcmp($199,9197)|0);
|
|
$201 = ($200|0)!=(0);
|
|
if (!($201)) {
|
|
HEAP32[$1>>2] = 21;
|
|
break;
|
|
}
|
|
$202 = HEAP32[$3>>2]|0;
|
|
$203 = (_strcmp($202,9210)|0);
|
|
$204 = ($203|0)!=(0);
|
|
if (!($204)) {
|
|
HEAP32[$1>>2] = 5;
|
|
break;
|
|
}
|
|
$205 = HEAP32[$3>>2]|0;
|
|
$206 = (_strcmp($205,9229)|0);
|
|
$207 = ($206|0)!=(0);
|
|
if (!($207)) {
|
|
HEAP32[$1>>2] = 6;
|
|
break;
|
|
}
|
|
$208 = HEAP32[$3>>2]|0;
|
|
$209 = (_strcmp($208,9248)|0);
|
|
$210 = ($209|0)!=(0);
|
|
if (!($210)) {
|
|
HEAP32[$1>>2] = 7;
|
|
break;
|
|
}
|
|
$211 = HEAP32[$3>>2]|0;
|
|
$212 = (_strcmp($211,9267)|0);
|
|
$213 = ($212|0)!=(0);
|
|
if (!($213)) {
|
|
HEAP32[$1>>2] = 18;
|
|
break;
|
|
}
|
|
$214 = HEAP32[$3>>2]|0;
|
|
$215 = (_strcmp($214,9280)|0);
|
|
$216 = ($215|0)!=(0);
|
|
if (!($216)) {
|
|
HEAP32[$1>>2] = 19;
|
|
break;
|
|
}
|
|
$217 = HEAP32[$3>>2]|0;
|
|
$218 = (_strcmp($217,9298)|0);
|
|
$219 = ($218|0)!=(0);
|
|
if (!($219)) {
|
|
HEAP32[$1>>2] = 20;
|
|
break;
|
|
}
|
|
$220 = HEAP32[$3>>2]|0;
|
|
$221 = (_strcmp($220,9316)|0);
|
|
$222 = ($221|0)!=(0);
|
|
if (!($222)) {
|
|
HEAP32[$1>>2] = 21;
|
|
break;
|
|
}
|
|
$223 = HEAP32[$3>>2]|0;
|
|
$224 = (_strcmp($223,9334)|0);
|
|
$225 = ($224|0)!=(0);
|
|
if (!($225)) {
|
|
HEAP32[$1>>2] = 22;
|
|
break;
|
|
}
|
|
$226 = HEAP32[$3>>2]|0;
|
|
$227 = (_strcmp($226,9352)|0);
|
|
$228 = ($227|0)!=(0);
|
|
if (!($228)) {
|
|
HEAP32[$1>>2] = 2;
|
|
break;
|
|
}
|
|
$229 = HEAP32[$3>>2]|0;
|
|
$230 = (_strcmp($229,9372)|0);
|
|
$231 = ($230|0)!=(0);
|
|
if (!($231)) {
|
|
HEAP32[$1>>2] = 3;
|
|
break;
|
|
}
|
|
$232 = HEAP32[$3>>2]|0;
|
|
$233 = (_strcmp($232,8313)|0);
|
|
$234 = ($233|0)!=(0);
|
|
if (!($234)) {
|
|
HEAP32[$1>>2] = 7;
|
|
break;
|
|
}
|
|
$235 = HEAP32[$3>>2]|0;
|
|
$236 = (_strcmp($235,9390)|0);
|
|
$237 = ($236|0)!=(0);
|
|
if (!($237)) {
|
|
HEAP32[$1>>2] = 1;
|
|
break;
|
|
}
|
|
$238 = HEAP32[$3>>2]|0;
|
|
$239 = (_strcmp($238,9405)|0);
|
|
$240 = ($239|0)!=(0);
|
|
if (!($240)) {
|
|
HEAP32[$1>>2] = 8;
|
|
break;
|
|
}
|
|
$241 = HEAP32[$3>>2]|0;
|
|
$242 = (_strcmp($241,9426)|0);
|
|
$243 = ($242|0)!=(0);
|
|
if (!($243)) {
|
|
HEAP32[$1>>2] = 9;
|
|
break;
|
|
}
|
|
$244 = HEAP32[$3>>2]|0;
|
|
$245 = (_strcmp($244,9441)|0);
|
|
$246 = ($245|0)!=(0);
|
|
if (!($246)) {
|
|
HEAP32[$1>>2] = 10;
|
|
break;
|
|
}
|
|
$247 = HEAP32[$3>>2]|0;
|
|
$248 = (_strcmp($247,9459)|0);
|
|
$249 = ($248|0)!=(0);
|
|
if (!($249)) {
|
|
HEAP32[$1>>2] = 2;
|
|
break;
|
|
}
|
|
$250 = HEAP32[$3>>2]|0;
|
|
$251 = (_strcmp($250,9475)|0);
|
|
$252 = ($251|0)!=(0);
|
|
if (!($252)) {
|
|
HEAP32[$1>>2] = 11;
|
|
break;
|
|
}
|
|
$253 = HEAP32[$3>>2]|0;
|
|
$254 = (_strcmp($253,9494)|0);
|
|
$255 = ($254|0)!=(0);
|
|
if (!($255)) {
|
|
HEAP32[$1>>2] = 22;
|
|
break;
|
|
}
|
|
$256 = HEAP32[$3>>2]|0;
|
|
$257 = (_strcmp($256,9508)|0);
|
|
$258 = ($257|0)!=(0);
|
|
if (!($258)) {
|
|
HEAP32[$1>>2] = 23;
|
|
break;
|
|
}
|
|
$259 = HEAP32[$3>>2]|0;
|
|
$260 = (_strcmp($259,9523)|0);
|
|
$261 = ($260|0)!=(0);
|
|
if (!($261)) {
|
|
HEAP32[$1>>2] = 8;
|
|
break;
|
|
}
|
|
$262 = HEAP32[$3>>2]|0;
|
|
$263 = (_strcmp($262,8244)|0);
|
|
$264 = ($263|0)!=(0);
|
|
if (!($264)) {
|
|
HEAP32[$1>>2] = 1;
|
|
break;
|
|
}
|
|
$265 = HEAP32[$3>>2]|0;
|
|
$266 = (_strcmp($265,9534)|0);
|
|
$267 = ($266|0)!=(0);
|
|
if (!($267)) {
|
|
HEAP32[$1>>2] = 3;
|
|
break;
|
|
}
|
|
$268 = HEAP32[$3>>2]|0;
|
|
$269 = (_strcmp($268,8343)|0);
|
|
$270 = ($269|0)!=(0);
|
|
if (!($270)) {
|
|
HEAP32[$1>>2] = 23;
|
|
break;
|
|
}
|
|
$271 = HEAP32[$3>>2]|0;
|
|
$272 = (_strcmp($271,8373)|0);
|
|
$273 = ($272|0)!=(0);
|
|
if (!($273)) {
|
|
HEAP32[$1>>2] = 24;
|
|
break;
|
|
}
|
|
$274 = HEAP32[$3>>2]|0;
|
|
$275 = (_strcmp($274,9550)|0);
|
|
$276 = ($275|0)!=(0);
|
|
if (!($276)) {
|
|
HEAP32[$1>>2] = 12;
|
|
break;
|
|
}
|
|
$277 = HEAP32[$3>>2]|0;
|
|
$278 = (_strcmp($277,9577)|0);
|
|
$279 = ($278|0)!=(0);
|
|
if (!($279)) {
|
|
HEAP32[$1>>2] = 4;
|
|
break;
|
|
}
|
|
$280 = HEAP32[$3>>2]|0;
|
|
$281 = (_strcmp($280,9591)|0);
|
|
$282 = ($281|0)!=(0);
|
|
if (!($282)) {
|
|
HEAP32[$1>>2] = 13;
|
|
break;
|
|
}
|
|
$283 = HEAP32[$3>>2]|0;
|
|
$284 = (_strcmp($283,8279)|0);
|
|
$285 = ($284|0)!=(0);
|
|
if (!($285)) {
|
|
HEAP32[$1>>2] = 5;
|
|
break;
|
|
}
|
|
$286 = HEAP32[$3>>2]|0;
|
|
$287 = (_strcmp($286,9611)|0);
|
|
$288 = ($287|0)!=(0);
|
|
if (!($288)) {
|
|
HEAP32[$1>>2] = 6;
|
|
break;
|
|
}
|
|
$289 = HEAP32[$3>>2]|0;
|
|
$290 = (_strcmp($289,9629)|0);
|
|
$291 = ($290|0)!=(0);
|
|
if (!($291)) {
|
|
HEAP32[$1>>2] = 9;
|
|
break;
|
|
}
|
|
$292 = HEAP32[$3>>2]|0;
|
|
$293 = (_strcmp($292,9641)|0);
|
|
$294 = ($293|0)!=(0);
|
|
if (!($294)) {
|
|
HEAP32[$1>>2] = 24;
|
|
break;
|
|
}
|
|
$295 = HEAP32[$3>>2]|0;
|
|
$296 = (_strcmp($295,9662)|0);
|
|
$297 = ($296|0)!=(0);
|
|
if (!($297)) {
|
|
HEAP32[$1>>2] = 25;
|
|
break;
|
|
}
|
|
$298 = HEAP32[$3>>2]|0;
|
|
$299 = (_strcmp($298,9680)|0);
|
|
$300 = ($299|0)!=(0);
|
|
if (!($300)) {
|
|
HEAP32[$1>>2] = 26;
|
|
break;
|
|
}
|
|
$301 = HEAP32[$3>>2]|0;
|
|
$302 = (_strcmp($301,9698)|0);
|
|
$303 = ($302|0)!=(0);
|
|
if (!($303)) {
|
|
HEAP32[$1>>2] = 27;
|
|
break;
|
|
}
|
|
$304 = HEAP32[$3>>2]|0;
|
|
$305 = (_strcmp($304,9719)|0);
|
|
$306 = ($305|0)!=(0);
|
|
if (!($306)) {
|
|
HEAP32[$1>>2] = 14;
|
|
break;
|
|
}
|
|
$307 = HEAP32[$3>>2]|0;
|
|
$308 = (_strcmp($307,9745)|0);
|
|
$309 = ($308|0)!=(0);
|
|
if (!($309)) {
|
|
HEAP32[$1>>2] = 3;
|
|
break;
|
|
}
|
|
$310 = HEAP32[$3>>2]|0;
|
|
$311 = (_strcmp($310,9768)|0);
|
|
$312 = ($311|0)!=(0);
|
|
if (!($312)) {
|
|
HEAP32[$1>>2] = 15;
|
|
break;
|
|
}
|
|
$313 = HEAP32[$3>>2]|0;
|
|
$314 = (_strcmp($313,9806)|0);
|
|
$315 = ($314|0)!=(0);
|
|
if (!($315)) {
|
|
HEAP32[$1>>2] = 10;
|
|
break;
|
|
}
|
|
$316 = HEAP32[$3>>2]|0;
|
|
$317 = (_strcmp($316,9822)|0);
|
|
$318 = ($317|0)!=(0);
|
|
if (!($318)) {
|
|
HEAP32[$1>>2] = 7;
|
|
break;
|
|
}
|
|
$319 = HEAP32[$3>>2]|0;
|
|
$320 = (_strcmp($319,9837)|0);
|
|
$321 = ($320|0)!=(0);
|
|
if (!($321)) {
|
|
HEAP32[$1>>2] = 25;
|
|
break;
|
|
}
|
|
$322 = HEAP32[$3>>2]|0;
|
|
$323 = (_strcmp($322,9860)|0);
|
|
$324 = ($323|0)!=(0);
|
|
if (!($324)) {
|
|
HEAP32[$1>>2] = 16;
|
|
break;
|
|
}
|
|
$325 = HEAP32[$3>>2]|0;
|
|
$326 = (_strcmp($325,9873)|0);
|
|
$327 = ($326|0)!=(0);
|
|
if (!($327)) {
|
|
HEAP32[$1>>2] = 28;
|
|
break;
|
|
}
|
|
$328 = HEAP32[$3>>2]|0;
|
|
$329 = (_strcmp($328,9887)|0);
|
|
$330 = ($329|0)!=(0);
|
|
if (!($330)) {
|
|
HEAP32[$1>>2] = 29;
|
|
break;
|
|
}
|
|
$331 = HEAP32[$3>>2]|0;
|
|
$332 = (_strcmp($331,9901)|0);
|
|
$333 = ($332|0)!=(0);
|
|
if (!($333)) {
|
|
HEAP32[$1>>2] = 1;
|
|
break;
|
|
}
|
|
$334 = HEAP32[$3>>2]|0;
|
|
$335 = (_strcmp($334,9921)|0);
|
|
$336 = ($335|0)!=(0);
|
|
if (!($336)) {
|
|
HEAP32[$1>>2] = 8;
|
|
break;
|
|
}
|
|
$337 = HEAP32[$3>>2]|0;
|
|
$338 = (_strcmp($337,9941)|0);
|
|
$339 = ($338|0)!=(0);
|
|
if (!($339)) {
|
|
HEAP32[$1>>2] = 17;
|
|
break;
|
|
}
|
|
$340 = HEAP32[$3>>2]|0;
|
|
$341 = (_strcmp($340,9957)|0);
|
|
$342 = ($341|0)!=(0);
|
|
if (!($342)) {
|
|
HEAP32[$1>>2] = 18;
|
|
break;
|
|
}
|
|
$343 = HEAP32[$3>>2]|0;
|
|
$344 = (_strcmp($343,9975)|0);
|
|
$345 = ($344|0)!=(0);
|
|
if (!($345)) {
|
|
HEAP32[$1>>2] = 26;
|
|
break;
|
|
}
|
|
$346 = HEAP32[$3>>2]|0;
|
|
$347 = (_strcmp($346,9991)|0);
|
|
$348 = ($347|0)!=(0);
|
|
if (!($348)) {
|
|
HEAP32[$1>>2] = 19;
|
|
break;
|
|
}
|
|
$349 = HEAP32[$3>>2]|0;
|
|
$350 = (_strcmp($349,10006)|0);
|
|
$351 = ($350|0)!=(0);
|
|
if (!($351)) {
|
|
HEAP32[$1>>2] = 9;
|
|
break;
|
|
}
|
|
$352 = HEAP32[$3>>2]|0;
|
|
$353 = (_strcmp($352,10028)|0);
|
|
$354 = ($353|0)!=(0);
|
|
if (!($354)) {
|
|
HEAP32[$1>>2] = 30;
|
|
break;
|
|
}
|
|
$355 = HEAP32[$3>>2]|0;
|
|
$356 = (_strcmp($355,10046)|0);
|
|
$357 = ($356|0)!=(0);
|
|
if (!($357)) {
|
|
HEAP32[$1>>2] = 31;
|
|
break;
|
|
}
|
|
$358 = HEAP32[$3>>2]|0;
|
|
$359 = (_strcmp($358,10067)|0);
|
|
$360 = ($359|0)!=(0);
|
|
if (!($360)) {
|
|
HEAP32[$1>>2] = 10;
|
|
break;
|
|
}
|
|
$361 = HEAP32[$3>>2]|0;
|
|
$362 = (_strcmp($361,10085)|0);
|
|
$363 = ($362|0)!=(0);
|
|
if (!($363)) {
|
|
HEAP32[$1>>2] = 11;
|
|
break;
|
|
}
|
|
$364 = HEAP32[$3>>2]|0;
|
|
$365 = (_strcmp($364,10098)|0);
|
|
$366 = ($365|0)!=(0);
|
|
if (!($366)) {
|
|
HEAP32[$1>>2] = 2;
|
|
break;
|
|
}
|
|
$367 = HEAP32[$3>>2]|0;
|
|
$368 = (_strcmp($367,10113)|0);
|
|
$369 = ($368|0)!=(0);
|
|
if (!($369)) {
|
|
HEAP32[$1>>2] = 12;
|
|
break;
|
|
}
|
|
$370 = HEAP32[$3>>2]|0;
|
|
$371 = (_strcmp($370,10127)|0);
|
|
$372 = ($371|0)!=(0);
|
|
if (!($372)) {
|
|
HEAP32[$1>>2] = 1;
|
|
break;
|
|
}
|
|
$373 = HEAP32[$3>>2]|0;
|
|
$374 = (_strcmp($373,10137)|0);
|
|
$375 = ($374|0)!=(0);
|
|
if (!($375)) {
|
|
HEAP32[$1>>2] = 1;
|
|
break;
|
|
}
|
|
$376 = HEAP32[$3>>2]|0;
|
|
$377 = (_strcmp($376,10147)|0);
|
|
$378 = ($377|0)!=(0);
|
|
if (!($378)) {
|
|
HEAP32[$1>>2] = 2;
|
|
break;
|
|
}
|
|
$379 = HEAP32[$3>>2]|0;
|
|
$380 = (_strcmp($379,10169)|0);
|
|
$381 = ($380|0)!=(0);
|
|
if (!($381)) {
|
|
HEAP32[$1>>2] = 13;
|
|
break;
|
|
}
|
|
$382 = HEAP32[$3>>2]|0;
|
|
$383 = (_strcmp($382,10195)|0);
|
|
$384 = ($383|0)!=(0);
|
|
if (!($384)) {
|
|
HEAP32[$1>>2] = 14;
|
|
break;
|
|
}
|
|
$385 = HEAP32[$3>>2]|0;
|
|
$386 = (_strcmp($385,10222)|0);
|
|
$387 = ($386|0)!=(0);
|
|
if (!($387)) {
|
|
HEAP32[$1>>2] = 27;
|
|
break;
|
|
}
|
|
$388 = HEAP32[$3>>2]|0;
|
|
$389 = (_strcmp($388,10235)|0);
|
|
$390 = ($389|0)!=(0);
|
|
if (!($390)) {
|
|
HEAP32[$1>>2] = 20;
|
|
break;
|
|
}
|
|
$391 = HEAP32[$3>>2]|0;
|
|
$392 = (_strcmp($391,10250)|0);
|
|
$393 = ($392|0)!=(0);
|
|
if (!($393)) {
|
|
HEAP32[$1>>2] = 4;
|
|
break;
|
|
}
|
|
$394 = HEAP32[$3>>2]|0;
|
|
$395 = (_strcmp($394,10265)|0);
|
|
$396 = ($395|0)!=(0);
|
|
if (!($396)) {
|
|
HEAP32[$1>>2] = 3;
|
|
break;
|
|
}
|
|
$397 = HEAP32[$3>>2]|0;
|
|
$398 = (_strcmp($397,10289)|0);
|
|
$399 = ($398|0)!=(0);
|
|
if (!($399)) {
|
|
HEAP32[$1>>2] = 2;
|
|
break;
|
|
}
|
|
$400 = HEAP32[$3>>2]|0;
|
|
$401 = (_strcmp($400,10300)|0);
|
|
$402 = ($401|0)!=(0);
|
|
if (!($402)) {
|
|
HEAP32[$1>>2] = 32;
|
|
break;
|
|
}
|
|
$403 = HEAP32[$3>>2]|0;
|
|
$404 = (_strcmp($403,10322)|0);
|
|
$405 = ($404|0)!=(0);
|
|
if (!($405)) {
|
|
HEAP32[$1>>2] = 21;
|
|
break;
|
|
}
|
|
$406 = HEAP32[$3>>2]|0;
|
|
$407 = (_strcmp($406,10344)|0);
|
|
$408 = ($407|0)!=(0);
|
|
if (!($408)) {
|
|
HEAP32[$1>>2] = 5;
|
|
break;
|
|
}
|
|
$409 = HEAP32[$3>>2]|0;
|
|
$410 = (_strcmp($409,10368)|0);
|
|
$411 = ($410|0)!=(0);
|
|
if (!($411)) {
|
|
HEAP32[$1>>2] = 4;
|
|
break;
|
|
}
|
|
$412 = HEAP32[$3>>2]|0;
|
|
$413 = (_strcmp($412,10377)|0);
|
|
$414 = ($413|0)!=(0);
|
|
if (!($414)) {
|
|
HEAP32[$1>>2] = 5;
|
|
break;
|
|
}
|
|
$415 = HEAP32[$3>>2]|0;
|
|
$416 = (_strcmp($415,10385)|0);
|
|
$417 = ($416|0)!=(0);
|
|
if (!($417)) {
|
|
HEAP32[$1>>2] = 1;
|
|
break;
|
|
}
|
|
$418 = HEAP32[$3>>2]|0;
|
|
$419 = (_strcmp($418,10398)|0);
|
|
$420 = ($419|0)!=(0);
|
|
if (!($420)) {
|
|
HEAP32[$1>>2] = 2;
|
|
break;
|
|
}
|
|
$421 = HEAP32[$3>>2]|0;
|
|
$422 = (_strcmp($421,10412)|0);
|
|
$423 = ($422|0)!=(0);
|
|
if (!($423)) {
|
|
HEAP32[$1>>2] = 15;
|
|
break;
|
|
}
|
|
$424 = HEAP32[$3>>2]|0;
|
|
$425 = (_strcmp($424,10424)|0);
|
|
$426 = ($425|0)!=(0);
|
|
if (!($426)) {
|
|
HEAP32[$1>>2] = 16;
|
|
break;
|
|
}
|
|
$427 = HEAP32[$3>>2]|0;
|
|
$428 = (_strcmp($427,10433)|0);
|
|
$429 = ($428|0)!=(0);
|
|
if (!($429)) {
|
|
HEAP32[$1>>2] = 17;
|
|
break;
|
|
}
|
|
$430 = HEAP32[$3>>2]|0;
|
|
$431 = (_strcmp($430,10443)|0);
|
|
$432 = ($431|0)!=(0);
|
|
if (!($432)) {
|
|
HEAP32[$1>>2] = 18;
|
|
break;
|
|
}
|
|
$433 = HEAP32[$3>>2]|0;
|
|
$434 = (_strcmp($433,10455)|0);
|
|
$435 = ($434|0)!=(0);
|
|
if (!($435)) {
|
|
HEAP32[$1>>2] = 19;
|
|
break;
|
|
}
|
|
$436 = HEAP32[$3>>2]|0;
|
|
$437 = (_strcmp($436,10466)|0);
|
|
$438 = ($437|0)!=(0);
|
|
if (!($438)) {
|
|
HEAP32[$1>>2] = 20;
|
|
break;
|
|
}
|
|
$439 = HEAP32[$3>>2]|0;
|
|
$440 = (_strcmp($439,10474)|0);
|
|
$441 = ($440|0)!=(0);
|
|
if (!($441)) {
|
|
HEAP32[$1>>2] = 3;
|
|
break;
|
|
}
|
|
$442 = HEAP32[$3>>2]|0;
|
|
$443 = (_strcmp($442,10486)|0);
|
|
$444 = ($443|0)!=(0);
|
|
if (!($444)) {
|
|
HEAP32[$1>>2] = 21;
|
|
break;
|
|
}
|
|
$445 = HEAP32[$3>>2]|0;
|
|
$446 = (_strcmp($445,10501)|0);
|
|
$447 = ($446|0)!=(0);
|
|
if (!($447)) {
|
|
HEAP32[$1>>2] = 22;
|
|
break;
|
|
}
|
|
$448 = HEAP32[$3>>2]|0;
|
|
$449 = (_strcmp($448,10513)|0);
|
|
$450 = ($449|0)!=(0);
|
|
if (!($450)) {
|
|
HEAP32[$1>>2] = 23;
|
|
break;
|
|
}
|
|
$451 = HEAP32[$3>>2]|0;
|
|
$452 = (_strcmp($451,10527)|0);
|
|
$453 = ($452|0)!=(0);
|
|
if (!($453)) {
|
|
HEAP32[$1>>2] = 11;
|
|
break;
|
|
}
|
|
$454 = HEAP32[$3>>2]|0;
|
|
$455 = (_strcmp($454,10552)|0);
|
|
$456 = ($455|0)!=(0);
|
|
if (!($456)) {
|
|
HEAP32[$1>>2] = 24;
|
|
break;
|
|
}
|
|
$457 = HEAP32[$3>>2]|0;
|
|
$458 = (_strcmp($457,10569)|0);
|
|
$459 = ($458|0)!=(0);
|
|
if (!($459)) {
|
|
HEAP32[$1>>2] = 25;
|
|
break;
|
|
}
|
|
$460 = HEAP32[$3>>2]|0;
|
|
$461 = (_strcmp($460,10585)|0);
|
|
$462 = ($461|0)!=(0);
|
|
if (!($462)) {
|
|
HEAP32[$1>>2] = 26;
|
|
break;
|
|
}
|
|
$463 = HEAP32[$3>>2]|0;
|
|
$464 = (_strcmp($463,10601)|0);
|
|
$465 = ($464|0)!=(0);
|
|
if (!($465)) {
|
|
HEAP32[$1>>2] = 12;
|
|
break;
|
|
}
|
|
$466 = HEAP32[$3>>2]|0;
|
|
$467 = (_strcmp($466,10613)|0);
|
|
$468 = ($467|0)!=(0);
|
|
if (!($468)) {
|
|
HEAP32[$1>>2] = 33;
|
|
break;
|
|
}
|
|
$469 = HEAP32[$3>>2]|0;
|
|
$470 = (_strcmp($469,10625)|0);
|
|
$471 = ($470|0)!=(0);
|
|
if (!($471)) {
|
|
HEAP32[$1>>2] = 34;
|
|
break;
|
|
}
|
|
$472 = HEAP32[$3>>2]|0;
|
|
$473 = (_strcmp($472,10649)|0);
|
|
$474 = ($473|0)!=(0);
|
|
if (!($474)) {
|
|
HEAP32[$1>>2] = 1;
|
|
break;
|
|
}
|
|
$475 = HEAP32[$3>>2]|0;
|
|
$476 = (_strcmp($475,10662)|0);
|
|
$477 = ($476|0)!=(0);
|
|
if (!($477)) {
|
|
HEAP32[$1>>2] = 2;
|
|
break;
|
|
}
|
|
$478 = HEAP32[$3>>2]|0;
|
|
$479 = (_strcmp($478,10676)|0);
|
|
$480 = ($479|0)!=(0);
|
|
if (!($480)) {
|
|
HEAP32[$1>>2] = 35;
|
|
break;
|
|
}
|
|
$481 = HEAP32[$3>>2]|0;
|
|
$482 = (_strcmp($481,10698)|0);
|
|
$483 = ($482|0)!=(0);
|
|
if (!($483)) {
|
|
HEAP32[$1>>2] = 36;
|
|
break;
|
|
}
|
|
$484 = HEAP32[$3>>2]|0;
|
|
$485 = (_strcmp($484,10705)|0);
|
|
$486 = ($485|0)!=(0);
|
|
if (!($486)) {
|
|
HEAP32[$1>>2] = 3;
|
|
break;
|
|
}
|
|
$487 = HEAP32[$3>>2]|0;
|
|
$488 = (_strcmp($487,10721)|0);
|
|
$489 = ($488|0)!=(0);
|
|
if (!($489)) {
|
|
HEAP32[$1>>2] = 2;
|
|
break;
|
|
}
|
|
$490 = HEAP32[$3>>2]|0;
|
|
$491 = (_strcmp($490,10738)|0);
|
|
$492 = ($491|0)!=(0);
|
|
if (!($492)) {
|
|
HEAP32[$1>>2] = 1;
|
|
break;
|
|
}
|
|
$493 = HEAP32[$3>>2]|0;
|
|
$494 = (_strcmp($493,10755)|0);
|
|
$495 = ($494|0)!=(0);
|
|
if (!($495)) {
|
|
HEAP32[$1>>2] = 28;
|
|
break;
|
|
}
|
|
$496 = HEAP32[$3>>2]|0;
|
|
$497 = (_strcmp($496,10771)|0);
|
|
$498 = ($497|0)!=(0);
|
|
if (!($498)) {
|
|
HEAP32[$1>>2] = 1;
|
|
break;
|
|
}
|
|
$499 = HEAP32[$3>>2]|0;
|
|
$500 = (_strcmp($499,10787)|0);
|
|
$501 = ($500|0)!=(0);
|
|
if (!($501)) {
|
|
HEAP32[$1>>2] = 4;
|
|
break;
|
|
}
|
|
$502 = HEAP32[$3>>2]|0;
|
|
$503 = (_strcmp($502,10804)|0);
|
|
$504 = ($503|0)!=(0);
|
|
if (!($504)) {
|
|
HEAP32[$1>>2] = 29;
|
|
break;
|
|
}
|
|
$505 = HEAP32[$3>>2]|0;
|
|
$506 = (_strcmp($505,10818)|0);
|
|
$507 = ($506|0)!=(0);
|
|
if (!($507)) {
|
|
HEAP32[$1>>2] = 30;
|
|
break;
|
|
}
|
|
$508 = HEAP32[$3>>2]|0;
|
|
$509 = (_strcmp($508,10830)|0);
|
|
$510 = ($509|0)!=(0);
|
|
if (!($510)) {
|
|
HEAP32[$1>>2] = 22;
|
|
break;
|
|
}
|
|
$511 = HEAP32[$3>>2]|0;
|
|
$512 = (_strcmp($511,10841)|0);
|
|
$513 = ($512|0)!=(0);
|
|
if (!($513)) {
|
|
HEAP32[$1>>2] = 2;
|
|
break;
|
|
}
|
|
$514 = HEAP32[$3>>2]|0;
|
|
$515 = (_strcmp($514,10854)|0);
|
|
$516 = ($515|0)!=(0);
|
|
if (!($516)) {
|
|
HEAP32[$1>>2] = 23;
|
|
break;
|
|
}
|
|
$517 = HEAP32[$3>>2]|0;
|
|
$518 = (_strcmp($517,10864)|0);
|
|
$519 = ($518|0)!=(0);
|
|
if (!($519)) {
|
|
HEAP32[$1>>2] = 2;
|
|
break;
|
|
}
|
|
$520 = HEAP32[$3>>2]|0;
|
|
$521 = (_strcmp($520,10881)|0);
|
|
$522 = ($521|0)!=(0);
|
|
if (!($522)) {
|
|
HEAP32[$1>>2] = 24;
|
|
break;
|
|
}
|
|
$523 = HEAP32[$3>>2]|0;
|
|
$524 = (_strcmp($523,10893)|0);
|
|
$525 = ($524|0)!=(0);
|
|
if (!($525)) {
|
|
HEAP32[$1>>2] = 25;
|
|
break;
|
|
}
|
|
$526 = HEAP32[$3>>2]|0;
|
|
$527 = (_strcmp($526,10915)|0);
|
|
$528 = ($527|0)!=(0);
|
|
if (!($528)) {
|
|
HEAP32[$1>>2] = 26;
|
|
break;
|
|
}
|
|
$529 = HEAP32[$3>>2]|0;
|
|
$530 = (_strcmp($529,10935)|0);
|
|
$531 = ($530|0)!=(0);
|
|
if (!($531)) {
|
|
HEAP32[$1>>2] = 3;
|
|
break;
|
|
}
|
|
$532 = HEAP32[$3>>2]|0;
|
|
$533 = (_strcmp($532,10948)|0);
|
|
$534 = ($533|0)!=(0);
|
|
if (!($534)) {
|
|
HEAP32[$1>>2] = 27;
|
|
break;
|
|
}
|
|
$535 = HEAP32[$3>>2]|0;
|
|
$536 = (_strcmp($535,10970)|0);
|
|
$537 = ($536|0)!=(0);
|
|
if (!($537)) {
|
|
HEAP32[$1>>2] = 28;
|
|
break;
|
|
}
|
|
$538 = HEAP32[$3>>2]|0;
|
|
$539 = (_strcmp($538,10990)|0);
|
|
$540 = ($539|0)!=(0);
|
|
if (!($540)) {
|
|
HEAP32[$1>>2] = 2;
|
|
break;
|
|
}
|
|
$541 = HEAP32[$3>>2]|0;
|
|
$542 = (_strcmp($541,11007)|0);
|
|
$543 = ($542|0)!=(0);
|
|
if (!($543)) {
|
|
HEAP32[$1>>2] = 2;
|
|
break;
|
|
}
|
|
$544 = HEAP32[$3>>2]|0;
|
|
$545 = (_strcmp($544,11024)|0);
|
|
$546 = ($545|0)!=(0);
|
|
if (!($546)) {
|
|
HEAP32[$1>>2] = 3;
|
|
break;
|
|
}
|
|
$547 = HEAP32[$3>>2]|0;
|
|
$548 = (_strcmp($547,11044)|0);
|
|
$549 = ($548|0)!=(0);
|
|
if ($549) {
|
|
$550 = HEAP32[$2>>2]|0;
|
|
$551 = HEAP32[$3>>2]|0;
|
|
$552 = _emscripten_asm_const_iii(0, ($550|0), ($551|0))|0;
|
|
HEAP32[$1>>2] = 0;
|
|
break;
|
|
} else {
|
|
HEAP32[$1>>2] = 37;
|
|
break;
|
|
}
|
|
} else {
|
|
HEAP32[$1>>2] = 5;
|
|
}
|
|
} while(0);
|
|
$553 = HEAP32[$1>>2]|0;
|
|
STACKTOP = sp;return ($553|0);
|
|
}
|
|
function _emscripten_get_global_libc() {
|
|
var label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
return (33224|0);
|
|
}
|
|
function ___emscripten_pthread_data_constructor() {
|
|
var $0 = 0, $1 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$0 = (_pthread_self()|0);
|
|
$1 = ((($0)) + 188|0);
|
|
HEAP32[$1>>2] = (33264);
|
|
return;
|
|
}
|
|
function ___stdio_close($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $vararg_buffer = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
|
|
$vararg_buffer = sp;
|
|
$1 = ((($0)) + 60|0);
|
|
$2 = HEAP32[$1>>2]|0;
|
|
$3 = (_dummy_736($2)|0);
|
|
HEAP32[$vararg_buffer>>2] = $3;
|
|
$4 = (___syscall6(6,($vararg_buffer|0))|0);
|
|
$5 = (___syscall_ret($4)|0);
|
|
STACKTOP = sp;return ($5|0);
|
|
}
|
|
function ___stdio_write($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $$0 = 0, $$04756 = 0, $$04855 = 0, $$04954 = 0, $$051 = 0, $$1 = 0, $$150 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0;
|
|
var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0;
|
|
var $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_buffer3 = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr6 = 0;
|
|
var $vararg_ptr7 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 48|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(48|0);
|
|
$vararg_buffer3 = sp + 16|0;
|
|
$vararg_buffer = sp;
|
|
$3 = sp + 32|0;
|
|
$4 = ((($0)) + 28|0);
|
|
$5 = HEAP32[$4>>2]|0;
|
|
HEAP32[$3>>2] = $5;
|
|
$6 = ((($3)) + 4|0);
|
|
$7 = ((($0)) + 20|0);
|
|
$8 = HEAP32[$7>>2]|0;
|
|
$9 = (($8) - ($5))|0;
|
|
HEAP32[$6>>2] = $9;
|
|
$10 = ((($3)) + 8|0);
|
|
HEAP32[$10>>2] = $1;
|
|
$11 = ((($3)) + 12|0);
|
|
HEAP32[$11>>2] = $2;
|
|
$12 = (($9) + ($2))|0;
|
|
$13 = ((($0)) + 60|0);
|
|
$14 = HEAP32[$13>>2]|0;
|
|
$15 = $3;
|
|
HEAP32[$vararg_buffer>>2] = $14;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = $15;
|
|
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
|
|
HEAP32[$vararg_ptr2>>2] = 2;
|
|
$16 = (___syscall146(146,($vararg_buffer|0))|0);
|
|
$17 = (___syscall_ret($16)|0);
|
|
$18 = ($12|0)==($17|0);
|
|
L1: do {
|
|
if ($18) {
|
|
label = 3;
|
|
} else {
|
|
$$04756 = 2;$$04855 = $12;$$04954 = $3;$26 = $17;
|
|
while(1) {
|
|
$25 = ($26|0)<(0);
|
|
if ($25) {
|
|
break;
|
|
}
|
|
$34 = (($$04855) - ($26))|0;
|
|
$35 = ((($$04954)) + 4|0);
|
|
$36 = HEAP32[$35>>2]|0;
|
|
$37 = ($26>>>0)>($36>>>0);
|
|
$38 = ((($$04954)) + 8|0);
|
|
$$150 = $37 ? $38 : $$04954;
|
|
$39 = $37 << 31 >> 31;
|
|
$$1 = (($39) + ($$04756))|0;
|
|
$40 = $37 ? $36 : 0;
|
|
$$0 = (($26) - ($40))|0;
|
|
$41 = HEAP32[$$150>>2]|0;
|
|
$42 = (($41) + ($$0)|0);
|
|
HEAP32[$$150>>2] = $42;
|
|
$43 = ((($$150)) + 4|0);
|
|
$44 = HEAP32[$43>>2]|0;
|
|
$45 = (($44) - ($$0))|0;
|
|
HEAP32[$43>>2] = $45;
|
|
$46 = HEAP32[$13>>2]|0;
|
|
$47 = $$150;
|
|
HEAP32[$vararg_buffer3>>2] = $46;
|
|
$vararg_ptr6 = ((($vararg_buffer3)) + 4|0);
|
|
HEAP32[$vararg_ptr6>>2] = $47;
|
|
$vararg_ptr7 = ((($vararg_buffer3)) + 8|0);
|
|
HEAP32[$vararg_ptr7>>2] = $$1;
|
|
$48 = (___syscall146(146,($vararg_buffer3|0))|0);
|
|
$49 = (___syscall_ret($48)|0);
|
|
$50 = ($34|0)==($49|0);
|
|
if ($50) {
|
|
label = 3;
|
|
break L1;
|
|
} else {
|
|
$$04756 = $$1;$$04855 = $34;$$04954 = $$150;$26 = $49;
|
|
}
|
|
}
|
|
$27 = ((($0)) + 16|0);
|
|
HEAP32[$27>>2] = 0;
|
|
HEAP32[$4>>2] = 0;
|
|
HEAP32[$7>>2] = 0;
|
|
$28 = HEAP32[$0>>2]|0;
|
|
$29 = $28 | 32;
|
|
HEAP32[$0>>2] = $29;
|
|
$30 = ($$04756|0)==(2);
|
|
if ($30) {
|
|
$$051 = 0;
|
|
} else {
|
|
$31 = ((($$04954)) + 4|0);
|
|
$32 = HEAP32[$31>>2]|0;
|
|
$33 = (($2) - ($32))|0;
|
|
$$051 = $33;
|
|
}
|
|
}
|
|
} while(0);
|
|
if ((label|0) == 3) {
|
|
$19 = ((($0)) + 44|0);
|
|
$20 = HEAP32[$19>>2]|0;
|
|
$21 = ((($0)) + 48|0);
|
|
$22 = HEAP32[$21>>2]|0;
|
|
$23 = (($20) + ($22)|0);
|
|
$24 = ((($0)) + 16|0);
|
|
HEAP32[$24>>2] = $23;
|
|
HEAP32[$4>>2] = $20;
|
|
HEAP32[$7>>2] = $20;
|
|
$$051 = $2;
|
|
}
|
|
STACKTOP = sp;return ($$051|0);
|
|
}
|
|
function ___stdio_seek($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $$pre = 0, $10 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, $vararg_ptr3 = 0, $vararg_ptr4 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
|
|
$vararg_buffer = sp;
|
|
$3 = sp + 20|0;
|
|
$4 = ((($0)) + 60|0);
|
|
$5 = HEAP32[$4>>2]|0;
|
|
$6 = $3;
|
|
HEAP32[$vararg_buffer>>2] = $5;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = 0;
|
|
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
|
|
HEAP32[$vararg_ptr2>>2] = $1;
|
|
$vararg_ptr3 = ((($vararg_buffer)) + 12|0);
|
|
HEAP32[$vararg_ptr3>>2] = $6;
|
|
$vararg_ptr4 = ((($vararg_buffer)) + 16|0);
|
|
HEAP32[$vararg_ptr4>>2] = $2;
|
|
$7 = (___syscall140(140,($vararg_buffer|0))|0);
|
|
$8 = (___syscall_ret($7)|0);
|
|
$9 = ($8|0)<(0);
|
|
if ($9) {
|
|
HEAP32[$3>>2] = -1;
|
|
$10 = -1;
|
|
} else {
|
|
$$pre = HEAP32[$3>>2]|0;
|
|
$10 = $$pre;
|
|
}
|
|
STACKTOP = sp;return ($10|0);
|
|
}
|
|
function ___syscall_ret($0) {
|
|
$0 = $0|0;
|
|
var $$0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = ($0>>>0)>(4294963200);
|
|
if ($1) {
|
|
$2 = (0 - ($0))|0;
|
|
$3 = (___errno_location()|0);
|
|
HEAP32[$3>>2] = $2;
|
|
$$0 = -1;
|
|
} else {
|
|
$$0 = $0;
|
|
}
|
|
return ($$0|0);
|
|
}
|
|
function ___errno_location() {
|
|
var $0 = 0, $1 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$0 = (___pthread_self_108()|0);
|
|
$1 = ((($0)) + 64|0);
|
|
return ($1|0);
|
|
}
|
|
function ___pthread_self_108() {
|
|
var $0 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$0 = (_pthread_self()|0);
|
|
return ($0|0);
|
|
}
|
|
function _dummy_736($0) {
|
|
$0 = $0|0;
|
|
var label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
return ($0|0);
|
|
}
|
|
function ___stdout_write($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $vararg_buffer = 0, $vararg_ptr1 = 0, $vararg_ptr2 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
|
|
$vararg_buffer = sp;
|
|
$3 = sp + 16|0;
|
|
$4 = ((($0)) + 36|0);
|
|
HEAP32[$4>>2] = 9;
|
|
$5 = HEAP32[$0>>2]|0;
|
|
$6 = $5 & 64;
|
|
$7 = ($6|0)==(0);
|
|
if ($7) {
|
|
$8 = ((($0)) + 60|0);
|
|
$9 = HEAP32[$8>>2]|0;
|
|
$10 = $3;
|
|
HEAP32[$vararg_buffer>>2] = $9;
|
|
$vararg_ptr1 = ((($vararg_buffer)) + 4|0);
|
|
HEAP32[$vararg_ptr1>>2] = 21523;
|
|
$vararg_ptr2 = ((($vararg_buffer)) + 8|0);
|
|
HEAP32[$vararg_ptr2>>2] = $10;
|
|
$11 = (___syscall54(54,($vararg_buffer|0))|0);
|
|
$12 = ($11|0)==(0);
|
|
if (!($12)) {
|
|
$13 = ((($0)) + 75|0);
|
|
HEAP8[$13>>0] = -1;
|
|
}
|
|
}
|
|
$14 = (___stdio_write($0,$1,$2)|0);
|
|
STACKTOP = sp;return ($14|0);
|
|
}
|
|
function _strcmp($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$011 = 0, $$0710 = 0, $$lcssa = 0, $$lcssa8 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond9 = 0, label = 0;
|
|
var sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = HEAP8[$0>>0]|0;
|
|
$3 = HEAP8[$1>>0]|0;
|
|
$4 = ($2<<24>>24)!=($3<<24>>24);
|
|
$5 = ($2<<24>>24)==(0);
|
|
$or$cond9 = $5 | $4;
|
|
if ($or$cond9) {
|
|
$$lcssa = $3;$$lcssa8 = $2;
|
|
} else {
|
|
$$011 = $1;$$0710 = $0;
|
|
while(1) {
|
|
$6 = ((($$0710)) + 1|0);
|
|
$7 = ((($$011)) + 1|0);
|
|
$8 = HEAP8[$6>>0]|0;
|
|
$9 = HEAP8[$7>>0]|0;
|
|
$10 = ($8<<24>>24)!=($9<<24>>24);
|
|
$11 = ($8<<24>>24)==(0);
|
|
$or$cond = $11 | $10;
|
|
if ($or$cond) {
|
|
$$lcssa = $9;$$lcssa8 = $8;
|
|
break;
|
|
} else {
|
|
$$011 = $7;$$0710 = $6;
|
|
}
|
|
}
|
|
}
|
|
$12 = $$lcssa8&255;
|
|
$13 = $$lcssa&255;
|
|
$14 = (($12) - ($13))|0;
|
|
return ($14|0);
|
|
}
|
|
function _memcmp($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $$01318 = 0, $$01417 = 0, $$019 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = ($2|0)==(0);
|
|
L1: do {
|
|
if ($3) {
|
|
$14 = 0;
|
|
} else {
|
|
$$01318 = $0;$$01417 = $2;$$019 = $1;
|
|
while(1) {
|
|
$4 = HEAP8[$$01318>>0]|0;
|
|
$5 = HEAP8[$$019>>0]|0;
|
|
$6 = ($4<<24>>24)==($5<<24>>24);
|
|
if (!($6)) {
|
|
break;
|
|
}
|
|
$7 = (($$01417) + -1)|0;
|
|
$8 = ((($$01318)) + 1|0);
|
|
$9 = ((($$019)) + 1|0);
|
|
$10 = ($7|0)==(0);
|
|
if ($10) {
|
|
$14 = 0;
|
|
break L1;
|
|
} else {
|
|
$$01318 = $8;$$01417 = $7;$$019 = $9;
|
|
}
|
|
}
|
|
$11 = $4&255;
|
|
$12 = $5&255;
|
|
$13 = (($11) - ($12))|0;
|
|
$14 = $13;
|
|
}
|
|
} while(0);
|
|
return ($14|0);
|
|
}
|
|
function _vsnprintf($0,$1,$2,$3) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
var $$$015 = 0, $$0 = 0, $$014 = 0, $$015 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
|
|
var $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, src = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 128|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(128|0);
|
|
$4 = sp + 124|0;
|
|
$5 = sp;
|
|
dest=$5; src=3120; stop=dest+124|0; do { HEAP32[dest>>2]=HEAP32[src>>2]|0; dest=dest+4|0; src=src+4|0; } while ((dest|0) < (stop|0));
|
|
$6 = (($1) + -1)|0;
|
|
$7 = ($6>>>0)>(2147483646);
|
|
if ($7) {
|
|
$8 = ($1|0)==(0);
|
|
if ($8) {
|
|
$$014 = $4;$$015 = 1;
|
|
label = 4;
|
|
} else {
|
|
$9 = (___errno_location()|0);
|
|
HEAP32[$9>>2] = 75;
|
|
$$0 = -1;
|
|
}
|
|
} else {
|
|
$$014 = $0;$$015 = $1;
|
|
label = 4;
|
|
}
|
|
if ((label|0) == 4) {
|
|
$10 = $$014;
|
|
$11 = (-2 - ($10))|0;
|
|
$12 = ($$015>>>0)>($11>>>0);
|
|
$$$015 = $12 ? $11 : $$015;
|
|
$13 = ((($5)) + 48|0);
|
|
HEAP32[$13>>2] = $$$015;
|
|
$14 = ((($5)) + 20|0);
|
|
HEAP32[$14>>2] = $$014;
|
|
$15 = ((($5)) + 44|0);
|
|
HEAP32[$15>>2] = $$014;
|
|
$16 = (($$014) + ($$$015)|0);
|
|
$17 = ((($5)) + 16|0);
|
|
HEAP32[$17>>2] = $16;
|
|
$18 = ((($5)) + 28|0);
|
|
HEAP32[$18>>2] = $16;
|
|
$19 = (_vfprintf($5,$2,$3)|0);
|
|
$20 = ($$$015|0)==(0);
|
|
if ($20) {
|
|
$$0 = $19;
|
|
} else {
|
|
$21 = HEAP32[$14>>2]|0;
|
|
$22 = HEAP32[$17>>2]|0;
|
|
$23 = ($21|0)==($22|0);
|
|
$24 = $23 << 31 >> 31;
|
|
$25 = (($21) + ($24)|0);
|
|
HEAP8[$25>>0] = 0;
|
|
$$0 = $19;
|
|
}
|
|
}
|
|
STACKTOP = sp;return ($$0|0);
|
|
}
|
|
function _vfprintf($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $$ = 0, $$0 = 0, $$1 = 0, $$1$ = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
|
|
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $5 = 0, $6 = 0, $7 = 0;
|
|
var $8 = 0, $9 = 0, $vacopy_currentptr = 0, dest = 0, label = 0, sp = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 224|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(224|0);
|
|
$3 = sp + 120|0;
|
|
$4 = sp + 80|0;
|
|
$5 = sp;
|
|
$6 = sp + 136|0;
|
|
dest=$4; stop=dest+40|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
|
|
$vacopy_currentptr = HEAP32[$2>>2]|0;
|
|
HEAP32[$3>>2] = $vacopy_currentptr;
|
|
$7 = (_printf_core(0,$1,$3,$5,$4)|0);
|
|
$8 = ($7|0)<(0);
|
|
if ($8) {
|
|
$$0 = -1;
|
|
} else {
|
|
$9 = ((($0)) + 76|0);
|
|
$10 = (Atomics_load(HEAP32,$9>>2)|0);
|
|
$11 = ($10|0)>(-1);
|
|
if ($11) {
|
|
$12 = (___lockfile($0)|0);
|
|
$40 = $12;
|
|
} else {
|
|
$40 = 0;
|
|
}
|
|
$13 = HEAP32[$0>>2]|0;
|
|
$14 = $13 & 32;
|
|
$15 = ((($0)) + 74|0);
|
|
$16 = HEAP8[$15>>0]|0;
|
|
$17 = ($16<<24>>24)<(1);
|
|
if ($17) {
|
|
$18 = $13 & -33;
|
|
HEAP32[$0>>2] = $18;
|
|
}
|
|
$19 = ((($0)) + 48|0);
|
|
$20 = HEAP32[$19>>2]|0;
|
|
$21 = ($20|0)==(0);
|
|
if ($21) {
|
|
$23 = ((($0)) + 44|0);
|
|
$24 = HEAP32[$23>>2]|0;
|
|
HEAP32[$23>>2] = $6;
|
|
$25 = ((($0)) + 28|0);
|
|
HEAP32[$25>>2] = $6;
|
|
$26 = ((($0)) + 20|0);
|
|
HEAP32[$26>>2] = $6;
|
|
HEAP32[$19>>2] = 80;
|
|
$27 = ((($6)) + 80|0);
|
|
$28 = ((($0)) + 16|0);
|
|
HEAP32[$28>>2] = $27;
|
|
$29 = (_printf_core($0,$1,$3,$5,$4)|0);
|
|
$30 = ($24|0)==(0|0);
|
|
if ($30) {
|
|
$$1 = $29;
|
|
} else {
|
|
$31 = ((($0)) + 36|0);
|
|
$32 = HEAP32[$31>>2]|0;
|
|
(FUNCTION_TABLE_iiii[$32 & 15]($0,0,0)|0);
|
|
$33 = HEAP32[$26>>2]|0;
|
|
$34 = ($33|0)==(0|0);
|
|
$$ = $34 ? -1 : $29;
|
|
HEAP32[$23>>2] = $24;
|
|
HEAP32[$19>>2] = 0;
|
|
HEAP32[$28>>2] = 0;
|
|
HEAP32[$25>>2] = 0;
|
|
HEAP32[$26>>2] = 0;
|
|
$$1 = $$;
|
|
}
|
|
} else {
|
|
$22 = (_printf_core($0,$1,$3,$5,$4)|0);
|
|
$$1 = $22;
|
|
}
|
|
$35 = HEAP32[$0>>2]|0;
|
|
$36 = $35 & 32;
|
|
$37 = ($36|0)==(0);
|
|
$$1$ = $37 ? $$1 : -1;
|
|
$38 = $35 | $14;
|
|
HEAP32[$0>>2] = $38;
|
|
$39 = ($40|0)==(0);
|
|
if (!($39)) {
|
|
___unlockfile($0);
|
|
}
|
|
$$0 = $$1$;
|
|
}
|
|
STACKTOP = sp;return ($$0|0);
|
|
}
|
|
function _printf_core($0,$1,$2,$3,$4) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
$4 = $4|0;
|
|
var $$ = 0, $$$ = 0, $$$0259 = 0, $$$0262 = 0, $$$0269 = 0, $$$4266 = 0, $$$5 = 0, $$0 = 0, $$0228 = 0, $$0228$ = 0, $$0229322 = 0, $$0232 = 0, $$0235 = 0, $$0237 = 0, $$0240$lcssa = 0, $$0240$lcssa357 = 0, $$0240321 = 0, $$0243 = 0, $$0247 = 0, $$0249$lcssa = 0;
|
|
var $$0249306 = 0, $$0252 = 0, $$0253 = 0, $$0254 = 0, $$0254$$0254$ = 0, $$0259 = 0, $$0262$lcssa = 0, $$0262311 = 0, $$0269 = 0, $$0269$phi = 0, $$1 = 0, $$1230333 = 0, $$1233 = 0, $$1236 = 0, $$1238 = 0, $$1241332 = 0, $$1244320 = 0, $$1248 = 0, $$1250 = 0, $$1255 = 0;
|
|
var $$1260 = 0, $$1263 = 0, $$1263$ = 0, $$1270 = 0, $$2 = 0, $$2234 = 0, $$2239 = 0, $$2242305 = 0, $$2245 = 0, $$2251 = 0, $$2256 = 0, $$2256$ = 0, $$2256$$$2256 = 0, $$2261 = 0, $$2271 = 0, $$284$ = 0, $$289 = 0, $$290 = 0, $$3257 = 0, $$3265 = 0;
|
|
var $$3272 = 0, $$3303 = 0, $$377 = 0, $$4258355 = 0, $$4266 = 0, $$5 = 0, $$6268 = 0, $$lcssa295 = 0, $$pre = 0, $$pre346 = 0, $$pre347 = 0, $$pre347$pre = 0, $$pre349 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0;
|
|
var $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0;
|
|
var $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0;
|
|
var $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0;
|
|
var $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0;
|
|
var $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0;
|
|
var $197 = 0, $198 = 0, $199 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0;
|
|
var $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0;
|
|
var $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0;
|
|
var $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0;
|
|
var $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0;
|
|
var $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0;
|
|
var $306 = 0.0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0;
|
|
var $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
|
|
var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0;
|
|
var $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0;
|
|
var $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0;
|
|
var $arglist_current = 0, $arglist_current2 = 0, $arglist_next = 0, $arglist_next3 = 0, $expanded = 0, $expanded10 = 0, $expanded11 = 0, $expanded13 = 0, $expanded14 = 0, $expanded15 = 0, $expanded4 = 0, $expanded6 = 0, $expanded7 = 0, $expanded8 = 0, $isdigit = 0, $isdigit275 = 0, $isdigit277 = 0, $isdigittmp = 0, $isdigittmp$ = 0, $isdigittmp274 = 0;
|
|
var $isdigittmp276 = 0, $narrow = 0, $or$cond = 0, $or$cond281 = 0, $or$cond283 = 0, $or$cond286 = 0, $storemerge = 0, $storemerge273310 = 0, $storemerge278 = 0, $trunc = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 64|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(64|0);
|
|
$5 = sp + 16|0;
|
|
$6 = sp;
|
|
$7 = sp + 24|0;
|
|
$8 = sp + 8|0;
|
|
$9 = sp + 20|0;
|
|
HEAP32[$5>>2] = $1;
|
|
$10 = ($0|0)!=(0|0);
|
|
$11 = ((($7)) + 40|0);
|
|
$12 = $11;
|
|
$13 = ((($7)) + 39|0);
|
|
$14 = ((($8)) + 4|0);
|
|
$$0243 = 0;$$0247 = 0;$$0269 = 0;$21 = $1;
|
|
L1: while(1) {
|
|
$15 = ($$0247|0)>(-1);
|
|
do {
|
|
if ($15) {
|
|
$16 = (2147483647 - ($$0247))|0;
|
|
$17 = ($$0243|0)>($16|0);
|
|
if ($17) {
|
|
$18 = (___errno_location()|0);
|
|
HEAP32[$18>>2] = 75;
|
|
$$1248 = -1;
|
|
break;
|
|
} else {
|
|
$19 = (($$0243) + ($$0247))|0;
|
|
$$1248 = $19;
|
|
break;
|
|
}
|
|
} else {
|
|
$$1248 = $$0247;
|
|
}
|
|
} while(0);
|
|
$20 = HEAP8[$21>>0]|0;
|
|
$22 = ($20<<24>>24)==(0);
|
|
if ($22) {
|
|
label = 87;
|
|
break;
|
|
} else {
|
|
$23 = $20;$25 = $21;
|
|
}
|
|
L9: while(1) {
|
|
switch ($23<<24>>24) {
|
|
case 37: {
|
|
$$0249306 = $25;$27 = $25;
|
|
label = 9;
|
|
break L9;
|
|
break;
|
|
}
|
|
case 0: {
|
|
$$0249$lcssa = $25;$39 = $25;
|
|
break L9;
|
|
break;
|
|
}
|
|
default: {
|
|
}
|
|
}
|
|
$24 = ((($25)) + 1|0);
|
|
HEAP32[$5>>2] = $24;
|
|
$$pre = HEAP8[$24>>0]|0;
|
|
$23 = $$pre;$25 = $24;
|
|
}
|
|
L12: do {
|
|
if ((label|0) == 9) {
|
|
while(1) {
|
|
label = 0;
|
|
$26 = ((($27)) + 1|0);
|
|
$28 = HEAP8[$26>>0]|0;
|
|
$29 = ($28<<24>>24)==(37);
|
|
if (!($29)) {
|
|
$$0249$lcssa = $$0249306;$39 = $27;
|
|
break L12;
|
|
}
|
|
$30 = ((($$0249306)) + 1|0);
|
|
$31 = ((($27)) + 2|0);
|
|
HEAP32[$5>>2] = $31;
|
|
$32 = HEAP8[$31>>0]|0;
|
|
$33 = ($32<<24>>24)==(37);
|
|
if ($33) {
|
|
$$0249306 = $30;$27 = $31;
|
|
label = 9;
|
|
} else {
|
|
$$0249$lcssa = $30;$39 = $31;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$34 = $$0249$lcssa;
|
|
$35 = $21;
|
|
$36 = (($34) - ($35))|0;
|
|
if ($10) {
|
|
_out($0,$21,$36);
|
|
}
|
|
$37 = ($36|0)==(0);
|
|
if (!($37)) {
|
|
$$0269$phi = $$0269;$$0243 = $36;$$0247 = $$1248;$21 = $39;$$0269 = $$0269$phi;
|
|
continue;
|
|
}
|
|
$38 = ((($39)) + 1|0);
|
|
$40 = HEAP8[$38>>0]|0;
|
|
$41 = $40 << 24 >> 24;
|
|
$isdigittmp = (($41) + -48)|0;
|
|
$isdigit = ($isdigittmp>>>0)<(10);
|
|
if ($isdigit) {
|
|
$42 = ((($39)) + 2|0);
|
|
$43 = HEAP8[$42>>0]|0;
|
|
$44 = ($43<<24>>24)==(36);
|
|
$45 = ((($39)) + 3|0);
|
|
$$377 = $44 ? $45 : $38;
|
|
$$$0269 = $44 ? 1 : $$0269;
|
|
$isdigittmp$ = $44 ? $isdigittmp : -1;
|
|
$$0253 = $isdigittmp$;$$1270 = $$$0269;$storemerge = $$377;
|
|
} else {
|
|
$$0253 = -1;$$1270 = $$0269;$storemerge = $38;
|
|
}
|
|
HEAP32[$5>>2] = $storemerge;
|
|
$46 = HEAP8[$storemerge>>0]|0;
|
|
$47 = $46 << 24 >> 24;
|
|
$48 = (($47) + -32)|0;
|
|
$49 = ($48>>>0)<(32);
|
|
L24: do {
|
|
if ($49) {
|
|
$$0262311 = 0;$329 = $46;$51 = $48;$storemerge273310 = $storemerge;
|
|
while(1) {
|
|
$50 = 1 << $51;
|
|
$52 = $50 & 75913;
|
|
$53 = ($52|0)==(0);
|
|
if ($53) {
|
|
$$0262$lcssa = $$0262311;$$lcssa295 = $329;$62 = $storemerge273310;
|
|
break L24;
|
|
}
|
|
$54 = $50 | $$0262311;
|
|
$55 = ((($storemerge273310)) + 1|0);
|
|
HEAP32[$5>>2] = $55;
|
|
$56 = HEAP8[$55>>0]|0;
|
|
$57 = $56 << 24 >> 24;
|
|
$58 = (($57) + -32)|0;
|
|
$59 = ($58>>>0)<(32);
|
|
if ($59) {
|
|
$$0262311 = $54;$329 = $56;$51 = $58;$storemerge273310 = $55;
|
|
} else {
|
|
$$0262$lcssa = $54;$$lcssa295 = $56;$62 = $55;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$0262$lcssa = 0;$$lcssa295 = $46;$62 = $storemerge;
|
|
}
|
|
} while(0);
|
|
$60 = ($$lcssa295<<24>>24)==(42);
|
|
if ($60) {
|
|
$61 = ((($62)) + 1|0);
|
|
$63 = HEAP8[$61>>0]|0;
|
|
$64 = $63 << 24 >> 24;
|
|
$isdigittmp276 = (($64) + -48)|0;
|
|
$isdigit277 = ($isdigittmp276>>>0)<(10);
|
|
if ($isdigit277) {
|
|
$65 = ((($62)) + 2|0);
|
|
$66 = HEAP8[$65>>0]|0;
|
|
$67 = ($66<<24>>24)==(36);
|
|
if ($67) {
|
|
$68 = (($4) + ($isdigittmp276<<2)|0);
|
|
HEAP32[$68>>2] = 10;
|
|
$69 = HEAP8[$61>>0]|0;
|
|
$70 = $69 << 24 >> 24;
|
|
$71 = (($70) + -48)|0;
|
|
$72 = (($3) + ($71<<3)|0);
|
|
$73 = $72;
|
|
$74 = $73;
|
|
$75 = HEAP32[$74>>2]|0;
|
|
$76 = (($73) + 4)|0;
|
|
$77 = $76;
|
|
$78 = HEAP32[$77>>2]|0;
|
|
$79 = ((($62)) + 3|0);
|
|
$$0259 = $75;$$2271 = 1;$storemerge278 = $79;
|
|
} else {
|
|
label = 23;
|
|
}
|
|
} else {
|
|
label = 23;
|
|
}
|
|
if ((label|0) == 23) {
|
|
label = 0;
|
|
$80 = ($$1270|0)==(0);
|
|
if (!($80)) {
|
|
$$0 = -1;
|
|
break;
|
|
}
|
|
if ($10) {
|
|
$arglist_current = HEAP32[$2>>2]|0;
|
|
$81 = $arglist_current;
|
|
$82 = ((0) + 4|0);
|
|
$expanded4 = $82;
|
|
$expanded = (($expanded4) - 1)|0;
|
|
$83 = (($81) + ($expanded))|0;
|
|
$84 = ((0) + 4|0);
|
|
$expanded8 = $84;
|
|
$expanded7 = (($expanded8) - 1)|0;
|
|
$expanded6 = $expanded7 ^ -1;
|
|
$85 = $83 & $expanded6;
|
|
$86 = $85;
|
|
$87 = HEAP32[$86>>2]|0;
|
|
$arglist_next = ((($86)) + 4|0);
|
|
HEAP32[$2>>2] = $arglist_next;
|
|
$$0259 = $87;$$2271 = 0;$storemerge278 = $61;
|
|
} else {
|
|
$$0259 = 0;$$2271 = 0;$storemerge278 = $61;
|
|
}
|
|
}
|
|
HEAP32[$5>>2] = $storemerge278;
|
|
$88 = ($$0259|0)<(0);
|
|
$89 = $$0262$lcssa | 8192;
|
|
$90 = (0 - ($$0259))|0;
|
|
$$$0262 = $88 ? $89 : $$0262$lcssa;
|
|
$$$0259 = $88 ? $90 : $$0259;
|
|
$$1260 = $$$0259;$$1263 = $$$0262;$$3272 = $$2271;$94 = $storemerge278;
|
|
} else {
|
|
$91 = (_getint($5)|0);
|
|
$92 = ($91|0)<(0);
|
|
if ($92) {
|
|
$$0 = -1;
|
|
break;
|
|
}
|
|
$$pre346 = HEAP32[$5>>2]|0;
|
|
$$1260 = $91;$$1263 = $$0262$lcssa;$$3272 = $$1270;$94 = $$pre346;
|
|
}
|
|
$93 = HEAP8[$94>>0]|0;
|
|
$95 = ($93<<24>>24)==(46);
|
|
do {
|
|
if ($95) {
|
|
$96 = ((($94)) + 1|0);
|
|
$97 = HEAP8[$96>>0]|0;
|
|
$98 = ($97<<24>>24)==(42);
|
|
if (!($98)) {
|
|
$125 = ((($94)) + 1|0);
|
|
HEAP32[$5>>2] = $125;
|
|
$126 = (_getint($5)|0);
|
|
$$pre347$pre = HEAP32[$5>>2]|0;
|
|
$$0254 = $126;$$pre347 = $$pre347$pre;
|
|
break;
|
|
}
|
|
$99 = ((($94)) + 2|0);
|
|
$100 = HEAP8[$99>>0]|0;
|
|
$101 = $100 << 24 >> 24;
|
|
$isdigittmp274 = (($101) + -48)|0;
|
|
$isdigit275 = ($isdigittmp274>>>0)<(10);
|
|
if ($isdigit275) {
|
|
$102 = ((($94)) + 3|0);
|
|
$103 = HEAP8[$102>>0]|0;
|
|
$104 = ($103<<24>>24)==(36);
|
|
if ($104) {
|
|
$105 = (($4) + ($isdigittmp274<<2)|0);
|
|
HEAP32[$105>>2] = 10;
|
|
$106 = HEAP8[$99>>0]|0;
|
|
$107 = $106 << 24 >> 24;
|
|
$108 = (($107) + -48)|0;
|
|
$109 = (($3) + ($108<<3)|0);
|
|
$110 = $109;
|
|
$111 = $110;
|
|
$112 = HEAP32[$111>>2]|0;
|
|
$113 = (($110) + 4)|0;
|
|
$114 = $113;
|
|
$115 = HEAP32[$114>>2]|0;
|
|
$116 = ((($94)) + 4|0);
|
|
HEAP32[$5>>2] = $116;
|
|
$$0254 = $112;$$pre347 = $116;
|
|
break;
|
|
}
|
|
}
|
|
$117 = ($$3272|0)==(0);
|
|
if (!($117)) {
|
|
$$0 = -1;
|
|
break L1;
|
|
}
|
|
if ($10) {
|
|
$arglist_current2 = HEAP32[$2>>2]|0;
|
|
$118 = $arglist_current2;
|
|
$119 = ((0) + 4|0);
|
|
$expanded11 = $119;
|
|
$expanded10 = (($expanded11) - 1)|0;
|
|
$120 = (($118) + ($expanded10))|0;
|
|
$121 = ((0) + 4|0);
|
|
$expanded15 = $121;
|
|
$expanded14 = (($expanded15) - 1)|0;
|
|
$expanded13 = $expanded14 ^ -1;
|
|
$122 = $120 & $expanded13;
|
|
$123 = $122;
|
|
$124 = HEAP32[$123>>2]|0;
|
|
$arglist_next3 = ((($123)) + 4|0);
|
|
HEAP32[$2>>2] = $arglist_next3;
|
|
$330 = $124;
|
|
} else {
|
|
$330 = 0;
|
|
}
|
|
HEAP32[$5>>2] = $99;
|
|
$$0254 = $330;$$pre347 = $99;
|
|
} else {
|
|
$$0254 = -1;$$pre347 = $94;
|
|
}
|
|
} while(0);
|
|
$$0252 = 0;$128 = $$pre347;
|
|
while(1) {
|
|
$127 = HEAP8[$128>>0]|0;
|
|
$129 = $127 << 24 >> 24;
|
|
$130 = (($129) + -65)|0;
|
|
$131 = ($130>>>0)>(57);
|
|
if ($131) {
|
|
$$0 = -1;
|
|
break L1;
|
|
}
|
|
$132 = ((($128)) + 1|0);
|
|
HEAP32[$5>>2] = $132;
|
|
$133 = HEAP8[$128>>0]|0;
|
|
$134 = $133 << 24 >> 24;
|
|
$135 = (($134) + -65)|0;
|
|
$136 = ((11160 + (($$0252*58)|0)|0) + ($135)|0);
|
|
$137 = HEAP8[$136>>0]|0;
|
|
$138 = $137&255;
|
|
$139 = (($138) + -1)|0;
|
|
$140 = ($139>>>0)<(8);
|
|
if ($140) {
|
|
$$0252 = $138;$128 = $132;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
$141 = ($137<<24>>24)==(0);
|
|
if ($141) {
|
|
$$0 = -1;
|
|
break;
|
|
}
|
|
$142 = ($137<<24>>24)==(19);
|
|
$143 = ($$0253|0)>(-1);
|
|
do {
|
|
if ($142) {
|
|
if ($143) {
|
|
$$0 = -1;
|
|
break L1;
|
|
} else {
|
|
label = 49;
|
|
}
|
|
} else {
|
|
if ($143) {
|
|
$144 = (($4) + ($$0253<<2)|0);
|
|
HEAP32[$144>>2] = $138;
|
|
$145 = (($3) + ($$0253<<3)|0);
|
|
$146 = $145;
|
|
$147 = $146;
|
|
$148 = HEAP32[$147>>2]|0;
|
|
$149 = (($146) + 4)|0;
|
|
$150 = $149;
|
|
$151 = HEAP32[$150>>2]|0;
|
|
$152 = $6;
|
|
$153 = $152;
|
|
HEAP32[$153>>2] = $148;
|
|
$154 = (($152) + 4)|0;
|
|
$155 = $154;
|
|
HEAP32[$155>>2] = $151;
|
|
label = 49;
|
|
break;
|
|
}
|
|
if (!($10)) {
|
|
$$0 = 0;
|
|
break L1;
|
|
}
|
|
_pop_arg($6,$138,$2);
|
|
}
|
|
} while(0);
|
|
if ((label|0) == 49) {
|
|
label = 0;
|
|
if (!($10)) {
|
|
$$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
|
|
continue;
|
|
}
|
|
}
|
|
$156 = HEAP8[$128>>0]|0;
|
|
$157 = $156 << 24 >> 24;
|
|
$158 = ($$0252|0)!=(0);
|
|
$159 = $157 & 15;
|
|
$160 = ($159|0)==(3);
|
|
$or$cond281 = $158 & $160;
|
|
$161 = $157 & -33;
|
|
$$0235 = $or$cond281 ? $161 : $157;
|
|
$162 = $$1263 & 8192;
|
|
$163 = ($162|0)==(0);
|
|
$164 = $$1263 & -65537;
|
|
$$1263$ = $163 ? $$1263 : $164;
|
|
L71: do {
|
|
switch ($$0235|0) {
|
|
case 110: {
|
|
$trunc = $$0252&255;
|
|
switch ($trunc<<24>>24) {
|
|
case 0: {
|
|
$171 = HEAP32[$6>>2]|0;
|
|
HEAP32[$171>>2] = $$1248;
|
|
$$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
|
|
continue L1;
|
|
break;
|
|
}
|
|
case 1: {
|
|
$172 = HEAP32[$6>>2]|0;
|
|
HEAP32[$172>>2] = $$1248;
|
|
$$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
|
|
continue L1;
|
|
break;
|
|
}
|
|
case 2: {
|
|
$173 = ($$1248|0)<(0);
|
|
$174 = $173 << 31 >> 31;
|
|
$175 = HEAP32[$6>>2]|0;
|
|
$176 = $175;
|
|
$177 = $176;
|
|
HEAP32[$177>>2] = $$1248;
|
|
$178 = (($176) + 4)|0;
|
|
$179 = $178;
|
|
HEAP32[$179>>2] = $174;
|
|
$$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
|
|
continue L1;
|
|
break;
|
|
}
|
|
case 3: {
|
|
$180 = $$1248&65535;
|
|
$181 = HEAP32[$6>>2]|0;
|
|
HEAP16[$181>>1] = $180;
|
|
$$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
|
|
continue L1;
|
|
break;
|
|
}
|
|
case 4: {
|
|
$182 = $$1248&255;
|
|
$183 = HEAP32[$6>>2]|0;
|
|
HEAP8[$183>>0] = $182;
|
|
$$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
|
|
continue L1;
|
|
break;
|
|
}
|
|
case 6: {
|
|
$184 = HEAP32[$6>>2]|0;
|
|
HEAP32[$184>>2] = $$1248;
|
|
$$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
|
|
continue L1;
|
|
break;
|
|
}
|
|
case 7: {
|
|
$185 = ($$1248|0)<(0);
|
|
$186 = $185 << 31 >> 31;
|
|
$187 = HEAP32[$6>>2]|0;
|
|
$188 = $187;
|
|
$189 = $188;
|
|
HEAP32[$189>>2] = $$1248;
|
|
$190 = (($188) + 4)|0;
|
|
$191 = $190;
|
|
HEAP32[$191>>2] = $186;
|
|
$$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
|
|
continue L1;
|
|
break;
|
|
}
|
|
default: {
|
|
$$0243 = 0;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
|
|
continue L1;
|
|
}
|
|
}
|
|
break;
|
|
}
|
|
case 112: {
|
|
$192 = ($$0254>>>0)>(8);
|
|
$193 = $192 ? $$0254 : 8;
|
|
$194 = $$1263$ | 8;
|
|
$$1236 = 120;$$1255 = $193;$$3265 = $194;
|
|
label = 61;
|
|
break;
|
|
}
|
|
case 88: case 120: {
|
|
$$1236 = $$0235;$$1255 = $$0254;$$3265 = $$1263$;
|
|
label = 61;
|
|
break;
|
|
}
|
|
case 111: {
|
|
$210 = $6;
|
|
$211 = $210;
|
|
$212 = HEAP32[$211>>2]|0;
|
|
$213 = (($210) + 4)|0;
|
|
$214 = $213;
|
|
$215 = HEAP32[$214>>2]|0;
|
|
$216 = (_fmt_o($212,$215,$11)|0);
|
|
$217 = $$1263$ & 8;
|
|
$218 = ($217|0)==(0);
|
|
$219 = $216;
|
|
$220 = (($12) - ($219))|0;
|
|
$221 = ($$0254|0)>($220|0);
|
|
$222 = (($220) + 1)|0;
|
|
$223 = $218 | $221;
|
|
$$0254$$0254$ = $223 ? $$0254 : $222;
|
|
$$0228 = $216;$$1233 = 0;$$1238 = 11624;$$2256 = $$0254$$0254$;$$4266 = $$1263$;$248 = $212;$250 = $215;
|
|
label = 67;
|
|
break;
|
|
}
|
|
case 105: case 100: {
|
|
$224 = $6;
|
|
$225 = $224;
|
|
$226 = HEAP32[$225>>2]|0;
|
|
$227 = (($224) + 4)|0;
|
|
$228 = $227;
|
|
$229 = HEAP32[$228>>2]|0;
|
|
$230 = ($229|0)<(0);
|
|
if ($230) {
|
|
$231 = (_i64Subtract(0,0,($226|0),($229|0))|0);
|
|
$232 = tempRet0;
|
|
$233 = $6;
|
|
$234 = $233;
|
|
HEAP32[$234>>2] = $231;
|
|
$235 = (($233) + 4)|0;
|
|
$236 = $235;
|
|
HEAP32[$236>>2] = $232;
|
|
$$0232 = 1;$$0237 = 11624;$242 = $231;$243 = $232;
|
|
label = 66;
|
|
break L71;
|
|
} else {
|
|
$237 = $$1263$ & 2048;
|
|
$238 = ($237|0)==(0);
|
|
$239 = $$1263$ & 1;
|
|
$240 = ($239|0)==(0);
|
|
$$ = $240 ? 11624 : (11626);
|
|
$$$ = $238 ? $$ : (11625);
|
|
$241 = $$1263$ & 2049;
|
|
$narrow = ($241|0)!=(0);
|
|
$$284$ = $narrow&1;
|
|
$$0232 = $$284$;$$0237 = $$$;$242 = $226;$243 = $229;
|
|
label = 66;
|
|
break L71;
|
|
}
|
|
break;
|
|
}
|
|
case 117: {
|
|
$165 = $6;
|
|
$166 = $165;
|
|
$167 = HEAP32[$166>>2]|0;
|
|
$168 = (($165) + 4)|0;
|
|
$169 = $168;
|
|
$170 = HEAP32[$169>>2]|0;
|
|
$$0232 = 0;$$0237 = 11624;$242 = $167;$243 = $170;
|
|
label = 66;
|
|
break;
|
|
}
|
|
case 99: {
|
|
$259 = $6;
|
|
$260 = $259;
|
|
$261 = HEAP32[$260>>2]|0;
|
|
$262 = (($259) + 4)|0;
|
|
$263 = $262;
|
|
$264 = HEAP32[$263>>2]|0;
|
|
$265 = $261&255;
|
|
HEAP8[$13>>0] = $265;
|
|
$$2 = $13;$$2234 = 0;$$2239 = 11624;$$2251 = $11;$$5 = 1;$$6268 = $164;
|
|
break;
|
|
}
|
|
case 109: {
|
|
$266 = (___errno_location()|0);
|
|
$267 = HEAP32[$266>>2]|0;
|
|
$268 = (_strerror($267)|0);
|
|
$$1 = $268;
|
|
label = 71;
|
|
break;
|
|
}
|
|
case 115: {
|
|
$269 = HEAP32[$6>>2]|0;
|
|
$270 = ($269|0)!=(0|0);
|
|
$271 = $270 ? $269 : 11634;
|
|
$$1 = $271;
|
|
label = 71;
|
|
break;
|
|
}
|
|
case 67: {
|
|
$278 = $6;
|
|
$279 = $278;
|
|
$280 = HEAP32[$279>>2]|0;
|
|
$281 = (($278) + 4)|0;
|
|
$282 = $281;
|
|
$283 = HEAP32[$282>>2]|0;
|
|
HEAP32[$8>>2] = $280;
|
|
HEAP32[$14>>2] = 0;
|
|
HEAP32[$6>>2] = $8;
|
|
$$4258355 = -1;$331 = $8;
|
|
label = 75;
|
|
break;
|
|
}
|
|
case 83: {
|
|
$$pre349 = HEAP32[$6>>2]|0;
|
|
$284 = ($$0254|0)==(0);
|
|
if ($284) {
|
|
_pad_672($0,32,$$1260,0,$$1263$);
|
|
$$0240$lcssa357 = 0;
|
|
label = 84;
|
|
} else {
|
|
$$4258355 = $$0254;$331 = $$pre349;
|
|
label = 75;
|
|
}
|
|
break;
|
|
}
|
|
case 65: case 71: case 70: case 69: case 97: case 103: case 102: case 101: {
|
|
$306 = +HEAPF64[$6>>3];
|
|
$307 = (_fmt_fp($0,$306,$$1260,$$0254,$$1263$,$$0235)|0);
|
|
$$0243 = $307;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
|
|
continue L1;
|
|
break;
|
|
}
|
|
default: {
|
|
$$2 = $21;$$2234 = 0;$$2239 = 11624;$$2251 = $11;$$5 = $$0254;$$6268 = $$1263$;
|
|
}
|
|
}
|
|
} while(0);
|
|
L95: do {
|
|
if ((label|0) == 61) {
|
|
label = 0;
|
|
$195 = $6;
|
|
$196 = $195;
|
|
$197 = HEAP32[$196>>2]|0;
|
|
$198 = (($195) + 4)|0;
|
|
$199 = $198;
|
|
$200 = HEAP32[$199>>2]|0;
|
|
$201 = $$1236 & 32;
|
|
$202 = (_fmt_x($197,$200,$11,$201)|0);
|
|
$203 = ($197|0)==(0);
|
|
$204 = ($200|0)==(0);
|
|
$205 = $203 & $204;
|
|
$206 = $$3265 & 8;
|
|
$207 = ($206|0)==(0);
|
|
$or$cond283 = $207 | $205;
|
|
$208 = $$1236 >> 4;
|
|
$209 = (11624 + ($208)|0);
|
|
$$289 = $or$cond283 ? 11624 : $209;
|
|
$$290 = $or$cond283 ? 0 : 2;
|
|
$$0228 = $202;$$1233 = $$290;$$1238 = $$289;$$2256 = $$1255;$$4266 = $$3265;$248 = $197;$250 = $200;
|
|
label = 67;
|
|
}
|
|
else if ((label|0) == 66) {
|
|
label = 0;
|
|
$244 = (_fmt_u($242,$243,$11)|0);
|
|
$$0228 = $244;$$1233 = $$0232;$$1238 = $$0237;$$2256 = $$0254;$$4266 = $$1263$;$248 = $242;$250 = $243;
|
|
label = 67;
|
|
}
|
|
else if ((label|0) == 71) {
|
|
label = 0;
|
|
$272 = (_memchr($$1,0,$$0254)|0);
|
|
$273 = ($272|0)==(0|0);
|
|
$274 = $272;
|
|
$275 = $$1;
|
|
$276 = (($274) - ($275))|0;
|
|
$277 = (($$1) + ($$0254)|0);
|
|
$$3257 = $273 ? $$0254 : $276;
|
|
$$1250 = $273 ? $277 : $272;
|
|
$$2 = $$1;$$2234 = 0;$$2239 = 11624;$$2251 = $$1250;$$5 = $$3257;$$6268 = $164;
|
|
}
|
|
else if ((label|0) == 75) {
|
|
label = 0;
|
|
$$0229322 = $331;$$0240321 = 0;$$1244320 = 0;
|
|
while(1) {
|
|
$285 = HEAP32[$$0229322>>2]|0;
|
|
$286 = ($285|0)==(0);
|
|
if ($286) {
|
|
$$0240$lcssa = $$0240321;$$2245 = $$1244320;
|
|
break;
|
|
}
|
|
$287 = (_wctomb($9,$285)|0);
|
|
$288 = ($287|0)<(0);
|
|
$289 = (($$4258355) - ($$0240321))|0;
|
|
$290 = ($287>>>0)>($289>>>0);
|
|
$or$cond286 = $288 | $290;
|
|
if ($or$cond286) {
|
|
$$0240$lcssa = $$0240321;$$2245 = $287;
|
|
break;
|
|
}
|
|
$291 = ((($$0229322)) + 4|0);
|
|
$292 = (($287) + ($$0240321))|0;
|
|
$293 = ($$4258355>>>0)>($292>>>0);
|
|
if ($293) {
|
|
$$0229322 = $291;$$0240321 = $292;$$1244320 = $287;
|
|
} else {
|
|
$$0240$lcssa = $292;$$2245 = $287;
|
|
break;
|
|
}
|
|
}
|
|
$294 = ($$2245|0)<(0);
|
|
if ($294) {
|
|
$$0 = -1;
|
|
break L1;
|
|
}
|
|
_pad_672($0,32,$$1260,$$0240$lcssa,$$1263$);
|
|
$295 = ($$0240$lcssa|0)==(0);
|
|
if ($295) {
|
|
$$0240$lcssa357 = 0;
|
|
label = 84;
|
|
} else {
|
|
$$1230333 = $331;$$1241332 = 0;
|
|
while(1) {
|
|
$296 = HEAP32[$$1230333>>2]|0;
|
|
$297 = ($296|0)==(0);
|
|
if ($297) {
|
|
$$0240$lcssa357 = $$0240$lcssa;
|
|
label = 84;
|
|
break L95;
|
|
}
|
|
$298 = (_wctomb($9,$296)|0);
|
|
$299 = (($298) + ($$1241332))|0;
|
|
$300 = ($299|0)>($$0240$lcssa|0);
|
|
if ($300) {
|
|
$$0240$lcssa357 = $$0240$lcssa;
|
|
label = 84;
|
|
break L95;
|
|
}
|
|
$301 = ((($$1230333)) + 4|0);
|
|
_out($0,$9,$298);
|
|
$302 = ($299>>>0)<($$0240$lcssa>>>0);
|
|
if ($302) {
|
|
$$1230333 = $301;$$1241332 = $299;
|
|
} else {
|
|
$$0240$lcssa357 = $$0240$lcssa;
|
|
label = 84;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
if ((label|0) == 67) {
|
|
label = 0;
|
|
$245 = ($$2256|0)>(-1);
|
|
$246 = $$4266 & -65537;
|
|
$$$4266 = $245 ? $246 : $$4266;
|
|
$247 = ($248|0)!=(0);
|
|
$249 = ($250|0)!=(0);
|
|
$251 = $247 | $249;
|
|
$252 = ($$2256|0)!=(0);
|
|
$or$cond = $252 | $251;
|
|
$253 = $$0228;
|
|
$254 = (($12) - ($253))|0;
|
|
$255 = $251 ^ 1;
|
|
$256 = $255&1;
|
|
$257 = (($256) + ($254))|0;
|
|
$258 = ($$2256|0)>($257|0);
|
|
$$2256$ = $258 ? $$2256 : $257;
|
|
$$2256$$$2256 = $or$cond ? $$2256$ : $$2256;
|
|
$$0228$ = $or$cond ? $$0228 : $11;
|
|
$$2 = $$0228$;$$2234 = $$1233;$$2239 = $$1238;$$2251 = $11;$$5 = $$2256$$$2256;$$6268 = $$$4266;
|
|
}
|
|
else if ((label|0) == 84) {
|
|
label = 0;
|
|
$303 = $$1263$ ^ 8192;
|
|
_pad_672($0,32,$$1260,$$0240$lcssa357,$303);
|
|
$304 = ($$1260|0)>($$0240$lcssa357|0);
|
|
$305 = $304 ? $$1260 : $$0240$lcssa357;
|
|
$$0243 = $305;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
|
|
continue;
|
|
}
|
|
$308 = $$2251;
|
|
$309 = $$2;
|
|
$310 = (($308) - ($309))|0;
|
|
$311 = ($$5|0)<($310|0);
|
|
$$$5 = $311 ? $310 : $$5;
|
|
$312 = (($$$5) + ($$2234))|0;
|
|
$313 = ($$1260|0)<($312|0);
|
|
$$2261 = $313 ? $312 : $$1260;
|
|
_pad_672($0,32,$$2261,$312,$$6268);
|
|
_out($0,$$2239,$$2234);
|
|
$314 = $$6268 ^ 65536;
|
|
_pad_672($0,48,$$2261,$312,$314);
|
|
_pad_672($0,48,$$$5,$310,0);
|
|
_out($0,$$2,$310);
|
|
$315 = $$6268 ^ 8192;
|
|
_pad_672($0,32,$$2261,$312,$315);
|
|
$$0243 = $$2261;$$0247 = $$1248;$$0269 = $$3272;$21 = $132;
|
|
}
|
|
L114: do {
|
|
if ((label|0) == 87) {
|
|
$316 = ($0|0)==(0|0);
|
|
if ($316) {
|
|
$317 = ($$0269|0)==(0);
|
|
if ($317) {
|
|
$$0 = 0;
|
|
} else {
|
|
$$2242305 = 1;
|
|
while(1) {
|
|
$318 = (($4) + ($$2242305<<2)|0);
|
|
$319 = HEAP32[$318>>2]|0;
|
|
$320 = ($319|0)==(0);
|
|
if ($320) {
|
|
$$3303 = $$2242305;
|
|
break;
|
|
}
|
|
$321 = (($3) + ($$2242305<<3)|0);
|
|
_pop_arg($321,$319,$2);
|
|
$322 = (($$2242305) + 1)|0;
|
|
$323 = ($322|0)<(10);
|
|
if ($323) {
|
|
$$2242305 = $322;
|
|
} else {
|
|
$$0 = 1;
|
|
break L114;
|
|
}
|
|
}
|
|
while(1) {
|
|
$326 = (($4) + ($$3303<<2)|0);
|
|
$327 = HEAP32[$326>>2]|0;
|
|
$328 = ($327|0)==(0);
|
|
$325 = (($$3303) + 1)|0;
|
|
if (!($328)) {
|
|
$$0 = -1;
|
|
break L114;
|
|
}
|
|
$324 = ($325|0)<(10);
|
|
if ($324) {
|
|
$$3303 = $325;
|
|
} else {
|
|
$$0 = 1;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
} else {
|
|
$$0 = $$1248;
|
|
}
|
|
}
|
|
} while(0);
|
|
STACKTOP = sp;return ($$0|0);
|
|
}
|
|
function ___lockfile($0) {
|
|
$0 = $0|0;
|
|
var label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
return 0;
|
|
}
|
|
function ___unlockfile($0) {
|
|
$0 = $0|0;
|
|
var label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
return;
|
|
}
|
|
function _out($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = HEAP32[$0>>2]|0;
|
|
$4 = $3 & 32;
|
|
$5 = ($4|0)==(0);
|
|
if ($5) {
|
|
(___fwritex($1,$2,$0)|0);
|
|
}
|
|
return;
|
|
}
|
|
function _getint($0) {
|
|
$0 = $0|0;
|
|
var $$0$lcssa = 0, $$06 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $isdigit = 0, $isdigit5 = 0, $isdigittmp = 0, $isdigittmp4 = 0, $isdigittmp7 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = HEAP32[$0>>2]|0;
|
|
$2 = HEAP8[$1>>0]|0;
|
|
$3 = $2 << 24 >> 24;
|
|
$isdigittmp4 = (($3) + -48)|0;
|
|
$isdigit5 = ($isdigittmp4>>>0)<(10);
|
|
if ($isdigit5) {
|
|
$$06 = 0;$7 = $1;$isdigittmp7 = $isdigittmp4;
|
|
while(1) {
|
|
$4 = ($$06*10)|0;
|
|
$5 = (($isdigittmp7) + ($4))|0;
|
|
$6 = ((($7)) + 1|0);
|
|
HEAP32[$0>>2] = $6;
|
|
$8 = HEAP8[$6>>0]|0;
|
|
$9 = $8 << 24 >> 24;
|
|
$isdigittmp = (($9) + -48)|0;
|
|
$isdigit = ($isdigittmp>>>0)<(10);
|
|
if ($isdigit) {
|
|
$$06 = $5;$7 = $6;$isdigittmp7 = $isdigittmp;
|
|
} else {
|
|
$$0$lcssa = $5;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$0$lcssa = 0;
|
|
}
|
|
return ($$0$lcssa|0);
|
|
}
|
|
function _pop_arg($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $$mask = 0, $$mask31 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0.0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0;
|
|
var $116 = 0.0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0;
|
|
var $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0;
|
|
var $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0;
|
|
var $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0;
|
|
var $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $arglist_current = 0, $arglist_current11 = 0, $arglist_current14 = 0, $arglist_current17 = 0;
|
|
var $arglist_current2 = 0, $arglist_current20 = 0, $arglist_current23 = 0, $arglist_current26 = 0, $arglist_current5 = 0, $arglist_current8 = 0, $arglist_next = 0, $arglist_next12 = 0, $arglist_next15 = 0, $arglist_next18 = 0, $arglist_next21 = 0, $arglist_next24 = 0, $arglist_next27 = 0, $arglist_next3 = 0, $arglist_next6 = 0, $arglist_next9 = 0, $expanded = 0, $expanded28 = 0, $expanded30 = 0, $expanded31 = 0;
|
|
var $expanded32 = 0, $expanded34 = 0, $expanded35 = 0, $expanded37 = 0, $expanded38 = 0, $expanded39 = 0, $expanded41 = 0, $expanded42 = 0, $expanded44 = 0, $expanded45 = 0, $expanded46 = 0, $expanded48 = 0, $expanded49 = 0, $expanded51 = 0, $expanded52 = 0, $expanded53 = 0, $expanded55 = 0, $expanded56 = 0, $expanded58 = 0, $expanded59 = 0;
|
|
var $expanded60 = 0, $expanded62 = 0, $expanded63 = 0, $expanded65 = 0, $expanded66 = 0, $expanded67 = 0, $expanded69 = 0, $expanded70 = 0, $expanded72 = 0, $expanded73 = 0, $expanded74 = 0, $expanded76 = 0, $expanded77 = 0, $expanded79 = 0, $expanded80 = 0, $expanded81 = 0, $expanded83 = 0, $expanded84 = 0, $expanded86 = 0, $expanded87 = 0;
|
|
var $expanded88 = 0, $expanded90 = 0, $expanded91 = 0, $expanded93 = 0, $expanded94 = 0, $expanded95 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = ($1>>>0)>(20);
|
|
L1: do {
|
|
if (!($3)) {
|
|
do {
|
|
switch ($1|0) {
|
|
case 9: {
|
|
$arglist_current = HEAP32[$2>>2]|0;
|
|
$4 = $arglist_current;
|
|
$5 = ((0) + 4|0);
|
|
$expanded28 = $5;
|
|
$expanded = (($expanded28) - 1)|0;
|
|
$6 = (($4) + ($expanded))|0;
|
|
$7 = ((0) + 4|0);
|
|
$expanded32 = $7;
|
|
$expanded31 = (($expanded32) - 1)|0;
|
|
$expanded30 = $expanded31 ^ -1;
|
|
$8 = $6 & $expanded30;
|
|
$9 = $8;
|
|
$10 = HEAP32[$9>>2]|0;
|
|
$arglist_next = ((($9)) + 4|0);
|
|
HEAP32[$2>>2] = $arglist_next;
|
|
HEAP32[$0>>2] = $10;
|
|
break L1;
|
|
break;
|
|
}
|
|
case 10: {
|
|
$arglist_current2 = HEAP32[$2>>2]|0;
|
|
$11 = $arglist_current2;
|
|
$12 = ((0) + 4|0);
|
|
$expanded35 = $12;
|
|
$expanded34 = (($expanded35) - 1)|0;
|
|
$13 = (($11) + ($expanded34))|0;
|
|
$14 = ((0) + 4|0);
|
|
$expanded39 = $14;
|
|
$expanded38 = (($expanded39) - 1)|0;
|
|
$expanded37 = $expanded38 ^ -1;
|
|
$15 = $13 & $expanded37;
|
|
$16 = $15;
|
|
$17 = HEAP32[$16>>2]|0;
|
|
$arglist_next3 = ((($16)) + 4|0);
|
|
HEAP32[$2>>2] = $arglist_next3;
|
|
$18 = ($17|0)<(0);
|
|
$19 = $18 << 31 >> 31;
|
|
$20 = $0;
|
|
$21 = $20;
|
|
HEAP32[$21>>2] = $17;
|
|
$22 = (($20) + 4)|0;
|
|
$23 = $22;
|
|
HEAP32[$23>>2] = $19;
|
|
break L1;
|
|
break;
|
|
}
|
|
case 11: {
|
|
$arglist_current5 = HEAP32[$2>>2]|0;
|
|
$24 = $arglist_current5;
|
|
$25 = ((0) + 4|0);
|
|
$expanded42 = $25;
|
|
$expanded41 = (($expanded42) - 1)|0;
|
|
$26 = (($24) + ($expanded41))|0;
|
|
$27 = ((0) + 4|0);
|
|
$expanded46 = $27;
|
|
$expanded45 = (($expanded46) - 1)|0;
|
|
$expanded44 = $expanded45 ^ -1;
|
|
$28 = $26 & $expanded44;
|
|
$29 = $28;
|
|
$30 = HEAP32[$29>>2]|0;
|
|
$arglist_next6 = ((($29)) + 4|0);
|
|
HEAP32[$2>>2] = $arglist_next6;
|
|
$31 = $0;
|
|
$32 = $31;
|
|
HEAP32[$32>>2] = $30;
|
|
$33 = (($31) + 4)|0;
|
|
$34 = $33;
|
|
HEAP32[$34>>2] = 0;
|
|
break L1;
|
|
break;
|
|
}
|
|
case 12: {
|
|
$arglist_current8 = HEAP32[$2>>2]|0;
|
|
$35 = $arglist_current8;
|
|
$36 = ((0) + 8|0);
|
|
$expanded49 = $36;
|
|
$expanded48 = (($expanded49) - 1)|0;
|
|
$37 = (($35) + ($expanded48))|0;
|
|
$38 = ((0) + 8|0);
|
|
$expanded53 = $38;
|
|
$expanded52 = (($expanded53) - 1)|0;
|
|
$expanded51 = $expanded52 ^ -1;
|
|
$39 = $37 & $expanded51;
|
|
$40 = $39;
|
|
$41 = $40;
|
|
$42 = $41;
|
|
$43 = HEAP32[$42>>2]|0;
|
|
$44 = (($41) + 4)|0;
|
|
$45 = $44;
|
|
$46 = HEAP32[$45>>2]|0;
|
|
$arglist_next9 = ((($40)) + 8|0);
|
|
HEAP32[$2>>2] = $arglist_next9;
|
|
$47 = $0;
|
|
$48 = $47;
|
|
HEAP32[$48>>2] = $43;
|
|
$49 = (($47) + 4)|0;
|
|
$50 = $49;
|
|
HEAP32[$50>>2] = $46;
|
|
break L1;
|
|
break;
|
|
}
|
|
case 13: {
|
|
$arglist_current11 = HEAP32[$2>>2]|0;
|
|
$51 = $arglist_current11;
|
|
$52 = ((0) + 4|0);
|
|
$expanded56 = $52;
|
|
$expanded55 = (($expanded56) - 1)|0;
|
|
$53 = (($51) + ($expanded55))|0;
|
|
$54 = ((0) + 4|0);
|
|
$expanded60 = $54;
|
|
$expanded59 = (($expanded60) - 1)|0;
|
|
$expanded58 = $expanded59 ^ -1;
|
|
$55 = $53 & $expanded58;
|
|
$56 = $55;
|
|
$57 = HEAP32[$56>>2]|0;
|
|
$arglist_next12 = ((($56)) + 4|0);
|
|
HEAP32[$2>>2] = $arglist_next12;
|
|
$58 = $57&65535;
|
|
$59 = $58 << 16 >> 16;
|
|
$60 = ($59|0)<(0);
|
|
$61 = $60 << 31 >> 31;
|
|
$62 = $0;
|
|
$63 = $62;
|
|
HEAP32[$63>>2] = $59;
|
|
$64 = (($62) + 4)|0;
|
|
$65 = $64;
|
|
HEAP32[$65>>2] = $61;
|
|
break L1;
|
|
break;
|
|
}
|
|
case 14: {
|
|
$arglist_current14 = HEAP32[$2>>2]|0;
|
|
$66 = $arglist_current14;
|
|
$67 = ((0) + 4|0);
|
|
$expanded63 = $67;
|
|
$expanded62 = (($expanded63) - 1)|0;
|
|
$68 = (($66) + ($expanded62))|0;
|
|
$69 = ((0) + 4|0);
|
|
$expanded67 = $69;
|
|
$expanded66 = (($expanded67) - 1)|0;
|
|
$expanded65 = $expanded66 ^ -1;
|
|
$70 = $68 & $expanded65;
|
|
$71 = $70;
|
|
$72 = HEAP32[$71>>2]|0;
|
|
$arglist_next15 = ((($71)) + 4|0);
|
|
HEAP32[$2>>2] = $arglist_next15;
|
|
$$mask31 = $72 & 65535;
|
|
$73 = $0;
|
|
$74 = $73;
|
|
HEAP32[$74>>2] = $$mask31;
|
|
$75 = (($73) + 4)|0;
|
|
$76 = $75;
|
|
HEAP32[$76>>2] = 0;
|
|
break L1;
|
|
break;
|
|
}
|
|
case 15: {
|
|
$arglist_current17 = HEAP32[$2>>2]|0;
|
|
$77 = $arglist_current17;
|
|
$78 = ((0) + 4|0);
|
|
$expanded70 = $78;
|
|
$expanded69 = (($expanded70) - 1)|0;
|
|
$79 = (($77) + ($expanded69))|0;
|
|
$80 = ((0) + 4|0);
|
|
$expanded74 = $80;
|
|
$expanded73 = (($expanded74) - 1)|0;
|
|
$expanded72 = $expanded73 ^ -1;
|
|
$81 = $79 & $expanded72;
|
|
$82 = $81;
|
|
$83 = HEAP32[$82>>2]|0;
|
|
$arglist_next18 = ((($82)) + 4|0);
|
|
HEAP32[$2>>2] = $arglist_next18;
|
|
$84 = $83&255;
|
|
$85 = $84 << 24 >> 24;
|
|
$86 = ($85|0)<(0);
|
|
$87 = $86 << 31 >> 31;
|
|
$88 = $0;
|
|
$89 = $88;
|
|
HEAP32[$89>>2] = $85;
|
|
$90 = (($88) + 4)|0;
|
|
$91 = $90;
|
|
HEAP32[$91>>2] = $87;
|
|
break L1;
|
|
break;
|
|
}
|
|
case 16: {
|
|
$arglist_current20 = HEAP32[$2>>2]|0;
|
|
$92 = $arglist_current20;
|
|
$93 = ((0) + 4|0);
|
|
$expanded77 = $93;
|
|
$expanded76 = (($expanded77) - 1)|0;
|
|
$94 = (($92) + ($expanded76))|0;
|
|
$95 = ((0) + 4|0);
|
|
$expanded81 = $95;
|
|
$expanded80 = (($expanded81) - 1)|0;
|
|
$expanded79 = $expanded80 ^ -1;
|
|
$96 = $94 & $expanded79;
|
|
$97 = $96;
|
|
$98 = HEAP32[$97>>2]|0;
|
|
$arglist_next21 = ((($97)) + 4|0);
|
|
HEAP32[$2>>2] = $arglist_next21;
|
|
$$mask = $98 & 255;
|
|
$99 = $0;
|
|
$100 = $99;
|
|
HEAP32[$100>>2] = $$mask;
|
|
$101 = (($99) + 4)|0;
|
|
$102 = $101;
|
|
HEAP32[$102>>2] = 0;
|
|
break L1;
|
|
break;
|
|
}
|
|
case 17: {
|
|
$arglist_current23 = HEAP32[$2>>2]|0;
|
|
$103 = $arglist_current23;
|
|
$104 = ((0) + 8|0);
|
|
$expanded84 = $104;
|
|
$expanded83 = (($expanded84) - 1)|0;
|
|
$105 = (($103) + ($expanded83))|0;
|
|
$106 = ((0) + 8|0);
|
|
$expanded88 = $106;
|
|
$expanded87 = (($expanded88) - 1)|0;
|
|
$expanded86 = $expanded87 ^ -1;
|
|
$107 = $105 & $expanded86;
|
|
$108 = $107;
|
|
$109 = +HEAPF64[$108>>3];
|
|
$arglist_next24 = ((($108)) + 8|0);
|
|
HEAP32[$2>>2] = $arglist_next24;
|
|
HEAPF64[$0>>3] = $109;
|
|
break L1;
|
|
break;
|
|
}
|
|
case 18: {
|
|
$arglist_current26 = HEAP32[$2>>2]|0;
|
|
$110 = $arglist_current26;
|
|
$111 = ((0) + 8|0);
|
|
$expanded91 = $111;
|
|
$expanded90 = (($expanded91) - 1)|0;
|
|
$112 = (($110) + ($expanded90))|0;
|
|
$113 = ((0) + 8|0);
|
|
$expanded95 = $113;
|
|
$expanded94 = (($expanded95) - 1)|0;
|
|
$expanded93 = $expanded94 ^ -1;
|
|
$114 = $112 & $expanded93;
|
|
$115 = $114;
|
|
$116 = +HEAPF64[$115>>3];
|
|
$arglist_next27 = ((($115)) + 8|0);
|
|
HEAP32[$2>>2] = $arglist_next27;
|
|
HEAPF64[$0>>3] = $116;
|
|
break L1;
|
|
break;
|
|
}
|
|
default: {
|
|
break L1;
|
|
}
|
|
}
|
|
} while(0);
|
|
}
|
|
} while(0);
|
|
return;
|
|
}
|
|
function _fmt_x($0,$1,$2,$3) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
var $$05$lcssa = 0, $$056 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0;
|
|
var sp = 0;
|
|
sp = STACKTOP;
|
|
$4 = ($0|0)==(0);
|
|
$5 = ($1|0)==(0);
|
|
$6 = $4 & $5;
|
|
if ($6) {
|
|
$$05$lcssa = $2;
|
|
} else {
|
|
$$056 = $2;$15 = $1;$8 = $0;
|
|
while(1) {
|
|
$7 = $8 & 15;
|
|
$9 = (11676 + ($7)|0);
|
|
$10 = HEAP8[$9>>0]|0;
|
|
$11 = $10&255;
|
|
$12 = $11 | $3;
|
|
$13 = $12&255;
|
|
$14 = ((($$056)) + -1|0);
|
|
HEAP8[$14>>0] = $13;
|
|
$16 = (_bitshift64Lshr(($8|0),($15|0),4)|0);
|
|
$17 = tempRet0;
|
|
$18 = ($16|0)==(0);
|
|
$19 = ($17|0)==(0);
|
|
$20 = $18 & $19;
|
|
if ($20) {
|
|
$$05$lcssa = $14;
|
|
break;
|
|
} else {
|
|
$$056 = $14;$15 = $17;$8 = $16;
|
|
}
|
|
}
|
|
}
|
|
return ($$05$lcssa|0);
|
|
}
|
|
function _fmt_o($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $$0$lcssa = 0, $$06 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = ($0|0)==(0);
|
|
$4 = ($1|0)==(0);
|
|
$5 = $3 & $4;
|
|
if ($5) {
|
|
$$0$lcssa = $2;
|
|
} else {
|
|
$$06 = $2;$11 = $1;$7 = $0;
|
|
while(1) {
|
|
$6 = $7&255;
|
|
$8 = $6 & 7;
|
|
$9 = $8 | 48;
|
|
$10 = ((($$06)) + -1|0);
|
|
HEAP8[$10>>0] = $9;
|
|
$12 = (_bitshift64Lshr(($7|0),($11|0),3)|0);
|
|
$13 = tempRet0;
|
|
$14 = ($12|0)==(0);
|
|
$15 = ($13|0)==(0);
|
|
$16 = $14 & $15;
|
|
if ($16) {
|
|
$$0$lcssa = $10;
|
|
break;
|
|
} else {
|
|
$$06 = $10;$11 = $13;$7 = $12;
|
|
}
|
|
}
|
|
}
|
|
return ($$0$lcssa|0);
|
|
}
|
|
function _fmt_u($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $$010$lcssa$off0 = 0, $$012 = 0, $$09$lcssa = 0, $$0914 = 0, $$1$lcssa = 0, $$111 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
|
|
var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = ($1>>>0)>(0);
|
|
$4 = ($0>>>0)>(4294967295);
|
|
$5 = ($1|0)==(0);
|
|
$6 = $5 & $4;
|
|
$7 = $3 | $6;
|
|
if ($7) {
|
|
$$0914 = $2;$8 = $0;$9 = $1;
|
|
while(1) {
|
|
$10 = (___uremdi3(($8|0),($9|0),10,0)|0);
|
|
$11 = tempRet0;
|
|
$12 = $10&255;
|
|
$13 = $12 | 48;
|
|
$14 = ((($$0914)) + -1|0);
|
|
HEAP8[$14>>0] = $13;
|
|
$15 = (___udivdi3(($8|0),($9|0),10,0)|0);
|
|
$16 = tempRet0;
|
|
$17 = ($9>>>0)>(9);
|
|
$18 = ($8>>>0)>(4294967295);
|
|
$19 = ($9|0)==(9);
|
|
$20 = $19 & $18;
|
|
$21 = $17 | $20;
|
|
if ($21) {
|
|
$$0914 = $14;$8 = $15;$9 = $16;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
$$010$lcssa$off0 = $15;$$09$lcssa = $14;
|
|
} else {
|
|
$$010$lcssa$off0 = $0;$$09$lcssa = $2;
|
|
}
|
|
$22 = ($$010$lcssa$off0|0)==(0);
|
|
if ($22) {
|
|
$$1$lcssa = $$09$lcssa;
|
|
} else {
|
|
$$012 = $$010$lcssa$off0;$$111 = $$09$lcssa;
|
|
while(1) {
|
|
$23 = (($$012>>>0) % 10)&-1;
|
|
$24 = $23 | 48;
|
|
$25 = $24&255;
|
|
$26 = ((($$111)) + -1|0);
|
|
HEAP8[$26>>0] = $25;
|
|
$27 = (($$012>>>0) / 10)&-1;
|
|
$28 = ($$012>>>0)<(10);
|
|
if ($28) {
|
|
$$1$lcssa = $26;
|
|
break;
|
|
} else {
|
|
$$012 = $27;$$111 = $26;
|
|
}
|
|
}
|
|
}
|
|
return ($$1$lcssa|0);
|
|
}
|
|
function _strerror($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = (___pthread_self_105()|0);
|
|
$2 = ((($1)) + 188|0);
|
|
$3 = HEAP32[$2>>2]|0;
|
|
$4 = (___strerror_l($0,$3)|0);
|
|
return ($4|0);
|
|
}
|
|
function _memchr($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $$0$lcssa = 0, $$035$lcssa = 0, $$035$lcssa65 = 0, $$03555 = 0, $$036$lcssa = 0, $$036$lcssa64 = 0, $$03654 = 0, $$046 = 0, $$137$lcssa = 0, $$13745 = 0, $$140 = 0, $$2 = 0, $$23839 = 0, $$3 = 0, $$lcssa = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0;
|
|
var $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0;
|
|
var $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond53 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = $1 & 255;
|
|
$4 = $0;
|
|
$5 = $4 & 3;
|
|
$6 = ($5|0)!=(0);
|
|
$7 = ($2|0)!=(0);
|
|
$or$cond53 = $7 & $6;
|
|
L1: do {
|
|
if ($or$cond53) {
|
|
$8 = $1&255;
|
|
$$03555 = $0;$$03654 = $2;
|
|
while(1) {
|
|
$9 = HEAP8[$$03555>>0]|0;
|
|
$10 = ($9<<24>>24)==($8<<24>>24);
|
|
if ($10) {
|
|
$$035$lcssa65 = $$03555;$$036$lcssa64 = $$03654;
|
|
label = 6;
|
|
break L1;
|
|
}
|
|
$11 = ((($$03555)) + 1|0);
|
|
$12 = (($$03654) + -1)|0;
|
|
$13 = $11;
|
|
$14 = $13 & 3;
|
|
$15 = ($14|0)!=(0);
|
|
$16 = ($12|0)!=(0);
|
|
$or$cond = $16 & $15;
|
|
if ($or$cond) {
|
|
$$03555 = $11;$$03654 = $12;
|
|
} else {
|
|
$$035$lcssa = $11;$$036$lcssa = $12;$$lcssa = $16;
|
|
label = 5;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$035$lcssa = $0;$$036$lcssa = $2;$$lcssa = $7;
|
|
label = 5;
|
|
}
|
|
} while(0);
|
|
if ((label|0) == 5) {
|
|
if ($$lcssa) {
|
|
$$035$lcssa65 = $$035$lcssa;$$036$lcssa64 = $$036$lcssa;
|
|
label = 6;
|
|
} else {
|
|
$$2 = $$035$lcssa;$$3 = 0;
|
|
}
|
|
}
|
|
L8: do {
|
|
if ((label|0) == 6) {
|
|
$17 = HEAP8[$$035$lcssa65>>0]|0;
|
|
$18 = $1&255;
|
|
$19 = ($17<<24>>24)==($18<<24>>24);
|
|
if ($19) {
|
|
$$2 = $$035$lcssa65;$$3 = $$036$lcssa64;
|
|
} else {
|
|
$20 = Math_imul($3, 16843009)|0;
|
|
$21 = ($$036$lcssa64>>>0)>(3);
|
|
L11: do {
|
|
if ($21) {
|
|
$$046 = $$035$lcssa65;$$13745 = $$036$lcssa64;
|
|
while(1) {
|
|
$22 = HEAP32[$$046>>2]|0;
|
|
$23 = $22 ^ $20;
|
|
$24 = (($23) + -16843009)|0;
|
|
$25 = $23 & -2139062144;
|
|
$26 = $25 ^ -2139062144;
|
|
$27 = $26 & $24;
|
|
$28 = ($27|0)==(0);
|
|
if (!($28)) {
|
|
break;
|
|
}
|
|
$29 = ((($$046)) + 4|0);
|
|
$30 = (($$13745) + -4)|0;
|
|
$31 = ($30>>>0)>(3);
|
|
if ($31) {
|
|
$$046 = $29;$$13745 = $30;
|
|
} else {
|
|
$$0$lcssa = $29;$$137$lcssa = $30;
|
|
label = 11;
|
|
break L11;
|
|
}
|
|
}
|
|
$$140 = $$046;$$23839 = $$13745;
|
|
} else {
|
|
$$0$lcssa = $$035$lcssa65;$$137$lcssa = $$036$lcssa64;
|
|
label = 11;
|
|
}
|
|
} while(0);
|
|
if ((label|0) == 11) {
|
|
$32 = ($$137$lcssa|0)==(0);
|
|
if ($32) {
|
|
$$2 = $$0$lcssa;$$3 = 0;
|
|
break;
|
|
} else {
|
|
$$140 = $$0$lcssa;$$23839 = $$137$lcssa;
|
|
}
|
|
}
|
|
while(1) {
|
|
$33 = HEAP8[$$140>>0]|0;
|
|
$34 = ($33<<24>>24)==($18<<24>>24);
|
|
if ($34) {
|
|
$$2 = $$140;$$3 = $$23839;
|
|
break L8;
|
|
}
|
|
$35 = ((($$140)) + 1|0);
|
|
$36 = (($$23839) + -1)|0;
|
|
$37 = ($36|0)==(0);
|
|
if ($37) {
|
|
$$2 = $35;$$3 = 0;
|
|
break;
|
|
} else {
|
|
$$140 = $35;$$23839 = $36;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$38 = ($$3|0)!=(0);
|
|
$39 = $38 ? $$2 : 0;
|
|
return ($39|0);
|
|
}
|
|
function _pad_672($0,$1,$2,$3,$4) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
$4 = $4|0;
|
|
var $$0$lcssa = 0, $$011 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 256|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(256|0);
|
|
$5 = sp;
|
|
$6 = $4 & 73728;
|
|
$7 = ($6|0)==(0);
|
|
$8 = ($2|0)>($3|0);
|
|
$or$cond = $8 & $7;
|
|
if ($or$cond) {
|
|
$9 = (($2) - ($3))|0;
|
|
$10 = ($9>>>0)<(256);
|
|
$11 = $10 ? $9 : 256;
|
|
_memset(($5|0),($1|0),($11|0))|0;
|
|
$12 = ($9>>>0)>(255);
|
|
if ($12) {
|
|
$13 = (($2) - ($3))|0;
|
|
$$011 = $9;
|
|
while(1) {
|
|
_out($0,$5,256);
|
|
$14 = (($$011) + -256)|0;
|
|
$15 = ($14>>>0)>(255);
|
|
if ($15) {
|
|
$$011 = $14;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
$16 = $13 & 255;
|
|
$$0$lcssa = $16;
|
|
} else {
|
|
$$0$lcssa = $9;
|
|
}
|
|
_out($0,$5,$$0$lcssa);
|
|
}
|
|
STACKTOP = sp;return;
|
|
}
|
|
function _wctomb($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$0 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = ($0|0)==(0|0);
|
|
if ($2) {
|
|
$$0 = 0;
|
|
} else {
|
|
$3 = (_wcrtomb($0,$1,0)|0);
|
|
$$0 = $3;
|
|
}
|
|
return ($$0|0);
|
|
}
|
|
function _fmt_fp($0,$1,$2,$3,$4,$5) {
|
|
$0 = $0|0;
|
|
$1 = +$1;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
$4 = $4|0;
|
|
$5 = $5|0;
|
|
var $$ = 0, $$$ = 0, $$$$559 = 0.0, $$$3484 = 0, $$$3484691 = 0, $$$3484692 = 0, $$$3501 = 0, $$$4502 = 0, $$$542 = 0.0, $$$559 = 0.0, $$0 = 0, $$0463$lcssa = 0, $$0463584 = 0, $$0464594 = 0, $$0471 = 0.0, $$0479 = 0, $$0487642 = 0, $$0488 = 0, $$0488653 = 0, $$0488655 = 0;
|
|
var $$0496$$9 = 0, $$0497654 = 0, $$0498 = 0, $$0509582 = 0.0, $$0510 = 0, $$0511 = 0, $$0514637 = 0, $$0520 = 0, $$0521 = 0, $$0521$ = 0, $$0523 = 0, $$0525 = 0, $$0527 = 0, $$0527629 = 0, $$0527631 = 0, $$0530636 = 0, $$1465 = 0, $$1467 = 0.0, $$1469 = 0.0, $$1472 = 0.0;
|
|
var $$1480 = 0, $$1482$lcssa = 0, $$1482661 = 0, $$1489641 = 0, $$1499$lcssa = 0, $$1499660 = 0, $$1508583 = 0, $$1512$lcssa = 0, $$1512607 = 0, $$1515 = 0, $$1524 = 0, $$1526 = 0, $$1528614 = 0, $$1531$lcssa = 0, $$1531630 = 0, $$1598 = 0, $$2 = 0, $$2473 = 0.0, $$2476 = 0, $$2476$$547 = 0;
|
|
var $$2476$$549 = 0, $$2483$ph = 0, $$2500 = 0, $$2513 = 0, $$2516618 = 0, $$2529 = 0, $$2532617 = 0, $$3 = 0.0, $$3477 = 0, $$3484$lcssa = 0, $$3484648 = 0, $$3501$lcssa = 0, $$3501647 = 0, $$3533613 = 0, $$4 = 0.0, $$4478$lcssa = 0, $$4478590 = 0, $$4492 = 0, $$4502 = 0, $$4518 = 0;
|
|
var $$5$lcssa = 0, $$534$ = 0, $$539 = 0, $$539$ = 0, $$542 = 0.0, $$546 = 0, $$548 = 0, $$5486$lcssa = 0, $$5486623 = 0, $$5493597 = 0, $$5519$ph = 0, $$555 = 0, $$556 = 0, $$559 = 0.0, $$5602 = 0, $$6 = 0, $$6494589 = 0, $$7495601 = 0, $$7505 = 0, $$7505$ = 0;
|
|
var $$7505$ph = 0, $$8 = 0, $$9$ph = 0, $$lcssa673 = 0, $$neg = 0, $$neg567 = 0, $$pn = 0, $$pn566 = 0, $$pr = 0, $$pr564 = 0, $$pre = 0, $$pre$phi690Z2D = 0, $$pre689 = 0, $$sink545$lcssa = 0, $$sink545622 = 0, $$sink562 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0;
|
|
var $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0.0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0.0, $117 = 0.0, $118 = 0.0, $119 = 0, $12 = 0, $120 = 0;
|
|
var $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0;
|
|
var $14 = 0.0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0;
|
|
var $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0;
|
|
var $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0;
|
|
var $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0;
|
|
var $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0.0, $229 = 0.0, $23 = 0;
|
|
var $230 = 0, $231 = 0.0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0;
|
|
var $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0;
|
|
var $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0;
|
|
var $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0;
|
|
var $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0;
|
|
var $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0, $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0;
|
|
var $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0.0, $350 = 0, $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0;
|
|
var $358 = 0, $359 = 0, $36 = 0.0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0, $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0;
|
|
var $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0, $388 = 0, $39 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0;
|
|
var $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $50 = 0, $51 = 0.0, $52 = 0, $53 = 0, $54 = 0, $55 = 0.0, $56 = 0.0, $57 = 0.0, $58 = 0.0, $59 = 0.0, $6 = 0, $60 = 0.0, $61 = 0, $62 = 0, $63 = 0;
|
|
var $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0;
|
|
var $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0.0, $88 = 0.0, $89 = 0.0, $9 = 0, $90 = 0, $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $exitcond = 0;
|
|
var $narrow = 0, $not$ = 0, $notlhs = 0, $notrhs = 0, $or$cond = 0, $or$cond3$not = 0, $or$cond537 = 0, $or$cond541 = 0, $or$cond544 = 0, $or$cond554 = 0, $or$cond6 = 0, $scevgep684 = 0, $scevgep684685 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 560|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(560|0);
|
|
$6 = sp + 8|0;
|
|
$7 = sp;
|
|
$8 = sp + 524|0;
|
|
$9 = $8;
|
|
$10 = sp + 512|0;
|
|
HEAP32[$7>>2] = 0;
|
|
$11 = ((($10)) + 12|0);
|
|
(___DOUBLE_BITS_673($1)|0);
|
|
$12 = tempRet0;
|
|
$13 = ($12|0)<(0);
|
|
if ($13) {
|
|
$14 = -$1;
|
|
$$0471 = $14;$$0520 = 1;$$0521 = 11641;
|
|
} else {
|
|
$15 = $4 & 2048;
|
|
$16 = ($15|0)==(0);
|
|
$17 = $4 & 1;
|
|
$18 = ($17|0)==(0);
|
|
$$ = $18 ? (11642) : (11647);
|
|
$$$ = $16 ? $$ : (11644);
|
|
$19 = $4 & 2049;
|
|
$narrow = ($19|0)!=(0);
|
|
$$534$ = $narrow&1;
|
|
$$0471 = $1;$$0520 = $$534$;$$0521 = $$$;
|
|
}
|
|
(___DOUBLE_BITS_673($$0471)|0);
|
|
$20 = tempRet0;
|
|
$21 = $20 & 2146435072;
|
|
$22 = ($21>>>0)<(2146435072);
|
|
$23 = (0)<(0);
|
|
$24 = ($21|0)==(2146435072);
|
|
$25 = $24 & $23;
|
|
$26 = $22 | $25;
|
|
do {
|
|
if ($26) {
|
|
$35 = (+_frexpl($$0471,$7));
|
|
$36 = $35 * 2.0;
|
|
$37 = $36 != 0.0;
|
|
if ($37) {
|
|
$38 = HEAP32[$7>>2]|0;
|
|
$39 = (($38) + -1)|0;
|
|
HEAP32[$7>>2] = $39;
|
|
}
|
|
$40 = $5 | 32;
|
|
$41 = ($40|0)==(97);
|
|
if ($41) {
|
|
$42 = $5 & 32;
|
|
$43 = ($42|0)==(0);
|
|
$44 = ((($$0521)) + 9|0);
|
|
$$0521$ = $43 ? $$0521 : $44;
|
|
$45 = $$0520 | 2;
|
|
$46 = ($3>>>0)>(11);
|
|
$47 = (12 - ($3))|0;
|
|
$48 = ($47|0)==(0);
|
|
$49 = $46 | $48;
|
|
do {
|
|
if ($49) {
|
|
$$1472 = $36;
|
|
} else {
|
|
$$0509582 = 8.0;$$1508583 = $47;
|
|
while(1) {
|
|
$50 = (($$1508583) + -1)|0;
|
|
$51 = $$0509582 * 16.0;
|
|
$52 = ($50|0)==(0);
|
|
if ($52) {
|
|
break;
|
|
} else {
|
|
$$0509582 = $51;$$1508583 = $50;
|
|
}
|
|
}
|
|
$53 = HEAP8[$$0521$>>0]|0;
|
|
$54 = ($53<<24>>24)==(45);
|
|
if ($54) {
|
|
$55 = -$36;
|
|
$56 = $55 - $51;
|
|
$57 = $51 + $56;
|
|
$58 = -$57;
|
|
$$1472 = $58;
|
|
break;
|
|
} else {
|
|
$59 = $36 + $51;
|
|
$60 = $59 - $51;
|
|
$$1472 = $60;
|
|
break;
|
|
}
|
|
}
|
|
} while(0);
|
|
$61 = HEAP32[$7>>2]|0;
|
|
$62 = ($61|0)<(0);
|
|
$63 = (0 - ($61))|0;
|
|
$64 = $62 ? $63 : $61;
|
|
$65 = ($64|0)<(0);
|
|
$66 = $65 << 31 >> 31;
|
|
$67 = (_fmt_u($64,$66,$11)|0);
|
|
$68 = ($67|0)==($11|0);
|
|
if ($68) {
|
|
$69 = ((($10)) + 11|0);
|
|
HEAP8[$69>>0] = 48;
|
|
$$0511 = $69;
|
|
} else {
|
|
$$0511 = $67;
|
|
}
|
|
$70 = $61 >> 31;
|
|
$71 = $70 & 2;
|
|
$72 = (($71) + 43)|0;
|
|
$73 = $72&255;
|
|
$74 = ((($$0511)) + -1|0);
|
|
HEAP8[$74>>0] = $73;
|
|
$75 = (($5) + 15)|0;
|
|
$76 = $75&255;
|
|
$77 = ((($$0511)) + -2|0);
|
|
HEAP8[$77>>0] = $76;
|
|
$notrhs = ($3|0)<(1);
|
|
$78 = $4 & 8;
|
|
$79 = ($78|0)==(0);
|
|
$$0523 = $8;$$2473 = $$1472;
|
|
while(1) {
|
|
$80 = (~~(($$2473)));
|
|
$81 = (11676 + ($80)|0);
|
|
$82 = HEAP8[$81>>0]|0;
|
|
$83 = $82&255;
|
|
$84 = $83 | $42;
|
|
$85 = $84&255;
|
|
$86 = ((($$0523)) + 1|0);
|
|
HEAP8[$$0523>>0] = $85;
|
|
$87 = (+($80|0));
|
|
$88 = $$2473 - $87;
|
|
$89 = $88 * 16.0;
|
|
$90 = $86;
|
|
$91 = (($90) - ($9))|0;
|
|
$92 = ($91|0)==(1);
|
|
if ($92) {
|
|
$notlhs = $89 == 0.0;
|
|
$or$cond3$not = $notrhs & $notlhs;
|
|
$or$cond = $79 & $or$cond3$not;
|
|
if ($or$cond) {
|
|
$$1524 = $86;
|
|
} else {
|
|
$93 = ((($$0523)) + 2|0);
|
|
HEAP8[$86>>0] = 46;
|
|
$$1524 = $93;
|
|
}
|
|
} else {
|
|
$$1524 = $86;
|
|
}
|
|
$94 = $89 != 0.0;
|
|
if ($94) {
|
|
$$0523 = $$1524;$$2473 = $89;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
$95 = ($3|0)!=(0);
|
|
$96 = $77;
|
|
$97 = $11;
|
|
$98 = $$1524;
|
|
$99 = (($98) - ($9))|0;
|
|
$100 = (($97) - ($96))|0;
|
|
$101 = (($99) + -2)|0;
|
|
$102 = ($101|0)<($3|0);
|
|
$or$cond537 = $95 & $102;
|
|
$103 = (($3) + 2)|0;
|
|
$$pn = $or$cond537 ? $103 : $99;
|
|
$$0525 = (($100) + ($45))|0;
|
|
$104 = (($$0525) + ($$pn))|0;
|
|
_pad_672($0,32,$2,$104,$4);
|
|
_out($0,$$0521$,$45);
|
|
$105 = $4 ^ 65536;
|
|
_pad_672($0,48,$2,$104,$105);
|
|
_out($0,$8,$99);
|
|
$106 = (($$pn) - ($99))|0;
|
|
_pad_672($0,48,$106,0,0);
|
|
_out($0,$77,$100);
|
|
$107 = $4 ^ 8192;
|
|
_pad_672($0,32,$2,$104,$107);
|
|
$$sink562 = $104;
|
|
break;
|
|
}
|
|
$108 = ($3|0)<(0);
|
|
$$539 = $108 ? 6 : $3;
|
|
if ($37) {
|
|
$109 = $36 * 268435456.0;
|
|
$110 = HEAP32[$7>>2]|0;
|
|
$111 = (($110) + -28)|0;
|
|
HEAP32[$7>>2] = $111;
|
|
$$3 = $109;$$pr = $111;
|
|
} else {
|
|
$$pre = HEAP32[$7>>2]|0;
|
|
$$3 = $36;$$pr = $$pre;
|
|
}
|
|
$112 = ($$pr|0)<(0);
|
|
$113 = ((($6)) + 288|0);
|
|
$$556 = $112 ? $6 : $113;
|
|
$$0498 = $$556;$$4 = $$3;
|
|
while(1) {
|
|
$114 = (~~(($$4))>>>0);
|
|
HEAP32[$$0498>>2] = $114;
|
|
$115 = ((($$0498)) + 4|0);
|
|
$116 = (+($114>>>0));
|
|
$117 = $$4 - $116;
|
|
$118 = $117 * 1.0E+9;
|
|
$119 = $118 != 0.0;
|
|
if ($119) {
|
|
$$0498 = $115;$$4 = $118;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
$120 = ($$pr|0)>(0);
|
|
if ($120) {
|
|
$$1482661 = $$556;$$1499660 = $115;$122 = $$pr;
|
|
while(1) {
|
|
$121 = ($122|0)<(29);
|
|
$123 = $121 ? $122 : 29;
|
|
$$0488653 = ((($$1499660)) + -4|0);
|
|
$124 = ($$0488653>>>0)<($$1482661>>>0);
|
|
if ($124) {
|
|
$$2483$ph = $$1482661;
|
|
} else {
|
|
$$0488655 = $$0488653;$$0497654 = 0;
|
|
while(1) {
|
|
$125 = HEAP32[$$0488655>>2]|0;
|
|
$126 = (_bitshift64Shl(($125|0),0,($123|0))|0);
|
|
$127 = tempRet0;
|
|
$128 = (_i64Add(($126|0),($127|0),($$0497654|0),0)|0);
|
|
$129 = tempRet0;
|
|
$130 = (___uremdi3(($128|0),($129|0),1000000000,0)|0);
|
|
$131 = tempRet0;
|
|
HEAP32[$$0488655>>2] = $130;
|
|
$132 = (___udivdi3(($128|0),($129|0),1000000000,0)|0);
|
|
$133 = tempRet0;
|
|
$$0488 = ((($$0488655)) + -4|0);
|
|
$134 = ($$0488>>>0)<($$1482661>>>0);
|
|
if ($134) {
|
|
break;
|
|
} else {
|
|
$$0488655 = $$0488;$$0497654 = $132;
|
|
}
|
|
}
|
|
$135 = ($132|0)==(0);
|
|
if ($135) {
|
|
$$2483$ph = $$1482661;
|
|
} else {
|
|
$136 = ((($$1482661)) + -4|0);
|
|
HEAP32[$136>>2] = $132;
|
|
$$2483$ph = $136;
|
|
}
|
|
}
|
|
$$2500 = $$1499660;
|
|
while(1) {
|
|
$137 = ($$2500>>>0)>($$2483$ph>>>0);
|
|
if (!($137)) {
|
|
break;
|
|
}
|
|
$138 = ((($$2500)) + -4|0);
|
|
$139 = HEAP32[$138>>2]|0;
|
|
$140 = ($139|0)==(0);
|
|
if ($140) {
|
|
$$2500 = $138;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
$141 = HEAP32[$7>>2]|0;
|
|
$142 = (($141) - ($123))|0;
|
|
HEAP32[$7>>2] = $142;
|
|
$143 = ($142|0)>(0);
|
|
if ($143) {
|
|
$$1482661 = $$2483$ph;$$1499660 = $$2500;$122 = $142;
|
|
} else {
|
|
$$1482$lcssa = $$2483$ph;$$1499$lcssa = $$2500;$$pr564 = $142;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$1482$lcssa = $$556;$$1499$lcssa = $115;$$pr564 = $$pr;
|
|
}
|
|
$144 = ($$pr564|0)<(0);
|
|
if ($144) {
|
|
$145 = (($$539) + 25)|0;
|
|
$146 = (($145|0) / 9)&-1;
|
|
$147 = (($146) + 1)|0;
|
|
$148 = ($40|0)==(102);
|
|
$$3484648 = $$1482$lcssa;$$3501647 = $$1499$lcssa;$150 = $$pr564;
|
|
while(1) {
|
|
$149 = (0 - ($150))|0;
|
|
$151 = ($149|0)<(9);
|
|
$152 = $151 ? $149 : 9;
|
|
$153 = ($$3484648>>>0)<($$3501647>>>0);
|
|
if ($153) {
|
|
$157 = 1 << $152;
|
|
$158 = (($157) + -1)|0;
|
|
$159 = 1000000000 >>> $152;
|
|
$$0487642 = 0;$$1489641 = $$3484648;
|
|
while(1) {
|
|
$160 = HEAP32[$$1489641>>2]|0;
|
|
$161 = $160 & $158;
|
|
$162 = $160 >>> $152;
|
|
$163 = (($162) + ($$0487642))|0;
|
|
HEAP32[$$1489641>>2] = $163;
|
|
$164 = Math_imul($161, $159)|0;
|
|
$165 = ((($$1489641)) + 4|0);
|
|
$166 = ($165>>>0)<($$3501647>>>0);
|
|
if ($166) {
|
|
$$0487642 = $164;$$1489641 = $165;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
$167 = HEAP32[$$3484648>>2]|0;
|
|
$168 = ($167|0)==(0);
|
|
$169 = ((($$3484648)) + 4|0);
|
|
$$$3484 = $168 ? $169 : $$3484648;
|
|
$170 = ($164|0)==(0);
|
|
if ($170) {
|
|
$$$3484692 = $$$3484;$$4502 = $$3501647;
|
|
} else {
|
|
$171 = ((($$3501647)) + 4|0);
|
|
HEAP32[$$3501647>>2] = $164;
|
|
$$$3484692 = $$$3484;$$4502 = $171;
|
|
}
|
|
} else {
|
|
$154 = HEAP32[$$3484648>>2]|0;
|
|
$155 = ($154|0)==(0);
|
|
$156 = ((($$3484648)) + 4|0);
|
|
$$$3484691 = $155 ? $156 : $$3484648;
|
|
$$$3484692 = $$$3484691;$$4502 = $$3501647;
|
|
}
|
|
$172 = $148 ? $$556 : $$$3484692;
|
|
$173 = $$4502;
|
|
$174 = $172;
|
|
$175 = (($173) - ($174))|0;
|
|
$176 = $175 >> 2;
|
|
$177 = ($176|0)>($147|0);
|
|
$178 = (($172) + ($147<<2)|0);
|
|
$$$4502 = $177 ? $178 : $$4502;
|
|
$179 = HEAP32[$7>>2]|0;
|
|
$180 = (($179) + ($152))|0;
|
|
HEAP32[$7>>2] = $180;
|
|
$181 = ($180|0)<(0);
|
|
if ($181) {
|
|
$$3484648 = $$$3484692;$$3501647 = $$$4502;$150 = $180;
|
|
} else {
|
|
$$3484$lcssa = $$$3484692;$$3501$lcssa = $$$4502;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$3484$lcssa = $$1482$lcssa;$$3501$lcssa = $$1499$lcssa;
|
|
}
|
|
$182 = ($$3484$lcssa>>>0)<($$3501$lcssa>>>0);
|
|
$183 = $$556;
|
|
if ($182) {
|
|
$184 = $$3484$lcssa;
|
|
$185 = (($183) - ($184))|0;
|
|
$186 = $185 >> 2;
|
|
$187 = ($186*9)|0;
|
|
$188 = HEAP32[$$3484$lcssa>>2]|0;
|
|
$189 = ($188>>>0)<(10);
|
|
if ($189) {
|
|
$$1515 = $187;
|
|
} else {
|
|
$$0514637 = $187;$$0530636 = 10;
|
|
while(1) {
|
|
$190 = ($$0530636*10)|0;
|
|
$191 = (($$0514637) + 1)|0;
|
|
$192 = ($188>>>0)<($190>>>0);
|
|
if ($192) {
|
|
$$1515 = $191;
|
|
break;
|
|
} else {
|
|
$$0514637 = $191;$$0530636 = $190;
|
|
}
|
|
}
|
|
}
|
|
} else {
|
|
$$1515 = 0;
|
|
}
|
|
$193 = ($40|0)!=(102);
|
|
$194 = $193 ? $$1515 : 0;
|
|
$195 = (($$539) - ($194))|0;
|
|
$196 = ($40|0)==(103);
|
|
$197 = ($$539|0)!=(0);
|
|
$198 = $197 & $196;
|
|
$$neg = $198 << 31 >> 31;
|
|
$199 = (($195) + ($$neg))|0;
|
|
$200 = $$3501$lcssa;
|
|
$201 = (($200) - ($183))|0;
|
|
$202 = $201 >> 2;
|
|
$203 = ($202*9)|0;
|
|
$204 = (($203) + -9)|0;
|
|
$205 = ($199|0)<($204|0);
|
|
if ($205) {
|
|
$206 = ((($$556)) + 4|0);
|
|
$207 = (($199) + 9216)|0;
|
|
$208 = (($207|0) / 9)&-1;
|
|
$209 = (($208) + -1024)|0;
|
|
$210 = (($206) + ($209<<2)|0);
|
|
$211 = (($207|0) % 9)&-1;
|
|
$$0527629 = (($211) + 1)|0;
|
|
$212 = ($$0527629|0)<(9);
|
|
if ($212) {
|
|
$$0527631 = $$0527629;$$1531630 = 10;
|
|
while(1) {
|
|
$213 = ($$1531630*10)|0;
|
|
$$0527 = (($$0527631) + 1)|0;
|
|
$exitcond = ($$0527|0)==(9);
|
|
if ($exitcond) {
|
|
$$1531$lcssa = $213;
|
|
break;
|
|
} else {
|
|
$$0527631 = $$0527;$$1531630 = $213;
|
|
}
|
|
}
|
|
} else {
|
|
$$1531$lcssa = 10;
|
|
}
|
|
$214 = HEAP32[$210>>2]|0;
|
|
$215 = (($214>>>0) % ($$1531$lcssa>>>0))&-1;
|
|
$216 = ($215|0)==(0);
|
|
$217 = ((($210)) + 4|0);
|
|
$218 = ($217|0)==($$3501$lcssa|0);
|
|
$or$cond541 = $218 & $216;
|
|
if ($or$cond541) {
|
|
$$4492 = $210;$$4518 = $$1515;$$8 = $$3484$lcssa;
|
|
} else {
|
|
$219 = (($214>>>0) / ($$1531$lcssa>>>0))&-1;
|
|
$220 = $219 & 1;
|
|
$221 = ($220|0)==(0);
|
|
$$542 = $221 ? 9007199254740992.0 : 9007199254740994.0;
|
|
$222 = (($$1531$lcssa|0) / 2)&-1;
|
|
$223 = ($215>>>0)<($222>>>0);
|
|
$224 = ($215|0)==($222|0);
|
|
$or$cond544 = $218 & $224;
|
|
$$559 = $or$cond544 ? 1.0 : 1.5;
|
|
$$$559 = $223 ? 0.5 : $$559;
|
|
$225 = ($$0520|0)==(0);
|
|
if ($225) {
|
|
$$1467 = $$$559;$$1469 = $$542;
|
|
} else {
|
|
$226 = HEAP8[$$0521>>0]|0;
|
|
$227 = ($226<<24>>24)==(45);
|
|
$228 = -$$542;
|
|
$229 = -$$$559;
|
|
$$$542 = $227 ? $228 : $$542;
|
|
$$$$559 = $227 ? $229 : $$$559;
|
|
$$1467 = $$$$559;$$1469 = $$$542;
|
|
}
|
|
$230 = (($214) - ($215))|0;
|
|
HEAP32[$210>>2] = $230;
|
|
$231 = $$1469 + $$1467;
|
|
$232 = $231 != $$1469;
|
|
if ($232) {
|
|
$233 = (($230) + ($$1531$lcssa))|0;
|
|
HEAP32[$210>>2] = $233;
|
|
$234 = ($233>>>0)>(999999999);
|
|
if ($234) {
|
|
$$5486623 = $$3484$lcssa;$$sink545622 = $210;
|
|
while(1) {
|
|
$235 = ((($$sink545622)) + -4|0);
|
|
HEAP32[$$sink545622>>2] = 0;
|
|
$236 = ($235>>>0)<($$5486623>>>0);
|
|
if ($236) {
|
|
$237 = ((($$5486623)) + -4|0);
|
|
HEAP32[$237>>2] = 0;
|
|
$$6 = $237;
|
|
} else {
|
|
$$6 = $$5486623;
|
|
}
|
|
$238 = HEAP32[$235>>2]|0;
|
|
$239 = (($238) + 1)|0;
|
|
HEAP32[$235>>2] = $239;
|
|
$240 = ($239>>>0)>(999999999);
|
|
if ($240) {
|
|
$$5486623 = $$6;$$sink545622 = $235;
|
|
} else {
|
|
$$5486$lcssa = $$6;$$sink545$lcssa = $235;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$5486$lcssa = $$3484$lcssa;$$sink545$lcssa = $210;
|
|
}
|
|
$241 = $$5486$lcssa;
|
|
$242 = (($183) - ($241))|0;
|
|
$243 = $242 >> 2;
|
|
$244 = ($243*9)|0;
|
|
$245 = HEAP32[$$5486$lcssa>>2]|0;
|
|
$246 = ($245>>>0)<(10);
|
|
if ($246) {
|
|
$$4492 = $$sink545$lcssa;$$4518 = $244;$$8 = $$5486$lcssa;
|
|
} else {
|
|
$$2516618 = $244;$$2532617 = 10;
|
|
while(1) {
|
|
$247 = ($$2532617*10)|0;
|
|
$248 = (($$2516618) + 1)|0;
|
|
$249 = ($245>>>0)<($247>>>0);
|
|
if ($249) {
|
|
$$4492 = $$sink545$lcssa;$$4518 = $248;$$8 = $$5486$lcssa;
|
|
break;
|
|
} else {
|
|
$$2516618 = $248;$$2532617 = $247;
|
|
}
|
|
}
|
|
}
|
|
} else {
|
|
$$4492 = $210;$$4518 = $$1515;$$8 = $$3484$lcssa;
|
|
}
|
|
}
|
|
$250 = ((($$4492)) + 4|0);
|
|
$251 = ($$3501$lcssa>>>0)>($250>>>0);
|
|
$$$3501 = $251 ? $250 : $$3501$lcssa;
|
|
$$5519$ph = $$4518;$$7505$ph = $$$3501;$$9$ph = $$8;
|
|
} else {
|
|
$$5519$ph = $$1515;$$7505$ph = $$3501$lcssa;$$9$ph = $$3484$lcssa;
|
|
}
|
|
$$7505 = $$7505$ph;
|
|
while(1) {
|
|
$252 = ($$7505>>>0)>($$9$ph>>>0);
|
|
if (!($252)) {
|
|
$$lcssa673 = 0;
|
|
break;
|
|
}
|
|
$253 = ((($$7505)) + -4|0);
|
|
$254 = HEAP32[$253>>2]|0;
|
|
$255 = ($254|0)==(0);
|
|
if ($255) {
|
|
$$7505 = $253;
|
|
} else {
|
|
$$lcssa673 = 1;
|
|
break;
|
|
}
|
|
}
|
|
$256 = (0 - ($$5519$ph))|0;
|
|
do {
|
|
if ($196) {
|
|
$not$ = $197 ^ 1;
|
|
$257 = $not$&1;
|
|
$$539$ = (($257) + ($$539))|0;
|
|
$258 = ($$539$|0)>($$5519$ph|0);
|
|
$259 = ($$5519$ph|0)>(-5);
|
|
$or$cond6 = $258 & $259;
|
|
if ($or$cond6) {
|
|
$260 = (($5) + -1)|0;
|
|
$$neg567 = (($$539$) + -1)|0;
|
|
$261 = (($$neg567) - ($$5519$ph))|0;
|
|
$$0479 = $260;$$2476 = $261;
|
|
} else {
|
|
$262 = (($5) + -2)|0;
|
|
$263 = (($$539$) + -1)|0;
|
|
$$0479 = $262;$$2476 = $263;
|
|
}
|
|
$264 = $4 & 8;
|
|
$265 = ($264|0)==(0);
|
|
if ($265) {
|
|
if ($$lcssa673) {
|
|
$266 = ((($$7505)) + -4|0);
|
|
$267 = HEAP32[$266>>2]|0;
|
|
$268 = ($267|0)==(0);
|
|
if ($268) {
|
|
$$2529 = 9;
|
|
} else {
|
|
$269 = (($267>>>0) % 10)&-1;
|
|
$270 = ($269|0)==(0);
|
|
if ($270) {
|
|
$$1528614 = 0;$$3533613 = 10;
|
|
while(1) {
|
|
$271 = ($$3533613*10)|0;
|
|
$272 = (($$1528614) + 1)|0;
|
|
$273 = (($267>>>0) % ($271>>>0))&-1;
|
|
$274 = ($273|0)==(0);
|
|
if ($274) {
|
|
$$1528614 = $272;$$3533613 = $271;
|
|
} else {
|
|
$$2529 = $272;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$2529 = 0;
|
|
}
|
|
}
|
|
} else {
|
|
$$2529 = 9;
|
|
}
|
|
$275 = $$0479 | 32;
|
|
$276 = ($275|0)==(102);
|
|
$277 = $$7505;
|
|
$278 = (($277) - ($183))|0;
|
|
$279 = $278 >> 2;
|
|
$280 = ($279*9)|0;
|
|
$281 = (($280) + -9)|0;
|
|
if ($276) {
|
|
$282 = (($281) - ($$2529))|0;
|
|
$283 = ($282|0)>(0);
|
|
$$546 = $283 ? $282 : 0;
|
|
$284 = ($$2476|0)<($$546|0);
|
|
$$2476$$547 = $284 ? $$2476 : $$546;
|
|
$$1480 = $$0479;$$3477 = $$2476$$547;$$pre$phi690Z2D = 0;
|
|
break;
|
|
} else {
|
|
$285 = (($281) + ($$5519$ph))|0;
|
|
$286 = (($285) - ($$2529))|0;
|
|
$287 = ($286|0)>(0);
|
|
$$548 = $287 ? $286 : 0;
|
|
$288 = ($$2476|0)<($$548|0);
|
|
$$2476$$549 = $288 ? $$2476 : $$548;
|
|
$$1480 = $$0479;$$3477 = $$2476$$549;$$pre$phi690Z2D = 0;
|
|
break;
|
|
}
|
|
} else {
|
|
$$1480 = $$0479;$$3477 = $$2476;$$pre$phi690Z2D = $264;
|
|
}
|
|
} else {
|
|
$$pre689 = $4 & 8;
|
|
$$1480 = $5;$$3477 = $$539;$$pre$phi690Z2D = $$pre689;
|
|
}
|
|
} while(0);
|
|
$289 = $$3477 | $$pre$phi690Z2D;
|
|
$290 = ($289|0)!=(0);
|
|
$291 = $290&1;
|
|
$292 = $$1480 | 32;
|
|
$293 = ($292|0)==(102);
|
|
if ($293) {
|
|
$294 = ($$5519$ph|0)>(0);
|
|
$295 = $294 ? $$5519$ph : 0;
|
|
$$2513 = 0;$$pn566 = $295;
|
|
} else {
|
|
$296 = ($$5519$ph|0)<(0);
|
|
$297 = $296 ? $256 : $$5519$ph;
|
|
$298 = ($297|0)<(0);
|
|
$299 = $298 << 31 >> 31;
|
|
$300 = (_fmt_u($297,$299,$11)|0);
|
|
$301 = $11;
|
|
$302 = $300;
|
|
$303 = (($301) - ($302))|0;
|
|
$304 = ($303|0)<(2);
|
|
if ($304) {
|
|
$$1512607 = $300;
|
|
while(1) {
|
|
$305 = ((($$1512607)) + -1|0);
|
|
HEAP8[$305>>0] = 48;
|
|
$306 = $305;
|
|
$307 = (($301) - ($306))|0;
|
|
$308 = ($307|0)<(2);
|
|
if ($308) {
|
|
$$1512607 = $305;
|
|
} else {
|
|
$$1512$lcssa = $305;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$1512$lcssa = $300;
|
|
}
|
|
$309 = $$5519$ph >> 31;
|
|
$310 = $309 & 2;
|
|
$311 = (($310) + 43)|0;
|
|
$312 = $311&255;
|
|
$313 = ((($$1512$lcssa)) + -1|0);
|
|
HEAP8[$313>>0] = $312;
|
|
$314 = $$1480&255;
|
|
$315 = ((($$1512$lcssa)) + -2|0);
|
|
HEAP8[$315>>0] = $314;
|
|
$316 = $315;
|
|
$317 = (($301) - ($316))|0;
|
|
$$2513 = $315;$$pn566 = $317;
|
|
}
|
|
$318 = (($$0520) + 1)|0;
|
|
$319 = (($318) + ($$3477))|0;
|
|
$$1526 = (($319) + ($291))|0;
|
|
$320 = (($$1526) + ($$pn566))|0;
|
|
_pad_672($0,32,$2,$320,$4);
|
|
_out($0,$$0521,$$0520);
|
|
$321 = $4 ^ 65536;
|
|
_pad_672($0,48,$2,$320,$321);
|
|
if ($293) {
|
|
$322 = ($$9$ph>>>0)>($$556>>>0);
|
|
$$0496$$9 = $322 ? $$556 : $$9$ph;
|
|
$323 = ((($8)) + 9|0);
|
|
$324 = $323;
|
|
$325 = ((($8)) + 8|0);
|
|
$$5493597 = $$0496$$9;
|
|
while(1) {
|
|
$326 = HEAP32[$$5493597>>2]|0;
|
|
$327 = (_fmt_u($326,0,$323)|0);
|
|
$328 = ($$5493597|0)==($$0496$$9|0);
|
|
if ($328) {
|
|
$334 = ($327|0)==($323|0);
|
|
if ($334) {
|
|
HEAP8[$325>>0] = 48;
|
|
$$1465 = $325;
|
|
} else {
|
|
$$1465 = $327;
|
|
}
|
|
} else {
|
|
$329 = ($327>>>0)>($8>>>0);
|
|
if ($329) {
|
|
$330 = $327;
|
|
$331 = (($330) - ($9))|0;
|
|
_memset(($8|0),48,($331|0))|0;
|
|
$$0464594 = $327;
|
|
while(1) {
|
|
$332 = ((($$0464594)) + -1|0);
|
|
$333 = ($332>>>0)>($8>>>0);
|
|
if ($333) {
|
|
$$0464594 = $332;
|
|
} else {
|
|
$$1465 = $332;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$1465 = $327;
|
|
}
|
|
}
|
|
$335 = $$1465;
|
|
$336 = (($324) - ($335))|0;
|
|
_out($0,$$1465,$336);
|
|
$337 = ((($$5493597)) + 4|0);
|
|
$338 = ($337>>>0)>($$556>>>0);
|
|
if ($338) {
|
|
break;
|
|
} else {
|
|
$$5493597 = $337;
|
|
}
|
|
}
|
|
$339 = ($289|0)==(0);
|
|
if (!($339)) {
|
|
_out($0,11692,1);
|
|
}
|
|
$340 = ($337>>>0)<($$7505>>>0);
|
|
$341 = ($$3477|0)>(0);
|
|
$342 = $340 & $341;
|
|
if ($342) {
|
|
$$4478590 = $$3477;$$6494589 = $337;
|
|
while(1) {
|
|
$343 = HEAP32[$$6494589>>2]|0;
|
|
$344 = (_fmt_u($343,0,$323)|0);
|
|
$345 = ($344>>>0)>($8>>>0);
|
|
if ($345) {
|
|
$346 = $344;
|
|
$347 = (($346) - ($9))|0;
|
|
_memset(($8|0),48,($347|0))|0;
|
|
$$0463584 = $344;
|
|
while(1) {
|
|
$348 = ((($$0463584)) + -1|0);
|
|
$349 = ($348>>>0)>($8>>>0);
|
|
if ($349) {
|
|
$$0463584 = $348;
|
|
} else {
|
|
$$0463$lcssa = $348;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$0463$lcssa = $344;
|
|
}
|
|
$350 = ($$4478590|0)<(9);
|
|
$351 = $350 ? $$4478590 : 9;
|
|
_out($0,$$0463$lcssa,$351);
|
|
$352 = ((($$6494589)) + 4|0);
|
|
$353 = (($$4478590) + -9)|0;
|
|
$354 = ($352>>>0)<($$7505>>>0);
|
|
$355 = ($$4478590|0)>(9);
|
|
$356 = $354 & $355;
|
|
if ($356) {
|
|
$$4478590 = $353;$$6494589 = $352;
|
|
} else {
|
|
$$4478$lcssa = $353;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$4478$lcssa = $$3477;
|
|
}
|
|
$357 = (($$4478$lcssa) + 9)|0;
|
|
_pad_672($0,48,$357,9,0);
|
|
} else {
|
|
$358 = ((($$9$ph)) + 4|0);
|
|
$$7505$ = $$lcssa673 ? $$7505 : $358;
|
|
$359 = ($$3477|0)>(-1);
|
|
if ($359) {
|
|
$360 = ((($8)) + 9|0);
|
|
$361 = ($$pre$phi690Z2D|0)==(0);
|
|
$362 = $360;
|
|
$363 = (0 - ($9))|0;
|
|
$364 = ((($8)) + 8|0);
|
|
$$5602 = $$3477;$$7495601 = $$9$ph;
|
|
while(1) {
|
|
$365 = HEAP32[$$7495601>>2]|0;
|
|
$366 = (_fmt_u($365,0,$360)|0);
|
|
$367 = ($366|0)==($360|0);
|
|
if ($367) {
|
|
HEAP8[$364>>0] = 48;
|
|
$$0 = $364;
|
|
} else {
|
|
$$0 = $366;
|
|
}
|
|
$368 = ($$7495601|0)==($$9$ph|0);
|
|
do {
|
|
if ($368) {
|
|
$372 = ((($$0)) + 1|0);
|
|
_out($0,$$0,1);
|
|
$373 = ($$5602|0)<(1);
|
|
$or$cond554 = $361 & $373;
|
|
if ($or$cond554) {
|
|
$$2 = $372;
|
|
break;
|
|
}
|
|
_out($0,11692,1);
|
|
$$2 = $372;
|
|
} else {
|
|
$369 = ($$0>>>0)>($8>>>0);
|
|
if (!($369)) {
|
|
$$2 = $$0;
|
|
break;
|
|
}
|
|
$scevgep684 = (($$0) + ($363)|0);
|
|
$scevgep684685 = $scevgep684;
|
|
_memset(($8|0),48,($scevgep684685|0))|0;
|
|
$$1598 = $$0;
|
|
while(1) {
|
|
$370 = ((($$1598)) + -1|0);
|
|
$371 = ($370>>>0)>($8>>>0);
|
|
if ($371) {
|
|
$$1598 = $370;
|
|
} else {
|
|
$$2 = $370;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$374 = $$2;
|
|
$375 = (($362) - ($374))|0;
|
|
$376 = ($$5602|0)>($375|0);
|
|
$377 = $376 ? $375 : $$5602;
|
|
_out($0,$$2,$377);
|
|
$378 = (($$5602) - ($375))|0;
|
|
$379 = ((($$7495601)) + 4|0);
|
|
$380 = ($379>>>0)<($$7505$>>>0);
|
|
$381 = ($378|0)>(-1);
|
|
$382 = $380 & $381;
|
|
if ($382) {
|
|
$$5602 = $378;$$7495601 = $379;
|
|
} else {
|
|
$$5$lcssa = $378;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$5$lcssa = $$3477;
|
|
}
|
|
$383 = (($$5$lcssa) + 18)|0;
|
|
_pad_672($0,48,$383,18,0);
|
|
$384 = $11;
|
|
$385 = $$2513;
|
|
$386 = (($384) - ($385))|0;
|
|
_out($0,$$2513,$386);
|
|
}
|
|
$387 = $4 ^ 8192;
|
|
_pad_672($0,32,$2,$320,$387);
|
|
$$sink562 = $320;
|
|
} else {
|
|
$27 = $5 & 32;
|
|
$28 = ($27|0)!=(0);
|
|
$29 = $28 ? 11660 : 11664;
|
|
$30 = ($$0471 != $$0471) | (0.0 != 0.0);
|
|
$31 = $28 ? 11668 : 11672;
|
|
$$0510 = $30 ? $31 : $29;
|
|
$32 = (($$0520) + 3)|0;
|
|
$33 = $4 & -65537;
|
|
_pad_672($0,32,$2,$32,$33);
|
|
_out($0,$$0521,$$0520);
|
|
_out($0,$$0510,3);
|
|
$34 = $4 ^ 8192;
|
|
_pad_672($0,32,$2,$32,$34);
|
|
$$sink562 = $32;
|
|
}
|
|
} while(0);
|
|
$388 = ($$sink562|0)<($2|0);
|
|
$$555 = $388 ? $2 : $$sink562;
|
|
STACKTOP = sp;return ($$555|0);
|
|
}
|
|
function ___DOUBLE_BITS_673($0) {
|
|
$0 = +$0;
|
|
var $1 = 0, $2 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
HEAPF64[tempDoublePtr>>3] = $0;$1 = HEAP32[tempDoublePtr>>2]|0;
|
|
$2 = HEAP32[tempDoublePtr+4>>2]|0;
|
|
tempRet0 = ($2);
|
|
return ($1|0);
|
|
}
|
|
function _frexpl($0,$1) {
|
|
$0 = +$0;
|
|
$1 = $1|0;
|
|
var $2 = 0.0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = (+_frexp($0,$1));
|
|
return (+$2);
|
|
}
|
|
function _frexp($0,$1) {
|
|
$0 = +$0;
|
|
$1 = $1|0;
|
|
var $$0 = 0.0, $$016 = 0.0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0.0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0.0, $9 = 0.0, $storemerge = 0, $trunc$clear = 0, label = 0;
|
|
var sp = 0;
|
|
sp = STACKTOP;
|
|
HEAPF64[tempDoublePtr>>3] = $0;$2 = HEAP32[tempDoublePtr>>2]|0;
|
|
$3 = HEAP32[tempDoublePtr+4>>2]|0;
|
|
$4 = (_bitshift64Lshr(($2|0),($3|0),52)|0);
|
|
$5 = tempRet0;
|
|
$6 = $4&65535;
|
|
$trunc$clear = $6 & 2047;
|
|
switch ($trunc$clear<<16>>16) {
|
|
case 0: {
|
|
$7 = $0 != 0.0;
|
|
if ($7) {
|
|
$8 = $0 * 1.8446744073709552E+19;
|
|
$9 = (+_frexp($8,$1));
|
|
$10 = HEAP32[$1>>2]|0;
|
|
$11 = (($10) + -64)|0;
|
|
$$016 = $9;$storemerge = $11;
|
|
} else {
|
|
$$016 = $0;$storemerge = 0;
|
|
}
|
|
HEAP32[$1>>2] = $storemerge;
|
|
$$0 = $$016;
|
|
break;
|
|
}
|
|
case 2047: {
|
|
$$0 = $0;
|
|
break;
|
|
}
|
|
default: {
|
|
$12 = $4 & 2047;
|
|
$13 = (($12) + -1022)|0;
|
|
HEAP32[$1>>2] = $13;
|
|
$14 = $3 & -2146435073;
|
|
$15 = $14 | 1071644672;
|
|
HEAP32[tempDoublePtr>>2] = $2;HEAP32[tempDoublePtr+4>>2] = $15;$16 = +HEAPF64[tempDoublePtr>>3];
|
|
$$0 = $16;
|
|
}
|
|
}
|
|
return (+$$0);
|
|
}
|
|
function _wcrtomb($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0;
|
|
var $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0;
|
|
var $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $not$ = 0, $or$cond = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = ($0|0)==(0|0);
|
|
do {
|
|
if ($3) {
|
|
$$0 = 1;
|
|
} else {
|
|
$4 = ($1>>>0)<(128);
|
|
if ($4) {
|
|
$5 = $1&255;
|
|
HEAP8[$0>>0] = $5;
|
|
$$0 = 1;
|
|
break;
|
|
}
|
|
$6 = (___pthread_self_446()|0);
|
|
$7 = ((($6)) + 188|0);
|
|
$8 = HEAP32[$7>>2]|0;
|
|
$9 = (Atomics_load(HEAP32,$8>>2)|0);
|
|
$not$ = ($9|0)==(0|0);
|
|
if ($not$) {
|
|
$10 = $1 & -128;
|
|
$11 = ($10|0)==(57216);
|
|
if ($11) {
|
|
$13 = $1&255;
|
|
HEAP8[$0>>0] = $13;
|
|
$$0 = 1;
|
|
break;
|
|
} else {
|
|
$12 = (___errno_location()|0);
|
|
HEAP32[$12>>2] = 84;
|
|
$$0 = -1;
|
|
break;
|
|
}
|
|
}
|
|
$14 = ($1>>>0)<(2048);
|
|
if ($14) {
|
|
$15 = $1 >>> 6;
|
|
$16 = $15 | 192;
|
|
$17 = $16&255;
|
|
$18 = ((($0)) + 1|0);
|
|
HEAP8[$0>>0] = $17;
|
|
$19 = $1 & 63;
|
|
$20 = $19 | 128;
|
|
$21 = $20&255;
|
|
HEAP8[$18>>0] = $21;
|
|
$$0 = 2;
|
|
break;
|
|
}
|
|
$22 = ($1>>>0)<(55296);
|
|
$23 = $1 & -8192;
|
|
$24 = ($23|0)==(57344);
|
|
$or$cond = $22 | $24;
|
|
if ($or$cond) {
|
|
$25 = $1 >>> 12;
|
|
$26 = $25 | 224;
|
|
$27 = $26&255;
|
|
$28 = ((($0)) + 1|0);
|
|
HEAP8[$0>>0] = $27;
|
|
$29 = $1 >>> 6;
|
|
$30 = $29 & 63;
|
|
$31 = $30 | 128;
|
|
$32 = $31&255;
|
|
$33 = ((($0)) + 2|0);
|
|
HEAP8[$28>>0] = $32;
|
|
$34 = $1 & 63;
|
|
$35 = $34 | 128;
|
|
$36 = $35&255;
|
|
HEAP8[$33>>0] = $36;
|
|
$$0 = 3;
|
|
break;
|
|
}
|
|
$37 = (($1) + -65536)|0;
|
|
$38 = ($37>>>0)<(1048576);
|
|
if ($38) {
|
|
$39 = $1 >>> 18;
|
|
$40 = $39 | 240;
|
|
$41 = $40&255;
|
|
$42 = ((($0)) + 1|0);
|
|
HEAP8[$0>>0] = $41;
|
|
$43 = $1 >>> 12;
|
|
$44 = $43 & 63;
|
|
$45 = $44 | 128;
|
|
$46 = $45&255;
|
|
$47 = ((($0)) + 2|0);
|
|
HEAP8[$42>>0] = $46;
|
|
$48 = $1 >>> 6;
|
|
$49 = $48 & 63;
|
|
$50 = $49 | 128;
|
|
$51 = $50&255;
|
|
$52 = ((($0)) + 3|0);
|
|
HEAP8[$47>>0] = $51;
|
|
$53 = $1 & 63;
|
|
$54 = $53 | 128;
|
|
$55 = $54&255;
|
|
HEAP8[$52>>0] = $55;
|
|
$$0 = 4;
|
|
break;
|
|
} else {
|
|
$56 = (___errno_location()|0);
|
|
HEAP32[$56>>2] = 84;
|
|
$$0 = -1;
|
|
break;
|
|
}
|
|
}
|
|
} while(0);
|
|
return ($$0|0);
|
|
}
|
|
function ___pthread_self_446() {
|
|
var $0 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$0 = (_pthread_self()|0);
|
|
return ($0|0);
|
|
}
|
|
function ___pthread_self_105() {
|
|
var $0 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$0 = (_pthread_self()|0);
|
|
return ($0|0);
|
|
}
|
|
function ___strerror_l($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$012$lcssa = 0, $$01214 = 0, $$016 = 0, $$113 = 0, $$115 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
|
|
var label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$$016 = 0;
|
|
while(1) {
|
|
$3 = (11694 + ($$016)|0);
|
|
$4 = HEAP8[$3>>0]|0;
|
|
$5 = $4&255;
|
|
$6 = ($5|0)==($0|0);
|
|
if ($6) {
|
|
label = 2;
|
|
break;
|
|
}
|
|
$7 = (($$016) + 1)|0;
|
|
$8 = ($7|0)==(87);
|
|
if ($8) {
|
|
$$01214 = 11782;$$115 = 87;
|
|
label = 5;
|
|
break;
|
|
} else {
|
|
$$016 = $7;
|
|
}
|
|
}
|
|
if ((label|0) == 2) {
|
|
$2 = ($$016|0)==(0);
|
|
if ($2) {
|
|
$$012$lcssa = 11782;
|
|
} else {
|
|
$$01214 = 11782;$$115 = $$016;
|
|
label = 5;
|
|
}
|
|
}
|
|
if ((label|0) == 5) {
|
|
while(1) {
|
|
label = 0;
|
|
$$113 = $$01214;
|
|
while(1) {
|
|
$9 = HEAP8[$$113>>0]|0;
|
|
$10 = ($9<<24>>24)==(0);
|
|
$11 = ((($$113)) + 1|0);
|
|
if ($10) {
|
|
break;
|
|
} else {
|
|
$$113 = $11;
|
|
}
|
|
}
|
|
$12 = (($$115) + -1)|0;
|
|
$13 = ($12|0)==(0);
|
|
if ($13) {
|
|
$$012$lcssa = $11;
|
|
break;
|
|
} else {
|
|
$$01214 = $11;$$115 = $12;
|
|
label = 5;
|
|
}
|
|
}
|
|
}
|
|
$14 = ((($1)) + 20|0);
|
|
$15 = (Atomics_load(HEAP32,$14>>2)|0);
|
|
$16 = (___lctrans($$012$lcssa,$15)|0);
|
|
return ($16|0);
|
|
}
|
|
function ___lctrans($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $2 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = (___lctrans_impl($0,$1)|0);
|
|
return ($2|0);
|
|
}
|
|
function ___lctrans_impl($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$0 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = ($1|0)==(0|0);
|
|
if ($2) {
|
|
$$0 = 0;
|
|
} else {
|
|
$3 = HEAP32[$1>>2]|0;
|
|
$4 = ((($1)) + 4|0);
|
|
$5 = HEAP32[$4>>2]|0;
|
|
$6 = (___mo_lookup($3,$5,$0)|0);
|
|
$$0 = $6;
|
|
}
|
|
$7 = ($$0|0)!=(0|0);
|
|
$8 = $7 ? $$0 : $0;
|
|
return ($8|0);
|
|
}
|
|
function ___mo_lookup($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $$ = 0, $$090 = 0, $$094 = 0, $$191 = 0, $$195 = 0, $$4 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
|
|
var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
|
|
var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0;
|
|
var $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond102 = 0, $or$cond104 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = HEAP32[$0>>2]|0;
|
|
$4 = (($3) + 1794895138)|0;
|
|
$5 = ((($0)) + 8|0);
|
|
$6 = HEAP32[$5>>2]|0;
|
|
$7 = (_swapc($6,$4)|0);
|
|
$8 = ((($0)) + 12|0);
|
|
$9 = HEAP32[$8>>2]|0;
|
|
$10 = (_swapc($9,$4)|0);
|
|
$11 = ((($0)) + 16|0);
|
|
$12 = HEAP32[$11>>2]|0;
|
|
$13 = (_swapc($12,$4)|0);
|
|
$14 = $1 >>> 2;
|
|
$15 = ($7>>>0)<($14>>>0);
|
|
L1: do {
|
|
if ($15) {
|
|
$16 = $7 << 2;
|
|
$17 = (($1) - ($16))|0;
|
|
$18 = ($10>>>0)<($17>>>0);
|
|
$19 = ($13>>>0)<($17>>>0);
|
|
$or$cond = $18 & $19;
|
|
if ($or$cond) {
|
|
$20 = $13 | $10;
|
|
$21 = $20 & 3;
|
|
$22 = ($21|0)==(0);
|
|
if ($22) {
|
|
$23 = $10 >>> 2;
|
|
$24 = $13 >>> 2;
|
|
$$090 = 0;$$094 = $7;
|
|
while(1) {
|
|
$25 = $$094 >>> 1;
|
|
$26 = (($$090) + ($25))|0;
|
|
$27 = $26 << 1;
|
|
$28 = (($27) + ($23))|0;
|
|
$29 = (($0) + ($28<<2)|0);
|
|
$30 = HEAP32[$29>>2]|0;
|
|
$31 = (_swapc($30,$4)|0);
|
|
$32 = (($28) + 1)|0;
|
|
$33 = (($0) + ($32<<2)|0);
|
|
$34 = HEAP32[$33>>2]|0;
|
|
$35 = (_swapc($34,$4)|0);
|
|
$36 = ($35>>>0)<($1>>>0);
|
|
$37 = (($1) - ($35))|0;
|
|
$38 = ($31>>>0)<($37>>>0);
|
|
$or$cond102 = $36 & $38;
|
|
if (!($or$cond102)) {
|
|
$$4 = 0;
|
|
break L1;
|
|
}
|
|
$39 = (($35) + ($31))|0;
|
|
$40 = (($0) + ($39)|0);
|
|
$41 = HEAP8[$40>>0]|0;
|
|
$42 = ($41<<24>>24)==(0);
|
|
if (!($42)) {
|
|
$$4 = 0;
|
|
break L1;
|
|
}
|
|
$43 = (($0) + ($35)|0);
|
|
$44 = (_strcmp($2,$43)|0);
|
|
$45 = ($44|0)==(0);
|
|
if ($45) {
|
|
break;
|
|
}
|
|
$62 = ($$094|0)==(1);
|
|
$63 = ($44|0)<(0);
|
|
$64 = (($$094) - ($25))|0;
|
|
$$195 = $63 ? $25 : $64;
|
|
$$191 = $63 ? $$090 : $26;
|
|
if ($62) {
|
|
$$4 = 0;
|
|
break L1;
|
|
} else {
|
|
$$090 = $$191;$$094 = $$195;
|
|
}
|
|
}
|
|
$46 = (($27) + ($24))|0;
|
|
$47 = (($0) + ($46<<2)|0);
|
|
$48 = HEAP32[$47>>2]|0;
|
|
$49 = (_swapc($48,$4)|0);
|
|
$50 = (($46) + 1)|0;
|
|
$51 = (($0) + ($50<<2)|0);
|
|
$52 = HEAP32[$51>>2]|0;
|
|
$53 = (_swapc($52,$4)|0);
|
|
$54 = ($53>>>0)<($1>>>0);
|
|
$55 = (($1) - ($53))|0;
|
|
$56 = ($49>>>0)<($55>>>0);
|
|
$or$cond104 = $54 & $56;
|
|
if ($or$cond104) {
|
|
$57 = (($0) + ($53)|0);
|
|
$58 = (($53) + ($49))|0;
|
|
$59 = (($0) + ($58)|0);
|
|
$60 = HEAP8[$59>>0]|0;
|
|
$61 = ($60<<24>>24)==(0);
|
|
$$ = $61 ? $57 : 0;
|
|
$$4 = $$;
|
|
} else {
|
|
$$4 = 0;
|
|
}
|
|
} else {
|
|
$$4 = 0;
|
|
}
|
|
} else {
|
|
$$4 = 0;
|
|
}
|
|
} else {
|
|
$$4 = 0;
|
|
}
|
|
} while(0);
|
|
return ($$4|0);
|
|
}
|
|
function _swapc($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$ = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = ($1|0)==(0);
|
|
$3 = (_llvm_bswap_i32(($0|0))|0);
|
|
$$ = $2 ? $0 : $3;
|
|
return ($$|0);
|
|
}
|
|
function ___fwritex($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $$038 = 0, $$042 = 0, $$1 = 0, $$139 = 0, $$141 = 0, $$143 = 0, $$pre = 0, $$pre47 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0;
|
|
var $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
|
|
var label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = ((($2)) + 16|0);
|
|
$4 = HEAP32[$3>>2]|0;
|
|
$5 = ($4|0)==(0|0);
|
|
if ($5) {
|
|
$7 = (___towrite($2)|0);
|
|
$8 = ($7|0)==(0);
|
|
if ($8) {
|
|
$$pre = HEAP32[$3>>2]|0;
|
|
$12 = $$pre;
|
|
label = 5;
|
|
} else {
|
|
$$1 = 0;
|
|
}
|
|
} else {
|
|
$6 = $4;
|
|
$12 = $6;
|
|
label = 5;
|
|
}
|
|
L5: do {
|
|
if ((label|0) == 5) {
|
|
$9 = ((($2)) + 20|0);
|
|
$10 = HEAP32[$9>>2]|0;
|
|
$11 = (($12) - ($10))|0;
|
|
$13 = ($11>>>0)<($1>>>0);
|
|
$14 = $10;
|
|
if ($13) {
|
|
$15 = ((($2)) + 36|0);
|
|
$16 = HEAP32[$15>>2]|0;
|
|
$17 = (FUNCTION_TABLE_iiii[$16 & 15]($2,$0,$1)|0);
|
|
$$1 = $17;
|
|
break;
|
|
}
|
|
$18 = ((($2)) + 75|0);
|
|
$19 = HEAP8[$18>>0]|0;
|
|
$20 = ($19<<24>>24)>(-1);
|
|
L10: do {
|
|
if ($20) {
|
|
$$038 = $1;
|
|
while(1) {
|
|
$21 = ($$038|0)==(0);
|
|
if ($21) {
|
|
$$139 = 0;$$141 = $0;$$143 = $1;$31 = $14;
|
|
break L10;
|
|
}
|
|
$22 = (($$038) + -1)|0;
|
|
$23 = (($0) + ($22)|0);
|
|
$24 = HEAP8[$23>>0]|0;
|
|
$25 = ($24<<24>>24)==(10);
|
|
if ($25) {
|
|
break;
|
|
} else {
|
|
$$038 = $22;
|
|
}
|
|
}
|
|
$26 = ((($2)) + 36|0);
|
|
$27 = HEAP32[$26>>2]|0;
|
|
$28 = (FUNCTION_TABLE_iiii[$27 & 15]($2,$0,$$038)|0);
|
|
$29 = ($28>>>0)<($$038>>>0);
|
|
if ($29) {
|
|
$$1 = $28;
|
|
break L5;
|
|
}
|
|
$30 = (($0) + ($$038)|0);
|
|
$$042 = (($1) - ($$038))|0;
|
|
$$pre47 = HEAP32[$9>>2]|0;
|
|
$$139 = $$038;$$141 = $30;$$143 = $$042;$31 = $$pre47;
|
|
} else {
|
|
$$139 = 0;$$141 = $0;$$143 = $1;$31 = $14;
|
|
}
|
|
} while(0);
|
|
_memcpy(($31|0),($$141|0),($$143|0))|0;
|
|
$32 = HEAP32[$9>>2]|0;
|
|
$33 = (($32) + ($$143)|0);
|
|
HEAP32[$9>>2] = $33;
|
|
$34 = (($$139) + ($$143))|0;
|
|
$$1 = $34;
|
|
}
|
|
} while(0);
|
|
return ($$1|0);
|
|
}
|
|
function ___towrite($0) {
|
|
$0 = $0|0;
|
|
var $$0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
|
|
var $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = ((($0)) + 74|0);
|
|
$2 = HEAP8[$1>>0]|0;
|
|
$3 = $2 << 24 >> 24;
|
|
$4 = (($3) + 255)|0;
|
|
$5 = $4 | $3;
|
|
$6 = $5&255;
|
|
HEAP8[$1>>0] = $6;
|
|
$7 = HEAP32[$0>>2]|0;
|
|
$8 = $7 & 8;
|
|
$9 = ($8|0)==(0);
|
|
if ($9) {
|
|
$11 = ((($0)) + 8|0);
|
|
HEAP32[$11>>2] = 0;
|
|
$12 = ((($0)) + 4|0);
|
|
HEAP32[$12>>2] = 0;
|
|
$13 = ((($0)) + 44|0);
|
|
$14 = HEAP32[$13>>2]|0;
|
|
$15 = ((($0)) + 28|0);
|
|
HEAP32[$15>>2] = $14;
|
|
$16 = ((($0)) + 20|0);
|
|
HEAP32[$16>>2] = $14;
|
|
$17 = ((($0)) + 48|0);
|
|
$18 = HEAP32[$17>>2]|0;
|
|
$19 = (($14) + ($18)|0);
|
|
$20 = ((($0)) + 16|0);
|
|
HEAP32[$20>>2] = $19;
|
|
$$0 = 0;
|
|
} else {
|
|
$10 = $7 | 32;
|
|
HEAP32[$0>>2] = $10;
|
|
$$0 = -1;
|
|
}
|
|
return ($$0|0);
|
|
}
|
|
function _sn_write($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $$ = 0, $10 = 0, $11 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = ((($0)) + 16|0);
|
|
$4 = HEAP32[$3>>2]|0;
|
|
$5 = ((($0)) + 20|0);
|
|
$6 = HEAP32[$5>>2]|0;
|
|
$7 = $6;
|
|
$8 = (($4) - ($7))|0;
|
|
$9 = ($8>>>0)>($2>>>0);
|
|
$$ = $9 ? $2 : $8;
|
|
_memcpy(($6|0),($1|0),($$|0))|0;
|
|
$10 = HEAP32[$5>>2]|0;
|
|
$11 = (($10) + ($$)|0);
|
|
HEAP32[$5>>2] = $11;
|
|
return ($2|0);
|
|
}
|
|
function _strlen($0) {
|
|
$0 = $0|0;
|
|
var $$0 = 0, $$015$lcssa = 0, $$01519 = 0, $$1$lcssa = 0, $$pn = 0, $$pre = 0, $$sink = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0;
|
|
var $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = $0;
|
|
$2 = $1 & 3;
|
|
$3 = ($2|0)==(0);
|
|
L1: do {
|
|
if ($3) {
|
|
$$015$lcssa = $0;
|
|
label = 4;
|
|
} else {
|
|
$$01519 = $0;$23 = $1;
|
|
while(1) {
|
|
$4 = HEAP8[$$01519>>0]|0;
|
|
$5 = ($4<<24>>24)==(0);
|
|
if ($5) {
|
|
$$sink = $23;
|
|
break L1;
|
|
}
|
|
$6 = ((($$01519)) + 1|0);
|
|
$7 = $6;
|
|
$8 = $7 & 3;
|
|
$9 = ($8|0)==(0);
|
|
if ($9) {
|
|
$$015$lcssa = $6;
|
|
label = 4;
|
|
break;
|
|
} else {
|
|
$$01519 = $6;$23 = $7;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
if ((label|0) == 4) {
|
|
$$0 = $$015$lcssa;
|
|
while(1) {
|
|
$10 = HEAP32[$$0>>2]|0;
|
|
$11 = (($10) + -16843009)|0;
|
|
$12 = $10 & -2139062144;
|
|
$13 = $12 ^ -2139062144;
|
|
$14 = $13 & $11;
|
|
$15 = ($14|0)==(0);
|
|
$16 = ((($$0)) + 4|0);
|
|
if ($15) {
|
|
$$0 = $16;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
$17 = $10&255;
|
|
$18 = ($17<<24>>24)==(0);
|
|
if ($18) {
|
|
$$1$lcssa = $$0;
|
|
} else {
|
|
$$pn = $$0;
|
|
while(1) {
|
|
$19 = ((($$pn)) + 1|0);
|
|
$$pre = HEAP8[$19>>0]|0;
|
|
$20 = ($$pre<<24>>24)==(0);
|
|
if ($20) {
|
|
$$1$lcssa = $19;
|
|
break;
|
|
} else {
|
|
$$pn = $19;
|
|
}
|
|
}
|
|
}
|
|
$21 = $$1$lcssa;
|
|
$$sink = $21;
|
|
}
|
|
$22 = (($$sink) - ($1))|0;
|
|
return ($22|0);
|
|
}
|
|
function _strchr($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = (___strchrnul($0,$1)|0);
|
|
$3 = HEAP8[$2>>0]|0;
|
|
$4 = $1&255;
|
|
$5 = ($3<<24>>24)==($4<<24>>24);
|
|
$6 = $5 ? $2 : 0;
|
|
return ($6|0);
|
|
}
|
|
function ___strchrnul($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$0 = 0, $$029$lcssa = 0, $$02936 = 0, $$030$lcssa = 0, $$03039 = 0, $$1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0;
|
|
var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0;
|
|
var $41 = 0, $42 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond33 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = $1 & 255;
|
|
$3 = ($2|0)==(0);
|
|
L1: do {
|
|
if ($3) {
|
|
$8 = (_strlen($0)|0);
|
|
$9 = (($0) + ($8)|0);
|
|
$$0 = $9;
|
|
} else {
|
|
$4 = $0;
|
|
$5 = $4 & 3;
|
|
$6 = ($5|0)==(0);
|
|
if ($6) {
|
|
$$030$lcssa = $0;
|
|
} else {
|
|
$7 = $1&255;
|
|
$$03039 = $0;
|
|
while(1) {
|
|
$10 = HEAP8[$$03039>>0]|0;
|
|
$11 = ($10<<24>>24)==(0);
|
|
$12 = ($10<<24>>24)==($7<<24>>24);
|
|
$or$cond = $11 | $12;
|
|
if ($or$cond) {
|
|
$$0 = $$03039;
|
|
break L1;
|
|
}
|
|
$13 = ((($$03039)) + 1|0);
|
|
$14 = $13;
|
|
$15 = $14 & 3;
|
|
$16 = ($15|0)==(0);
|
|
if ($16) {
|
|
$$030$lcssa = $13;
|
|
break;
|
|
} else {
|
|
$$03039 = $13;
|
|
}
|
|
}
|
|
}
|
|
$17 = Math_imul($2, 16843009)|0;
|
|
$18 = HEAP32[$$030$lcssa>>2]|0;
|
|
$19 = (($18) + -16843009)|0;
|
|
$20 = $18 & -2139062144;
|
|
$21 = $20 ^ -2139062144;
|
|
$22 = $21 & $19;
|
|
$23 = ($22|0)==(0);
|
|
L10: do {
|
|
if ($23) {
|
|
$$02936 = $$030$lcssa;$25 = $18;
|
|
while(1) {
|
|
$24 = $25 ^ $17;
|
|
$26 = (($24) + -16843009)|0;
|
|
$27 = $24 & -2139062144;
|
|
$28 = $27 ^ -2139062144;
|
|
$29 = $28 & $26;
|
|
$30 = ($29|0)==(0);
|
|
if (!($30)) {
|
|
$$029$lcssa = $$02936;
|
|
break L10;
|
|
}
|
|
$31 = ((($$02936)) + 4|0);
|
|
$32 = HEAP32[$31>>2]|0;
|
|
$33 = (($32) + -16843009)|0;
|
|
$34 = $32 & -2139062144;
|
|
$35 = $34 ^ -2139062144;
|
|
$36 = $35 & $33;
|
|
$37 = ($36|0)==(0);
|
|
if ($37) {
|
|
$$02936 = $31;$25 = $32;
|
|
} else {
|
|
$$029$lcssa = $31;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$029$lcssa = $$030$lcssa;
|
|
}
|
|
} while(0);
|
|
$38 = $1&255;
|
|
$$1 = $$029$lcssa;
|
|
while(1) {
|
|
$39 = HEAP8[$$1>>0]|0;
|
|
$40 = ($39<<24>>24)==(0);
|
|
$41 = ($39<<24>>24)==($38<<24>>24);
|
|
$or$cond33 = $40 | $41;
|
|
$42 = ((($$1)) + 1|0);
|
|
if ($or$cond33) {
|
|
$$0 = $$1;
|
|
break;
|
|
} else {
|
|
$$1 = $42;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
return ($$0|0);
|
|
}
|
|
function _strcpy($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
(___stpcpy($0,$1)|0);
|
|
return ($0|0);
|
|
}
|
|
function ___stpcpy($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$0$lcssa = 0, $$025$lcssa = 0, $$02536 = 0, $$026$lcssa = 0, $$02642 = 0, $$027$lcssa = 0, $$02741 = 0, $$029 = 0, $$037 = 0, $$1$ph = 0, $$128$ph = 0, $$12834 = 0, $$135 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0;
|
|
var $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0;
|
|
var $35 = 0, $36 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = $1;
|
|
$3 = $0;
|
|
$4 = $2 ^ $3;
|
|
$5 = $4 & 3;
|
|
$6 = ($5|0)==(0);
|
|
L1: do {
|
|
if ($6) {
|
|
$7 = $2 & 3;
|
|
$8 = ($7|0)==(0);
|
|
if ($8) {
|
|
$$026$lcssa = $1;$$027$lcssa = $0;
|
|
} else {
|
|
$$02642 = $1;$$02741 = $0;
|
|
while(1) {
|
|
$9 = HEAP8[$$02642>>0]|0;
|
|
HEAP8[$$02741>>0] = $9;
|
|
$10 = ($9<<24>>24)==(0);
|
|
if ($10) {
|
|
$$029 = $$02741;
|
|
break L1;
|
|
}
|
|
$11 = ((($$02642)) + 1|0);
|
|
$12 = ((($$02741)) + 1|0);
|
|
$13 = $11;
|
|
$14 = $13 & 3;
|
|
$15 = ($14|0)==(0);
|
|
if ($15) {
|
|
$$026$lcssa = $11;$$027$lcssa = $12;
|
|
break;
|
|
} else {
|
|
$$02642 = $11;$$02741 = $12;
|
|
}
|
|
}
|
|
}
|
|
$16 = HEAP32[$$026$lcssa>>2]|0;
|
|
$17 = (($16) + -16843009)|0;
|
|
$18 = $16 & -2139062144;
|
|
$19 = $18 ^ -2139062144;
|
|
$20 = $19 & $17;
|
|
$21 = ($20|0)==(0);
|
|
if ($21) {
|
|
$$02536 = $$027$lcssa;$$037 = $$026$lcssa;$24 = $16;
|
|
while(1) {
|
|
$22 = ((($$037)) + 4|0);
|
|
$23 = ((($$02536)) + 4|0);
|
|
HEAP32[$$02536>>2] = $24;
|
|
$25 = HEAP32[$22>>2]|0;
|
|
$26 = (($25) + -16843009)|0;
|
|
$27 = $25 & -2139062144;
|
|
$28 = $27 ^ -2139062144;
|
|
$29 = $28 & $26;
|
|
$30 = ($29|0)==(0);
|
|
if ($30) {
|
|
$$02536 = $23;$$037 = $22;$24 = $25;
|
|
} else {
|
|
$$0$lcssa = $22;$$025$lcssa = $23;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$0$lcssa = $$026$lcssa;$$025$lcssa = $$027$lcssa;
|
|
}
|
|
$$1$ph = $$0$lcssa;$$128$ph = $$025$lcssa;
|
|
label = 8;
|
|
} else {
|
|
$$1$ph = $1;$$128$ph = $0;
|
|
label = 8;
|
|
}
|
|
} while(0);
|
|
if ((label|0) == 8) {
|
|
$31 = HEAP8[$$1$ph>>0]|0;
|
|
HEAP8[$$128$ph>>0] = $31;
|
|
$32 = ($31<<24>>24)==(0);
|
|
if ($32) {
|
|
$$029 = $$128$ph;
|
|
} else {
|
|
$$12834 = $$128$ph;$$135 = $$1$ph;
|
|
while(1) {
|
|
$33 = ((($$135)) + 1|0);
|
|
$34 = ((($$12834)) + 1|0);
|
|
$35 = HEAP8[$33>>0]|0;
|
|
HEAP8[$34>>0] = $35;
|
|
$36 = ($35<<24>>24)==(0);
|
|
if ($36) {
|
|
$$029 = $34;
|
|
break;
|
|
} else {
|
|
$$12834 = $34;$$135 = $33;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
return ($$029|0);
|
|
}
|
|
function ___ofl_lock() {
|
|
var label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
___lock((33288|0));
|
|
return (33296|0);
|
|
}
|
|
function ___ofl_unlock() {
|
|
var label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
___unlock((33288|0));
|
|
return;
|
|
}
|
|
function _fflush($0) {
|
|
$0 = $0|0;
|
|
var $$0 = 0, $$023 = 0, $$02325 = 0, $$02327 = 0, $$024$lcssa = 0, $$02426 = 0, $$1 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0;
|
|
var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $phitmp = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = ($0|0)==(0|0);
|
|
do {
|
|
if ($1) {
|
|
$8 = (Atomics_load(HEAP32,779)|0);
|
|
$9 = ($8|0)==(0|0);
|
|
if ($9) {
|
|
$29 = 0;
|
|
} else {
|
|
$10 = (Atomics_load(HEAP32,779)|0);
|
|
$11 = (_fflush($10)|0);
|
|
$29 = $11;
|
|
}
|
|
$12 = (___ofl_lock()|0);
|
|
$$02325 = HEAP32[$12>>2]|0;
|
|
$13 = ($$02325|0)==(0|0);
|
|
if ($13) {
|
|
$$024$lcssa = $29;
|
|
} else {
|
|
$$02327 = $$02325;$$02426 = $29;
|
|
while(1) {
|
|
$14 = ((($$02327)) + 76|0);
|
|
$15 = (Atomics_load(HEAP32,$14>>2)|0);
|
|
$16 = ($15|0)>(-1);
|
|
if ($16) {
|
|
$17 = (___lockfile($$02327)|0);
|
|
$26 = $17;
|
|
} else {
|
|
$26 = 0;
|
|
}
|
|
$18 = ((($$02327)) + 20|0);
|
|
$19 = HEAP32[$18>>2]|0;
|
|
$20 = ((($$02327)) + 28|0);
|
|
$21 = HEAP32[$20>>2]|0;
|
|
$22 = ($19>>>0)>($21>>>0);
|
|
if ($22) {
|
|
$23 = (___fflush_unlocked($$02327)|0);
|
|
$24 = $23 | $$02426;
|
|
$$1 = $24;
|
|
} else {
|
|
$$1 = $$02426;
|
|
}
|
|
$25 = ($26|0)==(0);
|
|
if (!($25)) {
|
|
___unlockfile($$02327);
|
|
}
|
|
$27 = ((($$02327)) + 56|0);
|
|
$$023 = HEAP32[$27>>2]|0;
|
|
$28 = ($$023|0)==(0|0);
|
|
if ($28) {
|
|
$$024$lcssa = $$1;
|
|
break;
|
|
} else {
|
|
$$02327 = $$023;$$02426 = $$1;
|
|
}
|
|
}
|
|
}
|
|
___ofl_unlock();
|
|
$$0 = $$024$lcssa;
|
|
} else {
|
|
$2 = ((($0)) + 76|0);
|
|
$3 = (Atomics_load(HEAP32,$2>>2)|0);
|
|
$4 = ($3|0)>(-1);
|
|
if (!($4)) {
|
|
$5 = (___fflush_unlocked($0)|0);
|
|
$$0 = $5;
|
|
break;
|
|
}
|
|
$6 = (___lockfile($0)|0);
|
|
$phitmp = ($6|0)==(0);
|
|
$7 = (___fflush_unlocked($0)|0);
|
|
if ($phitmp) {
|
|
$$0 = $7;
|
|
} else {
|
|
___unlockfile($0);
|
|
$$0 = $7;
|
|
}
|
|
}
|
|
} while(0);
|
|
return ($$0|0);
|
|
}
|
|
function ___fflush_unlocked($0) {
|
|
$0 = $0|0;
|
|
var $$0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
|
|
var $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = ((($0)) + 20|0);
|
|
$2 = HEAP32[$1>>2]|0;
|
|
$3 = ((($0)) + 28|0);
|
|
$4 = HEAP32[$3>>2]|0;
|
|
$5 = ($2>>>0)>($4>>>0);
|
|
if ($5) {
|
|
$6 = ((($0)) + 36|0);
|
|
$7 = HEAP32[$6>>2]|0;
|
|
(FUNCTION_TABLE_iiii[$7 & 15]($0,0,0)|0);
|
|
$8 = HEAP32[$1>>2]|0;
|
|
$9 = ($8|0)==(0|0);
|
|
if ($9) {
|
|
$$0 = -1;
|
|
} else {
|
|
label = 3;
|
|
}
|
|
} else {
|
|
label = 3;
|
|
}
|
|
if ((label|0) == 3) {
|
|
$10 = ((($0)) + 4|0);
|
|
$11 = HEAP32[$10>>2]|0;
|
|
$12 = ((($0)) + 8|0);
|
|
$13 = HEAP32[$12>>2]|0;
|
|
$14 = ($11>>>0)<($13>>>0);
|
|
if ($14) {
|
|
$15 = $11;
|
|
$16 = $13;
|
|
$17 = (($15) - ($16))|0;
|
|
$18 = ((($0)) + 40|0);
|
|
$19 = HEAP32[$18>>2]|0;
|
|
(FUNCTION_TABLE_iiii[$19 & 15]($0,$17,1)|0);
|
|
}
|
|
$20 = ((($0)) + 16|0);
|
|
HEAP32[$20>>2] = 0;
|
|
HEAP32[$3>>2] = 0;
|
|
HEAP32[$1>>2] = 0;
|
|
HEAP32[$12>>2] = 0;
|
|
HEAP32[$10>>2] = 0;
|
|
$$0 = 0;
|
|
}
|
|
return ($$0|0);
|
|
}
|
|
function _strstr($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0;
|
|
var $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = HEAP8[$1>>0]|0;
|
|
$3 = ($2<<24>>24)==(0);
|
|
do {
|
|
if ($3) {
|
|
$$0 = $0;
|
|
} else {
|
|
$4 = $2 << 24 >> 24;
|
|
$5 = (_strchr($0,$4)|0);
|
|
$6 = ($5|0)==(0|0);
|
|
if ($6) {
|
|
$$0 = 0;
|
|
} else {
|
|
$7 = ((($1)) + 1|0);
|
|
$8 = HEAP8[$7>>0]|0;
|
|
$9 = ($8<<24>>24)==(0);
|
|
if ($9) {
|
|
$$0 = $5;
|
|
} else {
|
|
$10 = ((($5)) + 1|0);
|
|
$11 = HEAP8[$10>>0]|0;
|
|
$12 = ($11<<24>>24)==(0);
|
|
if ($12) {
|
|
$$0 = 0;
|
|
} else {
|
|
$13 = ((($1)) + 2|0);
|
|
$14 = HEAP8[$13>>0]|0;
|
|
$15 = ($14<<24>>24)==(0);
|
|
if ($15) {
|
|
$16 = (_twobyte_strstr($5,$1)|0);
|
|
$$0 = $16;
|
|
break;
|
|
}
|
|
$17 = ((($5)) + 2|0);
|
|
$18 = HEAP8[$17>>0]|0;
|
|
$19 = ($18<<24>>24)==(0);
|
|
if ($19) {
|
|
$$0 = 0;
|
|
} else {
|
|
$20 = ((($1)) + 3|0);
|
|
$21 = HEAP8[$20>>0]|0;
|
|
$22 = ($21<<24>>24)==(0);
|
|
if ($22) {
|
|
$23 = (_threebyte_strstr($5,$1)|0);
|
|
$$0 = $23;
|
|
break;
|
|
}
|
|
$24 = ((($5)) + 3|0);
|
|
$25 = HEAP8[$24>>0]|0;
|
|
$26 = ($25<<24>>24)==(0);
|
|
if ($26) {
|
|
$$0 = 0;
|
|
} else {
|
|
$27 = ((($1)) + 4|0);
|
|
$28 = HEAP8[$27>>0]|0;
|
|
$29 = ($28<<24>>24)==(0);
|
|
if ($29) {
|
|
$30 = (_fourbyte_strstr($5,$1)|0);
|
|
$$0 = $30;
|
|
break;
|
|
} else {
|
|
$31 = (_twoway_strstr($5,$1)|0);
|
|
$$0 = $31;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
return ($$0|0);
|
|
}
|
|
function _twobyte_strstr($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$lcssa = 0, $$sink = 0, $$sink$in = 0, $$sink$masked = 0, $$sink17$sink = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0;
|
|
var label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = HEAP8[$1>>0]|0;
|
|
$3 = $2&255;
|
|
$4 = $3 << 8;
|
|
$5 = ((($1)) + 1|0);
|
|
$6 = HEAP8[$5>>0]|0;
|
|
$7 = $6&255;
|
|
$8 = $4 | $7;
|
|
$9 = HEAP8[$0>>0]|0;
|
|
$10 = $9&255;
|
|
$$sink$in = $10;$$sink17$sink = $0;
|
|
while(1) {
|
|
$11 = ((($$sink17$sink)) + 1|0);
|
|
$12 = HEAP8[$11>>0]|0;
|
|
$13 = ($12<<24>>24)==(0);
|
|
if ($13) {
|
|
$$lcssa = 0;
|
|
break;
|
|
}
|
|
$$sink = $$sink$in << 8;
|
|
$14 = $12&255;
|
|
$$sink$masked = $$sink & 65280;
|
|
$15 = $14 | $$sink$masked;
|
|
$16 = ($15|0)==($8|0);
|
|
if ($16) {
|
|
$$lcssa = $$sink17$sink;
|
|
break;
|
|
} else {
|
|
$$sink$in = $15;$$sink17$sink = $11;
|
|
}
|
|
}
|
|
return ($$lcssa|0);
|
|
}
|
|
function _threebyte_strstr($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$016$lcssa = 0, $$01619 = 0, $$020 = 0, $$lcssa = 0, $$not = 0, $$not17 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0;
|
|
var $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $4 = 0, $5 = 0, $6 = 0;
|
|
var $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond18 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = HEAP8[$1>>0]|0;
|
|
$3 = $2&255;
|
|
$4 = $3 << 24;
|
|
$5 = ((($1)) + 1|0);
|
|
$6 = HEAP8[$5>>0]|0;
|
|
$7 = $6&255;
|
|
$8 = $7 << 16;
|
|
$9 = $8 | $4;
|
|
$10 = ((($1)) + 2|0);
|
|
$11 = HEAP8[$10>>0]|0;
|
|
$12 = $11&255;
|
|
$13 = $12 << 8;
|
|
$14 = $9 | $13;
|
|
$15 = HEAP8[$0>>0]|0;
|
|
$16 = $15&255;
|
|
$17 = $16 << 24;
|
|
$18 = ((($0)) + 1|0);
|
|
$19 = HEAP8[$18>>0]|0;
|
|
$20 = $19&255;
|
|
$21 = $20 << 16;
|
|
$22 = $21 | $17;
|
|
$23 = ((($0)) + 2|0);
|
|
$24 = HEAP8[$23>>0]|0;
|
|
$25 = $24&255;
|
|
$26 = $25 << 8;
|
|
$27 = $22 | $26;
|
|
$28 = ($24<<24>>24)!=(0);
|
|
$$not17 = $28 ^ 1;
|
|
$29 = ($27|0)==($14|0);
|
|
$or$cond18 = $29 | $$not17;
|
|
if ($or$cond18) {
|
|
$$016$lcssa = $23;$$lcssa = $28;
|
|
} else {
|
|
$$01619 = $23;$$020 = $27;
|
|
while(1) {
|
|
$30 = ((($$01619)) + 1|0);
|
|
$31 = HEAP8[$30>>0]|0;
|
|
$32 = $31&255;
|
|
$33 = $32 | $$020;
|
|
$34 = $33 << 8;
|
|
$35 = ($31<<24>>24)!=(0);
|
|
$$not = $35 ^ 1;
|
|
$36 = ($34|0)==($14|0);
|
|
$or$cond = $36 | $$not;
|
|
if ($or$cond) {
|
|
$$016$lcssa = $30;$$lcssa = $35;
|
|
break;
|
|
} else {
|
|
$$01619 = $30;$$020 = $34;
|
|
}
|
|
}
|
|
}
|
|
$37 = ((($$016$lcssa)) + -2|0);
|
|
$38 = $$lcssa ? $37 : 0;
|
|
return ($38|0);
|
|
}
|
|
function _fourbyte_strstr($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$lcssa = 0, $$not = 0, $$not22 = 0, $$sink21$lcssa = 0, $$sink2124 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
|
|
var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
|
|
var $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond23 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = HEAP8[$1>>0]|0;
|
|
$3 = $2&255;
|
|
$4 = $3 << 24;
|
|
$5 = ((($1)) + 1|0);
|
|
$6 = HEAP8[$5>>0]|0;
|
|
$7 = $6&255;
|
|
$8 = $7 << 16;
|
|
$9 = $8 | $4;
|
|
$10 = ((($1)) + 2|0);
|
|
$11 = HEAP8[$10>>0]|0;
|
|
$12 = $11&255;
|
|
$13 = $12 << 8;
|
|
$14 = $9 | $13;
|
|
$15 = ((($1)) + 3|0);
|
|
$16 = HEAP8[$15>>0]|0;
|
|
$17 = $16&255;
|
|
$18 = $14 | $17;
|
|
$19 = HEAP8[$0>>0]|0;
|
|
$20 = $19&255;
|
|
$21 = $20 << 24;
|
|
$22 = ((($0)) + 1|0);
|
|
$23 = HEAP8[$22>>0]|0;
|
|
$24 = $23&255;
|
|
$25 = $24 << 16;
|
|
$26 = $25 | $21;
|
|
$27 = ((($0)) + 2|0);
|
|
$28 = HEAP8[$27>>0]|0;
|
|
$29 = $28&255;
|
|
$30 = $29 << 8;
|
|
$31 = $26 | $30;
|
|
$32 = ((($0)) + 3|0);
|
|
$33 = HEAP8[$32>>0]|0;
|
|
$34 = $33&255;
|
|
$35 = $34 | $31;
|
|
$36 = ($33<<24>>24)!=(0);
|
|
$$not22 = $36 ^ 1;
|
|
$37 = ($35|0)==($18|0);
|
|
$or$cond23 = $37 | $$not22;
|
|
if ($or$cond23) {
|
|
$$lcssa = $36;$$sink21$lcssa = $32;
|
|
} else {
|
|
$$sink2124 = $32;$39 = $35;
|
|
while(1) {
|
|
$38 = $39 << 8;
|
|
$40 = ((($$sink2124)) + 1|0);
|
|
$41 = HEAP8[$40>>0]|0;
|
|
$42 = $41&255;
|
|
$43 = $42 | $38;
|
|
$44 = ($41<<24>>24)!=(0);
|
|
$$not = $44 ^ 1;
|
|
$45 = ($43|0)==($18|0);
|
|
$or$cond = $45 | $$not;
|
|
if ($or$cond) {
|
|
$$lcssa = $44;$$sink21$lcssa = $40;
|
|
break;
|
|
} else {
|
|
$$sink2124 = $40;$39 = $43;
|
|
}
|
|
}
|
|
}
|
|
$46 = ((($$sink21$lcssa)) + -3|0);
|
|
$47 = $$lcssa ? $46 : 0;
|
|
return ($47|0);
|
|
}
|
|
function _twoway_strstr($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$0166 = 0, $$0168 = 0, $$0169 = 0, $$0169$be = 0, $$0170 = 0, $$0175$ph$ph$lcssa220 = 0, $$0175$ph$ph$lcssa220323 = 0, $$0175$ph$ph256 = 0, $$0179244 = 0, $$0183$ph200$ph255 = 0, $$0183$ph200250 = 0, $$0183$ph262 = 0, $$0185$ph$lcssa = 0, $$0185$ph$lcssa322 = 0, $$0185$ph261 = 0, $$0187$lcssa320321 = 0, $$0187266 = 0, $$1176$$0175 = 0, $$1176$ph$ph$lcssa211 = 0, $$1176$ph$ph235 = 0;
|
|
var $$1180224 = 0, $$1184$ph196$ph234 = 0, $$1184$ph196229 = 0, $$1184$ph241 = 0, $$1186$$0185 = 0, $$1186$$0185$ = 0, $$1186$ph$lcssa = 0, $$1186$ph240 = 0, $$2181 = 0, $$2181$sink = 0, $$3 = 0, $$3173 = 0, $$3178 = 0, $$3182223 = 0, $$4 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0;
|
|
var $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0;
|
|
var $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0;
|
|
var $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0;
|
|
var $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0, $55 = 0;
|
|
var $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0, $73 = 0;
|
|
var $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0, $91 = 0;
|
|
var $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $cond = 0, $cond191 = 0, $cond191222 = 0, $cond265 = 0, $div = 0, $div188 = 0, $or$cond = 0, $or$cond190 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 1056|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(1056|0);
|
|
$2 = sp + 1024|0;
|
|
$3 = sp;
|
|
;HEAP32[$2>>2]=0|0;HEAP32[$2+4>>2]=0|0;HEAP32[$2+8>>2]=0|0;HEAP32[$2+12>>2]=0|0;HEAP32[$2+16>>2]=0|0;HEAP32[$2+20>>2]=0|0;HEAP32[$2+24>>2]=0|0;HEAP32[$2+28>>2]=0|0;
|
|
$4 = HEAP8[$1>>0]|0;
|
|
$cond265 = ($4<<24>>24)==(0);
|
|
L1: do {
|
|
if ($cond265) {
|
|
$$0175$ph$ph$lcssa220323 = 1;$$0185$ph$lcssa322 = -1;$$0187$lcssa320321 = 0;$$1176$ph$ph$lcssa211 = 1;$$1186$ph$lcssa = -1;
|
|
label = 27;
|
|
} else {
|
|
$5 = $4&255;
|
|
$$0187266 = 0;$12 = $4;$20 = $5;
|
|
while(1) {
|
|
$8 = (($0) + ($$0187266)|0);
|
|
$9 = HEAP8[$8>>0]|0;
|
|
$10 = ($9<<24>>24)==(0);
|
|
if ($10) {
|
|
$$3 = 0;
|
|
break L1;
|
|
}
|
|
$11 = $12 & 31;
|
|
$13 = $11&255;
|
|
$14 = 1 << $13;
|
|
$div188 = ($12&255) >>> 5;
|
|
$15 = $div188&255;
|
|
$16 = (($2) + ($15<<2)|0);
|
|
$17 = HEAP32[$16>>2]|0;
|
|
$18 = $17 | $14;
|
|
HEAP32[$16>>2] = $18;
|
|
$7 = (($$0187266) + 1)|0;
|
|
$19 = (($3) + ($20<<2)|0);
|
|
HEAP32[$19>>2] = $7;
|
|
$21 = (($1) + ($7)|0);
|
|
$22 = HEAP8[$21>>0]|0;
|
|
$23 = $22&255;
|
|
$cond = ($22<<24>>24)==(0);
|
|
if ($cond) {
|
|
break;
|
|
} else {
|
|
$$0187266 = $7;$12 = $22;$20 = $23;
|
|
}
|
|
}
|
|
$6 = ($7>>>0)>(1);
|
|
if ($6) {
|
|
$$0183$ph262 = 0;$$0185$ph261 = -1;$129 = 1;
|
|
L7: while(1) {
|
|
$$0175$ph$ph256 = 1;$$0183$ph200$ph255 = $$0183$ph262;$132 = $129;
|
|
while(1) {
|
|
$$0183$ph200250 = $$0183$ph200$ph255;$131 = $132;
|
|
L11: while(1) {
|
|
$$0179244 = 1;$31 = $131;
|
|
while(1) {
|
|
$27 = (($$0179244) + ($$0185$ph261))|0;
|
|
$28 = (($1) + ($27)|0);
|
|
$29 = HEAP8[$28>>0]|0;
|
|
$30 = (($1) + ($31)|0);
|
|
$32 = HEAP8[$30>>0]|0;
|
|
$33 = ($29<<24>>24)==($32<<24>>24);
|
|
if (!($33)) {
|
|
break L11;
|
|
}
|
|
$34 = ($$0179244|0)==($$0175$ph$ph256|0);
|
|
$25 = (($$0179244) + 1)|0;
|
|
if ($34) {
|
|
break;
|
|
}
|
|
$24 = (($25) + ($$0183$ph200250))|0;
|
|
$26 = ($24>>>0)<($7>>>0);
|
|
if ($26) {
|
|
$$0179244 = $25;$31 = $24;
|
|
} else {
|
|
$$0175$ph$ph$lcssa220 = $$0175$ph$ph256;$$0185$ph$lcssa = $$0185$ph261;
|
|
break L7;
|
|
}
|
|
}
|
|
$35 = (($$0175$ph$ph256) + ($$0183$ph200250))|0;
|
|
$36 = (($35) + 1)|0;
|
|
$37 = ($36>>>0)<($7>>>0);
|
|
if ($37) {
|
|
$$0183$ph200250 = $35;$131 = $36;
|
|
} else {
|
|
$$0175$ph$ph$lcssa220 = $$0175$ph$ph256;$$0185$ph$lcssa = $$0185$ph261;
|
|
break L7;
|
|
}
|
|
}
|
|
$38 = ($29&255)>($32&255);
|
|
$39 = (($31) - ($$0185$ph261))|0;
|
|
if (!($38)) {
|
|
break;
|
|
}
|
|
$43 = (($31) + 1)|0;
|
|
$44 = ($43>>>0)<($7>>>0);
|
|
if ($44) {
|
|
$$0175$ph$ph256 = $39;$$0183$ph200$ph255 = $31;$132 = $43;
|
|
} else {
|
|
$$0175$ph$ph$lcssa220 = $39;$$0185$ph$lcssa = $$0185$ph261;
|
|
break L7;
|
|
}
|
|
}
|
|
$40 = (($$0183$ph200250) + 1)|0;
|
|
$41 = (($$0183$ph200250) + 2)|0;
|
|
$42 = ($41>>>0)<($7>>>0);
|
|
if ($42) {
|
|
$$0183$ph262 = $40;$$0185$ph261 = $$0183$ph200250;$129 = $41;
|
|
} else {
|
|
$$0175$ph$ph$lcssa220 = 1;$$0185$ph$lcssa = $$0183$ph200250;
|
|
break;
|
|
}
|
|
}
|
|
if ($6) {
|
|
$$1184$ph241 = 0;$$1186$ph240 = -1;$130 = 1;
|
|
while(1) {
|
|
$$1176$ph$ph235 = 1;$$1184$ph196$ph234 = $$1184$ph241;$134 = $130;
|
|
while(1) {
|
|
$$1184$ph196229 = $$1184$ph196$ph234;$133 = $134;
|
|
L26: while(1) {
|
|
$$1180224 = 1;$52 = $133;
|
|
while(1) {
|
|
$48 = (($$1180224) + ($$1186$ph240))|0;
|
|
$49 = (($1) + ($48)|0);
|
|
$50 = HEAP8[$49>>0]|0;
|
|
$51 = (($1) + ($52)|0);
|
|
$53 = HEAP8[$51>>0]|0;
|
|
$54 = ($50<<24>>24)==($53<<24>>24);
|
|
if (!($54)) {
|
|
break L26;
|
|
}
|
|
$55 = ($$1180224|0)==($$1176$ph$ph235|0);
|
|
$46 = (($$1180224) + 1)|0;
|
|
if ($55) {
|
|
break;
|
|
}
|
|
$45 = (($46) + ($$1184$ph196229))|0;
|
|
$47 = ($45>>>0)<($7>>>0);
|
|
if ($47) {
|
|
$$1180224 = $46;$52 = $45;
|
|
} else {
|
|
$$0175$ph$ph$lcssa220323 = $$0175$ph$ph$lcssa220;$$0185$ph$lcssa322 = $$0185$ph$lcssa;$$0187$lcssa320321 = $7;$$1176$ph$ph$lcssa211 = $$1176$ph$ph235;$$1186$ph$lcssa = $$1186$ph240;
|
|
label = 27;
|
|
break L1;
|
|
}
|
|
}
|
|
$56 = (($$1176$ph$ph235) + ($$1184$ph196229))|0;
|
|
$57 = (($56) + 1)|0;
|
|
$58 = ($57>>>0)<($7>>>0);
|
|
if ($58) {
|
|
$$1184$ph196229 = $56;$133 = $57;
|
|
} else {
|
|
$$0175$ph$ph$lcssa220323 = $$0175$ph$ph$lcssa220;$$0185$ph$lcssa322 = $$0185$ph$lcssa;$$0187$lcssa320321 = $7;$$1176$ph$ph$lcssa211 = $$1176$ph$ph235;$$1186$ph$lcssa = $$1186$ph240;
|
|
label = 27;
|
|
break L1;
|
|
}
|
|
}
|
|
$59 = ($50&255)<($53&255);
|
|
$60 = (($52) - ($$1186$ph240))|0;
|
|
if (!($59)) {
|
|
break;
|
|
}
|
|
$64 = (($52) + 1)|0;
|
|
$65 = ($64>>>0)<($7>>>0);
|
|
if ($65) {
|
|
$$1176$ph$ph235 = $60;$$1184$ph196$ph234 = $52;$134 = $64;
|
|
} else {
|
|
$$0175$ph$ph$lcssa220323 = $$0175$ph$ph$lcssa220;$$0185$ph$lcssa322 = $$0185$ph$lcssa;$$0187$lcssa320321 = $7;$$1176$ph$ph$lcssa211 = $60;$$1186$ph$lcssa = $$1186$ph240;
|
|
label = 27;
|
|
break L1;
|
|
}
|
|
}
|
|
$61 = (($$1184$ph196229) + 1)|0;
|
|
$62 = (($$1184$ph196229) + 2)|0;
|
|
$63 = ($62>>>0)<($7>>>0);
|
|
if ($63) {
|
|
$$1184$ph241 = $61;$$1186$ph240 = $$1184$ph196229;$130 = $62;
|
|
} else {
|
|
$$0175$ph$ph$lcssa220323 = $$0175$ph$ph$lcssa220;$$0185$ph$lcssa322 = $$0185$ph$lcssa;$$0187$lcssa320321 = $7;$$1176$ph$ph$lcssa211 = 1;$$1186$ph$lcssa = $$1184$ph196229;
|
|
label = 27;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$0175$ph$ph$lcssa220323 = $$0175$ph$ph$lcssa220;$$0185$ph$lcssa322 = $$0185$ph$lcssa;$$0187$lcssa320321 = $7;$$1176$ph$ph$lcssa211 = 1;$$1186$ph$lcssa = -1;
|
|
label = 27;
|
|
}
|
|
} else {
|
|
$$0175$ph$ph$lcssa220323 = 1;$$0185$ph$lcssa322 = -1;$$0187$lcssa320321 = $7;$$1176$ph$ph$lcssa211 = 1;$$1186$ph$lcssa = -1;
|
|
label = 27;
|
|
}
|
|
}
|
|
} while(0);
|
|
L36: do {
|
|
if ((label|0) == 27) {
|
|
$66 = (($$1186$ph$lcssa) + 1)|0;
|
|
$67 = (($$0185$ph$lcssa322) + 1)|0;
|
|
$68 = ($66>>>0)>($67>>>0);
|
|
$$1176$$0175 = $68 ? $$1176$ph$ph$lcssa211 : $$0175$ph$ph$lcssa220323;
|
|
$$1186$$0185 = $68 ? $$1186$ph$lcssa : $$0185$ph$lcssa322;
|
|
$69 = (($1) + ($$1176$$0175)|0);
|
|
$70 = (($$1186$$0185) + 1)|0;
|
|
$71 = (_memcmp($1,$69,$70)|0);
|
|
$72 = ($71|0)==(0);
|
|
if ($72) {
|
|
$77 = (($$0187$lcssa320321) - ($$1176$$0175))|0;
|
|
$$0168 = $77;$$3178 = $$1176$$0175;
|
|
} else {
|
|
$73 = (($$0187$lcssa320321) - ($$1186$$0185))|0;
|
|
$74 = (($73) + -1)|0;
|
|
$75 = ($$1186$$0185>>>0)>($74>>>0);
|
|
$$1186$$0185$ = $75 ? $$1186$$0185 : $74;
|
|
$76 = (($$1186$$0185$) + 1)|0;
|
|
$$0168 = 0;$$3178 = $76;
|
|
}
|
|
$78 = $$0187$lcssa320321 | 63;
|
|
$79 = (($$0187$lcssa320321) + -1)|0;
|
|
$80 = ($$0168|0)!=(0);
|
|
$81 = (($$0187$lcssa320321) - ($$3178))|0;
|
|
$$0166 = $0;$$0169 = 0;$$0170 = $0;
|
|
while(1) {
|
|
$82 = $$0170;
|
|
$83 = $$0166;
|
|
$84 = (($82) - ($83))|0;
|
|
$85 = ($84>>>0)<($$0187$lcssa320321>>>0);
|
|
do {
|
|
if ($85) {
|
|
$86 = (_memchr($$0170,0,$78)|0);
|
|
$87 = ($86|0)==(0|0);
|
|
if ($87) {
|
|
$91 = (($$0170) + ($78)|0);
|
|
$$3173 = $91;
|
|
break;
|
|
} else {
|
|
$88 = $86;
|
|
$89 = (($88) - ($83))|0;
|
|
$90 = ($89>>>0)<($$0187$lcssa320321>>>0);
|
|
if ($90) {
|
|
$$3 = 0;
|
|
break L36;
|
|
} else {
|
|
$$3173 = $86;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$3173 = $$0170;
|
|
}
|
|
} while(0);
|
|
$92 = (($$0166) + ($79)|0);
|
|
$93 = HEAP8[$92>>0]|0;
|
|
$div = ($93&255) >>> 5;
|
|
$94 = $div&255;
|
|
$95 = (($2) + ($94<<2)|0);
|
|
$96 = HEAP32[$95>>2]|0;
|
|
$97 = $93 & 31;
|
|
$98 = $97&255;
|
|
$99 = 1 << $98;
|
|
$100 = $99 & $96;
|
|
$101 = ($100|0)==(0);
|
|
L50: do {
|
|
if ($101) {
|
|
$$0169$be = 0;$$2181$sink = $$0187$lcssa320321;
|
|
} else {
|
|
$102 = $93&255;
|
|
$103 = (($3) + ($102<<2)|0);
|
|
$104 = HEAP32[$103>>2]|0;
|
|
$105 = (($$0187$lcssa320321) - ($104))|0;
|
|
$106 = ($105|0)==(0);
|
|
if (!($106)) {
|
|
$107 = ($$0169|0)!=(0);
|
|
$or$cond = $80 & $107;
|
|
$108 = ($105>>>0)<($$3178>>>0);
|
|
$or$cond190 = $or$cond & $108;
|
|
$$2181 = $or$cond190 ? $81 : $105;
|
|
$$0169$be = 0;$$2181$sink = $$2181;
|
|
break;
|
|
}
|
|
$110 = ($70>>>0)>($$0169>>>0);
|
|
$111 = $110 ? $70 : $$0169;
|
|
$112 = (($1) + ($111)|0);
|
|
$113 = HEAP8[$112>>0]|0;
|
|
$cond191222 = ($113<<24>>24)==(0);
|
|
L55: do {
|
|
if ($cond191222) {
|
|
$$4 = $70;
|
|
} else {
|
|
$$3182223 = $111;$117 = $113;
|
|
while(1) {
|
|
$114 = (($$0166) + ($$3182223)|0);
|
|
$115 = HEAP8[$114>>0]|0;
|
|
$116 = ($117<<24>>24)==($115<<24>>24);
|
|
if (!($116)) {
|
|
break;
|
|
}
|
|
$118 = (($$3182223) + 1)|0;
|
|
$119 = (($1) + ($118)|0);
|
|
$120 = HEAP8[$119>>0]|0;
|
|
$cond191 = ($120<<24>>24)==(0);
|
|
if ($cond191) {
|
|
$$4 = $70;
|
|
break L55;
|
|
} else {
|
|
$$3182223 = $118;$117 = $120;
|
|
}
|
|
}
|
|
$121 = (($$3182223) - ($$1186$$0185))|0;
|
|
$$0169$be = 0;$$2181$sink = $121;
|
|
break L50;
|
|
}
|
|
} while(0);
|
|
while(1) {
|
|
$122 = ($$4>>>0)>($$0169>>>0);
|
|
if (!($122)) {
|
|
$$3 = $$0166;
|
|
break L36;
|
|
}
|
|
$123 = (($$4) + -1)|0;
|
|
$124 = (($1) + ($123)|0);
|
|
$125 = HEAP8[$124>>0]|0;
|
|
$126 = (($$0166) + ($123)|0);
|
|
$127 = HEAP8[$126>>0]|0;
|
|
$128 = ($125<<24>>24)==($127<<24>>24);
|
|
if ($128) {
|
|
$$4 = $123;
|
|
} else {
|
|
$$0169$be = $$0168;$$2181$sink = $$3178;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$109 = (($$0166) + ($$2181$sink)|0);
|
|
$$0166 = $109;$$0169 = $$0169$be;$$0170 = $$3173;
|
|
}
|
|
}
|
|
} while(0);
|
|
STACKTOP = sp;return ($$3|0);
|
|
}
|
|
function _strspn($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$0 = 0, $$01925 = 0, $$020 = 0, $$1$lcssa = 0, $$123 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
|
|
var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0;
|
|
var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $div = 0, $div21 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
|
|
$2 = sp;
|
|
;HEAP32[$2>>2]=0|0;HEAP32[$2+4>>2]=0|0;HEAP32[$2+8>>2]=0|0;HEAP32[$2+12>>2]=0|0;HEAP32[$2+16>>2]=0|0;HEAP32[$2+20>>2]=0|0;HEAP32[$2+24>>2]=0|0;HEAP32[$2+28>>2]=0|0;
|
|
$3 = HEAP8[$1>>0]|0;
|
|
$4 = ($3<<24>>24)==(0);
|
|
do {
|
|
if ($4) {
|
|
$$0 = 0;
|
|
} else {
|
|
$5 = ((($1)) + 1|0);
|
|
$6 = HEAP8[$5>>0]|0;
|
|
$7 = ($6<<24>>24)==(0);
|
|
if ($7) {
|
|
$$020 = $0;
|
|
while(1) {
|
|
$8 = HEAP8[$$020>>0]|0;
|
|
$9 = ($8<<24>>24)==($3<<24>>24);
|
|
$10 = ((($$020)) + 1|0);
|
|
if ($9) {
|
|
$$020 = $10;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
$11 = $$020;
|
|
$12 = $0;
|
|
$13 = (($11) - ($12))|0;
|
|
$$0 = $13;
|
|
break;
|
|
} else {
|
|
$$01925 = $1;$17 = $3;
|
|
}
|
|
while(1) {
|
|
$16 = $17 & 31;
|
|
$18 = $16&255;
|
|
$19 = 1 << $18;
|
|
$div21 = ($17&255) >>> 5;
|
|
$20 = $div21&255;
|
|
$21 = (($2) + ($20<<2)|0);
|
|
$22 = HEAP32[$21>>2]|0;
|
|
$23 = $22 | $19;
|
|
HEAP32[$21>>2] = $23;
|
|
$24 = ((($$01925)) + 1|0);
|
|
$25 = HEAP8[$24>>0]|0;
|
|
$26 = ($25<<24>>24)==(0);
|
|
if ($26) {
|
|
break;
|
|
} else {
|
|
$$01925 = $24;$17 = $25;
|
|
}
|
|
}
|
|
$14 = HEAP8[$0>>0]|0;
|
|
$15 = ($14<<24>>24)==(0);
|
|
L10: do {
|
|
if ($15) {
|
|
$$1$lcssa = $0;
|
|
} else {
|
|
$$123 = $0;$27 = $14;
|
|
while(1) {
|
|
$div = ($27&255) >>> 5;
|
|
$28 = $div&255;
|
|
$29 = (($2) + ($28<<2)|0);
|
|
$30 = HEAP32[$29>>2]|0;
|
|
$31 = $27 & 31;
|
|
$32 = $31&255;
|
|
$33 = 1 << $32;
|
|
$34 = $30 & $33;
|
|
$35 = ($34|0)==(0);
|
|
if ($35) {
|
|
$$1$lcssa = $$123;
|
|
break L10;
|
|
}
|
|
$36 = ((($$123)) + 1|0);
|
|
$37 = HEAP8[$36>>0]|0;
|
|
$38 = ($37<<24>>24)==(0);
|
|
if ($38) {
|
|
$$1$lcssa = $36;
|
|
break;
|
|
} else {
|
|
$$123 = $36;$27 = $37;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$39 = $$1$lcssa;
|
|
$40 = $0;
|
|
$41 = (($39) - ($40))|0;
|
|
$$0 = $41;
|
|
}
|
|
} while(0);
|
|
STACKTOP = sp;return ($$0|0);
|
|
}
|
|
function _srand($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = (($0) + -1)|0;
|
|
$2 = 14272;
|
|
$3 = $2;
|
|
HEAP32[$3>>2] = $1;
|
|
$4 = (($2) + 4)|0;
|
|
$5 = $4;
|
|
HEAP32[$5>>2] = 0;
|
|
return;
|
|
}
|
|
function _rand() {
|
|
var $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$0 = 14272;
|
|
$1 = $0;
|
|
$2 = HEAP32[$1>>2]|0;
|
|
$3 = (($0) + 4)|0;
|
|
$4 = $3;
|
|
$5 = HEAP32[$4>>2]|0;
|
|
$6 = (___muldi3(($2|0),($5|0),1284865837,1481765933)|0);
|
|
$7 = tempRet0;
|
|
$8 = (_i64Add(($6|0),($7|0),1,0)|0);
|
|
$9 = tempRet0;
|
|
$10 = 14272;
|
|
$11 = $10;
|
|
HEAP32[$11>>2] = $8;
|
|
$12 = (($10) + 4)|0;
|
|
$13 = $12;
|
|
HEAP32[$13>>2] = $9;
|
|
$14 = (_bitshift64Lshr(($8|0),($9|0),33)|0);
|
|
$15 = tempRet0;
|
|
return ($14|0);
|
|
}
|
|
function _vprintf($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $2 = 0, $3 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = HEAP32[747]|0;
|
|
$3 = (_vfprintf($2,$0,$1)|0);
|
|
return ($3|0);
|
|
}
|
|
function _strcspn($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$01824 = 0, $$019$sink = 0, $$01922 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
|
|
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $div = 0;
|
|
var $div20 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
|
|
$2 = sp;
|
|
$3 = HEAP8[$1>>0]|0;
|
|
$4 = ($3<<24>>24)==(0);
|
|
L1: do {
|
|
if ($4) {
|
|
label = 3;
|
|
} else {
|
|
$5 = ((($1)) + 1|0);
|
|
$6 = HEAP8[$5>>0]|0;
|
|
$7 = ($6<<24>>24)==(0);
|
|
if ($7) {
|
|
label = 3;
|
|
} else {
|
|
;HEAP32[$2>>2]=0|0;HEAP32[$2+4>>2]=0|0;HEAP32[$2+8>>2]=0|0;HEAP32[$2+12>>2]=0|0;HEAP32[$2+16>>2]=0|0;HEAP32[$2+20>>2]=0|0;HEAP32[$2+24>>2]=0|0;HEAP32[$2+28>>2]=0|0;
|
|
$$01824 = $1;$13 = $3;
|
|
while(1) {
|
|
$12 = $13 & 31;
|
|
$14 = $12&255;
|
|
$15 = 1 << $14;
|
|
$div20 = ($13&255) >>> 5;
|
|
$16 = $div20&255;
|
|
$17 = (($2) + ($16<<2)|0);
|
|
$18 = HEAP32[$17>>2]|0;
|
|
$19 = $18 | $15;
|
|
HEAP32[$17>>2] = $19;
|
|
$20 = ((($$01824)) + 1|0);
|
|
$21 = HEAP8[$20>>0]|0;
|
|
$22 = ($21<<24>>24)==(0);
|
|
if ($22) {
|
|
break;
|
|
} else {
|
|
$$01824 = $20;$13 = $21;
|
|
}
|
|
}
|
|
$10 = HEAP8[$0>>0]|0;
|
|
$11 = ($10<<24>>24)==(0);
|
|
if ($11) {
|
|
$$019$sink = $0;
|
|
} else {
|
|
$$01922 = $0;$23 = $10;
|
|
while(1) {
|
|
$div = ($23&255) >>> 5;
|
|
$24 = $div&255;
|
|
$25 = (($2) + ($24<<2)|0);
|
|
$26 = HEAP32[$25>>2]|0;
|
|
$27 = $23 & 31;
|
|
$28 = $27&255;
|
|
$29 = 1 << $28;
|
|
$30 = $26 & $29;
|
|
$31 = ($30|0)==(0);
|
|
if (!($31)) {
|
|
$$019$sink = $$01922;
|
|
break L1;
|
|
}
|
|
$32 = ((($$01922)) + 1|0);
|
|
$33 = HEAP8[$32>>0]|0;
|
|
$34 = ($33<<24>>24)==(0);
|
|
if ($34) {
|
|
$$019$sink = $32;
|
|
break;
|
|
} else {
|
|
$$01922 = $32;$23 = $33;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
if ((label|0) == 3) {
|
|
$8 = $3 << 24 >> 24;
|
|
$9 = (___strchrnul($0,$8)|0);
|
|
$$019$sink = $9;
|
|
}
|
|
$35 = $$019$sink;
|
|
$36 = $0;
|
|
$37 = (($35) - ($36))|0;
|
|
STACKTOP = sp;return ($37|0);
|
|
}
|
|
function _strcat($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $2 = 0, $3 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = (_strlen($0)|0);
|
|
$3 = (($0) + ($2)|0);
|
|
(_strcpy($3,$1)|0);
|
|
return ($0|0);
|
|
}
|
|
function _strtok($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$0 = 0, $$010 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = ($0|0)==(0|0);
|
|
if ($2) {
|
|
$3 = HEAP32[8325]|0;
|
|
$4 = ($3|0)==(0|0);
|
|
if ($4) {
|
|
$$0 = 0;
|
|
} else {
|
|
$$010 = $3;
|
|
label = 3;
|
|
}
|
|
} else {
|
|
$$010 = $0;
|
|
label = 3;
|
|
}
|
|
do {
|
|
if ((label|0) == 3) {
|
|
$5 = (_strspn($$010,$1)|0);
|
|
$6 = (($$010) + ($5)|0);
|
|
$7 = HEAP8[$6>>0]|0;
|
|
$8 = ($7<<24>>24)==(0);
|
|
if ($8) {
|
|
HEAP32[8325] = 0;
|
|
$$0 = 0;
|
|
break;
|
|
}
|
|
$9 = (_strcspn($6,$1)|0);
|
|
$10 = (($6) + ($9)|0);
|
|
HEAP32[8325] = $10;
|
|
$11 = HEAP8[$10>>0]|0;
|
|
$12 = ($11<<24>>24)==(0);
|
|
if ($12) {
|
|
HEAP32[8325] = 0;
|
|
$$0 = $6;
|
|
break;
|
|
} else {
|
|
$13 = ((($10)) + 1|0);
|
|
HEAP32[8325] = $13;
|
|
HEAP8[$10>>0] = 0;
|
|
$$0 = $6;
|
|
break;
|
|
}
|
|
}
|
|
} while(0);
|
|
return ($$0|0);
|
|
}
|
|
function __emscripten_atomic_fetch_and_add_u64($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
|
|
var $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = $0;
|
|
$4 = $3 >>> 3;
|
|
$5 = $4 & 255;
|
|
$6 = (34376 + ($5<<2)|0);
|
|
while(1) {
|
|
while(1) {
|
|
$7 = (Atomics_load(HEAP32, $6>>2)|0);
|
|
$8 = (Atomics_compareExchange(HEAP32, $6>>2, $7, 1)|0);
|
|
$9 = ($7|0)==($8|0);
|
|
if ($9) {
|
|
break;
|
|
}
|
|
}
|
|
$10 = ($7|0)==(0);
|
|
if ($10) {
|
|
break;
|
|
}
|
|
}
|
|
$11 = $0;
|
|
$12 = $11;
|
|
$13 = HEAP32[$12>>2]|0;
|
|
$14 = (($11) + 4)|0;
|
|
$15 = $14;
|
|
$16 = HEAP32[$15>>2]|0;
|
|
$17 = (_i64Add(($13|0),($16|0),($1|0),($2|0))|0);
|
|
$18 = tempRet0;
|
|
$19 = $0;
|
|
$20 = $19;
|
|
HEAP32[$20>>2] = $17;
|
|
$21 = (($19) + 4)|0;
|
|
$22 = $21;
|
|
HEAP32[$22>>2] = $18;
|
|
$23 = (Atomics_store(HEAP32, $6>>2, 0)|0);
|
|
tempRet0 = ($16);
|
|
return ($13|0);
|
|
}
|
|
function __emscripten_atomic_fetch_and_and_u64($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
|
|
var $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = $0;
|
|
$4 = $3 >>> 3;
|
|
$5 = $4 & 255;
|
|
$6 = (34376 + ($5<<2)|0);
|
|
while(1) {
|
|
while(1) {
|
|
$7 = (Atomics_load(HEAP32, $6>>2)|0);
|
|
$8 = (Atomics_compareExchange(HEAP32, $6>>2, $7, 1)|0);
|
|
$9 = ($7|0)==($8|0);
|
|
if ($9) {
|
|
break;
|
|
}
|
|
}
|
|
$10 = ($7|0)==(0);
|
|
if ($10) {
|
|
break;
|
|
}
|
|
}
|
|
$11 = $0;
|
|
$12 = $11;
|
|
$13 = HEAP32[$12>>2]|0;
|
|
$14 = (($11) + 4)|0;
|
|
$15 = $14;
|
|
$16 = HEAP32[$15>>2]|0;
|
|
$17 = $13 & $1;
|
|
$18 = $16 & $2;
|
|
$19 = $0;
|
|
$20 = $19;
|
|
HEAP32[$20>>2] = $17;
|
|
$21 = (($19) + 4)|0;
|
|
$22 = $21;
|
|
HEAP32[$22>>2] = $18;
|
|
$23 = (Atomics_store(HEAP32, $6>>2, 0)|0);
|
|
tempRet0 = ($16);
|
|
return ($13|0);
|
|
}
|
|
function __emscripten_atomic_fetch_and_or_u64($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
|
|
var $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = $0;
|
|
$4 = $3 >>> 3;
|
|
$5 = $4 & 255;
|
|
$6 = (34376 + ($5<<2)|0);
|
|
while(1) {
|
|
while(1) {
|
|
$7 = (Atomics_load(HEAP32, $6>>2)|0);
|
|
$8 = (Atomics_compareExchange(HEAP32, $6>>2, $7, 1)|0);
|
|
$9 = ($7|0)==($8|0);
|
|
if ($9) {
|
|
break;
|
|
}
|
|
}
|
|
$10 = ($7|0)==(0);
|
|
if ($10) {
|
|
break;
|
|
}
|
|
}
|
|
$11 = $0;
|
|
$12 = $11;
|
|
$13 = HEAP32[$12>>2]|0;
|
|
$14 = (($11) + 4)|0;
|
|
$15 = $14;
|
|
$16 = HEAP32[$15>>2]|0;
|
|
$17 = $13 | $1;
|
|
$18 = $16 | $2;
|
|
$19 = $0;
|
|
$20 = $19;
|
|
HEAP32[$20>>2] = $17;
|
|
$21 = (($19) + 4)|0;
|
|
$22 = $21;
|
|
HEAP32[$22>>2] = $18;
|
|
$23 = (Atomics_store(HEAP32, $6>>2, 0)|0);
|
|
tempRet0 = ($16);
|
|
return ($13|0);
|
|
}
|
|
function __emscripten_atomic_fetch_and_sub_u64($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
|
|
var $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = $0;
|
|
$4 = $3 >>> 3;
|
|
$5 = $4 & 255;
|
|
$6 = (34376 + ($5<<2)|0);
|
|
while(1) {
|
|
while(1) {
|
|
$7 = (Atomics_load(HEAP32, $6>>2)|0);
|
|
$8 = (Atomics_compareExchange(HEAP32, $6>>2, $7, 1)|0);
|
|
$9 = ($7|0)==($8|0);
|
|
if ($9) {
|
|
break;
|
|
}
|
|
}
|
|
$10 = ($7|0)==(0);
|
|
if ($10) {
|
|
break;
|
|
}
|
|
}
|
|
$11 = $0;
|
|
$12 = $11;
|
|
$13 = HEAP32[$12>>2]|0;
|
|
$14 = (($11) + 4)|0;
|
|
$15 = $14;
|
|
$16 = HEAP32[$15>>2]|0;
|
|
$17 = (_i64Subtract(($13|0),($16|0),($1|0),($2|0))|0);
|
|
$18 = tempRet0;
|
|
$19 = $0;
|
|
$20 = $19;
|
|
HEAP32[$20>>2] = $17;
|
|
$21 = (($19) + 4)|0;
|
|
$22 = $21;
|
|
HEAP32[$22>>2] = $18;
|
|
$23 = (Atomics_store(HEAP32, $6>>2, 0)|0);
|
|
tempRet0 = ($16);
|
|
return ($13|0);
|
|
}
|
|
function __emscripten_atomic_fetch_and_xor_u64($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
|
|
var $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = $0;
|
|
$4 = $3 >>> 3;
|
|
$5 = $4 & 255;
|
|
$6 = (34376 + ($5<<2)|0);
|
|
while(1) {
|
|
while(1) {
|
|
$7 = (Atomics_load(HEAP32, $6>>2)|0);
|
|
$8 = (Atomics_compareExchange(HEAP32, $6>>2, $7, 1)|0);
|
|
$9 = ($7|0)==($8|0);
|
|
if ($9) {
|
|
break;
|
|
}
|
|
}
|
|
$10 = ($7|0)==(0);
|
|
if ($10) {
|
|
break;
|
|
}
|
|
}
|
|
$11 = $0;
|
|
$12 = $11;
|
|
$13 = HEAP32[$12>>2]|0;
|
|
$14 = (($11) + 4)|0;
|
|
$15 = $14;
|
|
$16 = HEAP32[$15>>2]|0;
|
|
$17 = $13 ^ $1;
|
|
$18 = $16 ^ $2;
|
|
$19 = $0;
|
|
$20 = $19;
|
|
HEAP32[$20>>2] = $17;
|
|
$21 = (($19) + 4)|0;
|
|
$22 = $21;
|
|
HEAP32[$22>>2] = $18;
|
|
$23 = (Atomics_store(HEAP32, $6>>2, 0)|0);
|
|
tempRet0 = ($16);
|
|
return ($13|0);
|
|
}
|
|
function _emscripten_async_run_in_main_thread($0) {
|
|
$0 = $0|0;
|
|
var $$0 = 0, $$0$in = 0, $$0$in19 = 0, $$0$lcssa = 0, $$020 = 0, $$expand_i1_val = 0, $$lcssa = 0, $$lcssa18 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
|
|
var $9 = 0, $call_queue$init$val = 0, $call_queue$init$val$pre_trunc = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = ($0|0)==(0|0);
|
|
if ($1) {
|
|
___assert_fail((13876|0),(13708|0),260,(13881|0));
|
|
// unreachable;
|
|
}
|
|
$2 = (_emscripten_is_main_runtime_thread()|0);
|
|
$3 = ($2|0)==(0);
|
|
if (!($3)) {
|
|
__do_call($0);
|
|
return;
|
|
}
|
|
(___pthread_mutex_lock(33820)|0);
|
|
$call_queue$init$val$pre_trunc = HEAP8[38271]|0;
|
|
$call_queue$init$val = $call_queue$init$val$pre_trunc&1;
|
|
if (!($call_queue$init$val)) {
|
|
$$expand_i1_val = 1;
|
|
HEAP8[38271] = $$expand_i1_val;
|
|
}
|
|
$4 = (Atomics_load(HEAP32, 8462)|0);
|
|
$5 = (Atomics_load(HEAP32, 8463)|0);
|
|
$$0$in19 = (($5) + 1)|0;
|
|
$$020 = (($$0$in19|0) % 128)&-1;
|
|
$6 = ($$020|0)==($4|0);
|
|
if ($6) {
|
|
$7 = $4;
|
|
while(1) {
|
|
(___pthread_mutex_unlock(33820)|0);
|
|
(_emscripten_futex_wait((33848|0),($7|0),inf)|0);
|
|
(___pthread_mutex_lock(33820)|0);
|
|
$8 = (Atomics_load(HEAP32, 8462)|0);
|
|
$9 = (Atomics_load(HEAP32, 8463)|0);
|
|
$$0$in = (($9) + 1)|0;
|
|
$$0 = (($$0$in|0) % 128)&-1;
|
|
$10 = ($$0|0)==($8|0);
|
|
if ($10) {
|
|
$7 = $8;
|
|
} else {
|
|
$$0$lcssa = $$0;$$lcssa = $9;$$lcssa18 = $8;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$0$lcssa = $$020;$$lcssa = $5;$$lcssa18 = $4;
|
|
}
|
|
$11 = (33856 + ($$lcssa<<2)|0);
|
|
HEAP32[$11>>2] = $0;
|
|
$12 = ($$lcssa18|0)==($$lcssa|0);
|
|
if ($12) {
|
|
_emscripten_asm_const_v(1);
|
|
}
|
|
$13 = (Atomics_store(HEAP32, 8463, $$0$lcssa)|0);
|
|
(___pthread_mutex_unlock(33820)|0);
|
|
return;
|
|
}
|
|
function _emscripten_atomic_add_u64($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
|
|
var $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = $0;
|
|
$4 = $3 >>> 3;
|
|
$5 = $4 & 255;
|
|
$6 = (34376 + ($5<<2)|0);
|
|
while(1) {
|
|
while(1) {
|
|
$7 = (Atomics_load(HEAP32, $6>>2)|0);
|
|
$8 = (Atomics_compareExchange(HEAP32, $6>>2, $7, 1)|0);
|
|
$9 = ($7|0)==($8|0);
|
|
if ($9) {
|
|
break;
|
|
}
|
|
}
|
|
$10 = ($7|0)==(0);
|
|
if ($10) {
|
|
break;
|
|
}
|
|
}
|
|
$11 = $0;
|
|
$12 = $11;
|
|
$13 = HEAP32[$12>>2]|0;
|
|
$14 = (($11) + 4)|0;
|
|
$15 = $14;
|
|
$16 = HEAP32[$15>>2]|0;
|
|
$17 = (_i64Add(($13|0),($16|0),($1|0),($2|0))|0);
|
|
$18 = tempRet0;
|
|
$19 = $0;
|
|
$20 = $19;
|
|
HEAP32[$20>>2] = $17;
|
|
$21 = (($19) + 4)|0;
|
|
$22 = $21;
|
|
HEAP32[$22>>2] = $18;
|
|
$23 = (Atomics_store(HEAP32, $6>>2, 0)|0);
|
|
tempRet0 = ($18);
|
|
return ($17|0);
|
|
}
|
|
function _emscripten_atomic_and_u64($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
|
|
var $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = $0;
|
|
$4 = $3 >>> 3;
|
|
$5 = $4 & 255;
|
|
$6 = (34376 + ($5<<2)|0);
|
|
while(1) {
|
|
while(1) {
|
|
$7 = (Atomics_load(HEAP32, $6>>2)|0);
|
|
$8 = (Atomics_compareExchange(HEAP32, $6>>2, $7, 1)|0);
|
|
$9 = ($7|0)==($8|0);
|
|
if ($9) {
|
|
break;
|
|
}
|
|
}
|
|
$10 = ($7|0)==(0);
|
|
if ($10) {
|
|
break;
|
|
}
|
|
}
|
|
$11 = $0;
|
|
$12 = $11;
|
|
$13 = HEAP32[$12>>2]|0;
|
|
$14 = (($11) + 4)|0;
|
|
$15 = $14;
|
|
$16 = HEAP32[$15>>2]|0;
|
|
$17 = $13 & $1;
|
|
$18 = $16 & $2;
|
|
$19 = $0;
|
|
$20 = $19;
|
|
HEAP32[$20>>2] = $17;
|
|
$21 = (($19) + 4)|0;
|
|
$22 = $21;
|
|
HEAP32[$22>>2] = $18;
|
|
$23 = (Atomics_store(HEAP32, $6>>2, 0)|0);
|
|
tempRet0 = ($18);
|
|
return ($17|0);
|
|
}
|
|
function _emscripten_atomic_cas_u64($0,$1,$2,$3,$4) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
$4 = $4|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $5 = 0, $6 = 0, $7 = 0;
|
|
var $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$5 = $0;
|
|
$6 = $5 >>> 3;
|
|
$7 = $6 & 255;
|
|
$8 = (34376 + ($7<<2)|0);
|
|
while(1) {
|
|
while(1) {
|
|
$9 = (Atomics_load(HEAP32, $8>>2)|0);
|
|
$10 = (Atomics_compareExchange(HEAP32, $8>>2, $9, 1)|0);
|
|
$11 = ($9|0)==($10|0);
|
|
if ($11) {
|
|
break;
|
|
}
|
|
}
|
|
$12 = ($9|0)==(0);
|
|
if ($12) {
|
|
break;
|
|
}
|
|
}
|
|
$13 = $0;
|
|
$14 = $13;
|
|
$15 = HEAP32[$14>>2]|0;
|
|
$16 = (($13) + 4)|0;
|
|
$17 = $16;
|
|
$18 = HEAP32[$17>>2]|0;
|
|
$19 = ($15|0)==($1|0);
|
|
$20 = ($18|0)==($2|0);
|
|
$21 = $19 & $20;
|
|
if (!($21)) {
|
|
$26 = (Atomics_store(HEAP32, $8>>2, 0)|0);
|
|
tempRet0 = ($18);
|
|
return ($15|0);
|
|
}
|
|
$22 = $0;
|
|
$23 = $22;
|
|
HEAP32[$23>>2] = $3;
|
|
$24 = (($22) + 4)|0;
|
|
$25 = $24;
|
|
HEAP32[$25>>2] = $4;
|
|
$26 = (Atomics_store(HEAP32, $8>>2, 0)|0);
|
|
tempRet0 = ($18);
|
|
return ($15|0);
|
|
}
|
|
function _emscripten_atomic_exchange_u32($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $2 = 0, $3 = 0, $4 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
while(1) {
|
|
$2 = (Atomics_load(HEAP32, $0>>2)|0);
|
|
$3 = (Atomics_compareExchange(HEAP32, $0>>2, $2, $1)|0);
|
|
$4 = ($2|0)==($3|0);
|
|
if ($4) {
|
|
break;
|
|
}
|
|
}
|
|
return ($2|0);
|
|
}
|
|
function _emscripten_atomic_exchange_u64($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0;
|
|
var sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = $0;
|
|
$4 = $3 >>> 3;
|
|
$5 = $4 & 255;
|
|
$6 = (34376 + ($5<<2)|0);
|
|
while(1) {
|
|
while(1) {
|
|
$7 = (Atomics_load(HEAP32, $6>>2)|0);
|
|
$8 = (Atomics_compareExchange(HEAP32, $6>>2, $7, 1)|0);
|
|
$9 = ($7|0)==($8|0);
|
|
if ($9) {
|
|
break;
|
|
}
|
|
}
|
|
$10 = ($7|0)==(0);
|
|
if ($10) {
|
|
break;
|
|
}
|
|
}
|
|
$11 = $0;
|
|
$12 = $11;
|
|
$13 = HEAP32[$12>>2]|0;
|
|
$14 = (($11) + 4)|0;
|
|
$15 = $14;
|
|
$16 = HEAP32[$15>>2]|0;
|
|
$17 = $0;
|
|
$18 = $17;
|
|
HEAP32[$18>>2] = $1;
|
|
$19 = (($17) + 4)|0;
|
|
$20 = $19;
|
|
HEAP32[$20>>2] = $2;
|
|
$21 = (Atomics_store(HEAP32, $6>>2, 0)|0);
|
|
tempRet0 = ($16);
|
|
return ($13|0);
|
|
}
|
|
function _emscripten_atomic_load_f32($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0.0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = (Atomics_load(HEAP32, $0>>2)|0);
|
|
$2 = (HEAP32[tempDoublePtr>>2]=$1,+HEAPF32[tempDoublePtr>>2]);
|
|
return (+$2);
|
|
}
|
|
function _emscripten_atomic_load_f64($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0.0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = $0;
|
|
$2 = $1 >>> 3;
|
|
$3 = $2 & 255;
|
|
$4 = (34376 + ($3<<2)|0);
|
|
while(1) {
|
|
while(1) {
|
|
$5 = (Atomics_load(HEAP32, $4>>2)|0);
|
|
$6 = (Atomics_compareExchange(HEAP32, $4>>2, $5, 1)|0);
|
|
$7 = ($5|0)==($6|0);
|
|
if ($7) {
|
|
break;
|
|
}
|
|
}
|
|
$8 = ($5|0)==(0);
|
|
if ($8) {
|
|
break;
|
|
}
|
|
}
|
|
$9 = +HEAPF64[$0>>3];
|
|
$10 = (Atomics_store(HEAP32, $4>>2, 0)|0);
|
|
return (+$9);
|
|
}
|
|
function _emscripten_atomic_load_u64($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = $0;
|
|
$2 = $1 >>> 3;
|
|
$3 = $2 & 255;
|
|
$4 = (34376 + ($3<<2)|0);
|
|
while(1) {
|
|
while(1) {
|
|
$5 = (Atomics_load(HEAP32, $4>>2)|0);
|
|
$6 = (Atomics_compareExchange(HEAP32, $4>>2, $5, 1)|0);
|
|
$7 = ($5|0)==($6|0);
|
|
if ($7) {
|
|
break;
|
|
}
|
|
}
|
|
$8 = ($5|0)==(0);
|
|
if ($8) {
|
|
break;
|
|
}
|
|
}
|
|
$9 = $0;
|
|
$10 = $9;
|
|
$11 = HEAP32[$10>>2]|0;
|
|
$12 = (($9) + 4)|0;
|
|
$13 = $12;
|
|
$14 = HEAP32[$13>>2]|0;
|
|
$15 = (Atomics_store(HEAP32, $4>>2, 0)|0);
|
|
tempRet0 = ($14);
|
|
return ($11|0);
|
|
}
|
|
function _emscripten_atomic_or_u64($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
|
|
var $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = $0;
|
|
$4 = $3 >>> 3;
|
|
$5 = $4 & 255;
|
|
$6 = (34376 + ($5<<2)|0);
|
|
while(1) {
|
|
while(1) {
|
|
$7 = (Atomics_load(HEAP32, $6>>2)|0);
|
|
$8 = (Atomics_compareExchange(HEAP32, $6>>2, $7, 1)|0);
|
|
$9 = ($7|0)==($8|0);
|
|
if ($9) {
|
|
break;
|
|
}
|
|
}
|
|
$10 = ($7|0)==(0);
|
|
if ($10) {
|
|
break;
|
|
}
|
|
}
|
|
$11 = $0;
|
|
$12 = $11;
|
|
$13 = HEAP32[$12>>2]|0;
|
|
$14 = (($11) + 4)|0;
|
|
$15 = $14;
|
|
$16 = HEAP32[$15>>2]|0;
|
|
$17 = $13 | $1;
|
|
$18 = $16 | $2;
|
|
$19 = $0;
|
|
$20 = $19;
|
|
HEAP32[$20>>2] = $17;
|
|
$21 = (($19) + 4)|0;
|
|
$22 = $21;
|
|
HEAP32[$22>>2] = $18;
|
|
$23 = (Atomics_store(HEAP32, $6>>2, 0)|0);
|
|
tempRet0 = ($18);
|
|
return ($17|0);
|
|
}
|
|
function _emscripten_atomic_store_f32($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = +$1;
|
|
var $2 = 0, $3 = 0, $4 = 0.0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = (HEAPF32[tempDoublePtr>>2]=$1,HEAP32[tempDoublePtr>>2]|0);
|
|
$3 = (Atomics_store(HEAP32, $0>>2, $2)|0);
|
|
$4 = (+($3>>>0));
|
|
return (+$4);
|
|
}
|
|
function _emscripten_atomic_store_f64($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = +$1;
|
|
var $10 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = $0;
|
|
$3 = $2 >>> 3;
|
|
$4 = $3 & 255;
|
|
$5 = (34376 + ($4<<2)|0);
|
|
while(1) {
|
|
while(1) {
|
|
$6 = (Atomics_load(HEAP32, $5>>2)|0);
|
|
$7 = (Atomics_compareExchange(HEAP32, $5>>2, $6, 1)|0);
|
|
$8 = ($6|0)==($7|0);
|
|
if ($8) {
|
|
break;
|
|
}
|
|
}
|
|
$9 = ($6|0)==(0);
|
|
if ($9) {
|
|
break;
|
|
}
|
|
}
|
|
HEAPF64[$0>>3] = $1;
|
|
$10 = (Atomics_store(HEAP32, $5>>2, 0)|0);
|
|
return (+$1);
|
|
}
|
|
function _emscripten_atomic_store_u64($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = $0;
|
|
$4 = $3 >>> 3;
|
|
$5 = $4 & 255;
|
|
$6 = (34376 + ($5<<2)|0);
|
|
while(1) {
|
|
while(1) {
|
|
$7 = (Atomics_load(HEAP32, $6>>2)|0);
|
|
$8 = (Atomics_compareExchange(HEAP32, $6>>2, $7, 1)|0);
|
|
$9 = ($7|0)==($8|0);
|
|
if ($9) {
|
|
break;
|
|
}
|
|
}
|
|
$10 = ($7|0)==(0);
|
|
if ($10) {
|
|
break;
|
|
}
|
|
}
|
|
$11 = $0;
|
|
$12 = $11;
|
|
HEAP32[$12>>2] = $1;
|
|
$13 = (($11) + 4)|0;
|
|
$14 = $13;
|
|
HEAP32[$14>>2] = $2;
|
|
$15 = (Atomics_store(HEAP32, $6>>2, 0)|0);
|
|
tempRet0 = ($2);
|
|
return ($1|0);
|
|
}
|
|
function _emscripten_atomic_sub_u64($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
|
|
var $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = $0;
|
|
$4 = $3 >>> 3;
|
|
$5 = $4 & 255;
|
|
$6 = (34376 + ($5<<2)|0);
|
|
while(1) {
|
|
while(1) {
|
|
$7 = (Atomics_load(HEAP32, $6>>2)|0);
|
|
$8 = (Atomics_compareExchange(HEAP32, $6>>2, $7, 1)|0);
|
|
$9 = ($7|0)==($8|0);
|
|
if ($9) {
|
|
break;
|
|
}
|
|
}
|
|
$10 = ($7|0)==(0);
|
|
if ($10) {
|
|
break;
|
|
}
|
|
}
|
|
$11 = $0;
|
|
$12 = $11;
|
|
$13 = HEAP32[$12>>2]|0;
|
|
$14 = (($11) + 4)|0;
|
|
$15 = $14;
|
|
$16 = HEAP32[$15>>2]|0;
|
|
$17 = (_i64Subtract(($13|0),($16|0),($1|0),($2|0))|0);
|
|
$18 = tempRet0;
|
|
$19 = $0;
|
|
$20 = $19;
|
|
HEAP32[$20>>2] = $17;
|
|
$21 = (($19) + 4)|0;
|
|
$22 = $21;
|
|
HEAP32[$22>>2] = $18;
|
|
$23 = (Atomics_store(HEAP32, $6>>2, 0)|0);
|
|
tempRet0 = ($18);
|
|
return ($17|0);
|
|
}
|
|
function _emscripten_atomic_xor_u64($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0;
|
|
var $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$3 = $0;
|
|
$4 = $3 >>> 3;
|
|
$5 = $4 & 255;
|
|
$6 = (34376 + ($5<<2)|0);
|
|
while(1) {
|
|
while(1) {
|
|
$7 = (Atomics_load(HEAP32, $6>>2)|0);
|
|
$8 = (Atomics_compareExchange(HEAP32, $6>>2, $7, 1)|0);
|
|
$9 = ($7|0)==($8|0);
|
|
if ($9) {
|
|
break;
|
|
}
|
|
}
|
|
$10 = ($7|0)==(0);
|
|
if ($10) {
|
|
break;
|
|
}
|
|
}
|
|
$11 = $0;
|
|
$12 = $11;
|
|
$13 = HEAP32[$12>>2]|0;
|
|
$14 = (($11) + 4)|0;
|
|
$15 = $14;
|
|
$16 = HEAP32[$15>>2]|0;
|
|
$17 = $13 ^ $1;
|
|
$18 = $16 ^ $2;
|
|
$19 = $0;
|
|
$20 = $19;
|
|
HEAP32[$20>>2] = $17;
|
|
$21 = (($19) + 4)|0;
|
|
$22 = $21;
|
|
HEAP32[$22>>2] = $18;
|
|
$23 = (Atomics_store(HEAP32, $6>>2, 0)|0);
|
|
tempRet0 = ($18);
|
|
return ($17|0);
|
|
}
|
|
function _emscripten_main_thread_process_queued_calls() {
|
|
var $$0910 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$0 = (_emscripten_is_main_runtime_thread()|0);
|
|
$1 = ($0|0)==(0);
|
|
if ($1) {
|
|
___assert_fail((13586|0),(13708|0),424,(13772|0));
|
|
// unreachable;
|
|
}
|
|
$2 = (_emscripten_is_main_runtime_thread()|0);
|
|
$3 = ($2|0)==(0);
|
|
$4 = HEAP32[8454]|0;
|
|
$5 = ($4|0)!=(0);
|
|
$or$cond = $3 | $5;
|
|
if ($or$cond) {
|
|
return;
|
|
}
|
|
HEAP32[8454] = 1;
|
|
(___pthread_mutex_lock(33820)|0);
|
|
$6 = (Atomics_load(HEAP32, 8462)|0);
|
|
$7 = (Atomics_load(HEAP32, 8463)|0);
|
|
$8 = ($6|0)==($7|0);
|
|
(___pthread_mutex_unlock(33820)|0);
|
|
if (!($8)) {
|
|
$$0910 = $6;
|
|
while(1) {
|
|
$9 = (33856 + ($$0910<<2)|0);
|
|
$10 = HEAP32[$9>>2]|0;
|
|
__do_call($10);
|
|
(___pthread_mutex_lock(33820)|0);
|
|
$11 = (($$0910) + 1)|0;
|
|
$12 = (($11|0) % 128)&-1;
|
|
$13 = (Atomics_store(HEAP32, 8462, $12)|0);
|
|
$14 = (Atomics_load(HEAP32, 8463)|0);
|
|
$15 = ($12|0)==($14|0);
|
|
(___pthread_mutex_unlock(33820)|0);
|
|
if ($15) {
|
|
break;
|
|
} else {
|
|
$$0910 = $12;
|
|
}
|
|
}
|
|
}
|
|
(_emscripten_futex_wake((33848|0),2147483647)|0);
|
|
HEAP32[8454] = 0;
|
|
return;
|
|
}
|
|
function _emscripten_sync_run_in_main_thread($0) {
|
|
$0 = $0|0;
|
|
var label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
_emscripten_async_run_in_main_thread($0);
|
|
(_emscripten_wait_for_call_v($0,inf)|0);
|
|
return;
|
|
}
|
|
function _emscripten_sync_run_in_main_thread_0($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, $3 = 0, dest = 0, label = 0, sp = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 96|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(96|0);
|
|
$1 = sp;
|
|
dest=$1; stop=dest+96|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
|
|
HEAP32[$1>>2] = $0;
|
|
$2 = ((($1)) + 80|0);
|
|
HEAP32[$2>>2] = 0;
|
|
_emscripten_async_run_in_main_thread($1);
|
|
(_emscripten_wait_for_call_v($1,inf)|0);
|
|
$3 = HEAP32[$2>>2]|0;
|
|
STACKTOP = sp;return ($3|0);
|
|
}
|
|
function _emscripten_sync_run_in_main_thread_1($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $2 = 0, $3 = 0, $4 = 0, $5 = 0, dest = 0, label = 0, sp = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 96|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(96|0);
|
|
$2 = sp;
|
|
dest=$2; stop=dest+96|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
|
|
HEAP32[$2>>2] = $0;
|
|
$3 = ((($2)) + 16|0);
|
|
HEAP32[$3>>2] = $1;
|
|
$4 = ((($2)) + 80|0);
|
|
HEAP32[$4>>2] = 0;
|
|
_emscripten_async_run_in_main_thread($2);
|
|
(_emscripten_wait_for_call_v($2,inf)|0);
|
|
$5 = HEAP32[$4>>2]|0;
|
|
STACKTOP = sp;return ($5|0);
|
|
}
|
|
function _emscripten_sync_run_in_main_thread_2($0,$1,$2) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
var $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, dest = 0, label = 0, sp = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 96|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(96|0);
|
|
$3 = sp;
|
|
dest=$3; stop=dest+96|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
|
|
HEAP32[$3>>2] = $0;
|
|
$4 = ((($3)) + 16|0);
|
|
HEAP32[$4>>2] = $1;
|
|
$5 = ((($3)) + 24|0);
|
|
HEAP32[$5>>2] = $2;
|
|
$6 = ((($3)) + 80|0);
|
|
HEAP32[$6>>2] = 0;
|
|
_emscripten_async_run_in_main_thread($3);
|
|
(_emscripten_wait_for_call_v($3,inf)|0);
|
|
$7 = HEAP32[$6>>2]|0;
|
|
STACKTOP = sp;return ($7|0);
|
|
}
|
|
function _emscripten_sync_run_in_main_thread_3($0,$1,$2,$3) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
var $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 96|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(96|0);
|
|
$4 = sp;
|
|
dest=$4; stop=dest+96|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
|
|
HEAP32[$4>>2] = $0;
|
|
$5 = ((($4)) + 16|0);
|
|
HEAP32[$5>>2] = $1;
|
|
$6 = ((($4)) + 24|0);
|
|
HEAP32[$6>>2] = $2;
|
|
$7 = ((($4)) + 32|0);
|
|
HEAP32[$7>>2] = $3;
|
|
$8 = ((($4)) + 80|0);
|
|
HEAP32[$8>>2] = 0;
|
|
_emscripten_async_run_in_main_thread($4);
|
|
(_emscripten_wait_for_call_v($4,inf)|0);
|
|
$9 = HEAP32[$8>>2]|0;
|
|
STACKTOP = sp;return ($9|0);
|
|
}
|
|
function _emscripten_sync_run_in_main_thread_4($0,$1,$2,$3,$4) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
$4 = $4|0;
|
|
var $10 = 0, $11 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 96|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(96|0);
|
|
$5 = sp;
|
|
dest=$5; stop=dest+96|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
|
|
HEAP32[$5>>2] = $0;
|
|
$6 = ((($5)) + 16|0);
|
|
HEAP32[$6>>2] = $1;
|
|
$7 = ((($5)) + 24|0);
|
|
HEAP32[$7>>2] = $2;
|
|
$8 = ((($5)) + 32|0);
|
|
HEAP32[$8>>2] = $3;
|
|
$9 = ((($5)) + 40|0);
|
|
HEAP32[$9>>2] = $4;
|
|
$10 = ((($5)) + 80|0);
|
|
HEAP32[$10>>2] = 0;
|
|
_emscripten_async_run_in_main_thread($5);
|
|
(_emscripten_wait_for_call_v($5,inf)|0);
|
|
$11 = HEAP32[$10>>2]|0;
|
|
STACKTOP = sp;return ($11|0);
|
|
}
|
|
function _emscripten_sync_run_in_main_thread_5($0,$1,$2,$3,$4,$5) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
$4 = $4|0;
|
|
$5 = $5|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 96|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(96|0);
|
|
$6 = sp;
|
|
dest=$6; stop=dest+96|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
|
|
HEAP32[$6>>2] = $0;
|
|
$7 = ((($6)) + 16|0);
|
|
HEAP32[$7>>2] = $1;
|
|
$8 = ((($6)) + 24|0);
|
|
HEAP32[$8>>2] = $2;
|
|
$9 = ((($6)) + 32|0);
|
|
HEAP32[$9>>2] = $3;
|
|
$10 = ((($6)) + 40|0);
|
|
HEAP32[$10>>2] = $4;
|
|
$11 = ((($6)) + 48|0);
|
|
HEAP32[$11>>2] = $5;
|
|
$12 = ((($6)) + 80|0);
|
|
HEAP32[$12>>2] = 0;
|
|
_emscripten_async_run_in_main_thread($6);
|
|
(_emscripten_wait_for_call_v($6,inf)|0);
|
|
$13 = HEAP32[$12>>2]|0;
|
|
STACKTOP = sp;return ($13|0);
|
|
}
|
|
function _emscripten_sync_run_in_main_thread_6($0,$1,$2,$3,$4,$5,$6) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
$4 = $4|0;
|
|
$5 = $5|0;
|
|
$6 = $6|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 96|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(96|0);
|
|
$7 = sp;
|
|
dest=$7; stop=dest+96|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
|
|
HEAP32[$7>>2] = $0;
|
|
$8 = ((($7)) + 16|0);
|
|
HEAP32[$8>>2] = $1;
|
|
$9 = ((($7)) + 24|0);
|
|
HEAP32[$9>>2] = $2;
|
|
$10 = ((($7)) + 32|0);
|
|
HEAP32[$10>>2] = $3;
|
|
$11 = ((($7)) + 40|0);
|
|
HEAP32[$11>>2] = $4;
|
|
$12 = ((($7)) + 48|0);
|
|
HEAP32[$12>>2] = $5;
|
|
$13 = ((($7)) + 56|0);
|
|
HEAP32[$13>>2] = $6;
|
|
$14 = ((($7)) + 80|0);
|
|
HEAP32[$14>>2] = 0;
|
|
_emscripten_async_run_in_main_thread($7);
|
|
(_emscripten_wait_for_call_v($7,inf)|0);
|
|
$15 = HEAP32[$14>>2]|0;
|
|
STACKTOP = sp;return ($15|0);
|
|
}
|
|
function _emscripten_sync_run_in_main_thread_7($0,$1,$2,$3,$4,$5,$6,$7) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
$4 = $4|0;
|
|
$5 = $5|0;
|
|
$6 = $6|0;
|
|
$7 = $7|0;
|
|
var $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 96|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(96|0);
|
|
$8 = sp;
|
|
dest=$8; stop=dest+96|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
|
|
HEAP32[$8>>2] = $0;
|
|
$9 = ((($8)) + 16|0);
|
|
HEAP32[$9>>2] = $1;
|
|
$10 = ((($8)) + 24|0);
|
|
HEAP32[$10>>2] = $2;
|
|
$11 = ((($8)) + 32|0);
|
|
HEAP32[$11>>2] = $3;
|
|
$12 = ((($8)) + 40|0);
|
|
HEAP32[$12>>2] = $4;
|
|
$13 = ((($8)) + 48|0);
|
|
HEAP32[$13>>2] = $5;
|
|
$14 = ((($8)) + 56|0);
|
|
HEAP32[$14>>2] = $6;
|
|
$15 = ((($8)) + 64|0);
|
|
HEAP32[$15>>2] = $7;
|
|
$16 = ((($8)) + 80|0);
|
|
HEAP32[$16>>2] = 0;
|
|
_emscripten_async_run_in_main_thread($8);
|
|
(_emscripten_wait_for_call_v($8,inf)|0);
|
|
$17 = HEAP32[$16>>2]|0;
|
|
STACKTOP = sp;return ($17|0);
|
|
}
|
|
function _emscripten_sync_run_in_main_thread_xprintf_varargs($0,$1,$2,$varargs) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$varargs = $varargs|0;
|
|
var $$0 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, dest = 0, label = 0, sp = 0, stop = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 240|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(240|0);
|
|
$3 = sp + 96|0;
|
|
$4 = sp + 112|0;
|
|
$5 = sp;
|
|
HEAP32[$3>>2] = $varargs;
|
|
$6 = (_vsnprintf($4,128,$2,$3)|0);
|
|
$7 = ($6|0)>(127);
|
|
$8 = (($6) + 1)|0;
|
|
if ($7) {
|
|
$9 = (_malloc($8)|0);
|
|
HEAP32[$3>>2] = $varargs;
|
|
(_vsnprintf($9,$8,$2,$3)|0);
|
|
$$0 = $9;
|
|
} else {
|
|
$$0 = $4;
|
|
}
|
|
dest=$5; stop=dest+96|0; do { HEAP32[dest>>2]=0|0; dest=dest+4|0; } while ((dest|0) < (stop|0));
|
|
HEAP32[$5>>2] = $0;
|
|
$10 = $1;
|
|
$11 = ((($5)) + 16|0);
|
|
HEAP32[$11>>2] = $10;
|
|
$12 = ((($5)) + 24|0);
|
|
HEAP32[$12>>2] = $$0;
|
|
$13 = ((($5)) + 80|0);
|
|
HEAP32[$13>>2] = 0;
|
|
_emscripten_async_run_in_main_thread($5);
|
|
(_emscripten_wait_for_call_v($5,inf)|0);
|
|
$14 = ($$0|0)==($4|0);
|
|
if ($14) {
|
|
$15 = HEAP32[$13>>2]|0;
|
|
STACKTOP = sp;return ($15|0);
|
|
}
|
|
_free($$0);
|
|
$15 = HEAP32[$13>>2]|0;
|
|
STACKTOP = sp;return ($15|0);
|
|
}
|
|
function ___pthread_tsd_run_dtors() {
|
|
var $$02427 = 0, $$026 = 0, $$125 = 0, $$2 = 0, $0 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0;
|
|
var $8 = 0, $9 = 0, $exitcond = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$0 = (_pthread_self()|0);
|
|
$1 = ((($0)) + 60|0);
|
|
$2 = HEAP32[$1>>2]|0;
|
|
$3 = ($2|0)==(0);
|
|
if ($3) {
|
|
return;
|
|
}
|
|
$4 = ((($0)) + 116|0);
|
|
$$02427 = 0;
|
|
while(1) {
|
|
$$026 = 0;$$125 = 0;
|
|
while(1) {
|
|
$5 = HEAP32[$4>>2]|0;
|
|
$6 = (($5) + ($$026<<2)|0);
|
|
$7 = HEAP32[$6>>2]|0;
|
|
$8 = ($7|0)==(0|0);
|
|
if ($8) {
|
|
$$2 = $$125;
|
|
} else {
|
|
$9 = (33304 + ($$026<<2)|0);
|
|
$10 = (Atomics_load(HEAP32,$9>>2)|0);
|
|
$11 = ($10|0)==(0|0);
|
|
if ($11) {
|
|
$$2 = $$125;
|
|
} else {
|
|
HEAP32[$6>>2] = 0;
|
|
$12 = (Atomics_load(HEAP32,$9>>2)|0);
|
|
FUNCTION_TABLE_vi[$12 & 31]($7);
|
|
$$2 = 1;
|
|
}
|
|
}
|
|
$13 = (($$026) + 1)|0;
|
|
$exitcond = ($13|0)==(128);
|
|
if ($exitcond) {
|
|
break;
|
|
} else {
|
|
$$026 = $13;$$125 = $$2;
|
|
}
|
|
}
|
|
$14 = (($$02427) + 1)|0;
|
|
$15 = ($$2|0)!=(0);
|
|
$16 = ($14|0)<(4);
|
|
$17 = $16 & $15;
|
|
if ($17) {
|
|
$$02427 = $14;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
return;
|
|
}
|
|
function _emscripten_wait_for_call_v($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = +$1;
|
|
var $$ = 0, $$01921 = 0.0, $$020$lcssa = 0, $$1 = 0, $10 = 0.0, $11 = 0, $12 = 0, $13 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0.0, $6 = 0.0, $7 = 0, $8 = 0.0, $9 = 0, $or$cond = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = ((($0)) + 8|0);
|
|
$3 = (Atomics_load(HEAP32, $2>>2)|0);
|
|
$4 = ($3|0)==(0);
|
|
if (!($4)) {
|
|
$$1 = $3;
|
|
$13 = ($$1|0)==(0);
|
|
$$ = $13 ? -8 : 0;
|
|
return ($$|0);
|
|
}
|
|
$5 = (+_emscripten_get_now());
|
|
$6 = $5 + $1;
|
|
_emscripten_set_current_thread_status(5);
|
|
$7 = $5 < $6;
|
|
if ($7) {
|
|
$$01921 = $5;
|
|
while(1) {
|
|
$8 = $6 - $$01921;
|
|
(_emscripten_futex_wait(($2|0),0,(+$8))|0);
|
|
$9 = (Atomics_load(HEAP32, $2>>2)|0);
|
|
$10 = (+_emscripten_get_now());
|
|
$11 = ($9|0)==(0);
|
|
$12 = $10 < $6;
|
|
$or$cond = $11 & $12;
|
|
if ($or$cond) {
|
|
$$01921 = $10;
|
|
} else {
|
|
$$020$lcssa = $9;
|
|
break;
|
|
}
|
|
}
|
|
} else {
|
|
$$020$lcssa = 0;
|
|
}
|
|
_emscripten_set_current_thread_status(1);
|
|
$$1 = $$020$lcssa;
|
|
$13 = ($$1|0)==(0);
|
|
$$ = $13 ? -8 : 0;
|
|
return ($$|0);
|
|
}
|
|
function __do_call($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0;
|
|
var $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0;
|
|
var $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0;
|
|
var $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0;
|
|
var $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0;
|
|
var $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0;
|
|
var $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = HEAP32[$0>>2]|0;
|
|
do {
|
|
switch ($1|0) {
|
|
case 12: {
|
|
$2 = ((($0)) + 16|0);
|
|
$3 = HEAP32[$2>>2]|0;
|
|
$4 = ((($0)) + 24|0);
|
|
$5 = HEAP32[$4>>2]|0;
|
|
$6 = (_utime(($3|0),($5|0))|0);
|
|
$7 = ((($0)) + 80|0);
|
|
HEAP32[$7>>2] = $6;
|
|
break;
|
|
}
|
|
case 13: {
|
|
$8 = ((($0)) + 16|0);
|
|
$9 = HEAP32[$8>>2]|0;
|
|
$10 = ((($0)) + 24|0);
|
|
$11 = HEAP32[$10>>2]|0;
|
|
$12 = (_utimes(($9|0),($11|0))|0);
|
|
$13 = ((($0)) + 80|0);
|
|
HEAP32[$13>>2] = $12;
|
|
break;
|
|
}
|
|
case 37: {
|
|
$14 = ((($0)) + 16|0);
|
|
$15 = HEAP32[$14>>2]|0;
|
|
$16 = (_chroot(($15|0))|0);
|
|
$17 = ((($0)) + 80|0);
|
|
HEAP32[$17>>2] = $16;
|
|
break;
|
|
}
|
|
case 46: {
|
|
$18 = ((($0)) + 16|0);
|
|
$19 = HEAP32[$18>>2]|0;
|
|
$20 = ((($0)) + 24|0);
|
|
$21 = HEAP32[$20>>2]|0;
|
|
$22 = (_fpathconf(($19|0),($21|0))|0);
|
|
$23 = ((($0)) + 80|0);
|
|
HEAP32[$23>>2] = $22;
|
|
break;
|
|
}
|
|
case 68: {
|
|
$24 = ((($0)) + 16|0);
|
|
$25 = HEAP32[$24>>2]|0;
|
|
$26 = ((($0)) + 24|0);
|
|
$27 = HEAP32[$26>>2]|0;
|
|
$28 = ((($0)) + 32|0);
|
|
$29 = HEAP32[$28>>2]|0;
|
|
$30 = (_confstr(($25|0),($27|0),($29|0))|0);
|
|
$31 = ((($0)) + 80|0);
|
|
HEAP32[$31>>2] = $30;
|
|
break;
|
|
}
|
|
case 72: {
|
|
$32 = ((($0)) + 16|0);
|
|
$33 = HEAP32[$32>>2]|0;
|
|
$34 = (_sysconf(($33|0))|0);
|
|
$35 = ((($0)) + 80|0);
|
|
HEAP32[$35>>2] = $34;
|
|
break;
|
|
}
|
|
case 110: {
|
|
$36 = ((($0)) + 16|0);
|
|
$37 = HEAP32[$36>>2]|0;
|
|
$38 = (_atexit(($37|0))|0);
|
|
$39 = ((($0)) + 80|0);
|
|
HEAP32[$39>>2] = $38;
|
|
break;
|
|
}
|
|
case 111: {
|
|
$40 = ((($0)) + 16|0);
|
|
$41 = HEAP32[$40>>2]|0;
|
|
$42 = (_getenv(($41|0))|0);
|
|
$43 = ((($0)) + 80|0);
|
|
HEAP32[$43>>2] = $42;
|
|
break;
|
|
}
|
|
case 112: {
|
|
$44 = (_clearenv()|0);
|
|
$45 = ((($0)) + 80|0);
|
|
HEAP32[$45>>2] = $44;
|
|
break;
|
|
}
|
|
case 113: {
|
|
$46 = ((($0)) + 16|0);
|
|
$47 = HEAP32[$46>>2]|0;
|
|
$48 = ((($0)) + 24|0);
|
|
$49 = HEAP32[$48>>2]|0;
|
|
$50 = ((($0)) + 32|0);
|
|
$51 = HEAP32[$50>>2]|0;
|
|
$52 = (_setenv(($47|0),($49|0),($51|0))|0);
|
|
$53 = ((($0)) + 80|0);
|
|
HEAP32[$53>>2] = $52;
|
|
break;
|
|
}
|
|
case 114: {
|
|
$54 = ((($0)) + 16|0);
|
|
$55 = HEAP32[$54>>2]|0;
|
|
$56 = (_unsetenv(($55|0))|0);
|
|
$57 = ((($0)) + 80|0);
|
|
HEAP32[$57>>2] = $56;
|
|
break;
|
|
}
|
|
case 115: {
|
|
$58 = ((($0)) + 16|0);
|
|
$59 = HEAP32[$58>>2]|0;
|
|
$60 = (_putenv(($59|0))|0);
|
|
$61 = ((($0)) + 80|0);
|
|
HEAP32[$61>>2] = $60;
|
|
break;
|
|
}
|
|
case 119: {
|
|
_tzset();
|
|
break;
|
|
}
|
|
case 137: {
|
|
$62 = ((($0)) + 16|0);
|
|
$63 = HEAP32[$62>>2]|0;
|
|
$64 = ((($0)) + 24|0);
|
|
$65 = HEAP32[$64>>2]|0;
|
|
$66 = ((($0)) + 32|0);
|
|
$67 = HEAP32[$66>>2]|0;
|
|
$68 = ((($0)) + 40|0);
|
|
$69 = HEAP32[$68>>2]|0;
|
|
$70 = (_pthread_create(($63|0),($65|0),($67|0),($69|0))|0);
|
|
$71 = ((($0)) + 80|0);
|
|
HEAP32[$71>>2] = $70;
|
|
break;
|
|
}
|
|
case 138: {
|
|
$72 = ((($0)) + 16|0);
|
|
$73 = HEAP32[$72>>2]|0;
|
|
$74 = ((($0)) + 24|0);
|
|
$75 = HEAP32[$74>>2]|0;
|
|
$76 = (_emscripten_syscall(($73|0),($75|0))|0);
|
|
$77 = ((($0)) + 80|0);
|
|
HEAP32[$77>>2] = $76;
|
|
break;
|
|
}
|
|
case 1024: {
|
|
$78 = ((($0)) + 4|0);
|
|
$79 = HEAP32[$78>>2]|0;
|
|
FUNCTION_TABLE_v[$79 & 7]();
|
|
break;
|
|
}
|
|
case 1025: {
|
|
$80 = ((($0)) + 4|0);
|
|
$81 = HEAP32[$80>>2]|0;
|
|
$82 = ((($0)) + 16|0);
|
|
$83 = HEAP32[$82>>2]|0;
|
|
FUNCTION_TABLE_vi[$81 & 31]($83);
|
|
break;
|
|
}
|
|
case 1026: {
|
|
$84 = ((($0)) + 4|0);
|
|
$85 = HEAP32[$84>>2]|0;
|
|
$86 = ((($0)) + 16|0);
|
|
$87 = HEAP32[$86>>2]|0;
|
|
$88 = ((($0)) + 24|0);
|
|
$89 = HEAP32[$88>>2]|0;
|
|
FUNCTION_TABLE_vii[$85 & 63]($87,$89);
|
|
break;
|
|
}
|
|
case 1027: {
|
|
$90 = ((($0)) + 4|0);
|
|
$91 = HEAP32[$90>>2]|0;
|
|
$92 = ((($0)) + 16|0);
|
|
$93 = HEAP32[$92>>2]|0;
|
|
$94 = ((($0)) + 24|0);
|
|
$95 = HEAP32[$94>>2]|0;
|
|
$96 = ((($0)) + 32|0);
|
|
$97 = HEAP32[$96>>2]|0;
|
|
FUNCTION_TABLE_viii[$91 & 31]($93,$95,$97);
|
|
break;
|
|
}
|
|
case 2048: {
|
|
$98 = ((($0)) + 4|0);
|
|
$99 = HEAP32[$98>>2]|0;
|
|
$100 = (FUNCTION_TABLE_i[$99 & 3]()|0);
|
|
$101 = ((($0)) + 80|0);
|
|
HEAP32[$101>>2] = $100;
|
|
break;
|
|
}
|
|
case 2049: {
|
|
$102 = ((($0)) + 4|0);
|
|
$103 = HEAP32[$102>>2]|0;
|
|
$104 = ((($0)) + 16|0);
|
|
$105 = HEAP32[$104>>2]|0;
|
|
$106 = (FUNCTION_TABLE_ii[$103 & 15]($105)|0);
|
|
$107 = ((($0)) + 80|0);
|
|
HEAP32[$107>>2] = $106;
|
|
break;
|
|
}
|
|
case 2050: {
|
|
$108 = ((($0)) + 4|0);
|
|
$109 = HEAP32[$108>>2]|0;
|
|
$110 = ((($0)) + 16|0);
|
|
$111 = HEAP32[$110>>2]|0;
|
|
$112 = ((($0)) + 24|0);
|
|
$113 = HEAP32[$112>>2]|0;
|
|
$114 = (FUNCTION_TABLE_iii[$109 & 3]($111,$113)|0);
|
|
$115 = ((($0)) + 80|0);
|
|
HEAP32[$115>>2] = $114;
|
|
break;
|
|
}
|
|
case 2051: {
|
|
$116 = ((($0)) + 4|0);
|
|
$117 = HEAP32[$116>>2]|0;
|
|
$118 = ((($0)) + 16|0);
|
|
$119 = HEAP32[$118>>2]|0;
|
|
$120 = ((($0)) + 24|0);
|
|
$121 = HEAP32[$120>>2]|0;
|
|
$122 = ((($0)) + 32|0);
|
|
$123 = HEAP32[$122>>2]|0;
|
|
$124 = (FUNCTION_TABLE_iiii[$117 & 15]($119,$121,$123)|0);
|
|
$125 = ((($0)) + 80|0);
|
|
HEAP32[$125>>2] = $124;
|
|
break;
|
|
}
|
|
default: {
|
|
___assert_fail((13816|0),(13708|0),211,(13867|0));
|
|
// unreachable;
|
|
}
|
|
}
|
|
} while(0);
|
|
$126 = ((($0)) + 88|0);
|
|
$127 = HEAP32[$126>>2]|0;
|
|
$128 = ($127|0)==(0);
|
|
if ($128) {
|
|
$129 = ((($0)) + 8|0);
|
|
HEAP32[$129>>2] = 1;
|
|
(_emscripten_futex_wake(($129|0),2147483647)|0);
|
|
return;
|
|
} else {
|
|
_free($0);
|
|
return;
|
|
}
|
|
}
|
|
function ___pthread_mutex_unlock($0) {
|
|
$0 = $0|0;
|
|
var $$0 = 0, $$045 = 0, $$pre = 0, $$pre$phiZ2D = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0;
|
|
var $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $5 = 0, $6 = 0;
|
|
var $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond3 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = ((($0)) + 8|0);
|
|
$2 = (Atomics_load(HEAP32,$1>>2)|0);
|
|
$3 = HEAP32[$0>>2]|0;
|
|
$4 = $3 & 15;
|
|
$5 = $3 & 128;
|
|
$6 = $5 ^ 128;
|
|
$7 = ($4|0)==(0);
|
|
if ($7) {
|
|
$$pre = ((($0)) + 4|0);
|
|
$$045 = 0;$$pre$phiZ2D = $$pre;
|
|
} else {
|
|
$8 = (_pthread_self()|0);
|
|
$9 = ((($0)) + 4|0);
|
|
$10 = (Atomics_load(HEAP32,$9>>2)|0);
|
|
$11 = $10 & 2147483647;
|
|
$12 = ((($8)) + 52|0);
|
|
$13 = HEAP32[$12>>2]|0;
|
|
$14 = ($11|0)==($13|0);
|
|
if (!($14)) {
|
|
$$0 = 1;
|
|
return ($$0|0);
|
|
}
|
|
$15 = $3 & 3;
|
|
$16 = ($15|0)==(1);
|
|
if ($16) {
|
|
$17 = ((($0)) + 20|0);
|
|
$18 = HEAP32[$17>>2]|0;
|
|
$19 = ($18|0)==(0);
|
|
if (!($19)) {
|
|
$20 = (($18) + -1)|0;
|
|
HEAP32[$17>>2] = $20;
|
|
$$0 = 0;
|
|
return ($$0|0);
|
|
}
|
|
}
|
|
$21 = ($6|0)==(0);
|
|
$22 = ((($0)) + 16|0);
|
|
if ($21) {
|
|
$23 = ((($8)) + 176|0);
|
|
Atomics_store(HEAP32,$23>>2,$22)|0;
|
|
___vm_lock();
|
|
}
|
|
$24 = ((($0)) + 12|0);
|
|
$25 = HEAP32[$24>>2]|0;
|
|
$26 = HEAP32[$22>>2]|0;
|
|
Atomics_store(HEAP32,$25>>2,$26)|0;
|
|
$27 = ((($8)) + 168|0);
|
|
$28 = ($26|0)==($27|0);
|
|
if ($28) {
|
|
$$045 = $8;$$pre$phiZ2D = $9;
|
|
} else {
|
|
$29 = ((($26)) + -4|0);
|
|
Atomics_store(HEAP32,$29>>2,$25)|0;
|
|
$$045 = $8;$$pre$phiZ2D = $9;
|
|
}
|
|
}
|
|
$30 = $3 & 8;
|
|
$31 = ($30|0)!=(0);
|
|
$32 = $31 ? 2147483647 : 0;
|
|
while(1) {
|
|
$33 = (Atomics_load(HEAP32, $$pre$phiZ2D>>2)|0);
|
|
$34 = (Atomics_compareExchange(HEAP32, $$pre$phiZ2D>>2, $33, $32)|0);
|
|
$35 = ($34|0)==($33|0);
|
|
if ($35) {
|
|
break;
|
|
}
|
|
}
|
|
$36 = ($6|0)!=(0);
|
|
$or$cond = $7 | $36;
|
|
if (!($or$cond)) {
|
|
$37 = ((($$045)) + 176|0);
|
|
Atomics_store(HEAP32,$37>>2,0)|0;
|
|
___vm_unlock();
|
|
}
|
|
$38 = ($2|0)!=(0);
|
|
$39 = ($33|0)<(0);
|
|
$or$cond3 = $38 | $39;
|
|
if (!($or$cond3)) {
|
|
$$0 = 0;
|
|
return ($$0|0);
|
|
}
|
|
(_emscripten_futex_wake(($$pre$phiZ2D|0),1)|0);
|
|
$$0 = 0;
|
|
return ($$0|0);
|
|
}
|
|
function ___vm_lock() {
|
|
var $0 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$0 = (Atomics_add(HEAP32, 8592, 1)|0);
|
|
return;
|
|
}
|
|
function ___vm_unlock() {
|
|
var $0 = 0, $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$0 = (Atomics_add(HEAP32, 8592, -1)|0);
|
|
$1 = ($0|0)==(1);
|
|
if (!($1)) {
|
|
return;
|
|
}
|
|
$2 = (Atomics_load(HEAP32,(34372)>>2)|0);
|
|
$3 = ($2|0)==(0);
|
|
if ($3) {
|
|
return;
|
|
}
|
|
(_emscripten_futex_wake((34368|0),2147483647)|0);
|
|
return;
|
|
}
|
|
function ___pthread_mutex_lock($0) {
|
|
$0 = $0|0;
|
|
var $$0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = HEAP32[$0>>2]|0;
|
|
$2 = $1 & 15;
|
|
$3 = ($2|0)==(0);
|
|
if ($3) {
|
|
$4 = ((($0)) + 4|0);
|
|
$5 = (Atomics_compareExchange(HEAP32, $4>>2, 0, 16)|0);
|
|
$6 = ($5|0)==(0);
|
|
if ($6) {
|
|
$$0 = 0;
|
|
return ($$0|0);
|
|
}
|
|
}
|
|
$7 = (___pthread_mutex_timedlock($0,0)|0);
|
|
$$0 = $7;
|
|
return ($$0|0);
|
|
}
|
|
function ___pthread_mutex_timedlock($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$0 = 0, $$2 = 0, $$pre = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0;
|
|
var $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0;
|
|
var $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond40 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$2 = HEAP32[$0>>2]|0;
|
|
$3 = $2 & 15;
|
|
$4 = ($3|0)==(0);
|
|
do {
|
|
if ($4) {
|
|
$5 = ((($0)) + 4|0);
|
|
$6 = (Atomics_compareExchange(HEAP32, $5>>2, 0, 16)|0);
|
|
$7 = ($6|0)==(0);
|
|
if ($7) {
|
|
$$2 = 0;
|
|
return ($$2|0);
|
|
} else {
|
|
$$pre = HEAP32[$0>>2]|0;
|
|
$9 = $$pre;
|
|
break;
|
|
}
|
|
} else {
|
|
$9 = $2;
|
|
}
|
|
} while(0);
|
|
$8 = $9 & 128;
|
|
$10 = $8 ^ 128;
|
|
$11 = (___pthread_mutex_trylock($0)|0);
|
|
$12 = ($11|0)==(16);
|
|
if (!($12)) {
|
|
$$2 = $11;
|
|
return ($$2|0);
|
|
}
|
|
$13 = ((($0)) + 4|0);
|
|
$14 = ((($0)) + 8|0);
|
|
$$0 = 100;
|
|
while(1) {
|
|
$15 = (($$0) + -1)|0;
|
|
$16 = ($$0|0)==(0);
|
|
if ($16) {
|
|
break;
|
|
}
|
|
$17 = (Atomics_load(HEAP32,$13>>2)|0);
|
|
$18 = ($17|0)==(0);
|
|
if ($18) {
|
|
break;
|
|
}
|
|
$19 = (Atomics_load(HEAP32,$14>>2)|0);
|
|
$20 = ($19|0)==(0);
|
|
if ($20) {
|
|
$$0 = $15;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
$21 = (___pthread_mutex_trylock($0)|0);
|
|
$22 = ($21|0)==(16);
|
|
if (!($22)) {
|
|
$$2 = $21;
|
|
return ($$2|0);
|
|
}
|
|
L18: while(1) {
|
|
$23 = (Atomics_load(HEAP32,$13>>2)|0);
|
|
$24 = ($23|0)==(0);
|
|
if (!($24)) {
|
|
$27 = $23 & 1073741824;
|
|
$28 = ($27|0)==(0);
|
|
$29 = HEAP32[$0>>2]|0;
|
|
$30 = $29 & 4;
|
|
$31 = ($30|0)==(0);
|
|
$or$cond40 = $28 | $31;
|
|
if ($or$cond40) {
|
|
$32 = $29 & 3;
|
|
$33 = ($32|0)==(2);
|
|
if ($33) {
|
|
$34 = $23 & 2147483647;
|
|
$35 = (_pthread_self()|0);
|
|
$36 = ((($35)) + 52|0);
|
|
$37 = HEAP32[$36>>2]|0;
|
|
$38 = ($34|0)==($37|0);
|
|
if ($38) {
|
|
$$2 = 35;
|
|
label = 17;
|
|
break;
|
|
}
|
|
}
|
|
$39 = (Atomics_add(HEAP32, $14>>2, 1)|0);
|
|
$40 = $23 | -2147483648;
|
|
$41 = (Atomics_compareExchange(HEAP32, $13>>2, $23, $40)|0);
|
|
$42 = (___timedwait($13,$40,0,$1,$10)|0);
|
|
$43 = (Atomics_sub(HEAP32, $14>>2, 1)|0);
|
|
switch ($42|0) {
|
|
case 0: case 4: {
|
|
break;
|
|
}
|
|
default: {
|
|
$$2 = $42;
|
|
label = 17;
|
|
break L18;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
$25 = (___pthread_mutex_trylock($0)|0);
|
|
$26 = ($25|0)==(16);
|
|
if (!($26)) {
|
|
$$2 = $25;
|
|
label = 17;
|
|
break;
|
|
}
|
|
}
|
|
if ((label|0) == 17) {
|
|
return ($$2|0);
|
|
}
|
|
return (0)|0;
|
|
}
|
|
function ___timedwait($0,$1,$2,$3,$4) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
$4 = $4|0;
|
|
var $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
|
|
$5 = sp;
|
|
(___pthread_setcancelstate(1,($5|0))|0);
|
|
_emscripten_conditional_set_current_thread_status(1,4);
|
|
$6 = (___timedwait_cp($0,$1,$2,$3,$4)|0);
|
|
_emscripten_conditional_set_current_thread_status(4,1);
|
|
$7 = HEAP32[$5>>2]|0;
|
|
(___pthread_setcancelstate(($7|0),(0|0))|0);
|
|
STACKTOP = sp;return ($6|0);
|
|
}
|
|
function ___timedwait_cp($0,$1,$2,$3,$4) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
$2 = $2|0;
|
|
$3 = $3|0;
|
|
$4 = $4|0;
|
|
var $$$0$us = 0.0, $$$045 = 0.0, $$$046$us = 0.0, $$0$us = 0.0, $$0$us53 = 0.0, $$138 = 0, $$138$ph = 0, $$138$ph70 = 0, $$138$ph72 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $20 = 0;
|
|
var $21 = 0, $22 = 0, $23 = 0, $24 = 0, $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0.0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0.0, $39 = 0, $40 = 0;
|
|
var $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
|
|
$5 = sp;
|
|
$6 = ($3|0)!=(0|0);
|
|
if ($6) {
|
|
$7 = ((($3)) + 4|0);
|
|
$8 = HEAP32[$7>>2]|0;
|
|
$9 = ($8>>>0)>(999999999);
|
|
if ($9) {
|
|
$$138 = 22;
|
|
STACKTOP = sp;return ($$138|0);
|
|
}
|
|
$10 = (___clock_gettime(($2|0),($5|0))|0);
|
|
$11 = ($10|0)==(0);
|
|
if (!($11)) {
|
|
$$138 = 22;
|
|
STACKTOP = sp;return ($$138|0);
|
|
}
|
|
$12 = HEAP32[$3>>2]|0;
|
|
$13 = HEAP32[$5>>2]|0;
|
|
$14 = (($12) - ($13))|0;
|
|
HEAP32[$5>>2] = $14;
|
|
$15 = HEAP32[$7>>2]|0;
|
|
$16 = ((($5)) + 4|0);
|
|
$17 = HEAP32[$16>>2]|0;
|
|
$18 = (($15) - ($17))|0;
|
|
HEAP32[$16>>2] = $18;
|
|
$19 = ($18|0)<(0);
|
|
if ($19) {
|
|
$20 = (($14) + -1)|0;
|
|
HEAP32[$5>>2] = $20;
|
|
$21 = (($18) + 1000000000)|0;
|
|
HEAP32[$16>>2] = $21;
|
|
$23 = $20;
|
|
} else {
|
|
$23 = $14;
|
|
}
|
|
$22 = ($23|0)<(0);
|
|
if ($22) {
|
|
$$138 = 110;
|
|
STACKTOP = sp;return ($$138|0);
|
|
}
|
|
}
|
|
$24 = (_emscripten_is_main_runtime_thread()|0);
|
|
$25 = ($24|0)!=(0);
|
|
$$$045 = $25 ? 1.0 : 100.0;
|
|
if ($25) {
|
|
L15: while(1) {
|
|
$26 = (_pthread_self()|0);
|
|
$27 = (__pthread_isduecanceled($26)|0);
|
|
$28 = ($27|0)==(0);
|
|
if (!($28)) {
|
|
$$138$ph = 125;
|
|
break;
|
|
}
|
|
_emscripten_main_thread_process_queued_calls();
|
|
if ($6) {
|
|
$29 = (+__pthread_msecs_until($3));
|
|
$30 = !($29 <= 0.0);
|
|
$31 = $29 > 100.0;
|
|
$$0$us = $31 ? 100.0 : $29;
|
|
$32 = $$0$us > 1.0;
|
|
$$$0$us = $32 ? 1.0 : $$0$us;
|
|
if ($30) {
|
|
$$$046$us = $$$0$us;
|
|
} else {
|
|
$$138$ph = 110;
|
|
break;
|
|
}
|
|
} else {
|
|
$$$046$us = $$$045;
|
|
}
|
|
$33 = (_emscripten_futex_wait(($0|0),($1|0),(+$$$046$us))|0);
|
|
$34 = (0 - ($33))|0;
|
|
switch ($34|0) {
|
|
case 110: {
|
|
break;
|
|
}
|
|
case 4: case 125: {
|
|
$$138$ph = $34;
|
|
break L15;
|
|
break;
|
|
}
|
|
default: {
|
|
$$138 = 0;
|
|
label = 21;
|
|
break L15;
|
|
}
|
|
}
|
|
}
|
|
if ((label|0) == 21) {
|
|
STACKTOP = sp;return ($$138|0);
|
|
}
|
|
$$138 = $$138$ph;
|
|
STACKTOP = sp;return ($$138|0);
|
|
}
|
|
if (!($6)) {
|
|
L27: while(1) {
|
|
$43 = (_pthread_self()|0);
|
|
$44 = (__pthread_isduecanceled($43)|0);
|
|
$45 = ($44|0)==(0);
|
|
if (!($45)) {
|
|
$$138$ph72 = 125;
|
|
break;
|
|
}
|
|
$46 = (_emscripten_futex_wait(($0|0),($1|0),(+$$$045))|0);
|
|
$47 = (0 - ($46))|0;
|
|
switch ($47|0) {
|
|
case 110: {
|
|
break;
|
|
}
|
|
case 4: case 125: {
|
|
$$138$ph72 = $47;
|
|
break L27;
|
|
break;
|
|
}
|
|
default: {
|
|
$$138 = 0;
|
|
label = 21;
|
|
break L27;
|
|
}
|
|
}
|
|
}
|
|
if ((label|0) == 21) {
|
|
STACKTOP = sp;return ($$138|0);
|
|
}
|
|
$$138 = $$138$ph72;
|
|
STACKTOP = sp;return ($$138|0);
|
|
}
|
|
L34: while(1) {
|
|
$35 = (_pthread_self()|0);
|
|
$36 = (__pthread_isduecanceled($35)|0);
|
|
$37 = ($36|0)==(0);
|
|
if (!($37)) {
|
|
$$138$ph70 = 125;
|
|
break;
|
|
}
|
|
$38 = (+__pthread_msecs_until($3));
|
|
$39 = !($38 <= 0.0);
|
|
if (!($39)) {
|
|
$$138$ph70 = 110;
|
|
break;
|
|
}
|
|
$40 = $38 > 100.0;
|
|
$$0$us53 = $40 ? 100.0 : $38;
|
|
$41 = (_emscripten_futex_wait(($0|0),($1|0),(+$$0$us53))|0);
|
|
$42 = (0 - ($41))|0;
|
|
switch ($42|0) {
|
|
case 110: {
|
|
break;
|
|
}
|
|
case 4: case 125: {
|
|
$$138$ph70 = $42;
|
|
break L34;
|
|
break;
|
|
}
|
|
default: {
|
|
$$138 = 0;
|
|
label = 21;
|
|
break L34;
|
|
}
|
|
}
|
|
}
|
|
if ((label|0) == 21) {
|
|
STACKTOP = sp;return ($$138|0);
|
|
}
|
|
$$138 = $$138$ph70;
|
|
STACKTOP = sp;return ($$138|0);
|
|
}
|
|
function __pthread_isduecanceled($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = HEAP32[$0>>2]|0;
|
|
$2 = ($1|0)==(2);
|
|
$3 = $2&1;
|
|
return ($3|0);
|
|
}
|
|
function __pthread_msecs_until($0) {
|
|
$0 = $0|0;
|
|
var $1 = 0, $10 = 0, $11 = 0.0, $12 = 0.0, $13 = 0, $14 = 0, $15 = 0.0, $16 = 0.0, $17 = 0.0, $18 = 0.0, $2 = 0, $3 = 0.0, $4 = 0.0, $5 = 0, $6 = 0, $7 = 0.0, $8 = 0.0, $9 = 0.0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
|
|
$1 = sp;
|
|
(_gettimeofday(($1|0),(0|0))|0);
|
|
$2 = HEAP32[$1>>2]|0;
|
|
$3 = (+($2|0));
|
|
$4 = $3 * 1000.0;
|
|
$5 = ((($1)) + 4|0);
|
|
$6 = HEAP32[$5>>2]|0;
|
|
$7 = (+($6|0));
|
|
$8 = $7 * 0.001;
|
|
$9 = $4 + $8;
|
|
$10 = HEAP32[$0>>2]|0;
|
|
$11 = (+($10|0));
|
|
$12 = $11 * 1000.0;
|
|
$13 = ((($0)) + 4|0);
|
|
$14 = HEAP32[$13>>2]|0;
|
|
$15 = (+($14|0));
|
|
$16 = $15 * 9.9999999999999995E-7;
|
|
$17 = $12 + $16;
|
|
$18 = $17 - $9;
|
|
STACKTOP = sp;return (+$18);
|
|
}
|
|
function ___pthread_mutex_trylock($0) {
|
|
$0 = $0|0;
|
|
var $$0 = 0, $1 = 0, $2 = 0, $3 = 0, $4 = 0, $5 = 0, $6 = 0, $7 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = HEAP32[$0>>2]|0;
|
|
$2 = $1 & 15;
|
|
$3 = ($2|0)==(0);
|
|
if ($3) {
|
|
$4 = ((($0)) + 4|0);
|
|
$5 = (Atomics_compareExchange(HEAP32, $4>>2, 0, 16)|0);
|
|
$6 = $5 & 16;
|
|
$$0 = $6;
|
|
return ($$0|0);
|
|
} else {
|
|
$7 = (___pthread_mutex_trylock_owner($0)|0);
|
|
$$0 = $7;
|
|
return ($$0|0);
|
|
}
|
|
return (0)|0;
|
|
}
|
|
function ___pthread_mutex_trylock_owner($0) {
|
|
$0 = $0|0;
|
|
var $$ = 0, $$1 = 0, $$154 = 0, $1 = 0, $10 = 0, $11 = 0, $12 = 0, $13 = 0, $14 = 0, $15 = 0, $16 = 0, $17 = 0, $18 = 0, $19 = 0, $2 = 0, $20 = 0, $21 = 0, $22 = 0, $23 = 0, $24 = 0;
|
|
var $25 = 0, $26 = 0, $27 = 0, $28 = 0, $29 = 0, $3 = 0, $30 = 0, $31 = 0, $32 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0, $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0;
|
|
var $43 = 0, $44 = 0, $45 = 0, $5 = 0, $6 = 0, $7 = 0, $8 = 0, $9 = 0, $or$cond = 0, $or$cond57 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = HEAP32[$0>>2]|0;
|
|
$2 = (_pthread_self()|0);
|
|
$3 = ((($2)) + 52|0);
|
|
$4 = HEAP32[$3>>2]|0;
|
|
$5 = ((($0)) + 4|0);
|
|
$6 = (Atomics_load(HEAP32,$5>>2)|0);
|
|
$7 = $6 & 2147483647;
|
|
$8 = ($7|0)==($4|0);
|
|
$9 = $1 & 3;
|
|
$10 = ($9|0)==(1);
|
|
$or$cond = $10 & $8;
|
|
if ($or$cond) {
|
|
$11 = ((($0)) + 20|0);
|
|
$12 = HEAP32[$11>>2]|0;
|
|
$13 = ($12>>>0)>(2147483646);
|
|
if ($13) {
|
|
$$1 = 11;
|
|
return ($$1|0);
|
|
}
|
|
$14 = (($12) + 1)|0;
|
|
HEAP32[$11>>2] = $14;
|
|
$$1 = 0;
|
|
return ($$1|0);
|
|
}
|
|
$15 = ($7|0)==(2147483647);
|
|
if ($15) {
|
|
$$1 = 131;
|
|
return ($$1|0);
|
|
}
|
|
$16 = HEAP32[$0>>2]|0;
|
|
$17 = $16 & 128;
|
|
$18 = ($17|0)==(0);
|
|
if ($18) {
|
|
$$154 = $4;
|
|
} else {
|
|
$19 = ((($2)) + 172|0);
|
|
$20 = HEAP32[$19>>2]|0;
|
|
$21 = ($20|0)==(0);
|
|
if ($21) {
|
|
HEAP32[$19>>2] = -12;
|
|
}
|
|
$22 = ((($0)) + 8|0);
|
|
$23 = (Atomics_load(HEAP32,$22>>2)|0);
|
|
$24 = ($23|0)==(0);
|
|
$25 = $4 | -2147483648;
|
|
$$ = $24 ? $4 : $25;
|
|
$26 = ((($0)) + 16|0);
|
|
$27 = ((($2)) + 176|0);
|
|
Atomics_store(HEAP32,$27>>2,$26)|0;
|
|
$$154 = $$;
|
|
}
|
|
$28 = ($7|0)!=(0);
|
|
if ($28) {
|
|
$29 = $6 & 1073741824;
|
|
$30 = ($29|0)==(0);
|
|
$31 = $1 & 4;
|
|
$32 = ($31|0)==(0);
|
|
$or$cond57 = $32 | $30;
|
|
if (!($or$cond57)) {
|
|
label = 11;
|
|
}
|
|
} else {
|
|
label = 11;
|
|
}
|
|
if ((label|0) == 11) {
|
|
$33 = (Atomics_compareExchange(HEAP32, $5>>2, $6, $$154)|0);
|
|
$34 = ($33|0)==($6|0);
|
|
if ($34) {
|
|
$36 = ((($2)) + 168|0);
|
|
$37 = (Atomics_load(HEAP32,$36>>2)|0);
|
|
$38 = ((($0)) + 16|0);
|
|
HEAP32[$38>>2] = $37;
|
|
$39 = ((($0)) + 12|0);
|
|
HEAP32[$39>>2] = $36;
|
|
$40 = ($37|0)==($36|0);
|
|
if (!($40)) {
|
|
$41 = ((($37)) + -4|0);
|
|
Atomics_store(HEAP32,$41>>2,$38)|0;
|
|
}
|
|
Atomics_store(HEAP32,$36>>2,$38)|0;
|
|
$42 = ((($2)) + 176|0);
|
|
Atomics_store(HEAP32,$42>>2,0)|0;
|
|
if (!($28)) {
|
|
$$1 = 0;
|
|
return ($$1|0);
|
|
}
|
|
$43 = ((($0)) + 20|0);
|
|
HEAP32[$43>>2] = 0;
|
|
$44 = HEAP32[$0>>2]|0;
|
|
$45 = $44 | 8;
|
|
HEAP32[$0>>2] = $45;
|
|
$$1 = 130;
|
|
return ($$1|0);
|
|
}
|
|
}
|
|
$35 = ((($2)) + 176|0);
|
|
Atomics_store(HEAP32,$35>>2,0)|0;
|
|
$$1 = 16;
|
|
return ($$1|0);
|
|
}
|
|
function _pthread_mutexattr_destroy($0) {
|
|
$0 = $0|0;
|
|
var label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
return 0;
|
|
}
|
|
function _pthread_mutexattr_init($0) {
|
|
$0 = $0|0;
|
|
var label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
HEAP32[$0>>2] = 0;
|
|
return 0;
|
|
}
|
|
function _pthread_mutex_init($0,$1) {
|
|
$0 = $0|0;
|
|
$1 = $1|0;
|
|
var $$sroa$0 = 0, $2 = 0, $3 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 32|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(32|0);
|
|
$$sroa$0 = sp;
|
|
;HEAP32[$$sroa$0>>2]=0|0;HEAP32[$$sroa$0+4>>2]=0|0;HEAP32[$$sroa$0+8>>2]=0|0;HEAP32[$$sroa$0+12>>2]=0|0;HEAP32[$$sroa$0+16>>2]=0|0;HEAP32[$$sroa$0+20>>2]=0|0;HEAP32[$$sroa$0+24>>2]=0|0;
|
|
;HEAP32[$0>>2]=HEAP32[$$sroa$0>>2]|0;HEAP32[$0+4>>2]=HEAP32[$$sroa$0+4>>2]|0;HEAP32[$0+8>>2]=HEAP32[$$sroa$0+8>>2]|0;HEAP32[$0+12>>2]=HEAP32[$$sroa$0+12>>2]|0;HEAP32[$0+16>>2]=HEAP32[$$sroa$0+16>>2]|0;HEAP32[$0+20>>2]=HEAP32[$$sroa$0+20>>2]|0;HEAP32[$0+24>>2]=HEAP32[$$sroa$0+24>>2]|0;
|
|
$2 = ($1|0)==(0|0);
|
|
if ($2) {
|
|
STACKTOP = sp;return 0;
|
|
}
|
|
$3 = HEAP32[$1>>2]|0;
|
|
HEAP32[$0>>2] = $3;
|
|
STACKTOP = sp;return 0;
|
|
}
|
|
function _malloc($0) {
|
|
$0 = $0|0;
|
|
var $$$0192$i = 0, $$$0193$i = 0, $$$4230$i = 0, $$$4236$i = 0, $$$4351$i = 0, $$$i = 0, $$0$i$i = 0, $$0$i$i$i = 0, $$0$i17$i = 0, $$01$i$i = 0, $$0189$i = 0, $$0192$lcssa$i = 0, $$01928$i = 0, $$0193$lcssa$i = 0, $$01937$i = 0, $$0198 = 0, $$0200 = 0, $$0206$i$i = 0, $$0207$i$i = 0, $$0211$i$i = 0;
|
|
var $$0212$i$i = 0, $$024363$i = 0, $$0287$i$i = 0, $$0288$i$i = 0, $$0289$i$i = 0, $$0295$i$i = 0, $$0296$i$i = 0, $$0342$i = 0, $$0344$i = 0, $$0345$i = 0, $$0347$i = 0, $$0353$i = 0, $$0358$i = 0, $$0359$$i = 0, $$0359$i = 0, $$0361$i = 0, $$0362$i = 0, $$0368$i = 0, $$1 = 0, $$1196$i = 0;
|
|
var $$1198$i = 0, $$124462$i = 0, $$1291$i$i = 0, $$1293$i$i = 0, $$1343$i = 0, $$1348$i = 0, $$1363$i = 0, $$1370$i = 0, $$1374$i = 0, $$2 = 0, $$2234253237$i = 0, $$2247$ph$i = 0, $$2253$ph$i = 0, $$2355$i = 0, $$3$i = 0, $$3$i$i = 0, $$3$i202 = 0, $$3229$i = 0, $$3235$i = 0, $$3350$i = 0;
|
|
var $$3372$i = 0, $$4$lcssa$i = 0, $$4$ph$i = 0, $$415$i = 0, $$4230$i = 0, $$4236$i = 0, $$4351$lcssa$i = 0, $$435114$i = 0, $$4357$$4$i = 0, $$4357$ph$i = 0, $$435713$i = 0, $$7$i = 0, $$7239$i = 0, $$pre = 0, $$pre$i = 0, $$pre$i$i = 0, $$pre$i18$i = 0, $$pre$i211 = 0, $$pre$phi$i$iZ2D = 0, $$pre$phi$i19$iZ2D = 0;
|
|
var $$pre$phi$i212Z2D = 0, $$pre$phi$iZ2D = 0, $$pre$phi11$i$iZ2D = 0, $$pre$phiZ2D = 0, $$pre10$i$i = 0, $$sink1$i = 0, $$sink1$i$i = 0, $$sink16$i = 0, $$sink2$i = 0, $$sink2$i205 = 0, $$sink3$i = 0, $1 = 0, $10 = 0, $100 = 0, $1000 = 0, $1001 = 0, $1002 = 0, $1003 = 0, $1004 = 0, $1005 = 0;
|
|
var $1006 = 0, $1007 = 0, $1008 = 0, $1009 = 0, $101 = 0, $1010 = 0, $1011 = 0, $1012 = 0, $1013 = 0, $1014 = 0, $1015 = 0, $1016 = 0, $1017 = 0, $1018 = 0, $1019 = 0, $102 = 0, $1020 = 0, $1021 = 0, $1022 = 0, $1023 = 0;
|
|
var $1024 = 0, $1025 = 0, $1026 = 0, $1027 = 0, $1028 = 0, $1029 = 0, $103 = 0, $1030 = 0, $1031 = 0, $1032 = 0, $1033 = 0, $1034 = 0, $1035 = 0, $1036 = 0, $1037 = 0, $1038 = 0, $1039 = 0, $104 = 0, $1040 = 0, $1041 = 0;
|
|
var $1042 = 0, $1043 = 0, $1044 = 0, $1045 = 0, $1046 = 0, $1047 = 0, $1048 = 0, $1049 = 0, $105 = 0, $1050 = 0, $1051 = 0, $1052 = 0, $1053 = 0, $1054 = 0, $1055 = 0, $1056 = 0, $1057 = 0, $1058 = 0, $1059 = 0, $106 = 0;
|
|
var $1060 = 0, $1061 = 0, $1062 = 0, $1063 = 0, $1064 = 0, $1065 = 0, $1066 = 0, $1067 = 0, $1068 = 0, $1069 = 0, $107 = 0, $1070 = 0, $1071 = 0, $1072 = 0, $1073 = 0, $1074 = 0, $1075 = 0, $1076 = 0, $1077 = 0, $1078 = 0;
|
|
var $1079 = 0, $108 = 0, $1080 = 0, $1081 = 0, $1082 = 0, $1083 = 0, $1084 = 0, $1085 = 0, $1086 = 0, $1087 = 0, $1088 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0, $114 = 0, $115 = 0, $116 = 0;
|
|
var $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0, $132 = 0, $133 = 0, $134 = 0;
|
|
var $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0, $150 = 0, $151 = 0, $152 = 0;
|
|
var $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0, $169 = 0, $17 = 0, $170 = 0;
|
|
var $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0, $187 = 0, $188 = 0, $189 = 0;
|
|
var $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0, $204 = 0, $205 = 0, $206 = 0;
|
|
var $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0, $222 = 0, $223 = 0, $224 = 0;
|
|
var $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0, $240 = 0, $241 = 0, $242 = 0;
|
|
var $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0, $259 = 0, $26 = 0, $260 = 0;
|
|
var $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0, $277 = 0, $278 = 0, $279 = 0;
|
|
var $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0, $295 = 0, $296 = 0, $297 = 0;
|
|
var $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0, $312 = 0, $313 = 0, $314 = 0;
|
|
var $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $327 = 0, $328 = 0, $329 = 0, $33 = 0, $330 = 0, $331 = 0, $332 = 0;
|
|
var $333 = 0, $334 = 0, $335 = 0, $336 = 0, $337 = 0, $338 = 0, $339 = 0, $34 = 0, $340 = 0, $341 = 0, $342 = 0, $343 = 0, $344 = 0, $345 = 0, $346 = 0, $347 = 0, $348 = 0, $349 = 0, $35 = 0, $350 = 0;
|
|
var $351 = 0, $352 = 0, $353 = 0, $354 = 0, $355 = 0, $356 = 0, $357 = 0, $358 = 0, $359 = 0, $36 = 0, $360 = 0, $361 = 0, $362 = 0, $363 = 0, $364 = 0, $365 = 0, $366 = 0, $367 = 0, $368 = 0, $369 = 0;
|
|
var $37 = 0, $370 = 0, $371 = 0, $372 = 0, $373 = 0, $374 = 0, $375 = 0, $376 = 0, $377 = 0, $378 = 0, $379 = 0, $38 = 0, $380 = 0, $381 = 0, $382 = 0, $383 = 0, $384 = 0, $385 = 0, $386 = 0, $387 = 0;
|
|
var $388 = 0, $389 = 0, $39 = 0, $390 = 0, $391 = 0, $392 = 0, $393 = 0, $394 = 0, $395 = 0, $396 = 0, $397 = 0, $398 = 0, $399 = 0, $4 = 0, $40 = 0, $400 = 0, $401 = 0, $402 = 0, $403 = 0, $404 = 0;
|
|
var $405 = 0, $406 = 0, $407 = 0, $408 = 0, $409 = 0, $41 = 0, $410 = 0, $411 = 0, $412 = 0, $413 = 0, $414 = 0, $415 = 0, $416 = 0, $417 = 0, $418 = 0, $419 = 0, $42 = 0, $420 = 0, $421 = 0, $422 = 0;
|
|
var $423 = 0, $424 = 0, $425 = 0, $426 = 0, $427 = 0, $428 = 0, $429 = 0, $43 = 0, $430 = 0, $431 = 0, $432 = 0, $433 = 0, $434 = 0, $435 = 0, $436 = 0, $437 = 0, $438 = 0, $439 = 0, $44 = 0, $440 = 0;
|
|
var $441 = 0, $442 = 0, $443 = 0, $444 = 0, $445 = 0, $446 = 0, $447 = 0, $448 = 0, $449 = 0, $45 = 0, $450 = 0, $451 = 0, $452 = 0, $453 = 0, $454 = 0, $455 = 0, $456 = 0, $457 = 0, $458 = 0, $459 = 0;
|
|
var $46 = 0, $460 = 0, $461 = 0, $462 = 0, $463 = 0, $464 = 0, $465 = 0, $466 = 0, $467 = 0, $468 = 0, $469 = 0, $47 = 0, $470 = 0, $471 = 0, $472 = 0, $473 = 0, $474 = 0, $475 = 0, $476 = 0, $477 = 0;
|
|
var $478 = 0, $479 = 0, $48 = 0, $480 = 0, $481 = 0, $482 = 0, $483 = 0, $484 = 0, $485 = 0, $486 = 0, $487 = 0, $488 = 0, $489 = 0, $49 = 0, $490 = 0, $491 = 0, $492 = 0, $493 = 0, $494 = 0, $495 = 0;
|
|
var $496 = 0, $497 = 0, $498 = 0, $499 = 0, $5 = 0, $50 = 0, $500 = 0, $501 = 0, $502 = 0, $503 = 0, $504 = 0, $505 = 0, $506 = 0, $507 = 0, $508 = 0, $509 = 0, $51 = 0, $510 = 0, $511 = 0, $512 = 0;
|
|
var $513 = 0, $514 = 0, $515 = 0, $516 = 0, $517 = 0, $518 = 0, $519 = 0, $52 = 0, $520 = 0, $521 = 0, $522 = 0, $523 = 0, $524 = 0, $525 = 0, $526 = 0, $527 = 0, $528 = 0, $529 = 0, $53 = 0, $530 = 0;
|
|
var $531 = 0, $532 = 0, $533 = 0, $534 = 0, $535 = 0, $536 = 0, $537 = 0, $538 = 0, $539 = 0, $54 = 0, $540 = 0, $541 = 0, $542 = 0, $543 = 0, $544 = 0, $545 = 0, $546 = 0, $547 = 0, $548 = 0, $549 = 0;
|
|
var $55 = 0, $550 = 0, $551 = 0, $552 = 0, $553 = 0, $554 = 0, $555 = 0, $556 = 0, $557 = 0, $558 = 0, $559 = 0, $56 = 0, $560 = 0, $561 = 0, $562 = 0, $563 = 0, $564 = 0, $565 = 0, $566 = 0, $567 = 0;
|
|
var $568 = 0, $569 = 0, $57 = 0, $570 = 0, $571 = 0, $572 = 0, $573 = 0, $574 = 0, $575 = 0, $576 = 0, $577 = 0, $578 = 0, $579 = 0, $58 = 0, $580 = 0, $581 = 0, $582 = 0, $583 = 0, $584 = 0, $585 = 0;
|
|
var $586 = 0, $587 = 0, $588 = 0, $589 = 0, $59 = 0, $590 = 0, $591 = 0, $592 = 0, $593 = 0, $594 = 0, $595 = 0, $596 = 0, $597 = 0, $598 = 0, $599 = 0, $6 = 0, $60 = 0, $600 = 0, $601 = 0, $602 = 0;
|
|
var $603 = 0, $604 = 0, $605 = 0, $606 = 0, $607 = 0, $608 = 0, $609 = 0, $61 = 0, $610 = 0, $611 = 0, $612 = 0, $613 = 0, $614 = 0, $615 = 0, $616 = 0, $617 = 0, $618 = 0, $619 = 0, $62 = 0, $620 = 0;
|
|
var $621 = 0, $622 = 0, $623 = 0, $624 = 0, $625 = 0, $626 = 0, $627 = 0, $628 = 0, $629 = 0, $63 = 0, $630 = 0, $631 = 0, $632 = 0, $633 = 0, $634 = 0, $635 = 0, $636 = 0, $637 = 0, $638 = 0, $639 = 0;
|
|
var $64 = 0, $640 = 0, $641 = 0, $642 = 0, $643 = 0, $644 = 0, $645 = 0, $646 = 0, $647 = 0, $648 = 0, $649 = 0, $65 = 0, $650 = 0, $651 = 0, $652 = 0, $653 = 0, $654 = 0, $655 = 0, $656 = 0, $657 = 0;
|
|
var $658 = 0, $659 = 0, $66 = 0, $660 = 0, $661 = 0, $662 = 0, $663 = 0, $664 = 0, $665 = 0, $666 = 0, $667 = 0, $668 = 0, $669 = 0, $67 = 0, $670 = 0, $671 = 0, $672 = 0, $673 = 0, $674 = 0, $675 = 0;
|
|
var $676 = 0, $677 = 0, $678 = 0, $679 = 0, $68 = 0, $680 = 0, $681 = 0, $682 = 0, $683 = 0, $684 = 0, $685 = 0, $686 = 0, $687 = 0, $688 = 0, $689 = 0, $69 = 0, $690 = 0, $691 = 0, $692 = 0, $693 = 0;
|
|
var $694 = 0, $695 = 0, $696 = 0, $697 = 0, $698 = 0, $699 = 0, $7 = 0, $70 = 0, $700 = 0, $701 = 0, $702 = 0, $703 = 0, $704 = 0, $705 = 0, $706 = 0, $707 = 0, $708 = 0, $709 = 0, $71 = 0, $710 = 0;
|
|
var $711 = 0, $712 = 0, $713 = 0, $714 = 0, $715 = 0, $716 = 0, $717 = 0, $718 = 0, $719 = 0, $72 = 0, $720 = 0, $721 = 0, $722 = 0, $723 = 0, $724 = 0, $725 = 0, $726 = 0, $727 = 0, $728 = 0, $729 = 0;
|
|
var $73 = 0, $730 = 0, $731 = 0, $732 = 0, $733 = 0, $734 = 0, $735 = 0, $736 = 0, $737 = 0, $738 = 0, $739 = 0, $74 = 0, $740 = 0, $741 = 0, $742 = 0, $743 = 0, $744 = 0, $745 = 0, $746 = 0, $747 = 0;
|
|
var $748 = 0, $749 = 0, $75 = 0, $750 = 0, $751 = 0, $752 = 0, $753 = 0, $754 = 0, $755 = 0, $756 = 0, $757 = 0, $758 = 0, $759 = 0, $76 = 0, $760 = 0, $761 = 0, $762 = 0, $763 = 0, $764 = 0, $765 = 0;
|
|
var $766 = 0, $767 = 0, $768 = 0, $769 = 0, $77 = 0, $770 = 0, $771 = 0, $772 = 0, $773 = 0, $774 = 0, $775 = 0, $776 = 0, $777 = 0, $778 = 0, $779 = 0, $78 = 0, $780 = 0, $781 = 0, $782 = 0, $783 = 0;
|
|
var $784 = 0, $785 = 0, $786 = 0, $787 = 0, $788 = 0, $789 = 0, $79 = 0, $790 = 0, $791 = 0, $792 = 0, $793 = 0, $794 = 0, $795 = 0, $796 = 0, $797 = 0, $798 = 0, $799 = 0, $8 = 0, $80 = 0, $800 = 0;
|
|
var $801 = 0, $802 = 0, $803 = 0, $804 = 0, $805 = 0, $806 = 0, $807 = 0, $808 = 0, $809 = 0, $81 = 0, $810 = 0, $811 = 0, $812 = 0, $813 = 0, $814 = 0, $815 = 0, $816 = 0, $817 = 0, $818 = 0, $819 = 0;
|
|
var $82 = 0, $820 = 0, $821 = 0, $822 = 0, $823 = 0, $824 = 0, $825 = 0, $826 = 0, $827 = 0, $828 = 0, $829 = 0, $83 = 0, $830 = 0, $831 = 0, $832 = 0, $833 = 0, $834 = 0, $835 = 0, $836 = 0, $837 = 0;
|
|
var $838 = 0, $839 = 0, $84 = 0, $840 = 0, $841 = 0, $842 = 0, $843 = 0, $844 = 0, $845 = 0, $846 = 0, $847 = 0, $848 = 0, $849 = 0, $85 = 0, $850 = 0, $851 = 0, $852 = 0, $853 = 0, $854 = 0, $855 = 0;
|
|
var $856 = 0, $857 = 0, $858 = 0, $859 = 0, $86 = 0, $860 = 0, $861 = 0, $862 = 0, $863 = 0, $864 = 0, $865 = 0, $866 = 0, $867 = 0, $868 = 0, $869 = 0, $87 = 0, $870 = 0, $871 = 0, $872 = 0, $873 = 0;
|
|
var $874 = 0, $875 = 0, $876 = 0, $877 = 0, $878 = 0, $879 = 0, $88 = 0, $880 = 0, $881 = 0, $882 = 0, $883 = 0, $884 = 0, $885 = 0, $886 = 0, $887 = 0, $888 = 0, $889 = 0, $89 = 0, $890 = 0, $891 = 0;
|
|
var $892 = 0, $893 = 0, $894 = 0, $895 = 0, $896 = 0, $897 = 0, $898 = 0, $899 = 0, $9 = 0, $90 = 0, $900 = 0, $901 = 0, $902 = 0, $903 = 0, $904 = 0, $905 = 0, $906 = 0, $907 = 0, $908 = 0, $909 = 0;
|
|
var $91 = 0, $910 = 0, $911 = 0, $912 = 0, $913 = 0, $914 = 0, $915 = 0, $916 = 0, $917 = 0, $918 = 0, $919 = 0, $92 = 0, $920 = 0, $921 = 0, $922 = 0, $923 = 0, $924 = 0, $925 = 0, $926 = 0, $927 = 0;
|
|
var $928 = 0, $929 = 0, $93 = 0, $930 = 0, $931 = 0, $932 = 0, $933 = 0, $934 = 0, $935 = 0, $936 = 0, $937 = 0, $938 = 0, $939 = 0, $94 = 0, $940 = 0, $941 = 0, $942 = 0, $943 = 0, $944 = 0, $945 = 0;
|
|
var $946 = 0, $947 = 0, $948 = 0, $949 = 0, $95 = 0, $950 = 0, $951 = 0, $952 = 0, $953 = 0, $954 = 0, $955 = 0, $956 = 0, $957 = 0, $958 = 0, $959 = 0, $96 = 0, $960 = 0, $961 = 0, $962 = 0, $963 = 0;
|
|
var $964 = 0, $965 = 0, $966 = 0, $967 = 0, $968 = 0, $969 = 0, $97 = 0, $970 = 0, $971 = 0, $972 = 0, $973 = 0, $974 = 0, $975 = 0, $976 = 0, $977 = 0, $978 = 0, $979 = 0, $98 = 0, $980 = 0, $981 = 0;
|
|
var $982 = 0, $983 = 0, $984 = 0, $985 = 0, $986 = 0, $987 = 0, $988 = 0, $989 = 0, $99 = 0, $990 = 0, $991 = 0, $992 = 0, $993 = 0, $994 = 0, $995 = 0, $996 = 0, $997 = 0, $998 = 0, $999 = 0, $cond$i = 0;
|
|
var $cond$i$i = 0, $cond$i209 = 0, $exitcond$i$i = 0, $not$$i = 0, $not$$i$i = 0, $not$$i21$i = 0, $not$$i210 = 0, $not$1$i = 0, $not$1$i204 = 0, $not$5$i = 0, $not$7$i$i = 0, $not$8$i = 0, $not$9$i = 0, $or$cond$i = 0, $or$cond$i213 = 0, $or$cond1$i = 0, $or$cond10$i = 0, $or$cond11$i = 0, $or$cond12$i = 0, $or$cond2$i = 0;
|
|
var $or$cond2$i214 = 0, $or$cond43$i = 0, $or$cond5$i = 0, $or$cond7$i = 0, $or$cond9$i = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
STACKTOP = STACKTOP + 16|0; if ((STACKTOP|0) >= (STACK_MAX|0)) abortStackOverflow(16|0);
|
|
$1 = sp + 4|0;
|
|
$2 = sp;
|
|
$3 = HEAP32[8850]|0;
|
|
$4 = ($3|0)==(0);
|
|
if ($4) {
|
|
(___pthread_mutex_lock(35424)|0);
|
|
$5 = HEAP32[8850]|0;
|
|
$6 = ($5|0)==(0);
|
|
if ($6) {
|
|
HEAP32[(35408)>>2] = 4096;
|
|
HEAP32[(35404)>>2] = 4096;
|
|
HEAP32[(35412)>>2] = -1;
|
|
HEAP32[(35416)>>2] = -1;
|
|
HEAP32[(35420)>>2] = 2;
|
|
HEAP32[(35896)>>2] = 2;
|
|
$7 = (_pthread_mutexattr_init($1)|0);
|
|
$8 = ($7|0)==(0);
|
|
if ($8) {
|
|
$9 = (_pthread_mutex_init((35900),$1)|0);
|
|
$10 = ($9|0)==(0);
|
|
if ($10) {
|
|
}
|
|
}
|
|
$11 = $2;
|
|
$12 = $11 & -16;
|
|
$13 = $12 ^ 1431655768;
|
|
HEAP32[$2>>2] = $13;
|
|
Atomics_store(HEAP32,8850,$13)|0;
|
|
}
|
|
(___pthread_mutex_unlock(35424)|0);
|
|
}
|
|
$14 = HEAP32[(35896)>>2]|0;
|
|
$15 = $14 & 2;
|
|
$16 = ($15|0)==(0);
|
|
if (!($16)) {
|
|
$17 = (___pthread_mutex_lock((35900))|0);
|
|
$18 = ($17|0)==(0);
|
|
if (!($18)) {
|
|
$$1 = 0;
|
|
STACKTOP = sp;return ($$1|0);
|
|
}
|
|
}
|
|
$19 = ($0>>>0)<(245);
|
|
do {
|
|
if ($19) {
|
|
$20 = ($0>>>0)<(11);
|
|
$21 = (($0) + 11)|0;
|
|
$22 = $21 & -8;
|
|
$23 = $20 ? 16 : $22;
|
|
$24 = $23 >>> 3;
|
|
$25 = HEAP32[8863]|0;
|
|
$26 = $25 >>> $24;
|
|
$27 = $26 & 3;
|
|
$28 = ($27|0)==(0);
|
|
if (!($28)) {
|
|
$29 = $26 & 1;
|
|
$30 = $29 ^ 1;
|
|
$31 = (($30) + ($24))|0;
|
|
$32 = $31 << 1;
|
|
$33 = (35492 + ($32<<2)|0);
|
|
$34 = ((($33)) + 8|0);
|
|
$35 = HEAP32[$34>>2]|0;
|
|
$36 = ((($35)) + 8|0);
|
|
$37 = HEAP32[$36>>2]|0;
|
|
$38 = ($33|0)==($37|0);
|
|
do {
|
|
if ($38) {
|
|
$39 = 1 << $31;
|
|
$40 = $39 ^ -1;
|
|
$41 = $25 & $40;
|
|
HEAP32[8863] = $41;
|
|
} else {
|
|
$42 = HEAP32[(35468)>>2]|0;
|
|
$43 = ($37>>>0)<($42>>>0);
|
|
if ($43) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$44 = ((($37)) + 12|0);
|
|
$45 = HEAP32[$44>>2]|0;
|
|
$46 = ($45|0)==($35|0);
|
|
if ($46) {
|
|
HEAP32[$44>>2] = $33;
|
|
HEAP32[$34>>2] = $37;
|
|
break;
|
|
} else {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
}
|
|
} while(0);
|
|
$47 = $31 << 3;
|
|
$48 = $47 | 3;
|
|
$49 = ((($35)) + 4|0);
|
|
HEAP32[$49>>2] = $48;
|
|
$50 = (($35) + ($47)|0);
|
|
$51 = ((($50)) + 4|0);
|
|
$52 = HEAP32[$51>>2]|0;
|
|
$53 = $52 | 1;
|
|
HEAP32[$51>>2] = $53;
|
|
$$2 = $36;
|
|
break;
|
|
}
|
|
$54 = HEAP32[(35460)>>2]|0;
|
|
$55 = ($23>>>0)>($54>>>0);
|
|
if ($55) {
|
|
$56 = ($26|0)==(0);
|
|
if (!($56)) {
|
|
$57 = $26 << $24;
|
|
$58 = 2 << $24;
|
|
$59 = (0 - ($58))|0;
|
|
$60 = $58 | $59;
|
|
$61 = $57 & $60;
|
|
$62 = (0 - ($61))|0;
|
|
$63 = $61 & $62;
|
|
$64 = (($63) + -1)|0;
|
|
$65 = $64 >>> 12;
|
|
$66 = $65 & 16;
|
|
$67 = $64 >>> $66;
|
|
$68 = $67 >>> 5;
|
|
$69 = $68 & 8;
|
|
$70 = $69 | $66;
|
|
$71 = $67 >>> $69;
|
|
$72 = $71 >>> 2;
|
|
$73 = $72 & 4;
|
|
$74 = $70 | $73;
|
|
$75 = $71 >>> $73;
|
|
$76 = $75 >>> 1;
|
|
$77 = $76 & 2;
|
|
$78 = $74 | $77;
|
|
$79 = $75 >>> $77;
|
|
$80 = $79 >>> 1;
|
|
$81 = $80 & 1;
|
|
$82 = $78 | $81;
|
|
$83 = $79 >>> $81;
|
|
$84 = (($82) + ($83))|0;
|
|
$85 = $84 << 1;
|
|
$86 = (35492 + ($85<<2)|0);
|
|
$87 = ((($86)) + 8|0);
|
|
$88 = HEAP32[$87>>2]|0;
|
|
$89 = ((($88)) + 8|0);
|
|
$90 = HEAP32[$89>>2]|0;
|
|
$91 = ($86|0)==($90|0);
|
|
do {
|
|
if ($91) {
|
|
$92 = 1 << $84;
|
|
$93 = $92 ^ -1;
|
|
$94 = $25 & $93;
|
|
HEAP32[8863] = $94;
|
|
$115 = $94;
|
|
} else {
|
|
$95 = HEAP32[(35468)>>2]|0;
|
|
$96 = ($90>>>0)<($95>>>0);
|
|
if ($96) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$97 = ((($90)) + 12|0);
|
|
$98 = HEAP32[$97>>2]|0;
|
|
$99 = ($98|0)==($88|0);
|
|
if ($99) {
|
|
HEAP32[$97>>2] = $86;
|
|
HEAP32[$87>>2] = $90;
|
|
$115 = $25;
|
|
break;
|
|
} else {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
}
|
|
} while(0);
|
|
$100 = $84 << 3;
|
|
$101 = (($100) - ($23))|0;
|
|
$102 = $23 | 3;
|
|
$103 = ((($88)) + 4|0);
|
|
HEAP32[$103>>2] = $102;
|
|
$104 = (($88) + ($23)|0);
|
|
$105 = $101 | 1;
|
|
$106 = ((($104)) + 4|0);
|
|
HEAP32[$106>>2] = $105;
|
|
$107 = (($104) + ($101)|0);
|
|
HEAP32[$107>>2] = $101;
|
|
$108 = ($54|0)==(0);
|
|
if (!($108)) {
|
|
$109 = HEAP32[(35472)>>2]|0;
|
|
$110 = $54 >>> 3;
|
|
$111 = $110 << 1;
|
|
$112 = (35492 + ($111<<2)|0);
|
|
$113 = 1 << $110;
|
|
$114 = $115 & $113;
|
|
$116 = ($114|0)==(0);
|
|
if ($116) {
|
|
$117 = $115 | $113;
|
|
HEAP32[8863] = $117;
|
|
$$pre = ((($112)) + 8|0);
|
|
$$0200 = $112;$$pre$phiZ2D = $$pre;
|
|
} else {
|
|
$118 = ((($112)) + 8|0);
|
|
$119 = HEAP32[$118>>2]|0;
|
|
$120 = HEAP32[(35468)>>2]|0;
|
|
$121 = ($119>>>0)<($120>>>0);
|
|
if ($121) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$$0200 = $119;$$pre$phiZ2D = $118;
|
|
}
|
|
}
|
|
HEAP32[$$pre$phiZ2D>>2] = $109;
|
|
$122 = ((($$0200)) + 12|0);
|
|
HEAP32[$122>>2] = $109;
|
|
$123 = ((($109)) + 8|0);
|
|
HEAP32[$123>>2] = $$0200;
|
|
$124 = ((($109)) + 12|0);
|
|
HEAP32[$124>>2] = $112;
|
|
}
|
|
HEAP32[(35460)>>2] = $101;
|
|
HEAP32[(35472)>>2] = $104;
|
|
$$2 = $89;
|
|
break;
|
|
}
|
|
$125 = HEAP32[(35456)>>2]|0;
|
|
$126 = ($125|0)==(0);
|
|
if ($126) {
|
|
$$0198 = $23;
|
|
label = 153;
|
|
} else {
|
|
$127 = (0 - ($125))|0;
|
|
$128 = $125 & $127;
|
|
$129 = (($128) + -1)|0;
|
|
$130 = $129 >>> 12;
|
|
$131 = $130 & 16;
|
|
$132 = $129 >>> $131;
|
|
$133 = $132 >>> 5;
|
|
$134 = $133 & 8;
|
|
$135 = $134 | $131;
|
|
$136 = $132 >>> $134;
|
|
$137 = $136 >>> 2;
|
|
$138 = $137 & 4;
|
|
$139 = $135 | $138;
|
|
$140 = $136 >>> $138;
|
|
$141 = $140 >>> 1;
|
|
$142 = $141 & 2;
|
|
$143 = $139 | $142;
|
|
$144 = $140 >>> $142;
|
|
$145 = $144 >>> 1;
|
|
$146 = $145 & 1;
|
|
$147 = $143 | $146;
|
|
$148 = $144 >>> $146;
|
|
$149 = (($147) + ($148))|0;
|
|
$150 = (35756 + ($149<<2)|0);
|
|
$151 = HEAP32[$150>>2]|0;
|
|
$152 = ((($151)) + 4|0);
|
|
$153 = HEAP32[$152>>2]|0;
|
|
$154 = $153 & -8;
|
|
$155 = (($154) - ($23))|0;
|
|
$156 = ((($151)) + 16|0);
|
|
$157 = HEAP32[$156>>2]|0;
|
|
$not$5$i = ($157|0)==(0|0);
|
|
$$sink16$i = $not$5$i&1;
|
|
$158 = (((($151)) + 16|0) + ($$sink16$i<<2)|0);
|
|
$159 = HEAP32[$158>>2]|0;
|
|
$160 = ($159|0)==(0|0);
|
|
if ($160) {
|
|
$$0192$lcssa$i = $151;$$0193$lcssa$i = $155;
|
|
} else {
|
|
$$01928$i = $151;$$01937$i = $155;$162 = $159;
|
|
while(1) {
|
|
$161 = ((($162)) + 4|0);
|
|
$163 = HEAP32[$161>>2]|0;
|
|
$164 = $163 & -8;
|
|
$165 = (($164) - ($23))|0;
|
|
$166 = ($165>>>0)<($$01937$i>>>0);
|
|
$$$0193$i = $166 ? $165 : $$01937$i;
|
|
$$$0192$i = $166 ? $162 : $$01928$i;
|
|
$167 = ((($162)) + 16|0);
|
|
$168 = HEAP32[$167>>2]|0;
|
|
$not$$i = ($168|0)==(0|0);
|
|
$$sink1$i = $not$$i&1;
|
|
$169 = (((($162)) + 16|0) + ($$sink1$i<<2)|0);
|
|
$170 = HEAP32[$169>>2]|0;
|
|
$171 = ($170|0)==(0|0);
|
|
if ($171) {
|
|
$$0192$lcssa$i = $$$0192$i;$$0193$lcssa$i = $$$0193$i;
|
|
break;
|
|
} else {
|
|
$$01928$i = $$$0192$i;$$01937$i = $$$0193$i;$162 = $170;
|
|
}
|
|
}
|
|
}
|
|
$172 = HEAP32[(35468)>>2]|0;
|
|
$173 = ($$0192$lcssa$i>>>0)<($172>>>0);
|
|
if ($173) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$174 = (($$0192$lcssa$i) + ($23)|0);
|
|
$175 = ($$0192$lcssa$i>>>0)<($174>>>0);
|
|
if (!($175)) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$176 = ((($$0192$lcssa$i)) + 24|0);
|
|
$177 = HEAP32[$176>>2]|0;
|
|
$178 = ((($$0192$lcssa$i)) + 12|0);
|
|
$179 = HEAP32[$178>>2]|0;
|
|
$180 = ($179|0)==($$0192$lcssa$i|0);
|
|
do {
|
|
if ($180) {
|
|
$190 = ((($$0192$lcssa$i)) + 20|0);
|
|
$191 = HEAP32[$190>>2]|0;
|
|
$192 = ($191|0)==(0|0);
|
|
if ($192) {
|
|
$193 = ((($$0192$lcssa$i)) + 16|0);
|
|
$194 = HEAP32[$193>>2]|0;
|
|
$195 = ($194|0)==(0|0);
|
|
if ($195) {
|
|
$$3$i = 0;
|
|
break;
|
|
} else {
|
|
$$1196$i = $194;$$1198$i = $193;
|
|
}
|
|
} else {
|
|
$$1196$i = $191;$$1198$i = $190;
|
|
}
|
|
while(1) {
|
|
$196 = ((($$1196$i)) + 20|0);
|
|
$197 = HEAP32[$196>>2]|0;
|
|
$198 = ($197|0)==(0|0);
|
|
if (!($198)) {
|
|
$$1196$i = $197;$$1198$i = $196;
|
|
continue;
|
|
}
|
|
$199 = ((($$1196$i)) + 16|0);
|
|
$200 = HEAP32[$199>>2]|0;
|
|
$201 = ($200|0)==(0|0);
|
|
if ($201) {
|
|
break;
|
|
} else {
|
|
$$1196$i = $200;$$1198$i = $199;
|
|
}
|
|
}
|
|
$202 = ($$1198$i>>>0)<($172>>>0);
|
|
if ($202) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
HEAP32[$$1198$i>>2] = 0;
|
|
$$3$i = $$1196$i;
|
|
break;
|
|
}
|
|
} else {
|
|
$181 = ((($$0192$lcssa$i)) + 8|0);
|
|
$182 = HEAP32[$181>>2]|0;
|
|
$183 = ($182>>>0)<($172>>>0);
|
|
if ($183) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$184 = ((($182)) + 12|0);
|
|
$185 = HEAP32[$184>>2]|0;
|
|
$186 = ($185|0)==($$0192$lcssa$i|0);
|
|
if (!($186)) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$187 = ((($179)) + 8|0);
|
|
$188 = HEAP32[$187>>2]|0;
|
|
$189 = ($188|0)==($$0192$lcssa$i|0);
|
|
if ($189) {
|
|
HEAP32[$184>>2] = $179;
|
|
HEAP32[$187>>2] = $182;
|
|
$$3$i = $179;
|
|
break;
|
|
} else {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
}
|
|
} while(0);
|
|
$203 = ($177|0)==(0|0);
|
|
L85: do {
|
|
if (!($203)) {
|
|
$204 = ((($$0192$lcssa$i)) + 28|0);
|
|
$205 = HEAP32[$204>>2]|0;
|
|
$206 = (35756 + ($205<<2)|0);
|
|
$207 = HEAP32[$206>>2]|0;
|
|
$208 = ($$0192$lcssa$i|0)==($207|0);
|
|
do {
|
|
if ($208) {
|
|
HEAP32[$206>>2] = $$3$i;
|
|
$cond$i = ($$3$i|0)==(0|0);
|
|
if ($cond$i) {
|
|
$209 = 1 << $205;
|
|
$210 = $209 ^ -1;
|
|
$211 = $125 & $210;
|
|
HEAP32[(35456)>>2] = $211;
|
|
break L85;
|
|
}
|
|
} else {
|
|
$212 = HEAP32[(35468)>>2]|0;
|
|
$213 = ($177>>>0)<($212>>>0);
|
|
if ($213) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$214 = ((($177)) + 16|0);
|
|
$215 = HEAP32[$214>>2]|0;
|
|
$not$1$i = ($215|0)!=($$0192$lcssa$i|0);
|
|
$$sink2$i = $not$1$i&1;
|
|
$216 = (((($177)) + 16|0) + ($$sink2$i<<2)|0);
|
|
HEAP32[$216>>2] = $$3$i;
|
|
$217 = ($$3$i|0)==(0|0);
|
|
if ($217) {
|
|
break L85;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$218 = HEAP32[(35468)>>2]|0;
|
|
$219 = ($$3$i>>>0)<($218>>>0);
|
|
if ($219) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$220 = ((($$3$i)) + 24|0);
|
|
HEAP32[$220>>2] = $177;
|
|
$221 = ((($$0192$lcssa$i)) + 16|0);
|
|
$222 = HEAP32[$221>>2]|0;
|
|
$223 = ($222|0)==(0|0);
|
|
do {
|
|
if (!($223)) {
|
|
$224 = ($222>>>0)<($218>>>0);
|
|
if ($224) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$225 = ((($$3$i)) + 16|0);
|
|
HEAP32[$225>>2] = $222;
|
|
$226 = ((($222)) + 24|0);
|
|
HEAP32[$226>>2] = $$3$i;
|
|
break;
|
|
}
|
|
}
|
|
} while(0);
|
|
$227 = ((($$0192$lcssa$i)) + 20|0);
|
|
$228 = HEAP32[$227>>2]|0;
|
|
$229 = ($228|0)==(0|0);
|
|
if (!($229)) {
|
|
$230 = HEAP32[(35468)>>2]|0;
|
|
$231 = ($228>>>0)<($230>>>0);
|
|
if ($231) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$232 = ((($$3$i)) + 20|0);
|
|
HEAP32[$232>>2] = $228;
|
|
$233 = ((($228)) + 24|0);
|
|
HEAP32[$233>>2] = $$3$i;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$234 = ($$0193$lcssa$i>>>0)<(16);
|
|
if ($234) {
|
|
$235 = (($$0193$lcssa$i) + ($23))|0;
|
|
$236 = $235 | 3;
|
|
$237 = ((($$0192$lcssa$i)) + 4|0);
|
|
HEAP32[$237>>2] = $236;
|
|
$238 = (($$0192$lcssa$i) + ($235)|0);
|
|
$239 = ((($238)) + 4|0);
|
|
$240 = HEAP32[$239>>2]|0;
|
|
$241 = $240 | 1;
|
|
HEAP32[$239>>2] = $241;
|
|
} else {
|
|
$242 = $23 | 3;
|
|
$243 = ((($$0192$lcssa$i)) + 4|0);
|
|
HEAP32[$243>>2] = $242;
|
|
$244 = $$0193$lcssa$i | 1;
|
|
$245 = ((($174)) + 4|0);
|
|
HEAP32[$245>>2] = $244;
|
|
$246 = (($174) + ($$0193$lcssa$i)|0);
|
|
HEAP32[$246>>2] = $$0193$lcssa$i;
|
|
$247 = ($54|0)==(0);
|
|
if (!($247)) {
|
|
$248 = HEAP32[(35472)>>2]|0;
|
|
$249 = $54 >>> 3;
|
|
$250 = $249 << 1;
|
|
$251 = (35492 + ($250<<2)|0);
|
|
$252 = 1 << $249;
|
|
$253 = $25 & $252;
|
|
$254 = ($253|0)==(0);
|
|
if ($254) {
|
|
$255 = $25 | $252;
|
|
HEAP32[8863] = $255;
|
|
$$pre$i = ((($251)) + 8|0);
|
|
$$0189$i = $251;$$pre$phi$iZ2D = $$pre$i;
|
|
} else {
|
|
$256 = ((($251)) + 8|0);
|
|
$257 = HEAP32[$256>>2]|0;
|
|
$258 = HEAP32[(35468)>>2]|0;
|
|
$259 = ($257>>>0)<($258>>>0);
|
|
if ($259) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$$0189$i = $257;$$pre$phi$iZ2D = $256;
|
|
}
|
|
}
|
|
HEAP32[$$pre$phi$iZ2D>>2] = $248;
|
|
$260 = ((($$0189$i)) + 12|0);
|
|
HEAP32[$260>>2] = $248;
|
|
$261 = ((($248)) + 8|0);
|
|
HEAP32[$261>>2] = $$0189$i;
|
|
$262 = ((($248)) + 12|0);
|
|
HEAP32[$262>>2] = $251;
|
|
}
|
|
HEAP32[(35460)>>2] = $$0193$lcssa$i;
|
|
HEAP32[(35472)>>2] = $174;
|
|
}
|
|
$263 = ((($$0192$lcssa$i)) + 8|0);
|
|
$$2 = $263;
|
|
}
|
|
} else {
|
|
$$0198 = $23;
|
|
label = 153;
|
|
}
|
|
} else {
|
|
$264 = ($0>>>0)>(4294967231);
|
|
if ($264) {
|
|
$$0198 = -1;
|
|
label = 153;
|
|
} else {
|
|
$265 = (($0) + 11)|0;
|
|
$266 = $265 & -8;
|
|
$267 = HEAP32[(35456)>>2]|0;
|
|
$268 = ($267|0)==(0);
|
|
if ($268) {
|
|
$$0198 = $266;
|
|
label = 153;
|
|
} else {
|
|
$269 = (0 - ($266))|0;
|
|
$270 = $265 >>> 8;
|
|
$271 = ($270|0)==(0);
|
|
if ($271) {
|
|
$$0358$i = 0;
|
|
} else {
|
|
$272 = ($266>>>0)>(16777215);
|
|
if ($272) {
|
|
$$0358$i = 31;
|
|
} else {
|
|
$273 = (($270) + 1048320)|0;
|
|
$274 = $273 >>> 16;
|
|
$275 = $274 & 8;
|
|
$276 = $270 << $275;
|
|
$277 = (($276) + 520192)|0;
|
|
$278 = $277 >>> 16;
|
|
$279 = $278 & 4;
|
|
$280 = $279 | $275;
|
|
$281 = $276 << $279;
|
|
$282 = (($281) + 245760)|0;
|
|
$283 = $282 >>> 16;
|
|
$284 = $283 & 2;
|
|
$285 = $280 | $284;
|
|
$286 = (14 - ($285))|0;
|
|
$287 = $281 << $284;
|
|
$288 = $287 >>> 15;
|
|
$289 = (($286) + ($288))|0;
|
|
$290 = $289 << 1;
|
|
$291 = (($289) + 7)|0;
|
|
$292 = $266 >>> $291;
|
|
$293 = $292 & 1;
|
|
$294 = $293 | $290;
|
|
$$0358$i = $294;
|
|
}
|
|
}
|
|
$295 = (35756 + ($$0358$i<<2)|0);
|
|
$296 = HEAP32[$295>>2]|0;
|
|
$297 = ($296|0)==(0|0);
|
|
L128: do {
|
|
if ($297) {
|
|
$$2355$i = 0;$$3$i202 = 0;$$3350$i = $269;
|
|
label = 90;
|
|
} else {
|
|
$298 = ($$0358$i|0)==(31);
|
|
$299 = $$0358$i >>> 1;
|
|
$300 = (25 - ($299))|0;
|
|
$301 = $298 ? 0 : $300;
|
|
$302 = $266 << $301;
|
|
$$0342$i = 0;$$0347$i = $269;$$0353$i = $296;$$0359$i = $302;$$0362$i = 0;
|
|
while(1) {
|
|
$303 = ((($$0353$i)) + 4|0);
|
|
$304 = HEAP32[$303>>2]|0;
|
|
$305 = $304 & -8;
|
|
$306 = (($305) - ($266))|0;
|
|
$307 = ($306>>>0)<($$0347$i>>>0);
|
|
if ($307) {
|
|
$308 = ($306|0)==(0);
|
|
if ($308) {
|
|
$$415$i = $$0353$i;$$435114$i = 0;$$435713$i = $$0353$i;
|
|
label = 94;
|
|
break L128;
|
|
} else {
|
|
$$1343$i = $$0353$i;$$1348$i = $306;
|
|
}
|
|
} else {
|
|
$$1343$i = $$0342$i;$$1348$i = $$0347$i;
|
|
}
|
|
$309 = ((($$0353$i)) + 20|0);
|
|
$310 = HEAP32[$309>>2]|0;
|
|
$311 = $$0359$i >>> 31;
|
|
$312 = (((($$0353$i)) + 16|0) + ($311<<2)|0);
|
|
$313 = HEAP32[$312>>2]|0;
|
|
$314 = ($310|0)==(0|0);
|
|
$315 = ($310|0)==($313|0);
|
|
$or$cond2$i = $314 | $315;
|
|
$$1363$i = $or$cond2$i ? $$0362$i : $310;
|
|
$316 = ($313|0)==(0|0);
|
|
$not$8$i = $316 ^ 1;
|
|
$317 = $not$8$i&1;
|
|
$$0359$$i = $$0359$i << $317;
|
|
if ($316) {
|
|
$$2355$i = $$1363$i;$$3$i202 = $$1343$i;$$3350$i = $$1348$i;
|
|
label = 90;
|
|
break;
|
|
} else {
|
|
$$0342$i = $$1343$i;$$0347$i = $$1348$i;$$0353$i = $313;$$0359$i = $$0359$$i;$$0362$i = $$1363$i;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
if ((label|0) == 90) {
|
|
$318 = ($$2355$i|0)==(0|0);
|
|
$319 = ($$3$i202|0)==(0|0);
|
|
$or$cond$i = $318 & $319;
|
|
if ($or$cond$i) {
|
|
$320 = 2 << $$0358$i;
|
|
$321 = (0 - ($320))|0;
|
|
$322 = $320 | $321;
|
|
$323 = $267 & $322;
|
|
$324 = ($323|0)==(0);
|
|
if ($324) {
|
|
$$0198 = $266;
|
|
label = 153;
|
|
break;
|
|
}
|
|
$325 = (0 - ($323))|0;
|
|
$326 = $323 & $325;
|
|
$327 = (($326) + -1)|0;
|
|
$328 = $327 >>> 12;
|
|
$329 = $328 & 16;
|
|
$330 = $327 >>> $329;
|
|
$331 = $330 >>> 5;
|
|
$332 = $331 & 8;
|
|
$333 = $332 | $329;
|
|
$334 = $330 >>> $332;
|
|
$335 = $334 >>> 2;
|
|
$336 = $335 & 4;
|
|
$337 = $333 | $336;
|
|
$338 = $334 >>> $336;
|
|
$339 = $338 >>> 1;
|
|
$340 = $339 & 2;
|
|
$341 = $337 | $340;
|
|
$342 = $338 >>> $340;
|
|
$343 = $342 >>> 1;
|
|
$344 = $343 & 1;
|
|
$345 = $341 | $344;
|
|
$346 = $342 >>> $344;
|
|
$347 = (($345) + ($346))|0;
|
|
$348 = (35756 + ($347<<2)|0);
|
|
$349 = HEAP32[$348>>2]|0;
|
|
$$4$ph$i = 0;$$4357$ph$i = $349;
|
|
} else {
|
|
$$4$ph$i = $$3$i202;$$4357$ph$i = $$2355$i;
|
|
}
|
|
$350 = ($$4357$ph$i|0)==(0|0);
|
|
if ($350) {
|
|
$$4$lcssa$i = $$4$ph$i;$$4351$lcssa$i = $$3350$i;
|
|
} else {
|
|
$$415$i = $$4$ph$i;$$435114$i = $$3350$i;$$435713$i = $$4357$ph$i;
|
|
label = 94;
|
|
}
|
|
}
|
|
if ((label|0) == 94) {
|
|
while(1) {
|
|
label = 0;
|
|
$351 = ((($$435713$i)) + 4|0);
|
|
$352 = HEAP32[$351>>2]|0;
|
|
$353 = $352 & -8;
|
|
$354 = (($353) - ($266))|0;
|
|
$355 = ($354>>>0)<($$435114$i>>>0);
|
|
$$$4351$i = $355 ? $354 : $$435114$i;
|
|
$$4357$$4$i = $355 ? $$435713$i : $$415$i;
|
|
$356 = ((($$435713$i)) + 16|0);
|
|
$357 = HEAP32[$356>>2]|0;
|
|
$not$1$i204 = ($357|0)==(0|0);
|
|
$$sink2$i205 = $not$1$i204&1;
|
|
$358 = (((($$435713$i)) + 16|0) + ($$sink2$i205<<2)|0);
|
|
$359 = HEAP32[$358>>2]|0;
|
|
$360 = ($359|0)==(0|0);
|
|
if ($360) {
|
|
$$4$lcssa$i = $$4357$$4$i;$$4351$lcssa$i = $$$4351$i;
|
|
break;
|
|
} else {
|
|
$$415$i = $$4357$$4$i;$$435114$i = $$$4351$i;$$435713$i = $359;
|
|
label = 94;
|
|
}
|
|
}
|
|
}
|
|
$361 = ($$4$lcssa$i|0)==(0|0);
|
|
if ($361) {
|
|
$$0198 = $266;
|
|
label = 153;
|
|
} else {
|
|
$362 = HEAP32[(35460)>>2]|0;
|
|
$363 = (($362) - ($266))|0;
|
|
$364 = ($$4351$lcssa$i>>>0)<($363>>>0);
|
|
if ($364) {
|
|
$365 = HEAP32[(35468)>>2]|0;
|
|
$366 = ($$4$lcssa$i>>>0)<($365>>>0);
|
|
if ($366) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$367 = (($$4$lcssa$i) + ($266)|0);
|
|
$368 = ($$4$lcssa$i>>>0)<($367>>>0);
|
|
if (!($368)) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$369 = ((($$4$lcssa$i)) + 24|0);
|
|
$370 = HEAP32[$369>>2]|0;
|
|
$371 = ((($$4$lcssa$i)) + 12|0);
|
|
$372 = HEAP32[$371>>2]|0;
|
|
$373 = ($372|0)==($$4$lcssa$i|0);
|
|
do {
|
|
if ($373) {
|
|
$383 = ((($$4$lcssa$i)) + 20|0);
|
|
$384 = HEAP32[$383>>2]|0;
|
|
$385 = ($384|0)==(0|0);
|
|
if ($385) {
|
|
$386 = ((($$4$lcssa$i)) + 16|0);
|
|
$387 = HEAP32[$386>>2]|0;
|
|
$388 = ($387|0)==(0|0);
|
|
if ($388) {
|
|
$$3372$i = 0;
|
|
break;
|
|
} else {
|
|
$$1370$i = $387;$$1374$i = $386;
|
|
}
|
|
} else {
|
|
$$1370$i = $384;$$1374$i = $383;
|
|
}
|
|
while(1) {
|
|
$389 = ((($$1370$i)) + 20|0);
|
|
$390 = HEAP32[$389>>2]|0;
|
|
$391 = ($390|0)==(0|0);
|
|
if (!($391)) {
|
|
$$1370$i = $390;$$1374$i = $389;
|
|
continue;
|
|
}
|
|
$392 = ((($$1370$i)) + 16|0);
|
|
$393 = HEAP32[$392>>2]|0;
|
|
$394 = ($393|0)==(0|0);
|
|
if ($394) {
|
|
break;
|
|
} else {
|
|
$$1370$i = $393;$$1374$i = $392;
|
|
}
|
|
}
|
|
$395 = ($$1374$i>>>0)<($365>>>0);
|
|
if ($395) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
HEAP32[$$1374$i>>2] = 0;
|
|
$$3372$i = $$1370$i;
|
|
break;
|
|
}
|
|
} else {
|
|
$374 = ((($$4$lcssa$i)) + 8|0);
|
|
$375 = HEAP32[$374>>2]|0;
|
|
$376 = ($375>>>0)<($365>>>0);
|
|
if ($376) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$377 = ((($375)) + 12|0);
|
|
$378 = HEAP32[$377>>2]|0;
|
|
$379 = ($378|0)==($$4$lcssa$i|0);
|
|
if (!($379)) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$380 = ((($372)) + 8|0);
|
|
$381 = HEAP32[$380>>2]|0;
|
|
$382 = ($381|0)==($$4$lcssa$i|0);
|
|
if ($382) {
|
|
HEAP32[$377>>2] = $372;
|
|
HEAP32[$380>>2] = $375;
|
|
$$3372$i = $372;
|
|
break;
|
|
} else {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
}
|
|
} while(0);
|
|
$396 = ($370|0)==(0|0);
|
|
L175: do {
|
|
if ($396) {
|
|
$487 = $267;
|
|
} else {
|
|
$397 = ((($$4$lcssa$i)) + 28|0);
|
|
$398 = HEAP32[$397>>2]|0;
|
|
$399 = (35756 + ($398<<2)|0);
|
|
$400 = HEAP32[$399>>2]|0;
|
|
$401 = ($$4$lcssa$i|0)==($400|0);
|
|
do {
|
|
if ($401) {
|
|
HEAP32[$399>>2] = $$3372$i;
|
|
$cond$i209 = ($$3372$i|0)==(0|0);
|
|
if ($cond$i209) {
|
|
$402 = 1 << $398;
|
|
$403 = $402 ^ -1;
|
|
$404 = $267 & $403;
|
|
HEAP32[(35456)>>2] = $404;
|
|
$487 = $404;
|
|
break L175;
|
|
}
|
|
} else {
|
|
$405 = HEAP32[(35468)>>2]|0;
|
|
$406 = ($370>>>0)<($405>>>0);
|
|
if ($406) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$407 = ((($370)) + 16|0);
|
|
$408 = HEAP32[$407>>2]|0;
|
|
$not$$i210 = ($408|0)!=($$4$lcssa$i|0);
|
|
$$sink3$i = $not$$i210&1;
|
|
$409 = (((($370)) + 16|0) + ($$sink3$i<<2)|0);
|
|
HEAP32[$409>>2] = $$3372$i;
|
|
$410 = ($$3372$i|0)==(0|0);
|
|
if ($410) {
|
|
$487 = $267;
|
|
break L175;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$411 = HEAP32[(35468)>>2]|0;
|
|
$412 = ($$3372$i>>>0)<($411>>>0);
|
|
if ($412) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$413 = ((($$3372$i)) + 24|0);
|
|
HEAP32[$413>>2] = $370;
|
|
$414 = ((($$4$lcssa$i)) + 16|0);
|
|
$415 = HEAP32[$414>>2]|0;
|
|
$416 = ($415|0)==(0|0);
|
|
do {
|
|
if (!($416)) {
|
|
$417 = ($415>>>0)<($411>>>0);
|
|
if ($417) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$418 = ((($$3372$i)) + 16|0);
|
|
HEAP32[$418>>2] = $415;
|
|
$419 = ((($415)) + 24|0);
|
|
HEAP32[$419>>2] = $$3372$i;
|
|
break;
|
|
}
|
|
}
|
|
} while(0);
|
|
$420 = ((($$4$lcssa$i)) + 20|0);
|
|
$421 = HEAP32[$420>>2]|0;
|
|
$422 = ($421|0)==(0|0);
|
|
if ($422) {
|
|
$487 = $267;
|
|
} else {
|
|
$423 = HEAP32[(35468)>>2]|0;
|
|
$424 = ($421>>>0)<($423>>>0);
|
|
if ($424) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$425 = ((($$3372$i)) + 20|0);
|
|
HEAP32[$425>>2] = $421;
|
|
$426 = ((($421)) + 24|0);
|
|
HEAP32[$426>>2] = $$3372$i;
|
|
$487 = $267;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$427 = ($$4351$lcssa$i>>>0)<(16);
|
|
do {
|
|
if ($427) {
|
|
$428 = (($$4351$lcssa$i) + ($266))|0;
|
|
$429 = $428 | 3;
|
|
$430 = ((($$4$lcssa$i)) + 4|0);
|
|
HEAP32[$430>>2] = $429;
|
|
$431 = (($$4$lcssa$i) + ($428)|0);
|
|
$432 = ((($431)) + 4|0);
|
|
$433 = HEAP32[$432>>2]|0;
|
|
$434 = $433 | 1;
|
|
HEAP32[$432>>2] = $434;
|
|
} else {
|
|
$435 = $266 | 3;
|
|
$436 = ((($$4$lcssa$i)) + 4|0);
|
|
HEAP32[$436>>2] = $435;
|
|
$437 = $$4351$lcssa$i | 1;
|
|
$438 = ((($367)) + 4|0);
|
|
HEAP32[$438>>2] = $437;
|
|
$439 = (($367) + ($$4351$lcssa$i)|0);
|
|
HEAP32[$439>>2] = $$4351$lcssa$i;
|
|
$440 = $$4351$lcssa$i >>> 3;
|
|
$441 = ($$4351$lcssa$i>>>0)<(256);
|
|
if ($441) {
|
|
$442 = $440 << 1;
|
|
$443 = (35492 + ($442<<2)|0);
|
|
$444 = HEAP32[8863]|0;
|
|
$445 = 1 << $440;
|
|
$446 = $444 & $445;
|
|
$447 = ($446|0)==(0);
|
|
do {
|
|
if ($447) {
|
|
$448 = $444 | $445;
|
|
HEAP32[8863] = $448;
|
|
$$pre$i211 = ((($443)) + 8|0);
|
|
$$0368$i = $443;$$pre$phi$i212Z2D = $$pre$i211;
|
|
} else {
|
|
$449 = ((($443)) + 8|0);
|
|
$450 = HEAP32[$449>>2]|0;
|
|
$451 = HEAP32[(35468)>>2]|0;
|
|
$452 = ($450>>>0)<($451>>>0);
|
|
if (!($452)) {
|
|
$$0368$i = $450;$$pre$phi$i212Z2D = $449;
|
|
break;
|
|
}
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
} while(0);
|
|
HEAP32[$$pre$phi$i212Z2D>>2] = $367;
|
|
$453 = ((($$0368$i)) + 12|0);
|
|
HEAP32[$453>>2] = $367;
|
|
$454 = ((($367)) + 8|0);
|
|
HEAP32[$454>>2] = $$0368$i;
|
|
$455 = ((($367)) + 12|0);
|
|
HEAP32[$455>>2] = $443;
|
|
break;
|
|
}
|
|
$456 = $$4351$lcssa$i >>> 8;
|
|
$457 = ($456|0)==(0);
|
|
if ($457) {
|
|
$$0361$i = 0;
|
|
} else {
|
|
$458 = ($$4351$lcssa$i>>>0)>(16777215);
|
|
if ($458) {
|
|
$$0361$i = 31;
|
|
} else {
|
|
$459 = (($456) + 1048320)|0;
|
|
$460 = $459 >>> 16;
|
|
$461 = $460 & 8;
|
|
$462 = $456 << $461;
|
|
$463 = (($462) + 520192)|0;
|
|
$464 = $463 >>> 16;
|
|
$465 = $464 & 4;
|
|
$466 = $465 | $461;
|
|
$467 = $462 << $465;
|
|
$468 = (($467) + 245760)|0;
|
|
$469 = $468 >>> 16;
|
|
$470 = $469 & 2;
|
|
$471 = $466 | $470;
|
|
$472 = (14 - ($471))|0;
|
|
$473 = $467 << $470;
|
|
$474 = $473 >>> 15;
|
|
$475 = (($472) + ($474))|0;
|
|
$476 = $475 << 1;
|
|
$477 = (($475) + 7)|0;
|
|
$478 = $$4351$lcssa$i >>> $477;
|
|
$479 = $478 & 1;
|
|
$480 = $479 | $476;
|
|
$$0361$i = $480;
|
|
}
|
|
}
|
|
$481 = (35756 + ($$0361$i<<2)|0);
|
|
$482 = ((($367)) + 28|0);
|
|
HEAP32[$482>>2] = $$0361$i;
|
|
$483 = ((($367)) + 16|0);
|
|
$484 = ((($483)) + 4|0);
|
|
HEAP32[$484>>2] = 0;
|
|
HEAP32[$483>>2] = 0;
|
|
$485 = 1 << $$0361$i;
|
|
$486 = $487 & $485;
|
|
$488 = ($486|0)==(0);
|
|
if ($488) {
|
|
$489 = $487 | $485;
|
|
HEAP32[(35456)>>2] = $489;
|
|
HEAP32[$481>>2] = $367;
|
|
$490 = ((($367)) + 24|0);
|
|
HEAP32[$490>>2] = $481;
|
|
$491 = ((($367)) + 12|0);
|
|
HEAP32[$491>>2] = $367;
|
|
$492 = ((($367)) + 8|0);
|
|
HEAP32[$492>>2] = $367;
|
|
break;
|
|
}
|
|
$493 = HEAP32[$481>>2]|0;
|
|
$494 = ($$0361$i|0)==(31);
|
|
$495 = $$0361$i >>> 1;
|
|
$496 = (25 - ($495))|0;
|
|
$497 = $494 ? 0 : $496;
|
|
$498 = $$4351$lcssa$i << $497;
|
|
$$0344$i = $498;$$0345$i = $493;
|
|
while(1) {
|
|
$499 = ((($$0345$i)) + 4|0);
|
|
$500 = HEAP32[$499>>2]|0;
|
|
$501 = $500 & -8;
|
|
$502 = ($501|0)==($$4351$lcssa$i|0);
|
|
if ($502) {
|
|
label = 148;
|
|
break;
|
|
}
|
|
$503 = $$0344$i >>> 31;
|
|
$504 = (((($$0345$i)) + 16|0) + ($503<<2)|0);
|
|
$505 = $$0344$i << 1;
|
|
$506 = HEAP32[$504>>2]|0;
|
|
$507 = ($506|0)==(0|0);
|
|
if ($507) {
|
|
label = 145;
|
|
break;
|
|
} else {
|
|
$$0344$i = $505;$$0345$i = $506;
|
|
}
|
|
}
|
|
if ((label|0) == 145) {
|
|
$508 = HEAP32[(35468)>>2]|0;
|
|
$509 = ($504>>>0)<($508>>>0);
|
|
if ($509) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
HEAP32[$504>>2] = $367;
|
|
$510 = ((($367)) + 24|0);
|
|
HEAP32[$510>>2] = $$0345$i;
|
|
$511 = ((($367)) + 12|0);
|
|
HEAP32[$511>>2] = $367;
|
|
$512 = ((($367)) + 8|0);
|
|
HEAP32[$512>>2] = $367;
|
|
break;
|
|
}
|
|
}
|
|
else if ((label|0) == 148) {
|
|
$513 = ((($$0345$i)) + 8|0);
|
|
$514 = HEAP32[$513>>2]|0;
|
|
$515 = HEAP32[(35468)>>2]|0;
|
|
$516 = ($514>>>0)>=($515>>>0);
|
|
$not$9$i = ($$0345$i>>>0)>=($515>>>0);
|
|
$517 = $516 & $not$9$i;
|
|
if ($517) {
|
|
$518 = ((($514)) + 12|0);
|
|
HEAP32[$518>>2] = $367;
|
|
HEAP32[$513>>2] = $367;
|
|
$519 = ((($367)) + 8|0);
|
|
HEAP32[$519>>2] = $514;
|
|
$520 = ((($367)) + 12|0);
|
|
HEAP32[$520>>2] = $$0345$i;
|
|
$521 = ((($367)) + 24|0);
|
|
HEAP32[$521>>2] = 0;
|
|
break;
|
|
} else {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$522 = ((($$4$lcssa$i)) + 8|0);
|
|
$$2 = $522;
|
|
} else {
|
|
$$0198 = $266;
|
|
label = 153;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
L230: do {
|
|
if ((label|0) == 153) {
|
|
$523 = HEAP32[(35460)>>2]|0;
|
|
$524 = ($523>>>0)<($$0198>>>0);
|
|
if (!($524)) {
|
|
$525 = (($523) - ($$0198))|0;
|
|
$526 = HEAP32[(35472)>>2]|0;
|
|
$527 = ($525>>>0)>(15);
|
|
if ($527) {
|
|
$528 = (($526) + ($$0198)|0);
|
|
HEAP32[(35472)>>2] = $528;
|
|
HEAP32[(35460)>>2] = $525;
|
|
$529 = $525 | 1;
|
|
$530 = ((($528)) + 4|0);
|
|
HEAP32[$530>>2] = $529;
|
|
$531 = (($528) + ($525)|0);
|
|
HEAP32[$531>>2] = $525;
|
|
$532 = $$0198 | 3;
|
|
$533 = ((($526)) + 4|0);
|
|
HEAP32[$533>>2] = $532;
|
|
} else {
|
|
HEAP32[(35460)>>2] = 0;
|
|
HEAP32[(35472)>>2] = 0;
|
|
$534 = $523 | 3;
|
|
$535 = ((($526)) + 4|0);
|
|
HEAP32[$535>>2] = $534;
|
|
$536 = (($526) + ($523)|0);
|
|
$537 = ((($536)) + 4|0);
|
|
$538 = HEAP32[$537>>2]|0;
|
|
$539 = $538 | 1;
|
|
HEAP32[$537>>2] = $539;
|
|
}
|
|
$540 = ((($526)) + 8|0);
|
|
$$2 = $540;
|
|
break;
|
|
}
|
|
$541 = HEAP32[(35464)>>2]|0;
|
|
$542 = ($541>>>0)>($$0198>>>0);
|
|
if ($542) {
|
|
$543 = (($541) - ($$0198))|0;
|
|
HEAP32[(35464)>>2] = $543;
|
|
$544 = HEAP32[(35476)>>2]|0;
|
|
$545 = (($544) + ($$0198)|0);
|
|
HEAP32[(35476)>>2] = $545;
|
|
$546 = $543 | 1;
|
|
$547 = ((($545)) + 4|0);
|
|
HEAP32[$547>>2] = $546;
|
|
$548 = $$0198 | 3;
|
|
$549 = ((($544)) + 4|0);
|
|
HEAP32[$549>>2] = $548;
|
|
$550 = ((($544)) + 8|0);
|
|
$$2 = $550;
|
|
break;
|
|
}
|
|
$551 = HEAP32[8850]|0;
|
|
$552 = ($551|0)==(0);
|
|
if ($552) {
|
|
(___pthread_mutex_lock(35424)|0);
|
|
$553 = HEAP32[8850]|0;
|
|
$554 = ($553|0)==(0);
|
|
if ($554) {
|
|
HEAP32[(35408)>>2] = 4096;
|
|
HEAP32[(35404)>>2] = 4096;
|
|
HEAP32[(35412)>>2] = -1;
|
|
HEAP32[(35416)>>2] = -1;
|
|
HEAP32[(35420)>>2] = 2;
|
|
HEAP32[(35896)>>2] = 2;
|
|
$555 = (_pthread_mutexattr_init($1)|0);
|
|
$556 = ($555|0)==(0);
|
|
if ($556) {
|
|
$557 = (_pthread_mutex_init((35900),$1)|0);
|
|
$558 = ($557|0)==(0);
|
|
if ($558) {
|
|
}
|
|
}
|
|
$559 = $2;
|
|
$560 = $559 & -16;
|
|
$561 = $560 ^ 1431655768;
|
|
HEAP32[$2>>2] = $561;
|
|
Atomics_store(HEAP32,8850,$561)|0;
|
|
}
|
|
(___pthread_mutex_unlock(35424)|0);
|
|
}
|
|
$562 = (($$0198) + 48)|0;
|
|
$563 = HEAP32[(35408)>>2]|0;
|
|
$564 = (($$0198) + 47)|0;
|
|
$565 = (($563) + ($564))|0;
|
|
$566 = (0 - ($563))|0;
|
|
$567 = $565 & $566;
|
|
$568 = ($567>>>0)>($$0198>>>0);
|
|
if ($568) {
|
|
$569 = HEAP32[(35892)>>2]|0;
|
|
$570 = ($569|0)==(0);
|
|
if (!($570)) {
|
|
$571 = HEAP32[(35884)>>2]|0;
|
|
$572 = (($571) + ($567))|0;
|
|
$573 = ($572>>>0)<=($571>>>0);
|
|
$574 = ($572>>>0)>($569>>>0);
|
|
$or$cond1$i = $573 | $574;
|
|
if ($or$cond1$i) {
|
|
$$2 = 0;
|
|
break;
|
|
}
|
|
}
|
|
$575 = HEAP32[(35896)>>2]|0;
|
|
$576 = $575 & 4;
|
|
$577 = ($576|0)==(0);
|
|
if ($577) {
|
|
$578 = HEAP32[(35476)>>2]|0;
|
|
$579 = ($578|0)==(0|0);
|
|
L258: do {
|
|
if ($579) {
|
|
label = 176;
|
|
} else {
|
|
$$0$i$i = (35928);
|
|
while(1) {
|
|
$580 = HEAP32[$$0$i$i>>2]|0;
|
|
$581 = ($580>>>0)>($578>>>0);
|
|
if (!($581)) {
|
|
$582 = ((($$0$i$i)) + 4|0);
|
|
$583 = HEAP32[$582>>2]|0;
|
|
$584 = (($580) + ($583)|0);
|
|
$585 = ($584>>>0)>($578>>>0);
|
|
if ($585) {
|
|
break;
|
|
}
|
|
}
|
|
$586 = ((($$0$i$i)) + 8|0);
|
|
$587 = HEAP32[$586>>2]|0;
|
|
$588 = ($587|0)==(0|0);
|
|
if ($588) {
|
|
label = 176;
|
|
break L258;
|
|
} else {
|
|
$$0$i$i = $587;
|
|
}
|
|
}
|
|
(___pthread_mutex_lock(35424)|0);
|
|
$611 = HEAP32[(35464)>>2]|0;
|
|
$612 = HEAP32[(35408)>>2]|0;
|
|
$613 = (($564) - ($611))|0;
|
|
$614 = (($613) + ($612))|0;
|
|
$615 = (0 - ($612))|0;
|
|
$616 = $614 & $615;
|
|
$617 = ($616>>>0)<(2147483647);
|
|
if ($617) {
|
|
$618 = (_sbrk(($616|0))|0);
|
|
$619 = HEAP32[$$0$i$i>>2]|0;
|
|
$620 = HEAP32[$582>>2]|0;
|
|
$621 = (($619) + ($620)|0);
|
|
$622 = ($618|0)==($621|0);
|
|
if ($622) {
|
|
$623 = ($618|0)==((-1)|0);
|
|
if ($623) {
|
|
$$2234253237$i = $616;
|
|
label = 190;
|
|
} else {
|
|
$$3229$i = $618;$$3235$i = $616;
|
|
}
|
|
} else {
|
|
$$2247$ph$i = $618;$$2253$ph$i = $616;
|
|
label = 184;
|
|
}
|
|
} else {
|
|
$$2234253237$i = 0;
|
|
label = 190;
|
|
}
|
|
}
|
|
} while(0);
|
|
do {
|
|
if ((label|0) == 176) {
|
|
(___pthread_mutex_lock(35424)|0);
|
|
$589 = (_sbrk(0)|0);
|
|
$590 = ($589|0)==((-1)|0);
|
|
if ($590) {
|
|
$$2234253237$i = 0;
|
|
label = 190;
|
|
} else {
|
|
$591 = $589;
|
|
$592 = HEAP32[(35404)>>2]|0;
|
|
$593 = (($592) + -1)|0;
|
|
$594 = $593 & $591;
|
|
$595 = ($594|0)==(0);
|
|
$596 = (($593) + ($591))|0;
|
|
$597 = (0 - ($592))|0;
|
|
$598 = $596 & $597;
|
|
$599 = (($598) - ($591))|0;
|
|
$600 = $595 ? 0 : $599;
|
|
$$$i = (($600) + ($567))|0;
|
|
$601 = HEAP32[(35884)>>2]|0;
|
|
$602 = (($$$i) + ($601))|0;
|
|
$603 = ($$$i>>>0)>($$0198>>>0);
|
|
$604 = ($$$i>>>0)<(2147483647);
|
|
$or$cond$i213 = $603 & $604;
|
|
if ($or$cond$i213) {
|
|
$605 = HEAP32[(35892)>>2]|0;
|
|
$606 = ($605|0)==(0);
|
|
if (!($606)) {
|
|
$607 = ($602>>>0)<=($601>>>0);
|
|
$608 = ($602>>>0)>($605>>>0);
|
|
$or$cond2$i214 = $607 | $608;
|
|
if ($or$cond2$i214) {
|
|
$$2234253237$i = 0;
|
|
label = 190;
|
|
break;
|
|
}
|
|
}
|
|
$609 = (_sbrk(($$$i|0))|0);
|
|
$610 = ($609|0)==($589|0);
|
|
if ($610) {
|
|
$$3229$i = $589;$$3235$i = $$$i;
|
|
} else {
|
|
$$2247$ph$i = $609;$$2253$ph$i = $$$i;
|
|
label = 184;
|
|
}
|
|
} else {
|
|
$$2234253237$i = 0;
|
|
label = 190;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
do {
|
|
if ((label|0) == 184) {
|
|
$624 = (0 - ($$2253$ph$i))|0;
|
|
$625 = ($$2247$ph$i|0)!=((-1)|0);
|
|
$626 = ($$2253$ph$i>>>0)<(2147483647);
|
|
$or$cond7$i = $626 & $625;
|
|
$627 = ($562>>>0)>($$2253$ph$i>>>0);
|
|
$or$cond10$i = $627 & $or$cond7$i;
|
|
if (!($or$cond10$i)) {
|
|
$637 = ($$2247$ph$i|0)==((-1)|0);
|
|
if ($637) {
|
|
$$2234253237$i = 0;
|
|
label = 190;
|
|
break;
|
|
} else {
|
|
$$3229$i = $$2247$ph$i;$$3235$i = $$2253$ph$i;
|
|
break;
|
|
}
|
|
}
|
|
$628 = HEAP32[(35408)>>2]|0;
|
|
$629 = (($564) - ($$2253$ph$i))|0;
|
|
$630 = (($629) + ($628))|0;
|
|
$631 = (0 - ($628))|0;
|
|
$632 = $630 & $631;
|
|
$633 = ($632>>>0)<(2147483647);
|
|
if ($633) {
|
|
$634 = (_sbrk(($632|0))|0);
|
|
$635 = ($634|0)==((-1)|0);
|
|
if ($635) {
|
|
(_sbrk(($624|0))|0);
|
|
$$2234253237$i = 0;
|
|
label = 190;
|
|
break;
|
|
} else {
|
|
$636 = (($632) + ($$2253$ph$i))|0;
|
|
$$3229$i = $$2247$ph$i;$$3235$i = $636;
|
|
break;
|
|
}
|
|
} else {
|
|
$$3229$i = $$2247$ph$i;$$3235$i = $$2253$ph$i;
|
|
}
|
|
}
|
|
} while(0);
|
|
if ((label|0) == 190) {
|
|
$638 = HEAP32[(35896)>>2]|0;
|
|
$639 = $638 | 4;
|
|
HEAP32[(35896)>>2] = $639;
|
|
$$3229$i = (-1);$$3235$i = $$2234253237$i;
|
|
}
|
|
(___pthread_mutex_unlock(35424)|0);
|
|
$$4230$i = $$3229$i;$$4236$i = $$3235$i;
|
|
} else {
|
|
$$4230$i = (-1);$$4236$i = 0;
|
|
}
|
|
$640 = ($$4230$i|0)==((-1)|0);
|
|
$641 = ($567>>>0)<(2147483647);
|
|
$or$cond9$i = $641 & $640;
|
|
if ($or$cond9$i) {
|
|
(___pthread_mutex_lock(35424)|0);
|
|
$642 = (_sbrk(($567|0))|0);
|
|
$643 = (_sbrk(0)|0);
|
|
(___pthread_mutex_unlock(35424)|0);
|
|
$644 = ($642|0)!=((-1)|0);
|
|
$645 = ($643|0)!=((-1)|0);
|
|
$or$cond5$i = $644 & $645;
|
|
$646 = ($642>>>0)<($643>>>0);
|
|
$or$cond11$i = $646 & $or$cond5$i;
|
|
$647 = $643;
|
|
$648 = $642;
|
|
$649 = (($647) - ($648))|0;
|
|
$650 = (($$0198) + 40)|0;
|
|
$651 = ($649>>>0)>($650>>>0);
|
|
$$$4236$i = $651 ? $649 : $$4236$i;
|
|
$$$4230$i = $651 ? $642 : (-1);
|
|
if ($or$cond11$i) {
|
|
$$7$i = $$$4230$i;$$7239$i = $$$4236$i;
|
|
label = 194;
|
|
}
|
|
} else {
|
|
$$7$i = $$4230$i;$$7239$i = $$4236$i;
|
|
label = 194;
|
|
}
|
|
if ((label|0) == 194) {
|
|
$652 = ($$7$i|0)==((-1)|0);
|
|
if (!($652)) {
|
|
$653 = HEAP32[(35884)>>2]|0;
|
|
$654 = (($653) + ($$7239$i))|0;
|
|
HEAP32[(35884)>>2] = $654;
|
|
$655 = HEAP32[(35888)>>2]|0;
|
|
$656 = ($654>>>0)>($655>>>0);
|
|
if ($656) {
|
|
HEAP32[(35888)>>2] = $654;
|
|
}
|
|
$657 = HEAP32[(35476)>>2]|0;
|
|
$658 = ($657|0)==(0|0);
|
|
do {
|
|
if ($658) {
|
|
$659 = HEAP32[(35468)>>2]|0;
|
|
$660 = ($659|0)==(0|0);
|
|
$661 = ($$7$i>>>0)<($659>>>0);
|
|
$or$cond12$i = $660 | $661;
|
|
if ($or$cond12$i) {
|
|
HEAP32[(35468)>>2] = $$7$i;
|
|
}
|
|
HEAP32[(35928)>>2] = $$7$i;
|
|
HEAP32[(35932)>>2] = $$7239$i;
|
|
HEAP32[(35940)>>2] = 0;
|
|
$662 = HEAP32[8850]|0;
|
|
HEAP32[(35488)>>2] = $662;
|
|
HEAP32[(35484)>>2] = -1;
|
|
$$01$i$i = 0;
|
|
while(1) {
|
|
$663 = $$01$i$i << 1;
|
|
$664 = (35492 + ($663<<2)|0);
|
|
$665 = ((($664)) + 12|0);
|
|
HEAP32[$665>>2] = $664;
|
|
$666 = ((($664)) + 8|0);
|
|
HEAP32[$666>>2] = $664;
|
|
$667 = (($$01$i$i) + 1)|0;
|
|
$exitcond$i$i = ($667|0)==(32);
|
|
if ($exitcond$i$i) {
|
|
break;
|
|
} else {
|
|
$$01$i$i = $667;
|
|
}
|
|
}
|
|
$668 = (($$7239$i) + -40)|0;
|
|
$669 = ((($$7$i)) + 8|0);
|
|
$670 = $669;
|
|
$671 = $670 & 7;
|
|
$672 = ($671|0)==(0);
|
|
$673 = (0 - ($670))|0;
|
|
$674 = $673 & 7;
|
|
$675 = $672 ? 0 : $674;
|
|
$676 = (($$7$i) + ($675)|0);
|
|
$677 = (($668) - ($675))|0;
|
|
HEAP32[(35476)>>2] = $676;
|
|
HEAP32[(35464)>>2] = $677;
|
|
$678 = $677 | 1;
|
|
$679 = ((($676)) + 4|0);
|
|
HEAP32[$679>>2] = $678;
|
|
$680 = (($676) + ($677)|0);
|
|
$681 = ((($680)) + 4|0);
|
|
HEAP32[$681>>2] = 40;
|
|
$682 = HEAP32[(35416)>>2]|0;
|
|
HEAP32[(35480)>>2] = $682;
|
|
} else {
|
|
$$024363$i = (35928);
|
|
while(1) {
|
|
$683 = HEAP32[$$024363$i>>2]|0;
|
|
$684 = ((($$024363$i)) + 4|0);
|
|
$685 = HEAP32[$684>>2]|0;
|
|
$686 = (($683) + ($685)|0);
|
|
$687 = ($$7$i|0)==($686|0);
|
|
if ($687) {
|
|
label = 205;
|
|
break;
|
|
}
|
|
$688 = ((($$024363$i)) + 8|0);
|
|
$689 = HEAP32[$688>>2]|0;
|
|
$690 = ($689|0)==(0|0);
|
|
if ($690) {
|
|
break;
|
|
} else {
|
|
$$024363$i = $689;
|
|
}
|
|
}
|
|
if ((label|0) == 205) {
|
|
$691 = ((($$024363$i)) + 12|0);
|
|
$692 = HEAP32[$691>>2]|0;
|
|
$693 = $692 & 8;
|
|
$694 = ($693|0)==(0);
|
|
if ($694) {
|
|
$695 = ($657>>>0)>=($683>>>0);
|
|
$696 = ($657>>>0)<($$7$i>>>0);
|
|
$or$cond43$i = $696 & $695;
|
|
if ($or$cond43$i) {
|
|
$697 = (($685) + ($$7239$i))|0;
|
|
HEAP32[$684>>2] = $697;
|
|
$698 = HEAP32[(35464)>>2]|0;
|
|
$699 = ((($657)) + 8|0);
|
|
$700 = $699;
|
|
$701 = $700 & 7;
|
|
$702 = ($701|0)==(0);
|
|
$703 = (0 - ($700))|0;
|
|
$704 = $703 & 7;
|
|
$705 = $702 ? 0 : $704;
|
|
$706 = (($657) + ($705)|0);
|
|
$707 = (($$7239$i) - ($705))|0;
|
|
$708 = (($698) + ($707))|0;
|
|
HEAP32[(35476)>>2] = $706;
|
|
HEAP32[(35464)>>2] = $708;
|
|
$709 = $708 | 1;
|
|
$710 = ((($706)) + 4|0);
|
|
HEAP32[$710>>2] = $709;
|
|
$711 = (($706) + ($708)|0);
|
|
$712 = ((($711)) + 4|0);
|
|
HEAP32[$712>>2] = 40;
|
|
$713 = HEAP32[(35416)>>2]|0;
|
|
HEAP32[(35480)>>2] = $713;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
$714 = HEAP32[(35468)>>2]|0;
|
|
$715 = ($$7$i>>>0)<($714>>>0);
|
|
if ($715) {
|
|
HEAP32[(35468)>>2] = $$7$i;
|
|
$779 = $$7$i;
|
|
} else {
|
|
$779 = $714;
|
|
}
|
|
$716 = (($$7$i) + ($$7239$i)|0);
|
|
$$124462$i = (35928);
|
|
while(1) {
|
|
$717 = HEAP32[$$124462$i>>2]|0;
|
|
$718 = ($717|0)==($716|0);
|
|
if ($718) {
|
|
label = 213;
|
|
break;
|
|
}
|
|
$719 = ((($$124462$i)) + 8|0);
|
|
$720 = HEAP32[$719>>2]|0;
|
|
$721 = ($720|0)==(0|0);
|
|
if ($721) {
|
|
break;
|
|
} else {
|
|
$$124462$i = $720;
|
|
}
|
|
}
|
|
if ((label|0) == 213) {
|
|
$722 = ((($$124462$i)) + 12|0);
|
|
$723 = HEAP32[$722>>2]|0;
|
|
$724 = $723 & 8;
|
|
$725 = ($724|0)==(0);
|
|
if ($725) {
|
|
HEAP32[$$124462$i>>2] = $$7$i;
|
|
$726 = ((($$124462$i)) + 4|0);
|
|
$727 = HEAP32[$726>>2]|0;
|
|
$728 = (($727) + ($$7239$i))|0;
|
|
HEAP32[$726>>2] = $728;
|
|
$729 = ((($$7$i)) + 8|0);
|
|
$730 = $729;
|
|
$731 = $730 & 7;
|
|
$732 = ($731|0)==(0);
|
|
$733 = (0 - ($730))|0;
|
|
$734 = $733 & 7;
|
|
$735 = $732 ? 0 : $734;
|
|
$736 = (($$7$i) + ($735)|0);
|
|
$737 = ((($716)) + 8|0);
|
|
$738 = $737;
|
|
$739 = $738 & 7;
|
|
$740 = ($739|0)==(0);
|
|
$741 = (0 - ($738))|0;
|
|
$742 = $741 & 7;
|
|
$743 = $740 ? 0 : $742;
|
|
$744 = (($716) + ($743)|0);
|
|
$745 = $744;
|
|
$746 = $736;
|
|
$747 = (($745) - ($746))|0;
|
|
$748 = (($736) + ($$0198)|0);
|
|
$749 = (($747) - ($$0198))|0;
|
|
$750 = $$0198 | 3;
|
|
$751 = ((($736)) + 4|0);
|
|
HEAP32[$751>>2] = $750;
|
|
$752 = ($744|0)==($657|0);
|
|
do {
|
|
if ($752) {
|
|
$753 = HEAP32[(35464)>>2]|0;
|
|
$754 = (($753) + ($749))|0;
|
|
HEAP32[(35464)>>2] = $754;
|
|
HEAP32[(35476)>>2] = $748;
|
|
$755 = $754 | 1;
|
|
$756 = ((($748)) + 4|0);
|
|
HEAP32[$756>>2] = $755;
|
|
} else {
|
|
$757 = HEAP32[(35472)>>2]|0;
|
|
$758 = ($744|0)==($757|0);
|
|
if ($758) {
|
|
$759 = HEAP32[(35460)>>2]|0;
|
|
$760 = (($759) + ($749))|0;
|
|
HEAP32[(35460)>>2] = $760;
|
|
HEAP32[(35472)>>2] = $748;
|
|
$761 = $760 | 1;
|
|
$762 = ((($748)) + 4|0);
|
|
HEAP32[$762>>2] = $761;
|
|
$763 = (($748) + ($760)|0);
|
|
HEAP32[$763>>2] = $760;
|
|
break;
|
|
}
|
|
$764 = ((($744)) + 4|0);
|
|
$765 = HEAP32[$764>>2]|0;
|
|
$766 = $765 & 3;
|
|
$767 = ($766|0)==(1);
|
|
if ($767) {
|
|
$768 = $765 & -8;
|
|
$769 = $765 >>> 3;
|
|
$770 = ($765>>>0)<(256);
|
|
L329: do {
|
|
if ($770) {
|
|
$771 = ((($744)) + 8|0);
|
|
$772 = HEAP32[$771>>2]|0;
|
|
$773 = ((($744)) + 12|0);
|
|
$774 = HEAP32[$773>>2]|0;
|
|
$775 = $769 << 1;
|
|
$776 = (35492 + ($775<<2)|0);
|
|
$777 = ($772|0)==($776|0);
|
|
do {
|
|
if (!($777)) {
|
|
$778 = ($772>>>0)<($779>>>0);
|
|
if ($778) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$780 = ((($772)) + 12|0);
|
|
$781 = HEAP32[$780>>2]|0;
|
|
$782 = ($781|0)==($744|0);
|
|
if ($782) {
|
|
break;
|
|
}
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
} while(0);
|
|
$783 = ($774|0)==($772|0);
|
|
if ($783) {
|
|
$784 = 1 << $769;
|
|
$785 = $784 ^ -1;
|
|
$786 = HEAP32[8863]|0;
|
|
$787 = $786 & $785;
|
|
HEAP32[8863] = $787;
|
|
break;
|
|
}
|
|
$788 = ($774|0)==($776|0);
|
|
do {
|
|
if ($788) {
|
|
$$pre10$i$i = ((($774)) + 8|0);
|
|
$$pre$phi11$i$iZ2D = $$pre10$i$i;
|
|
} else {
|
|
$789 = ($774>>>0)<($779>>>0);
|
|
if ($789) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$790 = ((($774)) + 8|0);
|
|
$791 = HEAP32[$790>>2]|0;
|
|
$792 = ($791|0)==($744|0);
|
|
if ($792) {
|
|
$$pre$phi11$i$iZ2D = $790;
|
|
break;
|
|
}
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
} while(0);
|
|
$793 = ((($772)) + 12|0);
|
|
HEAP32[$793>>2] = $774;
|
|
HEAP32[$$pre$phi11$i$iZ2D>>2] = $772;
|
|
} else {
|
|
$794 = ((($744)) + 24|0);
|
|
$795 = HEAP32[$794>>2]|0;
|
|
$796 = ((($744)) + 12|0);
|
|
$797 = HEAP32[$796>>2]|0;
|
|
$798 = ($797|0)==($744|0);
|
|
do {
|
|
if ($798) {
|
|
$808 = ((($744)) + 16|0);
|
|
$809 = ((($808)) + 4|0);
|
|
$810 = HEAP32[$809>>2]|0;
|
|
$811 = ($810|0)==(0|0);
|
|
if ($811) {
|
|
$812 = HEAP32[$808>>2]|0;
|
|
$813 = ($812|0)==(0|0);
|
|
if ($813) {
|
|
$$3$i$i = 0;
|
|
break;
|
|
} else {
|
|
$$1291$i$i = $812;$$1293$i$i = $808;
|
|
}
|
|
} else {
|
|
$$1291$i$i = $810;$$1293$i$i = $809;
|
|
}
|
|
while(1) {
|
|
$814 = ((($$1291$i$i)) + 20|0);
|
|
$815 = HEAP32[$814>>2]|0;
|
|
$816 = ($815|0)==(0|0);
|
|
if (!($816)) {
|
|
$$1291$i$i = $815;$$1293$i$i = $814;
|
|
continue;
|
|
}
|
|
$817 = ((($$1291$i$i)) + 16|0);
|
|
$818 = HEAP32[$817>>2]|0;
|
|
$819 = ($818|0)==(0|0);
|
|
if ($819) {
|
|
break;
|
|
} else {
|
|
$$1291$i$i = $818;$$1293$i$i = $817;
|
|
}
|
|
}
|
|
$820 = ($$1293$i$i>>>0)<($779>>>0);
|
|
if ($820) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
HEAP32[$$1293$i$i>>2] = 0;
|
|
$$3$i$i = $$1291$i$i;
|
|
break;
|
|
}
|
|
} else {
|
|
$799 = ((($744)) + 8|0);
|
|
$800 = HEAP32[$799>>2]|0;
|
|
$801 = ($800>>>0)<($779>>>0);
|
|
if ($801) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$802 = ((($800)) + 12|0);
|
|
$803 = HEAP32[$802>>2]|0;
|
|
$804 = ($803|0)==($744|0);
|
|
if (!($804)) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$805 = ((($797)) + 8|0);
|
|
$806 = HEAP32[$805>>2]|0;
|
|
$807 = ($806|0)==($744|0);
|
|
if ($807) {
|
|
HEAP32[$802>>2] = $797;
|
|
HEAP32[$805>>2] = $800;
|
|
$$3$i$i = $797;
|
|
break;
|
|
} else {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
}
|
|
} while(0);
|
|
$821 = ($795|0)==(0|0);
|
|
if ($821) {
|
|
break;
|
|
}
|
|
$822 = ((($744)) + 28|0);
|
|
$823 = HEAP32[$822>>2]|0;
|
|
$824 = (35756 + ($823<<2)|0);
|
|
$825 = HEAP32[$824>>2]|0;
|
|
$826 = ($744|0)==($825|0);
|
|
do {
|
|
if ($826) {
|
|
HEAP32[$824>>2] = $$3$i$i;
|
|
$cond$i$i = ($$3$i$i|0)==(0|0);
|
|
if (!($cond$i$i)) {
|
|
break;
|
|
}
|
|
$827 = 1 << $823;
|
|
$828 = $827 ^ -1;
|
|
$829 = HEAP32[(35456)>>2]|0;
|
|
$830 = $829 & $828;
|
|
HEAP32[(35456)>>2] = $830;
|
|
break L329;
|
|
} else {
|
|
$831 = HEAP32[(35468)>>2]|0;
|
|
$832 = ($795>>>0)<($831>>>0);
|
|
if ($832) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$833 = ((($795)) + 16|0);
|
|
$834 = HEAP32[$833>>2]|0;
|
|
$not$$i$i = ($834|0)!=($744|0);
|
|
$$sink1$i$i = $not$$i$i&1;
|
|
$835 = (((($795)) + 16|0) + ($$sink1$i$i<<2)|0);
|
|
HEAP32[$835>>2] = $$3$i$i;
|
|
$836 = ($$3$i$i|0)==(0|0);
|
|
if ($836) {
|
|
break L329;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$837 = HEAP32[(35468)>>2]|0;
|
|
$838 = ($$3$i$i>>>0)<($837>>>0);
|
|
if ($838) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$839 = ((($$3$i$i)) + 24|0);
|
|
HEAP32[$839>>2] = $795;
|
|
$840 = ((($744)) + 16|0);
|
|
$841 = HEAP32[$840>>2]|0;
|
|
$842 = ($841|0)==(0|0);
|
|
do {
|
|
if (!($842)) {
|
|
$843 = ($841>>>0)<($837>>>0);
|
|
if ($843) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$844 = ((($$3$i$i)) + 16|0);
|
|
HEAP32[$844>>2] = $841;
|
|
$845 = ((($841)) + 24|0);
|
|
HEAP32[$845>>2] = $$3$i$i;
|
|
break;
|
|
}
|
|
}
|
|
} while(0);
|
|
$846 = ((($840)) + 4|0);
|
|
$847 = HEAP32[$846>>2]|0;
|
|
$848 = ($847|0)==(0|0);
|
|
if ($848) {
|
|
break;
|
|
}
|
|
$849 = HEAP32[(35468)>>2]|0;
|
|
$850 = ($847>>>0)<($849>>>0);
|
|
if ($850) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$851 = ((($$3$i$i)) + 20|0);
|
|
HEAP32[$851>>2] = $847;
|
|
$852 = ((($847)) + 24|0);
|
|
HEAP32[$852>>2] = $$3$i$i;
|
|
break;
|
|
}
|
|
}
|
|
} while(0);
|
|
$853 = (($744) + ($768)|0);
|
|
$854 = (($768) + ($749))|0;
|
|
$$0$i17$i = $853;$$0287$i$i = $854;
|
|
} else {
|
|
$$0$i17$i = $744;$$0287$i$i = $749;
|
|
}
|
|
$855 = ((($$0$i17$i)) + 4|0);
|
|
$856 = HEAP32[$855>>2]|0;
|
|
$857 = $856 & -2;
|
|
HEAP32[$855>>2] = $857;
|
|
$858 = $$0287$i$i | 1;
|
|
$859 = ((($748)) + 4|0);
|
|
HEAP32[$859>>2] = $858;
|
|
$860 = (($748) + ($$0287$i$i)|0);
|
|
HEAP32[$860>>2] = $$0287$i$i;
|
|
$861 = $$0287$i$i >>> 3;
|
|
$862 = ($$0287$i$i>>>0)<(256);
|
|
if ($862) {
|
|
$863 = $861 << 1;
|
|
$864 = (35492 + ($863<<2)|0);
|
|
$865 = HEAP32[8863]|0;
|
|
$866 = 1 << $861;
|
|
$867 = $865 & $866;
|
|
$868 = ($867|0)==(0);
|
|
do {
|
|
if ($868) {
|
|
$869 = $865 | $866;
|
|
HEAP32[8863] = $869;
|
|
$$pre$i$i = ((($864)) + 8|0);
|
|
$$0295$i$i = $864;$$pre$phi$i$iZ2D = $$pre$i$i;
|
|
} else {
|
|
$870 = ((($864)) + 8|0);
|
|
$871 = HEAP32[$870>>2]|0;
|
|
$872 = HEAP32[(35468)>>2]|0;
|
|
$873 = ($871>>>0)<($872>>>0);
|
|
if (!($873)) {
|
|
$$0295$i$i = $871;$$pre$phi$i$iZ2D = $870;
|
|
break;
|
|
}
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
} while(0);
|
|
HEAP32[$$pre$phi$i$iZ2D>>2] = $748;
|
|
$874 = ((($$0295$i$i)) + 12|0);
|
|
HEAP32[$874>>2] = $748;
|
|
$875 = ((($748)) + 8|0);
|
|
HEAP32[$875>>2] = $$0295$i$i;
|
|
$876 = ((($748)) + 12|0);
|
|
HEAP32[$876>>2] = $864;
|
|
break;
|
|
}
|
|
$877 = $$0287$i$i >>> 8;
|
|
$878 = ($877|0)==(0);
|
|
do {
|
|
if ($878) {
|
|
$$0296$i$i = 0;
|
|
} else {
|
|
$879 = ($$0287$i$i>>>0)>(16777215);
|
|
if ($879) {
|
|
$$0296$i$i = 31;
|
|
break;
|
|
}
|
|
$880 = (($877) + 1048320)|0;
|
|
$881 = $880 >>> 16;
|
|
$882 = $881 & 8;
|
|
$883 = $877 << $882;
|
|
$884 = (($883) + 520192)|0;
|
|
$885 = $884 >>> 16;
|
|
$886 = $885 & 4;
|
|
$887 = $886 | $882;
|
|
$888 = $883 << $886;
|
|
$889 = (($888) + 245760)|0;
|
|
$890 = $889 >>> 16;
|
|
$891 = $890 & 2;
|
|
$892 = $887 | $891;
|
|
$893 = (14 - ($892))|0;
|
|
$894 = $888 << $891;
|
|
$895 = $894 >>> 15;
|
|
$896 = (($893) + ($895))|0;
|
|
$897 = $896 << 1;
|
|
$898 = (($896) + 7)|0;
|
|
$899 = $$0287$i$i >>> $898;
|
|
$900 = $899 & 1;
|
|
$901 = $900 | $897;
|
|
$$0296$i$i = $901;
|
|
}
|
|
} while(0);
|
|
$902 = (35756 + ($$0296$i$i<<2)|0);
|
|
$903 = ((($748)) + 28|0);
|
|
HEAP32[$903>>2] = $$0296$i$i;
|
|
$904 = ((($748)) + 16|0);
|
|
$905 = ((($904)) + 4|0);
|
|
HEAP32[$905>>2] = 0;
|
|
HEAP32[$904>>2] = 0;
|
|
$906 = HEAP32[(35456)>>2]|0;
|
|
$907 = 1 << $$0296$i$i;
|
|
$908 = $906 & $907;
|
|
$909 = ($908|0)==(0);
|
|
if ($909) {
|
|
$910 = $906 | $907;
|
|
HEAP32[(35456)>>2] = $910;
|
|
HEAP32[$902>>2] = $748;
|
|
$911 = ((($748)) + 24|0);
|
|
HEAP32[$911>>2] = $902;
|
|
$912 = ((($748)) + 12|0);
|
|
HEAP32[$912>>2] = $748;
|
|
$913 = ((($748)) + 8|0);
|
|
HEAP32[$913>>2] = $748;
|
|
break;
|
|
}
|
|
$914 = HEAP32[$902>>2]|0;
|
|
$915 = ($$0296$i$i|0)==(31);
|
|
$916 = $$0296$i$i >>> 1;
|
|
$917 = (25 - ($916))|0;
|
|
$918 = $915 ? 0 : $917;
|
|
$919 = $$0287$i$i << $918;
|
|
$$0288$i$i = $919;$$0289$i$i = $914;
|
|
while(1) {
|
|
$920 = ((($$0289$i$i)) + 4|0);
|
|
$921 = HEAP32[$920>>2]|0;
|
|
$922 = $921 & -8;
|
|
$923 = ($922|0)==($$0287$i$i|0);
|
|
if ($923) {
|
|
label = 280;
|
|
break;
|
|
}
|
|
$924 = $$0288$i$i >>> 31;
|
|
$925 = (((($$0289$i$i)) + 16|0) + ($924<<2)|0);
|
|
$926 = $$0288$i$i << 1;
|
|
$927 = HEAP32[$925>>2]|0;
|
|
$928 = ($927|0)==(0|0);
|
|
if ($928) {
|
|
label = 277;
|
|
break;
|
|
} else {
|
|
$$0288$i$i = $926;$$0289$i$i = $927;
|
|
}
|
|
}
|
|
if ((label|0) == 277) {
|
|
$929 = HEAP32[(35468)>>2]|0;
|
|
$930 = ($925>>>0)<($929>>>0);
|
|
if ($930) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
HEAP32[$925>>2] = $748;
|
|
$931 = ((($748)) + 24|0);
|
|
HEAP32[$931>>2] = $$0289$i$i;
|
|
$932 = ((($748)) + 12|0);
|
|
HEAP32[$932>>2] = $748;
|
|
$933 = ((($748)) + 8|0);
|
|
HEAP32[$933>>2] = $748;
|
|
break;
|
|
}
|
|
}
|
|
else if ((label|0) == 280) {
|
|
$934 = ((($$0289$i$i)) + 8|0);
|
|
$935 = HEAP32[$934>>2]|0;
|
|
$936 = HEAP32[(35468)>>2]|0;
|
|
$937 = ($935>>>0)>=($936>>>0);
|
|
$not$7$i$i = ($$0289$i$i>>>0)>=($936>>>0);
|
|
$938 = $937 & $not$7$i$i;
|
|
if ($938) {
|
|
$939 = ((($935)) + 12|0);
|
|
HEAP32[$939>>2] = $748;
|
|
HEAP32[$934>>2] = $748;
|
|
$940 = ((($748)) + 8|0);
|
|
HEAP32[$940>>2] = $935;
|
|
$941 = ((($748)) + 12|0);
|
|
HEAP32[$941>>2] = $$0289$i$i;
|
|
$942 = ((($748)) + 24|0);
|
|
HEAP32[$942>>2] = 0;
|
|
break;
|
|
} else {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$1074 = ((($736)) + 8|0);
|
|
$$2 = $1074;
|
|
break L230;
|
|
}
|
|
}
|
|
$$0$i$i$i = (35928);
|
|
while(1) {
|
|
$943 = HEAP32[$$0$i$i$i>>2]|0;
|
|
$944 = ($943>>>0)>($657>>>0);
|
|
if (!($944)) {
|
|
$945 = ((($$0$i$i$i)) + 4|0);
|
|
$946 = HEAP32[$945>>2]|0;
|
|
$947 = (($943) + ($946)|0);
|
|
$948 = ($947>>>0)>($657>>>0);
|
|
if ($948) {
|
|
break;
|
|
}
|
|
}
|
|
$949 = ((($$0$i$i$i)) + 8|0);
|
|
$950 = HEAP32[$949>>2]|0;
|
|
$$0$i$i$i = $950;
|
|
}
|
|
$951 = ((($947)) + -47|0);
|
|
$952 = ((($951)) + 8|0);
|
|
$953 = $952;
|
|
$954 = $953 & 7;
|
|
$955 = ($954|0)==(0);
|
|
$956 = (0 - ($953))|0;
|
|
$957 = $956 & 7;
|
|
$958 = $955 ? 0 : $957;
|
|
$959 = (($951) + ($958)|0);
|
|
$960 = ((($657)) + 16|0);
|
|
$961 = ($959>>>0)<($960>>>0);
|
|
$962 = $961 ? $657 : $959;
|
|
$963 = ((($962)) + 8|0);
|
|
$964 = ((($962)) + 24|0);
|
|
$965 = (($$7239$i) + -40)|0;
|
|
$966 = ((($$7$i)) + 8|0);
|
|
$967 = $966;
|
|
$968 = $967 & 7;
|
|
$969 = ($968|0)==(0);
|
|
$970 = (0 - ($967))|0;
|
|
$971 = $970 & 7;
|
|
$972 = $969 ? 0 : $971;
|
|
$973 = (($$7$i) + ($972)|0);
|
|
$974 = (($965) - ($972))|0;
|
|
HEAP32[(35476)>>2] = $973;
|
|
HEAP32[(35464)>>2] = $974;
|
|
$975 = $974 | 1;
|
|
$976 = ((($973)) + 4|0);
|
|
HEAP32[$976>>2] = $975;
|
|
$977 = (($973) + ($974)|0);
|
|
$978 = ((($977)) + 4|0);
|
|
HEAP32[$978>>2] = 40;
|
|
$979 = HEAP32[(35416)>>2]|0;
|
|
HEAP32[(35480)>>2] = $979;
|
|
$980 = ((($962)) + 4|0);
|
|
HEAP32[$980>>2] = 27;
|
|
;HEAP32[$963>>2]=HEAP32[(35928)>>2]|0;HEAP32[$963+4>>2]=HEAP32[(35928)+4>>2]|0;HEAP32[$963+8>>2]=HEAP32[(35928)+8>>2]|0;HEAP32[$963+12>>2]=HEAP32[(35928)+12>>2]|0;
|
|
HEAP32[(35928)>>2] = $$7$i;
|
|
HEAP32[(35932)>>2] = $$7239$i;
|
|
HEAP32[(35940)>>2] = 0;
|
|
HEAP32[(35936)>>2] = $963;
|
|
$982 = $964;
|
|
while(1) {
|
|
$981 = ((($982)) + 4|0);
|
|
HEAP32[$981>>2] = 7;
|
|
$983 = ((($982)) + 8|0);
|
|
$984 = ($983>>>0)<($947>>>0);
|
|
if ($984) {
|
|
$982 = $981;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
$985 = ($962|0)==($657|0);
|
|
if (!($985)) {
|
|
$986 = $962;
|
|
$987 = $657;
|
|
$988 = (($986) - ($987))|0;
|
|
$989 = HEAP32[$980>>2]|0;
|
|
$990 = $989 & -2;
|
|
HEAP32[$980>>2] = $990;
|
|
$991 = $988 | 1;
|
|
$992 = ((($657)) + 4|0);
|
|
HEAP32[$992>>2] = $991;
|
|
HEAP32[$962>>2] = $988;
|
|
$993 = $988 >>> 3;
|
|
$994 = ($988>>>0)<(256);
|
|
if ($994) {
|
|
$995 = $993 << 1;
|
|
$996 = (35492 + ($995<<2)|0);
|
|
$997 = HEAP32[8863]|0;
|
|
$998 = 1 << $993;
|
|
$999 = $997 & $998;
|
|
$1000 = ($999|0)==(0);
|
|
do {
|
|
if ($1000) {
|
|
$1001 = $997 | $998;
|
|
HEAP32[8863] = $1001;
|
|
$$pre$i18$i = ((($996)) + 8|0);
|
|
$$0211$i$i = $996;$$pre$phi$i19$iZ2D = $$pre$i18$i;
|
|
} else {
|
|
$1002 = ((($996)) + 8|0);
|
|
$1003 = HEAP32[$1002>>2]|0;
|
|
$1004 = HEAP32[(35468)>>2]|0;
|
|
$1005 = ($1003>>>0)<($1004>>>0);
|
|
if (!($1005)) {
|
|
$$0211$i$i = $1003;$$pre$phi$i19$iZ2D = $1002;
|
|
break;
|
|
}
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
} while(0);
|
|
HEAP32[$$pre$phi$i19$iZ2D>>2] = $657;
|
|
$1006 = ((($$0211$i$i)) + 12|0);
|
|
HEAP32[$1006>>2] = $657;
|
|
$1007 = ((($657)) + 8|0);
|
|
HEAP32[$1007>>2] = $$0211$i$i;
|
|
$1008 = ((($657)) + 12|0);
|
|
HEAP32[$1008>>2] = $996;
|
|
break;
|
|
}
|
|
$1009 = $988 >>> 8;
|
|
$1010 = ($1009|0)==(0);
|
|
do {
|
|
if ($1010) {
|
|
$$0212$i$i = 0;
|
|
} else {
|
|
$1011 = ($988>>>0)>(16777215);
|
|
if ($1011) {
|
|
$$0212$i$i = 31;
|
|
break;
|
|
}
|
|
$1012 = (($1009) + 1048320)|0;
|
|
$1013 = $1012 >>> 16;
|
|
$1014 = $1013 & 8;
|
|
$1015 = $1009 << $1014;
|
|
$1016 = (($1015) + 520192)|0;
|
|
$1017 = $1016 >>> 16;
|
|
$1018 = $1017 & 4;
|
|
$1019 = $1018 | $1014;
|
|
$1020 = $1015 << $1018;
|
|
$1021 = (($1020) + 245760)|0;
|
|
$1022 = $1021 >>> 16;
|
|
$1023 = $1022 & 2;
|
|
$1024 = $1019 | $1023;
|
|
$1025 = (14 - ($1024))|0;
|
|
$1026 = $1020 << $1023;
|
|
$1027 = $1026 >>> 15;
|
|
$1028 = (($1025) + ($1027))|0;
|
|
$1029 = $1028 << 1;
|
|
$1030 = (($1028) + 7)|0;
|
|
$1031 = $988 >>> $1030;
|
|
$1032 = $1031 & 1;
|
|
$1033 = $1032 | $1029;
|
|
$$0212$i$i = $1033;
|
|
}
|
|
} while(0);
|
|
$1034 = (35756 + ($$0212$i$i<<2)|0);
|
|
$1035 = ((($657)) + 28|0);
|
|
HEAP32[$1035>>2] = $$0212$i$i;
|
|
$1036 = ((($657)) + 20|0);
|
|
HEAP32[$1036>>2] = 0;
|
|
HEAP32[$960>>2] = 0;
|
|
$1037 = HEAP32[(35456)>>2]|0;
|
|
$1038 = 1 << $$0212$i$i;
|
|
$1039 = $1037 & $1038;
|
|
$1040 = ($1039|0)==(0);
|
|
if ($1040) {
|
|
$1041 = $1037 | $1038;
|
|
HEAP32[(35456)>>2] = $1041;
|
|
HEAP32[$1034>>2] = $657;
|
|
$1042 = ((($657)) + 24|0);
|
|
HEAP32[$1042>>2] = $1034;
|
|
$1043 = ((($657)) + 12|0);
|
|
HEAP32[$1043>>2] = $657;
|
|
$1044 = ((($657)) + 8|0);
|
|
HEAP32[$1044>>2] = $657;
|
|
break;
|
|
}
|
|
$1045 = HEAP32[$1034>>2]|0;
|
|
$1046 = ($$0212$i$i|0)==(31);
|
|
$1047 = $$0212$i$i >>> 1;
|
|
$1048 = (25 - ($1047))|0;
|
|
$1049 = $1046 ? 0 : $1048;
|
|
$1050 = $988 << $1049;
|
|
$$0206$i$i = $1050;$$0207$i$i = $1045;
|
|
while(1) {
|
|
$1051 = ((($$0207$i$i)) + 4|0);
|
|
$1052 = HEAP32[$1051>>2]|0;
|
|
$1053 = $1052 & -8;
|
|
$1054 = ($1053|0)==($988|0);
|
|
if ($1054) {
|
|
label = 307;
|
|
break;
|
|
}
|
|
$1055 = $$0206$i$i >>> 31;
|
|
$1056 = (((($$0207$i$i)) + 16|0) + ($1055<<2)|0);
|
|
$1057 = $$0206$i$i << 1;
|
|
$1058 = HEAP32[$1056>>2]|0;
|
|
$1059 = ($1058|0)==(0|0);
|
|
if ($1059) {
|
|
label = 304;
|
|
break;
|
|
} else {
|
|
$$0206$i$i = $1057;$$0207$i$i = $1058;
|
|
}
|
|
}
|
|
if ((label|0) == 304) {
|
|
$1060 = HEAP32[(35468)>>2]|0;
|
|
$1061 = ($1056>>>0)<($1060>>>0);
|
|
if ($1061) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
HEAP32[$1056>>2] = $657;
|
|
$1062 = ((($657)) + 24|0);
|
|
HEAP32[$1062>>2] = $$0207$i$i;
|
|
$1063 = ((($657)) + 12|0);
|
|
HEAP32[$1063>>2] = $657;
|
|
$1064 = ((($657)) + 8|0);
|
|
HEAP32[$1064>>2] = $657;
|
|
break;
|
|
}
|
|
}
|
|
else if ((label|0) == 307) {
|
|
$1065 = ((($$0207$i$i)) + 8|0);
|
|
$1066 = HEAP32[$1065>>2]|0;
|
|
$1067 = HEAP32[(35468)>>2]|0;
|
|
$1068 = ($1066>>>0)>=($1067>>>0);
|
|
$not$$i21$i = ($$0207$i$i>>>0)>=($1067>>>0);
|
|
$1069 = $1068 & $not$$i21$i;
|
|
if ($1069) {
|
|
$1070 = ((($1066)) + 12|0);
|
|
HEAP32[$1070>>2] = $657;
|
|
HEAP32[$1065>>2] = $657;
|
|
$1071 = ((($657)) + 8|0);
|
|
HEAP32[$1071>>2] = $1066;
|
|
$1072 = ((($657)) + 12|0);
|
|
HEAP32[$1072>>2] = $$0207$i$i;
|
|
$1073 = ((($657)) + 24|0);
|
|
HEAP32[$1073>>2] = 0;
|
|
break;
|
|
} else {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$1075 = HEAP32[(35464)>>2]|0;
|
|
$1076 = ($1075>>>0)>($$0198>>>0);
|
|
if ($1076) {
|
|
$1077 = (($1075) - ($$0198))|0;
|
|
HEAP32[(35464)>>2] = $1077;
|
|
$1078 = HEAP32[(35476)>>2]|0;
|
|
$1079 = (($1078) + ($$0198)|0);
|
|
HEAP32[(35476)>>2] = $1079;
|
|
$1080 = $1077 | 1;
|
|
$1081 = ((($1079)) + 4|0);
|
|
HEAP32[$1081>>2] = $1080;
|
|
$1082 = $$0198 | 3;
|
|
$1083 = ((($1078)) + 4|0);
|
|
HEAP32[$1083>>2] = $1082;
|
|
$1084 = ((($1078)) + 8|0);
|
|
$$2 = $1084;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
$1085 = (___errno_location()|0);
|
|
HEAP32[$1085>>2] = 12;
|
|
$$2 = 0;
|
|
} else {
|
|
$$2 = 0;
|
|
}
|
|
}
|
|
} while(0);
|
|
$1086 = HEAP32[(35896)>>2]|0;
|
|
$1087 = $1086 & 2;
|
|
$1088 = ($1087|0)==(0);
|
|
if ($1088) {
|
|
$$1 = $$2;
|
|
STACKTOP = sp;return ($$1|0);
|
|
}
|
|
(___pthread_mutex_unlock((35900))|0);
|
|
$$1 = $$2;
|
|
STACKTOP = sp;return ($$1|0);
|
|
}
|
|
function _free($0) {
|
|
$0 = $0|0;
|
|
var $$0212$i = 0, $$0212$in$i = 0, $$0383 = 0, $$0384 = 0, $$0396 = 0, $$0403 = 0, $$1 = 0, $$1382 = 0, $$1387 = 0, $$1390 = 0, $$1398 = 0, $$1402 = 0, $$2 = 0, $$3 = 0, $$3400 = 0, $$pre = 0, $$pre$phi443Z2D = 0, $$pre$phi445Z2D = 0, $$pre$phiZ2D = 0, $$pre442 = 0;
|
|
var $$pre444 = 0, $$sink3 = 0, $$sink5 = 0, $1 = 0, $10 = 0, $100 = 0, $101 = 0, $102 = 0, $103 = 0, $104 = 0, $105 = 0, $106 = 0, $107 = 0, $108 = 0, $109 = 0, $11 = 0, $110 = 0, $111 = 0, $112 = 0, $113 = 0;
|
|
var $114 = 0, $115 = 0, $116 = 0, $117 = 0, $118 = 0, $119 = 0, $12 = 0, $120 = 0, $121 = 0, $122 = 0, $123 = 0, $124 = 0, $125 = 0, $126 = 0, $127 = 0, $128 = 0, $129 = 0, $13 = 0, $130 = 0, $131 = 0;
|
|
var $132 = 0, $133 = 0, $134 = 0, $135 = 0, $136 = 0, $137 = 0, $138 = 0, $139 = 0, $14 = 0, $140 = 0, $141 = 0, $142 = 0, $143 = 0, $144 = 0, $145 = 0, $146 = 0, $147 = 0, $148 = 0, $149 = 0, $15 = 0;
|
|
var $150 = 0, $151 = 0, $152 = 0, $153 = 0, $154 = 0, $155 = 0, $156 = 0, $157 = 0, $158 = 0, $159 = 0, $16 = 0, $160 = 0, $161 = 0, $162 = 0, $163 = 0, $164 = 0, $165 = 0, $166 = 0, $167 = 0, $168 = 0;
|
|
var $169 = 0, $17 = 0, $170 = 0, $171 = 0, $172 = 0, $173 = 0, $174 = 0, $175 = 0, $176 = 0, $177 = 0, $178 = 0, $179 = 0, $18 = 0, $180 = 0, $181 = 0, $182 = 0, $183 = 0, $184 = 0, $185 = 0, $186 = 0;
|
|
var $187 = 0, $188 = 0, $189 = 0, $19 = 0, $190 = 0, $191 = 0, $192 = 0, $193 = 0, $194 = 0, $195 = 0, $196 = 0, $197 = 0, $198 = 0, $199 = 0, $2 = 0, $20 = 0, $200 = 0, $201 = 0, $202 = 0, $203 = 0;
|
|
var $204 = 0, $205 = 0, $206 = 0, $207 = 0, $208 = 0, $209 = 0, $21 = 0, $210 = 0, $211 = 0, $212 = 0, $213 = 0, $214 = 0, $215 = 0, $216 = 0, $217 = 0, $218 = 0, $219 = 0, $22 = 0, $220 = 0, $221 = 0;
|
|
var $222 = 0, $223 = 0, $224 = 0, $225 = 0, $226 = 0, $227 = 0, $228 = 0, $229 = 0, $23 = 0, $230 = 0, $231 = 0, $232 = 0, $233 = 0, $234 = 0, $235 = 0, $236 = 0, $237 = 0, $238 = 0, $239 = 0, $24 = 0;
|
|
var $240 = 0, $241 = 0, $242 = 0, $243 = 0, $244 = 0, $245 = 0, $246 = 0, $247 = 0, $248 = 0, $249 = 0, $25 = 0, $250 = 0, $251 = 0, $252 = 0, $253 = 0, $254 = 0, $255 = 0, $256 = 0, $257 = 0, $258 = 0;
|
|
var $259 = 0, $26 = 0, $260 = 0, $261 = 0, $262 = 0, $263 = 0, $264 = 0, $265 = 0, $266 = 0, $267 = 0, $268 = 0, $269 = 0, $27 = 0, $270 = 0, $271 = 0, $272 = 0, $273 = 0, $274 = 0, $275 = 0, $276 = 0;
|
|
var $277 = 0, $278 = 0, $279 = 0, $28 = 0, $280 = 0, $281 = 0, $282 = 0, $283 = 0, $284 = 0, $285 = 0, $286 = 0, $287 = 0, $288 = 0, $289 = 0, $29 = 0, $290 = 0, $291 = 0, $292 = 0, $293 = 0, $294 = 0;
|
|
var $295 = 0, $296 = 0, $297 = 0, $298 = 0, $299 = 0, $3 = 0, $30 = 0, $300 = 0, $301 = 0, $302 = 0, $303 = 0, $304 = 0, $305 = 0, $306 = 0, $307 = 0, $308 = 0, $309 = 0, $31 = 0, $310 = 0, $311 = 0;
|
|
var $312 = 0, $313 = 0, $314 = 0, $315 = 0, $316 = 0, $317 = 0, $318 = 0, $319 = 0, $32 = 0, $320 = 0, $321 = 0, $322 = 0, $323 = 0, $324 = 0, $325 = 0, $326 = 0, $33 = 0, $34 = 0, $35 = 0, $36 = 0;
|
|
var $37 = 0, $38 = 0, $39 = 0, $4 = 0, $40 = 0, $41 = 0, $42 = 0, $43 = 0, $44 = 0, $45 = 0, $46 = 0, $47 = 0, $48 = 0, $49 = 0, $5 = 0, $50 = 0, $51 = 0, $52 = 0, $53 = 0, $54 = 0;
|
|
var $55 = 0, $56 = 0, $57 = 0, $58 = 0, $59 = 0, $6 = 0, $60 = 0, $61 = 0, $62 = 0, $63 = 0, $64 = 0, $65 = 0, $66 = 0, $67 = 0, $68 = 0, $69 = 0, $7 = 0, $70 = 0, $71 = 0, $72 = 0;
|
|
var $73 = 0, $74 = 0, $75 = 0, $76 = 0, $77 = 0, $78 = 0, $79 = 0, $8 = 0, $80 = 0, $81 = 0, $82 = 0, $83 = 0, $84 = 0, $85 = 0, $86 = 0, $87 = 0, $88 = 0, $89 = 0, $9 = 0, $90 = 0;
|
|
var $91 = 0, $92 = 0, $93 = 0, $94 = 0, $95 = 0, $96 = 0, $97 = 0, $98 = 0, $99 = 0, $cond421 = 0, $cond422 = 0, $not$ = 0, $not$405 = 0, $not$437 = 0, label = 0, sp = 0;
|
|
sp = STACKTOP;
|
|
$1 = ($0|0)==(0|0);
|
|
if ($1) {
|
|
return;
|
|
}
|
|
$2 = ((($0)) + -8|0);
|
|
$3 = HEAP32[(35896)>>2]|0;
|
|
$4 = $3 & 2;
|
|
$5 = ($4|0)==(0);
|
|
if (!($5)) {
|
|
$6 = (___pthread_mutex_lock((35900))|0);
|
|
$7 = ($6|0)==(0);
|
|
if (!($7)) {
|
|
return;
|
|
}
|
|
}
|
|
$8 = HEAP32[(35468)>>2]|0;
|
|
$9 = ($2>>>0)<($8>>>0);
|
|
if ($9) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$10 = ((($0)) + -4|0);
|
|
$11 = HEAP32[$10>>2]|0;
|
|
$12 = $11 & 3;
|
|
$13 = ($12|0)==(1);
|
|
if ($13) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$14 = $11 & -8;
|
|
$15 = (($2) + ($14)|0);
|
|
$16 = $11 & 1;
|
|
$17 = ($16|0)==(0);
|
|
L14: do {
|
|
if ($17) {
|
|
$18 = HEAP32[$2>>2]|0;
|
|
$19 = ($12|0)==(0);
|
|
if (!($19)) {
|
|
$20 = (0 - ($18))|0;
|
|
$21 = (($2) + ($20)|0);
|
|
$22 = (($18) + ($14))|0;
|
|
$23 = ($21>>>0)<($8>>>0);
|
|
if ($23) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$24 = HEAP32[(35472)>>2]|0;
|
|
$25 = ($21|0)==($24|0);
|
|
if ($25) {
|
|
$109 = ((($15)) + 4|0);
|
|
$110 = HEAP32[$109>>2]|0;
|
|
$111 = $110 & 3;
|
|
$112 = ($111|0)==(3);
|
|
if (!($112)) {
|
|
$$1 = $21;$$1382 = $22;$118 = $21;
|
|
label = 55;
|
|
break;
|
|
}
|
|
$113 = (($21) + ($22)|0);
|
|
$114 = ((($21)) + 4|0);
|
|
$115 = $22 | 1;
|
|
$116 = $110 & -2;
|
|
HEAP32[(35460)>>2] = $22;
|
|
HEAP32[$109>>2] = $116;
|
|
HEAP32[$114>>2] = $115;
|
|
HEAP32[$113>>2] = $22;
|
|
break;
|
|
}
|
|
$26 = $18 >>> 3;
|
|
$27 = ($18>>>0)<(256);
|
|
if ($27) {
|
|
$28 = ((($21)) + 8|0);
|
|
$29 = HEAP32[$28>>2]|0;
|
|
$30 = ((($21)) + 12|0);
|
|
$31 = HEAP32[$30>>2]|0;
|
|
$32 = $26 << 1;
|
|
$33 = (35492 + ($32<<2)|0);
|
|
$34 = ($29|0)==($33|0);
|
|
if (!($34)) {
|
|
$35 = ($29>>>0)<($8>>>0);
|
|
if ($35) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$36 = ((($29)) + 12|0);
|
|
$37 = HEAP32[$36>>2]|0;
|
|
$38 = ($37|0)==($21|0);
|
|
if (!($38)) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
}
|
|
$39 = ($31|0)==($29|0);
|
|
if ($39) {
|
|
$40 = 1 << $26;
|
|
$41 = $40 ^ -1;
|
|
$42 = HEAP32[8863]|0;
|
|
$43 = $42 & $41;
|
|
HEAP32[8863] = $43;
|
|
$$1 = $21;$$1382 = $22;$118 = $21;
|
|
label = 55;
|
|
break;
|
|
}
|
|
$44 = ($31|0)==($33|0);
|
|
if ($44) {
|
|
$$pre444 = ((($31)) + 8|0);
|
|
$$pre$phi445Z2D = $$pre444;
|
|
} else {
|
|
$45 = ($31>>>0)<($8>>>0);
|
|
if ($45) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$46 = ((($31)) + 8|0);
|
|
$47 = HEAP32[$46>>2]|0;
|
|
$48 = ($47|0)==($21|0);
|
|
if ($48) {
|
|
$$pre$phi445Z2D = $46;
|
|
} else {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
}
|
|
$49 = ((($29)) + 12|0);
|
|
HEAP32[$49>>2] = $31;
|
|
HEAP32[$$pre$phi445Z2D>>2] = $29;
|
|
$$1 = $21;$$1382 = $22;$118 = $21;
|
|
label = 55;
|
|
break;
|
|
}
|
|
$50 = ((($21)) + 24|0);
|
|
$51 = HEAP32[$50>>2]|0;
|
|
$52 = ((($21)) + 12|0);
|
|
$53 = HEAP32[$52>>2]|0;
|
|
$54 = ($53|0)==($21|0);
|
|
do {
|
|
if ($54) {
|
|
$64 = ((($21)) + 16|0);
|
|
$65 = ((($64)) + 4|0);
|
|
$66 = HEAP32[$65>>2]|0;
|
|
$67 = ($66|0)==(0|0);
|
|
if ($67) {
|
|
$68 = HEAP32[$64>>2]|0;
|
|
$69 = ($68|0)==(0|0);
|
|
if ($69) {
|
|
$$3 = 0;
|
|
break;
|
|
} else {
|
|
$$1387 = $68;$$1390 = $64;
|
|
}
|
|
} else {
|
|
$$1387 = $66;$$1390 = $65;
|
|
}
|
|
while(1) {
|
|
$70 = ((($$1387)) + 20|0);
|
|
$71 = HEAP32[$70>>2]|0;
|
|
$72 = ($71|0)==(0|0);
|
|
if (!($72)) {
|
|
$$1387 = $71;$$1390 = $70;
|
|
continue;
|
|
}
|
|
$73 = ((($$1387)) + 16|0);
|
|
$74 = HEAP32[$73>>2]|0;
|
|
$75 = ($74|0)==(0|0);
|
|
if ($75) {
|
|
break;
|
|
} else {
|
|
$$1387 = $74;$$1390 = $73;
|
|
}
|
|
}
|
|
$76 = ($$1390>>>0)<($8>>>0);
|
|
if ($76) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
HEAP32[$$1390>>2] = 0;
|
|
$$3 = $$1387;
|
|
break;
|
|
}
|
|
} else {
|
|
$55 = ((($21)) + 8|0);
|
|
$56 = HEAP32[$55>>2]|0;
|
|
$57 = ($56>>>0)<($8>>>0);
|
|
if ($57) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$58 = ((($56)) + 12|0);
|
|
$59 = HEAP32[$58>>2]|0;
|
|
$60 = ($59|0)==($21|0);
|
|
if (!($60)) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$61 = ((($53)) + 8|0);
|
|
$62 = HEAP32[$61>>2]|0;
|
|
$63 = ($62|0)==($21|0);
|
|
if ($63) {
|
|
HEAP32[$58>>2] = $53;
|
|
HEAP32[$61>>2] = $56;
|
|
$$3 = $53;
|
|
break;
|
|
} else {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
}
|
|
} while(0);
|
|
$77 = ($51|0)==(0|0);
|
|
if ($77) {
|
|
$$1 = $21;$$1382 = $22;$118 = $21;
|
|
label = 55;
|
|
} else {
|
|
$78 = ((($21)) + 28|0);
|
|
$79 = HEAP32[$78>>2]|0;
|
|
$80 = (35756 + ($79<<2)|0);
|
|
$81 = HEAP32[$80>>2]|0;
|
|
$82 = ($21|0)==($81|0);
|
|
do {
|
|
if ($82) {
|
|
HEAP32[$80>>2] = $$3;
|
|
$cond421 = ($$3|0)==(0|0);
|
|
if ($cond421) {
|
|
$83 = 1 << $79;
|
|
$84 = $83 ^ -1;
|
|
$85 = HEAP32[(35456)>>2]|0;
|
|
$86 = $85 & $84;
|
|
HEAP32[(35456)>>2] = $86;
|
|
$$1 = $21;$$1382 = $22;$118 = $21;
|
|
label = 55;
|
|
break L14;
|
|
}
|
|
} else {
|
|
$87 = HEAP32[(35468)>>2]|0;
|
|
$88 = ($51>>>0)<($87>>>0);
|
|
if ($88) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$89 = ((($51)) + 16|0);
|
|
$90 = HEAP32[$89>>2]|0;
|
|
$not$405 = ($90|0)!=($21|0);
|
|
$$sink3 = $not$405&1;
|
|
$91 = (((($51)) + 16|0) + ($$sink3<<2)|0);
|
|
HEAP32[$91>>2] = $$3;
|
|
$92 = ($$3|0)==(0|0);
|
|
if ($92) {
|
|
$$1 = $21;$$1382 = $22;$118 = $21;
|
|
label = 55;
|
|
break L14;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$93 = HEAP32[(35468)>>2]|0;
|
|
$94 = ($$3>>>0)<($93>>>0);
|
|
if ($94) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$95 = ((($$3)) + 24|0);
|
|
HEAP32[$95>>2] = $51;
|
|
$96 = ((($21)) + 16|0);
|
|
$97 = HEAP32[$96>>2]|0;
|
|
$98 = ($97|0)==(0|0);
|
|
do {
|
|
if (!($98)) {
|
|
$99 = ($97>>>0)<($93>>>0);
|
|
if ($99) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$100 = ((($$3)) + 16|0);
|
|
HEAP32[$100>>2] = $97;
|
|
$101 = ((($97)) + 24|0);
|
|
HEAP32[$101>>2] = $$3;
|
|
break;
|
|
}
|
|
}
|
|
} while(0);
|
|
$102 = ((($96)) + 4|0);
|
|
$103 = HEAP32[$102>>2]|0;
|
|
$104 = ($103|0)==(0|0);
|
|
if ($104) {
|
|
$$1 = $21;$$1382 = $22;$118 = $21;
|
|
label = 55;
|
|
} else {
|
|
$105 = HEAP32[(35468)>>2]|0;
|
|
$106 = ($103>>>0)<($105>>>0);
|
|
if ($106) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$107 = ((($$3)) + 20|0);
|
|
HEAP32[$107>>2] = $103;
|
|
$108 = ((($103)) + 24|0);
|
|
HEAP32[$108>>2] = $$3;
|
|
$$1 = $21;$$1382 = $22;$118 = $21;
|
|
label = 55;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
} else {
|
|
$$1 = $2;$$1382 = $14;$118 = $2;
|
|
label = 55;
|
|
}
|
|
} while(0);
|
|
do {
|
|
if ((label|0) == 55) {
|
|
$117 = ($118>>>0)<($15>>>0);
|
|
if (!($117)) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$119 = ((($15)) + 4|0);
|
|
$120 = HEAP32[$119>>2]|0;
|
|
$121 = $120 & 1;
|
|
$122 = ($121|0)==(0);
|
|
if ($122) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$123 = $120 & 2;
|
|
$124 = ($123|0)==(0);
|
|
if ($124) {
|
|
$125 = HEAP32[(35476)>>2]|0;
|
|
$126 = ($15|0)==($125|0);
|
|
$127 = HEAP32[(35472)>>2]|0;
|
|
if ($126) {
|
|
$128 = HEAP32[(35464)>>2]|0;
|
|
$129 = (($128) + ($$1382))|0;
|
|
HEAP32[(35464)>>2] = $129;
|
|
HEAP32[(35476)>>2] = $$1;
|
|
$130 = $129 | 1;
|
|
$131 = ((($$1)) + 4|0);
|
|
HEAP32[$131>>2] = $130;
|
|
$132 = ($$1|0)==($127|0);
|
|
if (!($132)) {
|
|
break;
|
|
}
|
|
HEAP32[(35472)>>2] = 0;
|
|
HEAP32[(35460)>>2] = 0;
|
|
break;
|
|
}
|
|
$133 = ($15|0)==($127|0);
|
|
if ($133) {
|
|
$134 = HEAP32[(35460)>>2]|0;
|
|
$135 = (($134) + ($$1382))|0;
|
|
HEAP32[(35460)>>2] = $135;
|
|
HEAP32[(35472)>>2] = $118;
|
|
$136 = $135 | 1;
|
|
$137 = ((($$1)) + 4|0);
|
|
HEAP32[$137>>2] = $136;
|
|
$138 = (($118) + ($135)|0);
|
|
HEAP32[$138>>2] = $135;
|
|
break;
|
|
}
|
|
$139 = $120 & -8;
|
|
$140 = (($139) + ($$1382))|0;
|
|
$141 = $120 >>> 3;
|
|
$142 = ($120>>>0)<(256);
|
|
L106: do {
|
|
if ($142) {
|
|
$143 = ((($15)) + 8|0);
|
|
$144 = HEAP32[$143>>2]|0;
|
|
$145 = ((($15)) + 12|0);
|
|
$146 = HEAP32[$145>>2]|0;
|
|
$147 = $141 << 1;
|
|
$148 = (35492 + ($147<<2)|0);
|
|
$149 = ($144|0)==($148|0);
|
|
if (!($149)) {
|
|
$150 = HEAP32[(35468)>>2]|0;
|
|
$151 = ($144>>>0)<($150>>>0);
|
|
if ($151) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$152 = ((($144)) + 12|0);
|
|
$153 = HEAP32[$152>>2]|0;
|
|
$154 = ($153|0)==($15|0);
|
|
if (!($154)) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
}
|
|
$155 = ($146|0)==($144|0);
|
|
if ($155) {
|
|
$156 = 1 << $141;
|
|
$157 = $156 ^ -1;
|
|
$158 = HEAP32[8863]|0;
|
|
$159 = $158 & $157;
|
|
HEAP32[8863] = $159;
|
|
break;
|
|
}
|
|
$160 = ($146|0)==($148|0);
|
|
if ($160) {
|
|
$$pre442 = ((($146)) + 8|0);
|
|
$$pre$phi443Z2D = $$pre442;
|
|
} else {
|
|
$161 = HEAP32[(35468)>>2]|0;
|
|
$162 = ($146>>>0)<($161>>>0);
|
|
if ($162) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$163 = ((($146)) + 8|0);
|
|
$164 = HEAP32[$163>>2]|0;
|
|
$165 = ($164|0)==($15|0);
|
|
if ($165) {
|
|
$$pre$phi443Z2D = $163;
|
|
} else {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
}
|
|
$166 = ((($144)) + 12|0);
|
|
HEAP32[$166>>2] = $146;
|
|
HEAP32[$$pre$phi443Z2D>>2] = $144;
|
|
} else {
|
|
$167 = ((($15)) + 24|0);
|
|
$168 = HEAP32[$167>>2]|0;
|
|
$169 = ((($15)) + 12|0);
|
|
$170 = HEAP32[$169>>2]|0;
|
|
$171 = ($170|0)==($15|0);
|
|
do {
|
|
if ($171) {
|
|
$182 = ((($15)) + 16|0);
|
|
$183 = ((($182)) + 4|0);
|
|
$184 = HEAP32[$183>>2]|0;
|
|
$185 = ($184|0)==(0|0);
|
|
if ($185) {
|
|
$186 = HEAP32[$182>>2]|0;
|
|
$187 = ($186|0)==(0|0);
|
|
if ($187) {
|
|
$$3400 = 0;
|
|
break;
|
|
} else {
|
|
$$1398 = $186;$$1402 = $182;
|
|
}
|
|
} else {
|
|
$$1398 = $184;$$1402 = $183;
|
|
}
|
|
while(1) {
|
|
$188 = ((($$1398)) + 20|0);
|
|
$189 = HEAP32[$188>>2]|0;
|
|
$190 = ($189|0)==(0|0);
|
|
if (!($190)) {
|
|
$$1398 = $189;$$1402 = $188;
|
|
continue;
|
|
}
|
|
$191 = ((($$1398)) + 16|0);
|
|
$192 = HEAP32[$191>>2]|0;
|
|
$193 = ($192|0)==(0|0);
|
|
if ($193) {
|
|
break;
|
|
} else {
|
|
$$1398 = $192;$$1402 = $191;
|
|
}
|
|
}
|
|
$194 = HEAP32[(35468)>>2]|0;
|
|
$195 = ($$1402>>>0)<($194>>>0);
|
|
if ($195) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
HEAP32[$$1402>>2] = 0;
|
|
$$3400 = $$1398;
|
|
break;
|
|
}
|
|
} else {
|
|
$172 = ((($15)) + 8|0);
|
|
$173 = HEAP32[$172>>2]|0;
|
|
$174 = HEAP32[(35468)>>2]|0;
|
|
$175 = ($173>>>0)<($174>>>0);
|
|
if ($175) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$176 = ((($173)) + 12|0);
|
|
$177 = HEAP32[$176>>2]|0;
|
|
$178 = ($177|0)==($15|0);
|
|
if (!($178)) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$179 = ((($170)) + 8|0);
|
|
$180 = HEAP32[$179>>2]|0;
|
|
$181 = ($180|0)==($15|0);
|
|
if ($181) {
|
|
HEAP32[$176>>2] = $170;
|
|
HEAP32[$179>>2] = $173;
|
|
$$3400 = $170;
|
|
break;
|
|
} else {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
}
|
|
} while(0);
|
|
$196 = ($168|0)==(0|0);
|
|
if (!($196)) {
|
|
$197 = ((($15)) + 28|0);
|
|
$198 = HEAP32[$197>>2]|0;
|
|
$199 = (35756 + ($198<<2)|0);
|
|
$200 = HEAP32[$199>>2]|0;
|
|
$201 = ($15|0)==($200|0);
|
|
do {
|
|
if ($201) {
|
|
HEAP32[$199>>2] = $$3400;
|
|
$cond422 = ($$3400|0)==(0|0);
|
|
if ($cond422) {
|
|
$202 = 1 << $198;
|
|
$203 = $202 ^ -1;
|
|
$204 = HEAP32[(35456)>>2]|0;
|
|
$205 = $204 & $203;
|
|
HEAP32[(35456)>>2] = $205;
|
|
break L106;
|
|
}
|
|
} else {
|
|
$206 = HEAP32[(35468)>>2]|0;
|
|
$207 = ($168>>>0)<($206>>>0);
|
|
if ($207) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$208 = ((($168)) + 16|0);
|
|
$209 = HEAP32[$208>>2]|0;
|
|
$not$ = ($209|0)!=($15|0);
|
|
$$sink5 = $not$&1;
|
|
$210 = (((($168)) + 16|0) + ($$sink5<<2)|0);
|
|
HEAP32[$210>>2] = $$3400;
|
|
$211 = ($$3400|0)==(0|0);
|
|
if ($211) {
|
|
break L106;
|
|
} else {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$212 = HEAP32[(35468)>>2]|0;
|
|
$213 = ($$3400>>>0)<($212>>>0);
|
|
if ($213) {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
$214 = ((($$3400)) + 24|0);
|
|
HEAP32[$214>>2] = $168;
|
|
$215 = ((($15)) + 16|0);
|
|
$216 = HEAP32[$215>>2]|0;
|
|
$217 = ($216|0)==(0|0);
|
|
do {
|
|
if (!($217)) {
|
|
$218 = ($216>>>0)<($212>>>0);
|
|
if ($218) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$219 = ((($$3400)) + 16|0);
|
|
HEAP32[$219>>2] = $216;
|
|
$220 = ((($216)) + 24|0);
|
|
HEAP32[$220>>2] = $$3400;
|
|
break;
|
|
}
|
|
}
|
|
} while(0);
|
|
$221 = ((($215)) + 4|0);
|
|
$222 = HEAP32[$221>>2]|0;
|
|
$223 = ($222|0)==(0|0);
|
|
if (!($223)) {
|
|
$224 = HEAP32[(35468)>>2]|0;
|
|
$225 = ($222>>>0)<($224>>>0);
|
|
if ($225) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$226 = ((($$3400)) + 20|0);
|
|
HEAP32[$226>>2] = $222;
|
|
$227 = ((($222)) + 24|0);
|
|
HEAP32[$227>>2] = $$3400;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$228 = $140 | 1;
|
|
$229 = ((($$1)) + 4|0);
|
|
HEAP32[$229>>2] = $228;
|
|
$230 = (($118) + ($140)|0);
|
|
HEAP32[$230>>2] = $140;
|
|
$231 = HEAP32[(35472)>>2]|0;
|
|
$232 = ($$1|0)==($231|0);
|
|
if ($232) {
|
|
HEAP32[(35460)>>2] = $140;
|
|
break;
|
|
} else {
|
|
$$2 = $140;
|
|
}
|
|
} else {
|
|
$233 = $120 & -2;
|
|
HEAP32[$119>>2] = $233;
|
|
$234 = $$1382 | 1;
|
|
$235 = ((($$1)) + 4|0);
|
|
HEAP32[$235>>2] = $234;
|
|
$236 = (($118) + ($$1382)|0);
|
|
HEAP32[$236>>2] = $$1382;
|
|
$$2 = $$1382;
|
|
}
|
|
$237 = $$2 >>> 3;
|
|
$238 = ($$2>>>0)<(256);
|
|
if ($238) {
|
|
$239 = $237 << 1;
|
|
$240 = (35492 + ($239<<2)|0);
|
|
$241 = HEAP32[8863]|0;
|
|
$242 = 1 << $237;
|
|
$243 = $241 & $242;
|
|
$244 = ($243|0)==(0);
|
|
if ($244) {
|
|
$245 = $241 | $242;
|
|
HEAP32[8863] = $245;
|
|
$$pre = ((($240)) + 8|0);
|
|
$$0403 = $240;$$pre$phiZ2D = $$pre;
|
|
} else {
|
|
$246 = ((($240)) + 8|0);
|
|
$247 = HEAP32[$246>>2]|0;
|
|
$248 = HEAP32[(35468)>>2]|0;
|
|
$249 = ($247>>>0)<($248>>>0);
|
|
if ($249) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
$$0403 = $247;$$pre$phiZ2D = $246;
|
|
}
|
|
}
|
|
HEAP32[$$pre$phiZ2D>>2] = $$1;
|
|
$250 = ((($$0403)) + 12|0);
|
|
HEAP32[$250>>2] = $$1;
|
|
$251 = ((($$1)) + 8|0);
|
|
HEAP32[$251>>2] = $$0403;
|
|
$252 = ((($$1)) + 12|0);
|
|
HEAP32[$252>>2] = $240;
|
|
break;
|
|
}
|
|
$253 = $$2 >>> 8;
|
|
$254 = ($253|0)==(0);
|
|
if ($254) {
|
|
$$0396 = 0;
|
|
} else {
|
|
$255 = ($$2>>>0)>(16777215);
|
|
if ($255) {
|
|
$$0396 = 31;
|
|
} else {
|
|
$256 = (($253) + 1048320)|0;
|
|
$257 = $256 >>> 16;
|
|
$258 = $257 & 8;
|
|
$259 = $253 << $258;
|
|
$260 = (($259) + 520192)|0;
|
|
$261 = $260 >>> 16;
|
|
$262 = $261 & 4;
|
|
$263 = $262 | $258;
|
|
$264 = $259 << $262;
|
|
$265 = (($264) + 245760)|0;
|
|
$266 = $265 >>> 16;
|
|
$267 = $266 & 2;
|
|
$268 = $263 | $267;
|
|
$269 = (14 - ($268))|0;
|
|
$270 = $264 << $267;
|
|
$271 = $270 >>> 15;
|
|
$272 = (($269) + ($271))|0;
|
|
$273 = $272 << 1;
|
|
$274 = (($272) + 7)|0;
|
|
$275 = $$2 >>> $274;
|
|
$276 = $275 & 1;
|
|
$277 = $276 | $273;
|
|
$$0396 = $277;
|
|
}
|
|
}
|
|
$278 = (35756 + ($$0396<<2)|0);
|
|
$279 = ((($$1)) + 28|0);
|
|
HEAP32[$279>>2] = $$0396;
|
|
$280 = ((($$1)) + 16|0);
|
|
$281 = ((($$1)) + 20|0);
|
|
HEAP32[$281>>2] = 0;
|
|
HEAP32[$280>>2] = 0;
|
|
$282 = HEAP32[(35456)>>2]|0;
|
|
$283 = 1 << $$0396;
|
|
$284 = $282 & $283;
|
|
$285 = ($284|0)==(0);
|
|
do {
|
|
if ($285) {
|
|
$286 = $282 | $283;
|
|
HEAP32[(35456)>>2] = $286;
|
|
HEAP32[$278>>2] = $$1;
|
|
$287 = ((($$1)) + 24|0);
|
|
HEAP32[$287>>2] = $278;
|
|
$288 = ((($$1)) + 12|0);
|
|
HEAP32[$288>>2] = $$1;
|
|
$289 = ((($$1)) + 8|0);
|
|
HEAP32[$289>>2] = $$1;
|
|
} else {
|
|
$290 = HEAP32[$278>>2]|0;
|
|
$291 = ($$0396|0)==(31);
|
|
$292 = $$0396 >>> 1;
|
|
$293 = (25 - ($292))|0;
|
|
$294 = $291 ? 0 : $293;
|
|
$295 = $$2 << $294;
|
|
$$0383 = $295;$$0384 = $290;
|
|
while(1) {
|
|
$296 = ((($$0384)) + 4|0);
|
|
$297 = HEAP32[$296>>2]|0;
|
|
$298 = $297 & -8;
|
|
$299 = ($298|0)==($$2|0);
|
|
if ($299) {
|
|
label = 126;
|
|
break;
|
|
}
|
|
$300 = $$0383 >>> 31;
|
|
$301 = (((($$0384)) + 16|0) + ($300<<2)|0);
|
|
$302 = $$0383 << 1;
|
|
$303 = HEAP32[$301>>2]|0;
|
|
$304 = ($303|0)==(0|0);
|
|
if ($304) {
|
|
label = 123;
|
|
break;
|
|
} else {
|
|
$$0383 = $302;$$0384 = $303;
|
|
}
|
|
}
|
|
if ((label|0) == 123) {
|
|
$305 = HEAP32[(35468)>>2]|0;
|
|
$306 = ($301>>>0)<($305>>>0);
|
|
if ($306) {
|
|
_abort();
|
|
// unreachable;
|
|
} else {
|
|
HEAP32[$301>>2] = $$1;
|
|
$307 = ((($$1)) + 24|0);
|
|
HEAP32[$307>>2] = $$0384;
|
|
$308 = ((($$1)) + 12|0);
|
|
HEAP32[$308>>2] = $$1;
|
|
$309 = ((($$1)) + 8|0);
|
|
HEAP32[$309>>2] = $$1;
|
|
break;
|
|
}
|
|
}
|
|
else if ((label|0) == 126) {
|
|
$310 = ((($$0384)) + 8|0);
|
|
$311 = HEAP32[$310>>2]|0;
|
|
$312 = HEAP32[(35468)>>2]|0;
|
|
$313 = ($311>>>0)>=($312>>>0);
|
|
$not$437 = ($$0384>>>0)>=($312>>>0);
|
|
$314 = $313 & $not$437;
|
|
if ($314) {
|
|
$315 = ((($311)) + 12|0);
|
|
HEAP32[$315>>2] = $$1;
|
|
HEAP32[$310>>2] = $$1;
|
|
$316 = ((($$1)) + 8|0);
|
|
HEAP32[$316>>2] = $311;
|
|
$317 = ((($$1)) + 12|0);
|
|
HEAP32[$317>>2] = $$0384;
|
|
$318 = ((($$1)) + 24|0);
|
|
HEAP32[$318>>2] = 0;
|
|
break;
|
|
} else {
|
|
_abort();
|
|
// unreachable;
|
|
}
|
|
}
|
|
}
|
|
} while(0);
|
|
$319 = HEAP32[(35484)>>2]|0;
|
|
$320 = (($319) + -1)|0;
|
|
HEAP32[(35484)>>2] = $320;
|
|
$321 = ($320|0)==(0);
|
|
if ($321) {
|
|
$$0212$in$i = (35936);
|
|
while(1) {
|
|
$$0212$i = HEAP32[$$0212$in$i>>2]|0;
|
|
$322 = ($$0212$i|0)==(0|0);
|
|
$323 = ((($$0212$i)) + 8|0);
|
|
if ($322) {
|
|
break;
|
|
} else {
|
|
$$0212$in$i = $323;
|
|
}
|
|
}
|
|
HEAP32[(35484)>>2] = -1;
|
|
}
|
|
}
|
|
} while(0);
|
|
$324 = HEAP32[(35896)>>2]|0;
|
|
$325 = $324 & 2;
|
|
$326 = ($325|0)==(0);
|
|
if ($326) {
|
|
return;
|
|
}
|
|
(___pthread_mutex_unlock((35900))|0);
|
|
return;
|
|
}
|
|
function runPostSets() {
|
|
}
|
|
function _memset(ptr, value, num) {
|
|
ptr = ptr|0; value = value|0; num = num|0;
|
|
var end = 0, aligned_end = 0, block_aligned_end = 0, value4 = 0;
|
|
end = (ptr + num)|0;
|
|
|
|
value = value & 0xff;
|
|
if ((num|0) >= 67 /* 64 bytes for an unrolled loop + 3 bytes for unaligned head*/) {
|
|
while ((ptr&3) != 0) {
|
|
HEAP8[((ptr)>>0)]=value;
|
|
ptr = (ptr+1)|0;
|
|
}
|
|
|
|
aligned_end = (end & -4)|0;
|
|
block_aligned_end = (aligned_end - 64)|0;
|
|
value4 = value | (value << 8) | (value << 16) | (value << 24);
|
|
|
|
while((ptr|0) <= (block_aligned_end|0)) {
|
|
HEAP32[((ptr)>>2)]=value4;
|
|
HEAP32[(((ptr)+(4))>>2)]=value4;
|
|
HEAP32[(((ptr)+(8))>>2)]=value4;
|
|
HEAP32[(((ptr)+(12))>>2)]=value4;
|
|
HEAP32[(((ptr)+(16))>>2)]=value4;
|
|
HEAP32[(((ptr)+(20))>>2)]=value4;
|
|
HEAP32[(((ptr)+(24))>>2)]=value4;
|
|
HEAP32[(((ptr)+(28))>>2)]=value4;
|
|
HEAP32[(((ptr)+(32))>>2)]=value4;
|
|
HEAP32[(((ptr)+(36))>>2)]=value4;
|
|
HEAP32[(((ptr)+(40))>>2)]=value4;
|
|
HEAP32[(((ptr)+(44))>>2)]=value4;
|
|
HEAP32[(((ptr)+(48))>>2)]=value4;
|
|
HEAP32[(((ptr)+(52))>>2)]=value4;
|
|
HEAP32[(((ptr)+(56))>>2)]=value4;
|
|
HEAP32[(((ptr)+(60))>>2)]=value4;
|
|
ptr = (ptr + 64)|0;
|
|
}
|
|
|
|
while ((ptr|0) < (aligned_end|0) ) {
|
|
HEAP32[((ptr)>>2)]=value4;
|
|
ptr = (ptr+4)|0;
|
|
}
|
|
}
|
|
// The remaining bytes.
|
|
while ((ptr|0) < (end|0)) {
|
|
HEAP8[((ptr)>>0)]=value;
|
|
ptr = (ptr+1)|0;
|
|
}
|
|
return (end-num)|0;
|
|
}
|
|
function _i64Subtract(a, b, c, d) {
|
|
a = a|0; b = b|0; c = c|0; d = d|0;
|
|
var l = 0, h = 0;
|
|
l = (a - c)>>>0;
|
|
h = (b - d)>>>0;
|
|
h = (b - d - (((c>>>0) > (a>>>0))|0))>>>0; // Borrow one from high word to low word on underflow.
|
|
return ((tempRet0 = h,l|0)|0);
|
|
}
|
|
function _i64Add(a, b, c, d) {
|
|
/*
|
|
x = a + b*2^32
|
|
y = c + d*2^32
|
|
result = l + h*2^32
|
|
*/
|
|
a = a|0; b = b|0; c = c|0; d = d|0;
|
|
var l = 0, h = 0;
|
|
l = (a + c)>>>0;
|
|
h = (b + d + (((l>>>0) < (a>>>0))|0))>>>0; // Add carry from low word to high word on overflow.
|
|
return ((tempRet0 = h,l|0)|0);
|
|
}
|
|
function ___muldsi3($a, $b) {
|
|
$a = $a | 0;
|
|
$b = $b | 0;
|
|
var $1 = 0, $2 = 0, $3 = 0, $6 = 0, $8 = 0, $11 = 0, $12 = 0;
|
|
$1 = $a & 65535;
|
|
$2 = $b & 65535;
|
|
$3 = Math_imul($2, $1) | 0;
|
|
$6 = $a >>> 16;
|
|
$8 = ($3 >>> 16) + (Math_imul($2, $6) | 0) | 0;
|
|
$11 = $b >>> 16;
|
|
$12 = Math_imul($11, $1) | 0;
|
|
return (tempRet0 = (($8 >>> 16) + (Math_imul($11, $6) | 0) | 0) + ((($8 & 65535) + $12 | 0) >>> 16) | 0, 0 | ($8 + $12 << 16 | $3 & 65535)) | 0;
|
|
}
|
|
function ___muldi3($a$0, $a$1, $b$0, $b$1) {
|
|
$a$0 = $a$0 | 0;
|
|
$a$1 = $a$1 | 0;
|
|
$b$0 = $b$0 | 0;
|
|
$b$1 = $b$1 | 0;
|
|
var $x_sroa_0_0_extract_trunc = 0, $y_sroa_0_0_extract_trunc = 0, $1$0 = 0, $1$1 = 0, $2 = 0;
|
|
$x_sroa_0_0_extract_trunc = $a$0;
|
|
$y_sroa_0_0_extract_trunc = $b$0;
|
|
$1$0 = ___muldsi3($x_sroa_0_0_extract_trunc, $y_sroa_0_0_extract_trunc) | 0;
|
|
$1$1 = tempRet0;
|
|
$2 = Math_imul($a$1, $y_sroa_0_0_extract_trunc) | 0;
|
|
return (tempRet0 = ((Math_imul($b$1, $x_sroa_0_0_extract_trunc) | 0) + $2 | 0) + $1$1 | $1$1 & 0, 0 | $1$0 & -1) | 0;
|
|
}
|
|
function _memcpy(dest, src, num) {
|
|
dest = dest|0; src = src|0; num = num|0;
|
|
var ret = 0;
|
|
var aligned_dest_end = 0;
|
|
var block_aligned_dest_end = 0;
|
|
var dest_end = 0;
|
|
// Test against a benchmarked cutoff limit for when HEAPU8.set() becomes faster to use.
|
|
if ((num|0) >=
|
|
8192
|
|
) {
|
|
return _emscripten_memcpy_big(dest|0, src|0, num|0)|0;
|
|
}
|
|
|
|
ret = dest|0;
|
|
dest_end = (dest + num)|0;
|
|
if ((dest&3) == (src&3)) {
|
|
// The initial unaligned < 4-byte front.
|
|
while (dest & 3) {
|
|
if ((num|0) == 0) return ret|0;
|
|
HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0);
|
|
dest = (dest+1)|0;
|
|
src = (src+1)|0;
|
|
num = (num-1)|0;
|
|
}
|
|
aligned_dest_end = (dest_end & -4)|0;
|
|
block_aligned_dest_end = (aligned_dest_end - 64)|0;
|
|
while ((dest|0) <= (block_aligned_dest_end|0) ) {
|
|
HEAP32[((dest)>>2)]=((HEAP32[((src)>>2)])|0);
|
|
HEAP32[(((dest)+(4))>>2)]=((HEAP32[(((src)+(4))>>2)])|0);
|
|
HEAP32[(((dest)+(8))>>2)]=((HEAP32[(((src)+(8))>>2)])|0);
|
|
HEAP32[(((dest)+(12))>>2)]=((HEAP32[(((src)+(12))>>2)])|0);
|
|
HEAP32[(((dest)+(16))>>2)]=((HEAP32[(((src)+(16))>>2)])|0);
|
|
HEAP32[(((dest)+(20))>>2)]=((HEAP32[(((src)+(20))>>2)])|0);
|
|
HEAP32[(((dest)+(24))>>2)]=((HEAP32[(((src)+(24))>>2)])|0);
|
|
HEAP32[(((dest)+(28))>>2)]=((HEAP32[(((src)+(28))>>2)])|0);
|
|
HEAP32[(((dest)+(32))>>2)]=((HEAP32[(((src)+(32))>>2)])|0);
|
|
HEAP32[(((dest)+(36))>>2)]=((HEAP32[(((src)+(36))>>2)])|0);
|
|
HEAP32[(((dest)+(40))>>2)]=((HEAP32[(((src)+(40))>>2)])|0);
|
|
HEAP32[(((dest)+(44))>>2)]=((HEAP32[(((src)+(44))>>2)])|0);
|
|
HEAP32[(((dest)+(48))>>2)]=((HEAP32[(((src)+(48))>>2)])|0);
|
|
HEAP32[(((dest)+(52))>>2)]=((HEAP32[(((src)+(52))>>2)])|0);
|
|
HEAP32[(((dest)+(56))>>2)]=((HEAP32[(((src)+(56))>>2)])|0);
|
|
HEAP32[(((dest)+(60))>>2)]=((HEAP32[(((src)+(60))>>2)])|0);
|
|
dest = (dest+64)|0;
|
|
src = (src+64)|0;
|
|
}
|
|
while ((dest|0) < (aligned_dest_end|0) ) {
|
|
HEAP32[((dest)>>2)]=((HEAP32[((src)>>2)])|0);
|
|
dest = (dest+4)|0;
|
|
src = (src+4)|0;
|
|
}
|
|
} else {
|
|
// In the unaligned copy case, unroll a bit as well.
|
|
aligned_dest_end = (dest_end - 4)|0;
|
|
while ((dest|0) < (aligned_dest_end|0) ) {
|
|
HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0);
|
|
HEAP8[(((dest)+(1))>>0)]=((HEAP8[(((src)+(1))>>0)])|0);
|
|
HEAP8[(((dest)+(2))>>0)]=((HEAP8[(((src)+(2))>>0)])|0);
|
|
HEAP8[(((dest)+(3))>>0)]=((HEAP8[(((src)+(3))>>0)])|0);
|
|
dest = (dest+4)|0;
|
|
src = (src+4)|0;
|
|
}
|
|
}
|
|
// The remaining unaligned < 4 byte tail.
|
|
while ((dest|0) < (dest_end|0)) {
|
|
HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0);
|
|
dest = (dest+1)|0;
|
|
src = (src+1)|0;
|
|
}
|
|
return ret|0;
|
|
}
|
|
function _memmove(dest, src, num) {
|
|
dest = dest|0; src = src|0; num = num|0;
|
|
var ret = 0;
|
|
if (((src|0) < (dest|0)) & ((dest|0) < ((src + num)|0))) {
|
|
// Unlikely case: Copy backwards in a safe manner
|
|
ret = dest;
|
|
src = (src + num)|0;
|
|
dest = (dest + num)|0;
|
|
while ((num|0) > 0) {
|
|
dest = (dest - 1)|0;
|
|
src = (src - 1)|0;
|
|
num = (num - 1)|0;
|
|
HEAP8[((dest)>>0)]=((HEAP8[((src)>>0)])|0);
|
|
}
|
|
dest = ret;
|
|
} else {
|
|
_memcpy(dest, src, num) | 0;
|
|
}
|
|
return dest | 0;
|
|
}
|
|
function _llvm_cttz_i32(x) {
|
|
x = x|0;
|
|
var ret = 0;
|
|
ret = ((HEAP8[(((cttz_i8)+(x & 0xff))>>0)])|0);
|
|
if ((ret|0) < 8) return ret|0;
|
|
ret = ((HEAP8[(((cttz_i8)+((x >> 8)&0xff))>>0)])|0);
|
|
if ((ret|0) < 8) return (ret + 8)|0;
|
|
ret = ((HEAP8[(((cttz_i8)+((x >> 16)&0xff))>>0)])|0);
|
|
if ((ret|0) < 8) return (ret + 16)|0;
|
|
return (((HEAP8[(((cttz_i8)+(x >>> 24))>>0)])|0) + 24)|0;
|
|
}
|
|
function ___udivmoddi4($a$0, $a$1, $b$0, $b$1, $rem) {
|
|
$a$0 = $a$0 | 0;
|
|
$a$1 = $a$1 | 0;
|
|
$b$0 = $b$0 | 0;
|
|
$b$1 = $b$1 | 0;
|
|
$rem = $rem | 0;
|
|
var $n_sroa_0_0_extract_trunc = 0, $n_sroa_1_4_extract_shift$0 = 0, $n_sroa_1_4_extract_trunc = 0, $d_sroa_0_0_extract_trunc = 0, $d_sroa_1_4_extract_shift$0 = 0, $d_sroa_1_4_extract_trunc = 0, $4 = 0, $17 = 0, $37 = 0, $49 = 0, $51 = 0, $57 = 0, $58 = 0, $66 = 0, $78 = 0, $86 = 0, $88 = 0, $89 = 0, $91 = 0, $92 = 0, $95 = 0, $105 = 0, $117 = 0, $119 = 0, $125 = 0, $126 = 0, $130 = 0, $q_sroa_1_1_ph = 0, $q_sroa_0_1_ph = 0, $r_sroa_1_1_ph = 0, $r_sroa_0_1_ph = 0, $sr_1_ph = 0, $d_sroa_0_0_insert_insert99$0 = 0, $d_sroa_0_0_insert_insert99$1 = 0, $137$0 = 0, $137$1 = 0, $carry_0203 = 0, $sr_1202 = 0, $r_sroa_0_1201 = 0, $r_sroa_1_1200 = 0, $q_sroa_0_1199 = 0, $q_sroa_1_1198 = 0, $147 = 0, $149 = 0, $r_sroa_0_0_insert_insert42$0 = 0, $r_sroa_0_0_insert_insert42$1 = 0, $150$1 = 0, $151$0 = 0, $152 = 0, $154$0 = 0, $r_sroa_0_0_extract_trunc = 0, $r_sroa_1_4_extract_trunc = 0, $155 = 0, $carry_0_lcssa$0 = 0, $carry_0_lcssa$1 = 0, $r_sroa_0_1_lcssa = 0, $r_sroa_1_1_lcssa = 0, $q_sroa_0_1_lcssa = 0, $q_sroa_1_1_lcssa = 0, $q_sroa_0_0_insert_ext75$0 = 0, $q_sroa_0_0_insert_ext75$1 = 0, $q_sroa_0_0_insert_insert77$1 = 0, $_0$0 = 0, $_0$1 = 0;
|
|
$n_sroa_0_0_extract_trunc = $a$0;
|
|
$n_sroa_1_4_extract_shift$0 = $a$1;
|
|
$n_sroa_1_4_extract_trunc = $n_sroa_1_4_extract_shift$0;
|
|
$d_sroa_0_0_extract_trunc = $b$0;
|
|
$d_sroa_1_4_extract_shift$0 = $b$1;
|
|
$d_sroa_1_4_extract_trunc = $d_sroa_1_4_extract_shift$0;
|
|
if (($n_sroa_1_4_extract_trunc | 0) == 0) {
|
|
$4 = ($rem | 0) != 0;
|
|
if (($d_sroa_1_4_extract_trunc | 0) == 0) {
|
|
if ($4) {
|
|
HEAP32[$rem >> 2] = ($n_sroa_0_0_extract_trunc >>> 0) % ($d_sroa_0_0_extract_trunc >>> 0);
|
|
HEAP32[$rem + 4 >> 2] = 0;
|
|
}
|
|
$_0$1 = 0;
|
|
$_0$0 = ($n_sroa_0_0_extract_trunc >>> 0) / ($d_sroa_0_0_extract_trunc >>> 0) >>> 0;
|
|
return (tempRet0 = $_0$1, $_0$0) | 0;
|
|
} else {
|
|
if (!$4) {
|
|
$_0$1 = 0;
|
|
$_0$0 = 0;
|
|
return (tempRet0 = $_0$1, $_0$0) | 0;
|
|
}
|
|
HEAP32[$rem >> 2] = $a$0 & -1;
|
|
HEAP32[$rem + 4 >> 2] = $a$1 & 0;
|
|
$_0$1 = 0;
|
|
$_0$0 = 0;
|
|
return (tempRet0 = $_0$1, $_0$0) | 0;
|
|
}
|
|
}
|
|
$17 = ($d_sroa_1_4_extract_trunc | 0) == 0;
|
|
do {
|
|
if (($d_sroa_0_0_extract_trunc | 0) == 0) {
|
|
if ($17) {
|
|
if (($rem | 0) != 0) {
|
|
HEAP32[$rem >> 2] = ($n_sroa_1_4_extract_trunc >>> 0) % ($d_sroa_0_0_extract_trunc >>> 0);
|
|
HEAP32[$rem + 4 >> 2] = 0;
|
|
}
|
|
$_0$1 = 0;
|
|
$_0$0 = ($n_sroa_1_4_extract_trunc >>> 0) / ($d_sroa_0_0_extract_trunc >>> 0) >>> 0;
|
|
return (tempRet0 = $_0$1, $_0$0) | 0;
|
|
}
|
|
if (($n_sroa_0_0_extract_trunc | 0) == 0) {
|
|
if (($rem | 0) != 0) {
|
|
HEAP32[$rem >> 2] = 0;
|
|
HEAP32[$rem + 4 >> 2] = ($n_sroa_1_4_extract_trunc >>> 0) % ($d_sroa_1_4_extract_trunc >>> 0);
|
|
}
|
|
$_0$1 = 0;
|
|
$_0$0 = ($n_sroa_1_4_extract_trunc >>> 0) / ($d_sroa_1_4_extract_trunc >>> 0) >>> 0;
|
|
return (tempRet0 = $_0$1, $_0$0) | 0;
|
|
}
|
|
$37 = $d_sroa_1_4_extract_trunc - 1 | 0;
|
|
if (($37 & $d_sroa_1_4_extract_trunc | 0) == 0) {
|
|
if (($rem | 0) != 0) {
|
|
HEAP32[$rem >> 2] = 0 | $a$0 & -1;
|
|
HEAP32[$rem + 4 >> 2] = $37 & $n_sroa_1_4_extract_trunc | $a$1 & 0;
|
|
}
|
|
$_0$1 = 0;
|
|
$_0$0 = $n_sroa_1_4_extract_trunc >>> ((_llvm_cttz_i32($d_sroa_1_4_extract_trunc | 0) | 0) >>> 0);
|
|
return (tempRet0 = $_0$1, $_0$0) | 0;
|
|
}
|
|
$49 = Math_clz32($d_sroa_1_4_extract_trunc | 0) | 0;
|
|
$51 = $49 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0;
|
|
if ($51 >>> 0 <= 30) {
|
|
$57 = $51 + 1 | 0;
|
|
$58 = 31 - $51 | 0;
|
|
$sr_1_ph = $57;
|
|
$r_sroa_0_1_ph = $n_sroa_1_4_extract_trunc << $58 | $n_sroa_0_0_extract_trunc >>> ($57 >>> 0);
|
|
$r_sroa_1_1_ph = $n_sroa_1_4_extract_trunc >>> ($57 >>> 0);
|
|
$q_sroa_0_1_ph = 0;
|
|
$q_sroa_1_1_ph = $n_sroa_0_0_extract_trunc << $58;
|
|
break;
|
|
}
|
|
if (($rem | 0) == 0) {
|
|
$_0$1 = 0;
|
|
$_0$0 = 0;
|
|
return (tempRet0 = $_0$1, $_0$0) | 0;
|
|
}
|
|
HEAP32[$rem >> 2] = 0 | $a$0 & -1;
|
|
HEAP32[$rem + 4 >> 2] = $n_sroa_1_4_extract_shift$0 | $a$1 & 0;
|
|
$_0$1 = 0;
|
|
$_0$0 = 0;
|
|
return (tempRet0 = $_0$1, $_0$0) | 0;
|
|
} else {
|
|
if (!$17) {
|
|
$117 = Math_clz32($d_sroa_1_4_extract_trunc | 0) | 0;
|
|
$119 = $117 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0;
|
|
if ($119 >>> 0 <= 31) {
|
|
$125 = $119 + 1 | 0;
|
|
$126 = 31 - $119 | 0;
|
|
$130 = $119 - 31 >> 31;
|
|
$sr_1_ph = $125;
|
|
$r_sroa_0_1_ph = $n_sroa_0_0_extract_trunc >>> ($125 >>> 0) & $130 | $n_sroa_1_4_extract_trunc << $126;
|
|
$r_sroa_1_1_ph = $n_sroa_1_4_extract_trunc >>> ($125 >>> 0) & $130;
|
|
$q_sroa_0_1_ph = 0;
|
|
$q_sroa_1_1_ph = $n_sroa_0_0_extract_trunc << $126;
|
|
break;
|
|
}
|
|
if (($rem | 0) == 0) {
|
|
$_0$1 = 0;
|
|
$_0$0 = 0;
|
|
return (tempRet0 = $_0$1, $_0$0) | 0;
|
|
}
|
|
HEAP32[$rem >> 2] = 0 | $a$0 & -1;
|
|
HEAP32[$rem + 4 >> 2] = $n_sroa_1_4_extract_shift$0 | $a$1 & 0;
|
|
$_0$1 = 0;
|
|
$_0$0 = 0;
|
|
return (tempRet0 = $_0$1, $_0$0) | 0;
|
|
}
|
|
$66 = $d_sroa_0_0_extract_trunc - 1 | 0;
|
|
if (($66 & $d_sroa_0_0_extract_trunc | 0) != 0) {
|
|
$86 = (Math_clz32($d_sroa_0_0_extract_trunc | 0) | 0) + 33 | 0;
|
|
$88 = $86 - (Math_clz32($n_sroa_1_4_extract_trunc | 0) | 0) | 0;
|
|
$89 = 64 - $88 | 0;
|
|
$91 = 32 - $88 | 0;
|
|
$92 = $91 >> 31;
|
|
$95 = $88 - 32 | 0;
|
|
$105 = $95 >> 31;
|
|
$sr_1_ph = $88;
|
|
$r_sroa_0_1_ph = $91 - 1 >> 31 & $n_sroa_1_4_extract_trunc >>> ($95 >>> 0) | ($n_sroa_1_4_extract_trunc << $91 | $n_sroa_0_0_extract_trunc >>> ($88 >>> 0)) & $105;
|
|
$r_sroa_1_1_ph = $105 & $n_sroa_1_4_extract_trunc >>> ($88 >>> 0);
|
|
$q_sroa_0_1_ph = $n_sroa_0_0_extract_trunc << $89 & $92;
|
|
$q_sroa_1_1_ph = ($n_sroa_1_4_extract_trunc << $89 | $n_sroa_0_0_extract_trunc >>> ($95 >>> 0)) & $92 | $n_sroa_0_0_extract_trunc << $91 & $88 - 33 >> 31;
|
|
break;
|
|
}
|
|
if (($rem | 0) != 0) {
|
|
HEAP32[$rem >> 2] = $66 & $n_sroa_0_0_extract_trunc;
|
|
HEAP32[$rem + 4 >> 2] = 0;
|
|
}
|
|
if (($d_sroa_0_0_extract_trunc | 0) == 1) {
|
|
$_0$1 = $n_sroa_1_4_extract_shift$0 | $a$1 & 0;
|
|
$_0$0 = 0 | $a$0 & -1;
|
|
return (tempRet0 = $_0$1, $_0$0) | 0;
|
|
} else {
|
|
$78 = _llvm_cttz_i32($d_sroa_0_0_extract_trunc | 0) | 0;
|
|
$_0$1 = 0 | $n_sroa_1_4_extract_trunc >>> ($78 >>> 0);
|
|
$_0$0 = $n_sroa_1_4_extract_trunc << 32 - $78 | $n_sroa_0_0_extract_trunc >>> ($78 >>> 0) | 0;
|
|
return (tempRet0 = $_0$1, $_0$0) | 0;
|
|
}
|
|
}
|
|
} while (0);
|
|
if (($sr_1_ph | 0) == 0) {
|
|
$q_sroa_1_1_lcssa = $q_sroa_1_1_ph;
|
|
$q_sroa_0_1_lcssa = $q_sroa_0_1_ph;
|
|
$r_sroa_1_1_lcssa = $r_sroa_1_1_ph;
|
|
$r_sroa_0_1_lcssa = $r_sroa_0_1_ph;
|
|
$carry_0_lcssa$1 = 0;
|
|
$carry_0_lcssa$0 = 0;
|
|
} else {
|
|
$d_sroa_0_0_insert_insert99$0 = 0 | $b$0 & -1;
|
|
$d_sroa_0_0_insert_insert99$1 = $d_sroa_1_4_extract_shift$0 | $b$1 & 0;
|
|
$137$0 = _i64Add($d_sroa_0_0_insert_insert99$0 | 0, $d_sroa_0_0_insert_insert99$1 | 0, -1, -1) | 0;
|
|
$137$1 = tempRet0;
|
|
$q_sroa_1_1198 = $q_sroa_1_1_ph;
|
|
$q_sroa_0_1199 = $q_sroa_0_1_ph;
|
|
$r_sroa_1_1200 = $r_sroa_1_1_ph;
|
|
$r_sroa_0_1201 = $r_sroa_0_1_ph;
|
|
$sr_1202 = $sr_1_ph;
|
|
$carry_0203 = 0;
|
|
while (1) {
|
|
$147 = $q_sroa_0_1199 >>> 31 | $q_sroa_1_1198 << 1;
|
|
$149 = $carry_0203 | $q_sroa_0_1199 << 1;
|
|
$r_sroa_0_0_insert_insert42$0 = 0 | ($r_sroa_0_1201 << 1 | $q_sroa_1_1198 >>> 31);
|
|
$r_sroa_0_0_insert_insert42$1 = $r_sroa_0_1201 >>> 31 | $r_sroa_1_1200 << 1 | 0;
|
|
_i64Subtract($137$0 | 0, $137$1 | 0, $r_sroa_0_0_insert_insert42$0 | 0, $r_sroa_0_0_insert_insert42$1 | 0) | 0;
|
|
$150$1 = tempRet0;
|
|
$151$0 = $150$1 >> 31 | (($150$1 | 0) < 0 ? -1 : 0) << 1;
|
|
$152 = $151$0 & 1;
|
|
$154$0 = _i64Subtract($r_sroa_0_0_insert_insert42$0 | 0, $r_sroa_0_0_insert_insert42$1 | 0, $151$0 & $d_sroa_0_0_insert_insert99$0 | 0, ((($150$1 | 0) < 0 ? -1 : 0) >> 31 | (($150$1 | 0) < 0 ? -1 : 0) << 1) & $d_sroa_0_0_insert_insert99$1 | 0) | 0;
|
|
$r_sroa_0_0_extract_trunc = $154$0;
|
|
$r_sroa_1_4_extract_trunc = tempRet0;
|
|
$155 = $sr_1202 - 1 | 0;
|
|
if (($155 | 0) == 0) {
|
|
break;
|
|
} else {
|
|
$q_sroa_1_1198 = $147;
|
|
$q_sroa_0_1199 = $149;
|
|
$r_sroa_1_1200 = $r_sroa_1_4_extract_trunc;
|
|
$r_sroa_0_1201 = $r_sroa_0_0_extract_trunc;
|
|
$sr_1202 = $155;
|
|
$carry_0203 = $152;
|
|
}
|
|
}
|
|
$q_sroa_1_1_lcssa = $147;
|
|
$q_sroa_0_1_lcssa = $149;
|
|
$r_sroa_1_1_lcssa = $r_sroa_1_4_extract_trunc;
|
|
$r_sroa_0_1_lcssa = $r_sroa_0_0_extract_trunc;
|
|
$carry_0_lcssa$1 = 0;
|
|
$carry_0_lcssa$0 = $152;
|
|
}
|
|
$q_sroa_0_0_insert_ext75$0 = $q_sroa_0_1_lcssa;
|
|
$q_sroa_0_0_insert_ext75$1 = 0;
|
|
$q_sroa_0_0_insert_insert77$1 = $q_sroa_1_1_lcssa | $q_sroa_0_0_insert_ext75$1;
|
|
if (($rem | 0) != 0) {
|
|
HEAP32[$rem >> 2] = 0 | $r_sroa_0_1_lcssa;
|
|
HEAP32[$rem + 4 >> 2] = $r_sroa_1_1_lcssa | 0;
|
|
}
|
|
$_0$1 = (0 | $q_sroa_0_0_insert_ext75$0) >>> 31 | $q_sroa_0_0_insert_insert77$1 << 1 | ($q_sroa_0_0_insert_ext75$1 << 1 | $q_sroa_0_0_insert_ext75$0 >>> 31) & 0 | $carry_0_lcssa$1;
|
|
$_0$0 = ($q_sroa_0_0_insert_ext75$0 << 1 | 0 >>> 31) & -2 | $carry_0_lcssa$0;
|
|
return (tempRet0 = $_0$1, $_0$0) | 0;
|
|
}
|
|
function ___uremdi3($a$0, $a$1, $b$0, $b$1) {
|
|
$a$0 = $a$0 | 0;
|
|
$a$1 = $a$1 | 0;
|
|
$b$0 = $b$0 | 0;
|
|
$b$1 = $b$1 | 0;
|
|
var $rem = 0, __stackBase__ = 0;
|
|
__stackBase__ = STACKTOP;
|
|
STACKTOP = STACKTOP + 16 | 0;
|
|
$rem = __stackBase__ | 0;
|
|
___udivmoddi4($a$0, $a$1, $b$0, $b$1, $rem) | 0;
|
|
STACKTOP = __stackBase__;
|
|
return (tempRet0 = HEAP32[$rem + 4 >> 2] | 0, HEAP32[$rem >> 2] | 0) | 0;
|
|
}
|
|
function ___udivdi3($a$0, $a$1, $b$0, $b$1) {
|
|
$a$0 = $a$0 | 0;
|
|
$a$1 = $a$1 | 0;
|
|
$b$0 = $b$0 | 0;
|
|
$b$1 = $b$1 | 0;
|
|
var $1$0 = 0;
|
|
$1$0 = ___udivmoddi4($a$0, $a$1, $b$0, $b$1, 0) | 0;
|
|
return $1$0 | 0;
|
|
}
|
|
function _roundf(f) {
|
|
f = +f;
|
|
return f >= +0 ? +Math_floor(f + +0.5) : +Math_ceil(f - +0.5); // TODO: use fround?
|
|
}
|
|
function _emscripten_set_current_thread_status(newStatus) {
|
|
newStatus = newStatus|0;
|
|
}
|
|
function _bitshift64Lshr(low, high, bits) {
|
|
low = low|0; high = high|0; bits = bits|0;
|
|
var ander = 0;
|
|
if ((bits|0) < 32) {
|
|
ander = ((1 << bits) - 1)|0;
|
|
tempRet0 = high >>> bits;
|
|
return (low >>> bits) | ((high&ander) << (32 - bits));
|
|
}
|
|
tempRet0 = 0;
|
|
return (high >>> (bits - 32))|0;
|
|
}
|
|
function _emscripten_conditional_set_current_thread_status(expectedStatus, newStatus) {
|
|
expectedStatus = expectedStatus|0;
|
|
newStatus = newStatus|0;
|
|
}
|
|
function _sbrk(increment) {
|
|
increment = increment|0;
|
|
var oldDynamicTop = 0;
|
|
var oldDynamicTopOnChange = 0;
|
|
var newDynamicTop = 0;
|
|
var totalMemory = 0;
|
|
increment = ((increment + 15) & -16)|0;
|
|
totalMemory = getTotalMemory()|0;
|
|
|
|
// Perform a compare-and-swap loop to update the new dynamic top value. This is because
|
|
// this function can becalled simultaneously in multiple threads.
|
|
do {
|
|
oldDynamicTop = Atomics_load(HEAP32, DYNAMICTOP_PTR>>2)|0;
|
|
newDynamicTop = oldDynamicTop + increment | 0;
|
|
// Asking to increase dynamic top to a too high value? In pthreads builds we cannot
|
|
// enlarge memory, so this needs to fail.
|
|
if (((increment|0) > 0 & (newDynamicTop|0) < (oldDynamicTop|0)) // Detect and fail if we would wrap around signed 32-bit int.
|
|
| (newDynamicTop|0) < 0 // Also underflow, sbrk() should be able to be used to subtract.
|
|
| (newDynamicTop|0) > (totalMemory|0)) {
|
|
abortOnCannotGrowMemory()|0;
|
|
}
|
|
// Attempt to update the dynamic top to new value. Another thread may have beat this thread to the update,
|
|
// in which case we will need to start over by iterating the loop body again.
|
|
oldDynamicTopOnChange = Atomics_compareExchange(HEAP32, DYNAMICTOP_PTR>>2, oldDynamicTop|0, newDynamicTop|0)|0;
|
|
} while((oldDynamicTopOnChange|0) != (oldDynamicTop|0));
|
|
return oldDynamicTop|0;
|
|
}
|
|
function _bitshift64Shl(low, high, bits) {
|
|
low = low|0; high = high|0; bits = bits|0;
|
|
var ander = 0;
|
|
if ((bits|0) < 32) {
|
|
ander = ((1 << bits) - 1)|0;
|
|
tempRet0 = (high << bits) | ((low&(ander << (32 - bits))) >>> (32 - bits));
|
|
return low << bits;
|
|
}
|
|
tempRet0 = low << (bits - 32);
|
|
return 0;
|
|
}
|
|
function _llvm_bswap_i32(x) {
|
|
x = x|0;
|
|
return (((x&0xff)<<24) | (((x>>8)&0xff)<<16) | (((x>>16)&0xff)<<8) | (x>>>24))|0;
|
|
}
|
|
|
|
|
|
function dynCall_viiiii(index,a1,a2,a3,a4,a5) {
|
|
index = index|0;
|
|
a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0;
|
|
FUNCTION_TABLE_viiiii[index&7](a1|0,a2|0,a3|0,a4|0,a5|0);
|
|
}
|
|
|
|
|
|
function dynCall_vd(index,a1) {
|
|
index = index|0;
|
|
a1=+a1;
|
|
FUNCTION_TABLE_vd[index&3](+a1);
|
|
}
|
|
|
|
|
|
function dynCall_vid(index,a1,a2) {
|
|
index = index|0;
|
|
a1=a1|0; a2=+a2;
|
|
FUNCTION_TABLE_vid[index&3](a1|0,+a2);
|
|
}
|
|
|
|
|
|
function dynCall_vi(index,a1) {
|
|
index = index|0;
|
|
a1=a1|0;
|
|
FUNCTION_TABLE_vi[index&31](a1|0);
|
|
}
|
|
|
|
|
|
function dynCall_vii(index,a1,a2) {
|
|
index = index|0;
|
|
a1=a1|0; a2=a2|0;
|
|
FUNCTION_TABLE_vii[index&63](a1|0,a2|0);
|
|
}
|
|
|
|
|
|
function dynCall_ii(index,a1) {
|
|
index = index|0;
|
|
a1=a1|0;
|
|
return FUNCTION_TABLE_ii[index&15](a1|0)|0;
|
|
}
|
|
|
|
|
|
function dynCall_viddd(index,a1,a2,a3,a4) {
|
|
index = index|0;
|
|
a1=a1|0; a2=+a2; a3=+a3; a4=+a4;
|
|
FUNCTION_TABLE_viddd[index&3](a1|0,+a2,+a3,+a4);
|
|
}
|
|
|
|
|
|
function dynCall_vidd(index,a1,a2,a3) {
|
|
index = index|0;
|
|
a1=a1|0; a2=+a2; a3=+a3;
|
|
FUNCTION_TABLE_vidd[index&7](a1|0,+a2,+a3);
|
|
}
|
|
|
|
|
|
function dynCall_iiii(index,a1,a2,a3) {
|
|
index = index|0;
|
|
a1=a1|0; a2=a2|0; a3=a3|0;
|
|
return FUNCTION_TABLE_iiii[index&15](a1|0,a2|0,a3|0)|0;
|
|
}
|
|
|
|
|
|
function dynCall_viiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8) {
|
|
index = index|0;
|
|
a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; a6=a6|0; a7=a7|0; a8=a8|0;
|
|
FUNCTION_TABLE_viiiiiiii[index&3](a1|0,a2|0,a3|0,a4|0,a5|0,a6|0,a7|0,a8|0);
|
|
}
|
|
|
|
|
|
function dynCall_viiiiii(index,a1,a2,a3,a4,a5,a6) {
|
|
index = index|0;
|
|
a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; a6=a6|0;
|
|
FUNCTION_TABLE_viiiiii[index&3](a1|0,a2|0,a3|0,a4|0,a5|0,a6|0);
|
|
}
|
|
|
|
|
|
function dynCall_viii(index,a1,a2,a3) {
|
|
index = index|0;
|
|
a1=a1|0; a2=a2|0; a3=a3|0;
|
|
FUNCTION_TABLE_viii[index&31](a1|0,a2|0,a3|0);
|
|
}
|
|
|
|
|
|
function dynCall_vidddd(index,a1,a2,a3,a4,a5) {
|
|
index = index|0;
|
|
a1=a1|0; a2=+a2; a3=+a3; a4=+a4; a5=+a5;
|
|
FUNCTION_TABLE_vidddd[index&3](a1|0,+a2,+a3,+a4,+a5);
|
|
}
|
|
|
|
|
|
function dynCall_vdi(index,a1,a2) {
|
|
index = index|0;
|
|
a1=+a1; a2=a2|0;
|
|
FUNCTION_TABLE_vdi[index&1](+a1,a2|0);
|
|
}
|
|
|
|
|
|
function dynCall_viiiiiii(index,a1,a2,a3,a4,a5,a6,a7) {
|
|
index = index|0;
|
|
a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; a6=a6|0; a7=a7|0;
|
|
FUNCTION_TABLE_viiiiiii[index&3](a1|0,a2|0,a3|0,a4|0,a5|0,a6|0,a7|0);
|
|
}
|
|
|
|
|
|
function dynCall_viiiiiiiii(index,a1,a2,a3,a4,a5,a6,a7,a8,a9) {
|
|
index = index|0;
|
|
a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0; a5=a5|0; a6=a6|0; a7=a7|0; a8=a8|0; a9=a9|0;
|
|
FUNCTION_TABLE_viiiiiiiii[index&3](a1|0,a2|0,a3|0,a4|0,a5|0,a6|0,a7|0,a8|0,a9|0);
|
|
}
|
|
|
|
|
|
function dynCall_iii(index,a1,a2) {
|
|
index = index|0;
|
|
a1=a1|0; a2=a2|0;
|
|
return FUNCTION_TABLE_iii[index&3](a1|0,a2|0)|0;
|
|
}
|
|
|
|
|
|
function dynCall_i(index) {
|
|
index = index|0;
|
|
|
|
return FUNCTION_TABLE_i[index&3]()|0;
|
|
}
|
|
|
|
|
|
function dynCall_vdddddd(index,a1,a2,a3,a4,a5,a6) {
|
|
index = index|0;
|
|
a1=+a1; a2=+a2; a3=+a3; a4=+a4; a5=+a5; a6=+a6;
|
|
FUNCTION_TABLE_vdddddd[index&1](+a1,+a2,+a3,+a4,+a5,+a6);
|
|
}
|
|
|
|
|
|
function dynCall_vdddd(index,a1,a2,a3,a4) {
|
|
index = index|0;
|
|
a1=+a1; a2=+a2; a3=+a3; a4=+a4;
|
|
FUNCTION_TABLE_vdddd[index&3](+a1,+a2,+a3,+a4);
|
|
}
|
|
|
|
|
|
function dynCall_vdd(index,a1,a2) {
|
|
index = index|0;
|
|
a1=+a1; a2=+a2;
|
|
FUNCTION_TABLE_vdd[index&3](+a1,+a2);
|
|
}
|
|
|
|
|
|
function dynCall_v(index) {
|
|
index = index|0;
|
|
|
|
FUNCTION_TABLE_v[index&7]();
|
|
}
|
|
|
|
|
|
function dynCall_viid(index,a1,a2,a3) {
|
|
index = index|0;
|
|
a1=a1|0; a2=a2|0; a3=+a3;
|
|
FUNCTION_TABLE_viid[index&1](a1|0,a2|0,+a3);
|
|
}
|
|
|
|
|
|
function dynCall_viiii(index,a1,a2,a3,a4) {
|
|
index = index|0;
|
|
a1=a1|0; a2=a2|0; a3=a3|0; a4=a4|0;
|
|
FUNCTION_TABLE_viiii[index&31](a1|0,a2|0,a3|0,a4|0);
|
|
}
|
|
|
|
function b0(p0,p1,p2,p3,p4) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; nullFunc_viiiii(0);
|
|
}
|
|
function _emscripten_glUniform4i__wrapper(p0,p1,p2,p3,p4) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; _emscripten_glUniform4i(p0|0,p1|0,p2|0,p3|0,p4|0);
|
|
}
|
|
function _emscripten_glFramebufferTexture2D__wrapper(p0,p1,p2,p3,p4) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; _emscripten_glFramebufferTexture2D(p0|0,p1|0,p2|0,p3|0,p4|0);
|
|
}
|
|
function _emscripten_glShaderBinary__wrapper(p0,p1,p2,p3,p4) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; _emscripten_glShaderBinary(p0|0,p1|0,p2|0,p3|0,p4|0);
|
|
}
|
|
function _emscripten_glDrawElementsInstanced__wrapper(p0,p1,p2,p3,p4) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0; _emscripten_glDrawElementsInstanced(p0|0,p1|0,p2|0,p3|0,p4|0);
|
|
}
|
|
function b1(p0) {
|
|
p0 = +p0; nullFunc_vd(1);
|
|
}
|
|
function _emscripten_glClearDepth__wrapper(p0) {
|
|
p0 = +p0; _emscripten_glClearDepth(+p0);
|
|
}
|
|
function _emscripten_glClearDepthf__wrapper(p0) {
|
|
p0 = +p0; _emscripten_glClearDepthf(+p0);
|
|
}
|
|
function _emscripten_glLineWidth__wrapper(p0) {
|
|
p0 = +p0; _emscripten_glLineWidth(+p0);
|
|
}
|
|
function b2(p0,p1) {
|
|
p0 = p0|0;p1 = +p1; nullFunc_vid(2);
|
|
}
|
|
function _emscripten_glUniform1f__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = +p1; _emscripten_glUniform1f(p0|0,+p1);
|
|
}
|
|
function _emscripten_glVertexAttrib1f__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = +p1; _emscripten_glVertexAttrib1f(p0|0,+p1);
|
|
}
|
|
function b3(p0) {
|
|
p0 = p0|0; nullFunc_vi(3);
|
|
}
|
|
function _emscripten_glDeleteShader__wrapper(p0) {
|
|
p0 = p0|0; _emscripten_glDeleteShader(p0|0);
|
|
}
|
|
function _emscripten_glCompileShader__wrapper(p0) {
|
|
p0 = p0|0; _emscripten_glCompileShader(p0|0);
|
|
}
|
|
function _emscripten_glDeleteProgram__wrapper(p0) {
|
|
p0 = p0|0; _emscripten_glDeleteProgram(p0|0);
|
|
}
|
|
function _emscripten_glLinkProgram__wrapper(p0) {
|
|
p0 = p0|0; _emscripten_glLinkProgram(p0|0);
|
|
}
|
|
function _emscripten_glUseProgram__wrapper(p0) {
|
|
p0 = p0|0; _emscripten_glUseProgram(p0|0);
|
|
}
|
|
function _emscripten_glValidateProgram__wrapper(p0) {
|
|
p0 = p0|0; _emscripten_glValidateProgram(p0|0);
|
|
}
|
|
function _emscripten_glDeleteObjectARB__wrapper(p0) {
|
|
p0 = p0|0; _emscripten_glDeleteObjectARB(p0|0);
|
|
}
|
|
function _emscripten_glEnableClientState__wrapper(p0) {
|
|
p0 = p0|0; _emscripten_glEnableClientState(p0|0);
|
|
}
|
|
function _emscripten_glClientActiveTexture__wrapper(p0) {
|
|
p0 = p0|0; _emscripten_glClientActiveTexture(p0|0);
|
|
}
|
|
function _emscripten_glBindVertexArray__wrapper(p0) {
|
|
p0 = p0|0; _emscripten_glBindVertexArray(p0|0);
|
|
}
|
|
function _emscripten_glMatrixMode__wrapper(p0) {
|
|
p0 = p0|0; _emscripten_glMatrixMode(p0|0);
|
|
}
|
|
function _emscripten_glLoadMatrixf__wrapper(p0) {
|
|
p0 = p0|0; _emscripten_glLoadMatrixf(p0|0);
|
|
}
|
|
function _emscripten_glEnableVertexAttribArray__wrapper(p0) {
|
|
p0 = p0|0; _emscripten_glEnableVertexAttribArray(p0|0);
|
|
}
|
|
function _emscripten_glDisableVertexAttribArray__wrapper(p0) {
|
|
p0 = p0|0; _emscripten_glDisableVertexAttribArray(p0|0);
|
|
}
|
|
function _emscripten_glDepthFunc__wrapper(p0) {
|
|
p0 = p0|0; _emscripten_glDepthFunc(p0|0);
|
|
}
|
|
function _emscripten_glEnable__wrapper(p0) {
|
|
p0 = p0|0; _emscripten_glEnable(p0|0);
|
|
}
|
|
function _emscripten_glDisable__wrapper(p0) {
|
|
p0 = p0|0; _emscripten_glDisable(p0|0);
|
|
}
|
|
function _emscripten_glFrontFace__wrapper(p0) {
|
|
p0 = p0|0; _emscripten_glFrontFace(p0|0);
|
|
}
|
|
function _emscripten_glCullFace__wrapper(p0) {
|
|
p0 = p0|0; _emscripten_glCullFace(p0|0);
|
|
}
|
|
function _emscripten_glClear__wrapper(p0) {
|
|
p0 = p0|0; _emscripten_glClear(p0|0);
|
|
}
|
|
function _emscripten_glClearStencil__wrapper(p0) {
|
|
p0 = p0|0; _emscripten_glClearStencil(p0|0);
|
|
}
|
|
function _emscripten_glDepthMask__wrapper(p0) {
|
|
p0 = p0|0; _emscripten_glDepthMask(p0|0);
|
|
}
|
|
function _emscripten_glStencilMask__wrapper(p0) {
|
|
p0 = p0|0; _emscripten_glStencilMask(p0|0);
|
|
}
|
|
function _emscripten_glGenerateMipmap__wrapper(p0) {
|
|
p0 = p0|0; _emscripten_glGenerateMipmap(p0|0);
|
|
}
|
|
function _emscripten_glActiveTexture__wrapper(p0) {
|
|
p0 = p0|0; _emscripten_glActiveTexture(p0|0);
|
|
}
|
|
function _emscripten_glBlendEquation__wrapper(p0) {
|
|
p0 = p0|0; _emscripten_glBlendEquation(p0|0);
|
|
}
|
|
function b4(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; nullFunc_vii(4);
|
|
}
|
|
function _emscripten_glPixelStorei__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glPixelStorei(p0|0,p1|0);
|
|
}
|
|
function _emscripten_glGetIntegerv__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glGetIntegerv(p0|0,p1|0);
|
|
}
|
|
function _emscripten_glGetFloatv__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glGetFloatv(p0|0,p1|0);
|
|
}
|
|
function _emscripten_glGetBooleanv__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glGetBooleanv(p0|0,p1|0);
|
|
}
|
|
function _emscripten_glGenTextures__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glGenTextures(p0|0,p1|0);
|
|
}
|
|
function _emscripten_glDeleteTextures__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glDeleteTextures(p0|0,p1|0);
|
|
}
|
|
function _emscripten_glBindTexture__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glBindTexture(p0|0,p1|0);
|
|
}
|
|
function _emscripten_glGenBuffers__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glGenBuffers(p0|0,p1|0);
|
|
}
|
|
function _emscripten_glDeleteBuffers__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glDeleteBuffers(p0|0,p1|0);
|
|
}
|
|
function _emscripten_glGenRenderbuffers__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glGenRenderbuffers(p0|0,p1|0);
|
|
}
|
|
function _emscripten_glDeleteRenderbuffers__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glDeleteRenderbuffers(p0|0,p1|0);
|
|
}
|
|
function _emscripten_glBindRenderbuffer__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glBindRenderbuffer(p0|0,p1|0);
|
|
}
|
|
function _emscripten_glUniform1i__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glUniform1i(p0|0,p1|0);
|
|
}
|
|
function _emscripten_glBindBuffer__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glBindBuffer(p0|0,p1|0);
|
|
}
|
|
function _emscripten_glVertexAttrib1fv__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttrib1fv(p0|0,p1|0);
|
|
}
|
|
function _emscripten_glVertexAttrib2fv__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttrib2fv(p0|0,p1|0);
|
|
}
|
|
function _emscripten_glVertexAttrib3fv__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttrib3fv(p0|0,p1|0);
|
|
}
|
|
function _emscripten_glVertexAttrib4fv__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttrib4fv(p0|0,p1|0);
|
|
}
|
|
function _emscripten_glAttachShader__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glAttachShader(p0|0,p1|0);
|
|
}
|
|
function _emscripten_glDetachShader__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glDetachShader(p0|0,p1|0);
|
|
}
|
|
function _emscripten_glBindFramebuffer__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glBindFramebuffer(p0|0,p1|0);
|
|
}
|
|
function _emscripten_glGenFramebuffers__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glGenFramebuffers(p0|0,p1|0);
|
|
}
|
|
function _emscripten_glDeleteFramebuffers__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glDeleteFramebuffers(p0|0,p1|0);
|
|
}
|
|
function _emscripten_glBindProgramARB__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glBindProgramARB(p0|0,p1|0);
|
|
}
|
|
function _emscripten_glGetPointerv__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glGetPointerv(p0|0,p1|0);
|
|
}
|
|
function _emscripten_glGenVertexArrays__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glGenVertexArrays(p0|0,p1|0);
|
|
}
|
|
function _emscripten_glDeleteVertexArrays__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glDeleteVertexArrays(p0|0,p1|0);
|
|
}
|
|
function _emscripten_glVertexAttribDivisor__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glVertexAttribDivisor(p0|0,p1|0);
|
|
}
|
|
function _emscripten_glBlendFunc__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glBlendFunc(p0|0,p1|0);
|
|
}
|
|
function _emscripten_glBlendEquationSeparate__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glBlendEquationSeparate(p0|0,p1|0);
|
|
}
|
|
function _emscripten_glStencilMaskSeparate__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glStencilMaskSeparate(p0|0,p1|0);
|
|
}
|
|
function _emscripten_glHint__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glHint(p0|0,p1|0);
|
|
}
|
|
function _emscripten_glDrawBuffers__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; _emscripten_glDrawBuffers(p0|0,p1|0);
|
|
}
|
|
function b5(p0) {
|
|
p0 = p0|0; nullFunc_ii(5);return 0;
|
|
}
|
|
function _emscripten_glGetString__wrapper(p0) {
|
|
p0 = p0|0; return _emscripten_glGetString(p0|0)|0;
|
|
}
|
|
function _emscripten_glIsTexture__wrapper(p0) {
|
|
p0 = p0|0; return _emscripten_glIsTexture(p0|0)|0;
|
|
}
|
|
function _emscripten_glIsBuffer__wrapper(p0) {
|
|
p0 = p0|0; return _emscripten_glIsBuffer(p0|0)|0;
|
|
}
|
|
function _emscripten_glIsRenderbuffer__wrapper(p0) {
|
|
p0 = p0|0; return _emscripten_glIsRenderbuffer(p0|0)|0;
|
|
}
|
|
function _emscripten_glCreateShader__wrapper(p0) {
|
|
p0 = p0|0; return _emscripten_glCreateShader(p0|0)|0;
|
|
}
|
|
function _emscripten_glIsShader__wrapper(p0) {
|
|
p0 = p0|0; return _emscripten_glIsShader(p0|0)|0;
|
|
}
|
|
function _emscripten_glIsProgram__wrapper(p0) {
|
|
p0 = p0|0; return _emscripten_glIsProgram(p0|0)|0;
|
|
}
|
|
function _emscripten_glIsFramebuffer__wrapper(p0) {
|
|
p0 = p0|0; return _emscripten_glIsFramebuffer(p0|0)|0;
|
|
}
|
|
function _emscripten_glCheckFramebufferStatus__wrapper(p0) {
|
|
p0 = p0|0; return _emscripten_glCheckFramebufferStatus(p0|0)|0;
|
|
}
|
|
function _emscripten_glIsEnabled__wrapper(p0) {
|
|
p0 = p0|0; return _emscripten_glIsEnabled(p0|0)|0;
|
|
}
|
|
function b6(p0,p1,p2,p3) {
|
|
p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3; nullFunc_viddd(6);
|
|
}
|
|
function _emscripten_glUniform3f__wrapper(p0,p1,p2,p3) {
|
|
p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glUniform3f(p0|0,+p1,+p2,+p3);
|
|
}
|
|
function _emscripten_glVertexAttrib3f__wrapper(p0,p1,p2,p3) {
|
|
p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glVertexAttrib3f(p0|0,+p1,+p2,+p3);
|
|
}
|
|
function b7(p0,p1,p2) {
|
|
p0 = p0|0;p1 = +p1;p2 = +p2; nullFunc_vidd(7);
|
|
}
|
|
function _emscripten_glUniform2f__wrapper(p0,p1,p2) {
|
|
p0 = p0|0;p1 = +p1;p2 = +p2; _emscripten_glUniform2f(p0|0,+p1,+p2);
|
|
}
|
|
function _emscripten_glVertexAttrib2f__wrapper(p0,p1,p2) {
|
|
p0 = p0|0;p1 = +p1;p2 = +p2; _emscripten_glVertexAttrib2f(p0|0,+p1,+p2);
|
|
}
|
|
function b8(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0; nullFunc_iiii(8);return 0;
|
|
}
|
|
function b9(p0,p1,p2,p3,p4,p5,p6,p7) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0; nullFunc_viiiiiiii(9);
|
|
}
|
|
function _emscripten_glCompressedTexImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0; _emscripten_glCompressedTexImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0);
|
|
}
|
|
function _emscripten_glCopyTexImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0; _emscripten_glCopyTexImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0);
|
|
}
|
|
function _emscripten_glCopyTexSubImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0; _emscripten_glCopyTexSubImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0);
|
|
}
|
|
function b10(p0,p1,p2,p3,p4,p5) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0; nullFunc_viiiiii(10);
|
|
}
|
|
function _emscripten_glDrawRangeElements__wrapper(p0,p1,p2,p3,p4,p5) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0; _emscripten_glDrawRangeElements(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0);
|
|
}
|
|
function _emscripten_glVertexAttribPointer__wrapper(p0,p1,p2,p3,p4,p5) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0; _emscripten_glVertexAttribPointer(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0);
|
|
}
|
|
function b11(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0; nullFunc_viii(11);
|
|
}
|
|
function _emscripten_glGetTexParameterfv__wrapper(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetTexParameterfv(p0|0,p1|0,p2|0);
|
|
}
|
|
function _emscripten_glGetTexParameteriv__wrapper(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetTexParameteriv(p0|0,p1|0,p2|0);
|
|
}
|
|
function _emscripten_glTexParameterfv__wrapper(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glTexParameterfv(p0|0,p1|0,p2|0);
|
|
}
|
|
function _emscripten_glTexParameteriv__wrapper(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glTexParameteriv(p0|0,p1|0,p2|0);
|
|
}
|
|
function _emscripten_glGetBufferParameteriv__wrapper(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetBufferParameteriv(p0|0,p1|0,p2|0);
|
|
}
|
|
function _emscripten_glGetRenderbufferParameteriv__wrapper(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetRenderbufferParameteriv(p0|0,p1|0,p2|0);
|
|
}
|
|
function _emscripten_glGetUniformfv__wrapper(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetUniformfv(p0|0,p1|0,p2|0);
|
|
}
|
|
function _emscripten_glGetUniformiv__wrapper(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetUniformiv(p0|0,p1|0,p2|0);
|
|
}
|
|
function _emscripten_glGetVertexAttribfv__wrapper(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetVertexAttribfv(p0|0,p1|0,p2|0);
|
|
}
|
|
function _emscripten_glGetVertexAttribiv__wrapper(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetVertexAttribiv(p0|0,p1|0,p2|0);
|
|
}
|
|
function _emscripten_glGetVertexAttribPointerv__wrapper(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetVertexAttribPointerv(p0|0,p1|0,p2|0);
|
|
}
|
|
function _emscripten_glUniform2i__wrapper(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform2i(p0|0,p1|0,p2|0);
|
|
}
|
|
function _emscripten_glUniform1iv__wrapper(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform1iv(p0|0,p1|0,p2|0);
|
|
}
|
|
function _emscripten_glUniform2iv__wrapper(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform2iv(p0|0,p1|0,p2|0);
|
|
}
|
|
function _emscripten_glUniform3iv__wrapper(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform3iv(p0|0,p1|0,p2|0);
|
|
}
|
|
function _emscripten_glUniform4iv__wrapper(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform4iv(p0|0,p1|0,p2|0);
|
|
}
|
|
function _emscripten_glUniform1fv__wrapper(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform1fv(p0|0,p1|0,p2|0);
|
|
}
|
|
function _emscripten_glUniform2fv__wrapper(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform2fv(p0|0,p1|0,p2|0);
|
|
}
|
|
function _emscripten_glUniform3fv__wrapper(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform3fv(p0|0,p1|0,p2|0);
|
|
}
|
|
function _emscripten_glUniform4fv__wrapper(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glUniform4fv(p0|0,p1|0,p2|0);
|
|
}
|
|
function _emscripten_glGetShaderiv__wrapper(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetShaderiv(p0|0,p1|0,p2|0);
|
|
}
|
|
function _emscripten_glGetProgramiv__wrapper(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetProgramiv(p0|0,p1|0,p2|0);
|
|
}
|
|
function _emscripten_glBindAttribLocation__wrapper(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glBindAttribLocation(p0|0,p1|0,p2|0);
|
|
}
|
|
function _emscripten_glGetObjectParameterivARB__wrapper(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glGetObjectParameterivARB(p0|0,p1|0,p2|0);
|
|
}
|
|
function _emscripten_glNormalPointer__wrapper(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glNormalPointer(p0|0,p1|0,p2|0);
|
|
}
|
|
function _emscripten_glDrawArrays__wrapper(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glDrawArrays(p0|0,p1|0,p2|0);
|
|
}
|
|
function _emscripten_glTexParameteri__wrapper(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glTexParameteri(p0|0,p1|0,p2|0);
|
|
}
|
|
function _emscripten_glStencilFunc__wrapper(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glStencilFunc(p0|0,p1|0,p2|0);
|
|
}
|
|
function _emscripten_glStencilOp__wrapper(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0; _emscripten_glStencilOp(p0|0,p1|0,p2|0);
|
|
}
|
|
function b12(p0,p1,p2,p3,p4) {
|
|
p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4; nullFunc_vidddd(12);
|
|
}
|
|
function _emscripten_glUniform4f__wrapper(p0,p1,p2,p3,p4) {
|
|
p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4; _emscripten_glUniform4f(p0|0,+p1,+p2,+p3,+p4);
|
|
}
|
|
function _emscripten_glVertexAttrib4f__wrapper(p0,p1,p2,p3,p4) {
|
|
p0 = p0|0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4; _emscripten_glVertexAttrib4f(p0|0,+p1,+p2,+p3,+p4);
|
|
}
|
|
function b13(p0,p1) {
|
|
p0 = +p0;p1 = p1|0; nullFunc_vdi(13);
|
|
}
|
|
function _emscripten_glSampleCoverage__wrapper(p0,p1) {
|
|
p0 = +p0;p1 = p1|0; _emscripten_glSampleCoverage(+p0,p1|0);
|
|
}
|
|
function b14(p0,p1,p2,p3,p4,p5,p6) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0; nullFunc_viiiiiii(14);
|
|
}
|
|
function _emscripten_glReadPixels__wrapper(p0,p1,p2,p3,p4,p5,p6) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0; _emscripten_glReadPixels(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0);
|
|
}
|
|
function _emscripten_glGetActiveUniform__wrapper(p0,p1,p2,p3,p4,p5,p6) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0; _emscripten_glGetActiveUniform(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0);
|
|
}
|
|
function _emscripten_glGetActiveAttrib__wrapper(p0,p1,p2,p3,p4,p5,p6) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0; _emscripten_glGetActiveAttrib(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0);
|
|
}
|
|
function b15(p0,p1,p2,p3,p4,p5,p6,p7,p8) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0;p8 = p8|0; nullFunc_viiiiiiiii(15);
|
|
}
|
|
function _emscripten_glCompressedTexSubImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7,p8) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0;p8 = p8|0; _emscripten_glCompressedTexSubImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0,p8|0);
|
|
}
|
|
function _emscripten_glTexImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7,p8) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0;p8 = p8|0; _emscripten_glTexImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0,p8|0);
|
|
}
|
|
function _emscripten_glTexSubImage2D__wrapper(p0,p1,p2,p3,p4,p5,p6,p7,p8) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0;p4 = p4|0;p5 = p5|0;p6 = p6|0;p7 = p7|0;p8 = p8|0; _emscripten_glTexSubImage2D(p0|0,p1|0,p2|0,p3|0,p4|0,p5|0,p6|0,p7|0,p8|0);
|
|
}
|
|
function b16(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; nullFunc_iii(16);return 0;
|
|
}
|
|
function _emscripten_glGetUniformLocation__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; return _emscripten_glGetUniformLocation(p0|0,p1|0)|0;
|
|
}
|
|
function _emscripten_glGetAttribLocation__wrapper(p0,p1) {
|
|
p0 = p0|0;p1 = p1|0; return _emscripten_glGetAttribLocation(p0|0,p1|0)|0;
|
|
}
|
|
function b17() {
|
|
; nullFunc_i(17);return 0;
|
|
}
|
|
function _emscripten_glCreateProgram__wrapper() {
|
|
; return _emscripten_glCreateProgram()|0;
|
|
}
|
|
function _emscripten_glGetError__wrapper() {
|
|
; return _emscripten_glGetError()|0;
|
|
}
|
|
function b18(p0,p1,p2,p3,p4,p5) {
|
|
p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4;p5 = +p5; nullFunc_vdddddd(18);
|
|
}
|
|
function _emscripten_glFrustum__wrapper(p0,p1,p2,p3,p4,p5) {
|
|
p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3;p4 = +p4;p5 = +p5; _emscripten_glFrustum(+p0,+p1,+p2,+p3,+p4,+p5);
|
|
}
|
|
function b19(p0,p1,p2,p3) {
|
|
p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3; nullFunc_vdddd(19);
|
|
}
|
|
function _emscripten_glRotatef__wrapper(p0,p1,p2,p3) {
|
|
p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glRotatef(+p0,+p1,+p2,+p3);
|
|
}
|
|
function _emscripten_glClearColor__wrapper(p0,p1,p2,p3) {
|
|
p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glClearColor(+p0,+p1,+p2,+p3);
|
|
}
|
|
function _emscripten_glBlendColor__wrapper(p0,p1,p2,p3) {
|
|
p0 = +p0;p1 = +p1;p2 = +p2;p3 = +p3; _emscripten_glBlendColor(+p0,+p1,+p2,+p3);
|
|
}
|
|
function b20(p0,p1) {
|
|
p0 = +p0;p1 = +p1; nullFunc_vdd(20);
|
|
}
|
|
function _emscripten_glDepthRange__wrapper(p0,p1) {
|
|
p0 = +p0;p1 = +p1; _emscripten_glDepthRange(+p0,+p1);
|
|
}
|
|
function _emscripten_glDepthRangef__wrapper(p0,p1) {
|
|
p0 = +p0;p1 = +p1; _emscripten_glDepthRangef(+p0,+p1);
|
|
}
|
|
function _emscripten_glPolygonOffset__wrapper(p0,p1) {
|
|
p0 = +p0;p1 = +p1; _emscripten_glPolygonOffset(+p0,+p1);
|
|
}
|
|
function b21() {
|
|
; nullFunc_v(21);
|
|
}
|
|
function _emscripten_glLoadIdentity__wrapper() {
|
|
; _emscripten_glLoadIdentity();
|
|
}
|
|
function _emscripten_glReleaseShaderCompiler__wrapper() {
|
|
; _emscripten_glReleaseShaderCompiler();
|
|
}
|
|
function _emscripten_glFinish__wrapper() {
|
|
; _emscripten_glFinish();
|
|
}
|
|
function _emscripten_glFlush__wrapper() {
|
|
; _emscripten_glFlush();
|
|
}
|
|
function b22(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = +p2; nullFunc_viid(22);
|
|
}
|
|
function _emscripten_glTexParameterf__wrapper(p0,p1,p2) {
|
|
p0 = p0|0;p1 = p1|0;p2 = +p2; _emscripten_glTexParameterf(p0|0,p1|0,+p2);
|
|
}
|
|
function b23(p0,p1,p2,p3) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; nullFunc_viiii(23);
|
|
}
|
|
function _emscripten_glBufferData__wrapper(p0,p1,p2,p3) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glBufferData(p0|0,p1|0,p2|0,p3|0);
|
|
}
|
|
function _emscripten_glBufferSubData__wrapper(p0,p1,p2,p3) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glBufferSubData(p0|0,p1|0,p2|0,p3|0);
|
|
}
|
|
function _emscripten_glUniform3i__wrapper(p0,p1,p2,p3) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glUniform3i(p0|0,p1|0,p2|0,p3|0);
|
|
}
|
|
function _emscripten_glUniformMatrix2fv__wrapper(p0,p1,p2,p3) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glUniformMatrix2fv(p0|0,p1|0,p2|0,p3|0);
|
|
}
|
|
function _emscripten_glUniformMatrix3fv__wrapper(p0,p1,p2,p3) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glUniformMatrix3fv(p0|0,p1|0,p2|0,p3|0);
|
|
}
|
|
function _emscripten_glUniformMatrix4fv__wrapper(p0,p1,p2,p3) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glUniformMatrix4fv(p0|0,p1|0,p2|0,p3|0);
|
|
}
|
|
function _emscripten_glGetAttachedShaders__wrapper(p0,p1,p2,p3) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetAttachedShaders(p0|0,p1|0,p2|0,p3|0);
|
|
}
|
|
function _emscripten_glShaderSource__wrapper(p0,p1,p2,p3) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glShaderSource(p0|0,p1|0,p2|0,p3|0);
|
|
}
|
|
function _emscripten_glGetShaderSource__wrapper(p0,p1,p2,p3) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetShaderSource(p0|0,p1|0,p2|0,p3|0);
|
|
}
|
|
function _emscripten_glGetShaderInfoLog__wrapper(p0,p1,p2,p3) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetShaderInfoLog(p0|0,p1|0,p2|0,p3|0);
|
|
}
|
|
function _emscripten_glGetShaderPrecisionFormat__wrapper(p0,p1,p2,p3) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetShaderPrecisionFormat(p0|0,p1|0,p2|0,p3|0);
|
|
}
|
|
function _emscripten_glGetProgramInfoLog__wrapper(p0,p1,p2,p3) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetProgramInfoLog(p0|0,p1|0,p2|0,p3|0);
|
|
}
|
|
function _emscripten_glFramebufferRenderbuffer__wrapper(p0,p1,p2,p3) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glFramebufferRenderbuffer(p0|0,p1|0,p2|0,p3|0);
|
|
}
|
|
function _emscripten_glGetFramebufferAttachmentParameteriv__wrapper(p0,p1,p2,p3) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetFramebufferAttachmentParameteriv(p0|0,p1|0,p2|0,p3|0);
|
|
}
|
|
function _emscripten_glGetInfoLogARB__wrapper(p0,p1,p2,p3) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glGetInfoLogARB(p0|0,p1|0,p2|0,p3|0);
|
|
}
|
|
function _emscripten_glVertexPointer__wrapper(p0,p1,p2,p3) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glVertexPointer(p0|0,p1|0,p2|0,p3|0);
|
|
}
|
|
function _emscripten_glTexCoordPointer__wrapper(p0,p1,p2,p3) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glTexCoordPointer(p0|0,p1|0,p2|0,p3|0);
|
|
}
|
|
function _emscripten_glColorPointer__wrapper(p0,p1,p2,p3) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glColorPointer(p0|0,p1|0,p2|0,p3|0);
|
|
}
|
|
function _emscripten_glDrawElements__wrapper(p0,p1,p2,p3) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glDrawElements(p0|0,p1|0,p2|0,p3|0);
|
|
}
|
|
function _emscripten_glDrawArraysInstanced__wrapper(p0,p1,p2,p3) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glDrawArraysInstanced(p0|0,p1|0,p2|0,p3|0);
|
|
}
|
|
function _emscripten_glViewport__wrapper(p0,p1,p2,p3) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glViewport(p0|0,p1|0,p2|0,p3|0);
|
|
}
|
|
function _emscripten_glScissor__wrapper(p0,p1,p2,p3) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glScissor(p0|0,p1|0,p2|0,p3|0);
|
|
}
|
|
function _emscripten_glColorMask__wrapper(p0,p1,p2,p3) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glColorMask(p0|0,p1|0,p2|0,p3|0);
|
|
}
|
|
function _emscripten_glRenderbufferStorage__wrapper(p0,p1,p2,p3) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glRenderbufferStorage(p0|0,p1|0,p2|0,p3|0);
|
|
}
|
|
function _emscripten_glBlendFuncSeparate__wrapper(p0,p1,p2,p3) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glBlendFuncSeparate(p0|0,p1|0,p2|0,p3|0);
|
|
}
|
|
function _emscripten_glStencilFuncSeparate__wrapper(p0,p1,p2,p3) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glStencilFuncSeparate(p0|0,p1|0,p2|0,p3|0);
|
|
}
|
|
function _emscripten_glStencilOpSeparate__wrapper(p0,p1,p2,p3) {
|
|
p0 = p0|0;p1 = p1|0;p2 = p2|0;p3 = p3|0; _emscripten_glStencilOpSeparate(p0|0,p1|0,p2|0,p3|0);
|
|
}
|
|
|
|
// EMSCRIPTEN_END_FUNCS
|
|
var FUNCTION_TABLE_viiiii = [b0,_KeyCallback,_emscripten_glUniform4i__wrapper,_emscripten_glFramebufferTexture2D__wrapper,_emscripten_glShaderBinary__wrapper,_emscripten_glDrawElementsInstanced__wrapper,b0,b0];
|
|
var FUNCTION_TABLE_vd = [b1,_emscripten_glClearDepth__wrapper,_emscripten_glClearDepthf__wrapper,_emscripten_glLineWidth__wrapper];
|
|
var FUNCTION_TABLE_vid = [b2,_emscripten_glUniform1f__wrapper,_emscripten_glVertexAttrib1f__wrapper,b2];
|
|
var FUNCTION_TABLE_vi = [b3,_emscripten_glDeleteShader__wrapper,_emscripten_glCompileShader__wrapper,_emscripten_glDeleteProgram__wrapper,_emscripten_glLinkProgram__wrapper,_emscripten_glUseProgram__wrapper,_emscripten_glValidateProgram__wrapper,_emscripten_glDeleteObjectARB__wrapper,_emscripten_glEnableClientState__wrapper,_emscripten_glClientActiveTexture__wrapper,_emscripten_glBindVertexArray__wrapper,_emscripten_glMatrixMode__wrapper,_emscripten_glLoadMatrixf__wrapper,_emscripten_glEnableVertexAttribArray__wrapper,_emscripten_glDisableVertexAttribArray__wrapper,_emscripten_glDepthFunc__wrapper,_emscripten_glEnable__wrapper,_emscripten_glDisable__wrapper,_emscripten_glFrontFace__wrapper,_emscripten_glCullFace__wrapper,_emscripten_glClear__wrapper,_emscripten_glClearStencil__wrapper,_emscripten_glDepthMask__wrapper,_emscripten_glStencilMask__wrapper,_emscripten_glGenerateMipmap__wrapper,_emscripten_glActiveTexture__wrapper,_emscripten_glBlendEquation__wrapper,b3,b3
|
|
,b3,b3,b3];
|
|
var FUNCTION_TABLE_vii = [b4,_ErrorCallback,_CursorEnterCallback,_CharCallback,_WindowIconifyCallback,_emscripten_glPixelStorei__wrapper,_emscripten_glGetIntegerv__wrapper,_emscripten_glGetFloatv__wrapper,_emscripten_glGetBooleanv__wrapper,_emscripten_glGenTextures__wrapper,_emscripten_glDeleteTextures__wrapper,_emscripten_glBindTexture__wrapper,_emscripten_glGenBuffers__wrapper,_emscripten_glDeleteBuffers__wrapper,_emscripten_glGenRenderbuffers__wrapper,_emscripten_glDeleteRenderbuffers__wrapper,_emscripten_glBindRenderbuffer__wrapper,_emscripten_glUniform1i__wrapper,_emscripten_glBindBuffer__wrapper,_emscripten_glVertexAttrib1fv__wrapper,_emscripten_glVertexAttrib2fv__wrapper,_emscripten_glVertexAttrib3fv__wrapper,_emscripten_glVertexAttrib4fv__wrapper,_emscripten_glAttachShader__wrapper,_emscripten_glDetachShader__wrapper,_emscripten_glBindFramebuffer__wrapper,_emscripten_glGenFramebuffers__wrapper,_emscripten_glDeleteFramebuffers__wrapper,_emscripten_glBindProgramARB__wrapper,_emscripten_glGetPointerv__wrapper,_emscripten_glGenVertexArrays__wrapper,_emscripten_glDeleteVertexArrays__wrapper,_emscripten_glVertexAttribDivisor__wrapper,_emscripten_glBlendFunc__wrapper,_emscripten_glBlendEquationSeparate__wrapper,_emscripten_glStencilMaskSeparate__wrapper,_emscripten_glHint__wrapper,_emscripten_glDrawBuffers__wrapper,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4,b4
|
|
,b4,b4,b4,b4,b4];
|
|
var FUNCTION_TABLE_ii = [b5,___stdio_close,_PhysicsLoop,_emscripten_glGetString__wrapper,_emscripten_glIsTexture__wrapper,_emscripten_glIsBuffer__wrapper,_emscripten_glIsRenderbuffer__wrapper,_emscripten_glCreateShader__wrapper,_emscripten_glIsShader__wrapper,_emscripten_glIsProgram__wrapper,_emscripten_glIsFramebuffer__wrapper,_emscripten_glCheckFramebufferStatus__wrapper,_emscripten_glIsEnabled__wrapper,b5,b5,b5];
|
|
var FUNCTION_TABLE_viddd = [b6,_emscripten_glUniform3f__wrapper,_emscripten_glVertexAttrib3f__wrapper,b6];
|
|
var FUNCTION_TABLE_vidd = [b7,_MouseCursorPosCallback,_ScrollCallback,_emscripten_glUniform2f__wrapper,_emscripten_glVertexAttrib2f__wrapper,b7,b7,b7];
|
|
var FUNCTION_TABLE_iiii = [b8,___stdout_write,___stdio_seek,_sn_write,_EmscriptenFullscreenChangeCallback,_EmscriptenKeyboardCallback,_EmscriptenMouseCallback,_EmscriptenTouchCallback,_EmscriptenGamepadCallback,___stdio_write,b8,b8,b8,b8,b8,b8];
|
|
var FUNCTION_TABLE_viiiiiiii = [b9,_emscripten_glCompressedTexImage2D__wrapper,_emscripten_glCopyTexImage2D__wrapper,_emscripten_glCopyTexSubImage2D__wrapper];
|
|
var FUNCTION_TABLE_viiiiii = [b10,_emscripten_glDrawRangeElements__wrapper,_emscripten_glVertexAttribPointer__wrapper,b10];
|
|
var FUNCTION_TABLE_viii = [b11,_WindowSizeCallback,_emscripten_glGetTexParameterfv__wrapper,_emscripten_glGetTexParameteriv__wrapper,_emscripten_glTexParameterfv__wrapper,_emscripten_glTexParameteriv__wrapper,_emscripten_glGetBufferParameteriv__wrapper,_emscripten_glGetRenderbufferParameteriv__wrapper,_emscripten_glGetUniformfv__wrapper,_emscripten_glGetUniformiv__wrapper,_emscripten_glGetVertexAttribfv__wrapper,_emscripten_glGetVertexAttribiv__wrapper,_emscripten_glGetVertexAttribPointerv__wrapper,_emscripten_glUniform2i__wrapper,_emscripten_glUniform1iv__wrapper,_emscripten_glUniform2iv__wrapper,_emscripten_glUniform3iv__wrapper,_emscripten_glUniform4iv__wrapper,_emscripten_glUniform1fv__wrapper,_emscripten_glUniform2fv__wrapper,_emscripten_glUniform3fv__wrapper,_emscripten_glUniform4fv__wrapper,_emscripten_glGetShaderiv__wrapper,_emscripten_glGetProgramiv__wrapper,_emscripten_glBindAttribLocation__wrapper,_emscripten_glGetObjectParameterivARB__wrapper,_emscripten_glNormalPointer__wrapper,_emscripten_glDrawArrays__wrapper,_emscripten_glTexParameteri__wrapper,_emscripten_glStencilFunc__wrapper,_emscripten_glStencilOp__wrapper,b11];
|
|
var FUNCTION_TABLE_vidddd = [b12,_emscripten_glUniform4f__wrapper,_emscripten_glVertexAttrib4f__wrapper,b12];
|
|
var FUNCTION_TABLE_vdi = [b13,_emscripten_glSampleCoverage__wrapper];
|
|
var FUNCTION_TABLE_viiiiiii = [b14,_emscripten_glReadPixels__wrapper,_emscripten_glGetActiveUniform__wrapper,_emscripten_glGetActiveAttrib__wrapper];
|
|
var FUNCTION_TABLE_viiiiiiiii = [b15,_emscripten_glCompressedTexSubImage2D__wrapper,_emscripten_glTexImage2D__wrapper,_emscripten_glTexSubImage2D__wrapper];
|
|
var FUNCTION_TABLE_iii = [b16,_emscripten_glGetUniformLocation__wrapper,_emscripten_glGetAttribLocation__wrapper,b16];
|
|
var FUNCTION_TABLE_i = [b17,_emscripten_glCreateProgram__wrapper,_emscripten_glGetError__wrapper,b17];
|
|
var FUNCTION_TABLE_vdddddd = [b18,_emscripten_glFrustum__wrapper];
|
|
var FUNCTION_TABLE_vdddd = [b19,_emscripten_glRotatef__wrapper,_emscripten_glClearColor__wrapper,_emscripten_glBlendColor__wrapper];
|
|
var FUNCTION_TABLE_vdd = [b20,_emscripten_glDepthRange__wrapper,_emscripten_glDepthRangef__wrapper,_emscripten_glPolygonOffset__wrapper];
|
|
var FUNCTION_TABLE_v = [b21,_UpdateDrawFrame,_emscripten_glLoadIdentity__wrapper,_emscripten_glReleaseShaderCompiler__wrapper,_emscripten_glFinish__wrapper,_emscripten_glFlush__wrapper,b21,b21];
|
|
var FUNCTION_TABLE_viid = [b22,_emscripten_glTexParameterf__wrapper];
|
|
var FUNCTION_TABLE_viiii = [b23,_MouseButtonCallback,_emscripten_glBufferData__wrapper,_emscripten_glBufferSubData__wrapper,_emscripten_glUniform3i__wrapper,_emscripten_glUniformMatrix2fv__wrapper,_emscripten_glUniformMatrix3fv__wrapper,_emscripten_glUniformMatrix4fv__wrapper,_emscripten_glGetAttachedShaders__wrapper,_emscripten_glShaderSource__wrapper,_emscripten_glGetShaderSource__wrapper,_emscripten_glGetShaderInfoLog__wrapper,_emscripten_glGetShaderPrecisionFormat__wrapper,_emscripten_glGetProgramInfoLog__wrapper,_emscripten_glFramebufferRenderbuffer__wrapper,_emscripten_glGetFramebufferAttachmentParameteriv__wrapper,_emscripten_glGetInfoLogARB__wrapper,_emscripten_glVertexPointer__wrapper,_emscripten_glTexCoordPointer__wrapper,_emscripten_glColorPointer__wrapper,_emscripten_glDrawElements__wrapper,_emscripten_glDrawArraysInstanced__wrapper,_emscripten_glViewport__wrapper,_emscripten_glScissor__wrapper,_emscripten_glColorMask__wrapper,_emscripten_glRenderbufferStorage__wrapper,_emscripten_glBlendFuncSeparate__wrapper,_emscripten_glStencilFuncSeparate__wrapper,_emscripten_glStencilOpSeparate__wrapper,b23,b23,b23];
|
|
|
|
return { _emscripten_sync_run_in_main_thread_3: _emscripten_sync_run_in_main_thread_3, _roundf: _roundf, _bitshift64Shl: _bitshift64Shl, _emscripten_atomic_load_f32: _emscripten_atomic_load_f32, ___uremdi3: ___uremdi3, ___udivdi3: ___udivdi3, _emscripten_atomic_xor_u64: _emscripten_atomic_xor_u64, _llvm_cttz_i32: _llvm_cttz_i32, _bitshift64Lshr: _bitshift64Lshr, _emscripten_atomic_and_u64: _emscripten_atomic_and_u64, _emscripten_sync_run_in_main_thread: _emscripten_sync_run_in_main_thread, _emscripten_sync_run_in_main_thread_4: _emscripten_sync_run_in_main_thread_4, _emscripten_sync_run_in_main_thread_5: _emscripten_sync_run_in_main_thread_5, _emscripten_sync_run_in_main_thread_6: _emscripten_sync_run_in_main_thread_6, _emscripten_sync_run_in_main_thread_7: _emscripten_sync_run_in_main_thread_7, _emscripten_sync_run_in_main_thread_0: _emscripten_sync_run_in_main_thread_0, _emscripten_sync_run_in_main_thread_1: _emscripten_sync_run_in_main_thread_1, _emscripten_sync_run_in_main_thread_2: _emscripten_sync_run_in_main_thread_2, __emscripten_atomic_fetch_and_sub_u64: __emscripten_atomic_fetch_and_sub_u64, _emscripten_atomic_exchange_u32: _emscripten_atomic_exchange_u32, _fflush: _fflush, _emscripten_set_current_thread_status: _emscripten_set_current_thread_status, _emscripten_atomic_cas_u64: _emscripten_atomic_cas_u64, _memset: _memset, _emscripten_atomic_sub_u64: _emscripten_atomic_sub_u64, _emscripten_sync_run_in_main_thread_xprintf_varargs: _emscripten_sync_run_in_main_thread_xprintf_varargs, _i64Subtract: _i64Subtract, _llvm_bswap_i32: _llvm_bswap_i32, ___muldi3: ___muldi3, __emscripten_atomic_fetch_and_and_u64: __emscripten_atomic_fetch_and_and_u64, _emscripten_atomic_add_u64: _emscripten_atomic_add_u64, _emscripten_atomic_store_f64: _emscripten_atomic_store_f64, ___muldsi3: ___muldsi3, __emscripten_atomic_fetch_and_xor_u64: __emscripten_atomic_fetch_and_xor_u64, ___udivmoddi4: ___udivmoddi4, _i64Add: _i64Add, _emscripten_atomic_store_u64: _emscripten_atomic_store_u64, _emscripten_atomic_load_f64: _emscripten_atomic_load_f64, _emscripten_get_global_libc: _emscripten_get_global_libc, __emscripten_atomic_fetch_and_add_u64: __emscripten_atomic_fetch_and_add_u64, __emscripten_atomic_fetch_and_or_u64: __emscripten_atomic_fetch_and_or_u64, _emscripten_GetProcAddress: _emscripten_GetProcAddress, _emscripten_async_run_in_main_thread: _emscripten_async_run_in_main_thread, ___errno_location: ___errno_location, _main: _main, _emscripten_main_thread_process_queued_calls: _emscripten_main_thread_process_queued_calls, _emscripten_atomic_load_u64: _emscripten_atomic_load_u64, _free: _free, _emscripten_atomic_store_f32: _emscripten_atomic_store_f32, _emscripten_atomic_exchange_u64: _emscripten_atomic_exchange_u64, _memmove: _memmove, ___pthread_tsd_run_dtors: ___pthread_tsd_run_dtors, _malloc: _malloc, _memcpy: _memcpy, _emscripten_conditional_set_current_thread_status: _emscripten_conditional_set_current_thread_status, _sbrk: _sbrk, _emscripten_atomic_or_u64: _emscripten_atomic_or_u64, _strstr: _strstr, ___emscripten_pthread_data_constructor: ___emscripten_pthread_data_constructor, runPostSets: runPostSets, stackAlloc: stackAlloc, stackSave: stackSave, stackRestore: stackRestore, establishStackSpace: establishStackSpace, setTempRet0: setTempRet0, getTempRet0: getTempRet0, setThrew: setThrew, stackAlloc: stackAlloc, stackSave: stackSave, stackRestore: stackRestore, establishStackSpace: establishStackSpace, setThrew: setThrew, setTempRet0: setTempRet0, getTempRet0: getTempRet0, dynCall_viiiii: dynCall_viiiii, dynCall_vd: dynCall_vd, dynCall_vid: dynCall_vid, dynCall_vi: dynCall_vi, dynCall_vii: dynCall_vii, dynCall_ii: dynCall_ii, dynCall_viddd: dynCall_viddd, dynCall_vidd: dynCall_vidd, dynCall_iiii: dynCall_iiii, dynCall_viiiiiiii: dynCall_viiiiiiii, dynCall_viiiiii: dynCall_viiiiii, dynCall_viii: dynCall_viii, dynCall_vidddd: dynCall_vidddd, dynCall_vdi: dynCall_vdi, dynCall_viiiiiii: dynCall_viiiiiii, dynCall_viiiiiiiii: dynCall_viiiiiiiii, dynCall_iii: dynCall_iii, dynCall_i: dynCall_i, dynCall_vdddddd: dynCall_vdddddd, dynCall_vdddd: dynCall_vdddd, dynCall_vdd: dynCall_vdd, dynCall_v: dynCall_v, dynCall_viid: dynCall_viid, dynCall_viiii: dynCall_viiii };
|
|
})
|
|
// EMSCRIPTEN_END_ASM
|
|
(Module.asmGlobalArg, Module.asmLibraryArg, buffer);
|
|
|
|
var real___emscripten_atomic_fetch_and_xor_u64 = asm["__emscripten_atomic_fetch_and_xor_u64"]; asm["__emscripten_atomic_fetch_and_xor_u64"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real___emscripten_atomic_fetch_and_xor_u64.apply(null, arguments);
|
|
};
|
|
|
|
var real__roundf = asm["_roundf"]; asm["_roundf"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__roundf.apply(null, arguments);
|
|
};
|
|
|
|
var real__bitshift64Shl = asm["_bitshift64Shl"]; asm["_bitshift64Shl"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__bitshift64Shl.apply(null, arguments);
|
|
};
|
|
|
|
var real__emscripten_atomic_load_f32 = asm["_emscripten_atomic_load_f32"]; asm["_emscripten_atomic_load_f32"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__emscripten_atomic_load_f32.apply(null, arguments);
|
|
};
|
|
|
|
var real____emscripten_pthread_data_constructor = asm["___emscripten_pthread_data_constructor"]; asm["___emscripten_pthread_data_constructor"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real____emscripten_pthread_data_constructor.apply(null, arguments);
|
|
};
|
|
|
|
var real_stackSave = asm["stackSave"]; asm["stackSave"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real_stackSave.apply(null, arguments);
|
|
};
|
|
|
|
var real__emscripten_atomic_xor_u64 = asm["_emscripten_atomic_xor_u64"]; asm["_emscripten_atomic_xor_u64"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__emscripten_atomic_xor_u64.apply(null, arguments);
|
|
};
|
|
|
|
var real__emscripten_atomic_load_u64 = asm["_emscripten_atomic_load_u64"]; asm["_emscripten_atomic_load_u64"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__emscripten_atomic_load_u64.apply(null, arguments);
|
|
};
|
|
|
|
var real____udivdi3 = asm["___udivdi3"]; asm["___udivdi3"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real____udivdi3.apply(null, arguments);
|
|
};
|
|
|
|
var real__bitshift64Lshr = asm["_bitshift64Lshr"]; asm["_bitshift64Lshr"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__bitshift64Lshr.apply(null, arguments);
|
|
};
|
|
|
|
var real_getTempRet0 = asm["getTempRet0"]; asm["getTempRet0"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real_getTempRet0.apply(null, arguments);
|
|
};
|
|
|
|
var real__emscripten_atomic_and_u64 = asm["_emscripten_atomic_and_u64"]; asm["_emscripten_atomic_and_u64"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__emscripten_atomic_and_u64.apply(null, arguments);
|
|
};
|
|
|
|
var real__emscripten_sync_run_in_main_thread = asm["_emscripten_sync_run_in_main_thread"]; asm["_emscripten_sync_run_in_main_thread"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__emscripten_sync_run_in_main_thread.apply(null, arguments);
|
|
};
|
|
|
|
var real__emscripten_sync_run_in_main_thread_4 = asm["_emscripten_sync_run_in_main_thread_4"]; asm["_emscripten_sync_run_in_main_thread_4"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__emscripten_sync_run_in_main_thread_4.apply(null, arguments);
|
|
};
|
|
|
|
var real__emscripten_sync_run_in_main_thread_5 = asm["_emscripten_sync_run_in_main_thread_5"]; asm["_emscripten_sync_run_in_main_thread_5"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__emscripten_sync_run_in_main_thread_5.apply(null, arguments);
|
|
};
|
|
|
|
var real__emscripten_sync_run_in_main_thread_6 = asm["_emscripten_sync_run_in_main_thread_6"]; asm["_emscripten_sync_run_in_main_thread_6"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__emscripten_sync_run_in_main_thread_6.apply(null, arguments);
|
|
};
|
|
|
|
var real__emscripten_sync_run_in_main_thread_7 = asm["_emscripten_sync_run_in_main_thread_7"]; asm["_emscripten_sync_run_in_main_thread_7"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__emscripten_sync_run_in_main_thread_7.apply(null, arguments);
|
|
};
|
|
|
|
var real__emscripten_sync_run_in_main_thread_0 = asm["_emscripten_sync_run_in_main_thread_0"]; asm["_emscripten_sync_run_in_main_thread_0"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__emscripten_sync_run_in_main_thread_0.apply(null, arguments);
|
|
};
|
|
|
|
var real__emscripten_sync_run_in_main_thread_1 = asm["_emscripten_sync_run_in_main_thread_1"]; asm["_emscripten_sync_run_in_main_thread_1"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__emscripten_sync_run_in_main_thread_1.apply(null, arguments);
|
|
};
|
|
|
|
var real__emscripten_sync_run_in_main_thread_2 = asm["_emscripten_sync_run_in_main_thread_2"]; asm["_emscripten_sync_run_in_main_thread_2"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__emscripten_sync_run_in_main_thread_2.apply(null, arguments);
|
|
};
|
|
|
|
var real___emscripten_atomic_fetch_and_sub_u64 = asm["__emscripten_atomic_fetch_and_sub_u64"]; asm["__emscripten_atomic_fetch_and_sub_u64"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real___emscripten_atomic_fetch_and_sub_u64.apply(null, arguments);
|
|
};
|
|
|
|
var real__emscripten_atomic_exchange_u32 = asm["_emscripten_atomic_exchange_u32"]; asm["_emscripten_atomic_exchange_u32"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__emscripten_atomic_exchange_u32.apply(null, arguments);
|
|
};
|
|
|
|
var real__fflush = asm["_fflush"]; asm["_fflush"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__fflush.apply(null, arguments);
|
|
};
|
|
|
|
var real__emscripten_set_current_thread_status = asm["_emscripten_set_current_thread_status"]; asm["_emscripten_set_current_thread_status"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__emscripten_set_current_thread_status.apply(null, arguments);
|
|
};
|
|
|
|
var real__emscripten_atomic_cas_u64 = asm["_emscripten_atomic_cas_u64"]; asm["_emscripten_atomic_cas_u64"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__emscripten_atomic_cas_u64.apply(null, arguments);
|
|
};
|
|
|
|
var real__llvm_cttz_i32 = asm["_llvm_cttz_i32"]; asm["_llvm_cttz_i32"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__llvm_cttz_i32.apply(null, arguments);
|
|
};
|
|
|
|
var real__emscripten_atomic_sub_u64 = asm["_emscripten_atomic_sub_u64"]; asm["_emscripten_atomic_sub_u64"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__emscripten_atomic_sub_u64.apply(null, arguments);
|
|
};
|
|
|
|
var real__main = asm["_main"]; asm["_main"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__main.apply(null, arguments);
|
|
};
|
|
|
|
var real__emscripten_sync_run_in_main_thread_xprintf_varargs = asm["_emscripten_sync_run_in_main_thread_xprintf_varargs"]; asm["_emscripten_sync_run_in_main_thread_xprintf_varargs"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__emscripten_sync_run_in_main_thread_xprintf_varargs.apply(null, arguments);
|
|
};
|
|
|
|
var real____errno_location = asm["___errno_location"]; asm["___errno_location"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real____errno_location.apply(null, arguments);
|
|
};
|
|
|
|
var real____muldi3 = asm["___muldi3"]; asm["___muldi3"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real____muldi3.apply(null, arguments);
|
|
};
|
|
|
|
var real___emscripten_atomic_fetch_and_and_u64 = asm["__emscripten_atomic_fetch_and_and_u64"]; asm["__emscripten_atomic_fetch_and_and_u64"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real___emscripten_atomic_fetch_and_and_u64.apply(null, arguments);
|
|
};
|
|
|
|
var real__emscripten_sync_run_in_main_thread_3 = asm["_emscripten_sync_run_in_main_thread_3"]; asm["_emscripten_sync_run_in_main_thread_3"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__emscripten_sync_run_in_main_thread_3.apply(null, arguments);
|
|
};
|
|
|
|
var real____uremdi3 = asm["___uremdi3"]; asm["___uremdi3"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real____uremdi3.apply(null, arguments);
|
|
};
|
|
|
|
var real_stackAlloc = asm["stackAlloc"]; asm["stackAlloc"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real_stackAlloc.apply(null, arguments);
|
|
};
|
|
|
|
var real__i64Subtract = asm["_i64Subtract"]; asm["_i64Subtract"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__i64Subtract.apply(null, arguments);
|
|
};
|
|
|
|
var real_setTempRet0 = asm["setTempRet0"]; asm["setTempRet0"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real_setTempRet0.apply(null, arguments);
|
|
};
|
|
|
|
var real__i64Add = asm["_i64Add"]; asm["_i64Add"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__i64Add.apply(null, arguments);
|
|
};
|
|
|
|
var real__emscripten_atomic_store_u64 = asm["_emscripten_atomic_store_u64"]; asm["_emscripten_atomic_store_u64"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__emscripten_atomic_store_u64.apply(null, arguments);
|
|
};
|
|
|
|
var real__emscripten_atomic_load_f64 = asm["_emscripten_atomic_load_f64"]; asm["_emscripten_atomic_load_f64"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__emscripten_atomic_load_f64.apply(null, arguments);
|
|
};
|
|
|
|
var real__emscripten_get_global_libc = asm["_emscripten_get_global_libc"]; asm["_emscripten_get_global_libc"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__emscripten_get_global_libc.apply(null, arguments);
|
|
};
|
|
|
|
var real___emscripten_atomic_fetch_and_add_u64 = asm["__emscripten_atomic_fetch_and_add_u64"]; asm["__emscripten_atomic_fetch_and_add_u64"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real___emscripten_atomic_fetch_and_add_u64.apply(null, arguments);
|
|
};
|
|
|
|
var real___emscripten_atomic_fetch_and_or_u64 = asm["__emscripten_atomic_fetch_and_or_u64"]; asm["__emscripten_atomic_fetch_and_or_u64"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real___emscripten_atomic_fetch_and_or_u64.apply(null, arguments);
|
|
};
|
|
|
|
var real__emscripten_GetProcAddress = asm["_emscripten_GetProcAddress"]; asm["_emscripten_GetProcAddress"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__emscripten_GetProcAddress.apply(null, arguments);
|
|
};
|
|
|
|
var real__emscripten_async_run_in_main_thread = asm["_emscripten_async_run_in_main_thread"]; asm["_emscripten_async_run_in_main_thread"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__emscripten_async_run_in_main_thread.apply(null, arguments);
|
|
};
|
|
|
|
var real__llvm_bswap_i32 = asm["_llvm_bswap_i32"]; asm["_llvm_bswap_i32"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__llvm_bswap_i32.apply(null, arguments);
|
|
};
|
|
|
|
var real____muldsi3 = asm["___muldsi3"]; asm["___muldsi3"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real____muldsi3.apply(null, arguments);
|
|
};
|
|
|
|
var real__emscripten_main_thread_process_queued_calls = asm["_emscripten_main_thread_process_queued_calls"]; asm["_emscripten_main_thread_process_queued_calls"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__emscripten_main_thread_process_queued_calls.apply(null, arguments);
|
|
};
|
|
|
|
var real__emscripten_atomic_add_u64 = asm["_emscripten_atomic_add_u64"]; asm["_emscripten_atomic_add_u64"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__emscripten_atomic_add_u64.apply(null, arguments);
|
|
};
|
|
|
|
var real__free = asm["_free"]; asm["_free"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__free.apply(null, arguments);
|
|
};
|
|
|
|
var real__emscripten_atomic_store_f32 = asm["_emscripten_atomic_store_f32"]; asm["_emscripten_atomic_store_f32"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__emscripten_atomic_store_f32.apply(null, arguments);
|
|
};
|
|
|
|
var real_setThrew = asm["setThrew"]; asm["setThrew"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real_setThrew.apply(null, arguments);
|
|
};
|
|
|
|
var real__emscripten_atomic_exchange_u64 = asm["_emscripten_atomic_exchange_u64"]; asm["_emscripten_atomic_exchange_u64"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__emscripten_atomic_exchange_u64.apply(null, arguments);
|
|
};
|
|
|
|
var real__emscripten_atomic_store_f64 = asm["_emscripten_atomic_store_f64"]; asm["_emscripten_atomic_store_f64"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__emscripten_atomic_store_f64.apply(null, arguments);
|
|
};
|
|
|
|
var real____pthread_tsd_run_dtors = asm["___pthread_tsd_run_dtors"]; asm["___pthread_tsd_run_dtors"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real____pthread_tsd_run_dtors.apply(null, arguments);
|
|
};
|
|
|
|
var real_stackRestore = asm["stackRestore"]; asm["stackRestore"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real_stackRestore.apply(null, arguments);
|
|
};
|
|
|
|
var real____udivmoddi4 = asm["___udivmoddi4"]; asm["___udivmoddi4"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real____udivmoddi4.apply(null, arguments);
|
|
};
|
|
|
|
var real__malloc = asm["_malloc"]; asm["_malloc"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__malloc.apply(null, arguments);
|
|
};
|
|
|
|
var real_establishStackSpace = asm["establishStackSpace"]; asm["establishStackSpace"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real_establishStackSpace.apply(null, arguments);
|
|
};
|
|
|
|
var real__emscripten_conditional_set_current_thread_status = asm["_emscripten_conditional_set_current_thread_status"]; asm["_emscripten_conditional_set_current_thread_status"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__emscripten_conditional_set_current_thread_status.apply(null, arguments);
|
|
};
|
|
|
|
var real__sbrk = asm["_sbrk"]; asm["_sbrk"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__sbrk.apply(null, arguments);
|
|
};
|
|
|
|
var real__memmove = asm["_memmove"]; asm["_memmove"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__memmove.apply(null, arguments);
|
|
};
|
|
|
|
var real__emscripten_atomic_or_u64 = asm["_emscripten_atomic_or_u64"]; asm["_emscripten_atomic_or_u64"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__emscripten_atomic_or_u64.apply(null, arguments);
|
|
};
|
|
|
|
var real__strstr = asm["_strstr"]; asm["_strstr"] = function() {
|
|
assert(runtimeInitialized, 'you need to wait for the runtime to be ready (e.g. wait for main() to be called)');
|
|
assert(!runtimeExited, 'the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)');
|
|
return real__strstr.apply(null, arguments);
|
|
};
|
|
var __emscripten_atomic_fetch_and_xor_u64 = Module["__emscripten_atomic_fetch_and_xor_u64"] = asm["__emscripten_atomic_fetch_and_xor_u64"];
|
|
var _roundf = Module["_roundf"] = asm["_roundf"];
|
|
var _bitshift64Shl = Module["_bitshift64Shl"] = asm["_bitshift64Shl"];
|
|
var _emscripten_atomic_load_f32 = Module["_emscripten_atomic_load_f32"] = asm["_emscripten_atomic_load_f32"];
|
|
var ___emscripten_pthread_data_constructor = Module["___emscripten_pthread_data_constructor"] = asm["___emscripten_pthread_data_constructor"];
|
|
var stackSave = Module["stackSave"] = asm["stackSave"];
|
|
var _emscripten_atomic_xor_u64 = Module["_emscripten_atomic_xor_u64"] = asm["_emscripten_atomic_xor_u64"];
|
|
var _emscripten_atomic_load_u64 = Module["_emscripten_atomic_load_u64"] = asm["_emscripten_atomic_load_u64"];
|
|
var ___udivdi3 = Module["___udivdi3"] = asm["___udivdi3"];
|
|
var _bitshift64Lshr = Module["_bitshift64Lshr"] = asm["_bitshift64Lshr"];
|
|
var getTempRet0 = Module["getTempRet0"] = asm["getTempRet0"];
|
|
var _emscripten_atomic_and_u64 = Module["_emscripten_atomic_and_u64"] = asm["_emscripten_atomic_and_u64"];
|
|
var _emscripten_sync_run_in_main_thread = Module["_emscripten_sync_run_in_main_thread"] = asm["_emscripten_sync_run_in_main_thread"];
|
|
var _emscripten_sync_run_in_main_thread_4 = Module["_emscripten_sync_run_in_main_thread_4"] = asm["_emscripten_sync_run_in_main_thread_4"];
|
|
var _emscripten_sync_run_in_main_thread_5 = Module["_emscripten_sync_run_in_main_thread_5"] = asm["_emscripten_sync_run_in_main_thread_5"];
|
|
var _emscripten_sync_run_in_main_thread_6 = Module["_emscripten_sync_run_in_main_thread_6"] = asm["_emscripten_sync_run_in_main_thread_6"];
|
|
var _emscripten_sync_run_in_main_thread_7 = Module["_emscripten_sync_run_in_main_thread_7"] = asm["_emscripten_sync_run_in_main_thread_7"];
|
|
var _emscripten_sync_run_in_main_thread_0 = Module["_emscripten_sync_run_in_main_thread_0"] = asm["_emscripten_sync_run_in_main_thread_0"];
|
|
var _emscripten_sync_run_in_main_thread_1 = Module["_emscripten_sync_run_in_main_thread_1"] = asm["_emscripten_sync_run_in_main_thread_1"];
|
|
var _emscripten_sync_run_in_main_thread_2 = Module["_emscripten_sync_run_in_main_thread_2"] = asm["_emscripten_sync_run_in_main_thread_2"];
|
|
var __emscripten_atomic_fetch_and_sub_u64 = Module["__emscripten_atomic_fetch_and_sub_u64"] = asm["__emscripten_atomic_fetch_and_sub_u64"];
|
|
var _emscripten_atomic_exchange_u32 = Module["_emscripten_atomic_exchange_u32"] = asm["_emscripten_atomic_exchange_u32"];
|
|
var _fflush = Module["_fflush"] = asm["_fflush"];
|
|
var _emscripten_set_current_thread_status = Module["_emscripten_set_current_thread_status"] = asm["_emscripten_set_current_thread_status"];
|
|
var _emscripten_atomic_cas_u64 = Module["_emscripten_atomic_cas_u64"] = asm["_emscripten_atomic_cas_u64"];
|
|
var _llvm_cttz_i32 = Module["_llvm_cttz_i32"] = asm["_llvm_cttz_i32"];
|
|
var _emscripten_atomic_sub_u64 = Module["_emscripten_atomic_sub_u64"] = asm["_emscripten_atomic_sub_u64"];
|
|
var _main = Module["_main"] = asm["_main"];
|
|
var _emscripten_sync_run_in_main_thread_xprintf_varargs = Module["_emscripten_sync_run_in_main_thread_xprintf_varargs"] = asm["_emscripten_sync_run_in_main_thread_xprintf_varargs"];
|
|
var _memcpy = Module["_memcpy"] = asm["_memcpy"];
|
|
var ___errno_location = Module["___errno_location"] = asm["___errno_location"];
|
|
var ___muldi3 = Module["___muldi3"] = asm["___muldi3"];
|
|
var __emscripten_atomic_fetch_and_and_u64 = Module["__emscripten_atomic_fetch_and_and_u64"] = asm["__emscripten_atomic_fetch_and_and_u64"];
|
|
var _emscripten_sync_run_in_main_thread_3 = Module["_emscripten_sync_run_in_main_thread_3"] = asm["_emscripten_sync_run_in_main_thread_3"];
|
|
var ___uremdi3 = Module["___uremdi3"] = asm["___uremdi3"];
|
|
var stackAlloc = Module["stackAlloc"] = asm["stackAlloc"];
|
|
var _i64Subtract = Module["_i64Subtract"] = asm["_i64Subtract"];
|
|
var _memset = Module["_memset"] = asm["_memset"];
|
|
var setTempRet0 = Module["setTempRet0"] = asm["setTempRet0"];
|
|
var _i64Add = Module["_i64Add"] = asm["_i64Add"];
|
|
var _emscripten_atomic_store_u64 = Module["_emscripten_atomic_store_u64"] = asm["_emscripten_atomic_store_u64"];
|
|
var _emscripten_atomic_load_f64 = Module["_emscripten_atomic_load_f64"] = asm["_emscripten_atomic_load_f64"];
|
|
var _emscripten_get_global_libc = Module["_emscripten_get_global_libc"] = asm["_emscripten_get_global_libc"];
|
|
var __emscripten_atomic_fetch_and_add_u64 = Module["__emscripten_atomic_fetch_and_add_u64"] = asm["__emscripten_atomic_fetch_and_add_u64"];
|
|
var __emscripten_atomic_fetch_and_or_u64 = Module["__emscripten_atomic_fetch_and_or_u64"] = asm["__emscripten_atomic_fetch_and_or_u64"];
|
|
var _emscripten_GetProcAddress = Module["_emscripten_GetProcAddress"] = asm["_emscripten_GetProcAddress"];
|
|
var _emscripten_async_run_in_main_thread = Module["_emscripten_async_run_in_main_thread"] = asm["_emscripten_async_run_in_main_thread"];
|
|
var _llvm_bswap_i32 = Module["_llvm_bswap_i32"] = asm["_llvm_bswap_i32"];
|
|
var runPostSets = Module["runPostSets"] = asm["runPostSets"];
|
|
var ___muldsi3 = Module["___muldsi3"] = asm["___muldsi3"];
|
|
var _emscripten_main_thread_process_queued_calls = Module["_emscripten_main_thread_process_queued_calls"] = asm["_emscripten_main_thread_process_queued_calls"];
|
|
var _emscripten_atomic_add_u64 = Module["_emscripten_atomic_add_u64"] = asm["_emscripten_atomic_add_u64"];
|
|
var _free = Module["_free"] = asm["_free"];
|
|
var _emscripten_atomic_store_f32 = Module["_emscripten_atomic_store_f32"] = asm["_emscripten_atomic_store_f32"];
|
|
var setThrew = Module["setThrew"] = asm["setThrew"];
|
|
var _emscripten_atomic_exchange_u64 = Module["_emscripten_atomic_exchange_u64"] = asm["_emscripten_atomic_exchange_u64"];
|
|
var _emscripten_atomic_store_f64 = Module["_emscripten_atomic_store_f64"] = asm["_emscripten_atomic_store_f64"];
|
|
var ___pthread_tsd_run_dtors = Module["___pthread_tsd_run_dtors"] = asm["___pthread_tsd_run_dtors"];
|
|
var stackRestore = Module["stackRestore"] = asm["stackRestore"];
|
|
var ___udivmoddi4 = Module["___udivmoddi4"] = asm["___udivmoddi4"];
|
|
var _malloc = Module["_malloc"] = asm["_malloc"];
|
|
var establishStackSpace = Module["establishStackSpace"] = asm["establishStackSpace"];
|
|
var _emscripten_conditional_set_current_thread_status = Module["_emscripten_conditional_set_current_thread_status"] = asm["_emscripten_conditional_set_current_thread_status"];
|
|
var _sbrk = Module["_sbrk"] = asm["_sbrk"];
|
|
var _memmove = Module["_memmove"] = asm["_memmove"];
|
|
var _emscripten_atomic_or_u64 = Module["_emscripten_atomic_or_u64"] = asm["_emscripten_atomic_or_u64"];
|
|
var _strstr = Module["_strstr"] = asm["_strstr"];
|
|
var dynCall_viiiii = Module["dynCall_viiiii"] = asm["dynCall_viiiii"];
|
|
var dynCall_vd = Module["dynCall_vd"] = asm["dynCall_vd"];
|
|
var dynCall_vid = Module["dynCall_vid"] = asm["dynCall_vid"];
|
|
var dynCall_vi = Module["dynCall_vi"] = asm["dynCall_vi"];
|
|
var dynCall_vii = Module["dynCall_vii"] = asm["dynCall_vii"];
|
|
var dynCall_ii = Module["dynCall_ii"] = asm["dynCall_ii"];
|
|
var dynCall_viddd = Module["dynCall_viddd"] = asm["dynCall_viddd"];
|
|
var dynCall_vidd = Module["dynCall_vidd"] = asm["dynCall_vidd"];
|
|
var dynCall_iiii = Module["dynCall_iiii"] = asm["dynCall_iiii"];
|
|
var dynCall_viiiiiiii = Module["dynCall_viiiiiiii"] = asm["dynCall_viiiiiiii"];
|
|
var dynCall_viiiiii = Module["dynCall_viiiiii"] = asm["dynCall_viiiiii"];
|
|
var dynCall_viii = Module["dynCall_viii"] = asm["dynCall_viii"];
|
|
var dynCall_vidddd = Module["dynCall_vidddd"] = asm["dynCall_vidddd"];
|
|
var dynCall_vdi = Module["dynCall_vdi"] = asm["dynCall_vdi"];
|
|
var dynCall_viiiiiii = Module["dynCall_viiiiiii"] = asm["dynCall_viiiiiii"];
|
|
var dynCall_viiiiiiiii = Module["dynCall_viiiiiiiii"] = asm["dynCall_viiiiiiiii"];
|
|
var dynCall_iii = Module["dynCall_iii"] = asm["dynCall_iii"];
|
|
var dynCall_i = Module["dynCall_i"] = asm["dynCall_i"];
|
|
var dynCall_vdddddd = Module["dynCall_vdddddd"] = asm["dynCall_vdddddd"];
|
|
var dynCall_vdddd = Module["dynCall_vdddd"] = asm["dynCall_vdddd"];
|
|
var dynCall_vdd = Module["dynCall_vdd"] = asm["dynCall_vdd"];
|
|
var dynCall_v = Module["dynCall_v"] = asm["dynCall_v"];
|
|
var dynCall_viid = Module["dynCall_viid"] = asm["dynCall_viid"];
|
|
var dynCall_viiii = Module["dynCall_viiii"] = asm["dynCall_viiii"];
|
|
;
|
|
|
|
Runtime.stackAlloc = Module['stackAlloc'];
|
|
Runtime.stackSave = Module['stackSave'];
|
|
Runtime.stackRestore = Module['stackRestore'];
|
|
Runtime.establishStackSpace = Module['establishStackSpace'];
|
|
|
|
Runtime.setTempRet0 = Module['setTempRet0'];
|
|
Runtime.getTempRet0 = Module['getTempRet0'];
|
|
|
|
|
|
|
|
// === Auto-generated postamble setup entry stuff ===
|
|
|
|
Module['asm'] = asm;
|
|
|
|
|
|
|
|
|
|
|
|
function ExitStatus(status) {
|
|
this.name = "ExitStatus";
|
|
this.message = "Program terminated with exit(" + status + ")";
|
|
this.status = status;
|
|
};
|
|
ExitStatus.prototype = new Error();
|
|
ExitStatus.prototype.constructor = ExitStatus;
|
|
|
|
var initialStackTop;
|
|
var preloadStartTime = null;
|
|
var calledMain = false;
|
|
|
|
dependenciesFulfilled = function runCaller() {
|
|
// If run has never been called, and we should call run (INVOKE_RUN is true, and Module.noInitialRun is not false)
|
|
if (!Module['calledRun']) run();
|
|
if (!Module['calledRun']) dependenciesFulfilled = runCaller; // try this again later, after new deps are fulfilled
|
|
}
|
|
|
|
Module['callMain'] = Module.callMain = function callMain(args) {
|
|
assert(runDependencies == 0, 'cannot call main when async dependencies remain! (listen on __ATMAIN__)');
|
|
assert(__ATPRERUN__.length == 0, 'cannot call main when preRun functions remain to be called');
|
|
|
|
args = args || [];
|
|
|
|
ensureInitRuntime();
|
|
|
|
var argc = args.length+1;
|
|
function pad() {
|
|
for (var i = 0; i < 4-1; i++) {
|
|
argv.push(0);
|
|
}
|
|
}
|
|
var argv = [allocate(intArrayFromString(Module['thisProgram']), 'i8', ALLOC_NORMAL) ];
|
|
pad();
|
|
for (var i = 0; i < argc-1; i = i + 1) {
|
|
argv.push(allocate(intArrayFromString(args[i]), 'i8', ALLOC_NORMAL));
|
|
pad();
|
|
}
|
|
argv.push(0);
|
|
argv = allocate(argv, 'i32', ALLOC_NORMAL);
|
|
|
|
|
|
try {
|
|
|
|
var ret = Module['_main'](argc, argv, 0);
|
|
|
|
|
|
// if we're not running an evented main loop, it's time to exit
|
|
exit(ret, /* implicit = */ true);
|
|
}
|
|
catch(e) {
|
|
if (e instanceof ExitStatus) {
|
|
// exit() throws this once it's done to make sure execution
|
|
// has been stopped completely
|
|
return;
|
|
} else if (e == 'SimulateInfiniteLoop') {
|
|
// running an evented main loop, don't immediately exit
|
|
Module['noExitRuntime'] = true;
|
|
return;
|
|
} else {
|
|
var toLog = e;
|
|
if (e && typeof e === 'object' && e.stack) {
|
|
toLog = [e, e.stack];
|
|
}
|
|
Module.printErr('exception thrown: ' + toLog);
|
|
Module['quit'](1, e);
|
|
}
|
|
} finally {
|
|
calledMain = true;
|
|
}
|
|
}
|
|
|
|
|
|
|
|
|
|
function run(args) {
|
|
args = args || Module['arguments'];
|
|
|
|
if (preloadStartTime === null) preloadStartTime = Date.now();
|
|
|
|
if (runDependencies > 0) {
|
|
Module.printErr('run() called, but dependencies remain, so not running');
|
|
return;
|
|
}
|
|
|
|
writeStackCookie();
|
|
|
|
preRun();
|
|
|
|
if (runDependencies > 0) return; // a preRun added a dependency, run will be called later
|
|
if (Module['calledRun']) return; // run may have just been called through dependencies being fulfilled just in this very frame
|
|
|
|
function doRun() {
|
|
if (Module['calledRun']) return; // run may have just been called while the async setStatus time below was happening
|
|
Module['calledRun'] = true;
|
|
|
|
if (ABORT) return;
|
|
|
|
ensureInitRuntime();
|
|
|
|
preMain();
|
|
|
|
if (ENVIRONMENT_IS_WEB && preloadStartTime !== null) {
|
|
Module.printErr('pre-main prep time: ' + (Date.now() - preloadStartTime) + ' ms');
|
|
}
|
|
|
|
if (Module['onRuntimeInitialized']) Module['onRuntimeInitialized']();
|
|
|
|
if (Module['_main'] && shouldRunNow) Module['callMain'](args);
|
|
|
|
postRun();
|
|
}
|
|
|
|
if (Module['setStatus']) {
|
|
Module['setStatus']('Running...');
|
|
setTimeout(function() {
|
|
setTimeout(function() {
|
|
Module['setStatus']('');
|
|
}, 1);
|
|
doRun();
|
|
}, 1);
|
|
} else {
|
|
doRun();
|
|
}
|
|
checkStackCookie();
|
|
}
|
|
Module['run'] = Module.run = run;
|
|
|
|
function exit(status, implicit) {
|
|
if (implicit && Module['noExitRuntime']) {
|
|
Module.printErr('exit(' + status + ') implicitly called by end of main(), but noExitRuntime, so not exiting the runtime (you can use emscripten_force_exit, if you want to force a true shutdown)');
|
|
return;
|
|
}
|
|
|
|
if (Module['noExitRuntime']) {
|
|
Module.printErr('exit(' + status + ') called, but noExitRuntime, so halting execution but not exiting the runtime or preventing further async execution (you can use emscripten_force_exit, if you want to force a true shutdown)');
|
|
} else {
|
|
PThread.terminateAllThreads();
|
|
|
|
ABORT = true;
|
|
EXITSTATUS = status;
|
|
STACKTOP = initialStackTop;
|
|
|
|
exitRuntime();
|
|
|
|
if (Module['onExit']) Module['onExit'](status);
|
|
}
|
|
|
|
if (ENVIRONMENT_IS_NODE) {
|
|
process['exit'](status);
|
|
}
|
|
Module['quit'](status, new ExitStatus(status));
|
|
}
|
|
Module['exit'] = Module.exit = exit;
|
|
|
|
var abortDecorators = [];
|
|
|
|
function abort(what) {
|
|
if (ENVIRONMENT_IS_PTHREAD) console.error('Pthread aborting at ' + new Error().stack);
|
|
if (what !== undefined) {
|
|
Module.print(what);
|
|
Module.printErr(what);
|
|
what = JSON.stringify(what)
|
|
} else {
|
|
what = '';
|
|
}
|
|
|
|
ABORT = true;
|
|
EXITSTATUS = 1;
|
|
|
|
var extra = '';
|
|
|
|
var output = 'abort(' + what + ') at ' + stackTrace() + extra;
|
|
if (abortDecorators) {
|
|
abortDecorators.forEach(function(decorator) {
|
|
output = decorator(output, what);
|
|
});
|
|
}
|
|
throw output;
|
|
}
|
|
Module['abort'] = Module.abort = abort;
|
|
|
|
// {{PRE_RUN_ADDITIONS}}
|
|
|
|
if (Module['preInit']) {
|
|
if (typeof Module['preInit'] == 'function') Module['preInit'] = [Module['preInit']];
|
|
while (Module['preInit'].length > 0) {
|
|
Module['preInit'].pop()();
|
|
}
|
|
}
|
|
|
|
// shouldRunNow refers to calling main(), not run().
|
|
var shouldRunNow = true;
|
|
if (Module['noInitialRun']) {
|
|
shouldRunNow = false;
|
|
}
|
|
|
|
|
|
if (!ENVIRONMENT_IS_PTHREAD) run();
|
|
|
|
// {{POST_RUN_ADDITIONS}}
|
|
|
|
|
|
|
|
|
|
|
|
// {{MODULE_ADDITIONS}}
|
|
|
|
|
|
|